From ac46e42aa23c174919cbfdbfbbe21790d6a41b13 Mon Sep 17 00:00:00 2001 From: Dirk Ziegelmeier Date: Tue, 2 Oct 2018 12:17:31 +0200 Subject: [PATCH] Import lwIP contrib rep ... from http://git.savannah.gnu.org/cgit/lwip/lwip-contrib.git/ into contrib/ subdir, STABLE-2_1_0_RELEASE tag lwIP contrib is now officially frozen TODO: Fix build --- .gitignore | 51 +- contrib/Coverity/coverity.c | 106 + contrib/Filelists.cmake | 56 + contrib/Filelists.mk | 56 + contrib/addons/ipv6_static_routing/README | 43 + .../ipv6_static_routing/ip6_route_table.c | 248 + .../ipv6_static_routing/ip6_route_table.h | 94 + .../addons/netconn/external_resolve/dnssd.c | 164 + .../addons/netconn/external_resolve/dnssd.h | 50 + contrib/addons/tcp_isn/tcp_isn.c | 182 + contrib/addons/tcp_isn/tcp_isn.h | 48 + contrib/addons/tcp_md5/README | 27 + contrib/addons/tcp_md5/tcp_md5.c | 534 ++ contrib/addons/tcp_md5/tcp_md5.h | 84 + .../CCodeGeneration/CCodeGeneration.csproj | 67 + .../LwipMibCompiler/CCodeGeneration/CFile.cs | 54 + .../CCodeGeneration/CGenerator.cs | 119 + .../LwipMibCompiler/CCodeGeneration/Code.cs | 56 + .../CCodeGeneration/CodeContainerBase.cs | 139 + .../CCodeGeneration/CodeElement.cs | 41 + .../CCodeGeneration/Comment.cs | 75 + .../CCodeGeneration/EmptyLine.cs | 64 + .../CCodeGeneration/Function.cs | 129 + .../CCodeGeneration/FunctionDeclaration.cs | 114 + .../CCodeGeneration/IfThenElse.cs | 137 + .../LwipMibCompiler/CCodeGeneration/PP_If.cs | 67 + .../CCodeGeneration/PP_Ifdef.cs | 76 + .../CCodeGeneration/PP_Include.cs | 71 + .../CCodeGeneration/PP_Macro.cs | 59 + .../CCodeGeneration/PlainText.cs | 49 + .../Properties/AssemblyInfo.cs | 36 + .../LwipMibCompiler/CCodeGeneration/Switch.cs | 146 + .../CCodeGeneration/VariableDeclaration.cs | 82 + .../CCodeGeneration/VariablePrototype.cs | 73 + .../CCodeGeneration/VariableType.cs | 130 + .../apps/LwipMibCompiler/LwipMibCompiler.sln | 47 + .../LwipMibCompiler/LwipMibCompiler.csproj | 73 + .../LwipMibCompiler/Program.cs | 480 ++ .../Properties/AssemblyInfo.cs | 36 + .../LwipMibCompiler/app.config | 3 + .../LwipSnmpCodeGeneration/IRestriction.cs | 120 + .../LwipSnmpCodeGeneration/LwipSnmp.cs | 199 + .../LwipSnmpCodeGeneration.csproj | 72 + .../LwipSnmpCodeGeneration/MibCFile.cs | 196 + .../LwipSnmpCodeGeneration/MibHeaderFile.cs | 129 + .../Properties/AssemblyInfo.cs | 36 + .../LwipSnmpCodeGeneration/SnmpMib.cs | 97 + .../LwipSnmpCodeGeneration/SnmpNode.cs | 119 + .../SnmpScalarAggregationNode.cs | 293 + .../SnmpScalarArrayNode.cs | 105 + .../LwipSnmpCodeGeneration/SnmpScalarNode.cs | 395 ++ .../SnmpScalarNodeBits.cs | 121 + .../SnmpScalarNodeCounter64.cs | 72 + .../SnmpScalarNodeInt.cs | 86 + .../SnmpScalarNodeObjectIdentifier.cs | 90 + .../SnmpScalarNodeOctetString.cs | 118 + .../SnmpScalarNodeTruthValue.cs | 66 + .../SnmpScalarNodeUint.cs | 91 + .../LwipSnmpCodeGeneration/SnmpTableNode.cs | 332 ++ .../LwipSnmpCodeGeneration/SnmpTreeNode.cs | 242 + .../MibViewer/FormMain.Designer.cs | 166 + .../LwipMibCompiler/MibViewer/FormMain.cs | 217 + .../LwipMibCompiler/MibViewer/FormMain.resx | 298 + .../MibViewer/MibViewer.csproj | 94 + .../apps/LwipMibCompiler/MibViewer/Program.cs | 51 + .../MibViewer/Properties/AssemblyInfo.cs | 36 + .../Properties/Resources.Designer.cs | 63 + .../MibViewer/Properties/Resources.resx | 117 + .../MibViewer/Properties/Settings.Designer.cs | 26 + .../MibViewer/Properties/Settings.settings | 7 + .../apps/LwipMibCompiler/MibViewer/app.config | 3 + .../Mibs/IANA-ADDRESS-FAMILY-NUMBERS-MIB | 131 + .../LwipMibCompiler/Mibs/IANA-CHARSET-MIB | 345 ++ .../Mibs/IANA/IANA-ITU-ALARM-TC-MIB | 333 ++ .../Mibs/IANA/IANA-LANGUAGE-MIB | 127 + .../LwipMibCompiler/Mibs/IANA/IANA-MALLOC-MIB | 67 + .../LwipMibCompiler/Mibs/IANA/IANA-MAU-MIB | 770 +++ .../Mibs/IANA/IANA-PRINTER-MIB | 1319 +++++ .../Mibs/IANA/IANA-RTPROTO-MIB | 92 + .../Mibs/IANA/IANATn3270eTC-MIB | 306 + .../LwipMibCompiler/Mibs/IANA/IANAifType-MIB | 572 ++ contrib/apps/LwipMibCompiler/Mibs/IF-MIB | 1899 ++++++ .../LwipMibCompiler/Mibs/INET-ADDRESS-MIB | 421 ++ contrib/apps/LwipMibCompiler/Mibs/IP-MIB | 5254 +++++++++++++++++ contrib/apps/LwipMibCompiler/Mibs/RFC-1212 | 75 + contrib/apps/LwipMibCompiler/Mibs/RFC-1215 | 34 + contrib/apps/LwipMibCompiler/Mibs/RFC1065-SMI | 132 + contrib/apps/LwipMibCompiler/Mibs/RFC1155-SMI | 129 + contrib/apps/LwipMibCompiler/Mibs/RFC1158-MIB | 1493 +++++ contrib/apps/LwipMibCompiler/Mibs/RFC1213-MIB | 2621 ++++++++ contrib/apps/LwipMibCompiler/Mibs/SNMPv2-CONF | 318 + contrib/apps/LwipMibCompiler/Mibs/SNMPv2-MIB | 903 +++ contrib/apps/LwipMibCompiler/Mibs/SNMPv2-SMI | 352 ++ contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TC | 786 +++ contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TM | 194 + contrib/apps/LwipMibCompiler/Mibs/TCP-MIB | 829 +++ contrib/apps/LwipMibCompiler/Mibs/UDP-MIB | 579 ++ .../SharpSnmpLib/Mib/DisplayHint.cs | 84 + .../Elements/Entities/AgentCapabilities.cs | 29 + .../Mib/Elements/Entities/EntityBase.cs | 46 + .../Mib/Elements/Entities/IEntity.cs | 62 + .../Mib/Elements/Entities/ModuleCompliance.cs | 23 + .../Mib/Elements/Entities/ModuleIdentity.cs | 10 + .../Elements/Entities/NotificationGroup.cs | 22 + .../Mib/Elements/Entities/NotificationType.cs | 11 + .../Mib/Elements/Entities/ObjectGroup.cs | 22 + .../Mib/Elements/Entities/ObjectIdentity.cs | 21 + .../Mib/Elements/Entities/ObjectType.cs | 336 ++ .../Elements/Entities/OidValueAssignment.cs | 30 + .../SharpSnmpLib/Mib/Elements/Exports.cs | 56 + .../SharpSnmpLib/Mib/Elements/IDeclaration.cs | 18 + .../SharpSnmpLib/Mib/Elements/IElement.cs | 35 + .../Mib/Elements/ITypeReferrer.cs | 10 + .../SharpSnmpLib/Mib/Elements/Imports.cs | 81 + .../SharpSnmpLib/Mib/Elements/ImportsFrom.cs | 60 + .../SharpSnmpLib/Mib/Elements/TrapType.cs | 48 + .../Mib/Elements/Types/BaseType.cs | 54 + .../Mib/Elements/Types/BitsType.cs | 26 + .../SharpSnmpLib/Mib/Elements/Types/Choice.cs | 35 + .../Mib/Elements/Types/ITypeAssignment.cs | 6 + .../Mib/Elements/Types/IntegerType.cs | 117 + .../Mib/Elements/Types/IpAddressType.cs | 21 + .../SharpSnmpLib/Mib/Elements/Types/Macro.cs | 34 + .../Elements/Types/ObjectIdentifierType.cs | 11 + .../Mib/Elements/Types/OctetStringType.cs | 31 + .../Mib/Elements/Types/OpaqueType.cs | 11 + .../Mib/Elements/Types/Sequence.cs | 46 + .../Mib/Elements/Types/SequenceOf.cs | 23 + .../Mib/Elements/Types/TextualConvention.cs | 238 + .../Mib/Elements/Types/TypeAssignment.cs | 147 + .../Mib/Elements/Types/UnsignedType.cs | 103 + .../SharpSnmpLib/Mib/IModule.cs | 81 + .../SharpSnmpLib/Mib/ISymbolEnumerator.cs | 9 + .../LwipMibCompiler/SharpSnmpLib/Mib/Lexer.cs | 581 ++ .../SharpSnmpLib/Mib/MaxAccess.cs | 17 + .../SharpSnmpLib/Mib/MibDocument.cs | 57 + .../SharpSnmpLib/Mib/MibException.cs | 113 + .../SharpSnmpLib/Mib/MibModule.cs | 294 + .../SharpSnmpLib/Mib/MibResolver.cs | 97 + .../SharpSnmpLib/Mib/MibTree.cs | 130 + .../SharpSnmpLib/Mib/MibTreeNode.cs | 112 + .../SharpSnmpLib/Mib/MibTypesResolver.cs | 216 + .../SharpSnmpLib/Mib/ObjectIdentifier.cs | 54 + .../SharpSnmpLib/Mib/Status.cs | 17 + .../SharpSnmpLib/Mib/Symbol.cs | 357 ++ .../SharpSnmpLib/Mib/SymbolList.cs | 146 + .../SharpSnmpLib/Mib/ValueMap.cs | 103 + .../SharpSnmpLib/Mib/ValueRange.cs | 76 + .../SharpSnmpLib/Properties/AssemblyInfo.cs | 61 + .../Properties/Resources.Designer.cs | 63 + .../SharpSnmpLib/Properties/Resources.resx | 120 + .../SharpSnmpLib/SharpSnmpLib.Mib.csproj | 140 + .../LwipMibCompiler/SharpSnmpLib/license.txt | 458 ++ .../SharpSnmpLib/sharpsnmplib.snk | Bin 0 -> 596 bytes .../example/compile_udp_mib.cmd | 1 + .../example/compile_udp_mib.sh | 1 + contrib/apps/chargen/README | 52 + contrib/apps/chargen/chargen.c | 274 + contrib/apps/chargen/chargen.h | 12 + contrib/apps/httpserver/README | 12 + contrib/apps/httpserver/httpserver-netconn.c | 103 + contrib/apps/httpserver/httpserver-netconn.h | 6 + contrib/apps/netio/netio.c | 55 + contrib/apps/netio/netio.h | 6 + contrib/apps/ping/ping.c | 396 ++ contrib/apps/ping/ping.h | 19 + contrib/apps/rtp/rtp.c | 308 + contrib/apps/rtp/rtp.h | 8 + contrib/apps/rtp/rtpdata.h | 2040 +++++++ contrib/apps/shell/shell.c | 1277 ++++ contrib/apps/shell/shell.h | 37 + .../apps/socket_examples/socket_examples.c | 680 +++ .../apps/socket_examples/socket_examples.h | 6 + contrib/apps/tcpecho/tcpecho.c | 101 + contrib/apps/tcpecho/tcpecho.h | 38 + contrib/apps/tcpecho_raw/tcpecho_raw.c | 303 + contrib/apps/tcpecho_raw/tcpecho_raw.h | 35 + contrib/apps/udpecho/udpecho.c | 87 + contrib/apps/udpecho/udpecho.h | 37 + contrib/apps/udpecho_raw/udpecho_raw.c | 88 + contrib/apps/udpecho_raw/udpecho_raw.h | 39 + contrib/examples/ethernetif/ethernetif.c | 337 ++ contrib/examples/example_app/default_netif.h | 47 + .../examples/example_app/lwipcfg.h.example | 76 + contrib/examples/example_app/lwipopts.h | 329 ++ contrib/examples/example_app/lwippools.h | 20 + contrib/examples/example_app/ppp_settings.h | 6 + contrib/examples/example_app/test.c | 758 +++ .../example_app/test_configs/opt_default.h | 296 + .../example_app/test_configs/opt_dualstack.h | 296 + .../example_app/test_configs/opt_ipv4only.h | 296 + .../example_app/test_configs/opt_ipv6only.h | 296 + .../test_configs/opt_no_tcp_dualstack.h | 4 + .../test_configs/opt_no_tcp_ipv4only.h | 4 + .../test_configs/opt_no_tcp_ipv6only.h | 4 + .../test_configs/opt_no_udp_dualstack.h | 4 + .../test_configs/opt_no_udp_ipv4only.h | 4 + .../test_configs/opt_no_udp_ipv6only.h | 4 + .../example_app/test_configs/opt_none.h | 2 + .../example_app/test_configs/opt_nosys_dual.h | 296 + .../example_app/test_configs/opt_nosys_ipv4.h | 296 + .../example_app/test_configs/opt_nosys_ipv6.h | 296 + .../examples/httpd/cgi_example/cgi_example.c | 107 + .../examples/httpd/cgi_example/cgi_example.h | 38 + contrib/examples/httpd/examples_fs/404.html | 21 + .../examples/httpd/examples_fs/img/sics.gif | Bin 0 -> 724 bytes contrib/examples/httpd/examples_fs/index.html | 47 + contrib/examples/httpd/examples_fs/login.html | 28 + .../examples/httpd/examples_fs/loginfail.html | 25 + .../examples/httpd/examples_fs/session.html | 25 + contrib/examples/httpd/examples_fs/ssi.shtml | 315 + contrib/examples/httpd/examples_fsdata.c | 1543 +++++ .../examples/httpd/fs_example/fs_example.c | 321 + .../examples/httpd/fs_example/fs_example.h | 38 + .../httpd/genfiles_example/genfiles_example.c | 183 + .../httpd/genfiles_example/genfiles_example.h | 38 + .../httpd/post_example/post_example.c | 157 + .../examples/httpd/ssi_example/ssi_example.c | 264 + .../examples/httpd/ssi_example/ssi_example.h | 38 + contrib/examples/lwiperf/lwiperf_example.c | 50 + contrib/examples/lwiperf/lwiperf_example.h | 43 + contrib/examples/mdns/mdns_example.c | 63 + contrib/examples/mdns/mdns_example.h | 43 + contrib/examples/mqtt/mqtt_example.c | 128 + contrib/examples/mqtt/mqtt_example.h | 43 + contrib/examples/ppp/pppos_example.c | 219 + contrib/examples/ppp/pppos_example.h | 43 + contrib/examples/snmp/snmp_example.c | 72 + contrib/examples/snmp/snmp_example.h | 43 + .../snmp/snmp_private_mib/lwip_prvmib.c | 401 ++ .../snmp/snmp_private_mib/private_mib.h | 26 + contrib/examples/snmp/snmp_v3/snmpv3_dummy.c | 395 ++ contrib/examples/snmp/snmp_v3/snmpv3_dummy.h | 53 + contrib/examples/sntp/sntp_example.c | 66 + contrib/examples/sntp/sntp_example.h | 45 + contrib/examples/tftp/tftp_example.c | 91 + contrib/examples/tftp/tftp_example.h | 28 + contrib/ports/CMakeCommon.cmake | 105 + contrib/ports/Common.allports.mk | 91 + contrib/ports/FILES | 8 + .../ports/freertos/include/arch/sys_arch.h | 95 + contrib/ports/freertos/sys_arch.c | 609 ++ contrib/ports/unix/Common.mk | 51 + contrib/ports/unix/Filelists.cmake | 40 + contrib/ports/unix/README | 25 + contrib/ports/unix/check/CMakeLists.txt | 59 + contrib/ports/unix/check/Makefile | 78 + contrib/ports/unix/check/README | 8 + contrib/ports/unix/check/config.h | 2 + contrib/ports/unix/example_app/CMakeLists.txt | 33 + contrib/ports/unix/example_app/Makefile | 58 + .../ports/unix/example_app/default_netif.c | 68 + contrib/ports/unix/example_app/iteropts.sh | 24 + contrib/ports/unix/lib/CMakeLists.txt | 34 + contrib/ports/unix/lib/README | 28 + contrib/ports/unix/lib/lwipopts.h | 445 ++ contrib/ports/unix/port/include/arch/cc.h | 86 + contrib/ports/unix/port/include/arch/perf.h | 63 + .../ports/unix/port/include/arch/sys_arch.h | 63 + contrib/ports/unix/port/include/netif/fifo.h | 54 + contrib/ports/unix/port/include/netif/list.h | 26 + .../ports/unix/port/include/netif/pcapif.h | 39 + contrib/ports/unix/port/include/netif/sio.h | 60 + contrib/ports/unix/port/include/netif/tapif.h | 43 + contrib/ports/unix/port/netif/fifo.c | 139 + contrib/ports/unix/port/netif/list.c | 153 + contrib/ports/unix/port/netif/pcapif.c | 207 + contrib/ports/unix/port/netif/sio.c | 489 ++ contrib/ports/unix/port/netif/tapif.c | 432 ++ contrib/ports/unix/port/perf.c | 65 + contrib/ports/unix/port/sys_arch.c | 719 +++ contrib/ports/unix/setup-tapif | 15 + contrib/ports/win32/Common.mk | 51 + contrib/ports/win32/Filelists.cmake | 27 + contrib/ports/win32/check/check_stdint.h | 1 + contrib/ports/win32/check/config.h | 30 + contrib/ports/win32/check/stdbool.h | 9 + contrib/ports/win32/check/sys/time.h | 12 + contrib/ports/win32/check/time.c | 66 + contrib/ports/win32/check/unistd.h | 7 + .../ports/win32/example_app/CMakeLists.txt | 33 + contrib/ports/win32/example_app/Makefile | 55 + .../ports/win32/example_app/default_netif.c | 79 + contrib/ports/win32/include/arch/bpstruct.h | 1 + contrib/ports/win32/include/arch/cc.h | 112 + contrib/ports/win32/include/arch/epstruct.h | 1 + contrib/ports/win32/include/arch/perf.h | 40 + contrib/ports/win32/include/arch/sys_arch.h | 81 + contrib/ports/win32/msvc/build_coverity.cmd | 26 + contrib/ports/win32/msvc/libcheck.vcxproj | 100 + .../ports/win32/msvc/libcheck.vcxproj.filters | 96 + contrib/ports/win32/msvc/lwIP.vcxproj | 577 ++ contrib/ports/win32/msvc/lwIP.vcxproj.filters | 1048 ++++ contrib/ports/win32/msvc/lwIP_Test.sln | 37 + contrib/ports/win32/msvc/lwIP_Test.vcxproj | 203 + .../win32/msvc/lwIP_Test.vcxproj.filters | 243 + contrib/ports/win32/msvc/lwIP_pcapif.vcxproj | 111 + .../win32/msvc/lwIP_pcapif.vcxproj.filters | 28 + contrib/ports/win32/msvc/lwIP_unittests.sln | 31 + .../ports/win32/msvc/lwip_unittests.vcxproj | 137 + .../win32/msvc/lwip_unittests.vcxproj.filters | 147 + contrib/ports/win32/msvc/makefsdata.vcxproj | 99 + .../win32/msvc/makefsdata.vcxproj.filters | 14 + contrib/ports/win32/pcapif.c | 1091 ++++ contrib/ports/win32/pcapif.h | 32 + contrib/ports/win32/pcapif_helper.c | 105 + contrib/ports/win32/pcapif_helper.h | 25 + contrib/ports/win32/readme.txt | 26 + contrib/ports/win32/sio.c | 304 + contrib/ports/win32/sys_arch.c | 772 +++ 310 files changed, 58603 insertions(+), 13 deletions(-) create mode 100644 contrib/Coverity/coverity.c create mode 100644 contrib/Filelists.cmake create mode 100644 contrib/Filelists.mk create mode 100644 contrib/addons/ipv6_static_routing/README create mode 100644 contrib/addons/ipv6_static_routing/ip6_route_table.c create mode 100644 contrib/addons/ipv6_static_routing/ip6_route_table.h create mode 100644 contrib/addons/netconn/external_resolve/dnssd.c create mode 100644 contrib/addons/netconn/external_resolve/dnssd.h create mode 100644 contrib/addons/tcp_isn/tcp_isn.c create mode 100644 contrib/addons/tcp_isn/tcp_isn.h create mode 100644 contrib/addons/tcp_md5/README create mode 100644 contrib/addons/tcp_md5/tcp_md5.c create mode 100644 contrib/addons/tcp_md5/tcp_md5.h create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/CCodeGeneration.csproj create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/CFile.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/CGenerator.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/Code.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/CodeContainerBase.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/CodeElement.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/Comment.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/EmptyLine.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/Function.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/FunctionDeclaration.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/IfThenElse.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/PP_If.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Ifdef.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Include.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Macro.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/PlainText.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/Properties/AssemblyInfo.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/Switch.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/VariableDeclaration.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/VariablePrototype.cs create mode 100644 contrib/apps/LwipMibCompiler/CCodeGeneration/VariableType.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipMibCompiler.sln create mode 100644 contrib/apps/LwipMibCompiler/LwipMibCompiler/LwipMibCompiler.csproj create mode 100644 contrib/apps/LwipMibCompiler/LwipMibCompiler/Program.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipMibCompiler/Properties/AssemblyInfo.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipMibCompiler/app.config create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/IRestriction.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/LwipSnmp.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/LwipSnmpCodeGeneration.csproj create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/MibCFile.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/MibHeaderFile.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/Properties/AssemblyInfo.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpMib.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpNode.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarAggregationNode.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarArrayNode.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNode.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeBits.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeCounter64.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeInt.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeObjectIdentifier.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeOctetString.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeTruthValue.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeUint.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpTableNode.cs create mode 100644 contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpTreeNode.cs create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/FormMain.Designer.cs create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/FormMain.cs create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/FormMain.resx create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/MibViewer.csproj create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/Program.cs create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/Properties/AssemblyInfo.cs create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/Properties/Resources.Designer.cs create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/Properties/Resources.resx create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/Properties/Settings.Designer.cs create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/Properties/Settings.settings create mode 100644 contrib/apps/LwipMibCompiler/MibViewer/app.config create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA-ADDRESS-FAMILY-NUMBERS-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA-CHARSET-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-ITU-ALARM-TC-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-LANGUAGE-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-MALLOC-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-MAU-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-PRINTER-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-RTPROTO-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA/IANATn3270eTC-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IANA/IANAifType-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IF-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/INET-ADDRESS-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/IP-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/RFC-1212 create mode 100644 contrib/apps/LwipMibCompiler/Mibs/RFC-1215 create mode 100644 contrib/apps/LwipMibCompiler/Mibs/RFC1065-SMI create mode 100644 contrib/apps/LwipMibCompiler/Mibs/RFC1155-SMI create mode 100644 contrib/apps/LwipMibCompiler/Mibs/RFC1158-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/RFC1213-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/SNMPv2-CONF create mode 100644 contrib/apps/LwipMibCompiler/Mibs/SNMPv2-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/SNMPv2-SMI create mode 100644 contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TC create mode 100644 contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TM create mode 100644 contrib/apps/LwipMibCompiler/Mibs/TCP-MIB create mode 100644 contrib/apps/LwipMibCompiler/Mibs/UDP-MIB create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/DisplayHint.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/AgentCapabilities.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/EntityBase.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/IEntity.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ModuleCompliance.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ModuleIdentity.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/NotificationGroup.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/NotificationType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectGroup.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectIdentity.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/OidValueAssignment.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Exports.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/IDeclaration.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/IElement.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/ITypeReferrer.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Imports.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/ImportsFrom.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/TrapType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/BaseType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/BitsType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Choice.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/ITypeAssignment.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/IntegerType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/IpAddressType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Macro.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/ObjectIdentifierType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/OctetStringType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/OpaqueType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Sequence.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/SequenceOf.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/TextualConvention.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/TypeAssignment.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/UnsignedType.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/IModule.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ISymbolEnumerator.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Lexer.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MaxAccess.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibDocument.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibException.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibModule.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibResolver.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTree.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTreeNode.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTypesResolver.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ObjectIdentifier.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Status.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Symbol.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/SymbolList.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ValueMap.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ValueRange.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/AssemblyInfo.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/Resources.Designer.cs create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/Resources.resx create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/SharpSnmpLib.Mib.csproj create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/license.txt create mode 100644 contrib/apps/LwipMibCompiler/SharpSnmpLib/sharpsnmplib.snk create mode 100644 contrib/apps/LwipMibCompiler/example/compile_udp_mib.cmd create mode 100644 contrib/apps/LwipMibCompiler/example/compile_udp_mib.sh create mode 100644 contrib/apps/chargen/README create mode 100644 contrib/apps/chargen/chargen.c create mode 100644 contrib/apps/chargen/chargen.h create mode 100644 contrib/apps/httpserver/README create mode 100644 contrib/apps/httpserver/httpserver-netconn.c create mode 100644 contrib/apps/httpserver/httpserver-netconn.h create mode 100644 contrib/apps/netio/netio.c create mode 100644 contrib/apps/netio/netio.h create mode 100644 contrib/apps/ping/ping.c create mode 100644 contrib/apps/ping/ping.h create mode 100644 contrib/apps/rtp/rtp.c create mode 100644 contrib/apps/rtp/rtp.h create mode 100644 contrib/apps/rtp/rtpdata.h create mode 100644 contrib/apps/shell/shell.c create mode 100644 contrib/apps/shell/shell.h create mode 100644 contrib/apps/socket_examples/socket_examples.c create mode 100644 contrib/apps/socket_examples/socket_examples.h create mode 100644 contrib/apps/tcpecho/tcpecho.c create mode 100644 contrib/apps/tcpecho/tcpecho.h create mode 100644 contrib/apps/tcpecho_raw/tcpecho_raw.c create mode 100644 contrib/apps/tcpecho_raw/tcpecho_raw.h create mode 100644 contrib/apps/udpecho/udpecho.c create mode 100644 contrib/apps/udpecho/udpecho.h create mode 100644 contrib/apps/udpecho_raw/udpecho_raw.c create mode 100644 contrib/apps/udpecho_raw/udpecho_raw.h create mode 100644 contrib/examples/ethernetif/ethernetif.c create mode 100644 contrib/examples/example_app/default_netif.h create mode 100644 contrib/examples/example_app/lwipcfg.h.example create mode 100644 contrib/examples/example_app/lwipopts.h create mode 100644 contrib/examples/example_app/lwippools.h create mode 100644 contrib/examples/example_app/ppp_settings.h create mode 100644 contrib/examples/example_app/test.c create mode 100644 contrib/examples/example_app/test_configs/opt_default.h create mode 100644 contrib/examples/example_app/test_configs/opt_dualstack.h create mode 100644 contrib/examples/example_app/test_configs/opt_ipv4only.h create mode 100644 contrib/examples/example_app/test_configs/opt_ipv6only.h create mode 100644 contrib/examples/example_app/test_configs/opt_no_tcp_dualstack.h create mode 100644 contrib/examples/example_app/test_configs/opt_no_tcp_ipv4only.h create mode 100644 contrib/examples/example_app/test_configs/opt_no_tcp_ipv6only.h create mode 100644 contrib/examples/example_app/test_configs/opt_no_udp_dualstack.h create mode 100644 contrib/examples/example_app/test_configs/opt_no_udp_ipv4only.h create mode 100644 contrib/examples/example_app/test_configs/opt_no_udp_ipv6only.h create mode 100644 contrib/examples/example_app/test_configs/opt_none.h create mode 100644 contrib/examples/example_app/test_configs/opt_nosys_dual.h create mode 100644 contrib/examples/example_app/test_configs/opt_nosys_ipv4.h create mode 100644 contrib/examples/example_app/test_configs/opt_nosys_ipv6.h create mode 100644 contrib/examples/httpd/cgi_example/cgi_example.c create mode 100644 contrib/examples/httpd/cgi_example/cgi_example.h create mode 100644 contrib/examples/httpd/examples_fs/404.html create mode 100644 contrib/examples/httpd/examples_fs/img/sics.gif create mode 100644 contrib/examples/httpd/examples_fs/index.html create mode 100644 contrib/examples/httpd/examples_fs/login.html create mode 100644 contrib/examples/httpd/examples_fs/loginfail.html create mode 100644 contrib/examples/httpd/examples_fs/session.html create mode 100644 contrib/examples/httpd/examples_fs/ssi.shtml create mode 100644 contrib/examples/httpd/examples_fsdata.c create mode 100644 contrib/examples/httpd/fs_example/fs_example.c create mode 100644 contrib/examples/httpd/fs_example/fs_example.h create mode 100644 contrib/examples/httpd/genfiles_example/genfiles_example.c create mode 100644 contrib/examples/httpd/genfiles_example/genfiles_example.h create mode 100644 contrib/examples/httpd/post_example/post_example.c create mode 100644 contrib/examples/httpd/ssi_example/ssi_example.c create mode 100644 contrib/examples/httpd/ssi_example/ssi_example.h create mode 100644 contrib/examples/lwiperf/lwiperf_example.c create mode 100644 contrib/examples/lwiperf/lwiperf_example.h create mode 100644 contrib/examples/mdns/mdns_example.c create mode 100644 contrib/examples/mdns/mdns_example.h create mode 100644 contrib/examples/mqtt/mqtt_example.c create mode 100644 contrib/examples/mqtt/mqtt_example.h create mode 100644 contrib/examples/ppp/pppos_example.c create mode 100644 contrib/examples/ppp/pppos_example.h create mode 100644 contrib/examples/snmp/snmp_example.c create mode 100644 contrib/examples/snmp/snmp_example.h create mode 100644 contrib/examples/snmp/snmp_private_mib/lwip_prvmib.c create mode 100644 contrib/examples/snmp/snmp_private_mib/private_mib.h create mode 100644 contrib/examples/snmp/snmp_v3/snmpv3_dummy.c create mode 100644 contrib/examples/snmp/snmp_v3/snmpv3_dummy.h create mode 100644 contrib/examples/sntp/sntp_example.c create mode 100644 contrib/examples/sntp/sntp_example.h create mode 100644 contrib/examples/tftp/tftp_example.c create mode 100644 contrib/examples/tftp/tftp_example.h create mode 100644 contrib/ports/CMakeCommon.cmake create mode 100644 contrib/ports/Common.allports.mk create mode 100644 contrib/ports/FILES create mode 100644 contrib/ports/freertos/include/arch/sys_arch.h create mode 100644 contrib/ports/freertos/sys_arch.c create mode 100644 contrib/ports/unix/Common.mk create mode 100644 contrib/ports/unix/Filelists.cmake create mode 100644 contrib/ports/unix/README create mode 100644 contrib/ports/unix/check/CMakeLists.txt create mode 100644 contrib/ports/unix/check/Makefile create mode 100644 contrib/ports/unix/check/README create mode 100644 contrib/ports/unix/check/config.h create mode 100644 contrib/ports/unix/example_app/CMakeLists.txt create mode 100644 contrib/ports/unix/example_app/Makefile create mode 100644 contrib/ports/unix/example_app/default_netif.c create mode 100644 contrib/ports/unix/example_app/iteropts.sh create mode 100644 contrib/ports/unix/lib/CMakeLists.txt create mode 100644 contrib/ports/unix/lib/README create mode 100644 contrib/ports/unix/lib/lwipopts.h create mode 100644 contrib/ports/unix/port/include/arch/cc.h create mode 100644 contrib/ports/unix/port/include/arch/perf.h create mode 100644 contrib/ports/unix/port/include/arch/sys_arch.h create mode 100644 contrib/ports/unix/port/include/netif/fifo.h create mode 100644 contrib/ports/unix/port/include/netif/list.h create mode 100644 contrib/ports/unix/port/include/netif/pcapif.h create mode 100644 contrib/ports/unix/port/include/netif/sio.h create mode 100644 contrib/ports/unix/port/include/netif/tapif.h create mode 100644 contrib/ports/unix/port/netif/fifo.c create mode 100644 contrib/ports/unix/port/netif/list.c create mode 100644 contrib/ports/unix/port/netif/pcapif.c create mode 100644 contrib/ports/unix/port/netif/sio.c create mode 100644 contrib/ports/unix/port/netif/tapif.c create mode 100644 contrib/ports/unix/port/perf.c create mode 100644 contrib/ports/unix/port/sys_arch.c create mode 100644 contrib/ports/unix/setup-tapif create mode 100644 contrib/ports/win32/Common.mk create mode 100644 contrib/ports/win32/Filelists.cmake create mode 100644 contrib/ports/win32/check/check_stdint.h create mode 100644 contrib/ports/win32/check/config.h create mode 100644 contrib/ports/win32/check/stdbool.h create mode 100644 contrib/ports/win32/check/sys/time.h create mode 100644 contrib/ports/win32/check/time.c create mode 100644 contrib/ports/win32/check/unistd.h create mode 100644 contrib/ports/win32/example_app/CMakeLists.txt create mode 100644 contrib/ports/win32/example_app/Makefile create mode 100644 contrib/ports/win32/example_app/default_netif.c create mode 100644 contrib/ports/win32/include/arch/bpstruct.h create mode 100644 contrib/ports/win32/include/arch/cc.h create mode 100644 contrib/ports/win32/include/arch/epstruct.h create mode 100644 contrib/ports/win32/include/arch/perf.h create mode 100644 contrib/ports/win32/include/arch/sys_arch.h create mode 100644 contrib/ports/win32/msvc/build_coverity.cmd create mode 100644 contrib/ports/win32/msvc/libcheck.vcxproj create mode 100644 contrib/ports/win32/msvc/libcheck.vcxproj.filters create mode 100644 contrib/ports/win32/msvc/lwIP.vcxproj create mode 100644 contrib/ports/win32/msvc/lwIP.vcxproj.filters create mode 100644 contrib/ports/win32/msvc/lwIP_Test.sln create mode 100644 contrib/ports/win32/msvc/lwIP_Test.vcxproj create mode 100644 contrib/ports/win32/msvc/lwIP_Test.vcxproj.filters create mode 100644 contrib/ports/win32/msvc/lwIP_pcapif.vcxproj create mode 100644 contrib/ports/win32/msvc/lwIP_pcapif.vcxproj.filters create mode 100644 contrib/ports/win32/msvc/lwIP_unittests.sln create mode 100644 contrib/ports/win32/msvc/lwip_unittests.vcxproj create mode 100644 contrib/ports/win32/msvc/lwip_unittests.vcxproj.filters create mode 100644 contrib/ports/win32/msvc/makefsdata.vcxproj create mode 100644 contrib/ports/win32/msvc/makefsdata.vcxproj.filters create mode 100644 contrib/ports/win32/pcapif.c create mode 100644 contrib/ports/win32/pcapif.h create mode 100644 contrib/ports/win32/pcapif_helper.c create mode 100644 contrib/ports/win32/pcapif_helper.h create mode 100644 contrib/ports/win32/readme.txt create mode 100644 contrib/ports/win32/sio.c create mode 100644 contrib/ports/win32/sys_arch.c diff --git a/.gitignore b/.gitignore index 9dda3408..061be760 100644 --- a/.gitignore +++ b/.gitignore @@ -1,19 +1,44 @@ *.o +*.so *.a +*lwip_unittests.xml +*.suo +.depend + /doc/doxygen/output/html -/src/apps/snmp/LwipMibCompiler/CCodeGeneration/bin/ -/src/apps/snmp/LwipMibCompiler/CCodeGeneration/obj/ -/src/apps/snmp/LwipMibCompiler/LwipMibCompiler/bin/ -/src/apps/snmp/LwipMibCompiler/LwipMibCompiler/obj/ -/src/apps/snmp/LwipMibCompiler/MibViewer/bin/ -/src/apps/snmp/LwipMibCompiler/MibViewer/obj/ -/src/apps/snmp/LwipMibCompiler/LwipSnmpCodeGeneration/bin/ -/src/apps/snmp/LwipMibCompiler/LwipSnmpCodeGeneration/obj/ -/src/apps/snmp/LwipMibCompiler/SharpSnmpLib/bin/ -/src/apps/snmp/LwipMibCompiler/SharpSnmpLib/obj/ -/src/apps/snmp/LwipMibCompiler/LwipMibCompiler.userprefs -/src/apps/snmp/LwipMibCompiler/*.suo + /test/fuzz/output /test/fuzz/lwip_fuzz /test/fuzz/.depend -/build \ No newline at end of file + +/build + +/contrib/examples/example_app/lwipcfg.h +/contrib/examples/example_app/lwipopts_test.h + +/contrib/ports/unix/example_app/iteropts.log +/contrib/ports/unix/example_app/build +/contrib/ports/unix/example_app/example_app +/contrib/ports/unix/example_app/makefsdata + +/contrib/ports/unix/check/build +/contrib/ports/unix/lib/build +/contrib/ports/unix/check/lwip_unittests + +/contrib/ports/win32/example_app/build +/contrib/ports/win32/lwipcfg_msvc.h + +/contrib/ports/win32/msvc/Debug +/contrib/ports/win32/msvc/Debug unittests +/contrib/ports/win32/msvc/Release +/contrib/ports/win32/msvc/Release unittests +/contrib/ports/win32/msvc/*.user +/contrib/ports/win32/msvc/*.ncb +/contrib/ports/win32/msvc/*.cache +/contrib/ports/win32/msvc/*.suo +/contrib/ports/win32/msvc/ipch +/contrib/ports/win32/msvc/*.opensdf +/contrib/ports/win32/msvc/*.sdf +/contrib/ports/win32/mingw/*.exe +/contrib/ports/win32/mingw/*.map +/contrib/ports/win32/mingw/cov-int diff --git a/contrib/Coverity/coverity.c b/contrib/Coverity/coverity.c new file mode 100644 index 00000000..99bebae9 --- /dev/null +++ b/contrib/Coverity/coverity.c @@ -0,0 +1,106 @@ +typedef unsigned char err_t; +typedef unsigned int u32_t; +typedef unsigned short u16_t; +typedef unsigned char u8_t; +typedef void sys_sem_t; +typedef void sys_mutex_t; +typedef size_t mem_size_t; +typedef size_t memp_t; +struct pbuf; +struct netif; + +void* mem_malloc(mem_size_t size) +{ + __coverity_alloc__(size); +} +void mem_free(void* mem) +{ + __coverity_free__(mem); +} + +void* memp_malloc(memp_t type) +{ + __coverity_alloc_nosize__(); +} +void memp_free(memp_t type, void* mem) +{ + __coverity_free__(mem); +} + +void sys_mutex_lock(sys_mutex_t* mutex) +{ + __coverity_exclusive_lock_acquire__(mutex); +} +void sys_mutex_unlock(sys_mutex_t* mutex) +{ + __coverity_exclusive_lock_release__(mutex); +} + +u32_t sys_arch_sem_wait(sys_sem_t *sem, u32_t timeout) +{ + __coverity_recursive_lock_acquire__(sem); +} +void sys_sem_signal(sys_sem_t *sem) +{ + __coverity_recursive_lock_release__(sem); +} + +err_t ethernet_input(struct pbuf *p, struct netif *inp) +{ + __coverity_tainted_string_sink_content__(p); +} +err_t tcpip_input(struct pbuf *p, struct netif *inp) +{ + __coverity_tainted_string_sink_content__(p); +} +err_t ip_input(struct pbuf *p, struct netif *inp) +{ + __coverity_tainted_string_sink_content__(p); +} +err_t ip4_input(struct pbuf *p, struct netif *inp) +{ + __coverity_tainted_string_sink_content__(p); +} +err_t ip6_input(struct pbuf *p, struct netif *inp) +{ + __coverity_tainted_string_sink_content__(p); +} + +err_t pbuf_take(struct pbuf *buf, const void *dataptr, u16_t len) +{ + __coverity_tainted_string_argument__(buf); + __coverity_tainted_data_argument__(buf); +} +err_t pbuf_take_at(struct pbuf *buf, const void *dataptr, u16_t len, u16_t offset) +{ + __coverity_tainted_string_argument__(buf); + __coverity_tainted_data_argument__(buf); +} +err_t pbuf_copy(struct pbuf *p_to, struct pbuf *p_from) +{ + __coverity_tainted_data_transitive__(p_to, p_from); +} +u16_t pbuf_copy_partial(struct pbuf *p, void *dataptr, u16_t len, u16_t offset) +{ + __coverity_tainted_string_argument__(dataptr); + __coverity_tainted_data_argument__(dataptr); +} +u8_t pbuf_get_at(struct pbuf* p, u16_t offset) +{ + __coverity_tainted_data_return__(); +} + +void abort(void) +{ + __coverity_panic__(); +} + +int check_path(char* path, size_t size) +{ + if (size) { + __coverity_tainted_data_sanitize__(path); + return 1; + } else { + return 0; + } +} diff --git a/contrib/Filelists.cmake b/contrib/Filelists.cmake new file mode 100644 index 00000000..2181707b --- /dev/null +++ b/contrib/Filelists.cmake @@ -0,0 +1,56 @@ +# This file is indended to be included in end-user CMakeLists.txt +# include(/path/to/Filelists.cmake) +# It assumes the variable LWIP_CONTRIB_DIR is defined pointing to the +# root path of lwIP contrib sources. +# +# This file is NOT designed (on purpose) to be used as cmake +# subdir via add_subdirectory() +# The intention is to provide greater flexibility to users to +# create their own targets using the *_SRCS variables. + +set(lwipcontribexamples_SRCS + ${LWIP_CONTRIB_DIR}/examples/httpd/fs_example/fs_example.c + ${LWIP_CONTRIB_DIR}/examples/httpd/ssi_example/ssi_example.c + ${LWIP_CONTRIB_DIR}/examples/lwiperf/lwiperf_example.c + ${LWIP_CONTRIB_DIR}/examples/mdns/mdns_example.c + ${LWIP_CONTRIB_DIR}/examples/mqtt/mqtt_example.c + ${LWIP_CONTRIB_DIR}/examples/ppp/pppos_example.c + ${LWIP_CONTRIB_DIR}/examples/snmp/snmp_private_mib/lwip_prvmib.c + ${LWIP_CONTRIB_DIR}/examples/snmp/snmp_v3/snmpv3_dummy.c + ${LWIP_CONTRIB_DIR}/examples/snmp/snmp_example.c + ${LWIP_CONTRIB_DIR}/examples/sntp/sntp_example.c + ${LWIP_CONTRIB_DIR}/examples/tftp/tftp_example.c +) +add_library(lwipcontribexamples EXCLUDE_FROM_ALL ${lwipcontribexamples_SRCS}) +target_compile_options(lwipcontribexamples PRIVATE ${LWIP_COMPILER_FLAGS}) +target_compile_definitions(lwipcontribexamples PRIVATE ${LWIP_DEFINITIONS} ${LWIP_MBEDTLS_DEFINITIONS}) +target_include_directories(lwipcontribexamples PRIVATE ${LWIP_INCLUDE_DIRS} ${LWIP_MBEDTLS_INCLUDE_DIRS}) + +set(lwipcontribapps_SRCS + ${LWIP_CONTRIB_DIR}/apps/httpserver/httpserver-netconn.c + ${LWIP_CONTRIB_DIR}/apps/chargen/chargen.c + ${LWIP_CONTRIB_DIR}/apps/udpecho/udpecho.c + ${LWIP_CONTRIB_DIR}/apps/tcpecho/tcpecho.c + ${LWIP_CONTRIB_DIR}/apps/shell/shell.c + ${LWIP_CONTRIB_DIR}/apps/udpecho_raw/udpecho_raw.c + ${LWIP_CONTRIB_DIR}/apps/tcpecho_raw/tcpecho_raw.c + ${LWIP_CONTRIB_DIR}/apps/netio/netio.c + ${LWIP_CONTRIB_DIR}/apps/ping/ping.c + ${LWIP_CONTRIB_DIR}/apps/socket_examples/socket_examples.c + ${LWIP_CONTRIB_DIR}/apps/rtp/rtp.c +) +add_library(lwipcontribapps EXCLUDE_FROM_ALL ${lwipcontribapps_SRCS}) +target_compile_options(lwipcontribapps PRIVATE ${LWIP_COMPILER_FLAGS}) +target_compile_definitions(lwipcontribapps PRIVATE ${LWIP_DEFINITIONS} ${LWIP_MBEDTLS_DEFINITIONS}) +target_include_directories(lwipcontribapps PRIVATE ${LWIP_INCLUDE_DIRS} ${LWIP_MBEDTLS_INCLUDE_DIRS}) + +set(lwipcontribaddons_SRCS + ${LWIP_CONTRIB_DIR}/addons/tcp_isn/tcp_isn.c + ${LWIP_CONTRIB_DIR}/addons/ipv6_static_routing/ip6_route_table.c +# ${LWIP_CONTRIB_DIR}/addons/netconn/external_resolve/dnssd.c +# ${LWIP_CONTRIB_DIR}/addons/tcp_md5/tcp_md5.c +) +add_library(lwipcontribaddons EXCLUDE_FROM_ALL ${lwipcontribaddons_SRCS}) +target_compile_options(lwipcontribaddons PRIVATE ${LWIP_COMPILER_FLAGS}) +target_compile_definitions(lwipcontribaddons PRIVATE ${LWIP_DEFINITIONS} ${LWIP_MBEDTLS_DEFINITIONS}) +target_include_directories(lwipcontribaddons PRIVATE ${LWIP_INCLUDE_DIRS} ${LWIP_MBEDTLS_INCLUDE_DIRS}) diff --git a/contrib/Filelists.mk b/contrib/Filelists.mk new file mode 100644 index 00000000..e330295f --- /dev/null +++ b/contrib/Filelists.mk @@ -0,0 +1,56 @@ +# +# Copyright (c) 2001, 2002 Swedish Institute of Computer Science. +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without modification, +# are permitted provided that the following conditions are met: +# +# 1. Redistributions of source code must retain the above copyright notice, +# this list of conditions and the following disclaimer. +# 2. Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# 3. The name of the author may not be used to endorse or promote products +# derived from this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED +# WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +# MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT +# SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +# EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT +# OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING +# IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY +# OF SUCH DAMAGE. +# +# This file is part of the lwIP TCP/IP stack. +# +# Author: Adam Dunkels +# + +# CONTRIBAPPFILES: Contrib Applications. +CONTRIBAPPFILES=$(CONTRIBDIR)/apps/httpserver/httpserver-netconn.c \ + $(CONTRIBDIR)/apps/chargen/chargen.c \ + $(CONTRIBDIR)/apps/udpecho/udpecho.c \ + $(CONTRIBDIR)/apps/tcpecho/tcpecho.c \ + $(CONTRIBDIR)/apps/shell/shell.c \ + $(CONTRIBDIR)/apps/udpecho_raw/udpecho_raw.c \ + $(CONTRIBDIR)/apps/tcpecho_raw/tcpecho_raw.c \ + $(CONTRIBDIR)/apps/netio/netio.c \ + $(CONTRIBDIR)/apps/ping/ping.c \ + $(CONTRIBDIR)/apps/socket_examples/socket_examples.c \ + $(CONTRIBDIR)/apps/rtp/rtp.c \ + $(CONTRIBDIR)/examples/httpd/fs_example/fs_example.c \ + $(CONTRIBDIR)/examples/httpd/ssi_example/ssi_example.c \ + $(CONTRIBDIR)/examples/lwiperf/lwiperf_example.c \ + $(CONTRIBDIR)/examples/mdns/mdns_example.c \ + $(CONTRIBDIR)/examples/mqtt/mqtt_example.c \ + $(CONTRIBDIR)/examples/ppp/pppos_example.c \ + $(CONTRIBDIR)/examples/snmp/snmp_private_mib/lwip_prvmib.c \ + $(CONTRIBDIR)/examples/snmp/snmp_v3/snmpv3_dummy.c \ + $(CONTRIBDIR)/examples/snmp/snmp_example.c \ + $(CONTRIBDIR)/examples/sntp/sntp_example.c \ + $(CONTRIBDIR)/examples/tftp/tftp_example.c \ + $(CONTRIBDIR)/addons/tcp_isn/tcp_isn.c \ + $(CONTRIBDIR)/addons/ipv6_static_routing/ip6_route_table.c diff --git a/contrib/addons/ipv6_static_routing/README b/contrib/addons/ipv6_static_routing/README new file mode 100644 index 00000000..0c3b06cc --- /dev/null +++ b/contrib/addons/ipv6_static_routing/README @@ -0,0 +1,43 @@ +A simple routing table implementation for addition, deletion and lookup of IPv6 routes.  + +APIs are: +1) s8_t ip6_add_route_entry(struct ip6_prefix *ip6_prefix, +                            struct netif *netif, +                            ip6_addr_t *gateway, +                            s8_t *index); + +2) err_t ip6_remove_route_entry(struct ip6_prefix *ip6_prefix); + +3) s8_t ip6_find_route_entry(ip6_addr_t *ip6_dest_addr); + +4) struct netif *ip6_static_route(ip6_addr_t *src, ip6_addr_t *dest); + +5) ip6_addr_t *ip6_get_gateway(struct netif *netif, ip6_addr_t *dest); + +6) struct ip6_route_entry *ip6_get_route_table(void); + +For route lookup from the table, The LWIP_HOOK_IP6_ROUTE hook in ip6_route(..) of ip6.c +could be assigned to the ip6_static_route() API of this implementation to return the +appropriate netif. + +-- The application can add routes using the API ip6_add_route_entry(..).  +   This API adds the ip6 prefix route into the static route table while +   keeping all entries sorted in decreasing order of prefix length. +   Subsequently, a linear search down the list can be performed to retrieve a +   matching route entry for a Longest Prefix Match. +   The prefix length is expected to be at an 8-bit boundary. While this is  +   a limitation, it would serve most practical purposes. + +-- The application can remove routes using the API ip6_remove_route_entry(..). + +-- The application can find a route entry for a specific address using the  +   ip6_find_route_entry() function which returns the index of the found entry.  +   This is used internally by the route lookup function ip6_static_route() API. + +-- To fetch the gateway IPv6 address for a specific destination IPv6  +   address and target netif, the application can call ip6_get_gateway(..). + This API could be assigned to the LWIP_HOOK_ND6_GET_GW() if a gateway has + been added as part of the ip6_add_route_entry(). + +-- To fetch a pointer to the head of the table, the application can call  +   ip6_get_route_table(). diff --git a/contrib/addons/ipv6_static_routing/ip6_route_table.c b/contrib/addons/ipv6_static_routing/ip6_route_table.c new file mode 100644 index 00000000..c4c7410e --- /dev/null +++ b/contrib/addons/ipv6_static_routing/ip6_route_table.c @@ -0,0 +1,248 @@ +/** + * @file + * IPv6 static route table. + */ + +/* + * Copyright (c) 2015 Nest Labs, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * Author: Pradip De + * + * + * Please coordinate changes and requests with Pradip De + * + */ + +#include "lwip/opt.h" + +#if LWIP_IPV6 /* don't build if not configured for use in lwipopts.h */ + +#include "ip6_route_table.h" +#include "lwip/def.h" +#include "lwip/mem.h" +#include "lwip/netif.h" +#include "lwip/ip6.h" +#include "lwip/ip6_addr.h" +#include "lwip/nd6.h" +#include "lwip/debug.h" +#include "lwip/stats.h" + +#include "string.h" + +static struct ip6_route_entry static_route_table[LWIP_IPV6_NUM_ROUTE_ENTRIES]; + +/** + * Add the ip6 prefix route and target netif into the static route table while + * keeping all entries sorted in decreasing order of prefix length. + * 1. Search from the last entry up to find the correct slot to insert while + * moving entries one position down to create room. + * 2. Insert into empty slot created. + * + * Subsequently, a linear search down the list can be performed to retrieve a + * matching route entry for a Longest Prefix Match. + * + * @param ip6_prefix the route prefix entry to add. + * @param netif pointer to target netif. + * @param gateway the gateway address to use to send through. Has to be link local. + * @param idx return value argument of index where route entry was added in table. + * @return ERR_OK if addition was successful. + * ERR_MEM if table is already full. + * ERR_ARG if passed argument is bad or route already exists in table. + */ +err_t +ip6_add_route_entry(const struct ip6_prefix *ip6_prefix, struct netif *netif, const ip6_addr_t *gateway, s8_t *idx) +{ + s8_t i = -1; + err_t retval = ERR_OK; + + if (!ip6_prefix_valid(ip6_prefix->prefix_len) || (netif == NULL)) { + retval = ERR_ARG; + goto exit; + } + + /* Check if an entry already exists with matching prefix; If so, replace it. */ + for (i = 0; i < LWIP_IPV6_NUM_ROUTE_ENTRIES; i++) { + if ((ip6_prefix->prefix_len == static_route_table[i].prefix.prefix_len) && + memcmp(&ip6_prefix->addr, &static_route_table[i].prefix.addr, + ip6_prefix->prefix_len / 8) == 0) { + /* Prefix matches; replace the netif with the one being added. */ + goto insert; + } + } + + /* Check if the table is full */ + if (static_route_table[LWIP_IPV6_NUM_ROUTE_ENTRIES - 1].netif != NULL) { + retval = ERR_MEM; + goto exit; + } + + /* Shift all entries down the table until slot is found */ + for (i = LWIP_IPV6_NUM_ROUTE_ENTRIES - 1; + i > 0 && (ip6_prefix->prefix_len > static_route_table[i - 1].prefix.prefix_len); i--) { + SMEMCPY(&static_route_table[i], &static_route_table[i - 1], sizeof(struct ip6_route_entry)); + } + +insert: + /* Insert into the slot selected */ + SMEMCPY(&static_route_table[i].prefix, ip6_prefix, sizeof(struct ip6_prefix)); + static_route_table[i].netif = netif; + + /* Add gateway to route table */ + static_route_table[i].gateway = gateway; + + if (idx != NULL) { + *idx = i; + } + +exit: + return retval; +} + +/** + * Removes the route entry from the static route table. + * + * @param ip6_prefix the route prefix entry to delete. + */ +void +ip6_remove_route_entry(const struct ip6_prefix *ip6_prefix) +{ + int i, pos = -1; + + for (i = 0; i < LWIP_IPV6_NUM_ROUTE_ENTRIES; i++) { + /* compare prefix to find position to delete */ + if (ip6_prefix->prefix_len == static_route_table[i].prefix.prefix_len && + memcmp(&ip6_prefix->addr, &static_route_table[i].prefix.addr, + ip6_prefix->prefix_len / 8) == 0) { + pos = i; + break; + } + } + + if (pos >= 0) { + /* Shift everything beyond pos one slot up */ + for (i = pos; i < LWIP_IPV6_NUM_ROUTE_ENTRIES - 1; i++) { + SMEMCPY(&static_route_table[i], &static_route_table[i+1], sizeof(struct ip6_route_entry)); + if (static_route_table[i].netif == NULL) { + break; + } + } + /* Zero the remaining entries */ + for (; i < LWIP_IPV6_NUM_ROUTE_ENTRIES; i++) { + ip6_addr_set_zero((&static_route_table[i].prefix.addr)); + static_route_table[i].netif = NULL; + } + } +} + +/** + * Finds the appropriate route entry in the static route table corresponding to the given + * destination IPv6 address. Since the entries in the route table are kept sorted in decreasing + * order of prefix length, a linear search down the list is performed to retrieve a matching + * index. + * + * @param ip6_dest_addr the destination address to match + * @return the idx of the found route entry; -1 if not found. + */ +s8_t +ip6_find_route_entry(const ip6_addr_t *ip6_dest_addr) +{ + s8_t i, idx = -1; + + /* Search prefix in the sorted(decreasing order of prefix length) list */ + for(i = 0; i < LWIP_IPV6_NUM_ROUTE_ENTRIES; i++) { + if (memcmp(ip6_dest_addr, &static_route_table[i].prefix.addr, + static_route_table[i].prefix.prefix_len / 8) == 0) { + idx = i; + break; + } + } + + return idx; +} + +/** + * Finds the appropriate network interface for a given IPv6 address from a routing table with + * static IPv6 routes. + * + * @param src the source IPv6 address, if known + * @param dest the destination IPv6 address for which to find the route + * @return the netif on which to send to reach dest + */ +struct netif * +ip6_static_route(const ip6_addr_t *src, const ip6_addr_t *dest) +{ + int i; + + LWIP_UNUSED_ARG(src); + + /* Perform table lookup */ + i = ip6_find_route_entry(dest); + + if (i >= 0) { + return static_route_table[i].netif; + } else { + return NULL; + } +} + +/** + * Finds the gateway IP6 address for a given destination IPv6 address and target netif + * from a routing table with static IPv6 routes. + * + * @param netif the netif used for sending + * @param dest the destination IPv6 address + * @return the ip6 address of the gateway to forward packet to + */ +const ip6_addr_t * +ip6_get_gateway(struct netif *netif, const ip6_addr_t *dest) +{ + const ip6_addr_t *ret_gw = NULL; + const int i = ip6_find_route_entry(dest); + + LWIP_UNUSED_ARG(netif); + + if (i >= 0) { + if (static_route_table[i].gateway != NULL) { + ret_gw = static_route_table[i].gateway; + } + } + + return ret_gw; +} + +/** + * Returns the top of the route table. + * This should be used for debug printing only. + * + * @return the top of the route table. + */ +const struct ip6_route_entry * +ip6_get_route_table(void) +{ + return static_route_table; +} + +#endif /* LWIP_IPV6 */ diff --git a/contrib/addons/ipv6_static_routing/ip6_route_table.h b/contrib/addons/ipv6_static_routing/ip6_route_table.h new file mode 100644 index 00000000..1cab880e --- /dev/null +++ b/contrib/addons/ipv6_static_routing/ip6_route_table.h @@ -0,0 +1,94 @@ +/** + * @file + * + * IPv6 static route table. + */ + +/* + * Copyright (c) 2015 Nest Labs, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * Author: Pradip De + * + * + * Please coordinate changes and requests with Pradip De + * + */ + +#ifndef __LWIP_IP6_ROUTE_TABLE_H__ +#define __LWIP_IP6_ROUTE_TABLE_H__ + +#include "lwip/opt.h" + +#if LWIP_IPV6 /* don't build if not configured for use in lwipopts.h */ + +#include "lwip/ip6_addr.h" +#include "lwip/err.h" + +#ifdef __cplusplus +extern "C" { +#endif + +struct netif; + +/** + * LWIP_IPV6_NUM_ROUTES: Number of IPV6 routes that can be kept in the static route table. + */ +#ifndef LWIP_IPV6_NUM_ROUTE_ENTRIES +#define LWIP_IPV6_NUM_ROUTE_ENTRIES (8) +#endif + +#define IP6_MAX_PREFIX_LEN (128) +#define IP6_PREFIX_ALLOWED_GRANULARITY (8) +/* Prefix length cannot be greater than 128 bits and needs to be at a byte boundary */ +#define ip6_prefix_valid(prefix_len) (((prefix_len) <= IP6_MAX_PREFIX_LEN) && \ + (((prefix_len) % IP6_PREFIX_ALLOWED_GRANULARITY) == 0)) + +struct ip6_prefix { + ip6_addr_t addr; + u8_t prefix_len; /* prefix length in bits at byte boundaries */ +}; + +struct ip6_route_entry { + struct ip6_prefix prefix; + struct netif *netif; + const ip6_addr_t *gateway; +}; + +err_t ip6_add_route_entry(const struct ip6_prefix *ip6_prefix, struct netif *netif, + const ip6_addr_t *gateway, s8_t *idx); +void ip6_remove_route_entry(const struct ip6_prefix *ip6_prefix); +s8_t ip6_find_route_entry(const ip6_addr_t *ip6_dest_addr); +struct netif *ip6_static_route(const ip6_addr_t *src, const ip6_addr_t *dest); +const ip6_addr_t *ip6_get_gateway(struct netif *netif, const ip6_addr_t *dest); +const struct ip6_route_entry *ip6_get_route_table(void); + +#ifdef __cplusplus +} +#endif + +#endif /* LWIP_IPV6 */ + +#endif /* __LWIP_IP6_ROUTE_TABLE_H__ */ diff --git a/contrib/addons/netconn/external_resolve/dnssd.c b/contrib/addons/netconn/external_resolve/dnssd.c new file mode 100644 index 00000000..d26743bc --- /dev/null +++ b/contrib/addons/netconn/external_resolve/dnssd.c @@ -0,0 +1,164 @@ +/** + * @file + * DNS-SD APIs used by LWIP_HOOK_NETCONN_EXTERNAL_RESOLVE + * + * This implementation assumes the DNS-SD API implementation (most likely provided by + * mDNSResponder) is implemented in the same process space as LwIP and can directly + * invoke the callback for DNSServiceGetAddrInfo. This is the typical deployment in + * an embedded environment where as a traditional OS requires pumping the callback results + * through an IPC mechanism (see DNSServiceRefSockFD/DNSServiceProcessResult) + * + * @defgroup dnssd DNS-SD + * @ingroup dns + */ + +/* + * Copyright (c) 2017 Joel Cunningham, Garmin International, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Joel Cunningham + * + */ +#include "lwip/opt.h" + +#include "lwip/err.h" +#include "lwip/inet.h" +#include "lwip/sockets.h" +#include "lwip/sys.h" + +#include "dnssd.h" + +/* External headers */ +#include +#include + +/* This timeout should allow for multiple queries. +mDNSResponder has the following query timeline: + Query 1: time = 0s + Query 2: time = 1s + Query 3: time = 4s +*/ +#define GETADDR_TIMEOUT_MS 5000 +#define LOCAL_DOMAIN ".local" + +/* Only consume .local hosts */ +#ifndef CONSUME_LOCAL_ONLY +#define CONSUME_LOCAL_ONLY 1 +#endif + +struct addr_clbk_msg { + sys_sem_t sem; + struct sockaddr_storage addr; + err_t err; +}; + +static void addr_info_callback(DNSServiceRef ref, DNSServiceFlags flags, u32_t interface_index, + DNSServiceErrorType error_code, char const* hostname, + const struct sockaddr* address, u32_t ttl, void* context); + +int +lwip_dnssd_gethostbyname(const char *name, ip_addr_t *addr, u8_t addrtype, err_t *err) +{ + DNSServiceErrorType result; + DNSServiceRef ref; + struct addr_clbk_msg msg; + char *p; + + /* @todo: use with IPv6 */ + LWIP_UNUSED_ARG(addrtype); + +#if CONSUME_LOCAL_ONLY + /* check if this is a .local host. If it is, then we consume the query */ + p = strstr(name, LOCAL_DOMAIN); + if (p == NULL) { + return 0; /* not consumed */ + } + p += (sizeof(LOCAL_DOMAIN) - 1); + /* check to make sure .local isn't a substring (only allow .local\0 or .local.\0) */ + if ((*p != '.' && *p != '\0') || + (*p == '.' && *(p + 1) != '\0')) { + return 0; /* not consumed */ + } +#endif /* CONSUME_LOCAL_ONLY */ + + msg.err = sys_sem_new(&msg.sem, 0); + if (msg.err != ERR_OK) { + goto query_done; + } + + msg.err = ERR_TIMEOUT; + result = DNSServiceGetAddrInfo(&ref, 0, 0, kDNSServiceProtocol_IPv4, name, addr_info_callback, &msg); + if (result == kDNSServiceErr_NoError) { + sys_arch_sem_wait(&msg.sem, GETADDR_TIMEOUT_MS); + DNSServiceRefDeallocate(ref); + + /* We got a response */ + if (msg.err == ERR_OK) { + struct sockaddr_in* addr_in = (struct sockaddr_in *)&msg.addr; + if (addr_in->sin_family == AF_INET) { + inet_addr_to_ip4addr(ip_2_ip4(addr), &addr_in->sin_addr); + } else { + /* @todo add IPv6 support */ + msg.err = ERR_VAL; + } + } + } + sys_sem_free(&msg.sem); + +/* Query has been consumed and is finished */ +query_done: +*err = msg.err; +return 1; +} + +static void +addr_info_callback(DNSServiceRef ref, DNSServiceFlags flags, u32_t interface_index, + DNSServiceErrorType error_code, char const* hostname, + const struct sockaddr* address, u32_t ttl, void* context) +{ + struct addr_clbk_msg* msg = (struct addr_clbk_msg*)context; + struct sockaddr_in* addr_in = (struct sockaddr_in *)address; + + LWIP_UNUSED_ARG(ref); + LWIP_UNUSED_ARG(flags); + LWIP_UNUSED_ARG(interface_index); + LWIP_UNUSED_ARG(hostname); + LWIP_UNUSED_ARG(ttl); + LWIP_UNUSED_ARG(context); + + if ((error_code == kDNSServiceErr_NoError) && + (addr_in->sin_family == AF_INET)) { + MEMCPY(&msg->addr, addr_in, sizeof(*addr_in)); + msg->err = ERR_OK; + } + else { + /* @todo add IPv6 support */ + msg->err = ERR_VAL; + } + + sys_sem_signal(&msg->sem); +} /* addr_info_callback() */ diff --git a/contrib/addons/netconn/external_resolve/dnssd.h b/contrib/addons/netconn/external_resolve/dnssd.h new file mode 100644 index 00000000..e2d71d93 --- /dev/null +++ b/contrib/addons/netconn/external_resolve/dnssd.h @@ -0,0 +1,50 @@ +/** + * @file + * DNS-SD APIs used by LWIP_HOOK_NETCONN_EXTERNAL_RESOLVE + * + * @defgroup dnssd DNS-SD + * @ingroup dns + */ + +/* + * Copyright (c) 2017 Joel Cunningham, Garmin International, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Joel Cunningham + * + */ +#include "lwip/opt.h" + +#ifndef LWIP_HDR_DNSSD_H +#define LWIP_HDR_DNSSD_H + +#include "lwip/err.h" +#include "lwip/ip_addr.h" + +int lwip_dnssd_gethostbyname(const char *name, ip_addr_t *addr, u8_t addrtype, err_t *err); + +#endif /* LWIP_HDR_DNSSD_H */ diff --git a/contrib/addons/tcp_isn/tcp_isn.c b/contrib/addons/tcp_isn/tcp_isn.c new file mode 100644 index 00000000..69a931e1 --- /dev/null +++ b/contrib/addons/tcp_isn/tcp_isn.c @@ -0,0 +1,182 @@ +/** + * @file + * + * Reference implementation of the TCP ISN algorithm standardized in RFC 6528. + * Produce TCP Initial Sequence Numbers by combining an MD5-generated hash + * based on the new TCP connection's identity and a stable secret, with the + * current time at 4-microsecond granularity. + * + * Specifically, the implementation uses MD5 to compute a hash of the input + * buffer, which contains both the four-tuple of the new TCP connection (local + * and remote IP address and port), as well as a 16-byte secret to make the + * results unpredictable to external parties. The secret must be given at + * initialization time and should ideally remain the same across system + * reboots. To be sure: the spoofing-resistance of the resulting ISN depends + * mainly on the strength of the supplied secret! + * + * The implementation takes 32 bits from the computed hash, and adds to it the + * current time, in 4-microsecond units. The current time is computed from a + * boot time given at initialization, and the current uptime as provided by + * sys_now(). Thus, it assumes that sys_now() returns a time value that is + * relative to the boot time, i.e., that it starts at 0 at system boot, and + * only ever increases monotonically. + * + * For efficiency reasons, a single MD5 input buffer is used, and partially + * filled in at initialization time. Specifically, of this 64-byte buffer, the + * first 36 bytes are used for the four-way TCP tuple data, followed by the + * 16-byte secret, followed by 12-byte zero padding. The 64-byte size of the + * buffer should achieve the best performance for the actual MD5 computation. + * + * Basic usage: + * + * 1. in your lwipopts.h, add the following lines: + * + * #include + * struct ip_addr; + * u32_t lwip_hook_tcp_isn(const struct ip_addr *local_ip, u16_t local_port, + * const struct ip_addr *remote_ip, u16_t remote_port); + * "#define LWIP_HOOK_TCP_ISN lwip_hook_tcp_isn"; + * + * 2. from your own code, call lwip_init_tcp_isn() at initialization time, with + * appropriate parameters. + */ + +/* + * Copyright (c) 2016 The MINIX 3 Project. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * Author: David van Moolenbroek + */ + +#include "tcp_isn.h" +#include "lwip/ip_addr.h" +#include "lwip/sys.h" +#include + +#ifdef LWIP_HOOK_TCP_ISN + +/* pull in md5 of ppp? */ +#include "netif/ppp/ppp_opts.h" +#if !PPP_SUPPORT || (!LWIP_USE_EXTERNAL_POLARSSL && !LWIP_USE_EXTERNAL_MBEDTLS) +#undef LWIP_INCLUDED_POLARSSL_MD5 +#define LWIP_INCLUDED_POLARSSL_MD5 1 +#include "netif/ppp/polarssl/md5.h" +#endif + +static u8_t input[64]; +static u32_t base_time; + +/** + * Initialize the TCP ISN module, with the boot time and a secret. + * + * @param boot_time Wall clock boot time of the system, in seconds. + * @param secret_16_bytes A 16-byte secret used to randomize the TCP ISNs. + */ +void +lwip_init_tcp_isn(u32_t boot_time, const u8_t *secret_16_bytes) +{ + /* Initialize the input buffer with the secret and trailing zeroes. */ + memset(input, 0, sizeof(input)); + + MEMCPY(&input[36], secret_16_bytes, 16); + + /* Save the boot time in 4-us units. Overflow is no problem here. */ + base_time = boot_time * 250000; +} + +/** + * Hook to generate an Initial Sequence Number (ISN) for a new TCP connection. + * + * @param local_ip The local IP address. + * @param local_port The local port number, in host-byte order. + * @param remote_ip The remote IP address. + * @param remote_port The remote port number, in host-byte order. + * @return The ISN to use for the new TCP connection. + */ +u32_t +lwip_hook_tcp_isn(const ip_addr_t *local_ip, u16_t local_port, + const ip_addr_t *remote_ip, u16_t remote_port) +{ + md5_context ctx; + u8_t output[16]; + u32_t isn; + +#if LWIP_IPV4 && LWIP_IPV6 + if (IP_IS_V6(local_ip)) +#endif /* LWIP_IPV4 && LWIP_IPV6 */ +#if LWIP_IPV6 + { + const ip6_addr_t *local_ip6, *remote_ip6; + + local_ip6 = ip_2_ip6(local_ip); + remote_ip6 = ip_2_ip6(remote_ip); + + SMEMCPY(&input[0], &local_ip6->addr, 16); + SMEMCPY(&input[16], &remote_ip6->addr, 16); + } +#endif /* LWIP_IPV6 */ +#if LWIP_IPV4 && LWIP_IPV6 + else +#endif /* LWIP_IPV4 && LWIP_IPV6 */ +#if LWIP_IPV4 + { + const ip4_addr_t *local_ip4, *remote_ip4; + + local_ip4 = ip_2_ip4(local_ip); + remote_ip4 = ip_2_ip4(remote_ip); + + /* Represent IPv4 addresses as IPv4-mapped IPv6 addresses, to ensure that + * the IPv4 and IPv6 address spaces are completely disjoint. */ + memset(&input[0], 0, 10); + input[10] = 0xff; + input[11] = 0xff; + SMEMCPY(&input[12], &local_ip4->addr, 4); + memset(&input[16], 0, 10); + input[26] = 0xff; + input[27] = 0xff; + SMEMCPY(&input[28], &remote_ip4->addr, 4); + } +#endif /* LWIP_IPV4 */ + + input[32] = (u8_t)(local_port >> 8); + input[33] = (u8_t)(local_port & 0xff); + input[34] = (u8_t)(remote_port >> 8); + input[35] = (u8_t)(remote_port & 0xff); + + /* The secret and padding are already filled in. */ + + /* Generate the hash, using MD5. */ + md5_starts(&ctx); + md5_update(&ctx, input, sizeof(input)); + md5_finish(&ctx, output); + + /* Arbitrarily take the first 32 bits from the generated hash. */ + MEMCPY(&isn, output, sizeof(isn)); + + /* Add the current time in 4-microsecond units. */ + return isn + base_time + sys_now() * 250; +} + +#endif /* LWIP_HOOK_TCP_ISN */ diff --git a/contrib/addons/tcp_isn/tcp_isn.h b/contrib/addons/tcp_isn/tcp_isn.h new file mode 100644 index 00000000..ebaeca24 --- /dev/null +++ b/contrib/addons/tcp_isn/tcp_isn.h @@ -0,0 +1,48 @@ +/* + * Copyright (c) 2016 The MINIX 3 Project. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * Author: David van Moolenbroek + */ + +#ifndef LWIP_HDR_CONTRIB_ADDONS_TCP_ISN_H +#define LWIP_HDR_CONTRIB_ADDONS_TCP_ISN_H + +#include "lwip/opt.h" +#include "lwip/ip_addr.h" + +#ifdef __cplusplus +extern "C" { +#endif + +void lwip_init_tcp_isn(u32_t boot_time, const u8_t *secret_16_bytes); +u32_t lwip_hook_tcp_isn(const ip_addr_t *local_ip, u16_t local_port, + const ip_addr_t *remote_ip, u16_t remote_port); + +#ifdef __cplusplus +} +#endif + +#endif /* LWIP_HDR_CONTRIB_ADDONS_TCP_ISN_H */ diff --git a/contrib/addons/tcp_md5/README b/contrib/addons/tcp_md5/README new file mode 100644 index 00000000..a6408ca2 --- /dev/null +++ b/contrib/addons/tcp_md5/README @@ -0,0 +1,27 @@ +This folder provides an example implementation of how to add custom tcp header +options and custom socket options. + +It does this by implementing the (seldom used) tcp md5 signature. + +To enable it, add an LWIP_HOOK_FILENAME hook file, include tcp_md5.h in it and +define these hooks: + + #define LWIP_HOOK_TCP_INPACKET_PCB(pcb, hdr, optlen, opt1len, opt2, p) tcp_md5_check_inpacket(pcb, hdr, optlen, opt1len, opt2, p) + #define LWIP_HOOK_TCP_OPT_LENGTH_SEGMENT(pcb, internal_len) tcp_md5_get_additional_option_length(pcb, internal_len) + #define LWIP_HOOK_TCP_ADD_TX_OPTIONS(p, hdr, pcb, opts) tcp_md5_add_tx_options(p, hdr, pcb, opts) + #define LWIP_HOOK_SOCKETS_SETSOCKOPT(s, sock, level, optname, optval, optlen, err) tcp_md5_setsockopt_hook(sock, level, optname, optval, optlen, err) + +Then, in your sockets application, enable md5 signature on a socket like this: + + struct tcp_md5sig md5; + struct sockaddr_storage addr_remote; /* Initialize this to remote address and port */ + memcpy(&md5.tcpm_addr, &addr_remote, sizeof(addr_remote)); + strcpy(md5.tcpm_key, key); /* this is the md5 key per connection */ + md5.tcpm_keylen = strlen(key); + if ((ret = setsockopt(sockfd, IPPROTO_TCP, TCP_MD5SIG, &md5, sizeof(md5))) < 0) { + perror("setsockopt TCP_MD5SIG"); + return; + } + +After that, your connection (client) or all incoming connections (server) require +tcp md5 signatures. diff --git a/contrib/addons/tcp_md5/tcp_md5.c b/contrib/addons/tcp_md5/tcp_md5.c new file mode 100644 index 00000000..1e50eb68 --- /dev/null +++ b/contrib/addons/tcp_md5/tcp_md5.c @@ -0,0 +1,534 @@ +/** + * @file: An implementation of TCP MD5 signatures by using various hooks in + * lwIP to implement custom tcp options and custom socket options. + */ + +/* + * Copyright (c) 2018 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * Author: Simon Goldschmidt + */ + +#include "tcp_md5.h" +#include "lwip/ip_addr.h" +#include "lwip/sys.h" +#include "lwip/prot/tcp.h" +#include "lwip/priv/tcp_priv.h" +#include "lwip/sockets.h" +#include "lwip/priv/sockets_priv.h" +#include "lwip/api.h" +#include + +/* pull in md5 of ppp? */ +#include "netif/ppp/ppp_opts.h" +#if !PPP_SUPPORT || (!LWIP_USE_EXTERNAL_POLARSSL && !LWIP_USE_EXTERNAL_MBEDTLS) +#undef LWIP_INCLUDED_POLARSSL_MD5 +#define LWIP_INCLUDED_POLARSSL_MD5 1 +#include "netif/ppp/polarssl/md5.h" +#endif + +#if !LWIP_TCP_PCB_NUM_EXT_ARGS +#error tcp_md5 needs LWIP_TCP_PCB_NUM_EXT_ARGS +#endif + +#define LWIP_TCP_OPT_MD5 19 /* number of the md5 option */ +#define LWIP_TCP_OPT_LEN_MD5 18 /* length of the md5 option */ +#define LWIP_TCP_OPT_LEN_MD5_OUT 20 /* 18 + alignment */ + +#define LWIP_TCP_MD5_DIGEST_LEN 16 + +/* This keeps the md5 state internally */ +struct tcp_md5_conn_info { + struct tcp_md5_conn_info *next; + ip_addr_t remote_addr; + u16_t remote_port; + u8_t key[TCP_MD5SIG_MAXKEYLEN]; + u16_t key_len; +}; + +/* Callback function prototypes: */ +static void tcp_md5_extarg_destroy(u8_t id, void *data); +static err_t tcp_md5_extarg_passive_open(u8_t id, struct tcp_pcb_listen *lpcb, struct tcp_pcb *cpcb); +/* Define our tcp ext arg callback structure: */ +const struct tcp_ext_arg_callbacks tcp_md5_ext_arg_callbacks = { + tcp_md5_extarg_destroy, + tcp_md5_extarg_passive_open +}; + +static u8_t tcp_md5_extarg_id = LWIP_TCP_PCB_NUM_EXT_ARG_ID_INVALID; +static u8_t tcp_md5_opts_buf[40]; + +/** Initialize this module (allocates a tcp ext arg id) */ +void +tcp_md5_init(void) +{ + tcp_md5_extarg_id = tcp_ext_arg_alloc_id(); +} + +/* Create a conn-info structure that holds the md5 state per connection */ +static struct tcp_md5_conn_info * +tcp_md5_conn_info_alloc(void) +{ + return (struct tcp_md5_conn_info *)mem_malloc(sizeof(struct tcp_md5_conn_info)); +} + +/* Frees a conn-info structure that holds the md5 state per connection */ +static void +tcp_md5_conn_info_free(struct tcp_md5_conn_info *info) +{ + mem_free(info); +} + +/* A pcb is about to be destroyed. Free its extdata */ +static void +tcp_md5_extarg_destroy(u8_t id, void *data) +{ + struct tcp_md5_conn_info *iter; + + LWIP_ASSERT("tcp_md5_extarg_id != LWIP_TCP_PCB_NUM_EXT_ARG_ID_INVALID", + tcp_md5_extarg_id != LWIP_TCP_PCB_NUM_EXT_ARG_ID_INVALID); + LWIP_ASSERT("id == tcp_md5_extarg_id", id == tcp_md5_extarg_id); + LWIP_UNUSED_ARG(id); + + iter = (struct tcp_md5_conn_info *)data; + while (iter != NULL) { + struct tcp_md5_conn_info *info = iter; + iter = iter->next; + tcp_md5_conn_info_free(info); + } +} + +/* Try to find an md5 connection info for the specified remote connection */ +static struct tcp_md5_conn_info * +tcp_md5_get_info(const struct tcp_pcb *pcb, const ip_addr_t *remote_ip, u16_t remote_port) +{ + if (pcb != NULL) { + struct tcp_md5_conn_info *info = (struct tcp_md5_conn_info *)tcp_ext_arg_get(pcb, tcp_md5_extarg_id); + while (info != NULL) { + if (ip_addr_cmp(&info->remote_addr, remote_ip)) { + if (info->remote_port == remote_port) { + return info; + } + } + info = info->next; + } + } + return NULL; +} + +/* Passive open: copy md5 connection info from listen pcb to connection pcb + * or return error (connection will be closed) + */ +static err_t +tcp_md5_extarg_passive_open(u8_t id, struct tcp_pcb_listen *lpcb, struct tcp_pcb *cpcb) +{ + struct tcp_md5_conn_info *iter; + + LWIP_ASSERT("lpcb != NULL", lpcb != NULL); + LWIP_ASSERT("cpcb != NULL", cpcb != NULL); + LWIP_ASSERT("tcp_md5_extarg_id != LWIP_TCP_PCB_NUM_EXT_ARG_ID_INVALID", + tcp_md5_extarg_id != LWIP_TCP_PCB_NUM_EXT_ARG_ID_INVALID); + LWIP_ASSERT("id == tcp_md5_extarg_id", id == tcp_md5_extarg_id); + LWIP_UNUSED_ARG(id); + + iter = (struct tcp_md5_conn_info *)tcp_ext_arg_get((struct tcp_pcb *)lpcb, id); + while (iter != NULL) { + if (iter->remote_port == cpcb->remote_port) { + if (ip_addr_cmp(&iter->remote_addr, &cpcb->remote_ip)) { + struct tcp_md5_conn_info *info = tcp_md5_conn_info_alloc(); + if (info != NULL) { + memcpy(info, iter, sizeof(struct tcp_md5_conn_info)); + tcp_ext_arg_set(cpcb, id, info); + tcp_ext_arg_set_callbacks(cpcb, id, &tcp_md5_ext_arg_callbacks); + return ERR_OK; + } else { + return ERR_MEM; + } + } + } + iter = iter->next; + } + /* remote connection not found */ + return ERR_VAL; +} + +/* Parse tcp header options and return 1 if an md5 signature option was found */ +static int +tcp_md5_parseopt(const u8_t *opts, u16_t optlen, u8_t *md5_digest_out) +{ + u8_t data; + u16_t optidx; + + /* Parse the TCP MSS option, if present. */ + if (optlen != 0) { + for (optidx = 0; optidx < optlen; ) { + u8_t opt = opts[optidx++]; + switch (opt) { + case LWIP_TCP_OPT_EOL: + /* End of options. */ + LWIP_DEBUGF(TCP_INPUT_DEBUG, ("tcp_parseopt: EOL\n")); + return 0; + case LWIP_TCP_OPT_NOP: + /* NOP option. */ + LWIP_DEBUGF(TCP_INPUT_DEBUG, ("tcp_parseopt: NOP\n")); + break; + case LWIP_TCP_OPT_MD5: + LWIP_DEBUGF(TCP_INPUT_DEBUG, ("tcp_parseopt: MD5\n")); + if (opts[optidx++] != LWIP_TCP_OPT_LEN_MD5 || (optidx - 2 + LWIP_TCP_OPT_LEN_MD5) > optlen) { + /* Bad length */ + LWIP_DEBUGF(TCP_INPUT_DEBUG, ("tcp_parseopt: bad length\n")); + return 0; + } + /* An MD5 option with the right option length. */ + memcpy(md5_digest_out, &opts[optidx], LWIP_TCP_MD5_DIGEST_LEN); + /* no need to process the options further */ + return 1; + break; + default: + LWIP_DEBUGF(TCP_INPUT_DEBUG, ("tcp_parseopt: other\n")); + data = opts[optidx++]; + if (data < 2) { + LWIP_DEBUGF(TCP_INPUT_DEBUG, ("tcp_parseopt: bad length\n")); + /* If the length field is zero, the options are malformed + and we don't process them further. */ + return 0; + } + /* All other options have a length field, so that we easily + can skip past them. */ + optidx += data - 2; + } + } + } + return 0; +} + +/* Get tcp options into contiguous memory. May be required if input pbufs + * are chained. + */ +static const u8_t* +tcp_md5_options_singlebuf(struct tcp_hdr *hdr, u16_t optlen, u16_t opt1len, u8_t *opt2) +{ + const u8_t *opts; + LWIP_ASSERT("hdr != NULL", hdr != NULL); + LWIP_ASSERT("optlen >= opt1len", optlen >= opt1len); + opts = (const u8_t *)hdr + TCP_HLEN; + if (optlen == opt1len) { + /* arleady in one piece */ + return opts; + } + if (optlen > sizeof(tcp_md5_opts_buf)) { + /* options too long */ + return NULL; + } + LWIP_ASSERT("opt2 != NULL", opt2 != NULL); + /* copy first part */ + memcpy(tcp_md5_opts_buf, opts, opt1len); + /* copy second part */ + memcpy(&tcp_md5_opts_buf[opt1len], opt2, optlen - opt1len); + return tcp_md5_opts_buf; +} + +/* Create the md5 digest for a given segment */ +static int +tcp_md5_create_digest(const ip_addr_t *ip_src, const ip_addr_t *ip_dst, const struct tcp_hdr *hdr, + const u8_t *key, size_t key_len, u8_t *digest_out, struct pbuf *p) +{ + md5_context ctx; + u8_t tmp8; + u16_t tmp16; + const size_t addr_len = IP_ADDR_RAW_SIZE(*ip_src); + + if (p != NULL) { + LWIP_ASSERT("pbuf must not point to tcp header here!", (const void *)hdr != p->payload); + } + + /* Generate the hash, using MD5. */ + md5_starts(&ctx); + /* 1. the TCP pseudo-header (in the order: source IP address, + destination IP address, zero-padded protocol number, and + segment length) */ + md5_update(&ctx, (const unsigned char*)ip_src, addr_len); + md5_update(&ctx, (const unsigned char*)ip_dst, addr_len); + tmp8 = 0; /* zero-padded */ + md5_update(&ctx, &tmp8, 1); + tmp8 = IP_PROTO_TCP; + md5_update(&ctx, &tmp8, 1); + tmp16 = lwip_htons(TCPH_HDRLEN_BYTES(hdr) + (p ? p->tot_len : 0)); + md5_update(&ctx, (const unsigned char*)&tmp16, 2); + /* 2. the TCP header, excluding options, and assuming a checksum of + zero */ + md5_update(&ctx, (const unsigned char*)hdr, sizeof(struct tcp_hdr)); + /* 3. the TCP segment data (if any) */ + if ((p != NULL) && (p->tot_len != 0)) { + struct pbuf *q; + for (q = p; q != NULL; q = q->next) { + md5_update(&ctx, (const unsigned char*)q->payload, q->len); + } + } + /* 4. an independently-specified key or password, known to both TCPs + and presumably connection-specific */ + md5_update(&ctx, key, key_len); + + md5_finish(&ctx, digest_out); + return 1; +} + +/* Duplicate a tcp header and make sure the fields are in network byte order */ +static void +tcp_md5_dup_tcphdr(struct tcp_hdr *tcphdr_copy, const struct tcp_hdr *tcphdr_in, int tcphdr_in_is_host_order) +{ + memcpy(tcphdr_copy, tcphdr_in, sizeof(struct tcp_hdr)); + tcphdr_copy->chksum = 0; /* checksum is zero for the pseudo header */ + if (tcphdr_in_is_host_order) { + /* lwIP writes the TCP header values back to the buffer, we need to invert that here: */ + tcphdr_copy->src = lwip_htons(tcphdr_copy->src); + tcphdr_copy->dest = lwip_htons(tcphdr_copy->dest); + tcphdr_copy->seqno = lwip_htonl(tcphdr_copy->seqno); + tcphdr_copy->ackno = lwip_htonl(tcphdr_copy->ackno); + tcphdr_copy->wnd = lwip_htons(tcphdr_copy->wnd); + tcphdr_copy->urgp = lwip_htons(tcphdr_copy->urgp); + } +} + +/* Check if md5 is enabled on a given pcb */ +static int +tcp_md5_is_enabled_on_pcb(const struct tcp_pcb *pcb) +{ + if (tcp_md5_extarg_id != LWIP_TCP_PCB_NUM_EXT_ARG_ID_INVALID) { + struct tcp_md5_conn_info *info = (struct tcp_md5_conn_info *)tcp_ext_arg_get(pcb, tcp_md5_extarg_id); + if (info != NULL) { + return 1; + } + } + return 0; +} + +/* Check if md5 is enabled on a given listen pcb */ +static int +tcp_md5_is_enabled_on_lpcb(const struct tcp_pcb_listen *lpcb) +{ + /* same as for connection pcbs */ + return tcp_md5_is_enabled_on_pcb((const struct tcp_pcb *)lpcb); +} + +/* Hook implementation for LWIP_HOOK_TCP_OPT_LENGTH_SEGMENT */ +u8_t +tcp_md5_get_additional_option_length(const struct tcp_pcb *pcb, u8_t internal_option_length) +{ + if ((pcb != NULL) && tcp_md5_is_enabled_on_pcb(pcb)) { + u8_t new_option_length = internal_option_length + LWIP_TCP_OPT_LEN_MD5_OUT; + LWIP_ASSERT("overflow", new_option_length > internal_option_length); + LWIP_ASSERT("options too long", new_option_length <= TCP_MAX_OPTION_BYTES); + return new_option_length; + } + return internal_option_length; +} + +/* Hook implementation for LWIP_HOOK_TCP_INPACKET_PCB when called for listen pcbs */ +static err_t +tcp_md5_check_listen(struct tcp_pcb_listen* lpcb, struct tcp_hdr *hdr, u16_t optlen, u16_t opt1len, u8_t *opt2) +{ + LWIP_ASSERT("lpcb != NULL", lpcb != NULL); + + if (tcp_md5_is_enabled_on_lpcb(lpcb)) { + const u8_t *opts; + u8_t digest_received[LWIP_TCP_MD5_DIGEST_LEN]; + u8_t digest_calculated[LWIP_TCP_MD5_DIGEST_LEN]; + const struct tcp_md5_conn_info *info = tcp_md5_get_info((struct tcp_pcb *)lpcb, ip_current_src_addr(), hdr->src); + if (info != NULL) { + opts = tcp_md5_options_singlebuf(hdr, optlen, opt1len, opt2); + if (opts != NULL) { + if (tcp_md5_parseopt(opts, optlen, digest_received)) { + struct tcp_hdr tcphdr_copy; + tcp_md5_dup_tcphdr(&tcphdr_copy, hdr, 1); + if (tcp_md5_create_digest(ip_current_src_addr(), ip_current_dest_addr(), &tcphdr_copy, info->key, info->key_len, digest_calculated, NULL)) { + /* everything set up, compare the digests */ + if (!memcmp(digest_received, digest_calculated, LWIP_TCP_MD5_DIGEST_LEN)) { + /* equal */ + return ERR_OK; + } + /* not equal */ + } + } + } + } + /* md5 enabled on this pcb but no match or other error -> fail */ + return ERR_VAL; + } + return ERR_OK; +} + +/* Hook implementation for LWIP_HOOK_TCP_INPACKET_PCB */ +err_t +tcp_md5_check_inpacket(struct tcp_pcb* pcb, struct tcp_hdr *hdr, u16_t optlen, u16_t opt1len, u8_t *opt2, struct pbuf *p) +{ + LWIP_ASSERT("pcb != NULL", pcb != NULL); + + if (pcb->state == LISTEN) { + return tcp_md5_check_listen((struct tcp_pcb_listen *)pcb, hdr, optlen, opt1len, opt2); + } + + if (tcp_md5_is_enabled_on_pcb(pcb)) { + const struct tcp_md5_conn_info *info = tcp_md5_get_info(pcb, ip_current_src_addr(), hdr->src); + if (info != NULL) { + const u8_t *opts; + u8_t digest_received[LWIP_TCP_MD5_DIGEST_LEN]; + u8_t digest_calculated[LWIP_TCP_MD5_DIGEST_LEN]; + opts = tcp_md5_options_singlebuf(hdr, optlen, opt1len, opt2); + if (opts != NULL) { + if (tcp_md5_parseopt(opts, optlen, digest_received)) { + struct tcp_hdr hdr_copy; + tcp_md5_dup_tcphdr(&hdr_copy, hdr, 1); + if (tcp_md5_create_digest(&pcb->remote_ip, &pcb->local_ip, &hdr_copy, info->key, info->key_len, digest_calculated, p)) { + /* everything set up, compare the digests */ + if (!memcmp(digest_received, digest_calculated, LWIP_TCP_MD5_DIGEST_LEN)) { + /* equal */ + return ERR_OK; + } + /* not equal */ + } + } + } + } + /* md5 enabled on this pcb but no match or other error -> fail */ + return ERR_VAL; + } + return ERR_OK; +} + +/* Hook implementation for LWIP_HOOK_TCP_ADD_TX_OPTIONS */ +u32_t * +tcp_md5_add_tx_options(struct pbuf *p, struct tcp_hdr *hdr, const struct tcp_pcb *pcb, u32_t *opts) +{ + LWIP_ASSERT("p != NULL", p != NULL); + LWIP_ASSERT("hdr != NULL", hdr != NULL); + LWIP_ASSERT("pcb != NULL", pcb != NULL); + LWIP_ASSERT("opts != NULL", opts != NULL); + + if (tcp_md5_is_enabled_on_pcb(pcb)) { + u8_t digest_calculated[LWIP_TCP_MD5_DIGEST_LEN]; + u32_t *opts_ret = opts + 5; /* we use 20 bytes: 2 bytes padding + 18 bytes for this option */ + u8_t *ptr = (u8_t*)opts; + + const struct tcp_md5_conn_info *info = tcp_md5_get_info(pcb, &pcb->remote_ip, pcb->remote_port); + if (info != NULL) { + struct tcp_hdr hdr_copy; + size_t hdrsize = TCPH_HDRLEN_BYTES(hdr); + tcp_md5_dup_tcphdr(&hdr_copy, hdr, 0); + /* p->payload points to the tcp header */ + LWIP_ASSERT("p->payload == hdr", p->payload == hdr); + if (!pbuf_remove_header(p, hdrsize)) { + u8_t ret; + if (!tcp_md5_create_digest(&pcb->local_ip, &pcb->remote_ip, &hdr_copy, info->key, info->key_len, digest_calculated, p)) { + info = NULL; + } + ret = pbuf_add_header_force(p, hdrsize); + LWIP_ASSERT("tcp_md5_add_tx_options: pbuf_add_header_force failed", !ret); + LWIP_UNUSED_ARG(ret); + } else { + LWIP_ASSERT("error", 0); + } + } + if (info == NULL) { + /* create an invalid signature by zeroing the digest */ + memset(&digest_calculated, 0, sizeof(digest_calculated)); + } + + *ptr++ = LWIP_TCP_OPT_NOP; + *ptr++ = LWIP_TCP_OPT_NOP; + *ptr++ = LWIP_TCP_OPT_MD5; + *ptr++ = LWIP_TCP_OPT_LEN_MD5; + memcpy(ptr, digest_calculated, LWIP_TCP_MD5_DIGEST_LEN); + ptr += LWIP_TCP_MD5_DIGEST_LEN; + LWIP_ASSERT("ptr == opts_ret", ptr == (u8_t *)opts_ret); + return opts_ret; + } + return opts; +} + +/* Hook implementation for LWIP_HOOK_SOCKETS_SETSOCKOPT */ +int +tcp_md5_setsockopt_hook(struct lwip_sock *sock, int level, int optname, const void *optval, socklen_t optlen, int *err) +{ + LWIP_ASSERT("sock != NULL", sock != NULL); + LWIP_ASSERT("err != NULL", err != NULL); + + if ((level == IPPROTO_TCP) && (optname == TCP_MD5SIG)) { + const struct tcp_md5sig *md5 = (const struct tcp_md5sig*)optval; + if ((optval == NULL) || (optlen < sizeof(struct tcp_md5sig))) { + *err = EINVAL; + } else { + if (sock->conn && (NETCONNTYPE_GROUP(netconn_type(sock->conn)) == NETCONN_TCP) && (sock->conn->pcb.tcp != NULL)) { + if (tcp_md5_extarg_id == LWIP_TCP_PCB_NUM_EXT_ARG_ID_INVALID) { + /* not initialized */ + *err = EINVAL; + } else { + struct tcp_md5_conn_info *info = tcp_md5_conn_info_alloc(); + if (info == NULL) { + *err = ENOMEM; + } else { + int addr_valid = 0; + /* OK, fill and link this request */ + memcpy(info->key, md5->tcpm_key, TCP_MD5SIG_MAXKEYLEN); + info->key_len = md5->tcpm_keylen; + memset(&info->remote_addr, 0, sizeof(info->remote_addr)); + if (md5->tcpm_addr.ss_family == AF_INET) { +#if LWIP_IPV4 + const struct sockaddr_in *sin = (const struct sockaddr_in *)&md5->tcpm_addr; + memcpy(&info->remote_addr, &sin->sin_addr, sizeof(sin->sin_addr)); + IP_SET_TYPE_VAL(info->remote_addr, IPADDR_TYPE_V4); + info->remote_port = lwip_htons(sin->sin_port); + addr_valid = 1; +#endif /* LWIP_IPV4 */ + } else if (md5->tcpm_addr.ss_family == AF_INET6) { +#if LWIP_IPV6 + const struct sockaddr_in6 *sin6 = (const struct sockaddr_in6 *)&md5->tcpm_addr; + memcpy(&info->remote_addr, &sin6->sin6_addr, sizeof(sin6->sin6_addr)); + IP_SET_TYPE_VAL(info->remote_addr, IPADDR_TYPE_V6); + info->remote_port = lwip_htons(sin6->sin6_port); + addr_valid = 1; +#endif /* LWIP_IPV6 */ + } + if (addr_valid) { + /* store it */ + tcp_ext_arg_set_callbacks(sock->conn->pcb.tcp, tcp_md5_extarg_id, &tcp_md5_ext_arg_callbacks); + info->next = (struct tcp_md5_conn_info *)tcp_ext_arg_get(sock->conn->pcb.tcp, tcp_md5_extarg_id); + tcp_ext_arg_set(sock->conn->pcb.tcp, tcp_md5_extarg_id, info); + } else { + *err = EINVAL; + tcp_md5_conn_info_free(info); + } + } + } + } else { + /* not a tcp netconn */ + *err = EINVAL; + } + } + return 1; + } + return 0; +} diff --git a/contrib/addons/tcp_md5/tcp_md5.h b/contrib/addons/tcp_md5/tcp_md5.h new file mode 100644 index 00000000..e55740a4 --- /dev/null +++ b/contrib/addons/tcp_md5/tcp_md5.h @@ -0,0 +1,84 @@ +/* + * Copyright (c) 2018 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * Author: Simon Goldschmidt + * + * To use the hooks in this file, make sure this file is included in LWIP_HOOK_FILENAME + * and define these hooks: + * + * #define LWIP_HOOK_TCP_INPACKET_PCB(pcb, hdr, optlen, opt1len, opt2, p) tcp_md5_check_inpacket(pcb, hdr, optlen, opt1len, opt2, p) + * #define LWIP_HOOK_TCP_OPT_LENGTH_SEGMENT(pcb, internal_len) tcp_md5_get_additional_option_length(pcb, internal_len) + * #define LWIP_HOOK_TCP_ADD_TX_OPTIONS(p, hdr, pcb, opts) tcp_md5_add_tx_options(p, hdr, pcb, opts) + * + * #define LWIP_HOOK_SOCKETS_SETSOCKOPT(s, sock, level, optname, optval, optlen, err) tcp_md5_setsockopt_hook(sock, level, optname, optval, optlen, err) + */ + +#ifndef LWIP_HDR_CONTRIB_ADDONS_TCP_MD5_H +#define LWIP_HDR_CONTRIB_ADDONS_TCP_MD5_H + +#include "lwip/opt.h" +#include "lwip/ip_addr.h" +#include "lwip/err.h" + +#include "lwip/priv/sockets_priv.h" +#include "lwip/priv/tcp_priv.h" + +#ifdef __cplusplus +extern "C" { +#endif + +/* setsockopt definitions and structs: */ + +/* This is the optname (for level = IPPROTO_TCP) */ +#ifndef TCP_MD5SIG +#define TCP_MD5SIG 14 +#endif + +#define TCP_MD5SIG_MAXKEYLEN 80 + +/* This is the optval type */ +struct tcp_md5sig { + struct sockaddr_storage tcpm_addr; + u16_t __tcpm_pad1; + u16_t tcpm_keylen; + u32_t __tcpm_pad2; + u8_t tcpm_key[TCP_MD5SIG_MAXKEYLEN]; +}; + +/* socket setsockopt hook: */ +int tcp_md5_setsockopt_hook(struct lwip_sock *sock, int level, int optname, const void *optval, u32_t optlen, int *err); + +/* Internal hook functions */ +void tcp_md5_init(void); +err_t tcp_md5_check_inpacket(struct tcp_pcb* pcb, struct tcp_hdr *hdr, u16_t optlen, u16_t opt1len, u8_t *opt2, struct pbuf *p); +u8_t tcp_md5_get_additional_option_length(const struct tcp_pcb *pcb, u8_t internal_option_length); +u32_t *tcp_md5_add_tx_options(struct pbuf *p, struct tcp_hdr *hdr, const struct tcp_pcb *pcb, u32_t *opts); + +#ifdef __cplusplus +} +#endif + +#endif /* LWIP_HDR_CONTRIB_ADDONS_TCP_MD5_H */ diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/CCodeGeneration.csproj b/contrib/apps/LwipMibCompiler/CCodeGeneration/CCodeGeneration.csproj new file mode 100644 index 00000000..06d5075e --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/CCodeGeneration.csproj @@ -0,0 +1,67 @@ + + + + Debug + AnyCPU + 8.0.30703 + 2.0 + {7DA7C0AB-0982-4BF5-9324-F59A7A08D65B} + Library + Properties + CCodeGeneration + CCodeGeneration + v4.0 + 512 + + + + true + full + false + bin\Debug\ + DEBUG;TRACE + prompt + 4 + + + pdbonly + true + bin\Release\ + TRACE + prompt + 4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/CFile.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/CFile.cs new file mode 100644 index 00000000..6f122742 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/CFile.cs @@ -0,0 +1,54 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; + +namespace CCodeGeneration +{ + public class CFile: CodeContainerBase + { + public CFile() + { + base.IncreaseLevel = false; + } + + public void Save(CGenerator generator) + { + if (generator == null) + { + throw new ArgumentNullException("generator"); + } + + this.GenerateCode(0, generator); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/CGenerator.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/CGenerator.cs new file mode 100644 index 00000000..4e8dfbc7 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/CGenerator.cs @@ -0,0 +1,119 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.IO; + +namespace CCodeGeneration +{ + public class CGenerator + { + public TextWriter OutputStream { get; private set; } + public string File { get; private set; } + public uint IndentCount { get; private set; } + public string IndentChar { get; private set; } + public string NewLine { get; private set; } + + public CGenerator(System.IO.TextWriter outputStream, string file, uint indentCount, string indentChar, string newLine) + { + this.OutputStream = outputStream; + this.File = file; + this.IndentCount = indentCount; + this.IndentChar = indentChar; + this.NewLine = newLine; + } + + public string FileName + { + get + { + if (!String.IsNullOrWhiteSpace(this.File)) + { + return Path.GetFileName(this.File); + } + + return null; + } + } + + public void WriteSequence(string value, uint repetitions) + { + while (repetitions > 0) + { + this.OutputStream.Write(value); + repetitions--; + } + } + + public void IndentLine(int level) + { + while (level > 0) + { + WriteSequence(this.IndentChar, this.IndentCount); + level--; + } + } + + public void WriteNewLine() + { + this.OutputStream.Write(this.NewLine); + } + + public void WriteMultilineString(string value, int level = 0) + { + if (String.IsNullOrEmpty(value)) + { + return; + } + + // only \n and \r\n are recognized as linebreaks + string[] lines = value.Split(new char[] { '\n' }, StringSplitOptions.None); + + for (int l = 0; l < (lines.Length - 1); l++) + { + if (lines[l].EndsWith("\r")) + { + this.OutputStream.Write(lines[l].Substring(0, lines[l].Length-1)); + } + else + { + this.OutputStream.Write(lines[l]); + } + + this.WriteNewLine(); + this.IndentLine(level); + } + + this.OutputStream.Write(lines[lines.Length - 1]); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/Code.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/Code.cs new file mode 100644 index 00000000..4834508a --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/Code.cs @@ -0,0 +1,56 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +namespace CCodeGeneration +{ + public class Code: CodeElement + { + public string Code_ { get; set; } + + public Code() + { + } + + public Code(string code) + { + this.Code_ = code; + } + + public override void GenerateCode(int level, CGenerator generator) + { + generator.IndentLine(level); + generator.WriteMultilineString(this.Code_, level); + generator.WriteNewLine(); + } + + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/CodeContainerBase.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/CodeContainerBase.cs new file mode 100644 index 00000000..4327d92d --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/CodeContainerBase.cs @@ -0,0 +1,139 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System.Collections.Generic; +using System; + +namespace CCodeGeneration +{ + public class CodeContainerBase: CodeElement + { + private readonly List declarations = new List(); + private readonly List innerElements = new List(); + private bool increaseLevel = true; + + public List Declarations + { + get { return this.declarations; } + } + + public List InnerElements + { + get { return this.innerElements; } + } + + protected bool IncreaseLevel + { + get { return this.increaseLevel; } + set { this.increaseLevel = value; } + } + + public void AddElements(IList elements, params CodeElement[] spacerElements) + { + if (elements != null) + { + if ((spacerElements == null) || (spacerElements.Length == 0)) + { + this.innerElements.AddRange(elements); + } + else + { + bool spacerAdded = false; + + foreach (CodeElement element in elements) + { + this.innerElements.Add(element); + this.innerElements.AddRange(spacerElements); + spacerAdded = true; + } + + if (spacerAdded) + { + // remove last spacer again + this.innerElements.RemoveRange(this.innerElements.Count - spacerElements.Length, spacerElements.Length); + } + } + } + } + + public CodeElement AddElement(CodeElement element) + { + if (element != null) + { + this.innerElements.Add(element); + } + + return element; + } + + public Code AddCode(string code) + { + return this.AddElement(new Code(code)) as Code; + } + + public Code AddCodeFormat(string codeFormat, params object[] args) + { + return this.AddElement(new Code(String.Format(codeFormat, args))) as Code; + } + + public CodeElement AddDeclaration(CodeElement declaration) + { + if (declaration != null) + { + this.declarations.Add(declaration); + } + + return declaration; + } + + public override void GenerateCode(int level, CGenerator generator) + { + if (this.increaseLevel) + level++; + + if (this.declarations.Count > 0) + { + foreach (CodeElement element in this.declarations) + { + element.GenerateCode(level, generator); + } + + EmptyLine.SingleLine.GenerateCode(level, generator); + } + + foreach (CodeElement element in this.innerElements) + { + element.GenerateCode(level, generator); + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/CodeElement.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/CodeElement.cs new file mode 100644 index 00000000..51cf2d24 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/CodeElement.cs @@ -0,0 +1,41 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +namespace CCodeGeneration +{ + public class CodeElement + { + public virtual void GenerateCode(int level, CGenerator generator) + { + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/Comment.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/Comment.cs new file mode 100644 index 00000000..51779bea --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/Comment.cs @@ -0,0 +1,75 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +namespace CCodeGeneration +{ + public class Comment: CodeElement + { + public const string CommentStart = "/*"; + public const string CommentEnd = "*/"; + + public string Comment_ { get; set; } + public bool SingleLine { get; set; } + + public Comment() + { + } + + public Comment(string comment, bool singleLine = false) + { + this.Comment_ = comment; + this.SingleLine = singleLine; + } + + public override void GenerateCode(int level, CGenerator generator) + { + generator.IndentLine(level); + generator.OutputStream.Write(CommentStart); + + if (!this.SingleLine) + { + generator.WriteNewLine(); + generator.IndentLine(level); + generator.WriteMultilineString(this.Comment_, level); + generator.WriteNewLine(); + generator.IndentLine(level); + } + else + { + generator.OutputStream.Write(" " + Comment_ + " "); + } + + generator.OutputStream.Write(CommentEnd); + generator.WriteNewLine(); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/EmptyLine.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/EmptyLine.cs new file mode 100644 index 00000000..604c9477 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/EmptyLine.cs @@ -0,0 +1,64 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +namespace CCodeGeneration +{ + public class EmptyLine : CodeElement + { + public static readonly EmptyLine SingleLine = new EmptyLine(); + public static readonly EmptyLine TwoLines = new EmptyLine(2); + public static readonly EmptyLine ThreeLines = new EmptyLine(3); + + public uint Count { get; set; } + + public EmptyLine() + { + this.Count = 1; + } + + public EmptyLine(uint count) + { + this.Count = count; + } + + public override void GenerateCode(int level, CGenerator generator) + { + uint c = this.Count; + + while (c > 0) + { + generator.WriteNewLine(); + c--; + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/Function.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/Function.cs new file mode 100644 index 00000000..d81f6e56 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/Function.cs @@ -0,0 +1,129 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Collections.Generic; + +namespace CCodeGeneration +{ + public class Function: CodeContainerBase + { + public string Name { get; set; } + public bool IsStatic { get; set; } + + private readonly List parameter = new List(); + private VariableType returnType = VariableType.Void; + + public Function() + { + } + + public Function(string name, bool isStatic = false) + { + this.Name = name; + this.IsStatic = isStatic; + } + + public List Parameter + { + get { return this.parameter; } + } + + public VariableType ReturnType + { + get { return this.returnType; } + set + { + if (value == null) + { + throw new ArgumentNullException("ReturnValue"); + } + this.returnType = value; + } + } + + public static Function FromDeclaration(FunctionDeclaration decl) + { + Function result = new Function(decl.Name, decl.IsStatic); + result.ReturnType = decl.ReturnType.Clone() as VariableType; + + foreach (VariableType param in decl.Parameter) + { + result.parameter.Add(param.Clone() as VariableType); + } + + return result; + } + + public override void GenerateCode(int level, CGenerator generator) + { + generator.IndentLine(level); + + if (this.IsStatic) + { + generator.OutputStream.Write("static "); + } + + this.returnType.GenerateCode(generator); + generator.OutputStream.Write(" " + this.Name + "("); + + if (this.Parameter.Count > 0) + { + for (int i = 0; i < this.parameter.Count; i++) + { + this.parameter[i].GenerateCode(generator); + + if (i < (this.parameter.Count - 1)) + { + generator.OutputStream.Write(", "); + } + } + } + else + { + generator.OutputStream.Write("void"); + } + + generator.OutputStream.Write(")"); + generator.WriteNewLine(); + generator.IndentLine(level); + generator.OutputStream.Write("{"); + generator.WriteNewLine(); + + base.GenerateCode(level, generator); + + generator.IndentLine(level); + generator.OutputStream.Write("}"); + generator.WriteNewLine(); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/FunctionDeclaration.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/FunctionDeclaration.cs new file mode 100644 index 00000000..3bc42888 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/FunctionDeclaration.cs @@ -0,0 +1,114 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Collections.Generic; + +namespace CCodeGeneration +{ + public class FunctionDeclaration: CodeElement + { + public string Name { get; set; } + public bool IsStatic { get; set; } + public bool IsExtern { get; set; } + + private readonly List parameter = new List(); + private VariableType returnType = VariableType.Void; + + public FunctionDeclaration() + { + } + + public FunctionDeclaration(string name, bool isStatic = false, bool isExtern = false) + { + this.Name = name; + this.IsStatic = isStatic; + this.IsExtern = isExtern; + } + + public List Parameter + { + get { return this.parameter; } + } + + public VariableType ReturnType + { + get { return this.returnType; } + set + { + if (value == null) + { + throw new ArgumentNullException("ReturnValue"); + } + this.returnType = value; + } + } + + public override void GenerateCode(int level, CGenerator generator) + { + generator.IndentLine(level); + + if (this.IsExtern) + { + generator.OutputStream.Write("extern "); + } + + if (this.IsStatic) + { + generator.OutputStream.Write("static "); + } + + this.returnType.GenerateCode(generator); + generator.OutputStream.Write(" " + this.Name + "("); + + if (this.Parameter.Count > 0) + { + for (int i = 0; i < this.parameter.Count; i++) + { + this.parameter[i].GenerateCode(generator); + + if (i < (this.parameter.Count - 1)) + { + generator.OutputStream.Write(", "); + } + } + } + else + { + generator.OutputStream.Write("void"); + } + + generator.OutputStream.Write(");"); + generator.WriteNewLine(); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/IfThenElse.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/IfThenElse.cs new file mode 100644 index 00000000..c4710225 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/IfThenElse.cs @@ -0,0 +1,137 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Collections.Generic; + +namespace CCodeGeneration +{ + public class ElseIf : CodeContainerBase + { + public string Condition { get; set; } + + public ElseIf() + { + } + + public ElseIf(string condition) + { + this.Condition = condition; + } + + public override void GenerateCode(int level, CGenerator generator) + { + if (!String.IsNullOrWhiteSpace(this.Condition)) + { + generator.IndentLine(level); + generator.OutputStream.Write(String.Format("else if ({0})", this.Condition)); + generator.WriteNewLine(); + generator.IndentLine(level); + generator.OutputStream.Write("{"); + generator.WriteNewLine(); + + base.GenerateCode(level, generator); + + generator.IndentLine(level); + generator.OutputStream.Write("}"); + generator.WriteNewLine(); + } + } + } + + public class IfThenElse: CodeContainerBase + { + public string Condition { get; set; } + + private List elseIf = new List(); + private CodeContainerBase else_ = new CodeContainerBase(); + + public IfThenElse() + { + } + + public IfThenElse(string condition) + { + this.Condition = condition; + } + + public List ElseIf + { + get { return this.elseIf; } + } + + public CodeContainerBase Else + { + get { return this.else_; } + } + + public override void GenerateCode(int level, CGenerator generator) + { + if (!String.IsNullOrWhiteSpace(this.Condition)) + { + generator.IndentLine(level); + generator.OutputStream.Write(String.Format("if ({0})", this.Condition)); + generator.WriteNewLine(); + generator.IndentLine(level); + generator.OutputStream.Write("{"); + generator.WriteNewLine(); + + base.GenerateCode(level, generator); + + generator.IndentLine(level); + generator.OutputStream.Write("}"); + generator.WriteNewLine(); + + foreach (ElseIf elif in this.elseIf) + { + elif.GenerateCode(level, generator); + } + + if (this.else_.InnerElements.Count > 0) + { + generator.IndentLine(level); + generator.OutputStream.Write("else"); + generator.WriteNewLine(); + generator.IndentLine(level); + generator.OutputStream.Write("{"); + generator.WriteNewLine(); + + this.else_.GenerateCode(level, generator); + + generator.IndentLine(level); + generator.OutputStream.Write("}"); + generator.WriteNewLine(); + } + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_If.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_If.cs new file mode 100644 index 00000000..55682155 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_If.cs @@ -0,0 +1,67 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; + +namespace CCodeGeneration +{ + public class PP_If: CodeContainerBase + { + public string Condition { get; set; } + + public PP_If() + { + base.IncreaseLevel = false; + } + + public PP_If(string condition) + : this() + { + this.Condition = condition; + } + + + public override void GenerateCode(int level, CGenerator generator) + { + if (!String.IsNullOrWhiteSpace(this.Condition)) + { + generator.OutputStream.Write("#if " + this.Condition); + generator.WriteNewLine(); + + base.GenerateCode(level, generator); + + generator.OutputStream.Write("#endif /* " + this.Condition + " */"); + generator.WriteNewLine(); + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Ifdef.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Ifdef.cs new file mode 100644 index 00000000..fd4f45af --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Ifdef.cs @@ -0,0 +1,76 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; + +namespace CCodeGeneration +{ + public class PP_Ifdef: CodeContainerBase + { + public string Macro { get; set; } + public bool Inverted { get; set; } + + public PP_Ifdef() + { + base.IncreaseLevel = false; + } + + public PP_Ifdef(string macro, bool inverted = false) + : this() + { + this.Macro = macro; + this.Inverted = inverted; + } + + + public override void GenerateCode(int level, CGenerator generator) + { + if (!String.IsNullOrWhiteSpace(this.Macro)) + { + if (this.Inverted) + { + generator.OutputStream.Write("#ifndef " + this.Macro); + } + else + { + generator.OutputStream.Write("#ifdef " + this.Macro); + } + generator.WriteNewLine(); + + base.GenerateCode(level, generator); + + generator.OutputStream.Write("#endif /* " + this.Macro + " */"); + generator.WriteNewLine(); + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Include.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Include.cs new file mode 100644 index 00000000..0393d271 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Include.cs @@ -0,0 +1,71 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; + +namespace CCodeGeneration +{ + public class PP_Include : CodeElement + { + public string File { get; set; } + public bool IsLocal { get; set; } + + public PP_Include() + { + this.IsLocal = true; + } + + public PP_Include(string file, bool isLocal = true) + { + this.File = file; + this.IsLocal = isLocal; + } + + public override void GenerateCode(int level, CGenerator generator) + { + if (!String.IsNullOrWhiteSpace(this.File)) + { + // includes are never indented + if (this.IsLocal) + { + generator.OutputStream.Write("#include \"" + this.File + "\""); + } + else + { + generator.OutputStream.Write("#include <" + this.File + ">"); + } + + generator.WriteNewLine(); + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Macro.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Macro.cs new file mode 100644 index 00000000..6f302aa9 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/PP_Macro.cs @@ -0,0 +1,59 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +namespace CCodeGeneration +{ + public class PP_Macro: CodeElement + { + public string Name { get; set; } + public string Value { get; set; } + + public PP_Macro() + { + } + + public PP_Macro(string name, string value) + { + this.Name = name; + this.Value = value; + } + + + public override void GenerateCode(int level, CGenerator generator) + { + // macros are not indented at all + generator.OutputStream.Write("#define " + this.Name + " "); + generator.WriteMultilineString(this.Value); + generator.WriteNewLine(); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/PlainText.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/PlainText.cs new file mode 100644 index 00000000..d5e076fe --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/PlainText.cs @@ -0,0 +1,49 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +namespace CCodeGeneration +{ + public class PlainText : CodeElement + { + public string Value { get; set; } + + public PlainText(string value) + { + this.Value = value; + } + + public override void GenerateCode(int level, CGenerator generator) + { + generator.WriteMultilineString(this.Value); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/Properties/AssemblyInfo.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/Properties/AssemblyInfo.cs new file mode 100644 index 00000000..4c716ad3 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/Properties/AssemblyInfo.cs @@ -0,0 +1,36 @@ +using System.Reflection; +using System.Runtime.CompilerServices; +using System.Runtime.InteropServices; + +// Allgemeine Informationen über eine Assembly werden über die folgenden +// Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern, +// die mit einer Assembly verknüpft sind. +[assembly: AssemblyTitle("CCodeGeneration")] +[assembly: AssemblyDescription("")] +[assembly: AssemblyConfiguration("")] +[assembly: AssemblyCompany("")] +[assembly: AssemblyProduct("CCodeGeneration")] +[assembly: AssemblyCopyright("Copyright © 2015")] +[assembly: AssemblyTrademark("")] +[assembly: AssemblyCulture("")] + +// Durch Festlegen von ComVisible auf "false" werden die Typen in dieser Assembly unsichtbar +// für COM-Komponenten. Wenn Sie auf einen Typ in dieser Assembly von +// COM zugreifen müssen, legen Sie das ComVisible-Attribut für diesen Typ auf "true" fest. +[assembly: ComVisible(false)] + +// Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird +[assembly: Guid("8f07a0fa-86f4-48a0-97c7-f94fc5c3f103")] + +// Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten: +// +// Hauptversion +// Nebenversion +// Buildnummer +// Revision +// +// Sie können alle Werte angeben oder die standardmäßigen Build- und Revisionsnummern +// übernehmen, indem Sie "*" eingeben: +// [assembly: AssemblyVersion("1.0.*")] +[assembly: AssemblyVersion("1.0.0.0")] +[assembly: AssemblyFileVersion("1.0.0.0")] diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/Switch.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/Switch.cs new file mode 100644 index 00000000..9166fb89 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/Switch.cs @@ -0,0 +1,146 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Collections.Generic; + +namespace CCodeGeneration +{ + public class SwitchCase : CodeContainerBase + { + public string Value { get; set; } + + public SwitchCase() + { + } + + public SwitchCase(string value) + { + this.Value = value; + } + + public bool IsDefault + { + get { return (this.Value.ToLowerInvariant() == "default"); } + } + + public static SwitchCase GenerateDefault() + { + return new SwitchCase("default"); + } + + public override void GenerateCode(int level, CGenerator generator) + { + if (!String.IsNullOrWhiteSpace(this.Value)) + { + generator.IndentLine(level); + if (this.IsDefault) + { + generator.OutputStream.Write("default:"); + } + else + { + generator.OutputStream.Write(String.Format("case {0}:", this.Value)); + } + generator.WriteNewLine(); + generator.IndentLine(level + 1); + generator.OutputStream.Write("{"); + generator.WriteNewLine(); + + base.GenerateCode(level + 1, generator); + + generator.IndentLine(level + 1); + generator.OutputStream.Write("}"); + generator.WriteNewLine(); + + generator.IndentLine(level + 1); + generator.OutputStream.Write("break;"); + generator.WriteNewLine(); + } + } + } + + public class Switch: CodeElement + { + public string SwitchVar { get; set; } + + private List switches = new List(); + + public Switch() + { + } + + public Switch(string switchVar) + { + this.SwitchVar = switchVar; + } + + public List Switches + { + get { return this.switches; } + } + + public override void GenerateCode(int level, CGenerator generator) + { + if (!String.IsNullOrWhiteSpace(this.SwitchVar)) + { + generator.IndentLine(level); + generator.OutputStream.Write(String.Format("switch ({0})", this.SwitchVar)); + generator.WriteNewLine(); + generator.IndentLine(level); + generator.OutputStream.Write("{"); + generator.WriteNewLine(); + + SwitchCase defaultCase = null; // generate 'default' always as last case + foreach (SwitchCase switchCase in this.switches) + { + if (switchCase.IsDefault) + { + defaultCase = switchCase; + } + else + { + switchCase.GenerateCode(level + 1, generator); + } + } + if (defaultCase != null) + { + defaultCase.GenerateCode(level + 1, generator); + } + + generator.IndentLine(level); + generator.OutputStream.Write("}"); + generator.WriteNewLine(); + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/VariableDeclaration.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/VariableDeclaration.cs new file mode 100644 index 00000000..bf2c9026 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/VariableDeclaration.cs @@ -0,0 +1,82 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; + +namespace CCodeGeneration +{ + public class VariableDeclaration : CodeElement + { + public VariableType Type { get; set; } + public string InitialValue { get; set; } + public bool IsStatic { get; set; } + + public VariableDeclaration() + : base() + { + } + + public VariableDeclaration(VariableType type, string initialValue = null, bool isStatic = false) : + base() + { + this.Type = type; + this.InitialValue = initialValue; + this.IsStatic = isStatic; + } + + public override void GenerateCode(int level, CGenerator generator) + { + if (this.Type != null) + { + generator.IndentLine(level); + + if (this.IsStatic) + { + generator.OutputStream.Write("static "); + } + + // declare the variable + this.Type.GenerateCode(generator); + + if (!String.IsNullOrWhiteSpace(this.InitialValue)) + { + // add initialization value + generator.OutputStream.Write(" = "); + generator.WriteMultilineString(this.InitialValue, level); + } + + generator.OutputStream.Write(";"); + generator.WriteNewLine(); + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/VariablePrototype.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/VariablePrototype.cs new file mode 100644 index 00000000..38a41663 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/VariablePrototype.cs @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +namespace CCodeGeneration +{ + public class VariablePrototype : CodeElement + { + public VariableType Type { get; set; } + + public VariablePrototype() + : base() + { + } + + public VariablePrototype(VariableType type) : + base() + { + Type = type; + } + + public static VariablePrototype FromVariableDeclaration(VariableDeclaration declaration) + { + return new VariablePrototype(declaration.Type); + } + + + public override void GenerateCode(int level, CGenerator generator) + { + if (this.Type != null) + { + generator.IndentLine(level); + + generator.OutputStream.Write("extern "); + + // declare the variable + this.Type.GenerateCode(generator); + + generator.OutputStream.Write(";"); + generator.WriteNewLine(); + } + } + + } +} diff --git a/contrib/apps/LwipMibCompiler/CCodeGeneration/VariableType.cs b/contrib/apps/LwipMibCompiler/CCodeGeneration/VariableType.cs new file mode 100644 index 00000000..313abbee --- /dev/null +++ b/contrib/apps/LwipMibCompiler/CCodeGeneration/VariableType.cs @@ -0,0 +1,130 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Text; + +namespace CCodeGeneration +{ + public enum ConstType + { + None, + Value, + Indirection, + Both + } + + public class VariableType : ICloneable + { + public const string VoidString = "void"; + public static readonly VariableType Void = new VariableType(null, "void"); + + public string Name { get; set; } + public string Type { get; set; } + public string Indirection { get; set; } + public ConstType Const { get; set; } + public string ArraySpecifier { get; set; } + + public VariableType() + { + } + + public VariableType(string name, string type, string indirection = null, ConstType const_ = ConstType.None, string arraySpecifier = null) + { + this.Name = name; + this.Type = type; + this.Indirection = indirection; + this.Const = const_; + this.ArraySpecifier = arraySpecifier; + } + + public void GenerateCode(CGenerator generator) + { + if (!String.IsNullOrWhiteSpace(this.Type)) + { + generator.OutputStream.Write(this.ToString().Trim()); + } + } + + public override string ToString() + { + if (!String.IsNullOrWhiteSpace(this.Type)) + { + StringBuilder vt = new StringBuilder(); + + if ((this.Const == ConstType.Value) || (this.Const == ConstType.Both)) + { + vt.Append("const "); + } + + vt.Append(this.Type); + vt.Append(" "); + + if (!String.IsNullOrWhiteSpace(this.Indirection)) + { + vt.Append(this.Indirection); + } + + if ((this.Const == ConstType.Indirection) || (this.Const == ConstType.Both)) + { + vt.Append("const "); + } + + if (!String.IsNullOrWhiteSpace(this.Name)) + { + vt.Append(this.Name); + } + + if (this.ArraySpecifier != null) + { + vt.Append("["); + vt.Append(this.ArraySpecifier); + vt.Append("]"); + } + + return vt.ToString().Trim(); + } + + return base.ToString(); + } + + #region ICloneable Member + + public object Clone() + { + // we only have value types as members -> simply use .net base function + return this.MemberwiseClone(); + } + + #endregion + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipMibCompiler.sln b/contrib/apps/LwipMibCompiler/LwipMibCompiler.sln new file mode 100644 index 00000000..ee041413 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipMibCompiler.sln @@ -0,0 +1,47 @@ + +Microsoft Visual Studio Solution File, Format Version 11.00 +# Visual Studio 2010 +Project("{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}") = "LwipMibCompiler", "LwipMibCompiler\LwipMibCompiler.csproj", "{C25D5640-D999-49BD-82E0-A1975296A91E}" +EndProject +Project("{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}") = "LwipSnmpCodeGeneration", "LwipSnmpCodeGeneration\LwipSnmpCodeGeneration.csproj", "{AABCAB90-1540-45D4-A159-14831A54E9A3}" +EndProject +Project("{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}") = "CCodeGeneration", "CCodeGeneration\CCodeGeneration.csproj", "{7DA7C0AB-0982-4BF5-9324-F59A7A08D65B}" +EndProject +Project("{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}") = "SharpSnmpLib.Mib", "SharpSnmpLib\SharpSnmpLib.Mib.csproj", "{CBE20411-5DB7-487D-825D-7694267BB6F5}" +EndProject +Project("{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}") = "MibViewer", "MibViewer\MibViewer.csproj", "{86CC0B65-7985-4017-A252-0A7A18DCAEF3}" +EndProject +Global + GlobalSection(SolutionConfigurationPlatforms) = preSolution + Debug|Any CPU = Debug|Any CPU + Release|Any CPU = Release|Any CPU + EndGlobalSection + GlobalSection(ProjectConfigurationPlatforms) = postSolution + {7DA7C0AB-0982-4BF5-9324-F59A7A08D65B}.Debug|Any CPU.ActiveCfg = Debug|Any CPU + {7DA7C0AB-0982-4BF5-9324-F59A7A08D65B}.Debug|Any CPU.Build.0 = Debug|Any CPU + {7DA7C0AB-0982-4BF5-9324-F59A7A08D65B}.Release|Any CPU.ActiveCfg = Release|Any CPU + {7DA7C0AB-0982-4BF5-9324-F59A7A08D65B}.Release|Any CPU.Build.0 = Release|Any CPU + {86CC0B65-7985-4017-A252-0A7A18DCAEF3}.Debug|Any CPU.ActiveCfg = Debug|Any CPU + {86CC0B65-7985-4017-A252-0A7A18DCAEF3}.Debug|Any CPU.Build.0 = Debug|Any CPU + {86CC0B65-7985-4017-A252-0A7A18DCAEF3}.Release|Any CPU.ActiveCfg = Release|Any CPU + {86CC0B65-7985-4017-A252-0A7A18DCAEF3}.Release|Any CPU.Build.0 = Release|Any CPU + {AABCAB90-1540-45D4-A159-14831A54E9A3}.Debug|Any CPU.ActiveCfg = Debug|Any CPU + {AABCAB90-1540-45D4-A159-14831A54E9A3}.Debug|Any CPU.Build.0 = Debug|Any CPU + {AABCAB90-1540-45D4-A159-14831A54E9A3}.Release|Any CPU.ActiveCfg = Release|Any CPU + {AABCAB90-1540-45D4-A159-14831A54E9A3}.Release|Any CPU.Build.0 = Release|Any CPU + {C25D5640-D999-49BD-82E0-A1975296A91E}.Debug|Any CPU.ActiveCfg = Debug|Any CPU + {C25D5640-D999-49BD-82E0-A1975296A91E}.Debug|Any CPU.Build.0 = Debug|Any CPU + {C25D5640-D999-49BD-82E0-A1975296A91E}.Release|Any CPU.ActiveCfg = Release|Any CPU + {C25D5640-D999-49BD-82E0-A1975296A91E}.Release|Any CPU.Build.0 = Release|Any CPU + {CBE20411-5DB7-487D-825D-7694267BB6F5}.Debug|Any CPU.ActiveCfg = Debug|Any CPU + {CBE20411-5DB7-487D-825D-7694267BB6F5}.Debug|Any CPU.Build.0 = Debug|Any CPU + {CBE20411-5DB7-487D-825D-7694267BB6F5}.Release|Any CPU.ActiveCfg = Release|Any CPU + {CBE20411-5DB7-487D-825D-7694267BB6F5}.Release|Any CPU.Build.0 = Release|Any CPU + EndGlobalSection + GlobalSection(MonoDevelopProperties) = preSolution + StartupItem = LwipMibCompiler\LwipMibCompiler.csproj + EndGlobalSection + GlobalSection(SolutionProperties) = preSolution + HideSolutionNode = FALSE + EndGlobalSection +EndGlobal diff --git a/contrib/apps/LwipMibCompiler/LwipMibCompiler/LwipMibCompiler.csproj b/contrib/apps/LwipMibCompiler/LwipMibCompiler/LwipMibCompiler.csproj new file mode 100644 index 00000000..694263aa --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipMibCompiler/LwipMibCompiler.csproj @@ -0,0 +1,73 @@ + + + + Debug + AnyCPU + 8.0.30703 + 2.0 + {C25D5640-D999-49BD-82E0-A1975296A91E} + Exe + Properties + LwipMibCompiler + LwipMibCompiler + v4.0 + 512 + + + + true + bin\Debug\ + DEBUG;TRACE + full + AnyCPU + prompt + false + false + 4 + false + false + + + bin\Release\ + TRACE + true + pdbonly + AnyCPU + prompt + 4 + false + + + + + + + + + + + + + + {7DA7C0AB-0982-4BF5-9324-F59A7A08D65B} + CCodeGeneration + + + {AABCAB90-1540-45D4-A159-14831A54E9A3} + LwipSnmpCodeGeneration + + + {CBE20411-5DB7-487D-825D-7694267BB6F5} + SharpSnmpLib.Mib + + + + + + \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/LwipMibCompiler/Program.cs b/contrib/apps/LwipMibCompiler/LwipMibCompiler/Program.cs new file mode 100644 index 00000000..a00d74b1 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipMibCompiler/Program.cs @@ -0,0 +1,480 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Collections.Generic; +using System.IO; +using System.Reflection; +using System.Text.RegularExpressions; +using CCodeGeneration; +using Lextm.SharpSnmpLib.Mib; +using Lextm.SharpSnmpLib.Mib.Elements.Entities; +using Lextm.SharpSnmpLib.Mib.Elements.Types; +using LwipSnmpCodeGeneration; + +namespace LwipMibCompiler +{ + class Program + { + private static readonly Regex _alphaNumericRegex = new Regex("[^a-zA-Z0-9]"); + + static void Main(string[] args) + { + Console.WriteLine("lwIP MIB Compiler"); + Console.WriteLine(""); + + // check args + if ((args.Length < 2) || String.IsNullOrWhiteSpace(args[0]) || String.IsNullOrWhiteSpace(args[1])) + { + PrintUsage(); + return; + } + + string mibFile = args[0]; + if (!File.Exists(mibFile)) + { + Console.WriteLine(String.Format("Unable to find file '{0}'!", mibFile)); + } + + string destFile = args[1]; + string destHeaderFile; + + if (Directory.Exists(destFile)) + { + // only directory passed -> create dest filename from mib filename + string mibFileName = Path.GetFileNameWithoutExtension(mibFile).ToLowerInvariant(); + destFile = Path.Combine(destFile, mibFileName + ".c"); + } + + string destFileExt = Path.GetExtension(destFile); + if (!String.IsNullOrEmpty(destFileExt)) + { + destHeaderFile = destFile.Substring(0, destFile.Length - destFileExt.Length); + } + else + { + destHeaderFile = destFile; + } + destHeaderFile += ".h"; + + for (int i=2; i [ ...]", appName)); + Console.WriteLine(""); + Console.WriteLine(" "); + Console.WriteLine(" Path and filename of MIB file to convert."); + Console.WriteLine(""); + Console.WriteLine(" "); + Console.WriteLine(" Destination path and file. If a path is passed only, filename is auto"); + Console.WriteLine(" generated from MIB file name."); + Console.WriteLine(""); + Console.WriteLine(" "); + Console.WriteLine(" It's important to provide all referred MIB's in order to correctly "); + Console.WriteLine(" resolve all used types."); + Console.WriteLine(""); + } + + + #region Generation of LWIP Object Tree + + private static void ProcessMibTreeNode(MibTreeNode mibTreeNode, SnmpTreeNode assignedSnmpNode) + { + foreach (MibTreeNode mtn in mibTreeNode.ChildNodes) + { + // in theory container nodes may also be scalars or tables at the same time (for now only process real containers) + if (mtn.NodeType == MibTreeNodeType.Container) + { + SnmpTreeNode snmpTreeNode = GenerateSnmpTreeNode(mtn, assignedSnmpNode); + assignedSnmpNode.ChildNodes.Add(snmpTreeNode); + + ProcessMibTreeNode(mtn, snmpTreeNode); + } + else if ((mtn.NodeType & MibTreeNodeType.Scalar) != 0) + { + SnmpScalarNode snmpScalarNode = GenerateSnmpScalarNode(mtn, assignedSnmpNode); + if (snmpScalarNode != null) + { + assignedSnmpNode.ChildNodes.Add(snmpScalarNode); + } + } + else if ((mtn.NodeType & MibTreeNodeType.Table) != 0) + { + SnmpTableNode snmpTableNode = GenerateSnmpTableNode(mtn, assignedSnmpNode); + if (snmpTableNode != null) + { + assignedSnmpNode.ChildNodes.Add(snmpTableNode); + } + } + } + } + + private static SnmpTreeNode GenerateSnmpTreeNode(MibTreeNode mibTreeNode, SnmpTreeNode parentNode) + { + SnmpTreeNode result = new SnmpTreeNode(parentNode); + result.Name = _alphaNumericRegex.Replace (mibTreeNode.Entity.Name, ""); + result.Oid = mibTreeNode.Entity.Value; + result.FullOid = MibTypesResolver.ResolveOid(mibTreeNode.Entity).GetOidString(); + + return result; + } + + private static SnmpScalarNode GenerateSnmpScalarNode(MibTreeNode mibTreeNode, SnmpTreeNode parentNode, bool ignoreAccessibleFlag = false) + { + ObjectType ote = mibTreeNode.Entity as ObjectType; + if (ote != null) + { + return GenerateSnmpScalarNode(ote, parentNode, ignoreAccessibleFlag); + } + + return null; + } + + private static SnmpScalarNode GenerateSnmpScalarNode(ObjectType ote, SnmpTreeNode parentNode, bool ignoreAccessibleFlag = false) + { + SnmpScalarNode result; + + ITypeAssignment mibType = ote.BaseType; + IntegerType it = (mibType as IntegerType); + if (it != null) + { + if (ote.ReferredType.Name == Symbol.TruthValue.ToString()) + { + result = new SnmpScalarNodeTruthValue(parentNode); + } + else if ((it.Type == IntegerType.Types.Integer) || (it.Type == IntegerType.Types.Integer32)) + { + result = new SnmpScalarNodeInt(parentNode); + } + else + { + Console.WriteLine(String.Format("Unsupported IntegerType '{0}'!", it.Type)); + return null; + } + if (it.IsEnumeration) + { + result.Restrictions.AddRange(CreateRestrictions(it.Enumeration)); + } + else + { + result.Restrictions.AddRange(CreateRestrictions(it.Ranges)); + } + } + else + { + UnsignedType ut = (mibType as UnsignedType); + if (ut != null) + { + if ((ut.Type == UnsignedType.Types.Unsigned32) || + (ut.Type == UnsignedType.Types.Gauge32)) + { + result = new SnmpScalarNodeUint(SnmpDataType.Gauge, parentNode); + } + else if (ut.Type == UnsignedType.Types.Counter32) + { + result = new SnmpScalarNodeUint(SnmpDataType.Counter, parentNode); + } + else if (ut.Type == UnsignedType.Types.TimeTicks) + { + result = new SnmpScalarNodeUint(SnmpDataType.TimeTicks, parentNode); + } + else if (ut.Type == UnsignedType.Types.Counter64) + { + result = new SnmpScalarNodeCounter64(parentNode); + if ((ut.Ranges != null) && (ut.Ranges.Count > 0)) + { + Console.WriteLine(String.Format("Generation of ranges is not supported for Counter64 type!")); + return null; + } + } + else + { + Console.WriteLine(String.Format("Unsupported UnsignedType '{0}'!", ut.Type)); + return null; + } + result.Restrictions.AddRange(CreateRestrictions(ut.Ranges)); + } + else if (mibType is IpAddressType) + { + result = new SnmpScalarNodeOctetString(SnmpDataType.IpAddress, parentNode); + result.Restrictions.AddRange(CreateRestrictions((mibType as OctetStringType).Size)); + } + else if (mibType is OpaqueType) + { + result = new SnmpScalarNodeOctetString(SnmpDataType.Opaque, parentNode); + result.Restrictions.AddRange(CreateRestrictions((mibType as OctetStringType).Size)); + } + else if (mibType is OctetStringType) + { + result = new SnmpScalarNodeOctetString(SnmpDataType.OctetString, parentNode); + result.Restrictions.AddRange(CreateRestrictions((mibType as OctetStringType).Size)); + } + else if (mibType is ObjectIdentifierType) + { + result = new SnmpScalarNodeObjectIdentifier(parentNode); + } + else if (mibType is BitsType) + { + result = new SnmpScalarNodeBits(parentNode, (uint)((mibType as BitsType).Map.GetHighestValue() + 1)); + result.Restrictions.AddRange(CreateRestrictions(mibType as BitsType)); + } + else + { + TypeAssignment ta = mibType as TypeAssignment; + if (ta != null) + { + Console.WriteLine(String.Format("Unsupported BaseType: Module='{0}', Name='{1}', Type='{2}'!", ta.Module.Name, ta.Name, ta.Type)); + } + else + { + Console.WriteLine(String.Format("Unsupported BaseType: Module='{0}', Name='{1}'!", mibType.Module, mibType.Name)); + } + + return null; + } + } + + result.Name = _alphaNumericRegex.Replace(ote.Name, ""); + result.Oid = ote.Value; + + if (ote.Access == MaxAccess.readWrite) + { + result.AccessMode = SnmpAccessMode.ReadWrite; + } + else if (ote.Access == MaxAccess.readOnly) + { + result.AccessMode = SnmpAccessMode.ReadOnly; + } + else if (ote.Access == MaxAccess.readCreate) + { + result.AccessMode = SnmpAccessMode.ReadOnly; + } + else if (ignoreAccessibleFlag && (ote.Access == MaxAccess.notAccessible)) + { + result.AccessMode = SnmpAccessMode.NotAccessible; + } + else + { + // not accessible or unsupported accress type + return null; + } + + return result; + } + + private static IEnumerable CreateRestrictions(ValueRanges ranges) + { + List result = new List(); + + if (ranges != null) + { + foreach (ValueRange range in ranges) + { + if (!range.End.HasValue) + { + result.Add(new IsEqualRestriction(range.Start)); + } + else + { + result.Add(new IsInRangeRestriction(range.Start, range.End.Value)); + } + } + } + + return result; + } + + private static IEnumerable CreateRestrictions(ValueMap map) + { + if ((map != null) && (map.Count > 0)) + { + return CreateRestrictions(map.GetContinousRanges()); + } + + return new List(); + } + + private static IEnumerable CreateRestrictions(BitsType bt) + { + List result = new List(); + + if ((bt != null) && (bt.Map != null)) + { + result.Add(new BitMaskRestriction(bt.Map.GetBitMask())); + } + + return result; + } + + private static SnmpTableNode GenerateSnmpTableNode(MibTreeNode mibTreeNode, SnmpTreeNode parentNode) + { + SnmpTableNode result = new SnmpTableNode(parentNode); + result.Name = mibTreeNode.Entity.Name; + result.Oid = mibTreeNode.Entity.Value; + + // expect exactly one row entry + if ((mibTreeNode.ChildNodes.Count != 1) || ((mibTreeNode.ChildNodes[0].NodeType & MibTreeNodeType.TableRow) == 0) || (mibTreeNode.ChildNodes[0].Entity.Value != 1)) + { + Console.WriteLine("Found table with unsupported properties! Table needs exactly one (fixed) TableRow with OID=1 ! (" + mibTreeNode.Entity.Name + ")"); + return null; + } + + MibTreeNode rowNode = mibTreeNode.ChildNodes[0]; + + ObjectType rot = rowNode.Entity as ObjectType; + if (rot != null) + { + if (!String.IsNullOrWhiteSpace(rot.Augments)) + { + result.AugmentedTableRow = rot.Augments; + + // the indeces from another table shall be used because this table is only an extension of it + rot = MibTypesResolver.ResolveDeclaration(rot.Module, rot.Augments) as ObjectType; + } + + if (rot.Indices != null) + { + foreach (string index in rot.Indices) + { + ObjectType indexEntity = MibTypesResolver.ResolveDeclaration(rot.Module, index) as ObjectType; + if (indexEntity == null) + { + Console.WriteLine(String.Format("Could not resolve index '{0}' for table '{1}'! Table omitted!", index, result.Name)); + return null; + } + + result.IndexNodes.Add(GenerateSnmpScalarNode(indexEntity, parentNode, ignoreAccessibleFlag: true)); + } + } + } + + if (result.IndexNodes.Count == 0) + { + // a table cannot be used without index + Console.WriteLine("Found table without any index column ! (" + mibTreeNode.Entity.Name + ")"); + return null; + } + + // add child nodes + foreach (MibTreeNode cellNode in rowNode.ChildNodes) + { + SnmpScalarNode ssn = GenerateSnmpScalarNode(cellNode, parentNode); + if (ssn != null) + { + result.CellNodes.Add(ssn); + } + } + + return result; + } + + #endregion + + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipMibCompiler/Properties/AssemblyInfo.cs b/contrib/apps/LwipMibCompiler/LwipMibCompiler/Properties/AssemblyInfo.cs new file mode 100644 index 00000000..d30b8425 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipMibCompiler/Properties/AssemblyInfo.cs @@ -0,0 +1,36 @@ +using System.Reflection; +using System.Runtime.CompilerServices; +using System.Runtime.InteropServices; + +// Allgemeine Informationen über eine Assembly werden über die folgenden +// Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern, +// die mit einer Assembly verknüpft sind. +[assembly: AssemblyTitle("ConsoleApplication28")] +[assembly: AssemblyDescription("")] +[assembly: AssemblyConfiguration("")] +[assembly: AssemblyCompany("")] +[assembly: AssemblyProduct("ConsoleApplication28")] +[assembly: AssemblyCopyright("Copyright © 2015")] +[assembly: AssemblyTrademark("")] +[assembly: AssemblyCulture("")] + +// Durch Festlegen von ComVisible auf "false" werden die Typen in dieser Assembly unsichtbar +// für COM-Komponenten. Wenn Sie auf einen Typ in dieser Assembly von +// COM zugreifen müssen, legen Sie das ComVisible-Attribut für diesen Typ auf "true" fest. +[assembly: ComVisible(false)] + +// Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird +[assembly: Guid("0abf7541-6a96-43cd-9e24-462e074b2c96")] + +// Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten: +// +// Hauptversion +// Nebenversion +// Buildnummer +// Revision +// +// Sie können alle Werte angeben oder die standardmäßigen Build- und Revisionsnummern +// übernehmen, indem Sie "*" eingeben: +// [assembly: AssemblyVersion("1.0.*")] +[assembly: AssemblyVersion("1.0.0.0")] +[assembly: AssemblyFileVersion("1.0.0.0")] diff --git a/contrib/apps/LwipMibCompiler/LwipMibCompiler/app.config b/contrib/apps/LwipMibCompiler/LwipMibCompiler/app.config new file mode 100644 index 00000000..e3656033 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipMibCompiler/app.config @@ -0,0 +1,3 @@ + + + diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/IRestriction.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/IRestriction.cs new file mode 100644 index 00000000..ee2f4536 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/IRestriction.cs @@ -0,0 +1,120 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; + +namespace LwipSnmpCodeGeneration +{ + public interface IRestriction + { + string GetCheckCodeValid(string varNameToCheck); + string GetCheckCodeInvalid(string varNameToCheck); + } + + public class BitMaskRestriction : IRestriction + { + UInt32 mask; + + public BitMaskRestriction(UInt32 mask) + { + this.mask = mask; + } + + public string GetCheckCodeValid(string varNameToCheck) + { + return String.Format("(({0} & {1}) == {0})", varNameToCheck, this.mask); + } + + public string GetCheckCodeInvalid(string varNameToCheck) + { + return String.Format("(({0} & {1}) != {0})", varNameToCheck, this.mask); + } + } + + public class IsEqualRestriction : IRestriction + { + private Int64 value; + + public IsEqualRestriction(Int64 value) + { + this.value = value; + } + + public long Value + { + get { return value; } + } + + public string GetCheckCodeValid(string varNameToCheck) + { + return String.Format("({0} == {1})", varNameToCheck, this.value); + } + + public string GetCheckCodeInvalid(string varNameToCheck) + { + return String.Format("({0} != {1})", varNameToCheck, this.value); + } + } + + public class IsInRangeRestriction : IRestriction + { + private Int64 rangeStart; + private Int64 rangeEnd; + + public IsInRangeRestriction(Int64 rangeStart, Int64 rangeEnd) + { + this.rangeStart = rangeStart; + this.rangeEnd = rangeEnd; + } + + public long RangeStart + { + get { return this.rangeStart; } + } + + public long RangeEnd + { + get { return this.rangeEnd; } + } + + public string GetCheckCodeValid(string varNameToCheck) + { + return String.Format("(({0} >= {1}) && ({0} <= {2}))", varNameToCheck, this.rangeStart, this.rangeEnd); + } + + public string GetCheckCodeInvalid(string varNameToCheck) + { + return String.Format("(({0} < {1}) || ({0} > {2}))", varNameToCheck, this.rangeStart, this.rangeEnd); + } + } + +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/LwipSnmp.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/LwipSnmp.cs new file mode 100644 index 00000000..edac59e0 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/LwipSnmp.cs @@ -0,0 +1,199 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; + +namespace LwipSnmpCodeGeneration +{ + public static class LwipOpts + { + public static bool GenerateEmptyFolders = false; + /// + /// If a tree node only has scalar nodes as child nodes, it is replaced by + /// a single scalar array node in order to save memory and have only one single get/test/set method for all scalars. + /// + public static bool GenerateScalarArrays = true; + /// + /// If a tree node has multiple scalars as subnodes as well as other treenodes it + /// defines a single get/test/set method for all scalar child node. + /// (without other treenodes as child it would have been converted to scalar array node). + /// + public static bool GenerateSingleAccessMethodsForTreeNodeScalars = GenerateScalarArrays; + } + + public static class LwipDefs + { + public const string Null = "NULL"; + public const string Vt_U8 = "u8_t"; + public const string Vt_U16 = "u16_t"; + public const string Vt_U32 = "u32_t"; + public const string Vt_S8 = "s8_t"; + public const string Vt_S16 = "s16_t"; + public const string Vt_S32 = "s32_t"; + public const string Vt_Snmp_err = "snmp_err_t"; + + public const string Incl_SnmpOpts = "lwip/apps/snmp_opts.h"; + public const string Opt_SnmpEnabled = "LWIP_SNMP"; + + public const string Vt_StMib = "struct snmp_mib"; + public const string Vt_StObjectId = "struct snmp_obj_id"; + public const string Vt_StNode = "struct snmp_node"; + public const string Vt_StNodeInstance = "struct snmp_node_instance"; + public const string Vt_StTreeNode = "struct snmp_tree_node"; + public const string Vt_StScalarNode = "struct snmp_scalar_node"; + public const string Vt_StScalarArrayNode = "struct snmp_scalar_array_node"; + public const string Vt_StScalarArrayNodeDef = "struct snmp_scalar_array_node_def"; + public const string Vt_StTableNode = "struct snmp_table_node"; + public const string Vt_StTableColumnDef = "struct snmp_table_col_def"; + public const string Vt_StNextOidState = "struct snmp_next_oid_state"; + + public const string Def_NodeAccessReadOnly = "SNMP_NODE_INSTANCE_READ_ONLY"; + public const string Def_NodeAccessReadWrite = "SNMP_NODE_INSTANCE_READ_WRITE"; + public const string Def_NodeAccessWriteOnly = "SNMP_NODE_INSTANCE_WRITE_ONLY"; + public const string Def_NodeAccessNotAccessible = "SNMP_NODE_INSTANCE_NOT_ACCESSIBLE"; + + public const string Def_ErrorCode_Ok = "SNMP_ERR_NOERROR"; + public const string Def_ErrorCode_WrongValue = "SNMP_ERR_WRONGVALUE"; + public const string Def_ErrorCode_NoSuchInstance = "SNMP_ERR_NOSUCHINSTANCE"; + + public const string FnctSuffix_GetValue = "_get_value"; + public const string FnctSuffix_SetTest = "_set_test"; + public const string FnctSuffix_SetValue = "_set_value"; + public const string FnctSuffix_GetInstance = "_get_instance"; + public const string FnctSuffix_GetNextInstance = "_get_next_instance"; + + public const string FnctName_SetTest_Ok = "snmp_set_test_ok"; + + public static string GetLwipDefForSnmpAccessMode(SnmpAccessMode am) + { + switch (am) + { + case SnmpAccessMode.ReadOnly: return Def_NodeAccessReadOnly; + case SnmpAccessMode.ReadWrite: return Def_NodeAccessReadWrite; + case SnmpAccessMode.NotAccessible: return Def_NodeAccessNotAccessible; + case SnmpAccessMode.WriteOnly: return Def_NodeAccessWriteOnly; + default: throw new NotSupportedException("Unknown SnmpAccessMode!"); + } + } + + public static string GetAsn1DefForSnmpDataType(SnmpDataType dt) + { + switch (dt) + { + // primitive + case SnmpDataType.Null: + return "SNMP_ASN1_TYPE_NULL"; + case SnmpDataType.Bits: + case SnmpDataType.OctetString: + return "SNMP_ASN1_TYPE_OCTET_STRING"; + case SnmpDataType.ObjectIdentifier: + return "SNMP_ASN1_TYPE_OBJECT_ID"; + case SnmpDataType.Integer: + return "SNMP_ASN1_TYPE_INTEGER"; + + // application + case SnmpDataType.IpAddress: + return "SNMP_ASN1_TYPE_IPADDR"; + case SnmpDataType.Counter: + return "SNMP_ASN1_TYPE_COUNTER"; + case SnmpDataType.Gauge: + return "SNMP_ASN1_TYPE_GAUGE"; + case SnmpDataType.TimeTicks: + return "SNMP_ASN1_TYPE_TIMETICKS"; + case SnmpDataType.Opaque: + return "SNMP_ASN1_TYPE_OPAQUE"; + case SnmpDataType.Counter64: + return "SNMP_ASN1_TYPE_COUNTER64"; + default: + throw new NotSupportedException("Unknown SnmpDataType!"); + } + } + + public static string GetLengthForSnmpDataType(SnmpDataType dt) + { + switch (dt) + { + case SnmpDataType.Null: + return "0"; + + case SnmpDataType.Integer: + case SnmpDataType.Counter: + case SnmpDataType.IpAddress: + case SnmpDataType.Gauge: + case SnmpDataType.TimeTicks: + return "4"; + + case SnmpDataType.Counter64: + return "8"; + + case SnmpDataType.OctetString: + case SnmpDataType.ObjectIdentifier: + case SnmpDataType.Bits: + case SnmpDataType.Opaque: + return null; + + default: + throw new NotSupportedException("Unknown SnmpDataType!"); + } + } + } + + public enum SnmpDataType + { + Null, + + Integer, // INTEGER, Integer32 + + Counter, // Counter, Counter32 + Gauge, // Gauge, Gauge32, Unsigned32 + TimeTicks, + + Counter64, + + OctetString, + Opaque, + Bits, + + ObjectIdentifier, + + IpAddress, + } + + public enum SnmpAccessMode + { + ReadOnly, + ReadWrite, + WriteOnly, + NotAccessible + } + +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/LwipSnmpCodeGeneration.csproj b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/LwipSnmpCodeGeneration.csproj new file mode 100644 index 00000000..f4541c0c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/LwipSnmpCodeGeneration.csproj @@ -0,0 +1,72 @@ + + + + Debug + AnyCPU + 8.0.30703 + 2.0 + {AABCAB90-1540-45D4-A159-14831A54E9A3} + Library + Properties + LwipSnmpCodeGeneration + LwipSnmpCodeGeneration + v4.0 + 512 + + + + true + full + false + bin\Debug\ + DEBUG;TRACE + prompt + 4 + + + pdbonly + true + bin\Release\ + TRACE + prompt + 4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + {7DA7C0AB-0982-4BF5-9324-F59A7A08D65B} + CCodeGeneration + + + + + \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/MibCFile.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/MibCFile.cs new file mode 100644 index 00000000..c48ec29d --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/MibCFile.cs @@ -0,0 +1,196 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System.Collections.Generic; +using CCodeGeneration; +using System; +using System.IO; + +namespace LwipSnmpCodeGeneration +{ + public class MibCFile + { + #region Fields + + private const string PreservedSectionMarker = "LWIP MIB generator - preserved section begin"; + private const string PreservedSectionHeader = + "+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++\n" + + PreservedSectionMarker + "\n" + + "Code below is preserved on regeneration. Remove these comment lines to regenerate code.\n" + + "+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++"; + + private readonly List includes = new List(); + private readonly List defines = new List(); + private readonly List declarations = new List(); + private readonly List implementation = new List(); + private readonly List preservedCode = new List(); + + #endregion + + public MibCFile() + { + } + + #region Accessors + + public List Includes + { + get { return this.includes; } + } + + public List Defines + { + get { return this.defines; } + } + + public List Declarations + { + get { return this.declarations; } + } + + public List Implementation + { + get { return this.implementation; } + } + + public List PreservedCode + { + get { return this.preservedCode; } + } + + #endregion + + #region Methods + + public void Save(CGenerator cGenerator) + { + CFile cFile = new CFile(); + + cFile.AddElement(new Comment("Generated by LwipMibCompiler")); + cFile.AddElement(EmptyLine.SingleLine); + + cFile.AddElement(new PP_Include(LwipDefs.Incl_SnmpOpts)); + CodeContainerBase e = cFile.AddElement(new PP_If(LwipDefs.Opt_SnmpEnabled)) as CodeContainerBase; + e.AddElement(EmptyLine.SingleLine); + + // include header file + string file = cGenerator.FileName; + if (!String.IsNullOrWhiteSpace(file)) + { + string ext = System.IO.Path.GetExtension(file); + + string headerFile = !String.IsNullOrEmpty(ext) ? file.Substring(0, file.Length - ext.Length) : file; + headerFile += ".h"; + + e.AddElement(new PP_Include(headerFile)); + } + + // include common snmp files + e.AddElement(new PP_Include("lwip/apps/snmp.h")); + e.AddElement(new PP_Include("lwip/apps/snmp_core.h")); + e.AddElement(new PP_Include("lwip/apps/snmp_scalar.h")); + e.AddElement(new PP_Include("lwip/apps/snmp_table.h")); + + if (this.includes.Count > 0) + { + e.AddElement(EmptyLine.SingleLine); + e.AddElements(this.includes); + } + + if (this.defines.Count > 0) + { + e.AddElement(EmptyLine.SingleLine); + e.AddElements(this.defines); + } + + if (this.declarations.Count > 0) + { + e.AddElement(EmptyLine.TwoLines); + e.AddElements(this.declarations); + } + + if (this.implementation.Count > 0) + { + e.AddElement(EmptyLine.TwoLines); + e.AddElements(this.implementation); + } + + if (this.preservedCode.Count > 0) + { + e.AddElement(EmptyLine.TwoLines); + e.AddElement(new Comment(PreservedSectionHeader)); + e.AddElement(EmptyLine.SingleLine); + e.AddElements(this.preservedCode); + } + + cFile.Save(cGenerator); + } + + public static string GetPreservedCode(string file) + { + if (File.Exists(file)) + { + using (StreamReader fileStream = new StreamReader(file)) + { + while (!fileStream.EndOfStream) + { + string line = fileStream.ReadLine(); + if (line == PreservedSectionMarker) + { + break; + } + } + + if (!fileStream.EndOfStream) + { + // skip the rest of the comment + spacer line + fileStream.ReadLine(); // "Code below is preserved... + fileStream.ReadLine(); // "+++++++++++++++++++++++... + fileStream.ReadLine(); // */ + fileStream.ReadLine(); // + + string preservedCode = fileStream.ReadToEnd(); + + int lastEndif = preservedCode.LastIndexOf("#endif", StringComparison.Ordinal); + preservedCode = preservedCode.Remove(lastEndif); + + return preservedCode; + } + } + } + + return null; + } + + #endregion + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/MibHeaderFile.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/MibHeaderFile.cs new file mode 100644 index 00000000..95f2a06c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/MibHeaderFile.cs @@ -0,0 +1,129 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System.Collections.Generic; +using System.Text.RegularExpressions; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class MibHeaderFile + { + + #region Fields + + private readonly List defines = new List(); + private readonly List includes = new List(); + private readonly List functionDeclarations = new List(); + private readonly List variableDeclarations = new List(); + + #endregion + + public MibHeaderFile() + { + } + + #region Accessors + + public List Defines + { + get { return this.defines; } + } + + public List Includes + { + get { return this.includes; } + } + + public List FunctionDeclarations + { + get { return this.functionDeclarations; } + } + + public List VariableDeclarations + { + get { return this.variableDeclarations; } + } + + #endregion + + #region Methods + + public void Save(CGenerator cGenerator) + { + CFile cFile = new CFile(); + + cFile.AddElement(new Comment("Generated by LwipMibCompiler")); + cFile.AddElement(EmptyLine.SingleLine); + + string headerDefine = cGenerator.FileName; + headerDefine = new Regex("[^a-zA-Z0-9]").Replace(headerDefine, "_"); + headerDefine = headerDefine.ToUpperInvariant(); + + CodeContainerBase e = cFile.AddElement(new PP_Ifdef(headerDefine, inverted: true)) as CodeContainerBase; + e.AddElement(new PP_Macro(headerDefine, headerDefine)); + e.AddElement(EmptyLine.SingleLine); + + e.AddElement(new PP_Include(LwipDefs.Incl_SnmpOpts)); + e = e.AddElement(new PP_If(LwipDefs.Opt_SnmpEnabled)) as CodeContainerBase; + e.AddElement(EmptyLine.SingleLine); + + CodeContainerBase cplusplusopen = e.AddElement(new PP_Ifdef("__cplusplus")) as CodeContainerBase; + cplusplusopen.AddElement(new Code("extern \"C\" {")); + e.AddElement(EmptyLine.SingleLine); + + if (this.includes.Count > 0) + { + e.AddElements(this.includes); + e.AddElement(EmptyLine.SingleLine); + } + + if (this.defines.Count > 0) + { + e.AddElements(this.defines); + e.AddElement(EmptyLine.SingleLine); + } + + e.AddElements(this.functionDeclarations, EmptyLine.SingleLine); + e.AddElements(this.variableDeclarations, EmptyLine.SingleLine); + + e.AddElement(EmptyLine.SingleLine); + CodeContainerBase cplusplusclose = e.AddElement(new PP_Ifdef("__cplusplus")) as CodeContainerBase; + cplusplusclose.AddElement(new Code("}")); + + e.AddElement(EmptyLine.SingleLine); + cFile.Save(cGenerator); + } + + #endregion + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/Properties/AssemblyInfo.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/Properties/AssemblyInfo.cs new file mode 100644 index 00000000..e68b43d5 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/Properties/AssemblyInfo.cs @@ -0,0 +1,36 @@ +using System.Reflection; +using System.Runtime.CompilerServices; +using System.Runtime.InteropServices; + +// Allgemeine Informationen über eine Assembly werden über die folgenden +// Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern, +// die mit einer Assembly verknüpft sind. +[assembly: AssemblyTitle("LwipSnmpCodeGeneration")] +[assembly: AssemblyDescription("")] +[assembly: AssemblyConfiguration("")] +[assembly: AssemblyCompany("")] +[assembly: AssemblyProduct("LwipSnmpCodeGeneration")] +[assembly: AssemblyCopyright("Copyright © 2015")] +[assembly: AssemblyTrademark("")] +[assembly: AssemblyCulture("")] + +// Durch Festlegen von ComVisible auf "false" werden die Typen in dieser Assembly unsichtbar +// für COM-Komponenten. Wenn Sie auf einen Typ in dieser Assembly von +// COM zugreifen müssen, legen Sie das ComVisible-Attribut für diesen Typ auf "true" fest. +[assembly: ComVisible(false)] + +// Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird +[assembly: Guid("8cfbbb8b-dfbb-4dd5-80c9-e07845dd58c9")] + +// Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten: +// +// Hauptversion +// Nebenversion +// Buildnummer +// Revision +// +// Sie können alle Werte angeben oder die standardmäßigen Build- und Revisionsnummern +// übernehmen, indem Sie "*" eingeben: +// [assembly: AssemblyVersion("1.0.*")] +[assembly: AssemblyVersion("1.0.0.0")] +[assembly: AssemblyFileVersion("1.0.0.0")] diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpMib.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpMib.cs new file mode 100644 index 00000000..477a18b6 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpMib.cs @@ -0,0 +1,97 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Text; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpMib : SnmpTreeNode + { + public uint[] BaseOid { get; set; } + + public SnmpMib() + : base(null) + { + } + + public SnmpMib(uint[] baseOid) + : base(null) + { + this.BaseOid = baseOid; + } + + public override string FullNodeName + { + get { return this.Name.ToLowerInvariant() + "_root"; } + } + + public override void GenerateCode(MibCFile mibFile) + { + base.GenerateCode(mibFile); + + System.Diagnostics.Debug.Assert((this.BaseOid != null) && (this.BaseOid.Length > 0)); + + // create and add BaseOID declarations + StringBuilder boidInitialization = new StringBuilder("{"); + foreach (uint t in this.BaseOid) + { + boidInitialization.Append(t); + boidInitialization.Append(","); + } + boidInitialization.Length -= 1; + boidInitialization.Append("}"); + + VariableDeclaration boidDecl = new VariableDeclaration( + new VariableType(this.Name.ToLowerInvariant() + "_base_oid", LwipDefs.Vt_U32, null, ConstType.Value, String.Empty), + boidInitialization.ToString(), true); + + mibFile.Declarations.Add(boidDecl); + mibFile.Declarations.Add(GetExportDeclaration()); + } + + public override void GenerateHeaderCode(MibHeaderFile mibHeaderFile) + { + mibHeaderFile.Includes.Add(new PP_Include("lwip/apps/snmp_core.h")); + + mibHeaderFile.VariableDeclarations.Add(VariablePrototype.FromVariableDeclaration(GetExportDeclaration())); + } + + VariableDeclaration GetExportDeclaration() + { + return new VariableDeclaration( + new VariableType(this.Name.ToLowerInvariant(), LwipDefs.Vt_StMib, null, ConstType.Value), + String.Format("{{{0}_base_oid, LWIP_ARRAYSIZE({0}_base_oid), &{1}.node}}", this.Name.ToLowerInvariant(), this.FullNodeName)); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpNode.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpNode.cs new file mode 100644 index 00000000..fceb4d52 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpNode.cs @@ -0,0 +1,119 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Text.RegularExpressions; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public abstract class SnmpNode + { + public static readonly Regex NameValidationRegex = new Regex(@"^\w+$"); + + private string name; + private readonly SnmpTreeNode parentNode; + + protected SnmpNode(SnmpTreeNode parentNode) + { + this.parentNode = parentNode; + } + + public SnmpTreeNode ParentNode + { + get { return this.parentNode; } + } + + public virtual uint Oid { get; set; } + + public abstract string FullNodeName + { + get; + } + + public virtual string Name + { + get { return this.name; } + set + { + if (value != this.name) + { + // check for valid name + if (!NameValidationRegex.IsMatch(value)) + { + throw new ArgumentOutOfRangeException("Name"); + } + + this.name = value; + } + } + } + + public virtual void Generate(MibCFile generatedFile, MibHeaderFile generatedHeaderFile) + { + int declCount = generatedFile.Declarations.Count; + int implCount = generatedFile.Implementation.Count; + + this.GenerateHeaderCode(generatedHeaderFile); + this.GenerateCode(generatedFile); + + if (generatedFile.Declarations.Count != declCount) + { + generatedFile.Declarations.Add(EmptyLine.SingleLine); + } + if (generatedFile.Implementation.Count != implCount) + { + generatedFile.Implementation.Add(EmptyLine.SingleLine); + } + } + + public abstract void GenerateCode(MibCFile mibFile); + + public virtual void GenerateHeaderCode(MibHeaderFile mibHeaderFile) + { + } + + /// + /// Called after node structure creation is completed and before code is created. + /// Offers the possibility to perform operations depending on properties/subnodes. + /// If the node shall be transformed to another node(-type) than the own instance + /// may be replaced on parent node by the transformed instance. + /// Calling sequence is always from leafs up to root. So a tree node can assume + /// that the analyze method was already called on all child nodes. + /// E.g. a tree node only has scalar sub nodes -> it transforms itself to a scalar array node + /// + /// The transformed node or null if nothing shall be changed in parent structure. + public virtual void Analyze() + { + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarAggregationNode.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarAggregationNode.cs new file mode 100644 index 00000000..f5c558c5 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarAggregationNode.cs @@ -0,0 +1,293 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System.Collections.Generic; +using System.Globalization; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public abstract class SnmpScalarAggregationNode: SnmpNode + { + private bool getMethodRequired = false; + private bool testMethodRequired = false; + private bool setMethodRequired = false; + + protected SnmpScalarAggregationNode(SnmpTreeNode parentNode) + : base(parentNode) + { + } + + protected virtual string GetMethodName + { + get { return this.FullNodeName + LwipDefs.FnctSuffix_GetValue; } + } + + protected bool GetMethodRequired + { + get { return this.getMethodRequired; } + } + + protected virtual string TestMethodName + { + get { return this.FullNodeName + LwipDefs.FnctSuffix_SetTest; } + } + + protected bool TestMethodRequired + { + get { return this.testMethodRequired; } + } + + protected virtual string SetMethodName + { + get { return this.FullNodeName + LwipDefs.FnctSuffix_SetValue; } + } + + protected bool SetMethodRequired + { + get { return this.setMethodRequired; } + } + + protected abstract IEnumerable AggregatedScalarNodes + { + get; + } + + public override void Analyze() + { + base.Analyze(); + + this.getMethodRequired = false; + this.testMethodRequired = false; + this.setMethodRequired = false; + + foreach (SnmpScalarNode scalarNode in this.AggregatedScalarNodes) + { + if ((scalarNode.AccessMode == SnmpAccessMode.ReadOnly) || (scalarNode.AccessMode == SnmpAccessMode.ReadWrite)) + { + this.getMethodRequired = true; + } + if ((scalarNode.AccessMode == SnmpAccessMode.WriteOnly) || (scalarNode.AccessMode == SnmpAccessMode.ReadWrite)) + { + this.testMethodRequired = true; + this.setMethodRequired = true; + } + + if (this.getMethodRequired && this.setMethodRequired) + { + break; + } + } + } + + protected void GenerateAggregatedCode(MibCFile mibFile, VariableType instanceType, string switchSelector, bool generateDeclarations = true, bool generateImplementations = true) + { + if (this.getMethodRequired) + { + FunctionDeclaration getMethodDecl = new FunctionDeclaration(this.GetMethodName, isStatic: true); + getMethodDecl.Parameter.Add(instanceType); + getMethodDecl.Parameter.Add(new VariableType("value", VariableType.VoidString, "*")); + getMethodDecl.ReturnType = new VariableType(null, LwipDefs.Vt_S16); + + if (generateDeclarations) + { + mibFile.Declarations.Add(getMethodDecl); + } + if (generateImplementations) + { + Function getMethod = Function.FromDeclaration(getMethodDecl); + GenerateGetMethodCode(getMethod, switchSelector); + mibFile.Implementation.Add(getMethod); + } + } + + if (this.testMethodRequired) + { + FunctionDeclaration testMethodDecl = new FunctionDeclaration(this.TestMethodName, isStatic: true); + testMethodDecl.Parameter.Add(instanceType); + testMethodDecl.Parameter.Add(new VariableType("len", LwipDefs.Vt_U16)); + testMethodDecl.Parameter.Add(new VariableType("value", VariableType.VoidString, "*")); + testMethodDecl.ReturnType = new VariableType(null, LwipDefs.Vt_Snmp_err); + + if (generateDeclarations) + { + mibFile.Declarations.Add(testMethodDecl); + } + if (generateImplementations) + { + Function testMethod = Function.FromDeclaration(testMethodDecl); + GenerateTestMethodCode(testMethod, switchSelector); + mibFile.Implementation.Add(testMethod); + } + } + + if (this.setMethodRequired) + { + FunctionDeclaration setMethodDecl = new FunctionDeclaration(this.SetMethodName, isStatic: true); + setMethodDecl.Parameter.Add(instanceType); + setMethodDecl.Parameter.Add(new VariableType("len", LwipDefs.Vt_U16)); + setMethodDecl.Parameter.Add(new VariableType("value", VariableType.VoidString, "*")); + setMethodDecl.ReturnType = new VariableType(null, LwipDefs.Vt_Snmp_err); + + if (generateDeclarations) + { + mibFile.Declarations.Add(setMethodDecl); + } + if (generateImplementations) + { + Function setMethod = Function.FromDeclaration(setMethodDecl); + GenerateSetMethodCode(setMethod, switchSelector); + mibFile.Implementation.Add(setMethod); + } + } + } + + protected virtual void GenerateGetMethodCode(Function getMethod, string switchSelector) + { + VariableDeclaration returnValue = new VariableDeclaration((VariableType)getMethod.ReturnType.Clone()); + returnValue.Type.Name = "value_len"; + getMethod.Declarations.Add(returnValue); + Switch sw = new Switch(switchSelector); + + bool valueVarUsed = false; + + foreach (SnmpScalarNode scalarNode in this.AggregatedScalarNodes) + { + if ((scalarNode.AccessMode == SnmpAccessMode.ReadOnly) || (scalarNode.AccessMode == SnmpAccessMode.ReadWrite)) + { + SwitchCase sc = new SwitchCase(scalarNode.Oid.ToString(CultureInfo.InvariantCulture)); + sc.Declarations.Add(new Comment(scalarNode.Name, singleLine: true)); + + scalarNode.GenerateGetMethodCode(sc, getMethod.Parameter[1].Name, ref valueVarUsed, returnValue.Type.Name); + + sw.Switches.Add(sc); + } + } + + SwitchCase scd = SwitchCase.GenerateDefault(); + scd.AddCodeFormat("LWIP_DEBUGF(SNMP_MIB_DEBUG,(\"{0}(): unknown id: %\"S32_F\"\\n\", {1}));", getMethod.Name, switchSelector); + scd.AddCodeFormat("{0} = 0;", returnValue.Type.Name); + sw.Switches.Add(scd); + + if (!valueVarUsed) + { + getMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", getMethod.Parameter[1].Name); + } + + getMethod.AddElement(sw); + + getMethod.AddCodeFormat("return {0};", returnValue.Type.Name); + } + + protected virtual void GenerateTestMethodCode(Function testMethod, string switchSelector) + { + VariableDeclaration returnValue = new VariableDeclaration((VariableType)testMethod.ReturnType.Clone(), LwipDefs.Def_ErrorCode_WrongValue); + returnValue.Type.Name = "err"; + testMethod.Declarations.Add(returnValue); + Switch sw = new Switch(switchSelector); + + bool valueVarUsed = false; + bool lenVarUsed = false; + + foreach (SnmpScalarNode scalarNode in this.AggregatedScalarNodes) + { + if ((scalarNode.AccessMode == SnmpAccessMode.WriteOnly) || (scalarNode.AccessMode == SnmpAccessMode.ReadWrite)) + { + SwitchCase sc = new SwitchCase(scalarNode.Oid.ToString(CultureInfo.InvariantCulture)); + sc.Declarations.Add(new Comment(scalarNode.Name, singleLine: true)); + + scalarNode.GenerateTestMethodCode(sc, testMethod.Parameter[2].Name, ref valueVarUsed, testMethod.Parameter[1].Name, ref lenVarUsed, returnValue.Type.Name); + + sw.Switches.Add(sc); + } + } + + SwitchCase scd = SwitchCase.GenerateDefault(); + scd.AddCodeFormat("LWIP_DEBUGF(SNMP_MIB_DEBUG,(\"{0}(): unknown id: %\"S32_F\"\\n\", {1}));", testMethod.Name, switchSelector); + sw.Switches.Add(scd); + + if (!valueVarUsed) + { + testMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", testMethod.Parameter[2].Name); + } + if (!lenVarUsed) + { + testMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", testMethod.Parameter[1].Name); + } + + testMethod.AddElement(sw); + + testMethod.AddCodeFormat("return {0};", returnValue.Type.Name); + } + + protected virtual void GenerateSetMethodCode(Function setMethod, string switchSelector) + { + VariableDeclaration returnValue = new VariableDeclaration((VariableType)setMethod.ReturnType.Clone(), LwipDefs.Def_ErrorCode_Ok); + returnValue.Type.Name = "err"; + setMethod.Declarations.Add(returnValue); + Switch sw = new Switch(switchSelector); + + bool valueVarUsed = false; + bool lenVarUsed = false; + + foreach (SnmpScalarNode scalarNode in this.AggregatedScalarNodes) + { + if ((scalarNode.AccessMode == SnmpAccessMode.WriteOnly) || (scalarNode.AccessMode == SnmpAccessMode.ReadWrite)) + { + SwitchCase sc = new SwitchCase(scalarNode.Oid.ToString(CultureInfo.InvariantCulture)); + sc.Declarations.Add(new Comment(scalarNode.Name, singleLine: true)); + + scalarNode.GenerateSetMethodCode(sc, setMethod.Parameter[2].Name, ref valueVarUsed, setMethod.Parameter[1].Name, ref lenVarUsed, returnValue.Type.Name); + + sw.Switches.Add(sc); + } + } + + SwitchCase scd = SwitchCase.GenerateDefault(); + scd.AddCodeFormat("LWIP_DEBUGF(SNMP_MIB_DEBUG,(\"{0}(): unknown id: %\"S32_F\"\\n\", {1}));", setMethod.Name, switchSelector); + sw.Switches.Add(scd); + + if (!valueVarUsed) + { + setMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", setMethod.Parameter[2].Name); + } + if (!lenVarUsed) + { + setMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", setMethod.Parameter[1].Name); + } + + setMethod.AddElement(sw); + + setMethod.AddCodeFormat("return {0};", returnValue.Type.Name); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarArrayNode.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarArrayNode.cs new file mode 100644 index 00000000..086fbb9f --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarArrayNode.cs @@ -0,0 +1,105 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Collections.Generic; +using System.Text; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpScalarArrayNode : SnmpScalarAggregationNode + { + private readonly List scalarNodes; + + public SnmpScalarArrayNode(List scalarNodes, SnmpTreeNode parentNode) + : base(parentNode) + { + this.scalarNodes = scalarNodes; + } + + public override string FullNodeName + { + get { return this.Name.ToLowerInvariant() + "_scalars"; } + } + + protected override IEnumerable AggregatedScalarNodes + { + get { return this.scalarNodes; } + } + + public override void GenerateCode(MibCFile mibFile) + { + VariableType instanceType = new VariableType("node", LwipDefs.Vt_StScalarArrayNodeDef, "*", ConstType.Value); + GenerateAggregatedCode( + mibFile, + instanceType, + instanceType.Name + "->oid"); + + + // create and add node definitions + StringBuilder nodeDefs = new StringBuilder(); + foreach (SnmpScalarNode scalarNode in this.scalarNodes) + { + nodeDefs.AppendFormat(" {{{0}, {1}, {2}}}, /* {3} */ \n", + scalarNode.Oid, + LwipDefs.GetAsn1DefForSnmpDataType(scalarNode.DataType), + LwipDefs.GetLwipDefForSnmpAccessMode(scalarNode.AccessMode), + scalarNode.Name); + } + if (nodeDefs.Length > 0) + nodeDefs.Length--; + + VariableDeclaration nodeDefsDecl = new VariableDeclaration( + new VariableType(this.FullNodeName + "_nodes", LwipDefs.Vt_StScalarArrayNodeDef, null, ConstType.Value, String.Empty), + "{\n" + nodeDefs + "\n}" , + isStatic: true); + + mibFile.Declarations.Add(nodeDefsDecl); + + + // create and add node declaration + string nodeInitialization = String.Format("SNMP_SCALAR_CREATE_ARRAY_NODE({0}, {1}, {2}, {3}, {4})", + this.Oid, + nodeDefsDecl.Type.Name, + (this.GetMethodRequired) ? this.GetMethodName : LwipDefs.Null, + (this.TestMethodRequired) ? this.TestMethodName : LwipDefs.Null, + (this.SetMethodRequired) ? this.SetMethodName : LwipDefs.Null + ); + + mibFile.Declarations.Add(new VariableDeclaration( + new VariableType(this.FullNodeName, LwipDefs.Vt_StScalarArrayNode, null, ConstType.Value), + nodeInitialization, + isStatic: true)); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNode.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNode.cs new file mode 100644 index 00000000..6be54c49 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNode.cs @@ -0,0 +1,395 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Collections.Generic; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpScalarNode: SnmpNode + { + protected const string LocalValueName = "v"; // name of (casted) local value variable + + private SnmpDataType dataType; + private SnmpAccessMode accessMode; + private readonly List restrictions = new List(); + + private bool useExternalMethods = false; + private string externalGetMethod; + private string externalTestMethod; + private string externalSetMethod; + + + public SnmpScalarNode(SnmpTreeNode parentNode) + : base(parentNode) + { + } + + public override string FullNodeName + { + get { return this.Name.ToLowerInvariant() + "_scalar"; } + } + + public SnmpDataType DataType + { + get { return this.dataType; } + set { this.dataType = value; } + } + + public List Restrictions + { + get { return this.restrictions; } + } + + public SnmpAccessMode AccessMode + { + get { return this.accessMode; } + set { this.accessMode = value; } + } + + public virtual string FixedValueLength + { + get { return null; } + } + + /// + /// If scalar is used as a table index its value becomes part of the OID. This value returns how many OID parts are required to represent this value. + /// + public virtual int OidRepresentationLen + { + get { return -1; } + } + + public bool UseExternalMethods + { + get { return this.useExternalMethods; } + set { this.useExternalMethods = value; } + } + + public string ExternalGetMethod + { + get { return this.externalGetMethod; } + set { this.externalGetMethod = value; } + } + public string ExternalTestMethod + { + get { return this.externalTestMethod; } + set { this.externalTestMethod = value; } + } + public string ExternalSetMethod + { + get { return this.externalSetMethod; } + set { this.externalSetMethod = value; } + } + + public override void GenerateCode(MibCFile mibFile) + { + string getMethodName; + string testMethodName; + string setMethodName; + + if (this.useExternalMethods) + { + getMethodName = this.externalGetMethod; + testMethodName = this.externalTestMethod; + setMethodName = this.externalSetMethod; + } + else + { + getMethodName = LwipDefs.Null; + testMethodName = LwipDefs.Null; + setMethodName = LwipDefs.Null; + + if ((this.accessMode == SnmpAccessMode.ReadWrite) || (this.accessMode == SnmpAccessMode.ReadOnly)) + { + FunctionDeclaration getMethodDecl = new FunctionDeclaration(this.Name + LwipDefs.FnctSuffix_GetValue, isStatic: true); + getMethodDecl.Parameter.Add(new VariableType("instance", LwipDefs.Vt_StNodeInstance, "*")); + getMethodDecl.Parameter.Add(new VariableType("value", VariableType.VoidString, "*")); + getMethodDecl.ReturnType = new VariableType(null, LwipDefs.Vt_S16); + mibFile.Declarations.Add(getMethodDecl); + + Function getMethod = Function.FromDeclaration(getMethodDecl); + getMethodName = getMethod.Name; + + VariableDeclaration returnValue = new VariableDeclaration((VariableType)getMethod.ReturnType.Clone()); + returnValue.Type.Name = "value_len"; + getMethod.Declarations.Add(returnValue); + getMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", getMethod.Parameter[0].Name); + + bool valueVarUsed = false; + GenerateGetMethodCode(getMethod, getMethod.Parameter[1].Name, ref valueVarUsed, returnValue.Type.Name); + if (!valueVarUsed) + { + getMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", getMethod.Parameter[1].Name); + } + + getMethod.AddCodeFormat("return {0};", returnValue.Type.Name); + + mibFile.Implementation.Add(getMethod); + } + + if ((this.accessMode == SnmpAccessMode.ReadWrite) || (this.accessMode == SnmpAccessMode.WriteOnly)) + { + bool valueVarUsed; + bool lenVarUsed; + VariableDeclaration returnValue; + + if (this.restrictions.Count > 0) + { + FunctionDeclaration testMethodDecl = new FunctionDeclaration(this.Name + LwipDefs.FnctSuffix_SetTest, isStatic: true); + testMethodDecl.Parameter.Add(new VariableType("instance", LwipDefs.Vt_StNodeInstance, "*")); + testMethodDecl.Parameter.Add(new VariableType("len", LwipDefs.Vt_U16)); + testMethodDecl.Parameter.Add(new VariableType("value", VariableType.VoidString, "*")); + testMethodDecl.ReturnType = new VariableType(null, LwipDefs.Vt_Snmp_err); + mibFile.Declarations.Add(testMethodDecl); + + Function testMethod = Function.FromDeclaration(testMethodDecl); + testMethodName = testMethod.Name; + + returnValue = new VariableDeclaration((VariableType)testMethod.ReturnType.Clone(), LwipDefs.Def_ErrorCode_WrongValue); + returnValue.Type.Name = "err"; + testMethod.Declarations.Add(returnValue); + testMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", testMethod.Parameter[0].Name); + + valueVarUsed = false; + lenVarUsed = false; + + GenerateTestMethodCode(testMethod, testMethod.Parameter[2].Name, ref valueVarUsed, testMethod.Parameter[1].Name, ref lenVarUsed, returnValue.Type.Name); + + if (!valueVarUsed) + { + testMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", testMethod.Parameter[2].Name); + } + if (!lenVarUsed) + { + testMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", testMethod.Parameter[1].Name); + } + + testMethod.AddCodeFormat("return {0};", returnValue.Type.Name); + + mibFile.Implementation.Add(testMethod); + + } + else + { + testMethodName = LwipDefs.FnctName_SetTest_Ok; + } + + FunctionDeclaration setMethodDecl = null; + setMethodDecl = new FunctionDeclaration(this.Name + LwipDefs.FnctSuffix_SetValue, isStatic: true); + setMethodDecl.Parameter.Add(new VariableType("instance", LwipDefs.Vt_StNodeInstance, "*")); + setMethodDecl.Parameter.Add(new VariableType("len", LwipDefs.Vt_U16)); + setMethodDecl.Parameter.Add(new VariableType("value", VariableType.VoidString, "*")); + setMethodDecl.ReturnType = new VariableType(null, LwipDefs.Vt_Snmp_err); + mibFile.Declarations.Add(setMethodDecl); + + Function setMethod = Function.FromDeclaration(setMethodDecl); + setMethodName = setMethod.Name; + + returnValue = new VariableDeclaration((VariableType)setMethod.ReturnType.Clone(), LwipDefs.Def_ErrorCode_Ok); + returnValue.Type.Name = "err"; + setMethod.Declarations.Add(returnValue); + setMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", setMethod.Parameter[0].Name); + + valueVarUsed = false; + lenVarUsed = false; + + GenerateSetMethodCode(setMethod, setMethod.Parameter[2].Name, ref valueVarUsed, setMethod.Parameter[1].Name, ref lenVarUsed, returnValue.Type.Name); + + if (!valueVarUsed) + { + setMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", setMethod.Parameter[2].Name); + } + if (!lenVarUsed) + { + setMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", setMethod.Parameter[1].Name); + } + + setMethod.AddCodeFormat("return {0};", returnValue.Type.Name); + + mibFile.Implementation.Add(setMethod); + } + } + + // create and add node declaration + string nodeInitialization; + if (this.accessMode == SnmpAccessMode.ReadOnly) + { + nodeInitialization = String.Format("SNMP_SCALAR_CREATE_NODE_READONLY({0}, {1}, {2})", + this.Oid, + LwipDefs.GetAsn1DefForSnmpDataType(this.dataType), + getMethodName); + } + else + { + nodeInitialization = String.Format("SNMP_SCALAR_CREATE_NODE({0}, {1}, {2}, {3}, {4}, {5})", + this.Oid, + LwipDefs.GetLwipDefForSnmpAccessMode(this.accessMode), + LwipDefs.GetAsn1DefForSnmpDataType(this.dataType), + getMethodName, + testMethodName, + setMethodName); + } + + mibFile.Declarations.Add(new VariableDeclaration( + new VariableType(this.FullNodeName, LwipDefs.Vt_StScalarNode, null, ConstType.Value), + nodeInitialization, isStatic: true)); + } + + public virtual void GenerateGetMethodCode(CodeContainerBase container, string valueVarName, ref bool valueVarUsed, string retLenVarName) + { + bool localValueVarUsed; + if (GenerateValueDeclaration(container, LocalValueName, valueVarName)) + { + valueVarUsed = true; + localValueVarUsed = false; + } + else + { + localValueVarUsed = true; // do not generate UNUSED_ARG code + } + + if (this.FixedValueLength == null) + { + // check that value with variable length fits into buffer + container.AddElement(new Comment(String.Format("TODO: take care that value with variable length fits into buffer: ({0} <= SNMP_MAX_VALUE_SIZE)", retLenVarName), singleLine: true)); + } + + GenerateGetMethodCodeCore(container, LocalValueName, ref localValueVarUsed, retLenVarName); + if (!localValueVarUsed) + { + container.AddCode(String.Format("LWIP_UNUSED_ARG({0});", LocalValueName)); + } + } + + protected virtual void GenerateGetMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string retLenVarName) + { + container.AddElement(new Comment(String.Format("TODO: put requested value to '*{0}' here", localValueVarName), singleLine: true)); + container.AddCodeFormat("{0} = {1};", + retLenVarName, + (!String.IsNullOrWhiteSpace(this.FixedValueLength)) ? this.FixedValueLength : "0"); + } + + public virtual void GenerateTestMethodCode(CodeContainerBase container, string valueVarName, ref bool valueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + if (this.Restrictions.Count > 0) + { + bool localVarUsed; + if (GenerateValueDeclaration(container, LocalValueName, valueVarName)) + { + valueVarUsed = true; + localVarUsed = false; + } + else + { + localVarUsed = true; // do not generate UNUSED_ARG code + } + + if (!String.IsNullOrWhiteSpace(this.FixedValueLength)) + { + // check for fixed value + container.AddCodeFormat("LWIP_ASSERT(\"Invalid length for datatype\", ({0} == {1}));", lenVarName, this.FixedValueLength); + lenVarUsed = true; + } + + GenerateTestMethodCodeCore(container, LocalValueName, ref localVarUsed, lenVarName, ref lenVarUsed, retErrVarName); + + if (!localVarUsed) + { + container.AddCode(String.Format("LWIP_UNUSED_ARG({0});", LocalValueName)); + } + } + else + { + container.AddCodeFormat("{0} = {1};", retErrVarName, LwipDefs.Def_ErrorCode_Ok); + } + } + + protected virtual void GenerateTestMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + container.AddElement(new Comment(String.Format("TODO: test new value here:\nif (*{0} == ) {1} = {2};", localValueVarName, retErrVarName, LwipDefs.Def_ErrorCode_Ok))); + } + + public virtual void GenerateSetMethodCode(CodeContainerBase container, string valueVarName, ref bool valueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + bool localVarUsed; + if (GenerateValueDeclaration(container, LocalValueName, valueVarName)) + { + valueVarUsed = true; + localVarUsed = false; + } + else + { + localVarUsed = true; // do not generate UNUSED_ARG code + } + + GenerateSetMethodCodeCore(container, LocalValueName, ref localVarUsed, lenVarName, ref lenVarUsed, retErrVarName); + + if (!localVarUsed) + { + container.AddCode(String.Format("LWIP_UNUSED_ARG({0});", LocalValueName)); + } + } + + protected virtual void GenerateSetMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + container.AddElement(new Comment(String.Format("TODO: store new value contained in '*{0}' here", localValueVarName), singleLine: true)); + } + + + protected virtual bool GenerateValueDeclaration(CodeContainerBase container, string variableName, string sourceName) + { + container.AddDeclaration(new VariableDeclaration( + new VariableType(variableName, LwipDefs.Vt_U8, "*"), + "(" + new VariableType(null, LwipDefs.Vt_U8, "*") + ")" + sourceName)); + + return true; + } + + public static SnmpScalarNode CreateFromDatatype(SnmpDataType dataType, SnmpTreeNode parentNode) + { + switch (dataType) + { + case SnmpDataType.Integer: + return new SnmpScalarNodeInt(parentNode); + + case SnmpDataType.Gauge: + case SnmpDataType.Counter: + case SnmpDataType.TimeTicks: + return new SnmpScalarNodeUint(dataType, parentNode); + } + + return new SnmpScalarNode(parentNode); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeBits.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeBits.cs new file mode 100644 index 00000000..906a5a6c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeBits.cs @@ -0,0 +1,121 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Text; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpScalarNodeBits : SnmpScalarNode + { + private readonly uint bitCount; + + public SnmpScalarNodeBits(SnmpTreeNode parentNode, uint bitCount) + : base(parentNode) + { + this.DataType = SnmpDataType.Bits; + this.bitCount = bitCount; + } + + public override void GenerateGetMethodCode(CodeContainerBase container, string valueVarName, ref bool valueVarUsed, string retLenVarName) + { + container.AddCode(String.Format( + "{0} = snmp_encode_bits(({1} *){2}, SNMP_MAX_VALUE_SIZE, 0 /* TODO: pass real value here */, {3});", + retLenVarName, + LwipDefs.Vt_U8, + valueVarName, + this.bitCount)); + + valueVarUsed = true; + } + + public override void GenerateTestMethodCode(CodeContainerBase container, string valueVarName, ref bool valueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + if (this.Restrictions.Count > 0) + { + const string bitVarName = "bits"; + + container.Declarations.Add(new VariableDeclaration(new VariableType(bitVarName, LwipDefs.Vt_U32))); + + IfThenElse ite = new IfThenElse(String.Format( + "snmp_decode_bits(({0} *){1}, {2}, &{3}) == ERR_OK", + LwipDefs.Vt_U8, + valueVarName, + lenVarName, + bitVarName)); + + valueVarUsed = true; + lenVarUsed = true; + + StringBuilder innerIfCond = new StringBuilder(); + foreach (IRestriction restriction in this.Restrictions) + { + innerIfCond.Append(restriction.GetCheckCodeValid(bitVarName)); + innerIfCond.Append(" || "); + } + + innerIfCond.Length -= 4; + + IfThenElse innerIte = new IfThenElse(innerIfCond.ToString()); + innerIte.AddCode(String.Format("{0} = {1};", retErrVarName, LwipDefs.Def_ErrorCode_Ok)); + ite.AddElement(innerIte); + container.AddElement(ite); + } + else + { + base.GenerateTestMethodCode(container, valueVarName, ref valueVarUsed, lenVarName, ref lenVarUsed, retErrVarName); + } + } + + public override void GenerateSetMethodCode(CodeContainerBase container, string valueVarName, ref bool valueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + const string bitVarName = "bits"; + + container.Declarations.Add(new VariableDeclaration(new VariableType(bitVarName, LwipDefs.Vt_U32))); + + IfThenElse ite = new IfThenElse(String.Format( + "snmp_decode_bits(({0} *){1}, {2}, &{3}) == ERR_OK", + LwipDefs.Vt_U8, + valueVarName, + lenVarName, + bitVarName)); + + valueVarUsed = true; + lenVarUsed = true; + + ite.AddElement(new Comment(String.Format("TODO: store new value contained in '{0}' here", bitVarName), singleLine: true)); + + container.AddElement(ite); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeCounter64.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeCounter64.cs new file mode 100644 index 00000000..8f450c8a --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeCounter64.cs @@ -0,0 +1,72 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Text; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpScalarNodeCounter64 : SnmpScalarNode + { + public SnmpScalarNodeCounter64(SnmpTreeNode parentNode) + : base(parentNode) + { + this.DataType = SnmpDataType.Counter64; + } + + protected override bool GenerateValueDeclaration(CodeContainerBase container, string variableName, string sourceName) + { + container.AddDeclaration(new VariableDeclaration( + new VariableType(variableName + "_high", LwipDefs.Vt_U32, "*"), + "(" + new VariableType(null, LwipDefs.Vt_U32, "*").ToString() + ")" + sourceName)); + container.AddDeclaration(new VariableDeclaration( + new VariableType(variableName + "_low", LwipDefs.Vt_U32, "*"), + variableName + "_high + 1")); + + container.AddCode(String.Format("LWIP_UNUSED_ARG({0}_high);", variableName)); + container.AddCode(String.Format("LWIP_UNUSED_ARG({0}_low);", variableName)); + + return false; + } + + public override string FixedValueLength + { + get { return String.Format("(2 * sizeof({0}))", LwipDefs.Vt_U32); } + } + + public override int OidRepresentationLen + { + get { return 1; } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeInt.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeInt.cs new file mode 100644 index 00000000..a381234c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeInt.cs @@ -0,0 +1,86 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Text; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpScalarNodeInt : SnmpScalarNode + { + public SnmpScalarNodeInt(SnmpTreeNode parentNode) + : base(parentNode) + { + this.DataType = SnmpDataType.Integer; + } + + protected override void GenerateTestMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + System.Diagnostics.Trace.Assert(this.Restrictions.Count > 0); + + StringBuilder ifCond = new StringBuilder(); + foreach (IRestriction restriction in this.Restrictions) + { + ifCond.Append(restriction.GetCheckCodeValid("*" + localValueVarName)); + ifCond.Append(" || "); + + localValueVarUsed = true; + } + + ifCond.Length -= 4; + + IfThenElse ite = new IfThenElse(ifCond.ToString()); + ite.AddCode(String.Format("{0} = {1};", retErrVarName, LwipDefs.Def_ErrorCode_Ok)); + container.AddElement(ite); + } + + protected override bool GenerateValueDeclaration(CodeContainerBase container, string variableName, string sourceName) + { + container.AddDeclaration(new VariableDeclaration( + new VariableType(variableName, LwipDefs.Vt_S32, "*"), + "(" + new VariableType(null, LwipDefs.Vt_S32, "*") + ")" + sourceName)); + + return true; + } + + public override string FixedValueLength + { + get { return String.Format("sizeof({0})", LwipDefs.Vt_S32); } + } + + public override int OidRepresentationLen + { + get { return 1; } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeObjectIdentifier.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeObjectIdentifier.cs new file mode 100644 index 00000000..5ce8d146 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeObjectIdentifier.cs @@ -0,0 +1,90 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpScalarNodeObjectIdentifier: SnmpScalarNode + { + public SnmpScalarNodeObjectIdentifier(SnmpTreeNode parentNode) + : base(parentNode) + { + this.DataType = SnmpDataType.ObjectIdentifier; + } + + protected override bool GenerateValueDeclaration(CodeContainerBase container, string variableName, string sourceName) + { + container.AddDeclaration(new VariableDeclaration( + new VariableType(variableName, LwipDefs.Vt_U32, "*"), + "(" + new VariableType(null, LwipDefs.Vt_U32, "*") + ")" + sourceName)); + + return true; + } + + protected override void GenerateGetMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string retLenVarName) + { + container.AddElement(new Comment(String.Format("TODO: put requested value to '*{0}' here. '{0}' has to be interpreted as {1}[]", localValueVarName, LwipDefs.Vt_U32), singleLine: true)); + container.AddElement(EmptyLine.SingleLine); + container.AddCode(String.Format("{0} = 0; // TODO: return real value length here (should be 'numOfElements * sizeof({1})')", retLenVarName, LwipDefs.Vt_U32)); + } + + protected override void GenerateTestMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + VariableDeclaration objIdLenVar = new VariableDeclaration( + new VariableType(localValueVarName + "_len", LwipDefs.Vt_U8), + String.Format("{0} / sizeof({1})", lenVarName, LwipDefs.Vt_U32)); + lenVarUsed = true; + + container.Declarations.Add(objIdLenVar); + + base.GenerateTestMethodCodeCore(container, localValueVarName, ref localValueVarUsed, lenVarName, ref lenVarUsed, retErrVarName); + + container.AddCode(String.Format("LWIP_UNUSED_ARG({0});", objIdLenVar.Type.Name)); + } + + protected override void GenerateSetMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + VariableDeclaration objIdLenVar = new VariableDeclaration( + new VariableType(localValueVarName + "_len", LwipDefs.Vt_U8), + String.Format("{0} / sizeof({1})", lenVarName, LwipDefs.Vt_U32)); + lenVarUsed = true; + + container.Declarations.Add(objIdLenVar); + + base.GenerateSetMethodCodeCore(container, localValueVarName, ref localValueVarUsed, lenVarName, ref lenVarUsed, retErrVarName); + + container.AddCode(String.Format("LWIP_UNUSED_ARG({0});", objIdLenVar.Type.Name)); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeOctetString.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeOctetString.cs new file mode 100644 index 00000000..bf10f9a8 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeOctetString.cs @@ -0,0 +1,118 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Text; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpScalarNodeOctetString : SnmpScalarNode + { + public SnmpScalarNodeOctetString(SnmpDataType dataType, SnmpTreeNode parentNode) + : base(parentNode) + { + System.Diagnostics.Debug.Assert( + (dataType == SnmpDataType.OctetString) || + (dataType == SnmpDataType.Opaque) || + (dataType == SnmpDataType.IpAddress)); + + this.DataType = dataType; + } + + protected override void GenerateGetMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string retLenVarName) + { + if (this.Restrictions.Count > 0) + { + StringBuilder ifCond = new StringBuilder(); + foreach (IRestriction restriction in this.Restrictions) + { + ifCond.Append(restriction.GetCheckCodeValid(retLenVarName)); + ifCond.Append(" || "); + } + + ifCond.Length -= 4; + container.AddElement(new Comment("TODO: take care of len restrictions defined in MIB: " + ifCond, singleLine: true)); + } + base.GenerateGetMethodCodeCore(container, localValueVarName, ref localValueVarUsed, retLenVarName); + } + + protected override void GenerateTestMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + System.Diagnostics.Trace.Assert(this.Restrictions.Count > 0); + + // checks refer to length of octet string + StringBuilder ifCond = new StringBuilder(); + foreach (IRestriction restriction in this.Restrictions) + { + ifCond.Append(restriction.GetCheckCodeValid(lenVarName)); + ifCond.Append(" || "); + + lenVarUsed = true; + } + + ifCond.Length -= 4; + + IfThenElse ite = new IfThenElse(ifCond.ToString()); + ite.AddCode(String.Format("{0} = {1};", retErrVarName, LwipDefs.Def_ErrorCode_Ok)); + container.AddElement(ite); + } + + public override int OidRepresentationLen + { + get + { + // check restrictions if we are set to one fixed length + if ((this.Restrictions != null) && (this.Restrictions.Count > 0)) + { + foreach (IRestriction restriction in this.Restrictions) + { + if (restriction is IsInRangeRestriction) + { + if ((restriction as IsInRangeRestriction).RangeStart == (restriction as IsInRangeRestriction).RangeEnd) + { + return (int)(restriction as IsInRangeRestriction).RangeStart; + } + } + else if (restriction is IsEqualRestriction) + { + return (int)(restriction as IsEqualRestriction).Value; + } + } + } + + return -1; // variable length + } + } + + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeTruthValue.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeTruthValue.cs new file mode 100644 index 00000000..0f557526 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeTruthValue.cs @@ -0,0 +1,66 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpScalarNodeTruthValue : SnmpScalarNodeInt + { + public SnmpScalarNodeTruthValue(SnmpTreeNode parentNode) + : base(parentNode) + { + } + + protected override void GenerateGetMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string retLenVarName) + { + container.AddCodeFormat("snmp_encode_truthvalue({0}, /* TODO: put requested bool value here */ 0);", localValueVarName); + localValueVarUsed = true; + + container.AddCode(String.Format("{0} = {1};", + retLenVarName, + (!String.IsNullOrWhiteSpace(this.FixedValueLength)) ? this.FixedValueLength : "0")); + } + + protected override void GenerateSetMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + VariableType truthVar = new VariableType("bool_value", LwipDefs.Vt_U8); + container.Declarations.Add(new VariableDeclaration(truthVar)); + + container.AddCodeFormat("snmp_decode_truthvalue({0}, &{1});", localValueVarName, truthVar.Name); + localValueVarUsed = true; + + container.AddElement(new Comment(String.Format("TODO: store new value contained in '{0}' here", truthVar.Name), singleLine: true)); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeUint.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeUint.cs new file mode 100644 index 00000000..edc161ac --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpScalarNodeUint.cs @@ -0,0 +1,91 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Text; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpScalarNodeUint : SnmpScalarNode + { + public SnmpScalarNodeUint(SnmpDataType dataType, SnmpTreeNode parentNode) + : base(parentNode) + { + System.Diagnostics.Debug.Assert( + (dataType == SnmpDataType.Counter) || + (dataType == SnmpDataType.Gauge) || + (dataType == SnmpDataType.TimeTicks)); + + this.DataType = dataType; + } + + protected override void GenerateTestMethodCodeCore(CodeContainerBase container, string localValueVarName, ref bool localValueVarUsed, string lenVarName, ref bool lenVarUsed, string retErrVarName) + { + System.Diagnostics.Trace.Assert(this.Restrictions.Count > 0); + + StringBuilder ifCond = new StringBuilder(); + foreach (IRestriction restriction in this.Restrictions) + { + ifCond.Append(restriction.GetCheckCodeValid("*" + localValueVarName)); + ifCond.Append(" || "); + + localValueVarUsed = true; + } + + ifCond.Length -= 4; + + IfThenElse ite = new IfThenElse(ifCond.ToString()); + ite.AddCode(String.Format("{0} = {1};", retErrVarName, LwipDefs.Def_ErrorCode_Ok)); + container.AddElement(ite); + } + + protected override bool GenerateValueDeclaration(CodeContainerBase container, string variableName, string sourceName) + { + container.AddDeclaration(new VariableDeclaration( + new VariableType(variableName, LwipDefs.Vt_U32, "*"), + "(" + new VariableType(null, LwipDefs.Vt_U32, "*") + ")" + sourceName)); + + return true; + } + + public override string FixedValueLength + { + get { return String.Format("sizeof({0})", LwipDefs.Vt_U32); } + } + + public override int OidRepresentationLen + { + get { return 1; } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpTableNode.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpTableNode.cs new file mode 100644 index 00000000..13a3bf27 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpTableNode.cs @@ -0,0 +1,332 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Collections.Generic; +using System.Text; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpTableNode: SnmpScalarAggregationNode + { + private readonly List cellNodes = new List(); + private readonly List indexNodes = new List(); + private string augmentedTableRow = null; + + + public SnmpTableNode(SnmpTreeNode parentNode) + : base(parentNode) + { + } + + public List CellNodes + { + get { return cellNodes; } + } + + public List IndexNodes + { + get { return indexNodes; } + } + + public string AugmentedTableRow + { + get { return this.augmentedTableRow; } + set { this.augmentedTableRow = value; } + } + + public override string FullNodeName + { + get + { + string result = this.Name.ToLowerInvariant(); + if (!result.Contains("table")) + { + result += "_table"; + } + + return result; + } + } + + protected override IEnumerable AggregatedScalarNodes + { + get { return this.cellNodes; } + } + + public override void GenerateCode(MibCFile mibFile) + { + FunctionDeclaration getInstanceMethodDecl = new FunctionDeclaration(this.FullNodeName + LwipDefs.FnctSuffix_GetInstance, isStatic: true); + getInstanceMethodDecl.Parameter.Add(new VariableType("column", LwipDefs.Vt_U32, "*", ConstType.Value)); + getInstanceMethodDecl.Parameter.Add(new VariableType("row_oid", LwipDefs.Vt_U32, "*", ConstType.Value)); + getInstanceMethodDecl.Parameter.Add(new VariableType("row_oid_len", LwipDefs.Vt_U8, "")); + getInstanceMethodDecl.Parameter.Add(new VariableType("cell_instance", LwipDefs.Vt_StNodeInstance, "*")); + getInstanceMethodDecl.ReturnType = new VariableType(null, LwipDefs.Vt_Snmp_err); + mibFile.Declarations.Add(getInstanceMethodDecl); + + Function getInstanceMethod = Function.FromDeclaration(getInstanceMethodDecl); + GenerateGetInstanceMethodCode(getInstanceMethod); + mibFile.Implementation.Add(getInstanceMethod); + + + FunctionDeclaration getNextInstanceMethodDecl = new FunctionDeclaration(this.FullNodeName + LwipDefs.FnctSuffix_GetNextInstance, isStatic: true); + getNextInstanceMethodDecl.Parameter.Add(new VariableType("column", LwipDefs.Vt_U32, "*", ConstType.Value)); + getNextInstanceMethodDecl.Parameter.Add(new VariableType("row_oid", LwipDefs.Vt_StObjectId, "*")); + getNextInstanceMethodDecl.Parameter.Add(new VariableType("cell_instance", LwipDefs.Vt_StNodeInstance, "*")); + getNextInstanceMethodDecl.ReturnType = new VariableType(null, LwipDefs.Vt_Snmp_err); + mibFile.Declarations.Add(getNextInstanceMethodDecl); + + Function getNextInstanceMethod = Function.FromDeclaration(getNextInstanceMethodDecl); + GenerateGetNextInstanceMethodCode(getNextInstanceMethod); + mibFile.Implementation.Add(getNextInstanceMethod); + + + VariableType instanceType = new VariableType("cell_instance", LwipDefs.Vt_StNodeInstance, "*"); + GenerateAggregatedCode( + mibFile, + instanceType, + String.Format("SNMP_TABLE_GET_COLUMN_FROM_OID({0}->instance_oid.id)", instanceType.Name)); + + + #region create and add column/table definitions + + StringBuilder colDefs = new StringBuilder(); + foreach (SnmpScalarNode colNode in this.cellNodes) + { + colDefs.AppendFormat(" {{{0}, {1}, {2}}}, /* {3} */ \n", + colNode.Oid, + LwipDefs.GetAsn1DefForSnmpDataType(colNode.DataType), + LwipDefs.GetLwipDefForSnmpAccessMode(colNode.AccessMode), + colNode.Name); + } + if (colDefs.Length > 0) + { + colDefs.Length--; + } + + VariableDeclaration colDefsDecl = new VariableDeclaration( + new VariableType(this.FullNodeName + "_columns", LwipDefs.Vt_StTableColumnDef, null, ConstType.Value, String.Empty), + "{\n" + colDefs + "\n}", + isStatic: true); + + mibFile.Declarations.Add(colDefsDecl); + + string nodeInitialization = String.Format("SNMP_TABLE_CREATE({0}, {1}, {2}, {3}, {4}, {5}, {6})", + this.Oid, + colDefsDecl.Type.Name, + getInstanceMethodDecl.Name, getNextInstanceMethodDecl.Name, + (this.GetMethodRequired) ? this.GetMethodName : LwipDefs.Null, + (this.TestMethodRequired) ? this.TestMethodName : LwipDefs.Null, + (this.SetMethodRequired) ? this.SetMethodName : LwipDefs.Null + ); + + mibFile.Declarations.Add(new VariableDeclaration( + new VariableType(this.FullNodeName, LwipDefs.Vt_StTableNode, null, ConstType.Value), + nodeInitialization, + isStatic: true)); + + #endregion + } + + protected virtual void GenerateGetInstanceMethodCode(Function getInstanceMethod) + { + VariableDeclaration returnValue = new VariableDeclaration((VariableType)getInstanceMethod.ReturnType.Clone(), LwipDefs.Def_ErrorCode_NoSuchInstance); + returnValue.Type.Name = "err"; + getInstanceMethod.Declarations.Add(returnValue); + + int instanceOidLength = 0; + StringBuilder indexColumns = new StringBuilder(); + foreach (SnmpScalarNode indexNode in this.indexNodes) + { + if (instanceOidLength >= 0) + { + if (indexNode.OidRepresentationLen >= 0) + { + instanceOidLength += indexNode.OidRepresentationLen; + } + else + { + // at least one index column has a variable length -> we cannot perform a static check + instanceOidLength = -1; + } + } + + indexColumns.AppendFormat( + " {0} ({1}, OID length = {2})\n", + indexNode.Name, + indexNode.DataType, + (indexNode.OidRepresentationLen >= 0) ? indexNode.OidRepresentationLen.ToString() : "variable"); + } + if (indexColumns.Length > 0) + { + indexColumns.Length--; + + getInstanceMethod.Declarations.Insert(0, new Comment(String.Format( + "The instance OID of this table consists of following (index) column(s):\n{0}", + indexColumns))); + } + + string augmentsHint = ""; + if (!String.IsNullOrWhiteSpace(this.augmentedTableRow)) + { + augmentsHint = String.Format( + "This table augments table '{0}'! Index columns therefore belong to table '{0}'!\n" + + "You may simply call the '*{1}' method of this table.\n\n", + (this.augmentedTableRow.ToLowerInvariant().EndsWith("entry")) ? this.augmentedTableRow.Substring(0, this.augmentedTableRow.Length-5) : this.augmentedTableRow, + LwipDefs.FnctSuffix_GetInstance); + } + + CodeContainerBase ccb = getInstanceMethod; + if (instanceOidLength > 0) + { + IfThenElse ite = new IfThenElse(String.Format("{0} == {1}", getInstanceMethod.Parameter[2].Name, instanceOidLength)); + getInstanceMethod.AddElement(ite); + ccb = ite; + } + + ccb.AddCodeFormat("LWIP_UNUSED_ARG({0});", getInstanceMethod.Parameter[0].Name); + ccb.AddCodeFormat("LWIP_UNUSED_ARG({0});", getInstanceMethod.Parameter[1].Name); + if (instanceOidLength <= 0) + { + ccb.AddCodeFormat("LWIP_UNUSED_ARG({0});", getInstanceMethod.Parameter[2].Name); + } + ccb.AddCodeFormat("LWIP_UNUSED_ARG({0});", getInstanceMethod.Parameter[3].Name); + + ccb.AddElement(new Comment(String.Format( + "TODO: check if '{0}'/'{1}' params contain a valid instance oid for a row\n" + + "If so, set '{2} = {3};'\n\n" + + "snmp_oid_* methods may be used for easier processing of oid\n\n" + + "{4}" + + "In order to avoid decoding OID a second time in subsequent get_value/set_test/set_value methods,\n" + + "you may store an arbitrary value (like a pointer to target value object) in '{5}->reference'/'{5}->reference_len'.\n" + + "But be aware that not always a subsequent method is called -> Do NOT allocate memory here and try to release it in subsequent methods!\n\n" + + "You also may replace function pointers in '{5}' param for get/test/set methods which contain the default values from table definition,\n" + + "in order to provide special methods, for the currently processed cell. Changed pointers are only valid for current request.", + getInstanceMethod.Parameter[1].Name, + getInstanceMethod.Parameter[2].Name, + returnValue.Type.Name, + LwipDefs.Def_ErrorCode_Ok, + augmentsHint, + getInstanceMethod.Parameter[3].Name + ))); + + getInstanceMethod.AddCodeFormat("return {0};", returnValue.Type.Name); + } + + protected virtual void GenerateGetNextInstanceMethodCode(Function getNextInstanceMethod) + { + getNextInstanceMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", getNextInstanceMethod.Parameter[0].Name); + getNextInstanceMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", getNextInstanceMethod.Parameter[1].Name); + getNextInstanceMethod.AddCodeFormat("LWIP_UNUSED_ARG({0});", getNextInstanceMethod.Parameter[2].Name); + + VariableDeclaration returnValue = new VariableDeclaration((VariableType)getNextInstanceMethod.ReturnType.Clone(), LwipDefs.Def_ErrorCode_NoSuchInstance); + returnValue.Type.Name = "err"; + getNextInstanceMethod.Declarations.Add(returnValue); + + StringBuilder indexColumns = new StringBuilder(); + foreach (SnmpScalarNode indexNode in this.indexNodes) + { + indexColumns.AppendFormat( + " {0} ({1}, OID length = {2})\n", + indexNode.Name, + indexNode.DataType, + (indexNode.OidRepresentationLen >= 0) ? indexNode.OidRepresentationLen.ToString() : "variable"); + } + if (indexColumns.Length > 0) + { + indexColumns.Length--; + + getNextInstanceMethod.Declarations.Insert(0, new Comment(String.Format( + "The instance OID of this table consists of following (index) column(s):\n{0}", + indexColumns))); + } + + string augmentsHint = ""; + if (!String.IsNullOrWhiteSpace(this.augmentedTableRow)) + { + augmentsHint = String.Format( + "This table augments table '{0}'! Index columns therefore belong to table '{0}'!\n" + + "You may simply call the '*{1}' method of this table.\n\n", + (this.augmentedTableRow.ToLowerInvariant().EndsWith("entry")) ? this.augmentedTableRow.Substring(0, this.augmentedTableRow.Length-5) : this.augmentedTableRow, + LwipDefs.FnctSuffix_GetNextInstance); + } + + getNextInstanceMethod.AddElement(new Comment(String.Format( + "TODO: analyze '{0}->id'/'{0}->len' and return the subsequent row instance\n" + + "Be aware that '{0}->id'/'{0}->len' must not point to a valid instance or have correct instance length.\n" + + "If '{0}->len' is 0, return the first instance. If '{0}->len' is longer than expected, cut superfluous OID parts.\n" + + "If a valid next instance is found, store it in '{0}->id'/'{0}->len' and set '{1} = {2};'\n\n" + + "snmp_oid_* methods may be used for easier processing of oid\n\n" + + "{3}" + + "In order to avoid decoding OID a second time in subsequent get_value/set_test/set_value methods,\n" + + "you may store an arbitrary value (like a pointer to target value object) in '{4}->reference'/'{4}->reference_len'.\n" + + "But be aware that not always a subsequent method is called -> Do NOT allocate memory here and try to release it in subsequent methods!\n\n" + + "You also may replace function pointers in '{4}' param for get/test/set methods which contain the default values from table definition,\n" + + "in order to provide special methods, for the currently processed cell. Changed pointers are only valid for current request.", + getNextInstanceMethod.Parameter[1].Name, + returnValue.Type.Name, + LwipDefs.Def_ErrorCode_Ok, + augmentsHint, + getNextInstanceMethod.Parameter[2].Name + ))); + + getNextInstanceMethod.AddElement(new Comment(String.Format( + "For easier processing and getting the next instance, you may use the 'snmp_next_oid_*' enumerator.\n" + + "Simply pass all known instance OID's to it and it returns the next valid one:\n\n" + + "{0} state;\n" + + "{1} result_buf;\n" + + "snmp_next_oid_init(&state, {2}->id, {2}->len, result_buf.id, SNMP_MAX_OBJ_ID_LEN);\n" + + "while ({{not all instances passed}}) {{\n" + + " {1} test_oid;\n" + + " {{fill test_oid to create instance oid for next instance}}\n" + + " snmp_next_oid_check(&state, test_oid.id, test_oid.len, {{target_data_ptr}});\n" + + "}}\n" + + "if(state.status == SNMP_NEXT_OID_STATUS_SUCCESS) {{\n" + + " snmp_oid_assign(row_oid, state.next_oid, state.next_oid_len);\n" + + " {3}->reference.ptr = state.reference; //==target_data_ptr, for usage in subsequent get/test/set\n" + + " {4} = {5};\n" + + "}}" + , + LwipDefs.Vt_StNextOidState, + LwipDefs.Vt_StObjectId, + getNextInstanceMethod.Parameter[1].Name, + getNextInstanceMethod.Parameter[2].Name, + returnValue.Type.Name, + LwipDefs.Def_ErrorCode_Ok + ))); + + getNextInstanceMethod.AddCodeFormat("return {0};", returnValue.Type.Name); + } + + } +} diff --git a/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpTreeNode.cs b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpTreeNode.cs new file mode 100644 index 00000000..bf0c604e --- /dev/null +++ b/contrib/apps/LwipMibCompiler/LwipSnmpCodeGeneration/SnmpTreeNode.cs @@ -0,0 +1,242 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Collections.Generic; +using System.Text; +using CCodeGeneration; + +namespace LwipSnmpCodeGeneration +{ + public class SnmpTreeNode: SnmpScalarAggregationNode + { + private readonly List childNodes = new List(); + private readonly List childScalarNodes = new List(); + private string fullOid = ""; + + public SnmpTreeNode(SnmpTreeNode parentNode) + : base(parentNode) + { + } + + public override string FullNodeName + { + get { return this.Name.ToLowerInvariant() + "_treenode"; } + } + + public string FullOid + { + get { return this.fullOid; } + set { this.fullOid = value; } + } + + public List ChildNodes + { + get { return this.childNodes; } + } + + protected override IEnumerable AggregatedScalarNodes + { + get { return this.childScalarNodes; } + } + + private void GenerateAggregatedCode(MibCFile mibFile, bool generateDeclarations, bool generateImplementations) + { + VariableType instanceType = new VariableType("instance", LwipDefs.Vt_StNodeInstance, "*"); + base.GenerateAggregatedCode( + mibFile, + instanceType, + String.Format("{0}->node->oid", instanceType.Name), + generateDeclarations, + generateImplementations); + } + + private void GenerateAggregateMethodDeclarations(MibCFile mibFile) + { + if (LwipOpts.GenerateSingleAccessMethodsForTreeNodeScalars && (this.childScalarNodes.Count > 1)) + { + GenerateAggregatedCode(mibFile, true, false); + } + } + + public override void GenerateCode(MibCFile mibFile) + { + string nodeInitialization; + + if (LwipOpts.GenerateSingleAccessMethodsForTreeNodeScalars && (this.childScalarNodes.Count > 1)) + { + GenerateAggregatedCode(mibFile, false, true); + } + + // create and add node declaration + if (this.childNodes.Count > 0) + { + StringBuilder subnodeArrayInitialization = new StringBuilder(); + + for (int i=0; i=0; i--) + { + this.ChildNodes[i].Analyze(); + } + + // collect scalar nodes + foreach (SnmpNode childNode in this.childNodes) + { + SnmpScalarNode scalarNode = childNode as SnmpScalarNode; + if (scalarNode != null) + { + this.childScalarNodes.Add(scalarNode); + } + } + + base.Analyze(); + + // check if we can merge this node to a scalar array node (all childs need to be scalars) + if (this.childNodes.Count > 0) + { + if (LwipOpts.GenerateScalarArrays && (this.childScalarNodes.Count == this.childNodes.Count) && (this.ParentNode != null)) + { + SnmpScalarArrayNode scalarArrayNode = new SnmpScalarArrayNode(this.childScalarNodes, this.ParentNode); + scalarArrayNode.Oid = this.Oid; + scalarArrayNode.Name = this.Name; + scalarArrayNode.Analyze(); + + for (int i=0; i 1)) + { + foreach (SnmpScalarNode scalarNode in this.childScalarNodes) + { + scalarNode.UseExternalMethods = true; + scalarNode.ExternalGetMethod = this.GetMethodName; + scalarNode.ExternalTestMethod = this.TestMethodName; + scalarNode.ExternalSetMethod = this.SetMethodName; + } + } + } + else // if (this.childNodes.Count == 0) + { + if (!LwipOpts.GenerateEmptyFolders && (this.ParentNode != null)) + { + // do not generate this empty folder because it only waste (static) memory + for (int i=0; i + /// Erforderliche Designervariable. + /// + private System.ComponentModel.IContainer components = null; + + /// + /// Verwendete Ressourcen bereinigen. + /// + /// True, wenn verwaltete Ressourcen gelöscht werden sollen; andernfalls False. + protected override void Dispose(bool disposing) + { + if (disposing && (components != null)) + { + components.Dispose(); + } + base.Dispose(disposing); + } + + #region Vom Windows Form-Designer generierter Code + + /// + /// Erforderliche Methode für die Designerunterstützung. + /// Der Inhalt der Methode darf nicht mit dem Code-Editor geändert werden. + /// + private void InitializeComponent() + { + this.components = new System.ComponentModel.Container(); + System.ComponentModel.ComponentResourceManager resources = new System.ComponentModel.ComponentResourceManager(typeof(FormMain)); + this.treeMib = new System.Windows.Forms.TreeView(); + this.imagelistTreeNodeImages = new System.Windows.Forms.ImageList(this.components); + this.splitContainerMain = new System.Windows.Forms.SplitContainer(); + this.listviewNodeDetails = new System.Windows.Forms.ListView(); + this.columnHeader1 = ((System.Windows.Forms.ColumnHeader)(new System.Windows.Forms.ColumnHeader())); + this.columnHeader2 = ((System.Windows.Forms.ColumnHeader)(new System.Windows.Forms.ColumnHeader())); + this.toolStripMain = new System.Windows.Forms.ToolStrip(); + this.toolbuttonOpenMib = new System.Windows.Forms.ToolStripButton(); + this.dialogOpenMib = new System.Windows.Forms.OpenFileDialog(); + ((System.ComponentModel.ISupportInitialize)(this.splitContainerMain)).BeginInit(); + this.splitContainerMain.Panel1.SuspendLayout(); + this.splitContainerMain.Panel2.SuspendLayout(); + this.splitContainerMain.SuspendLayout(); + this.toolStripMain.SuspendLayout(); + this.SuspendLayout(); + // + // treeMib + // + this.treeMib.Dock = System.Windows.Forms.DockStyle.Fill; + this.treeMib.ImageIndex = 0; + this.treeMib.ImageList = this.imagelistTreeNodeImages; + this.treeMib.Location = new System.Drawing.Point(0, 0); + this.treeMib.Name = "treeMib"; + this.treeMib.SelectedImageIndex = 0; + this.treeMib.Size = new System.Drawing.Size(1028, 418); + this.treeMib.TabIndex = 0; + this.treeMib.AfterSelect += new System.Windows.Forms.TreeViewEventHandler(this.treeMib_AfterSelect); + // + // imagelistTreeNodeImages + // + this.imagelistTreeNodeImages.ImageStream = ((System.Windows.Forms.ImageListStreamer)(resources.GetObject("imagelistTreeNodeImages.ImageStream"))); + this.imagelistTreeNodeImages.TransparentColor = System.Drawing.Color.Transparent; + this.imagelistTreeNodeImages.Images.SetKeyName(0, "ntimgContainer"); + this.imagelistTreeNodeImages.Images.SetKeyName(1, "ntimgTable"); + this.imagelistTreeNodeImages.Images.SetKeyName(2, "ntimgRow"); + this.imagelistTreeNodeImages.Images.SetKeyName(3, "ntimgColumn"); + this.imagelistTreeNodeImages.Images.SetKeyName(4, "ntimgScalar"); + this.imagelistTreeNodeImages.Images.SetKeyName(5, "ntimgUnknown"); + // + // splitContainerMain + // + this.splitContainerMain.Dock = System.Windows.Forms.DockStyle.Fill; + this.splitContainerMain.Location = new System.Drawing.Point(0, 25); + this.splitContainerMain.Name = "splitContainerMain"; + this.splitContainerMain.Orientation = System.Windows.Forms.Orientation.Horizontal; + // + // splitContainerMain.Panel1 + // + this.splitContainerMain.Panel1.Controls.Add(this.treeMib); + // + // splitContainerMain.Panel2 + // + this.splitContainerMain.Panel2.Controls.Add(this.listviewNodeDetails); + this.splitContainerMain.Size = new System.Drawing.Size(1028, 625); + this.splitContainerMain.SplitterDistance = 418; + this.splitContainerMain.TabIndex = 1; + // + // listviewNodeDetails + // + this.listviewNodeDetails.Columns.AddRange(new System.Windows.Forms.ColumnHeader[] { + this.columnHeader1, + this.columnHeader2}); + this.listviewNodeDetails.Dock = System.Windows.Forms.DockStyle.Fill; + this.listviewNodeDetails.FullRowSelect = true; + this.listviewNodeDetails.HeaderStyle = System.Windows.Forms.ColumnHeaderStyle.None; + this.listviewNodeDetails.Location = new System.Drawing.Point(0, 0); + this.listviewNodeDetails.Name = "listviewNodeDetails"; + this.listviewNodeDetails.Size = new System.Drawing.Size(1028, 203); + this.listviewNodeDetails.TabIndex = 0; + this.listviewNodeDetails.UseCompatibleStateImageBehavior = false; + this.listviewNodeDetails.View = System.Windows.Forms.View.Details; + // + // columnHeader1 + // + this.columnHeader1.Text = ""; + this.columnHeader1.Width = 150; + // + // columnHeader2 + // + this.columnHeader2.Text = ""; + this.columnHeader2.Width = 777; + // + // toolStripMain + // + this.toolStripMain.Items.AddRange(new System.Windows.Forms.ToolStripItem[] { + this.toolbuttonOpenMib}); + this.toolStripMain.Location = new System.Drawing.Point(0, 0); + this.toolStripMain.Name = "toolStripMain"; + this.toolStripMain.Size = new System.Drawing.Size(1028, 25); + this.toolStripMain.TabIndex = 2; + // + // toolbuttonOpenMib + // + this.toolbuttonOpenMib.Image = ((System.Drawing.Image)(resources.GetObject("toolbuttonOpenMib.Image"))); + this.toolbuttonOpenMib.Name = "toolbuttonOpenMib"; + this.toolbuttonOpenMib.Size = new System.Drawing.Size(65, 22); + this.toolbuttonOpenMib.Text = "Open..."; + this.toolbuttonOpenMib.Click += new System.EventHandler(this.toolbuttonOpenMib_Click); + // + // FormMain + // + this.AutoScaleDimensions = new System.Drawing.SizeF(6F, 13F); + this.AutoScaleMode = System.Windows.Forms.AutoScaleMode.Font; + this.ClientSize = new System.Drawing.Size(1028, 650); + this.Controls.Add(this.splitContainerMain); + this.Controls.Add(this.toolStripMain); + this.Name = "FormMain"; + this.Text = "MIB Viewer"; + this.WindowState = System.Windows.Forms.FormWindowState.Maximized; + this.splitContainerMain.Panel1.ResumeLayout(false); + this.splitContainerMain.Panel2.ResumeLayout(false); + ((System.ComponentModel.ISupportInitialize)(this.splitContainerMain)).EndInit(); + this.splitContainerMain.ResumeLayout(false); + this.toolStripMain.ResumeLayout(false); + this.toolStripMain.PerformLayout(); + this.ResumeLayout(false); + this.PerformLayout(); + + } + + #endregion + + private System.Windows.Forms.TreeView treeMib; + private System.Windows.Forms.SplitContainer splitContainerMain; + private System.Windows.Forms.ListView listviewNodeDetails; + private System.Windows.Forms.ColumnHeader columnHeader1; + private System.Windows.Forms.ColumnHeader columnHeader2; + private System.Windows.Forms.ImageList imagelistTreeNodeImages; + private System.Windows.Forms.ToolStrip toolStripMain; + private System.Windows.Forms.ToolStripButton toolbuttonOpenMib; + private System.Windows.Forms.OpenFileDialog dialogOpenMib; + } +} + diff --git a/contrib/apps/LwipMibCompiler/MibViewer/FormMain.cs b/contrib/apps/LwipMibCompiler/MibViewer/FormMain.cs new file mode 100644 index 00000000..7d2490db --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/FormMain.cs @@ -0,0 +1,217 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System.Windows.Forms; +using Lextm.SharpSnmpLib.Mib; +using Lextm.SharpSnmpLib.Mib.Elements; +using Lextm.SharpSnmpLib.Mib.Elements.Types; +using Lextm.SharpSnmpLib.Mib.Elements.Entities; +using System.IO; + +namespace LwipMibViewer +{ + public partial class FormMain : Form + { + readonly ListViewGroup listviewgroupAbstract; + readonly ListViewGroup listviewgroupElement; + readonly ListViewGroup listviewgroupBaseType; + readonly ListViewGroup listviewgroupTypeChain; + + public FormMain() + { + this.Font = SystemInformation.MenuFont; + InitializeComponent(); + + this.listviewgroupAbstract = new ListViewGroup("Abstract", System.Windows.Forms.HorizontalAlignment.Left); + this.listviewgroupElement = new ListViewGroup("Element Properties", System.Windows.Forms.HorizontalAlignment.Left); + this.listviewgroupBaseType = new ListViewGroup("Element Base Type", System.Windows.Forms.HorizontalAlignment.Left); + this.listviewgroupTypeChain = new ListViewGroup("Element Type Chain", System.Windows.Forms.HorizontalAlignment.Left); + this.listviewNodeDetails.Groups.AddRange(new System.Windows.Forms.ListViewGroup[] { + listviewgroupAbstract, + listviewgroupElement, + listviewgroupBaseType, + listviewgroupTypeChain}); + + try + { + DirectoryInfo dirInfo = new DirectoryInfo(Path.GetDirectoryName(Application.ExecutablePath)); + if (dirInfo != null) + { + dirInfo = dirInfo.Parent; + if (dirInfo != null) + { + dirInfo = dirInfo.Parent; + if (dirInfo != null) + { + dirInfo = new DirectoryInfo(Path.Combine(dirInfo.FullName, "Mibs")); + if (dirInfo.Exists) + { + MibTypesResolver.RegisterResolver(new FileSystemMibResolver(dirInfo.FullName, true)); + } + } + } + } + } + catch + { } + } + + #region GUI Event Handler + + private void toolbuttonOpenMib_Click(object sender, System.EventArgs e) + { + if (this.dialogOpenMib.ShowDialog() == DialogResult.OK) + { + OpenMib(this.dialogOpenMib.FileName); + } + } + + private void treeMib_AfterSelect(object sender, TreeViewEventArgs e) + { + listviewNodeDetails.Items.Clear(); + + if (e.Node != null) + { + MibTreeNode mtn = e.Node.Tag as MibTreeNode; + if (mtn != null) + { + listviewNodeDetails.Items.Add(new ListViewItem(new string[] { "Abstract", mtn.NodeType.ToString() }, this.listviewgroupAbstract)); + + listviewNodeDetails.Items.Add(new ListViewItem(new string[] { "Module", (mtn.Entity.Module != null) ? mtn.Entity.Module.Name : "" }, this.listviewgroupElement)); + listviewNodeDetails.Items.Add(new ListViewItem(new string[] { "Type", mtn.Entity.GetType().Name }, this.listviewgroupElement)); + listviewNodeDetails.Items.Add(new ListViewItem(new string[] { "Name", mtn.Entity.Name }, this.listviewgroupElement)); + listviewNodeDetails.Items.Add(new ListViewItem(new string[] { "Description", mtn.Entity.Description }, this.listviewgroupElement)); + listviewNodeDetails.Items.Add(new ListViewItem(new string[] { "OID", mtn.Entity.Value.ToString() }, this.listviewgroupElement)); + listviewNodeDetails.Items.Add(new ListViewItem(new string[] { "Full OID", MibTypesResolver.ResolveOid(mtn.Entity).GetOidString() }, this.listviewgroupElement)); + if (mtn.Entity is ObjectType) + { + listviewNodeDetails.Items.Add(new ListViewItem(new string[] { "Access", (mtn.Entity as ObjectType).Access.ToString() }, this.listviewgroupElement)); + } + + ITypeReferrer tr = mtn.Entity as ITypeReferrer; + if (tr != null) + { + ShowTypeDetails(listviewNodeDetails, this.listviewgroupBaseType, tr.BaseType); + ShowTypeChain(listviewNodeDetails, tr.ReferredType); + } + } + } + } + + #endregion + + #region Methods + + private void OpenMib(string file) + { + try + { + MibDocument md = new MibDocument(file); + MibTypesResolver.ResolveTypes(md.Modules[0]); + + this.treeMib.Nodes.Clear(); + this.listviewNodeDetails.Items.Clear(); + + MibTree mt = new MibTree(md.Modules[0] as MibModule); + foreach (MibTreeNode mibTreeNode in mt.Root) + { + AddNode(mibTreeNode, this.treeMib.Nodes); + + foreach (TreeNode node in this.treeMib.Nodes) + { + node.Expand(); + } + } + } + catch + { + } + } + + private void AddNode(MibTreeNode mibNode, TreeNodeCollection parentNodes) + { + int imgIndex = 5; //unknown + if ((mibNode.NodeType & MibTreeNodeType.Table) != 0) + { + imgIndex = 1; + } + else if ((mibNode.NodeType & MibTreeNodeType.TableRow) != 0) + { + imgIndex = 2; + } + else if ((mibNode.NodeType & MibTreeNodeType.TableCell) != 0) + { + imgIndex = 3; + } + else if ((mibNode.NodeType & MibTreeNodeType.Scalar) != 0) + { + imgIndex = 4; + } + else if ((mibNode.NodeType & MibTreeNodeType.Container) != 0) + { + imgIndex = 0; + } + + TreeNode newNode = new TreeNode(mibNode.Entity.Name, imgIndex, imgIndex); + newNode.Tag = mibNode; + + parentNodes.Add(newNode); + + foreach (MibTreeNode child in mibNode.ChildNodes) + { + AddNode(child, newNode.Nodes); + } + } + + private void ShowTypeChain(ListView lv, ITypeAssignment type) + { + ShowTypeDetails(lv, this.listviewgroupTypeChain, type); + + ITypeReferrer tr = type as ITypeReferrer; + if ((tr != null) && (tr.ReferredType != null)) + { + lv.Items.Add(new ListViewItem(new string[] { " >>>", "" }, this.listviewgroupTypeChain)); + ShowTypeChain(listviewNodeDetails, tr.ReferredType); + } + } + + private void ShowTypeDetails(ListView lv, ListViewGroup lvg, ITypeAssignment type) + { + lv.Items.Add(new ListViewItem(new string[] { "Module", (type.Module != null) ? type.Module.Name : "" }, lvg)); + lv.Items.Add(new ListViewItem(new string[] { "Type", type.GetType().Name }, lvg)); + lv.Items.Add(new ListViewItem(new string[] { "Name", type.Name }, lvg)); + } + + #endregion + + } +} diff --git a/contrib/apps/LwipMibCompiler/MibViewer/FormMain.resx b/contrib/apps/LwipMibCompiler/MibViewer/FormMain.resx new file mode 100644 index 00000000..973f546b --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/FormMain.resx @@ -0,0 +1,298 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + text/microsoft-resx + + + 2.0 + + + System.Resources.ResXResourceReader, System.Windows.Forms, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089 + + + System.Resources.ResXResourceWriter, System.Windows.Forms, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089 + + + 17, 17 + + + + AAEAAAD/////AQAAAAAAAAAMAgAAAFdTeXN0ZW0uV2luZG93cy5Gb3JtcywgVmVyc2lvbj00LjAuMC4w + LCBDdWx0dXJlPW5ldXRyYWwsIFB1YmxpY0tleVRva2VuPWI3N2E1YzU2MTkzNGUwODkFAQAAACZTeXN0 + ZW0uV2luZG93cy5Gb3Jtcy5JbWFnZUxpc3RTdHJlYW1lcgEAAAAERGF0YQcCAgAAAAkDAAAADwMAAABo + IQAAAk1TRnQBSQFMAgEBBgEAARABAAEQAQABEAEAARABAAT/ASEBAAj/AUIBTQE2BwABNgMAASgDAAFA + AwABIAMAAQEBAAEgBgABIBIAAwQBBQMWAR4DIgEyAzEBTwJGAUQBhwMvAUsDHgErAxsBJgMYASIDFQEd + AxIBGAMNARIDCgENAwcBCQMEAQUDAQECAwQBBQMWAR4DIgEyAzEBTgJGAUQBhwMvAUsDHgErAxsBJgMb + ASYDIQExAyEBMAMdASoDGwEmAxgBIQMLAQ8DAQECgAADAgEDAwwBEAMrAUMCRgFEAYIC/wHwAf8CRgFE + AYIDKgFAAw8BFAMNAREDCwEPAwkBDAMHAQoDBQEHAwQBBQMCAQMDAAEBAwIBAwMLAQ8DKwFDAkYBRAGC + Av8B8AH/AkYBRAGCAyoBQAMOARMDEgEZAT0COwFpAVwBRQFCAawBZwE+AToBxAFaAUUBQwGqATwBOwE6 + AWYDEAEWAwABAYQAAx4BKwJEAUIBewL/AfAB/wLpAdoD/wHxAf8CRAFCAXsDHgErJAADHgErAkQBQgF7 + Av8B8AH/AukB2gP/AfEB/wJEAUIBewMeASsBLgItAUcBdwFHATwByQG7AVQBPQHxA+4B/wG7AVMBPAHx + AXcBRgE8AckBLgItAUeEAAMdASoCRAFCAXcC/wHwAf8B6wHdAbEB/wH3AcEBNwH/Ae0B3wGzA/8B8gH/ + AkQBQgF3Ax0BKhwAAx0BKgJEAUIBdwL/AfAB/wLpAdoB/wLqAdwB/wLrAd4D/wHyAf8CRAFCAXcBZAFJ + AUIBrwG2AVkBQQHxAc0BVAEyAf8BvQF5AWIB/wHFAVABLgH/AbEBUQE1AfEBXAFIAUQBn4QAAkMBQQF2 + Av8B8AH/AukB2gH/AecBqwEhAf8B5wGrASEB/wHnAasBIQH/AeoB2wGwA/8B9AH/AkMBQQF2Ax0BKhgA + AkMBQQF2Av8B8AH/AukB2gH/AuoB3AH/AusB3gH/AuwB3wH/Au0B4QP/AfQB/wGAAUQBMQHaAc4BcAFN + AfwBugFMASoB/wPSAf8BvgGLAXgB/wG7AVIBMgH8AW8BSQE/AbqEAAMdASkCQwFBAXQC/wHxAf8B5wHX + AasB/wHXAZYBDAH/AdcBlgEMAf8B1wGWAQwB/wHoAdgBrgP/AfUB/wJDAUEBdAMdASkUAAMdASkCQwFB + AXQC/wHxAf8C6wHeAf8C7AHfAf8C7QHhAf8C7gHjAf8C7wHlAf8BzQF5AV4B/wHOAXcBWAH3AbwBVAEy + Af8BtAFMASoB/wPmAf8BtwFlAUsB8AFdAUkBRAGdiAADHQEpAkIBQQFyAv8B8gH/AeUB1AGpAf8BzQGJ + AQAB/wHNAYkBAAH/Ac0BiQEAAf8B6AHXAa8D/wH3Af8CQgFBAXIDHAEoFAADHQEpAkIBQQFyAv8B8gH/ + Au0B4QH/Au4B4wH/Au8B5QH/AvAB5wH/AeABuwGqAf8BzgFpAUgB/wHjAcsBwQH5BP8B3gHHAb0B9QF+ + AU8BQgHEAi0BLAFFjAADHAEoAkEBQAFxAv8B9AH/AecB1gGsAf8B0QGOAQQB/wHRAY4BBAH/AdEBjgEE + Af8B7AHbAbMD/wH4Af8CQQFAAXEDHAEoFAADHAEoAkEBQAFxAv8B9AH/Au8B5QH/AvAB5wH/AvEB6QH/ + AvMB6gH/AeQBvgGsAf8B1AGBAWIB/wGGAUoBNAHXAWYBTQFEAaoCLQEsAUWUAAMcAScCQQFAAW8C/wH1 + Af8B7AHcAbMB/wHfAaEBFwH/Ad8BoQEXAf8B3wGhARcB/wHxAeIBuwP/AfoB/wJBAUABbwMcAScUAAMc + AScCQQFAAW8C/wH1Af8C8QHpAf8C8wHqAf8C9AHsAf8C9QHuAf8C9gHwA/8B+gH/AkEBQAFvAxwBJ5gA + AxwBJwJAAT8BbQL/AfcB/wHyAeMBuwH/AfABuAEuAf8B8AG4AS4B/wHwAbgBLgH/AvgB9AP/AfsB/wJA + AT8BbQMcAScUAAMcAScCQAE/AW0C/wH3Af8C9AHsAf8C9QHuAf8C9gHwAf8C9wHyAf8C+AH0A/8B+wH/ + AkABPwFtAxwBJ5gAAxsBJgJAAT8BbAL/AfgB/wH3AeoBwwH/Af0ByQE/Af8B+QHsAccB/wL7AfcB/wL8 + AfkD/wH8Af8CQAE/AWwDGwEmFAADGwEmAkABPwFsAv8B+AH/AvYB8AH/AvcB8gH/AvgB9AH/AvsB9wH/ + AvwB+QP/AfwB/wJAAT8BbAMbASaYAAMbASYCPwE+AWsC/wH6Af8C+AH0Af8C+wH3Af8C3wHVAf8CyQG5 + Af8C4AHWA/8B/gH/Aj8BPgFrGAADGwEmAj8BPgFrAv8B+gH/AvgB9AH/AvsB9wH/At8B1QH/AskBuQH/ + AuAB1gP/Af4B/wI/AT4Ba5wAAxoBJQI/AT0BaQL/AfsB/wL8AfkB/wK8AawB/wQAArwBrAP/Af4B/wI/ + AT0BaRwAAxoBJQI/AT0BaQL/AfsB/wL8AfkB/wK8AawB/wQAArwBrAP/Af4B/wI/AT0BaaAAAxoBJQI+ + AT0BaAL/AfwB/wLLAcEB/wKgAZAB/wLLAcED/wH+Af8CPgE9AWggAAMaASUCPgE9AWgC/wH8Af8CywHB + Af8CoAGQAf8CywHBA/8B/gH/Aj4BPQFopAADGgElAj4BPQFnAv8B/gP/Af4D/wH+Bf8CPgE9AWckAAMa + ASUCPgE9AWcC/wH+A/8B/gP/Af4F/wI+AT0BZ6gAAxoBJAI+AT0BZgI+AT0BZgI+AT0BZgI+AT0BZgMx + AU0oAAMaASQCPgE9AWYCPgE9AWYCPgE9AWYCPgE9AWYDMQFNlAADIQEwAUABRgFIAXwBQwFOAVIBkgMF + AQccAAMHAQkDEAEWAxMBGgMTARoDEwEaAxMBGgMTARoDEwEaAxMBGgMTARoDEwEaAxMBGgMTARoDEwEa + AxABFgMHAQkDBwEJAxABFgMTARoDEwEaAxMBGgMTARoDEwEaAxMBGgMTARoDEwEaAxMBGgMTARoDEwEa + AxMBGgMQARYDBwEJAwcBCQMQARYDEwEaAxMBGgMTARoDEwEaAxMBGgMTARoDEwEaAxMBGgMTARoDEwEa + AxMBGgMTARoDEAEWAwcBCQwAAjIBMwFQAUMBUQFXAZkBRQFkAXQBwAFYAYsBogHgATwBWAFqAcEDEwEa + AwUBBxgAAjwBOwFpAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGH + AkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAjwBOwFpAjkBNAFpAkABNwGHAkABNwGH + AkABNwGHAkABNwGHAkABNwGHAkABNwGHAkABNwGHAkABNwGHAkABNwGHAkABNwGHAkABNwGHAkABNwGH + AkABNwGHAkABNwGHAjkBNAFpAjwBOwFpAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGH + AkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAkYBRAGHAjwBOwFpAw0BEQMa + ASQBRAFNAVEBmAE8AYkBrAHyAWcBrwHTAfoBggHLAewB/wGFAc4B7gH/ARUBWwGCAe8BOgFXAWYBxAE6 + AVcBZgHEAT4BWgFqAb4BPgFaAWoBvgE+AVoBagG+AUQBTQFRAZgDGgEkAw0BEQJGAUMBgQL5AekB/wLz + AeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLz + AeIB/wLzAeIB/wL5AekB/wJGAUMBgQJDAToBgQL5AekB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLz + AeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wL5AekB/wJDAToBgQJG + AUMBgQL5AekB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLzAeIB/wLz + AeIB/wLzAeIB/wLzAeIB/wLzAeIB/wL5AekB/wJGAUMBgQMHAQkDDQESAUIBWwFmAbIBiAHQAe8B/wF9 + AcoB6QH/AX0BygHpAf8BhwHQAe8B/wEkAXsBqQH/AX0BvAHbAf8BfQG8AdsB/wGNAdEB8wH/AY0B0QHz + Af8BkAHUAfUB/wFCAVsBZgGyATACMQFNAwcBCQJEAUMBegL0AeQC/wHMAUIB/wH+AcsBQQH/AewB0gGG + Af8C2gHJAf8C2AHHAf8C1gHFAf8C1AHDAf8C0wHCAf8C0QHAAf8CzwG+Af8CzgG9Af8CzQG8Af8C9AHk + Af8CRAFDAXoCRgE+AXoC9AHkAv8BzAFDAf8B/gHLAUIB/wHsAdIBhgH/AtoByQH/AtgBxwH/AtYBxQH/ + AtQBwwH/AtMBwgH/AtEBwAH/As8BvgH/As4BvQH/As0BvAH/AvQB5AH/AkYBPgF6AkQBQwF6AvQB5AL/ + AcwBQgH/Af4BywFBAf8B7AHSAYYB/wLaAckB/wLYAccB/wHnAWEBPwH/AecBYQE/Af8B5wFhAT8B/wHn + AWEBPwH/As8BvgH/As4BvQH/As0BvAH/AvQB5AH/AkQBQwF6CAABQwFXAWABpAGKAdMB8AH/AYIBzQHr + Af8BggHNAesB/wGKAdMB8AH/ASQBfAGrAf8BegG5AdgB/wF6AbkB2AH/AYoBzgHwAf8BigHOAfAB/wGP + AdMB9AH/AfQBtgEsAf8BQwFXAWABpAQAAkQBQgF3AvUB5gL/AcwBQgL/Ae4BiAH/AewB0gGGAf8C9QHu + Af8C9QHuAf8C1gHFAf8C9QHuAf8C9QHuAf8C0QHAAf8C9QHuAf8C9QHuAf8CzQG8Af8C9QHmAf8CRAFC + AXcCRwE/AXcC9QHmAv8BzAFDAv8B7gGIAf8B7AHSAYYB/wL1Ae4B/wL1Ae4B/wLWAcUB/wL1Ae4B/wL1 + Ae4B/wLRAcAB/wL1Ae4B/wL1Ae4B/wLNAbwB/wL1AeYB/wJHAT8BdwJEAUIBdwL1AeYC/wHMAUIC/wHu + AYgB/wHsAdIBhgH/AvUB7gH/AvUB7gH/AdkBWAE2Af8B8gHJAbgB/wHyAckBuAH/AdkBWAE2Af8C9QHu + Af8C9QHuAf8CzQG8Af8C9QHmAf8CRAFCAXcIAAFDAVUBXgGeAY4B1gHyAf8BhwHQAe0B/wGHAdAB7QH/ + AY4B1gHyAf8BJgGCAa8B/wF7AboB2AH/AXsBugHYAf8BiwHPAfEB/wGLAc8B8QH/AZEB1QH1Af8B/gHJ + AT8B/wFDAVUBXgGeBAACQwFBAXUC9gHpAv8BzAFCAf8B/gHLAUEB/wHsAdIBhgH/AtoByQH/AtgBxwH/ + AtwBzAH/AtQBwwH/AtMBwgH/AtgByAH/As8BvgH/As4BvQH/As0BvAH/AvYB6QH/AkMBQQF1AkcBPwF1 + AvYB6QL/AcwBQwH/Af4BywFCAf8B7AHSAYYB/wLaAckB/wLYAccB/wLcAcwB/wLUAcMB/wLTAcIB/wLY + AcgB/wLPAb4B/wLOAb0B/wLNAbwB/wL2AekB/wJHAT8BdQJDAUEBdQL2AekC/wHMAUIB/wH+AcsBQQH/ + AewB0gGGAf8C2gHJAf8C2AHHAf8ByAFPAS0B/wHeAbYBngH/Ad4BtQGdAf8ByAFPAS0B/wLPAb4B/wLO + Ab0B/wLNAbwB/wL2AekB/wJDAUEBdQgAAUQBVQFdAZsBkgHaAfQB/wGLAdQB8AH/AYsB1AHwAf8BkgHa + AfQB/wEpAYUBswH/AX0BvAHaAf8BfQG8AdoB/wGNAdEB8wH/AY0B0QHzAf8BkwHXAfYB/wLrAd0B/wFE + AVUBXQGbBAACQgFBAXMC9wHrAv8BzAFCAv8B7gGIAf8B7AHSAYYB/wL3AfEB/wL3AfEB/wLWAcUB/wL3 + AfEB/wL3AfEB/wLRAcAB/wL3AfEB/wL3AfEB/wLNAbwB/wL3AesB/wJCAUEBcwJHAT8BcwL3AesC/wHM + AUMC/wHuAYgB/wHsAdIBhgH/AvcB8QH/AvcB8QH/AtYBxQH/AvcB8QH/AvcB8QH/AtEBwAH/AvcB8QH/ + AvcB8QH/As0BvAH/AvcB6wH/AkcBPwFzAkIBQQFzAvcB6wL/AcwBQgL/Ae4BiAH/AewB0gGGAf8C9wHx + Af8C9wHxAf8BuAFHASUB/wHzAcsBuQH/AfMBywG5Af8BuAFHASUB/wL3AfEB/wL3AfEB/wLNAbwB/wL3 + AesB/wJCAUEBcwgAAUQBUwFbApcB3gH2Af8BkAHYAfIB/wGQAdgB8gH/AZcB3gH2Af8BKwGJAbcB/wGA + Ab0B3AH/AYABvQHcAf8BjwHTAfUB/wGPAdMB9QH/AZUB2QH4Af8C9QHuAf8BRAFTAVsBlwQAAkIBQQFy + AvgB7gL/AcwBQgH/Af4BywFBAf8B7AHSAYYB/wLaAckB/wLYAccB/wLdAc4B/wLUAcMB/wLTAcIB/wLZ + AcoB/wLPAb4B/wLOAb0B/wLNAbwB/wL4Ae4B/wJCAUEBcgJIAUABcgL4Ae4B/wHsAYYBYwH/AeIBewFZ + Af8B1AFuAUwB/wHEAWABPgH/AbYBUgEwAf8BrQFHASUB/wGrAUMBIQH/AbEBRAEiAf8BvQFKASgB/wHM + AVIBMAH/AdsBWgE4Af8B6AFiAUAB/wL4Ae4B/wJIAUABcgJCAUEBcgL4Ae4C/wHMAUIB/wH+AcsBQQH/ + AewB0gGGAf8C2gHJAf8C2AHHAf8BrQFCASAB/wHeAbYBngH/Ad4BtQGdAf8BrQFCASAB/wLPAb4B/wLO + Ab0B/wLNAbwB/wL4Ae4B/wJCAUEBcggAAUQBUwFaAZQBmwHhAfcB/wGUAdsB9AH/AZQB2wH0Af8BmwHh + AfcB/wEuAY0BvAH/AYEBvgHdAf8BgQG+Ad0B/wGQAdQB9gH/AZAB1AH2Af8BlwHbAfkB/wL+Af0B/wFE + AVMBWgGUBAACQQFAAXAC+QHxAv8BzAFCAv8B7gGIAf8B7AHSAYYB/wL5AfUB/wL5AfUB/wLWAcUB/wL5 + AfUB/wL5AfUB/wLRAcAB/wL5AfUB/wL5AfUB/wLNAbwB/wL5AfEB/wJBAUABcAJHAUABcAL5AfEB/wHs + AYYBYwH/AfgBxQF5Af8B7QG1AXgB/wH1AcwBvAH/AfUBzAG8Af8B4AG3AZ8B/wH1AcwBvAH/AfUBzAG8 + Af8B3QG0AZwB/wH1AcwBvAH/AfUBzAG8Af8B6AFiAUAB/wL5AfEB/wJHAUABcAJBAUABcAL5AfEC/wHM + AUIC/wHuAYgB/wHsAdIBhgH/AvkB9QH/AvkB9QH/AasBRAEiAf8B9QHMAbwB/wH1AcwBvAH/AasBRAEi + Af8C+QH1Af8C+QH1Af8CzQG8Af8C+QHxAf8CQQFAAXAIAAFEAVEBVwGQAZ4B5QH5Af8BmAHfAfYB/wGY + Ad8B9gH/AZ4B5QH5Af8BMAGQAcAB/wGDAcAB3wH/AYMBwAHfAf8BkgHWAfgB/wGSAdYB+AH/AZkB3QH6 + Af8BRAFRAVcBkAMjATMEAAJBAUABbgL7AfQC/wHMAUIB/wH+AcsBQQH/AewB0gGGAf8C2gHJAf8C2AHH + Af8C3gHQAf8C1AHDAf8C0wHCAf8C2gHMAf8CzwG+Af8CzgG9Af8CzQG8Af8C+wH0Af8CQQFAAW4CRwFA + AW4C+wH0Af8B7AGGAWMB/wHiAXsBWQH/AdQBbgFMAf8BxAFgAT4B/wG2AVIBMAH/Aa0BRwElAf8BqwFD + ASEB/wGxAUQBIgH/Ab0BSgEoAf8BzAFSATAB/wHbAVoBOAH/AegBYgFAAf8C+wH0Af8CRwFAAW4CQQFA + AW4C+wH0Av8BzAFCAf8B/gHLAUEB/wHsAdIBhgH/AtoByQH/AtgBxwH/AbIBTAEqAf8B3gG2AZ4B/wHe + AbUBnQH/AbIBTAEqAf8CzwG+Af8CzgG9Af8CzQG8Af8C+wH0Af8CQQFAAW4IAAFDAU8BVQGNAaMB6AH7 + Af8BnQHjAfkB/wGdAeMB+QH/AaMB6AH7Af8BMwGUAcUB/wGFAcIB4QH/AYUBwgHhAf8BlAHYAfoB/wGU + AdgB+gH/AZsB3wH8Af8BQwFPAVUBjQgAAkABPwFtAvwB9wL/AcwBQgL/Ae4BiAH/AewB0gGGAf8C/AH6 + Af8C/AH6Af8C1gHFAf8C/AH6Af8C/AH6Af8C0QHAAf8C/AH6Af8C/AH6Af8CzQG8Af8C/AH3Af8CQAE/ + AW0CRwFAAW0C/AH3Av8BzAFDAv8B7gGIAf8B7AHSAYYB/wL8AfoB/wL8AfoB/wLWAcUB/wL8AfoB/wL8 + AfoB/wLRAcAB/wL8AfoB/wL8AfoB/wLNAbwB/wL8AfcB/wJHAUABbQJAAT8BbQL8AfcC/wHMAUIC/wHu + AYgB/wHsAdIBhgH/AvwB+gH/AvwB+gH/AcABWgE4Af8B9gHOAb8B/wH2Ac4BvwH/AcABWgE4Af8C/AH6 + Af8C/AH6Af8CzQG8Af8C/AH3Af8CQAE/AW0IAAFDAU8BVAGKAaYB6wH8Af8BoQHmAfsB/wGhAeYB+wH/ + AaYB6wH8Af8BOgGdAc8B/wGHAcQB4gH/AYcBxAHiAf8BlgHaAfwB/wGWAdoB/AH/AZ4B4gH9Af8BQwFP + AVQBiggAAj8BPgFrAv0B+QL/AcwBQgH/Af4BywFBAf8B9QHOAWIB/wHrAdIBhQH/AekB0AGDAf8B5wHO + AYEB/wHlAcwBgAH/AeQBywF8Af8B4gHJAXoB/wHgAccBeAH/Ad8BxgF3Af8B3gHFAXYB/wL9AfkB/wI/ + AT4BawJHAUABawL9AfkC/wHMAUMB/wH+AcsBQgH/AfUBzgFjAf8B6wHSAYUB/wHpAdABgwH/AecBzgGB + Af8B5QHMAYAB/wHkAcsBfQH/AeIByQF7Af8B4AHHAXkB/wHfAcYBeAH/Ad4BxQF3Af8C/QH5Af8CRwFA + AWsCPwE+AWsC/QH5Av8BzAFCAf8B/gHLAUEB/wH1Ac4BYgH/AesB0gGFAf8B6QHQAYMB/wHRAWoBSAH/ + AekBsQF0Af8B6AGwAXMB/wHRAWoBSAH/AeABxwF4Af8B3wHGAXcB/wHeAcUBdgH/Av0B+QH/Aj8BPgFr + CAABQgFNAVIBhwGpAe4B/QH/AaQB6QH8Af8BpAHpAfwB/wGqAe8B/QH/AUABoQHRAf8BkAHRAfEB/wGW + AdoB+wH/AZcB2wH9Af8BlwHbAf0B/wGfAeMB/gH/AUIBTQFSAYcIAAI/AT4BagL+AfwC/wHMAUIC/wHu + AYgB/wH9AcoBQAH/AfwB6wGFAf8B+wHqAYQB/wH4AcUBOwH/AfYB5QF9Af8B9AHjAXsB/wHzAcABNgH/ + AfEB4AF4Af8B7wHeAXYB/wHvAbwBMgH/Av4B/AH/Aj8BPgFqAkcBQAFqAv4B/AL/AcwBQwL/Ae4BiAH/ + Af0BygFBAf8B/AHrAYUB/wH7AeoBhAH/AfgBxQE8Af8B9gHlAX4B/wH0AeMBfAH/AfMBwAE3Af8B8QHg + AXkB/wHvAd4BdwH/Ae8BvAEzAf8C/gH8Af8CRwFAAWoCPwE+AWoC/gH8Av8BzAFCAv8B7gGIAf8B/QHK + AUAB/wH8AesBhQH/AfsB6gGEAf8B4QF5AVcB/wHzAcABcwH/AfIBvwFyAf8B4QF5AVcB/wHxAeABeAH/ + Ae8B3gF2Af8B7wG8ATIB/wL+AfwB/wI/AT4BaggAAUMBTAFSAYUBrQHxAv8BqwHvAf4B/wGVAeIB+AH/ + AWwByQHtAf8BRgGpAdkB/wGYAdwB/gH/AZgB3AH+Af8BmAHcAf4B/wGYAdwB/gH/AaEB5QL/AUMBTAFS + AYUIAAI+AT0BaAL/Af4C/wHMAUIB/wH+AcsBQQH/Af0BygFAAf8B/AHJAT8B/wH6AccBPQH/AfgBxQE7 + Af8B9gHDAToB/wH1AcIBOAH/AfMBwAE2Af8B8QG+ATQB/wHwAb0BMwH/Ae8BvAEyA/8B/gH/Aj4BPQFo + AkcBQAFoAv8B/gL/AcwBQwH/Af4BywFCAf8B/QHKAUEB/wH8AckBQAH/AfoBxwE+Af8B+AHFATwB/wH2 + AcMBOwH/AfUBwgE5Af8B8wHAATcB/wHxAb4BNQH/AfABvQE0Af8B7wG8ATMD/wH+Af8CRwFAAWgCPgE9 + AWgC/wH+Av8BzAFCAf8B/gHLAUEB/wH9AcoBQAH/AfwByQE/Af8B+gHHAT0B/wHsAYYBYgH/AewBhgFi + Af8B7AGGAWIB/wHsAYYBYgH/AfEBvgE0Af8B8AG9ATMB/wHvAbwBMgP/Af4B/wI+AT0BaAgAAUMBTAFQ + AYMBiAHcAfQB/wFeAcAB6QH/AV0BvwHqAf8BgAHTAfQB/wGcAeMB/QH/AaIB5gL/AaIB5gL/AaIB5gL/ + AaIB5gL/AaYB6gL/AUMBTAFQAYMIAAI+AT0BZzj/Aj4BPQFnAkcBQAFnOP8CRwFAAWcCPgE9AWc4/wI+ + AT0BZwgAATkBOwE9AWEBQgFLAU8BgQFCAUsBTwGBAUIBSwFPAYEBQgFLAU8BgQFCAUsBTwGBAUIBSwFP + AYEBQgFLAU8BgQFCAUsBTwGBAUIBSwFPAYEBQgFLAU8BgQE5ATsBPQFhCAADMQFNAj4BPQFmAj4BPQFm + Aj4BPQFmAj4BPQFmAj4BPQFmAj4BPQFmAj4BPQFmAj4BPQFmAj4BPQFmAj4BPQFmAj4BPQFmAj4BPQFm + Aj4BPQFmAj4BPQFmAzEBTQI3ATQBTQJHAUABZgJHAUABZgJHAUABZgJHAUABZgJHAUABZgJHAUABZgJH + AUABZgJHAUABZgJHAUABZgJHAUABZgJHAUABZgJHAUABZgJHAUABZgJHAUABZgI3ATQBTQMxAU0CPgE9 + AWYCPgE9AWYCPgE9AWYCPgE9AWYCPgE9AWYCPgE9AWYCPgE9AWYCPgE9AWYCPgE9AWYCPgE9AWYCPgE9 + AWYCPgE9AWYCPgE9AWYCPgE9AWYDMQFNAUIBTQE+BwABPgMAASgDAAFAAwABIAMAAQEBAAEBBgABARYA + A/8RAAGAAf8BgAEBBQABfwEAAQEFAAE/AQABAQUAAR8BAAEBBAABgAEPAYABAQQAAcABBwHAAQMEAAHg + AQMB4AEDBAAB8AEBAfABAQQAAfgBAAH4BQAB/AEAAfwFAAH+AQgB/gEIBAAB/wEAAf8FAAH/AYAB/wGA + BAAB/wHAAf8BwAQAAfgBfwYAAeABPxYAAcABAQYAAcABAQYAAcABAQYAAcABAQYAAcABAQYAAcABAQYA + AcABAwYAAcABAwYAAcABAwYAAcABAwYAAcABAwYAAcABAwYACw== + + + + 211, 17 + + + + + iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAYAAAAf8/9hAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8 + YQUAAAAJcEhZcwAADsIAAA7CARUoSoAAAAK6SURBVDhPjZNbSNNRHMfPU9DtwR71oZf5IgkF0YMEEYb2 + EGgG5YNgGQmGSUoYimbel5KKmlM0u3jJSpv3ad7WnGkzb2yO4bByF3WuuTnnnLv47Zw/9YclQQc+/L// + P+d8/r/f+Z8/Ib/HjJDcmhaS3P+Bzf2zjr8qiki+QyuE6dNNbIzFw6F8DJ++AVh97c9GK9jcA4LJAlKI + rQ7sW9/DpauGZSoFg6JwfJSU+TE0XIXOgqCaAwJ5ASn2bb6F19TM4bO+w4z4HgwWC9YcDugpK3Y7umQy + FOZEDMRkZQX7SWS5pMRrboVn9RUHy1/aEqDSajGn0WDZbIZ6bQ0t/f1gIzojI8lPMvaIPPWsN2FP/5yD + ZdmLWLwUi/FhZASSqSlOUtXczBMcGZnFVzGUTSr2jI1wfq/lYHms4Tqkc3MYnZ2F0mDAqs3GV8LaiUhN + TeYFA5mkenelHg5tNQfLw3UxaOrpQZdUiu7xca5/Mc0do6PQb28jPDk5hRf0PiQi5zcR7JoKDpYHaqIg + VyohW1jg+lcZjVwlCzod1p1OXEhMvM8LOtNJvWOpEjZVKQfL/ZVX0NrXh165HP2Tk5hQqzGuUmFQocCm + y4XzCQlpvKA9jTTa1WWwzBdzsNxdfhmfFxcxQRct0Q3UmEzY2t2FdWcHdrcb5+LiHvCC1hTSbFOWwDyT + x8GyuDQCbRIJ3tBPp6CfU0pbcdA3M4mDCs7ExqYzwWHKibo7pNs6T4+yIofDSqtof3IJBtqzTq+Hx+uF + y+OBky5kkh2aT0VFZTNBAEWQFEFqhyvO2pclSe6f03nYnC1EW9FFGOnGGSi+/X14KW6fD3tUtkdzYFiY + 0O801iWSaNFtUteWGST92nL1R/q1Q7ojAkHV0ZCQkuOhocV/c0wguHvgn2APyuPJ6dI4kpV/gzyjtycp + gf8g4Begs1B6Kbj3cQAAAABJRU5ErkJggg== + + + + 337, 17 + + \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/MibViewer/MibViewer.csproj b/contrib/apps/LwipMibCompiler/MibViewer/MibViewer.csproj new file mode 100644 index 00000000..957c058c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/MibViewer.csproj @@ -0,0 +1,94 @@ + + + + Debug + AnyCPU + 8.0.30703 + 2.0 + {86CC0B65-7985-4017-A252-0A7A18DCAEF3} + WinExe + Properties + LwipMibViewer + MibViewer + v4.0 + 512 + + + + true + bin\Debug\ + DEBUG;TRACE + full + prompt + true + true + 4 + false + false + + + bin\Release\ + TRACE + true + pdbonly + AnyCPU + prompt + true + true + 4 + false + + + + + + + + + Form + + + FormMain.cs + + + + + FormMain.cs + + + ResXFileCodeGenerator + Resources.Designer.cs + Designer + + + True + Resources.resx + True + + + + SettingsSingleFileGenerator + Settings.Designer.cs + + + True + Settings.settings + True + + + + + {CBE20411-5DB7-487D-825D-7694267BB6F5} + SharpSnmpLib.Mib + + + + + + \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/MibViewer/Program.cs b/contrib/apps/LwipMibCompiler/MibViewer/Program.cs new file mode 100644 index 00000000..cd3ef314 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/Program.cs @@ -0,0 +1,51 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Martin Hentschel + * + */ + +using System; +using System.Windows.Forms; + +namespace LwipMibViewer +{ + static class Program + { + /// + /// Der Haupteinstiegspunkt für die Anwendung. + /// + [STAThread] + static void Main() + { + Application.EnableVisualStyles(); + Application.SetCompatibleTextRenderingDefault(false); + Application.Run(new FormMain()); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/MibViewer/Properties/AssemblyInfo.cs b/contrib/apps/LwipMibCompiler/MibViewer/Properties/AssemblyInfo.cs new file mode 100644 index 00000000..06e7286c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/Properties/AssemblyInfo.cs @@ -0,0 +1,36 @@ +using System.Reflection; +using System.Runtime.CompilerServices; +using System.Runtime.InteropServices; + +// Allgemeine Informationen über eine Assembly werden über die folgenden +// Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern, +// die mit einer Assembly verknüpft sind. +[assembly: AssemblyTitle("LwipMibViewer")] +[assembly: AssemblyDescription("")] +[assembly: AssemblyConfiguration("")] +[assembly: AssemblyCompany("")] +[assembly: AssemblyProduct("LwipMibViewer")] +[assembly: AssemblyCopyright("Copyright © 2015")] +[assembly: AssemblyTrademark("")] +[assembly: AssemblyCulture("")] + +// Durch Festlegen von ComVisible auf "false" werden die Typen in dieser Assembly unsichtbar +// für COM-Komponenten. Wenn Sie auf einen Typ in dieser Assembly von +// COM zugreifen müssen, legen Sie das ComVisible-Attribut für diesen Typ auf "true" fest. +[assembly: ComVisible(false)] + +// Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird +[assembly: Guid("7ffbd1c1-1c64-45bb-b243-2400446c649d")] + +// Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten: +// +// Hauptversion +// Nebenversion +// Buildnummer +// Revision +// +// Sie können alle Werte angeben oder die standardmäßigen Build- und Revisionsnummern +// übernehmen, indem Sie "*" eingeben: +// [assembly: AssemblyVersion("1.0.*")] +[assembly: AssemblyVersion("1.0.0.0")] +[assembly: AssemblyFileVersion("1.0.0.0")] diff --git a/contrib/apps/LwipMibCompiler/MibViewer/Properties/Resources.Designer.cs b/contrib/apps/LwipMibCompiler/MibViewer/Properties/Resources.Designer.cs new file mode 100644 index 00000000..bf157177 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/Properties/Resources.Designer.cs @@ -0,0 +1,63 @@ +//------------------------------------------------------------------------------ +// +// Dieser Code wurde von einem Tool generiert. +// Laufzeitversion:4.0.30319.225 +// +// Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn +// der Code erneut generiert wird. +// +//------------------------------------------------------------------------------ + +namespace LwipMibViewer.Properties { + using System; + + + /// + /// Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw. + /// + // Diese Klasse wurde von der StronglyTypedResourceBuilder automatisch generiert + // -Klasse über ein Tool wie ResGen oder Visual Studio automatisch generiert. + // Um einen Member hinzuzufügen oder zu entfernen, bearbeiten Sie die .ResX-Datei und führen dann ResGen + // mit der /str-Option erneut aus, oder Sie erstellen Ihr VS-Projekt neu. + [global::System.CodeDom.Compiler.GeneratedCodeAttribute("System.Resources.Tools.StronglyTypedResourceBuilder", "4.0.0.0")] + [global::System.Diagnostics.DebuggerNonUserCodeAttribute()] + [global::System.Runtime.CompilerServices.CompilerGeneratedAttribute()] + internal class Resources { + + private static global::System.Resources.ResourceManager resourceMan; + + private static global::System.Globalization.CultureInfo resourceCulture; + + [global::System.Diagnostics.CodeAnalysis.SuppressMessageAttribute("Microsoft.Performance", "CA1811:AvoidUncalledPrivateCode")] + internal Resources() { + } + + /// + /// Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird. + /// + [global::System.ComponentModel.EditorBrowsableAttribute(global::System.ComponentModel.EditorBrowsableState.Advanced)] + internal static global::System.Resources.ResourceManager ResourceManager { + get { + if (object.ReferenceEquals(resourceMan, null)) { + global::System.Resources.ResourceManager temp = new global::System.Resources.ResourceManager("LwipMibViewer.Properties.Resources", typeof(Resources).Assembly); + resourceMan = temp; + } + return resourceMan; + } + } + + /// + /// Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle + /// Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden. + /// + [global::System.ComponentModel.EditorBrowsableAttribute(global::System.ComponentModel.EditorBrowsableState.Advanced)] + internal static global::System.Globalization.CultureInfo Culture { + get { + return resourceCulture; + } + set { + resourceCulture = value; + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/MibViewer/Properties/Resources.resx b/contrib/apps/LwipMibCompiler/MibViewer/Properties/Resources.resx new file mode 100644 index 00000000..af7dbebb --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/Properties/Resources.resx @@ -0,0 +1,117 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + text/microsoft-resx + + + 2.0 + + + System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089 + + + System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089 + + \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/MibViewer/Properties/Settings.Designer.cs b/contrib/apps/LwipMibCompiler/MibViewer/Properties/Settings.Designer.cs new file mode 100644 index 00000000..9831b20f --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/Properties/Settings.Designer.cs @@ -0,0 +1,26 @@ +//------------------------------------------------------------------------------ +// +// Dieser Code wurde von einem Tool generiert. +// Laufzeitversion:4.0.30319.225 +// +// Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn +// der Code erneut generiert wird. +// +//------------------------------------------------------------------------------ + +namespace LwipMibViewer.Properties { + + + [global::System.Runtime.CompilerServices.CompilerGeneratedAttribute()] + [global::System.CodeDom.Compiler.GeneratedCodeAttribute("Microsoft.VisualStudio.Editors.SettingsDesigner.SettingsSingleFileGenerator", "10.0.0.0")] + internal sealed partial class Settings : global::System.Configuration.ApplicationSettingsBase { + + private static Settings defaultInstance = ((Settings)(global::System.Configuration.ApplicationSettingsBase.Synchronized(new Settings()))); + + public static Settings Default { + get { + return defaultInstance; + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/MibViewer/Properties/Settings.settings b/contrib/apps/LwipMibCompiler/MibViewer/Properties/Settings.settings new file mode 100644 index 00000000..39645652 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/Properties/Settings.settings @@ -0,0 +1,7 @@ + + + + + + + diff --git a/contrib/apps/LwipMibCompiler/MibViewer/app.config b/contrib/apps/LwipMibCompiler/MibViewer/app.config new file mode 100644 index 00000000..e3656033 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/MibViewer/app.config @@ -0,0 +1,3 @@ + + + diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA-ADDRESS-FAMILY-NUMBERS-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA-ADDRESS-FAMILY-NUMBERS-MIB new file mode 100644 index 00000000..10107955 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA-ADDRESS-FAMILY-NUMBERS-MIB @@ -0,0 +1,131 @@ + + + IANA-ADDRESS-FAMILY-NUMBERS-MIB DEFINITIONS ::= BEGIN + + IMPORTS + MODULE-IDENTITY, + mib-2 FROM SNMPv2-SMI + TEXTUAL-CONVENTION FROM SNMPv2-TC; + + ianaAddressFamilyNumbers MODULE-IDENTITY + LAST-UPDATED "200203140000Z" -- March 14, 2002 + ORGANIZATION "IANA" + CONTACT-INFO + "Postal: Internet Assigned Numbers Authority + Internet Corporation for Assigned Names + and Numbers + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292-6601 + USA + + Tel: +1 310-823-9358 + E-Mail: iana&iana.org" + DESCRIPTION + "The MIB module defines the AddressFamilyNumbers + textual convention." + + -- revision history + + REVISION "200203140000Z" -- March 14, 2002 + DESCRIPTION "AddressFamilyNumbers assignment 22 to + fibreChannelWWPN. AddressFamilyNumbers + assignment 23 to fibreChannelWWNN. + AddressFamilyNumers assignment 24 to gwid." + + REVISION "200009080000Z" -- September 8, 2000 + DESCRIPTION "AddressFamilyNumbers assignment 19 to xtpOverIpv4. + AddressFamilyNumbers assignment 20 to xtpOverIpv6. + AddressFamilyNumbers assignment 21 to xtpNativeModeXTP." + + REVISION "200003010000Z" -- March 1, 2000 + DESCRIPTION "AddressFamilyNumbers assignment 17 to distinguishedName. + AddressFamilyNumbers assignment 18 to asNumber." + + REVISION "200002040000Z" -- February 4, 2000 + DESCRIPTION "AddressFamilyNumbers assignment 16 to dns." + + REVISION "9908260000Z" -- August 26, 1999 + DESCRIPTION "Initial version, published as RFC 2677." + + ::= { mib-2 72 } + + + AddressFamilyNumbers ::= TEXTUAL-CONVENTION + + STATUS current + DESCRIPTION + "The definition of this textual convention with the + addition of newly assigned values is published + periodically by the IANA, in either the Assigned + Numbers RFC, or some derivative of it specific to + Internet Network Management number assignments. + (The latest arrangements can be obtained by + contacting the IANA.) + + The enumerations are described as: + + other(0), -- none of the following + ipV4(1), -- IP Version 4 + ipV6(2), -- IP Version 6 + nsap(3), -- NSAP + hdlc(4), -- (8-bit multidrop) + bbn1822(5), + all802(6), -- (includes all 802 media + -- plus Ethernet 'canonical format') + e163(7), + e164(8), -- (SMDS, Frame Relay, ATM) + f69(9), -- (Telex) + x121(10), -- (X.25, Frame Relay) + ipx(11), -- IPX (Internet Protocol Exchange) + appleTalk(12), -- Apple Talk + decnetIV(13), -- DEC Net Phase IV + banyanVines(14), -- Banyan Vines + e164withNsap(15), + -- (E.164 with NSAP format subaddress) + dns(16), -- (Domain Name System) + distinguishedName(17), -- (Distinguished Name, per X.500) + asNumber(18), -- (16-bit quantity, per the AS number space) + xtpOverIpv4(19), -- XTP over IP version 4 + xtpOverIpv6(20), -- XTP over IP version 6 + xtpNativeModeXTP(21), -- XTP native mode XTP + fibreChannelWWPN(22), -- Fibre Channel World-Wide Port Name + fibreChannelWWNN(23), -- Fibre Channel World-Wide Node Name + gwid(24), -- Gateway Identifier + afi(25), -- AFI for L2VPN information + reserved(65535) + + + + Requests for new values should be made to IANA via + email (iana&iana.org)." + + SYNTAX INTEGER { + other(0), + ipV4(1), + ipV6(2), + nsap(3), + hdlc(4), + bbn1822(5), + all802(6), + e163(7), + e164(8), + f69(9), + x121(10), + ipx(11), + appleTalk(12), + decnetIV(13), + banyanVines(14), + e164withNsap(15), + dns(16), + distinguishedName(17), -- (Distinguished Name, per X.500) + asNumber(18), -- (16-bit quantity, per the AS number space) + xtpOverIpv4(19), + xtpOverIpv6(20), + xtpNativeModeXTP(21), + fibreChannelWWPN(22), + fibreChannelWWNN(23), + gwid(24), + afi(25), + reserved(65535) + } + END diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA-CHARSET-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA-CHARSET-MIB new file mode 100644 index 00000000..499d54e4 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA-CHARSET-MIB @@ -0,0 +1,345 @@ +IANA-CHARSET-MIB DEFINITIONS ::= BEGIN +-- http://www.iana.org/assignments/ianacharset-mib + +IMPORTS + MODULE-IDENTITY, + mib-2 + FROM SNMPv2-SMI -- [RFC2578] + TEXTUAL-CONVENTION + FROM SNMPv2-TC; -- [RFC2579] + +ianaCharsetMIB MODULE-IDENTITY + LAST-UPDATED "200705140000Z" + ORGANIZATION "IANA" + CONTACT-INFO " Internet Assigned Numbers Authority + + Postal: ICANN + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292 + + Tel: +1 310 823 9358 + E-Mail: iana&iana.org" + + DESCRIPTION "This MIB module defines the IANACharset + TEXTUAL-CONVENTION. The IANACharset TC is used to + specify the encoding of string objects defined in + a MIB. + + Each version of this MIB will be released based on + the IANA Charset Registry file (see RFC 2978) at + http://www.iana.org/assignments/character-sets. + + Note: The IANACharset TC, originally defined in + RFC 1759, was inaccurately named CodedCharSet. + + Note: Best practice is to define new MIB string + objects with invariant UTF-8 (RFC 3629) syntax + using the SnmpAdminString TC (defined in RFC 3411) + in accordance with IETF Policy on Character Sets and + Languages (RFC 2277). + + Copyright (C) The Internet Society (2004). The + initial version of this MIB module was published + in RFC 3808; for full legal notices see the RFC + itself. Supplementary information may be + available on + http://www.ietf.org/copyrights/ianamib.html." + + -- revision history + + REVISION "200705140000Z" + DESCRIPTION "Registration of new charset 2107." + + REVISION "200612070000Z" + DESCRIPTION "Registration of new charsets numbered 118, 119, + and 2106." + + REVISION "200406080000Z" + DESCRIPTION "Original version transferred from Printer MIB, + generated from the IANA maintained assignments + http://www.iana.org/assignments/character-sets." + + ::= { mib-2 106 } + +IANACharset ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Specifies an IANA registered 'charset' - coded character set + (CCS) plus optional character encoding scheme (CES) - terms + defined in 'IANA Charset Registration Procedures' (RFC 2978). + + Objects of this syntax are used to specify the encoding for + string objects defined in one or more MIBs. For example, the + prtLocalizationCharacterSet, prtInterpreterDefaultCharSetIn, and + prtInterpreterDefaultCharSetOut objects defined in Printer MIB. + + The current list of 'charset' names and enumerated values + is contained in the IANA Character Set Registry at: + + http://www.iana.org/assignments/character-sets + + Enum names are derived from the IANA Charset Registry 'Alias' + fields that begin with 'cs' (for character set). + Enum values are derived from the parallel 'MIBenum' fields." + SYNTAX INTEGER { + other(1), -- used if the designated + -- character set is not currently + -- registered by IANA + unknown(2), -- used as a default value + csASCII(3), + csISOLatin1(4), + csISOLatin2(5), + csISOLatin3(6), + csISOLatin4(7), + csISOLatinCyrillic(8), + csISOLatinArabic(9), + csISOLatinGreek(10), + csISOLatinHebrew(11), + csISOLatin5(12), + csISOLatin6(13), + csISOTextComm(14), + csHalfWidthKatakana(15), + csJISEncoding(16), + csShiftJIS(17), + csEUCPkdFmtJapanese(18), + csEUCFixWidJapanese(19), + csISO4UnitedKingdom(20), + csISO11SwedishForNames(21), + csISO15Italian(22), + csISO17Spanish(23), + csISO21German(24), + csISO60DanishNorwegian(25), + csISO69French(26), + csISO10646UTF1(27), + csISO646basic1983(28), + csINVARIANT(29), + csISO2IntlRefVersion(30), + csNATSSEFI(31), + csNATSSEFIADD(32), + csNATSDANO(33), + csNATSDANOADD(34), + csISO10Swedish(35), + csKSC56011987(36), + csISO2022KR(37), + csEUCKR(38), + csISO2022JP(39), + csISO2022JP2(40), + csISO13JISC6220jp(41), + csISO14JISC6220ro(42), + csISO16Portuguese(43), + csISO18Greek7Old(44), + csISO19LatinGreek(45), + csISO25French(46), + csISO27LatinGreek1(47), + csISO5427Cyrillic(48), + csISO42JISC62261978(49), + csISO47BSViewdata(50), + csISO49INIS(51), + csISO50INIS8(52), + csISO51INISCyrillic(53), + csISO54271981(54), + csISO5428Greek(55), + csISO57GB1988(56), + csISO58GB231280(57), + csISO61Norwegian2(58), + csISO70VideotexSupp1(59), + csISO84Portuguese2(60), + csISO85Spanish2(61), + csISO86Hungarian(62), + csISO87JISX0208(63), + csISO88Greek7(64), + csISO89ASMO449(65), + csISO90(66), + csISO91JISC62291984a(67), + csISO92JISC62991984b(68), + csISO93JIS62291984badd(69), + csISO94JIS62291984hand(70), + csISO95JIS62291984handadd(71), + csISO96JISC62291984kana(72), + csISO2033(73), + csISO99NAPLPS(74), + csISO102T617bit(75), + csISO103T618bit(76), + csISO111ECMACyrillic(77), + csa71(78), + csa72(79), + csISO123CSAZ24341985gr(80), + csISO88596E(81), + csISO88596I(82), + csISO128T101G2(83), + csISO88598E(84), + csISO88598I(85), + csISO139CSN369103(86), + csISO141JUSIB1002(87), + csISO143IECP271(88), + csISO146Serbian(89), + csISO147Macedonian(90), + csISO150(91), + csISO151Cuba(92), + csISO6937Add(93), + csISO153GOST1976874(94), + csISO8859Supp(95), + csISO10367Box(96), + csISO158Lap(97), + csISO159JISX02121990(98), + csISO646Danish(99), + csUSDK(100), + csDKUS(101), + csKSC5636(102), + csUnicode11UTF7(103), + csISO2022CN(104), + csISO2022CNEXT(105), + csUTF8(106), + csISO885913(109), + csISO885914(110), + csISO885915(111), + csISO885916(112), + csGBK(113), + csGB18030(114), + csOSDEBCDICDF0415(115), + csOSDEBCDICDF03IRV(116), + csOSDEBCDICDF041(117), + csISO115481(118), + csKZ1048(119), + csUnicode(1000), + csUCS4(1001), + csUnicodeASCII(1002), + csUnicodeLatin1(1003), + csUnicodeIBM1261(1005), + csUnicodeIBM1268(1006), + csUnicodeIBM1276(1007), + csUnicodeIBM1264(1008), + csUnicodeIBM1265(1009), + csUnicode11(1010), + csSCSU(1011), + csUTF7(1012), + csUTF16BE(1013), + csUTF16LE(1014), + csUTF16(1015), + csCESU8(1016), + csUTF32(1017), + csUTF32BE(1018), + csUTF32LE(1019), + csBOCU1(1020), + csWindows30Latin1(2000), + csWindows31Latin1(2001), + csWindows31Latin2(2002), + csWindows31Latin5(2003), + csHPRoman8(2004), + csAdobeStandardEncoding(2005), + csVenturaUS(2006), + csVenturaInternational(2007), + csDECMCS(2008), + csPC850Multilingual(2009), + csPCp852(2010), + csPC8CodePage437(2011), + csPC8DanishNorwegian(2012), + csPC862LatinHebrew(2013), + csPC8Turkish(2014), + csIBMSymbols(2015), + csIBMThai(2016), + csHPLegal(2017), + csHPPiFont(2018), + csHPMath8(2019), + csHPPSMath(2020), + csHPDesktop(2021), + csVenturaMath(2022), + csMicrosoftPublishing(2023), + csWindows31J(2024), + csGB2312(2025), + csBig5(2026), + csMacintosh(2027), + csIBM037(2028), + csIBM038(2029), + csIBM273(2030), + csIBM274(2031), + csIBM275(2032), + csIBM277(2033), + csIBM278(2034), + csIBM280(2035), + csIBM281(2036), + csIBM284(2037), + csIBM285(2038), + csIBM290(2039), + csIBM297(2040), + csIBM420(2041), + csIBM423(2042), + csIBM424(2043), + csIBM500(2044), + csIBM851(2045), + csIBM855(2046), + csIBM857(2047), + csIBM860(2048), + csIBM861(2049), + csIBM863(2050), + csIBM864(2051), + csIBM865(2052), + csIBM868(2053), + csIBM869(2054), + csIBM870(2055), + csIBM871(2056), + csIBM880(2057), + csIBM891(2058), + csIBM903(2059), + csIBBM904(2060), + csIBM905(2061), + csIBM918(2062), + csIBM1026(2063), + csIBMEBCDICATDE(2064), + csEBCDICATDEA(2065), + csEBCDICCAFR(2066), + csEBCDICDKNO(2067), + csEBCDICDKNOA(2068), + csEBCDICFISE(2069), + csEBCDICFISEA(2070), + csEBCDICFR(2071), + csEBCDICIT(2072), + csEBCDICPT(2073), + csEBCDICES(2074), + csEBCDICESA(2075), + csEBCDICESS(2076), + csEBCDICUK(2077), + csEBCDICUS(2078), + csUnknown8BiT(2079), + csMnemonic(2080), + csMnem(2081), + csVISCII(2082), + csVIQR(2083), + csKOI8R(2084), + csHZGB2312(2085), + csIBM866(2086), + csPC775Baltic(2087), + csKOI8U(2088), + csIBM00858(2089), + csIBM00924(2090), + csIBM01140(2091), + csIBM01141(2092), + csIBM01142(2093), + csIBM01143(2094), + csIBM01144(2095), + csIBM01145(2096), + csIBM01146(2097), + csIBM01147(2098), + csIBM01148(2099), + csIBM01149(2100), + csBig5HKSCS(2101), + csIBM1047(2102), + csPTCP154(2103), + csAmiga1251(2104), + csKOI7switched(2105), + csBRF(2106), + csTSCII(2107), + cswindows1250(2250), + cswindows1251(2251), + cswindows1252(2252), + cswindows1253(2253), + cswindows1254(2254), + cswindows1255(2255), + cswindows1256(2256), + cswindows1257(2257), + cswindows1258(2258), + csTIS620(2259), + reserved(3000) + } +END + diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-ITU-ALARM-TC-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-ITU-ALARM-TC-MIB new file mode 100644 index 00000000..8579485c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-ITU-ALARM-TC-MIB @@ -0,0 +1,333 @@ +IANA-ITU-ALARM-TC-MIB DEFINITIONS ::= BEGIN + + IMPORTS + MODULE-IDENTITY, mib-2 FROM SNMPv2-SMI + TEXTUAL-CONVENTION FROM SNMPv2-TC; + + ianaItuAlarmNumbers MODULE-IDENTITY + LAST-UPDATED "200409090000Z" -- September 09, 2004 + ORGANIZATION "IANA" + CONTACT-INFO + "Postal: Internet Assigned Numbers Authority + Internet Corporation for Assigned Names + and Numbers + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292-6601 + USA + + Tel: +1 310-823-9358 + E-Mail: iana&iana.org" + DESCRIPTION + "The MIB module defines the ITU Alarm + textual convention for objects expected to require + regular extension. + + Copyright (C) The Internet Society (2004). The + initial version of this MIB module was published + in RFC 3877. For full legal notices see the RFC + itself. Supplementary information may be available on: + http://www.ietf.org/copyrights/ianamib.html" + REVISION "200409090000Z" + DESCRIPTION + "Initial version, published as RFC 3877." + ::= { mib-2 119 } + + + IANAItuProbableCause ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "ITU-T probable cause values. Duplicate values defined in + X.733 are appended with X733 to ensure syntactic uniqueness. + Probable cause value 0 is reserved for special purposes. + + The Internet Assigned Number Authority (IANA) is responsible + for the assignment of the enumerations in this TC. + IANAItuProbableCause value of 0 is reserved for special + purposes and MUST NOT be assigned. + + Values of IANAItuProbableCause in the range 1 to 1023 are + reserved for causes that correspond to ITU-T probable cause. + + All other requests for new causes will be handled on a + first-come, first served basis and will be assigned + enumeration values starting with 1025. + + Request should come in the form of well-formed + SMI [RFC2578] for enumeration names that are unique and + sufficiently descriptive. + + While some effort will be taken to ensure that new probable + causes do not conceptually duplicate existing probable + causes it is acknowledged that the existence of conceptual + duplicates in the starting probable cause list is an known + industry reality. + + To aid IANA in the administration of probable cause names + and values, the OPS Area Director will appoint one or more + experts to help review requests. + + See http://www.iana.org" + REFERENCE + "ITU Recommendation M.3100, 'Generic Network Information + Model', 1995 + ITU Recommendation X.733, 'Information Technology - Open + Systems Interconnection - System Management: Alarm + Reporting Function', 1992 + ITU Recommendation X.736, 'Information Technology - Open + Systems Interconnection - System Management: Security + Alarm Reporting Function', 1992" + + SYNTAX INTEGER + { + -- The following probable causes were defined in M.3100 + aIS (1), + callSetUpFailure (2), + degradedSignal (3), + farEndReceiverFailure (4), + framingError (5), + lossOfFrame (6), + lossOfPointer (7), + lossOfSignal (8), + payloadTypeMismatch (9), + transmissionError (10), + remoteAlarmInterface (11), + excessiveBER (12), + pathTraceMismatch (13), + unavailable (14), + signalLabelMismatch (15), + lossOfMultiFrame (16), + receiveFailure (17), + transmitFailure (18), + modulationFailure (19), + demodulationFailure (20), + broadcastChannelFailure (21), + connectionEstablishmentError (22), + invalidMessageReceived (23), + localNodeTransmissionError (24), + remoteNodeTransmissionError (25), + routingFailure (26), + --Values 27-50 are reserved for communications alarm related + --probable causes + -- The following are used with equipment alarm. + backplaneFailure (51), + dataSetProblem (52), + equipmentIdentifierDuplication (53), + externalIFDeviceProblem (54), + lineCardProblem (55), + multiplexerProblem (56), + nEIdentifierDuplication (57), + powerProblem (58), + processorProblem (59), + protectionPathFailure (60), + receiverFailure (61), + replaceableUnitMissing (62), + replaceableUnitTypeMismatch (63), + synchronizationSourceMismatch (64), + terminalProblem (65), + timingProblem (66), + transmitterFailure (67), + trunkCardProblem (68), + replaceableUnitProblem (69), + realTimeClockFailure (70), + --An equipment alarm to be issued if the system detects that the + --real time clock has failed + antennaFailure (71), + batteryChargingFailure (72), + diskFailure (73), + frequencyHoppingFailure (74), + iODeviceError (75), + lossOfSynchronisation (76), + lossOfRedundancy (77), + powerSupplyFailure (78), + signalQualityEvaluationFailure (79), + tranceiverFailure (80), + protectionMechanismFailure (81), + protectingResourceFailure (82), + -- Values 83-100 are reserved for equipment alarm related probable + -- causes + -- The following are used with environmental alarm. + airCompressorFailure (101), + airConditioningFailure (102), + airDryerFailure (103), + batteryDischarging (104), + batteryFailure (105), + commercialPowerFailure (106), + coolingFanFailure (107), + engineFailure (108), + fireDetectorFailure (109), + fuseFailure (110), + generatorFailure (111), + lowBatteryThreshold (112), + pumpFailure (113), + rectifierFailure (114), + rectifierHighVoltage (115), + rectifierLowFVoltage (116), + ventilationsSystemFailure (117), + enclosureDoorOpen (118), + explosiveGas (119), + fire (120), + flood (121), + highHumidity (122), + highTemperature (123), + highWind (124), + iceBuildUp (125), + intrusionDetection (126), + lowFuel (127), + lowHumidity (128), + lowCablePressure (129), + lowTemperatue (130), + lowWater (131), + smoke (132), + toxicGas (133), + coolingSystemFailure (134), + externalEquipmentFailure (135), + externalPointFailure (136), + -- Values 137-150 are reserved for environmental alarm related + -- probable causes + -- The following are used with Processing error alarm. + storageCapacityProblem (151), + memoryMismatch (152), + corruptData (153), + outOfCPUCycles (154), + sfwrEnvironmentProblem (155), + sfwrDownloadFailure (156), + lossOfRealTimel (157), + --A processing error alarm to be issued after the system has + --reinitialised. This will indicate + --to the management systems that the view they have of the managed + --system may no longer + --be valid. Usage example: The managed + --system issues this alarm after a reinitialization with severity + --warning to inform the + --management system about the event. No clearing notification will + --be sent. + applicationSubsystemFailure (158), + configurationOrCustomisationError (159), + databaseInconsistency (160), + fileError (161), + outOfMemory (162), + softwareError (163), + timeoutExpired (164), + underlayingResourceUnavailable (165), + versionMismatch (166), + --Values 168-200 are reserved for processing error alarm related + -- probable causes. + bandwidthReduced (201), + congestion (202), + excessiveErrorRate (203), + excessiveResponseTime (204), + excessiveRetransmissionRate (205), + reducedLoggingCapability (206), + systemResourcesOverload (207 ), + -- The following were defined X.733 + adapterError (500), + applicationSubsystemFailture (501), + bandwidthReducedX733 (502), + callEstablishmentError (503), + communicationsProtocolError (504), + communicationsSubsystemFailure (505), + configurationOrCustomizationError (506), + congestionX733 (507), + coruptData (508), + cpuCyclesLimitExceeded (509), + dataSetOrModemError (510), + degradedSignalX733 (511), + dteDceInterfaceError (512), + enclosureDoorOpenX733 (513), + equipmentMalfunction (514), + excessiveVibration (515), + fileErrorX733 (516), + fireDetected (517), + framingErrorX733 (518), + heatingVentCoolingSystemProblem (519), + humidityUnacceptable (520), + inputOutputDeviceError (521), + inputDeviceError (522), + lanError (523), + leakDetected (524), + localNodeTransmissionErrorX733 (525), + lossOfFrameX733 (526), + lossOfSignalX733 (527), + materialSupplyExhausted (528), + multiplexerProblemX733 (529), + outOfMemoryX733 (530), + ouputDeviceError (531), + performanceDegraded (532), + powerProblems (533), + pressureUnacceptable (534), + processorProblems (535), + pumpFailureX733 (536), + queueSizeExceeded (537), + receiveFailureX733 (538), + receiverFailureX733 (539), + remoteNodeTransmissionErrorX733 (540), + resourceAtOrNearingCapacity (541), + responseTimeExecessive (542), + retransmissionRateExcessive (543), + softwareErrorX733 (544), + softwareProgramAbnormallyTerminated (545), + softwareProgramError (546), + storageCapacityProblemX733 (547), + temperatureUnacceptable (548), + thresholdCrossed (549), + timingProblemX733 (550), + toxicLeakDetected (551), + transmitFailureX733 (552), + transmiterFailure (553), + underlyingResourceUnavailable (554), + versionMismatchX733 (555), + -- The following are defined in X.736 + authenticationFailure (600), + breachOfConfidentiality (601), + cableTamper (602), + delayedInformation (603), + denialOfService (604), + duplicateInformation (605), + informationMissing (606), + informationModificationDetected (607), + informationOutOfSequence (608), + keyExpired (609), + nonRepudiationFailure (610), + outOfHoursActivity (611), + outOfService (612), + proceduralError (613), + unauthorizedAccessAttempt (614), + unexpectedInformation (615), + + other (1024) + } + + IANAItuEventType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The ITU event Type values. + + The Internet Assigned Number Authority (IANA) is + responsible for the assignment of the enumerations + in this TC. + + Request should come in the form of well-formed + SMI [RFC2578] for enumeration names that are unique + and sufficiently descriptive. + + See http://www.iana.org " + REFERENCE + "ITU Recommendation X.736, 'Information Technology - Open + Systems Interconnection - System Management: Security + Alarm Reporting Function', 1992" + SYNTAX INTEGER + { + other (1), + communicationsAlarm (2), + qualityOfServiceAlarm (3), + processingErrorAlarm (4), + equipmentAlarm (5), + environmentalAlarm (6), + integrityViolation (7), + operationalViolation (8), + physicalViolation (9), + securityServiceOrMechanismViolation (10), + timeDomainViolation (11) + } + + END diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-LANGUAGE-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-LANGUAGE-MIB new file mode 100644 index 00000000..6210f723 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-LANGUAGE-MIB @@ -0,0 +1,127 @@ + + IANA-LANGUAGE-MIB DEFINITIONS ::= BEGIN + + IMPORTS + MODULE-IDENTITY, OBJECT-IDENTITY, mib-2 + FROM SNMPv2-SMI; + + ianaLanguages MODULE-IDENTITY + LAST-UPDATED "200005100000Z" -- May 10, 2000 + ORGANIZATION "IANA" + CONTACT-INFO + "Internet Assigned Numbers Authority (IANA) + + Postal: ICANN + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292 + + Tel: +1 310 823 9358 x20 + E-Mail: iana&iana.org" + DESCRIPTION + "The MIB module registers object identifier values for + well-known programming and scripting languages. Every + language registration MUST describe the format used + when transferring scripts written in this language. + + Any additions or changes to the contents of this MIB + module require Designated Expert Review as defined in + the Guidelines for Writing IANA Considerations Section + document. The Designated Expert will be selected by + the IESG Area Director of the OPS Area. + + Note, this module does not have to register all possible + languages since languages are identified by object + identifier values. It is therefore possible to registered + languages in private OID trees. The references given below are not + normative with regard to the language version. Other + references might be better suited to describe some newer + versions of this language. The references are only + provided as `a pointer into the right direction'." + + -- Revision log, in reverse chronological order + + REVISION "200005100000Z" -- May 10, 2000 + DESCRIPTION "Import mib-2 instead of experimental, so that + this module compiles" + + REVISION "199909090900Z" -- September 9, 1999 + DESCRIPTION "Initial version as published at time of + publication of RFC 2591." + + ::= { mib-2 73 } + + + ianaLangJavaByteCode OBJECT-IDENTITY + STATUS current + DESCRIPTION + "Java byte code to be processed by a Java virtual machine. + A script written in Java byte code is transferred by using + the Java archive file format (JAR)." + REFERENCE + "The Java Virtual Machine Specification. + ISBN 0-201-63452-X" + ::= { ianaLanguages 1 } + + ianaLangTcl OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The Tool Command Language (Tcl). A script written in the + Tcl language is transferred in Tcl source code format." + REFERENCE + "Tcl and the Tk Toolkit. + ISBN 0-201-63337-X" + ::= { ianaLanguages 2 } + + ianaLangPerl OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The Perl language. A script written in the Perl language + is transferred in Perl source code format." + REFERENCE + "Programming Perl. + ISBN 1-56592-149-6" + ::= { ianaLanguages 3 } + + ianaLangScheme OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The Scheme language. A script written in the Scheme + language is transferred in Scheme source code format." + REFERENCE + "The Revised^4 Report on the Algorithmic Language Scheme. + MIT Press" + ::= { ianaLanguages 4 } + + ianaLangSRSL OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The SNMP Script Language defined by SNMP Research. A + script written in the SNMP Script Language is transferred + in the SNMP Script Language source code format." + ::= { ianaLanguages 5 } + + ianaLangPSL OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The Patrol Script Language defined by BMC Software. A script + written in the Patrol Script Language is transferred in the + Patrol Script Language source code format." + REFERENCE + "PATROL Script Language Reference Manual, Version 3.0, + November 30, 1995. BMC Software, Inc. 2101 City West Blvd., + Houston, Texas 77042." + ::= { ianaLanguages 6 } + + ianaLangSMSL OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The Systems Management Scripting Language. A script written + in the SMSL language is transferred in the SMSL source code + format." + REFERENCE + "ISO/ITU Command Sequencer. + ISO 10164-21 or ITU X.753" + ::= { ianaLanguages 7 } + + END + diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-MALLOC-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-MALLOC-MIB new file mode 100644 index 00000000..5869a363 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-MALLOC-MIB @@ -0,0 +1,67 @@ + +IANA-MALLOC-MIB DEFINITIONS ::= BEGIN + +IMPORTS + MODULE-IDENTITY, mib-2 FROM SNMPv2-SMI + TEXTUAL-CONVENTION FROM SNMPv2-TC; + +ianaMallocMIB MODULE-IDENTITY + LAST-UPDATED "200301271200Z" -- January 27, 2003 + ORGANIZATION "IANA" + CONTACT-INFO + " Internet Assigned Numbers Authority + Internet Corporation for Assigned Names and Numbers + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292-6601 + + Phone: +1 310 823 9358 + EMail: iana&iana.org" + DESCRIPTION + "This MIB module defines the IANAscopeSource and + IANAmallocRangeSource textual conventions for use in MIBs + which need to identify ways of learning multicast scope and + range information. + + Any additions or changes to the contents of this MIB module + require either publication of an RFC, or Designated Expert + Review as defined in the Guidelines for Writing IANA + Considerations Section document. The Designated Expert will + be selected by the IESG Area Director(s) of the Transport + Area." + + -- revision log + + REVISION "200301271200Z" -- January 27, 2003 + DESCRIPTION + "Initial version." + ::= { mib-2 102 } + +IANAscopeSource ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The source of multicast scope information." + SYNTAX INTEGER { + other(1), -- none of the following + manual(2), -- statically configured + local(3), -- automatically added by the system, + -- such as a Source-Specific Multicast + -- scope + mzap(4), -- MZAP + madcap(5) -- MADCAP + } + +IANAmallocRangeSource ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The source of multicast address allocation range + information." + SYNTAX INTEGER { + other(1), -- none of the following + manual(2), -- statically configured + local(3) -- automatically added by the system, + -- such as a Source-Specific Multicast + -- range + } + +END + diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-MAU-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-MAU-MIB new file mode 100644 index 00000000..35c3f4a8 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-MAU-MIB @@ -0,0 +1,770 @@ +IANA-MAU-MIB DEFINITIONS ::= BEGIN + + IMPORTS + MODULE-IDENTITY, OBJECT-IDENTITY, mib-2 + FROM SNMPv2-SMI + TEXTUAL-CONVENTION + FROM SNMPv2-TC + ; + + ianaMauMIB MODULE-IDENTITY + LAST-UPDATED "200704210000Z" -- April 21, 2007 + ORGANIZATION "IANA" + CONTACT-INFO " Internet Assigned Numbers Authority + + Postal: ICANN + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292 + + Tel: +1-310-823-9358 + EMail: iana&iana.org" + + DESCRIPTION + "This MIB module defines dot3MauType OBJECT-IDENTITIES and + IANAifMauListBits, IANAifMauMediaAvailable, + IANAifMauAutoNegCapBits, and IANAifJackType + + TEXTUAL-CONVENTIONs, specifying enumerated values of the + ifMauTypeListBits, ifMauMediaAvailable / rpMauMediaAvailable, + ifMauAutoNegCapabilityBits / ifMauAutoNegCapAdvertisedBits / + ifMauAutoNegCapReceivedBits and ifJackType / rpJackType objects + respectively, defined in the MAU-MIB. + + It is intended that each new MAU type, Media Availability + state, Auto Negotiation capability and/or Jack type defined by + the IEEE 802.3 working group and approved for publication in a + revision of IEEE Std 802.3 will be added to this MIB module, + provided that it is suitable for being managed by the base + objects in the MAU-MIB. An Expert Review, as defined in + RFC 2434 [RFC2434], is REQUIRED for such additions. + + The following reference is used throughout this MIB module: + + [IEEE802.3] refers to: + IEEE Std 802.3, 2005 Edition: 'IEEE Standard for + Information technology - Telecommunications and information + exchange between systems - Local and metropolitan area + networks - Specific requirements - + Part 3: Carrier sense multiple access with collision + detection (CSMA/CD) access method and physical layer + specifications'. + + This reference should be updated as appropriate when new + MAU types, Media Availability states, Auto Negotiation + capabilities, and/or Jack types are added to this MIB module. + + Copyright (C) The IETF Trust (2007). + The initial version of this MIB module was published in + RFC 4836; for full legal notices see the RFC itself. + Supplementary information may be available at: + http://www.ietf.org/copyrights/ianamib.html" + + REVISION "200704210000Z" -- April 21, 2007 + DESCRIPTION "Initial version of this MIB as published in + RFC 4836." + ::= { mib-2 154 } + + -- Textual Conventions + + IANAifMauTypeListBits ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "This data type is used as the syntax of the ifMauTypeListBits + object in the (updated) definition of MAU-MIB's ifMauTable. + + The most recent version of this textual convention is available + in the online version of this MIB module on the IANA web site. + + Requests for new values should be made to IANA via email + (iana&iana.org). + + Note that changes in this textual convention SHALL be + synchronized with relevant changes in the dot3MauType + OBJECT-IDENTITIES." + REFERENCE + "[IEEE802.3], Section 30.5.1.1.2" + SYNTAX BITS { + bOther(0), -- other or unknown + bAUI(1), -- AUI + b10base5(2), -- 10BASE-5 + bFoirl(3), -- FOIRL + + b10base2(4), -- 10BASE-2 + b10baseT(5), -- 10BASE-T duplex mode unknown + b10baseFP(6), -- 10BASE-FP + b10baseFB(7), -- 10BASE-FB + b10baseFL(8), -- 10BASE-FL duplex mode unknown + b10broad36(9), -- 10BROAD36 + b10baseTHD(10), -- 10BASE-T half duplex mode + b10baseTFD(11), -- 10BASE-T full duplex mode + b10baseFLHD(12), -- 10BASE-FL half duplex mode + b10baseFLFD(13), -- 10BASE-FL full duplex mode + b100baseT4(14), -- 100BASE-T4 + b100baseTXHD(15), -- 100BASE-TX half duplex mode + b100baseTXFD(16), -- 100BASE-TX full duplex mode + b100baseFXHD(17), -- 100BASE-FX half duplex mode + b100baseFXFD(18), -- 100BASE-FX full duplex mode + b100baseT2HD(19), -- 100BASE-T2 half duplex mode + b100baseT2FD(20), -- 100BASE-T2 full duplex mode + + b1000baseXHD(21), -- 1000BASE-X half duplex mode + b1000baseXFD(22), -- 1000BASE-X full duplex mode + b1000baseLXHD(23), -- 1000BASE-LX half duplex mode + b1000baseLXFD(24), -- 1000BASE-LX full duplex mode + b1000baseSXHD(25), -- 1000BASE-SX half duplex mode + b1000baseSXFD(26), -- 1000BASE-SX full duplex mode + b1000baseCXHD(27), -- 1000BASE-CX half duplex mode + b1000baseCXFD(28), -- 1000BASE-CX full duplex mode + b1000baseTHD(29), -- 1000BASE-T half duplex mode + b1000baseTFD(30), -- 1000BASE-T full duplex mode + + b10GbaseX(31), -- 10GBASE-X + b10GbaseLX4(32), -- 10GBASE-LX4 + + b10GbaseR(33), -- 10GBASE-R + b10GbaseER(34), -- 10GBASE-ER + b10GbaseLR(35), -- 10GBASE-LR + b10GbaseSR(36), -- 10GBASE-SR + b10GbaseW(37), -- 10GBASE-W + b10GbaseEW(38), -- 10GBASE-EW + b10GbaseLW(39), -- 10GBASE-LW + b10GbaseSW(40), -- 10GBASE-SW + -- new since RFC 3636 + b10GbaseCX4(41), -- 10GBASE-CX4 + b2BaseTL(42), -- 2BASE-TL + b10PassTS(43), -- 10PASS-TS + b100BaseBX10D(44), -- 100BASE-BX10D + b100BaseBX10U(45), -- 100BASE-BX10U + b100BaseLX10(46), -- 100BASE-LX10 + b1000BaseBX10D(47), -- 1000BASE-BX10D + b1000BaseBX10U(48), -- 1000BASE-BX10U + b1000BaseLX10(49), -- 1000BASE-LX10 + b1000BasePX10D(50), -- 1000BASE-PX10D + b1000BasePX10U(51), -- 1000BASE-PX10U + b1000BasePX20D(52), -- 1000BASE-PX20D + b1000BasePX20U(53) -- 1000BASE-PX20U + } + + IANAifMauMediaAvailable ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "This data type is used as the syntax of the + ifMauMediaAvailable and rpMauMediaAvailable objects in the + (updated) definition of MAU-MIB's ifMauTable and rpMauTable + respectively. + + Possible values are: + other(1) - undefined (not listed below) + unknown(2) - MAU's true state is unknown; e.g., + during initialization + available(3) - link, light, or loopback is normal + notAvailable(4) - link loss, low light, or no loopback + remoteFault(5) - a fault has been detected at the + remote end of the link. This value + applies to 10BASE-FB, 100BASE-T4 Far + End Fault Indication and non-specified + remote faults from a system running + auto-negotiation + invalidSignal(6) - invalid signal has been received from + the other end of the link, 10BASE-FB + only + remoteJabber(7) - remote fault, due to jabber + + remoteLinkLoss(8) - remote fault, due to link loss + remoteTest(9) - remote fault, due to test + offline(10) - offline, Clause 37 Auto-Negotiation + only + autoNegError(11) - Auto-Negotiation Error, Clause 37 + Auto-Negotiation only + pmdLinkFault(12) - PMA/PMD receive link fault. In case + of PAF (2BASE-TL / 10PASS-TS PHYs), + all PMEs in the aggregation group have + detected a link fault + wisFrameLoss(13) - WIS loss of frame, 10GBASE-W only + wisSignalLoss(14) - WIS loss of signal, 10GBASE-W only + pcsLinkFault(15) - PCS receive link fault + excessiveBER(16) - PCS Bit Error Ratio monitor + reporting excessive error ratio + dxsLinkFault(17) - DTE XGXS receive link fault, XAUI only + pxsLinkFault(18) - PHY XGXS receive link fault, XAUI only + availableReduced(19) - link normal, reduced bandwidth, + 2BASE-TL / 10PASS-TS only + ready(20) - at least one PME in the aggregation + group is detecting handshake tones, + 2BASE-TL / 10PASS-TS only + + If the MAU is a 10M b/s link or fiber type (FOIRL, 10BASE-T, + 10BASE-F), then this is equivalent to the link test fail + state/low light function. For an AUI, 10BASE2, 10BASE5, or + 10BROAD36 MAU, this indicates whether loopback is detected on + the DI circuit. The value of this attribute persists between + packets for MAU types AUI, 10BASE5, 10BASE2, 10BROAD36, and + 10BASEFP. + + At power-up or following a reset, the Media Available state + will be unknown(2) for AUI, 10BASE5, 10BASE2, 10BROAD36, and + 10BASE-FP MAUs. For these MAUs loopback will be tested on each + transmission during which no collision is detected. + If DI is receiving input when DO returns to IDL after a + transmission and there has been no collision during the + transmission, then loopback will be detected. The Media + Available state will only change during noncollided + transmissions for AUI, 10BASE2, 10BASE5, 10BROAD36, and + 10BASE-FP MAUs. + + For 100BASE-T2, 100BASE-T4, 100BASE-TX, 100BASE-FX, + 100BASE-LX10, and 100BASE-BX10 PHYs the enumerations match the + states within the link integrity state diagram. + Any MAU that implements management of [IEEE802.3] Clause + 28 Auto-Negotiation, will map remote fault indication to + remoteFault(5). + + Any MAU that implements management of Clause 37 + Auto-Negotiation, will map the received RF1 and RF2 bits as + follows: Offline maps to offline(10), Link_Failure maps to + remoteFault(5), and Auto-Negotiation Error maps to + autoNegError(11). + + The value remoteFault(5) applies to 10BASE-FB remote + fault indication, the 100BASE-X far-end fault indication, and + nonspecified remote faults from a system running Clause 28 + Auto-Negotiation. + + The value remoteJabber(7), remoteLink loss(8), or remoteTest(9) + SHOULD be used instead of remoteFault(5) where the reason for + remote fault is identified in the remote signaling protocol. + Where a Clause 22 MII or Clause 35 GMII is present, a logic + one in the remote fault bit maps to the value remoteFault(5), + a logic zero in the link status bit maps to the enumeration + notAvailable(4). The value notAvailable(4) takes precedence + over remoteFault(5). + + For 2BASE-TL and 10PASS-TS PHYs, the value unknown(2) maps to + the condition where the PHY (PCS with connected PMEs) is + initializing, the value ready(20) maps to the condition where + the interface is down and at least one PME in the aggregation + group is ready for handshake, the value available(3) maps to + the condition where all the PMEs in the aggregation group are + up, the value notAvailable(4) maps to the condition where all + the PMEs in the aggregation group are down and no handshake + tones are detected, the value availableReduced(19) maps to the + condition where the interface is up, a link fault is detected + at the receive direction by one or more PMEs in the + aggregation group, but at least one PME is up and the + enumeration pmdLinkFault(12) maps to the condition where a link + fault is detected at the receive direction by all of the PMEs + in the aggregation group. + + For 10 Gb/s the enumerations map to value of the link_fault + variable within the Link Fault Signaling state diagram + as follows: the value OK maps to the value available(3), + the value Local Fault maps to the value notAvailable(4), + and the value Remote Fault maps to the value remoteFault(5). + The value pmdLinkFault(12), wisFrameLoss(13), + wisSignalLoss(14), pcsLinkFault(15), excessiveBER(16), or + dxsLinkFault(17) SHOULD be used instead of the value + notAvailable(4), where the reason for the Local Fault state can + be identified through the use of the Clause 45 MDIO Interface. + Where multiple reasons for the Local Fault state can be + identified, only the highest precedence error SHOULD be + + reported. This precedence in descending order is as follows: + + pxsLinkFault + pmdLinkFault + wisFrameLoss + wisSignalLoss + pcsLinkFault + excessiveBER + dxsLinkFault. + + Where a Clause 45 MDIO interface is present a logic zero in + the PMA/PMD Receive link status bit ([IEEE802.3] + Section 45.2.1.2.2) maps to the value pmdLinkFault(12), + logic one in the LOF status bit (Section 45.2.2.10.4) maps + to the value wisFrameLoss(13), a logic one in the LOS + status bit (Section 45.2.2.10.5) maps to the value + wisSignalLoss, a logic zero in the PCS Receive + link status bit (Section 45.2.3.2.2) maps to the value + pcsLinkFault(15), a logic one in the 10GBASE-R PCS Latched + high BER status bit (Section 45.2.3.12.2) maps to the value + excessiveBER, a logic zero in the DTE XS receive link status + bit (Section 45.2.5.2.2) maps to the value dxsLinkFault(17) + and a logic zero in the PHY XS transmit link status bit + (Section 45.2.4.2.2) maps to the value pxsLinkFault(18). + + The most recent version of this textual convention is available + in the online version of this MIB module on the IANA web site. + + Requests for new values should be made to IANA via email + (iana&iana.org)." + REFERENCE + "[IEEE802.3], Section 30.5.1.1.4" + SYNTAX INTEGER { + other(1), + unknown(2), + available(3), + notAvailable(4), + remoteFault(5), + invalidSignal(6), + remoteJabber(7), + remoteLinkLoss(8), + remoteTest(9), + offline(10), + autoNegError(11), + pmdLinkFault(12), + wisFrameLoss(13), + wisSignalLoss(14), + pcsLinkFault(15), + + excessiveBER(16), + dxsLinkFault(17), + pxsLinkFault(18), + availableReduced(19), + ready(20) + } + + IANAifMauAutoNegCapBits ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "This data type is used as the syntax of the + ifMauAutoNegCapabilityBits, ifMauAutoNegCapAdvertisedBits, and + ifMauAutoNegCapReceivedBits objects in the (updated) definition + of MAU-MIB's ifMauAutoNegTable. + + The most recent version of this textual convention is available + in the online version of this MIB module on the IANA web site. + + Requests for new values should be made to IANA via email + (iana&iana.org)." + REFERENCE + "[IEEE802.3], Section 30.6.1.1.5" + SYNTAX BITS { + bOther(0), -- other or unknown + b10baseT(1), -- 10BASE-T half duplex mode + b10baseTFD(2), -- 10BASE-T full duplex mode + b100baseT4(3), -- 100BASE-T4 + b100baseTX(4), -- 100BASE-TX half duplex mode + b100baseTXFD(5), -- 100BASE-TX full duplex mode + b100baseT2(6), -- 100BASE-T2 half duplex mode + b100baseT2FD(7), -- 100BASE-T2 full duplex mode + bFdxPause(8), -- PAUSE for full-duplex links + bFdxAPause(9), -- Asymmetric PAUSE for full-duplex + -- links + bFdxSPause(10), -- Symmetric PAUSE for full-duplex + -- links + bFdxBPause(11), -- Asymmetric and Symmetric PAUSE for + -- full-duplex links + b1000baseX(12), -- 1000BASE-X, -LX, -SX, -CX half + -- duplex mode + b1000baseXFD(13), -- 1000BASE-X, -LX, -SX, -CX full + -- duplex mode + b1000baseT(14), -- 1000BASE-T half duplex mode + b1000baseTFD(15) -- 1000BASE-T full duplex mode + } + + IANAifJackType ::= TEXTUAL-CONVENTION + STATUS current + + DESCRIPTION + "Common enumeration values for repeater and interface MAU + jack types. This data type is used as the syntax of the + ifJackType and rpJackType objects in the (updated) definition + of MAU-MIB's ifJackTable and rpJackTable respectively. + + Possible values are: + other(1) - undefined or unknown + rj45(2) - RJ45 + rj45S(3) - RJ45 shielded + db9(4) - DB9 + bnc(5) - BNC + fAUI(6) - AUI female + mAUI(7) - AUI male + fiberSC(8) - SC fiber + fiberMIC(9) - MIC fiber + fiberST(10) - ST fiber + telco(11) - Telco + mtrj(12) - MT-RJ fiber + hssdc(13) - fiber channel style-2 + fiberLC(14) - LC fiber + cx4(15) - IB4X for 10GBASE-CX4 + + The most recent version of this textual convention is available + in the online version of this MIB module on the IANA web site. + + Requests for new values should be made to IANA via email + (iana&iana.org)." + SYNTAX INTEGER { + other(1), + rj45(2), + rj45S(3), + db9(4), + bnc(5), + fAUI(6), + mAUI(7), + fiberSC(8), + fiberMIC(9), + fiberST(10), + telco(11), + mtrj(12), + hssdc(13), + fiberLC(14), + -- new since RFC 3636 + cx4(15) + } + + -- OBJECT IDENTITIES for MAU types + + -- (see rpMauType and ifMauType of MAU-MIB for usage) + -- The following definitions has been moved from RFC 3636 and + -- no longer appear in its revision. + + dot3MauType OBJECT IDENTIFIER ::= { mib-2 snmpDot3MauMgt(26) 4 } + + dot3MauTypeAUI OBJECT-IDENTITY + STATUS current + DESCRIPTION "no internal MAU, view from AUI" + REFERENCE "[IEEE802.3], Section 7" + ::= { dot3MauType 1 } + + dot3MauType10Base5 OBJECT-IDENTITY + STATUS current + DESCRIPTION "thick coax MAU" + REFERENCE "[IEEE802.3], Section 7" + ::= { dot3MauType 2 } + + dot3MauTypeFoirl OBJECT-IDENTITY + STATUS current + DESCRIPTION "FOIRL MAU" + REFERENCE "[IEEE802.3], Section 9.9" + ::= { dot3MauType 3 } + + dot3MauType10Base2 OBJECT-IDENTITY + STATUS current + DESCRIPTION "thin coax MAU" + REFERENCE "[IEEE802.3], Section 10" + ::= { dot3MauType 4 } + + dot3MauType10BaseT OBJECT-IDENTITY + STATUS current + DESCRIPTION "UTP MAU. + Note that it is strongly recommended that + agents return either dot3MauType10BaseTHD or + dot3MauType10BaseTFD if the duplex mode is + known. However, management applications should + be prepared to receive this MAU type value from + older agent implementations." + REFERENCE "[IEEE802.3], Section 14" + ::= { dot3MauType 5 } + + dot3MauType10BaseFP OBJECT-IDENTITY + STATUS current + DESCRIPTION "passive fiber MAU" + REFERENCE "[IEEE802.3], Section 16" + ::= { dot3MauType 6 } + + dot3MauType10BaseFB OBJECT-IDENTITY + STATUS current + DESCRIPTION "sync fiber MAU" + REFERENCE "[IEEE802.3], Section 17" + ::= { dot3MauType 7 } + + dot3MauType10BaseFL OBJECT-IDENTITY + STATUS current + DESCRIPTION "async fiber MAU. + Note that it is strongly recommended that + agents return either dot3MauType10BaseFLHD or + dot3MauType10BaseFLFD if the duplex mode is + known. However, management applications should + be prepared to receive this MAU type value from + older agent implementations." + REFERENCE "[IEEE802.3], Section 18" + ::= { dot3MauType 8 } + + dot3MauType10Broad36 OBJECT-IDENTITY + STATUS current + DESCRIPTION "broadband DTE MAU. + Note that 10BROAD36 MAUs can be attached to + interfaces but not to repeaters." + REFERENCE "[IEEE802.3], Section 11" + ::= { dot3MauType 9 } + + ------ new since RFC 1515: + dot3MauType10BaseTHD OBJECT-IDENTITY + STATUS current + DESCRIPTION "UTP MAU, half duplex mode" + REFERENCE "[IEEE802.3], Section 14" + ::= { dot3MauType 10 } + + dot3MauType10BaseTFD OBJECT-IDENTITY + STATUS current + DESCRIPTION "UTP MAU, full duplex mode" + REFERENCE "[IEEE802.3], Section 14" + ::= { dot3MauType 11 } + + dot3MauType10BaseFLHD OBJECT-IDENTITY + STATUS current + DESCRIPTION "async fiber MAU, half duplex mode" + REFERENCE "[IEEE802.3], Section 18" + ::= { dot3MauType 12 } + + dot3MauType10BaseFLFD OBJECT-IDENTITY + STATUS current + DESCRIPTION "async fiber MAU, full duplex mode" + + REFERENCE "[IEEE802.3], Section 18" + ::= { dot3MauType 13 } + + dot3MauType100BaseT4 OBJECT-IDENTITY + STATUS current + DESCRIPTION "4 pair category 3 UTP" + REFERENCE "[IEEE802.3], Section 23" + ::= { dot3MauType 14 } + + dot3MauType100BaseTXHD OBJECT-IDENTITY + STATUS current + DESCRIPTION "2 pair category 5 UTP, half duplex mode" + REFERENCE "[IEEE802.3], Section 25" + ::= { dot3MauType 15 } + + dot3MauType100BaseTXFD OBJECT-IDENTITY + STATUS current + DESCRIPTION "2 pair category 5 UTP, full duplex mode" + REFERENCE "[IEEE802.3], Section 25" + ::= { dot3MauType 16 } + + dot3MauType100BaseFXHD OBJECT-IDENTITY + STATUS current + DESCRIPTION "X fiber over PMT, half duplex mode" + REFERENCE "[IEEE802.3], Section 26" + ::= { dot3MauType 17 } + + dot3MauType100BaseFXFD OBJECT-IDENTITY + STATUS current + DESCRIPTION "X fiber over PMT, full duplex mode" + REFERENCE "[IEEE802.3], Section 26" + ::= { dot3MauType 18 } + + dot3MauType100BaseT2HD OBJECT-IDENTITY + STATUS current + DESCRIPTION "2 pair category 3 UTP, half duplex mode" + REFERENCE "[IEEE802.3], Section 32" + ::= { dot3MauType 19 } + + dot3MauType100BaseT2FD OBJECT-IDENTITY + STATUS current + DESCRIPTION "2 pair category 3 UTP, full duplex mode" + REFERENCE "[IEEE802.3], Section 32" + ::= { dot3MauType 20 } + + ------ new since RFC 2239: + dot3MauType1000BaseXHD OBJECT-IDENTITY + STATUS current + + DESCRIPTION "PCS/PMA, unknown PMD, half duplex mode" + REFERENCE "[IEEE802.3], Section 36" + ::= { dot3MauType 21 } + + dot3MauType1000BaseXFD OBJECT-IDENTITY + STATUS current + DESCRIPTION "PCS/PMA, unknown PMD, full duplex mode" + REFERENCE "[IEEE802.3], Section 36" + ::= { dot3MauType 22 } + + dot3MauType1000BaseLXHD OBJECT-IDENTITY + STATUS current + DESCRIPTION "Fiber over long-wavelength laser, half duplex + mode" + REFERENCE "[IEEE802.3], Section 38" + ::= { dot3MauType 23 } + + dot3MauType1000BaseLXFD OBJECT-IDENTITY + STATUS current + DESCRIPTION "Fiber over long-wavelength laser, full duplex + mode" + REFERENCE "[IEEE802.3], Section 38" + ::= { dot3MauType 24 } + + dot3MauType1000BaseSXHD OBJECT-IDENTITY + STATUS current + DESCRIPTION "Fiber over short-wavelength laser, half + duplex mode" + REFERENCE "[IEEE802.3], Section 38" + ::= { dot3MauType 25 } + + dot3MauType1000BaseSXFD OBJECT-IDENTITY + STATUS current + DESCRIPTION "Fiber over short-wavelength laser, full + duplex mode" + REFERENCE "[IEEE802.3], Section 38" + ::= { dot3MauType 26 } + + dot3MauType1000BaseCXHD OBJECT-IDENTITY + STATUS current + DESCRIPTION "Copper over 150-Ohm balanced cable, half + duplex mode" + REFERENCE "[IEEE802.3], Section 39" + ::= { dot3MauType 27 } + + dot3MauType1000BaseCXFD OBJECT-IDENTITY + STATUS current + DESCRIPTION "Copper over 150-Ohm balanced cable, full + + duplex mode" + REFERENCE "[IEEE802.3], Section 39" + ::= { dot3MauType 28 } + + dot3MauType1000BaseTHD OBJECT-IDENTITY + STATUS current + DESCRIPTION "Four-pair Category 5 UTP, half duplex mode" + REFERENCE "[IEEE802.3], Section 40" + ::= { dot3MauType 29 } + + dot3MauType1000BaseTFD OBJECT-IDENTITY + STATUS current + DESCRIPTION "Four-pair Category 5 UTP, full duplex mode" + REFERENCE "[IEEE802.3], Section 40" + ::= { dot3MauType 30 } + + ------ new since RFC 2668: + dot3MauType10GigBaseX OBJECT-IDENTITY + STATUS current + DESCRIPTION "X PCS/PMA, unknown PMD." + REFERENCE "[IEEE802.3], Section 48" + ::= { dot3MauType 31 } + + dot3MauType10GigBaseLX4 OBJECT-IDENTITY + STATUS current + DESCRIPTION "X fiber over WWDM optics" + REFERENCE "[IEEE802.3], Section 53" + ::= { dot3MauType 32 } + + dot3MauType10GigBaseR OBJECT-IDENTITY + STATUS current + DESCRIPTION "R PCS/PMA, unknown PMD." + REFERENCE "[IEEE802.3], Section 49" + ::= { dot3MauType 33 } + + dot3MauType10GigBaseER OBJECT-IDENTITY + STATUS current + DESCRIPTION "R fiber over 1550 nm optics" + REFERENCE "[IEEE802.3], Section 52" + ::= { dot3MauType 34 } + + dot3MauType10GigBaseLR OBJECT-IDENTITY + STATUS current + DESCRIPTION "R fiber over 1310 nm optics" + REFERENCE "[IEEE802.3], Section 52" + ::= { dot3MauType 35 } + + dot3MauType10GigBaseSR OBJECT-IDENTITY + + STATUS current + DESCRIPTION "R fiber over 850 nm optics" + REFERENCE "[IEEE802.3], Section 52" + ::= { dot3MauType 36 } + + dot3MauType10GigBaseW OBJECT-IDENTITY + STATUS current + DESCRIPTION "W PCS/PMA, unknown PMD." + REFERENCE "[IEEE802.3], Section 49 and 50" + ::= { dot3MauType 37 } + + dot3MauType10GigBaseEW OBJECT-IDENTITY + STATUS current + DESCRIPTION "W fiber over 1550 nm optics" + REFERENCE "[IEEE802.3], Section 52" + ::= { dot3MauType 38 } + + dot3MauType10GigBaseLW OBJECT-IDENTITY + STATUS current + DESCRIPTION "W fiber over 1310 nm optics" + REFERENCE "[IEEE802.3], Section 52" + ::= { dot3MauType 39 } + + dot3MauType10GigBaseSW OBJECT-IDENTITY + STATUS current + DESCRIPTION "W fiber over 850 nm optics" + REFERENCE "[IEEE802.3], Section 52" + ::= { dot3MauType 40 } + + ------ new since RFC 3636: + dot3MauType10GigBaseCX4 OBJECT-IDENTITY + STATUS current + DESCRIPTION "X copper over 8 pair 100-Ohm balanced cable" + REFERENCE "[IEEE802.3], Section 54" + ::= { dot3MauType 41 } + + dot3MauType2BaseTL OBJECT-IDENTITY + STATUS current + DESCRIPTION "Voice grade UTP copper, up to 2700m, optional PAF" + REFERENCE "[IEEE802.3], Sections 61 and 63" + ::= { dot3MauType 42 } + + dot3MauType10PassTS OBJECT-IDENTITY + STATUS current + DESCRIPTION "Voice grade UTP copper, up to 750m, optional PAF" + REFERENCE "[IEEE802.3], Sections 61 and 62" + ::= { dot3MauType 43 } + + dot3MauType100BaseBX10D OBJECT-IDENTITY + STATUS current + DESCRIPTION "One single-mode fiber OLT, long wavelength, 10km" + REFERENCE "[IEEE802.3], Section 58" + ::= { dot3MauType 44 } + + dot3MauType100BaseBX10U OBJECT-IDENTITY + STATUS current + DESCRIPTION "One single-mode fiber ONU, long wavelength, 10km" + REFERENCE "[IEEE802.3], Section 58" + ::= { dot3MauType 45 } + + dot3MauType100BaseLX10 OBJECT-IDENTITY + STATUS current + DESCRIPTION "Two single-mode fibers, long wavelength, 10km" + REFERENCE "[IEEE802.3], Section 58" + ::= { dot3MauType 46 } + + dot3MauType1000BaseBX10D OBJECT-IDENTITY + STATUS current + DESCRIPTION "One single-mode fiber OLT, long wavelength, 10km" + REFERENCE "[IEEE802.3], Section 59" + ::= { dot3MauType 47 } + + dot3MauType1000BaseBX10U OBJECT-IDENTITY + STATUS current + DESCRIPTION "One single-mode fiber ONU, long wavelength, 10km" + REFERENCE "[IEEE802.3], Section 59" + ::= { dot3MauType 48 } + + dot3MauType1000BaseLX10 OBJECT-IDENTITY + STATUS current + DESCRIPTION "Two sigle-mode fiber, long wavelength, 10km" + REFERENCE "[IEEE802.3], Section 59" + ::= { dot3MauType 49 } + + dot3MauType1000BasePX10D OBJECT-IDENTITY + STATUS current + DESCRIPTION "One single-mode fiber EPON OLT, 10km" + REFERENCE "[IEEE802.3], Section 60" + ::= { dot3MauType 50 } + + dot3MauType1000BasePX10U OBJECT-IDENTITY + STATUS current + DESCRIPTION "One single-mode fiber EPON ONU, 10km" + REFERENCE "[IEEE802.3], Section 60" + ::= { dot3MauType 51 } + + dot3MauType1000BasePX20D OBJECT-IDENTITY + STATUS current + DESCRIPTION "One single-mode fiber EPON OLT, 20km" + REFERENCE "[IEEE802.3], Section 60" + ::= { dot3MauType 52 } + + dot3MauType1000BasePX20U OBJECT-IDENTITY + STATUS current + DESCRIPTION "One single-mode fiber EPON ONU, 20km" + REFERENCE "[IEEE802.3], Section 60" + ::= { dot3MauType 53 } + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-PRINTER-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-PRINTER-MIB new file mode 100644 index 00000000..856ed5f8 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-PRINTER-MIB @@ -0,0 +1,1319 @@ +IANA-PRINTER-MIB DEFINITIONS ::= BEGIN + -- http://www.iana.org/assignments/ianaprinter-mib + +IMPORTS + MODULE-IDENTITY, + mib-2 + FROM SNMPv2-SMI -- [RFC2578] + TEXTUAL-CONVENTION + FROM SNMPv2-TC; -- [RFC2579] + +ianaPrinterMIB MODULE-IDENTITY + LAST-UPDATED "200509140000Z" -- September 14, 2005 + + ORGANIZATION "IANA" + CONTACT-INFO "Internet Assigned Numbers Authority + Postal: ICANN + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292 + + Tel: +1 310 823 9358 + E-Mail: iana&iana.org" + + DESCRIPTION "This MIB module defines a set of printing-related + TEXTUAL-CONVENTIONs for use in Printer MIB (RFC 3805), + Finisher MIB (RFC 3806), and other MIBs which need to + specify printing mechanism details. + + Any additions or changes to the contents of this MIB + module require either publication of an RFC, or + Designated Expert Review as defined in RFC 2434, + Guidelines for Writing an IANA Considerations Section + in RFCs. The Designated Expert will be selected by + the IESG Area Director(s) of the Applications Area. + + Copyright (C) The Internet Society (2004). The + initial version of this MIB module was published + in RFC 3805. For full legal notices see the RFC + itself or see: + http://www.ietf.org/copyrights/ianamib.html" + + REVISION "200509140000Z" -- September 14, 2005 + DESCRIPTION "Updates to include missing 'unknown' values + for PrtCoverStatusTC, PrtChannelTypeTC, + PrtAlertGroupTC and removal of comment for + for PrtAlertGroupTC." + + REVISION "200406020000Z" -- June 2, 2004 + DESCRIPTION "Original version, published in coordination + with Printer MIB (RFC 3805)." + ::= { mib-2 109 } + +-- +-- Generic TEXTUAL-CONVENTIONs +-- + +PrtCoverStatusTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtCoverStatus in RFC 1759. + STATUS current + DESCRIPTION + "Values for encoding the state of a particular cover or + access panel on the printer case or enclosure." + SYNTAX INTEGER { + other(1), + unknown(2), + coverOpen(3), + coverClosed(4), + interlockOpen(5), + interlockClosed(6) + + } + +-- +-- General Group TEXTUAL-CONVENTIONs +-- + +PrtGeneralResetTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtGeneralReset in RFC 1759. + STATUS current + DESCRIPTION + "Values for reading and writing the prtGeneralReset object. + + If a device does not have NVRAM, the device shall none the + less respond to a SET with the value resetToNVRAM(5) with a + sort of warm reset that resets the device to implementation- + defined state that is preferably under control of the system + administrator by some means outside the scope of the Printer + MIB specification." + + SYNTAX INTEGER { + notResetting(3), + powerCycleReset(4), -- Cold Start + resetToNVRAM(5), -- Warm Start + resetToFactoryDefaults(6) -- Reset contents of + -- NVRAM to factory + -- defaults + } +-- +-- Channel Group TEXTUAL-CONVENTIONs +-- + +PrtChannelTypeTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtChannelType in RFC 1759. + STATUS current + DESCRIPTION + "This enumeration indicates the type of channel that is + receiving jobs." + SYNTAX INTEGER { + other(1), + unknown(2), + chSerialPort(3), + chParallelPort(4), + chIEEE1284Port(5), + chSCSIPort(6), + chAppleTalkPAP(7), + -- AppleTalk Printer + -- Access Protocol (PAP) + -- + -- prtChannelInformation entry: + + -- + -- Printer Name + -- Keyword: Name + -- Syntax: Name + -- Status: Optional + -- Multiplicity: Single + -- Description: The name of the printer + -- within the AppleTalk naming scope + chLPDServer(8), + -- prtChannelInformation entry: + -- + -- Printer queue name + -- Keyword: Queue + -- Syntax: Name + -- Status: Mandatory + -- Multiplicity: Single + -- Description: queue name as + -- defined in [RFC1179]. + chNetwareRPrinter(9), + -- Novell, Inc. + -- For each entry of this type, the + -- prtChannelInformation must have a pair of + -- keywords. For Netware 3.x channels this must + -- be a (PServer, Printer) pair. For Netware + -- 4.x channels and for IntranetWare channels + -- this must be a (NDSTree, NDSPrinter) pair. + -- + -- prtChannelInformation entries: + + -- Print Server Name + -- Keyword: PServer + -- Syntax: Name + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The Pserver's SAP name + -- + -- Printer Number + -- Keyword: Printer + -- Syntax: Integer + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The printer number + -- + -- NDSTree + -- Keyword: NDSTree + -- Syntax: Name + -- Multiplicity: Single + -- Description: The tree's SAP name + + -- + -- NDS Printer object + -- Keyword: NDSPrinter + -- Syntax: Text (Unicode) + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The fully qualified + -- name of the Printer + -- + -- In the Netware 3.x environment, the + -- client checks the Bindery object + -- representing the named PServer. The + -- client then checks for queues which + -- are associated with the numbered + -- printer. In the 4.x and IntraNetware + -- environment, the client looks up the + -- queues which are associated with the + -- NDS Printer Object in the named Tree. + -- Depending on client access rights to + -- those queues, the client submits jobs + -- to the appropriate queue. + chNetwarePServer(10), + -- Novell,Inc. + -- For each entry of this type, the + -- prtChannelInformation must have a pair + -- of keywords. For Netware 3.x channels + -- this must be a (Server, PServer) pair. + -- For Netware 4.x and IntranetWare + -- channels, this must be a + -- (NDSTree, NDSPServer) pair. + -- + -- prtChannelInformation entries: + -- + -- Server Name + -- Keyword: Server + -- Syntax: Name + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The SAP name of the + -- server for which the PServer is defined. + -- + -- PServer + -- Keyword: PServer + -- Syntax: Name + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The bindery name of + -- the PServer + + -- + -- NDS Tree + -- Keyword: NDSTree + -- Syntax: Name + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The NDS Tree name + -- + -- PServer + -- Keyword: NDSPServer + -- Syntax: Text (Unicode) + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The fully qualified + -- name of the PServer object in the tree. + -- + -- In the 3.x environment, the client + -- checks the bindery object + -- representing the named PServer on the + -- named Server. In the 4.x and + -- IntranetWare environment, + -- the client checks the NDS object + -- representing the named PServer in the + -- named Tree. In either case, the + -- client then checks for all queues + -- associated with the Pserver object. + -- Depending on client access rights + -- to those queues, the client submits + -- jobs to the appropriate queue. + chPort9100(11), + -- DEPRECATED + -- (see chPortTCP - 37; chBidirPortTCP - 38) + chAppSocket(12), + -- A bi-directional, LPD-like, protocol using + -- 9101 for control and 9100 for data. + -- Adobe Systems, Inc. + chFTP(13), -- [RFC959] + chTFTP(14), -- [RFC1350] + chDLCLLCPort(15), + chIBM3270(16), -- IBM Coax + chIBM5250(17), -- IBM Twinax + chFax(18), + chIEEE1394(19), + chTransport1(20), + -- TCP port 35, for reserved TCP port list see + -- [RFC3232]. This RFC should also be + -- referenced for other channel + -- enumerations utilizing TCP port + + -- numbers 0 through 1024. + chCPAP(21), -- TCP port 170 + -- Digital Equipment Corp. + chDCERemoteProcCall(22), -- OSF + -- DEPRECATED + chONCRemoteProcCall(23), -- SUN Microsystems + -- DEPRECATED + chOLE(24), -- Microsoft + -- DEPRECATED + chNamedPipe(25), + chPCPrint(26), -- Banyan + chServerMessageBlock(27), + -- File/Print sharing protocol used by + -- various network operating systems + -- from IBM 3Com, Microsoft and others + -- + -- prtChannelInformation entry: + -- + -- Service Name + -- Keyword: Name + -- Syntax: Name + -- Status: Optional + -- Multiplicity: Single + -- Description: The service name of + -- the printer + chDPMF(28), -- IBM Infoprint + chDLLAPI(29), -- Microsoft + -- DEPRECATED + chVxDAPI(30), -- Microsoft + -- DEPRECATED + chSystemObjectManager(31), -- IBM + chDECLAT(32), + -- Digital Equipment Corp. + -- + -- prtChannelInformation entries: + -- + -- Port Name + -- Keyword: Port + -- Syntax: Name + -- Status: Conditionally + -- Mandatory + -- (see note below) + -- Multiplicity: Single + -- Description: LAT port name + -- + -- Service Name + -- Keyword: Service + -- Syntax: Name + + -- Status: Conditionally + -- Mandatory + -- Multiplicity: Single + -- Description: LAT service name + -- + -- The LAT channel may be + -- identified by either a port or + -- service, so either a + -- Port or Service entry must be + -- specified, but not both. + chNPAP(33), + chUSB(34), -- Not in RFC 1759 + -- Universal Serial Bus + chIRDA(35), -- Not in RFC 1759 + -- Infrared Data Assoc. Prot. + chPrintXChange(36), -- Not in RFC 1759 + -- PrintXChange Protocol + chPortTCP(37), -- Not in RFC 1759 + -- A unidirectional "raw" TCP + -- channel that uses an administratively + -- assigned TCP port address. + -- + -- prtChannelInformation entry: + -- + -- Port Number + -- Keyword: Port + -- Syntax: decimal number + -- Status: Mandatory + -- Multiplicity: Single + -- Description: TCP port number + chBidirPortTCP(38), -- Not in RFC 1759 + -- A bi-directional version of chPortTCP + -- + -- prtChannelInformation entries: + -- (See chPortTCP) + chUNPP(39), -- Not in RFC 1759 + -- Universal Network Printing + -- Protocol(UNPP). A bi-directional, + -- multiport network printing + -- application protocol available on + -- multiple transport protocols. + -- Underscore, Inc. + -- Contact: info&underscore.com + chAppleTalkADSP(40), -- Not in RFC 1759 + -- AppleTalk Data Stream Protocol. + -- ADSP is part of the AppleTalk + -- suite of protocols. + -- It is a symmetric, connection- + + -- oriented protocol that makes + -- possible the establishment + -- and maintenance of full-duplex + -- streams of data bytes between + -- two sockets in an AppleTalk + -- internet. + -- See [APPLEMAC]. + chPortSPX(41), -- Not in RFC 1759 + -- Sequenced Packet Exchange (SPX) + -- socket. + -- Novell, Inc. Similar to TCP, a + -- bi-directional data pipe using + -- Novell SPX as a transport. + -- + -- prtChannelInformation entries: + -- + -- Network Number + -- Keyword: Net + -- Syntax: HexString + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The network number + -- + -- Node Number + -- Keyword: Node + -- Syntax: HexString + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The node number + -- + -- Socket Number + -- Keyword: Socket + -- Syntax: HexString + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The SPX socket number + -- + -- There must be exactly one "Net" and + -- one "Node" and one "Socket" entry. A + -- HexString is a binary value + -- represented as a string of + -- ASCII characters using hexadecimal + -- notation. + chPortHTTP(42), -- Not in RFC 1759 + -- Hypertext Transfer Protocol. See [RFC1945] + -- and [RFC2616]. + chNDPS(43), -- Not in RFC 1759 + -- Novell, Inc. + + -- + -- prtChannelInformation entry: + -- + -- Printer Agent Name + -- Keyword: PA + -- Syntax: Name + -- Status: Mandatory + -- Multiplicity: Single + -- Description: The NDPS Printer + -- Agent Name + chIPP(44), -- Not in RFC 1759 + -- Internet Printing Protocol (IPP), + -- (IPP/1.1 - see [RFC2910] and [RFC2911]) + -- also applies to all future versions of IPP. + -- + -- IPP Printer URI + -- Keyword: URI + -- Syntax: URI (Unicode UTF-8 per + -- [RFC2396]) + -- Status: Mandatory + -- Multiplicity: Single + -- Default: not applicable + -- Description: URI of this IPP Printer + -- within Internet naming scope. Unicode + -- UTF-8 [RFC3629] string with + -- hexadecimal escapes for any non-ASCII + -- characters (per [RFC2396]). + -- Conformance: An IPP Printer shall list all + -- IPP URI it supports (one per IPP Channel + -- entry). If a URI contains the 'http:' + -- scheme it must have an explicit port. + -- See: [RFC3629], [RFC2396], [RFC2910], + -- [RFC2911]. + -- + -- IPP Printer Client Authentication + -- Keyword: Auth + -- Syntax: Keyword + -- Status: Optional + -- Multiplicity: Single + -- Default: 'none' + -- Description: A client authentication + -- mechanism supported for this IPP Printer + -- URI: + -- 'none' + -- no client authentication mechanism + -- 'requesting-user-name' + -- authenticated user in 'requesting- + -- user-name' + + -- 'basic' + -- authenticated user via HTTP Basic + -- mechanism + -- 'digest' + -- authenticated user via HTTP Digest + -- mechanism + -- 'certificate' + -- authenticated user via certificate + -- mechanism + -- Conformance: An IPP Printer should list + -- all IPP client authentication mechanisms + -- it supports (one per IPP Channel entry). + -- See: [RFC2911] and [RFC2910]. + -- + -- IPP Printer Security + -- Keyword: Security + -- Syntax: Keyword + -- Status: Optional + -- Multiplicity: Single + -- Default: 'none' + -- Description: A security mechanism + -- supported for this IPP Printer URI: + -- 'none' + -- no security mechanism + -- 'ssl3' + -- SSL3 secure communications channel + -- protocol + -- 'tls' + -- TLS secure communications channel + -- protocol + -- Conformance: An IPP Printer should list + -- all IPP security mechanisms it supports + -- (one per IPP Channel entry). + -- See: [RFC2246], [RFC2911]. + -- + -- IPP Printer Protocol Version + -- Keyword: Version + -- Syntax: Keyword + -- Status: Optional + -- Multiplicity: Multiple + -- Default: '1.1' + -- Description: All of the IPP protocol + -- versions (major.minor) supported for + -- this IPP Printer URI: + -- '1.0' + -- IPP/1.0 conforming Printer + -- '1.1' + -- IPP/1.1 conforming Printer + + -- Conformance: An IPP Printer should list + -- all IPP versions it supports (all listed + -- in each IPP Channel entry). An IPP + -- Client should select the highest + -- numbered version the IPP Client supports + -- for use in all IPP Requests (for optimum + -- interworking). + -- See: [RFC2911]. + chSMTP(45) + -- Print Job submission via Simple Mail + -- Transfer Protocol (SMTP) - see [RFC2821] + -- + -- prtChannelInformation entry: + -- + -- Keyword: Mailto + -- Syntax: Name + -- Status: Mandatory + -- Multiplicity: Single + -- Default: not applicable + -- Description: The SMTP URL of the printer. +} + +-- +-- Interpreter Group TEXTUAL-CONVENTIONs +-- + +PrtInterpreterLangFamilyTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtInterpreterLangFamily in RFC 1759. + STATUS current + DESCRIPTION + "This enumeration indicates the type of interpreter that is + receiving jobs." + SYNTAX INTEGER { + other(1), + unknown(2), -- Not in RFC 1759 + langPCL(3), -- PCL. Starting with PCL version 5, + -- HP-GL/2 is included as part of the + -- PCL language. + -- PCL and HP-GL/2 are registered + -- trademarks of Hewlett-Packard + -- Company. + langHPGL(4), -- Hewlett-Packard Graphics Language. + -- HP-GL is a registered trademark of + -- Hewlett-Packard Company. + langPJL(5), -- Peripheral Job Language. Appears in + -- the data stream between data intended + -- for a page description language. + -- Hewlett-Packard Co. + + langPS(6), -- PostScript (tm) Language + -- Postscript - a trademark of Adobe + -- Systems Incorporated which may be + -- registered in certain jurisdictions + langIPDS(7), -- Intelligent Printer Data Stream + -- Bi-directional print data stream for + -- documents consisting of data objects + -- (text, image, graphics, bar codes), + -- resources (fonts, overlays) and page, + -- form and finishing instructions. + -- Facilitates system level device + -- control, document tracking and error + -- recovery throughout the print + -- process. + -- IBM Corporation. + langPPDS(8), -- IBM Personal Printer Data Stream. + -- Originally called IBM ASCII, the name + -- was changed to PPDS when the Laser + -- Printer was introduced in 1989. + -- Lexmark International, Inc. + langEscapeP(9), -- Epson Corp. + langEpson(10), + langDDIF(11), -- Digital Document Interchange Format + -- Digital Equipment Corp., Maynard MA + langInterpress(12), + -- Xerox Corp. + langISO6429(13), -- ISO 6429. Control functions for + -- Coded Character Sets (has ASCII + -- control characters, plus additional + -- controls for + -- character imaging devices.) + langLineData(14), -- line-data: Lines of data as + -- separate ASCII or EBCDIC records + -- and containing no control functions + -- (no CR, LF, HT, FF, etc.) + -- For use with traditional line + -- printers. May use CR and/or LF to + -- delimit lines, instead of records. + -- See ISO 10175 Document Printing + -- Application (DPA) [ISO10175]. + langMODCA(15), -- Mixed Object Document Content + -- Architecture + -- Definitions that allow the + -- composition, interchange, and + -- presentation of final form + -- documents as a collection of data + -- objects (text, image, graphics, bar + -- codes), resources (fonts, overlays) + + -- and page, form and finishing + -- instructions. + -- IBM Corporation. + langREGIS(16), -- Remote Graphics Instruction Set, + -- Digital Equipment Corp., Maynard MA + langSCS(17), -- SNA Character String + -- Bi-directional print data stream for + -- SNA LU-1 mode of communication. + -- IBM + langSPDL(18), -- ISO 10180 Standard Page Description + -- Language + -- ISO Standard + langTEK4014(19), -- Tektronix Corp. + langPDS(20), + langIGP(21), -- Printronix Corp. + langCodeV(22), -- Magnum Code-V, Image and printer + -- control language used to control + -- impact/dot-matrix printers. + -- QMS, Inc., Mobile AL + langDSCDSE(23), -- DSC-DSE: Data Stream Compatible and + -- Emulation Bi-directional print data + -- stream for non-SNA (DSC) and SNA LU-3 + -- 3270 controller (DSE) communications + -- IBM + langWPS(24), -- Windows Printing System, Resource + -- based command/data stream used by + -- Microsoft At Work Peripherals. + -- Developed by the Microsoft + -- Corporation. + langLN03(25), -- Early DEC-PPL3, Digital Equipment + -- Corp. + langCCITT(26), + langQUIC(27), -- QUIC (Quality Information Code), Page + -- Description Language for laser + -- printers. Included graphics, printer + -- control capability and emulation of + -- other well-known printer. + -- QMS, Inc. + langCPAP(28), -- Common Printer Access Protocol + -- Digital Equipment Corp. + langDecPPL(29), -- Digital ANSI-Compliant Printing + -- Protocol + -- (DEC-PPL) + -- Digital Equipment Corp. + langSimpleText(30), + -- simple-text: character coded data, + -- including NUL, CR , LF, HT, and FF + -- control characters. See ISO 10175 + + -- Document Printing Application (DPA) + -- [ISO10175]. + langNPAP(31), -- Network Printer Alliance Protocol + -- (NPAP). This protocol has been + -- superseded by the IEEE 1284.1 TIPSI + -- Std (ref. LangTIPSI(49)). + langDOC(32), -- Document Option Commands, Appears in + -- the data stream between data + -- intended for a page description. + -- QMS, Inc. + langimPress(33), -- imPRESS, Page description language + -- originally developed for the + -- ImageServer product line. A binary + -- language providing representations + -- of text, simple graphics, and some + -- large forms (simple + -- bit-map and CCITT group 3/4 + -- encoded).The + -- language was intended to be sent over + -- an 8-bit channel and supported early + -- document preparation languages (e.g., + -- TeX and TROFF). + -- QMS, Inc. + langPinwriter(34), + -- 24 wire dot matrix printer for + -- USA, Europe, and Asia except + -- Japan. + -- More widely used in Germany, and + -- some Asian countries than in US. + -- NEC + langNPDL(35), -- Page printer for Japanese market. + -- NEC + langNEC201PL(36), -- Serial printer language used in + -- the Japanese market. + -- NEC + langAutomatic(37), + -- Automatic PDL sensing. Automatic + -- sensing of the interpreter + -- language family by the printer + -- examining the document content. + -- Which actual interpreter language + -- families are sensed depends on + -- the printer implementation. + langPages(38), -- Page printer Advanced Graphic + -- Escape Set + -- IBM Japan + langLIPS(39), -- LBP Image Processing System + langTIFF(40), -- Tagged Image File Format (Aldus) + + langDiagnostic(41), + -- A hex dump of the input to the + -- interpreter + langPSPrinter(42), + -- The PostScript Language used for + -- control (with any PDLs) + -- Adobe Systems Incorporated + langCaPSL(43), -- Canon Print Systems Language + langEXCL(44), -- Extended Command Language + -- Talaris Systems Inc. + langLCDS(45), -- Line Conditioned Data Stream + -- Xerox Corporation + langXES(46), -- Xerox Escape Sequences + -- Xerox Corporation + langPCLXL(47), -- Not in RFC 1759 + -- Printer Control Language. Extended + -- language features for printing, and + -- printer control. + -- Hewlett-Packard Co. + langART(48), -- Not in RFC 1759 + -- Advanced Rendering Tools (ART). + -- Page Description language + -- originally developed for the Laser + -- Press printers. + -- Technical reference manual: "ART IV + -- Reference Manual", No F33M. + -- Fuji Xerox Co., Ltd. + langTIPSI(49), -- Not in RFC 1759 + -- Transport Independent Printer + -- System Interface (ref. IEEE Std. + -- 1284.1) + langPrescribe(50), -- Not in RFC 1759 + -- Page description and printer + -- control language. It can be + -- described with ordinary ASCII + -- Technical reference manual: + -- "PRESCRIBE II Programming Manual" + langLinePrinter(51), -- Not in RFC 1759 + -- A simple-text character stream which + -- supports the control codes LF, VT, + -- FF, and plus Centronics or + -- Dataproducts Vertical Format Unit + -- (VFU) language is commonly used on + -- many older model line and matrix + -- printers. + langIDP(52), -- Not in RFC 1759 + -- Imaging Device Protocol + -- Apple Computer. + + langXJCL(53), -- Not in RFC 1759 + -- Xerox Job Control Language (JCL). + -- A Job Control language originally + -- developed for the LaserPress printers + -- and is capable of switching PDLs. + -- Technical reference manual: + -- "ART IV Reference Manual", No F33M. + -- Fuji Xerox Co., Ltd. + langPDF(54), -- Not in RFC 1759 + -- Adobe Portable Document Format + -- Adobe Systems, Inc. + langRPDL(55), -- Not in RFC 1759 + -- Ricoh Page Description Language for + -- printers. + -- Technical manual "RPDL command + -- reference" No.307029 + -- RICOH, Co. LTD + langIntermecIPL(56), -- Not in RFC 1759 + -- Intermec Printer Language for label + -- printers. + -- Technical Manual: "IPL Programmers + -- Reference Manual" + -- Intermec Corporation + langUBIFingerprint(57), -- Not in RFC 1759 + -- An intelligent basic-like programming + -- language for label printers. + -- Reference Manual: "UBI Fingerprint + -- 7.1", No. 1-960434-00 + -- United Barcode Industries + langUBIDirectProtocol(58), -- Not in RFC 1759 + -- An intelligent control language for + -- label printers. + -- Programmers guide: " UBI Direct + -- Protocol", No. 1-960419-00 + -- United Barcode Industries + langFujitsu(59), -- Not in RFC 1759 + -- Fujitsu Printer Language + -- Reference Manual: + -- "FM Printer Sequence" No. 80HP-0770 + -- FUJITSU LIMITED + langCGM(60), -- Not in RFC 1759 + -- Computer Graphics Metafile + -- MIME type 'image/cgm' + langJPEG(61), -- Not in RFC 1759 + -- Joint Photographic Experts Group + -- MIME type 'image/jpeg' + langCALS1(62), -- Not in RFC 1759 + -- US DOD CALS1 (see MIL-STD-1840) + + -- MIME type 'application/cals-1840' + langCALS2(63), -- Not in RFC 1759 + -- US DOD CALS2 (see MIL-STD-1840) + -- MIME type 'application/cals-1840' + langNIRS(64), -- Not in RFC 1759 + -- US DOD NIRS (see MIL-STD-1840) + -- MIME type 'application/cals-1840' + langC4(65) -- Not in RFC 1759 + -- US DOD C4 (see MIL-STD-1840) + -- MIME type 'application/cals-1840' +} + +-- +-- Input/Output Group TEXTUAL-CONVENTIONs +-- + +PrtInputTypeTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtInputType in RFC 1759. + STATUS current + DESCRIPTION + "The type of technology (discriminated primarily according to + feeder mechanism type) employed by a specific component or + components." + SYNTAX INTEGER { + other(1), + unknown(2), + sheetFeedAutoRemovableTray(3), + sheetFeedAutoNonRemovableTray(4), + sheetFeedManual(5), + continuousRoll(6), + continuousFanFold(7) + } + +PrtOutputTypeTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtOutputType in RFC 1759. + STATUS current + DESCRIPTION + "The Type of technology supported by this output subunit." + SYNTAX INTEGER { + other(1), + unknown(2), + removableBin(3), + unRemovableBin(4), + continuousRollDevice(5), + mailBox(6), + continuousFanFold(7) + } + +-- +-- Marker Group TEXTUAL-CONVENTIONs +-- + +PrtMarkerMarkTechTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtMarkerMarkTech in RFC 1759. + STATUS current + DESCRIPTION + "The type of marking technology used for this marking + subunit." + SYNTAX INTEGER { + other(1), + unknown(2), + electrophotographicLED(3), + electrophotographicLaser(4), + electrophotographicOther(5), + impactMovingHeadDotMatrix9pin(6), + impactMovingHeadDotMatrix24pin(7), + impactMovingHeadDotMatrixOther(8), + impactMovingHeadFullyFormed(9), + impactBand(10), + impactOther(11), + inkjetAqueous(12), + inkjetSolid(13), + inkjetOther(14), + pen(15), + thermalTransfer(16), + thermalSensitive(17), + thermalDiffusion(18), + thermalOther(19), + electroerosion(20), + electrostatic(21), + photographicMicrofiche(22), + photographicImagesetter(23), + photographicOther(24), + ionDeposition(25), + eBeam(26), + typesetter(27) + } + +PrtMarkerSuppliesTypeTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtMarkerSuppliesType in RFC 1759. + STATUS current + DESCRIPTION + "The type of this supply." + SYNTAX INTEGER { + other(1), + unknown(2), + + -- Values for Printer MIB + toner(3), + wasteToner(4), + ink(5), + inkCartridge(6), + inkRibbon(7), + wasteInk(8), + opc(9), -- photo conductor + developer(10), + fuserOil(11), + solidWax(12), + ribbonWax(13), + wasteWax(14), + fuser(15), -- Not in RFC 1759 + coronaWire(16), -- Not in RFC 1759 + fuserOilWick(17), -- Not in RFC 1759 + cleanerUnit(18), -- Not in RFC 1759 + fuserCleaningPad(19), -- Not in RFC 1759 + transferUnit(20), -- Not in RFC 1759 + tonerCartridge(21), -- Not in RFC 1759 + fuserOiler(22), -- Not in RFC 1759 + -- End of values for Printer MIB + -- Values for Finisher MIB + water(23), -- Not in RFC 1759 + wasteWater(24), -- Not in RFC 1759 + glueWaterAdditive(25),-- Not in RFC 1759 + wastePaper(26), -- Not in RFC 1759 + bindingSupply(27), -- Not in RFC 1759 + bandingSupply(28), -- Not in RFC 1759 + stitchingWire(29), -- Not in RFC 1759 + shrinkWrap(30), -- Not in RFC 1759 + paperWrap(31), -- Not in RFC 1759 + staples(32), -- Not in RFC 1759 + inserts(33), -- Not in RFC 1759 + covers(34) -- Not in RFC 1759 + -- End of values for Finisher MIB + } + +-- +-- Media Path TEXTUAL-CONVENTIONs +-- + +PrtMediaPathTypeTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtMediaPathType in RFC 1759. + STATUS current + DESCRIPTION + "The type of the media path for this media path." + SYNTAX INTEGER { + + other(1), + unknown(2), + longEdgeBindingDuplex(3), + shortEdgeBindingDuplex(4), + simplex(5) + } + +-- +-- Console Group TEXTUAL-CONVENTIONs +-- + +PrtConsoleColorTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtConsoleColor in RFC 1759. + STATUS current + DESCRIPTION + "The color of this light." + SYNTAX INTEGER { + other(1), + unknown(2), + white(3), + red(4), + green(5), + blue(6), + cyan(7), + magenta(8), + yellow(9), + orange(10) -- Not in RFC 1759 + } + +PrtConsoleDisableTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtConsoleDisable in RFC 1759. + STATUS current + DESCRIPTION + "This value indicates whether or not input is accepted from + the operator console. A value of 'enabled' indicates that + input is accepted from the console, and a value of 'disabled' + indicates that input is not accepted from the console. " + SYNTAX INTEGER { + enabled(3), + disabled(4) + } + +-- +-- Alert Group TEXTUAL-CONVENTIONs +-- + +PrtAlertTrainingLevelTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtAlertTrainingLevel in RFC 1759. + + STATUS current + DESCRIPTION + "The level of training required to handle this alert, if + human intervention is required. The noInterventionRequired + value should be used if the event does not require any human + intervention. The training level is an enumeration that is + determined and assigned by the printer manufacturer based on + the information or training required to handle this alert. + The printer will break alerts into these different training + levels. It is the responsibility of a management application + in the system to determine how a particular alert is handled + and how and to whom that alert is routed. The following are + the four training levels of alerts: + + Field Service - Alerts that typically require advanced + training and technical knowledge of the printer and its + subunits. An example of a technical person would be a + manufacturer's Field Service representative, or other + person formally trained by the manufacturer or similar + representative. + Trained - Alerts that require an intermediate or moderate + knowledge of the printer and its subunits. A typical + example of such an alert is replacing a toner cartridge. + Untrained - Alerts that can be fixed without prior + training either because the action to correct the alert + is obvious or the printer can help the untrained person + fix the problem. A typical example of such an alert is + reloading paper trays or emptying output bins on a low + end printer. + Management - Alerts that have to do with overall operation + of and configuration of the printer. Examples of such + management events are configuration change of subunits." + SYNTAX INTEGER { + other(1), + unknown(2), + untrained(3), + trained(4), + fieldService(5), + management(6), + noInterventionRequired(7) -- Not in RFC 1759 + } + +PrtAlertGroupTC ::= TEXTUAL-CONVENTION + -- Values in the range 1 to 29 must not be IANA-assigned without + -- re-publishing Printer MIB. + -- Values of 30 and greater are for use in MIBs that augment + -- the Printer MIB, such as the Finisher MIB. + -- This TC extracted from prtAlertGroup in RFC 1759. + + STATUS current + DESCRIPTION + "The type of subunit within the printer model that this alert + is related. Input, output, and markers are examples of + printer model groups, i.e., examples of types of subunits. + Wherever possible, the enumerations match the sub-identifier + that identifies the relevant table in the Printer MIB. + + NOTE: Alert type codes have been added for the Host Resources + MIB storage table and device table. These additional types + are for situations in which the printer's storage and device + objects must generate alerts (and possibly traps for critical + alerts)." + SYNTAX INTEGER { + other(1), + unknown(2), + -- Values for Host Resources MIB + hostResourcesMIBStorageTable(3), + hostResourcesMIBDeviceTable(4), + -- Values for Printer MIB + generalPrinter(5), + cover(6), + localization(7), + input(8), + output(9), + marker(10), + markerSupplies(11), + markerColorant(12), + mediaPath(13), + channel(14), + interpreter(15), + consoleDisplayBuffer(16), + consoleLights(17), + alert(18), -- Not in RFC 1759 + -- Values (5) to (29) reserved for Printer MIB + -- Values for Finisher MIB + finDevice(30), -- Not in RFC 1759 + finSupply(31), -- Not in RFC 1759 + finSupplyMediaInput(32), -- Not in RFC 1759 + finAttribute(33) -- Not in RFC 1759 + -- Values (30) to (39) reserved for Finisher MIB + } + +PrtAlertCodeTC ::= TEXTUAL-CONVENTION + -- This TC was extracted from prtAlertCode in RFC 1759. + STATUS current + DESCRIPTION + "The code that describes the type of alert for this entry in + + the table. Binary change event alerts describe states of the + subunit while unary change event alerts describe a single + event. The same alert code can be used for a binary change + event or a unary change event, depending on implementation. + Also, the same alert code can be used to indicate a critical + or non-critical (warning) alert, depending on implementation. + The value of prtAlertSeverityLevel specifies binary vs. unary + and critical vs. non-critical for each event for the + implementation. + + While there are some specific codes for many subunits, the + generic codes should be used for most subunit alerts. The + network management station can then query the subunit + specified by prtAlertGroup to determine further subunit + status and other subunit information. + + An agent shall not add two entries to the alert table for the + same event, one containing a generic event code and the other + containing a specific event code; the agent shall add only + one entry in the alert table for each event; either generic + (preferred) or specific, not both. + + Implementation of the unary change event + alertRemovalOfBinaryChangeEntry(1801) is optional. When + implemented, this alert code shall indicate to network + management stations that the trailing edge of a binary change + event has occurred and the corresponding alert entry has been + removed from the alert table. As with all events, the + alertRemovalOfBinaryChangeEntry(1801) alert shall be placed + at the end of the alert table. Such an alert table entry + shall specify the following information: + + prtAlertSeverityLevel warningUnaryChangeEvent(4) + prtAlertTrainingLevel noInterventionRequired(7) + prtAlertGroup alert(18) + prtAlertGroupIndex the index of the row in the + alert table of the binary + change event that this event + has removed. + prtAlertLocation unknown (-2) + prtAlertCode alertRemovalOfBinaryChangeEntry(1801) + prtAlertDescription + prtAlertTime the value of sysUpTime at + the time of the removal of the + binary change event from the + alert table. + + Optionally, the agent may generate a trap coincident with + + removing the binary change event and placing the unary change + event alertRemovalOfBinaryChangeEntry(1801) in the alert + table. For such a trap, the prtAlertIndex sent with the above + trap parameters shall be the index of the + alertRemovalOfBinaryChangeEvent row that was added to the + prtAlertTable; not the index of the row that was removed from + the prtAlertTable." + SYNTAX INTEGER { + other(1), + -- an event that is not represented + -- by one of the alert codes + -- specified below. + unknown(2), + -- The following generic codes are common to + -- multiple groups. The NMS may examine the + -- prtAlertGroup object to determine what group + -- to query for further information. + coverOpen(3), + coverClosed(4), + interlockOpen(5), + interlockClosed(6), + configurationChange(7), + jam(8), + subunitMissing(9), -- Not in RFC 1759 + -- The subunit tray, bin, etc. + -- has been removed. + subunitLifeAlmostOver(10), -- Not in RFC 1759 + subunitLifeOver(11), -- Not in RFC 1759 + subunitAlmostEmpty(12), -- Not in RFC 1759 + subunitEmpty(13), -- Not in RFC 1759 + subunitAlmostFull(14), -- Not in RFC 1759 + subunitFull(15), -- Not in RFC 1759 + subunitNearLimit(16), -- Not in RFC 1759 + subunitAtLimit(17), -- Not in RFC 1759 + subunitOpened(18), -- Not in RFC 1759 + subunitClosed(19), -- Not in RFC 1759 + subunitTurnedOn(20), -- Not in RFC 1759 + subunitTurnedOff(21), -- Not in RFC 1759 + subunitOffline(22), -- Not in RFC 1759 + subunitPowerSaver(23), -- Not in RFC 1759 + subunitWarmingUp(24), -- Not in RFC 1759 + subunitAdded(25), -- Not in RFC 1759 + subunitRemoved(26), -- Not in RFC 1759 + subunitResourceAdded(27), -- Not in RFC 1759 + subunitResourceRemoved(28), -- Not in RFC 1759 + subunitRecoverableFailure(29), + -- Not in RFC 1759 + subunitUnrecoverableFailure(30), + + -- Not in RFC 1759 + subunitRecoverableStorageError(31), + -- Not in RFC 1759 + subunitUnrecoverableStorageError(32), + -- Not in RFC 1759 + subunitMotorFailure(33), -- Not in RFC 1759 + subunitMemoryExhausted(34), -- Not in RFC 1759 + subunitUnderTemperature(35), -- Not in RFC 1759 + subunitOverTemperature(36), -- Not in RFC 1759 + subunitTimingFailure(37), -- Not in RFC 1759 + subunitThermistorFailure(38), -- Not in RFC 1759 + + -- General Printer group + doorOpen(501), -- DEPRECATED + -- Use coverOpened(3) + doorClosed(502), -- DEPRECATED + -- Use coverClosed(4) + powerUp(503), + powerDown(504), + printerNMSReset(505), -- Not in RFC 1759 + -- The printer has been reset by some + -- network management station(NMS) + -- writing into 'prtGeneralReset'. + printerManualReset(506), -- Not in RFC 1759 + -- The printer has been reset manually. + printerReadyToPrint(507), -- Not in RFC 1759 + -- The printer is ready to print. (i.e., + -- not warming up, not in power save + -- state, not adjusting print quality, + -- etc.). + + -- Input Group + inputMediaTrayMissing(801), + inputMediaSizeChange(802), + inputMediaWeightChange(803), + inputMediaTypeChange(804), + inputMediaColorChange(805), + inputMediaFormPartsChange(806), + inputMediaSupplyLow(807), + inputMediaSupplyEmpty(808), + inputMediaChangeRequest(809), -- Not in RFC 1759 + -- An interpreter has detected that a + -- different medium is need in this input + -- tray subunit. The prtAlertDescription may + -- be used to convey a human readable + -- description of the medium required to + -- satisfy the request. + inputManualInputRequest(810), -- Not in RFC 1759 + + -- An interpreter has detected that manual + -- input is required in this subunit. The + -- prtAlertDescription may be used to convey + -- a human readable description of the medium + -- required to satisfy the request. + inputTrayPositionFailure(811), -- Not in RFC 1759 + -- The input tray failed to position correctly. + inputTrayElevationFailure(812), + -- Not in RFC 1759 + inputCannotFeedSizeSelected(813), + -- Not in RFC 1759 + -- Output Group + outputMediaTrayMissing(901), + outputMediaTrayAlmostFull(902), + outputMediaTrayFull(903), + outputMailboxSelectFailure(904), + -- Not in RFC 1759 + -- Marker group + markerFuserUnderTemperature(1001), + markerFuserOverTemperature(1002), + markerFuserTimingFailure(1003), + -- Not in RFC 1759 + markerFuserThermistorFailure(1004), + -- Not in RFC 1759 + markerAdjustingPrintQuality(1005), + -- Not in RFC 1759 + -- Marker Supplies group + markerTonerEmpty(1101), + markerInkEmpty(1102), + markerPrintRibbonEmpty(1103), + markerTonerAlmostEmpty(1104), + markerInkAlmostEmpty(1105), + markerPrintRibbonAlmostEmpty(1106), + markerWasteTonerReceptacleAlmostFull(1107), + markerWasteInkReceptacleAlmostFull(1108), + markerWasteTonerReceptacleFull(1109), + markerWasteInkReceptacleFull(1110), + markerOpcLifeAlmostOver(1111), + markerOpcLifeOver(1112), + markerDeveloperAlmostEmpty(1113), + markerDeveloperEmpty(1114), + markerTonerCartridgeMissing(1115), + -- Not in RFC 1759 + -- Media Path Device Group + mediaPathMediaTrayMissing(1301), + mediaPathMediaTrayAlmostFull(1302), + mediaPathMediaTrayFull(1303), + mediaPathCannotDuplexMediaSelected(1304), + + -- Not in RFC 1759 + -- Interpreter Group + interpreterMemoryIncrease(1501), + interpreterMemoryDecrease(1502), + interpreterCartridgeAdded(1503), + interpreterCartridgeDeleted(1504), + interpreterResourceAdded(1505), + interpreterResourceDeleted(1506), + interpreterResourceUnavailable(1507), + interpreterComplexPageEncountered(1509), + -- Not in RFC 1759 + -- The interpreter has encountered a page + -- that is too complex for the resources that + -- are available. + -- Alert Group + alertRemovalOfBinaryChangeEntry(1801) + -- Not in RFC 1759 + -- A binary change event entry has been + -- removed from the alert table. This unary + -- change alert table entry is added to the + -- end of the alert table. + } +END + + diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-RTPROTO-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-RTPROTO-MIB new file mode 100644 index 00000000..952c84e2 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANA-RTPROTO-MIB @@ -0,0 +1,92 @@ + +IANA-RTPROTO-MIB DEFINITIONS ::= BEGIN + +IMPORTS + MODULE-IDENTITY, mib-2 FROM SNMPv2-SMI + TEXTUAL-CONVENTION FROM SNMPv2-TC; + +ianaRtProtoMIB MODULE-IDENTITY + LAST-UPDATED "200009260000Z" -- September 26, 2000 + ORGANIZATION "IANA" + CONTACT-INFO + " Internet Assigned Numbers Authority + Internet Corporation for Assigned Names and Numbers + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292-6601 + + Phone: +1 310 823 9358 + EMail: iana&iana.org" + DESCRIPTION + "This MIB module defines the IANAipRouteProtocol and + IANAipMRouteProtocol textual conventions for use in MIBs + which need to identify unicast or multicast routing + mechanisms. + + Any additions or changes to the contents of this MIB module + require either publication of an RFC, or Designated Expert + Review as defined in RFC 2434, Guidelines for Writing an + IANA Considerations Section in RFCs. The Designated Expert + will be selected by the IESG Area Director(s) of the Routing + Area." + + REVISION "200009260000Z" -- September 26, 2000 + DESCRIPTION "Original version, published in coordination + with RFC 2932." + + ::= { mib-2 84 } + +IANAipRouteProtocol ::= TEXTUAL-CONVENTION + STATUS current + + DESCRIPTION + "A mechanism for learning routes. Inclusion of values for + routing protocols is not intended to imply that those + protocols need be supported." + SYNTAX INTEGER { + other (1), -- not specified + local (2), -- local interface + netmgmt (3), -- static route + icmp (4), -- result of ICMP Redirect + + -- the following are all dynamic + -- routing protocols + + egp (5), -- Exterior Gateway Protocol + ggp (6), -- Gateway-Gateway Protocol + hello (7), -- FuzzBall HelloSpeak + rip (8), -- Berkeley RIP or RIP-II + isIs (9), -- Dual IS-IS + esIs (10), -- ISO 9542 + ciscoIgrp (11), -- Cisco IGRP + bbnSpfIgp (12), -- BBN SPF IGP + ospf (13), -- Open Shortest Path First + bgp (14), -- Border Gateway Protocol + idpr (15), -- InterDomain Policy Routing + ciscoEigrp (16), -- Cisco EIGRP + dvmrp (17) -- DVMRP + } + +IANAipMRouteProtocol ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The multicast routing protocol. Inclusion of values for + multicast routing protocols is not intended to imply that + those protocols need be supported." + SYNTAX INTEGER { + other(1), -- none of the following + local(2), -- e.g., manually configured + netmgmt(3), -- set via net.mgmt protocol + dvmrp(4), + mospf(5), + pimSparseDense(6), -- PIMv1, both DM and SM + cbt(7), + pimSparseMode(8), -- PIM-SM + pimDenseMode(9), -- PIM-DM + igmpOnly(10), + bgmp(11), + msdp(12) + } + +END + + diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA/IANATn3270eTC-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANATn3270eTC-MIB new file mode 100644 index 00000000..e774ac00 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANATn3270eTC-MIB @@ -0,0 +1,306 @@ + + IANATn3270eTC-MIB DEFINITIONS ::= BEGIN + + IMPORTS + MODULE-IDENTITY, mib-2 + FROM SNMPv2-SMI + TEXTUAL-CONVENTION + FROM SNMPv2-TC; + + ianaTn3270eTcMib MODULE-IDENTITY + LAST-UPDATED "200005100000Z" -- May 10, 2000 + ORGANIZATION "IANA" + CONTACT-INFO + "Internet Assigned Numbers Authority + + Postal: ICANN + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292 + + Tel: +1 310 823 9358 x20 + E-Mail: iana&iana.org" + DESCRIPTION + "This module defines a set of textual conventions + for use by the TN3270E-MIB and the TN3270E-RT-MIB. + + Any additions or changes to the contents of this + MIB module must first be discussed on the tn3270e + working group list at: tn3270e&list.nih.gov + and approved by one of the following TN3270E + working group contacts: + + Ed Bailey (co-chair) - elbailey&us.ibm.com + Michael Boe (co-chair) - mboe&cisco.com + Ken White - kennethw&vnet.ibm.com + Robert Moore - remoore&us.ibm.com + + The above list of contacts can be altered with + the approval of the two co-chairs. + + The Textual Conventions defined within this MIB have + no security issues associated with them unless + explicitly stated in their corresponding + DESCRIPTION clause." + + -- revision log, in reverse chronological order + + REVISION "200005100000Z" -- May 10, 2000 + DESCRIPTION "Fix to import mib-2 instead of experimental." + + REVISION "199909011000Z" -- September 1, 1999 + DESCRIPTION + "Initial version transferred from the TN3270E + working group to IANA." + + ::= { mib-2 61 } + + + -- Textual Conventions + + IANATn3270eAddrType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The textual convention for defining the type of a + client address. The enumeration value unknown(0) is + also used to indicate that no actual address is present." + SYNTAX INTEGER { + unknown(0), + ipv4(1), + ipv6(2) + } + + IANATn3270eAddress ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Denotes a client address. The type of client address is + determined by use of the IANATn3270eAddrType textual +convention. + The length in octets of a IANATn3270eAddress object is: + + IANATn3270eAddrType Address Length + +++++++++++++++++++ ++++++++++++++ + unknown(0) not specified or unknown; the + actual length of the + IANATn3270eAddress octet string + indicates if an address + is present + ipv4(1) 4 OCTETS + ipv6(2) 16 OCTETS + + This textual convention is similar to the TAddress + TC defined by RFC1903 except that it allows a + zero-length octet string and is not a full transport + layer address." + SYNTAX OCTET STRING (SIZE (0..255)) + + IANATn3270eClientType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The textual convention for defining the set of + enumerations used by tn3270eTcpConnClientIdFormat + in the TN3270E-MIB: + + ENUMERATION OCTETs DESCRIPTION + + none(1) 0 Not specified + other(2) 1..512 Implementation specific + ipv4(3) 6 4-octet IP Address plus + 2-octet TCP Port + ipv6(4) 18 16-octet IPv6 Address + plus 2-octet TCP Port + domainName(5) 1..512 The DNS name of a + client. + truncDomainName(6) 1..512 The (truncated) DNS name + of a client. + string(7) 1..512 Unknown Utf8String + certificate(8) 1..512 certificate + userId(9) 1..8 Client's userid + x509dn(10) 1..512 X.509 Distinguished Name + + Representation of a certificate(8) may be lead to + a security exposure and is NOT RECOMMENDED without + adequate security." + SYNTAX INTEGER { + none(1), + other(2), + ipv4(3), + ipv6(4), + domainName(5), + truncDomainName(6), + string(7), + certificate(8), + userId(9), + x509dn(10) + } + + IANATn3270Functions ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "This textual convention reflects the current set of + TN3270 and TN3270E functions that can be negotiated + between a server and its client: + + RFC856 + transmitBinary The sender of this command REQUESTS + permission to begin transmitting, or + confirms that it will now begin + transmitting characters which are to + be interpreted as 8 bits of binary + data by the receiver of the data. + RFC860 + timingMark The sender of this command REQUESTS + that the receiver of this command + return a WILL TIMING-MARK in the data + stream at the 'appropriate place'. + RFC885 + endOfRecord The sender of this command requests + permission to begin transmission of + the Telnet END-OF-RECORD (EOR) code + when transmitting data characters, or + the sender of this command confirms it + will now begin transmission of EORs + with transmitted data characters. + RFC1091 + terminalType Sender is willing to send terminal + type information in a subsequent + sub-negotiation. + + RFC1041 + tn3270Regime Sender is willing to send list of + supported 3270 Regimes in a + subsequent sub-negotiation. + RFC2355 + scsCtlCodes (Printer sessions only). Allows the + use of the SNA Character Stream (SCS) + and SCS control codes on the session. + SCS is used with LU type 1 SNA sessions. + dataStreamCtl (Printer sessions only). Allows the use + of the standard 3270 data stream. This + corresponds to LU type 3 SNA sessions. + responses Provides support for positive and + negative response handling. Allows the + server to reflect to the client any and + all definite, exception, and no response + requests sent by the host application. + bindImage Allows the server to send the SNA Bind + image and Unbind notification to the + client. + sysreq Allows the client and server to emulate + some (or all, depending on the server) of + the functions of the SYSREQ key in an SNA + environment." + SYNTAX BITS { + transmitBinary(0),-- rfc856 + timemark(1), -- rfc860 + endOfRecord(2), -- rfc885 + terminalType(3), -- rfc1091 + tn3270Regime(4), -- rfc1041 + scsCtlCodes(5), -- rfc2355 + dataStreamCtl(6), -- rfc2355 + responses(7), -- rfc2355 + bindImage(8), -- rfc2355 + sysreq(9) -- rfc2355 + } + + IANATn3270ResourceType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The type of resource defined by a resource pool. Refer + to tn3270eResPoolTable." + SYNTAX INTEGER { + other(1), + terminal(2), + printer(3), + terminalOrPrinter(4) + } + + IANATn3270DeviceType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "This textual convention defines the list of device + types that can be set, as defined by RFC 2355." + SYNTAX INTEGER { + -- terminals + ibm3278d2(1), -- (24 row x 80 col display) + ibm3278d2E(2), -- (24 row x 80 col display) + ibm3278d3(3), -- (32 row x 80 col display) + ibm3278d3E(4), -- (32 row x 80 col display) + ibm3278d4(5), -- (43 row x 80 col display) + ibm3278d4E(6), -- (43 row x 80 col display) + ibm3278d5(7), -- (27 row x 132 col display) + ibm3278d5E(8), -- (27 row x 132 col display) + ibmDynamic(9), -- (no pre-defined display size) + + -- printers + ibm3287d1(10), + + unknown(100) + } + + IANATn3270eLogData ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "An octet string representing log data as pertaining to + either a TN3270 or TN3270E Session as reported from a + TN3270E Server. Log data is stored in an octet string + in time order (from earliest to latest). + + Each log element has the following form: + + +------+----+---------+------------+ + !length!type!TimeStamp! data ! + +------+----+---------+------------+ + + where + + length = one-octet length of the data portion of the + trace element, not including the length, + type, and TimeStamp fields + type = one-octet code point characterizing the data. + TimeStamp = A 4-octet field representing the number of + TimeTicks since the TN3270E server was last + activated. The server's last activation time + is available in the tn3270eSrvrConfLastActTime + object in the TN3270E MIB, which has the + syntax DateAndTime. + data = initial part of a PDU. + + length type + + 0-255 x'00' - unknown + 0 x'01' - inactivity timer expired + 0 x'02' - dynamic timer expired + 0 x'03' - actlu req + 0 x'04' - bind req + 0 x'05' - clear req + 0 x'06' - dactlu req + 0 x'07' - warm actpu req + 0 x'08' - sdt req + 0 x'09' - unbind req + 0 x'0A' - notify resp + 0 x'0B' - reply PSID neg rsp + 0 x'0C' - reply PSID pos rsp + 0 x'0D' - unbind rsp + 0 x'0E' - hierarchical reset + 0 x'0F' - client connect req + 0 x'10' - client disconnect req + 0 x'11' - timingmark received + 0 x'12' - flowControl timer expired + 0 x'13' - neg rsp to host + 0 x'14' - neg rsp from host + 0 x'15' - data contention + 0 x'16' - no buffer to send SNA data + 0 x'17' - receive response while inbound + 0 x'18' - client protocol error + 0 x'19' - badClientSequenceReceived + 1-255 x'1A' - utf8String + 2 x'1B' - hexCode, implementation dependent + + Log element entries have a minimum length of 6 octets. + The zero-length string indicates that no log data is + available." + SYNTAX OCTET STRING (SIZE (0 | 6..2048)) + + END + + diff --git a/contrib/apps/LwipMibCompiler/Mibs/IANA/IANAifType-MIB b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANAifType-MIB new file mode 100644 index 00000000..39dddf9e --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IANA/IANAifType-MIB @@ -0,0 +1,572 @@ + IANAifType-MIB DEFINITIONS ::= BEGIN + + IMPORTS + MODULE-IDENTITY, mib-2 FROM SNMPv2-SMI + TEXTUAL-CONVENTION FROM SNMPv2-TC; + + ianaifType MODULE-IDENTITY + LAST-UPDATED "200709130000Z" -- September 13, 2007 + ORGANIZATION "IANA" + CONTACT-INFO " Internet Assigned Numbers Authority + + Postal: ICANN + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292 + + Tel: +1 310 823 9358 + E-Mail: iana&iana.org" + + DESCRIPTION "This MIB module defines the IANAifType Textual + Convention, and thus the enumerated values of + the ifType object defined in MIB-II's ifTable." + + REVISION "200709130000Z" -- September 13, 2007 + DESCRIPTION "Registration of new IANAifTypes 243 and 244." + + REVISION "200705290000Z" -- May 29, 2007 + DESCRIPTION "Changed the description for IANAifType 228." + + REVISION "200703080000Z" -- March 08, 2007 + DESCRIPTION "Registration of new IANAifType 242." + + REVISION "200701230000Z" -- January 23, 2007 + DESCRIPTION "Registration of new IANAifTypes 239, 240, and 241." + + REVISION "200610170000Z" -- October 17, 2006 + DESCRIPTION "Deprecated/Obsoleted IANAifType 230. Registration of + IANAifType 238." + + REVISION "200609250000Z" -- September 25, 2006 + DESCRIPTION "Changed the description for IANA ifType + 184 and added new IANA ifType 237." + + REVISION "200608170000Z" -- August 17, 2006 + DESCRIPTION "Changed the descriptions for IANAifTypes + 20 and 21." + + REVISION "200608110000Z" -- August 11, 2006 + DESCRIPTION "Changed the descriptions for IANAifTypes + 7, 11, 62, 69, and 117." + + REVISION "200607250000Z" -- July 25, 2006 + DESCRIPTION "Registration of new IANA ifType 236." + + REVISION "200606140000Z" -- June 14, 2006 + DESCRIPTION "Registration of new IANA ifType 235." + + REVISION "200603310000Z" -- March 31, 2006 + DESCRIPTION "Registration of new IANA ifType 234." + + REVISION "200603300000Z" -- March 30, 2006 + DESCRIPTION "Registration of new IANA ifType 233." + + REVISION "200512220000Z" -- December 22, 2005 + DESCRIPTION "Registration of new IANA ifTypes 231 and 232." + + REVISION "200510100000Z" -- October 10, 2005 + DESCRIPTION "Registration of new IANA ifType 230." + + REVISION "200509090000Z" -- September 09, 2005 + DESCRIPTION "Registration of new IANA ifType 229." + + REVISION "200505270000Z" -- May 27, 2005 + DESCRIPTION "Registration of new IANA ifType 228." + + REVISION "200503030000Z" -- March 3, 2005 + DESCRIPTION "Added the IANAtunnelType TC and deprecated + IANAifType sixToFour (215) per RFC4087." + + REVISION "200411220000Z" -- November 22, 2004 + DESCRIPTION "Registration of new IANA ifType 227 per RFC4631." + + REVISION "200406170000Z" -- June 17, 2004 + DESCRIPTION "Registration of new IANA ifType 226." + + REVISION "200405120000Z" -- May 12, 2004 + DESCRIPTION "Added description for IANAifType 6, and + changed the descriptions for IANAifTypes + 180, 181, and 182." + + REVISION "200405070000Z" -- May 7, 2004 + DESCRIPTION "Registration of new IANAifType 225." + + REVISION "200308250000Z" -- Aug 25, 2003 + DESCRIPTION "Deprecated IANAifTypes 7 and 11. Obsoleted + IANAifTypes 62, 69, and 117. ethernetCsmacd (6) + should be used instead of these values" + + REVISION "200308180000Z" -- Aug 18, 2003 + DESCRIPTION "Registration of new IANAifType + 224." + + REVISION "200308070000Z" -- Aug 7, 2003 + DESCRIPTION "Registration of new IANAifTypes + 222 and 223." + + REVISION "200303180000Z" -- Mar 18, 2003 + DESCRIPTION "Registration of new IANAifType + 221." + + REVISION "200301130000Z" -- Jan 13, 2003 + DESCRIPTION "Registration of new IANAifType + 220." + + REVISION "200210170000Z" -- Oct 17, 2002 + DESCRIPTION "Registration of new IANAifType + 219." + + REVISION "200207160000Z" -- Jul 16, 2002 + DESCRIPTION "Registration of new IANAifTypes + 217 and 218." + + REVISION "200207100000Z" -- Jul 10, 2002 + DESCRIPTION "Registration of new IANAifTypes + 215 and 216." + + REVISION "200206190000Z" -- Jun 19, 2002 + DESCRIPTION "Registration of new IANAifType + 214." + + REVISION "200201040000Z" -- Jan 4, 2002 + DESCRIPTION "Registration of new IANAifTypes + 211, 212 and 213." + + REVISION "200112200000Z" -- Dec 20, 2001 + DESCRIPTION "Registration of new IANAifTypes + 209 and 210." + + REVISION "200111150000Z" -- Nov 15, 2001 + DESCRIPTION "Registration of new IANAifTypes + 207 and 208." + + + REVISION "200111060000Z" -- Nov 6, 2001 + DESCRIPTION "Registration of new IANAifType + 206." + + + REVISION "200111020000Z" -- Nov 2, 2001 + DESCRIPTION "Registration of new IANAifType + 205." + + + REVISION "200110160000Z" -- Oct 16, 2001 + DESCRIPTION "Registration of new IANAifTypes + 199, 200, 201, 202, 203, and 204." + + + REVISION "200109190000Z" -- Sept 19, 2001 + DESCRIPTION "Registration of new IANAifType + 198." + + REVISION "200105110000Z" -- May 11, 2001 + DESCRIPTION "Registration of new IANAifType + 197." + + + REVISION "200101120000Z" -- Jan 12, 2001 + DESCRIPTION "Registration of new IANAifTypes + 195 and 196." + + REVISION "200012190000Z" -- Dec 19, 2000 + DESCRIPTION "Registration of new IANAifTypes + 193 and 194." + + REVISION "200012070000Z" -- Dec 07, 2000 + DESCRIPTION "Registration of new IANAifTypes + 191 and 192." + + REVISION "200012040000Z" -- Dec 04, 2000 + DESCRIPTION "Registration of new IANAifType + 190." + + REVISION "200010170000Z" -- Oct 17, 2000 + DESCRIPTION "Registration of new IANAifTypes + 188 and 189." + + REVISION "200010020000Z" -- Oct 02, 2000 + DESCRIPTION "Registration of new IANAifType 187." + + REVISION "200009010000Z" -- Sept 01, 2000 + DESCRIPTION "Registration of new IANAifTypes + 184, 185, and 186." + + REVISION "200008240000Z" -- Aug 24, 2000 + DESCRIPTION "Registration of new IANAifType 183." + + REVISION "200008230000Z" -- Aug 23, 2000 + DESCRIPTION "Registration of new IANAifTypes + 174-182." + + REVISION "200008220000Z" -- Aug 22, 2000 + DESCRIPTION "Registration of new IANAifTypes 170, + 171, 172 and 173." + + REVISION "200004250000Z" -- Apr 25, 2000 + DESCRIPTION "Registration of new IANAifTypes 168 and 169." + + REVISION "200003060000Z" -- Mar 6, 2000 + DESCRIPTION "Fixed a missing semi-colon in the IMPORT. + Also cleaned up the REVISION log a bit. + It is not complete, but from now on it will + be maintained and kept up to date with each + change to this MIB module." + + REVISION "199910081430Z" -- Oct 08, 1999 + DESCRIPTION "Include new name assignments up to cnr(85). + This is the first version available via the WWW + at: ftp://ftp.isi.edu/mib/ianaiftype.mib" + + REVISION "199401310000Z" -- Jan 31, 1994 + DESCRIPTION "Initial version of this MIB as published in + RFC 1573." + + ::= { mib-2 30 } + + + IANAifType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "This data type is used as the syntax of the ifType + object in the (updated) definition of MIB-II's + ifTable. + + The definition of this textual convention with the + addition of newly assigned values is published + periodically by the IANA, in either the Assigned + Numbers RFC, or some derivative of it specific to + Internet Network Management number assignments. (The + latest arrangements can be obtained by contacting the + IANA.) + + Requests for new values should be made to IANA via + email (iana&iana.org). + + The relationship between the assignment of ifType + values and of OIDs to particular media-specific MIBs + is solely the purview of IANA and is subject to change + without notice. Quite often, a media-specific MIB's + OID-subtree assignment within MIB-II's 'transmission' + subtree will be the same as its ifType value. + However, in some circumstances this will not be the + case, and implementors must not pre-assume any + specific relationship between ifType values and + transmission subtree OIDs." + SYNTAX INTEGER { + other(1), -- none of the following + regular1822(2), + hdh1822(3), + ddnX25(4), + rfc877x25(5), + ethernetCsmacd(6), -- for all ethernet-like interfaces, + -- regardless of speed, as per RFC3635 + iso88023Csmacd(7), -- Deprecated via RFC3635 + -- ethernetCsmacd (6) should be used instead + iso88024TokenBus(8), + iso88025TokenRing(9), + iso88026Man(10), + starLan(11), -- Deprecated via RFC3635 + -- ethernetCsmacd (6) should be used instead + proteon10Mbit(12), + proteon80Mbit(13), + hyperchannel(14), + fddi(15), + lapb(16), + sdlc(17), + ds1(18), -- DS1-MIB + e1(19), -- Obsolete see DS1-MIB + basicISDN(20), -- no longer used + -- see also RFC2127 + primaryISDN(21), -- no longer used + -- see also RFC2127 + propPointToPointSerial(22), -- proprietary serial + ppp(23), + softwareLoopback(24), + eon(25), -- CLNP over IP + ethernet3Mbit(26), + nsip(27), -- XNS over IP + slip(28), -- generic SLIP + ultra(29), -- ULTRA technologies + ds3(30), -- DS3-MIB + sip(31), -- SMDS, coffee + frameRelay(32), -- DTE only. + rs232(33), + para(34), -- parallel-port + arcnet(35), -- arcnet + arcnetPlus(36), -- arcnet plus + atm(37), -- ATM cells + miox25(38), + sonet(39), -- SONET or SDH + x25ple(40), + iso88022llc(41), + localTalk(42), + smdsDxi(43), + frameRelayService(44), -- FRNETSERV-MIB + v35(45), + hssi(46), + hippi(47), + modem(48), -- Generic modem + aal5(49), -- AAL5 over ATM + sonetPath(50), + sonetVT(51), + smdsIcip(52), -- SMDS InterCarrier Interface + propVirtual(53), -- proprietary virtual/internal + propMultiplexor(54),-- proprietary multiplexing + ieee80212(55), -- 100BaseVG + fibreChannel(56), -- Fibre Channel + hippiInterface(57), -- HIPPI interfaces + frameRelayInterconnect(58), -- Obsolete use either + -- frameRelay(32) or + -- frameRelayService(44). + aflane8023(59), -- ATM Emulated LAN for 802.3 + aflane8025(60), -- ATM Emulated LAN for 802.5 + cctEmul(61), -- ATM Emulated circuit + fastEther(62), -- Obsoleted via RFC3635 + -- ethernetCsmacd (6) should be used instead + isdn(63), -- ISDN and X.25 + v11(64), -- CCITT V.11/X.21 + v36(65), -- CCITT V.36 + g703at64k(66), -- CCITT G703 at 64Kbps + g703at2mb(67), -- Obsolete see DS1-MIB + qllc(68), -- SNA QLLC + fastEtherFX(69), -- Obsoleted via RFC3635 + -- ethernetCsmacd (6) should be used instead + channel(70), -- channel + ieee80211(71), -- radio spread spectrum + ibm370parChan(72), -- IBM System 360/370 OEMI Channel + escon(73), -- IBM Enterprise Systems Connection + dlsw(74), -- Data Link Switching + isdns(75), -- ISDN S/T interface + isdnu(76), -- ISDN U interface + lapd(77), -- Link Access Protocol D + ipSwitch(78), -- IP Switching Objects + rsrb(79), -- Remote Source Route Bridging + atmLogical(80), -- ATM Logical Port + ds0(81), -- Digital Signal Level 0 + ds0Bundle(82), -- group of ds0s on the same ds1 + bsc(83), -- Bisynchronous Protocol + async(84), -- Asynchronous Protocol + cnr(85), -- Combat Net Radio + iso88025Dtr(86), -- ISO 802.5r DTR + eplrs(87), -- Ext Pos Loc Report Sys + arap(88), -- Appletalk Remote Access Protocol + propCnls(89), -- Proprietary Connectionless Protocol + hostPad(90), -- CCITT-ITU X.29 PAD Protocol + termPad(91), -- CCITT-ITU X.3 PAD Facility + frameRelayMPI(92), -- Multiproto Interconnect over FR + x213(93), -- CCITT-ITU X213 + adsl(94), -- Asymmetric Digital Subscriber Loop + radsl(95), -- Rate-Adapt. Digital Subscriber Loop + sdsl(96), -- Symmetric Digital Subscriber Loop + vdsl(97), -- Very H-Speed Digital Subscrib. Loop + iso88025CRFPInt(98), -- ISO 802.5 CRFP + myrinet(99), -- Myricom Myrinet + voiceEM(100), -- voice recEive and transMit + voiceFXO(101), -- voice Foreign Exchange Office + voiceFXS(102), -- voice Foreign Exchange Station + voiceEncap(103), -- voice encapsulation + voiceOverIp(104), -- voice over IP encapsulation + atmDxi(105), -- ATM DXI + atmFuni(106), -- ATM FUNI + atmIma (107), -- ATM IMA + pppMultilinkBundle(108), -- PPP Multilink Bundle + ipOverCdlc (109), -- IBM ipOverCdlc + ipOverClaw (110), -- IBM Common Link Access to Workstn + stackToStack (111), -- IBM stackToStack + virtualIpAddress (112), -- IBM VIPA + mpc (113), -- IBM multi-protocol channel support + ipOverAtm (114), -- IBM ipOverAtm + iso88025Fiber (115), -- ISO 802.5j Fiber Token Ring + tdlc (116), -- IBM twinaxial data link control + gigabitEthernet (117), -- Obsoleted via RFC3635 + -- ethernetCsmacd (6) should be used instead + hdlc (118), -- HDLC + lapf (119), -- LAP F + v37 (120), -- V.37 + x25mlp (121), -- Multi-Link Protocol + x25huntGroup (122), -- X25 Hunt Group + trasnpHdlc (123), -- Transp HDLC + interleave (124), -- Interleave channel + fast (125), -- Fast channel + ip (126), -- IP (for APPN HPR in IP networks) + docsCableMaclayer (127), -- CATV Mac Layer + docsCableDownstream (128), -- CATV Downstream interface + docsCableUpstream (129), -- CATV Upstream interface + a12MppSwitch (130), -- Avalon Parallel Processor + tunnel (131), -- Encapsulation interface + coffee (132), -- coffee pot + ces (133), -- Circuit Emulation Service + atmSubInterface (134), -- ATM Sub Interface + l2vlan (135), -- Layer 2 Virtual LAN using 802.1Q + l3ipvlan (136), -- Layer 3 Virtual LAN using IP + l3ipxvlan (137), -- Layer 3 Virtual LAN using IPX + digitalPowerline (138), -- IP over Power Lines + mediaMailOverIp (139), -- Multimedia Mail over IP + dtm (140), -- Dynamic syncronous Transfer Mode + dcn (141), -- Data Communications Network + ipForward (142), -- IP Forwarding Interface + msdsl (143), -- Multi-rate Symmetric DSL + ieee1394 (144), -- IEEE1394 High Performance Serial Bus + if-gsn (145), -- HIPPI-6400 + dvbRccMacLayer (146), -- DVB-RCC MAC Layer + dvbRccDownstream (147), -- DVB-RCC Downstream Channel + dvbRccUpstream (148), -- DVB-RCC Upstream Channel + atmVirtual (149), -- ATM Virtual Interface + mplsTunnel (150), -- MPLS Tunnel Virtual Interface + srp (151), -- Spatial Reuse Protocol + voiceOverAtm (152), -- Voice Over ATM + voiceOverFrameRelay (153), -- Voice Over Frame Relay + idsl (154), -- Digital Subscriber Loop over ISDN + compositeLink (155), -- Avici Composite Link Interface + ss7SigLink (156), -- SS7 Signaling Link + propWirelessP2P (157), -- Prop. P2P wireless interface + frForward (158), -- Frame Forward Interface + rfc1483 (159), -- Multiprotocol over ATM AAL5 + usb (160), -- USB Interface + ieee8023adLag (161), -- IEEE 802.3ad Link Aggregate + bgppolicyaccounting (162), -- BGP Policy Accounting + frf16MfrBundle (163), -- FRF .16 Multilink Frame Relay + h323Gatekeeper (164), -- H323 Gatekeeper + h323Proxy (165), -- H323 Voice and Video Proxy + mpls (166), -- MPLS + mfSigLink (167), -- Multi-frequency signaling link + hdsl2 (168), -- High Bit-Rate DSL - 2nd generation + shdsl (169), -- Multirate HDSL2 + ds1FDL (170), -- Facility Data Link 4Kbps on a DS1 + pos (171), -- Packet over SONET/SDH Interface + dvbAsiIn (172), -- DVB-ASI Input + dvbAsiOut (173), -- DVB-ASI Output + plc (174), -- Power Line Communtications + nfas (175), -- Non Facility Associated Signaling + tr008 (176), -- TR008 + gr303RDT (177), -- Remote Digital Terminal + gr303IDT (178), -- Integrated Digital Terminal + isup (179), -- ISUP + propDocsWirelessMaclayer (180), -- Cisco proprietary Maclayer + propDocsWirelessDownstream (181), -- Cisco proprietary Downstream + propDocsWirelessUpstream (182), -- Cisco proprietary Upstream + hiperlan2 (183), -- HIPERLAN Type 2 Radio Interface + propBWAp2Mp (184), -- PropBroadbandWirelessAccesspt2multipt + -- use of this iftype for IEEE 802.16 WMAN + -- interfaces as per IEEE Std 802.16f is + -- deprecated and ifType 237 should be used instead. + sonetOverheadChannel (185), -- SONET Overhead Channel + digitalWrapperOverheadChannel (186), -- Digital Wrapper + aal2 (187), -- ATM adaptation layer 2 + radioMAC (188), -- MAC layer over radio links + atmRadio (189), -- ATM over radio links + imt (190), -- Inter Machine Trunks + mvl (191), -- Multiple Virtual Lines DSL + reachDSL (192), -- Long Reach DSL + frDlciEndPt (193), -- Frame Relay DLCI End Point + atmVciEndPt (194), -- ATM VCI End Point + opticalChannel (195), -- Optical Channel + opticalTransport (196), -- Optical Transport + propAtm (197), -- Proprietary ATM + voiceOverCable (198), -- Voice Over Cable Interface + infiniband (199), -- Infiniband + teLink (200), -- TE Link + q2931 (201), -- Q.2931 + virtualTg (202), -- Virtual Trunk Group + sipTg (203), -- SIP Trunk Group + sipSig (204), -- SIP Signaling + docsCableUpstreamChannel (205), -- CATV Upstream Channel + econet (206), -- Acorn Econet + pon155 (207), -- FSAN 155Mb Symetrical PON interface + pon622 (208), -- FSAN622Mb Symetrical PON interface + bridge (209), -- Transparent bridge interface + linegroup (210), -- Interface common to multiple lines + voiceEMFGD (211), -- voice E&M Feature Group D + voiceFGDEANA (212), -- voice FGD Exchange Access North American + voiceDID (213), -- voice Direct Inward Dialing + mpegTransport (214), -- MPEG transport interface + sixToFour (215), -- 6to4 interface (DEPRECATED) + gtp (216), -- GTP (GPRS Tunneling Protocol) + pdnEtherLoop1 (217), -- Paradyne EtherLoop 1 + pdnEtherLoop2 (218), -- Paradyne EtherLoop 2 + opticalChannelGroup (219), -- Optical Channel Group + homepna (220), -- HomePNA ITU-T G.989 + gfp (221), -- Generic Framing Procedure (GFP) + ciscoISLvlan (222), -- Layer 2 Virtual LAN using Cisco ISL + actelisMetaLOOP (223), -- Acteleis proprietary MetaLOOP High Speed Link + fcipLink (224), -- FCIP Link + rpr (225), -- Resilient Packet Ring Interface Type + qam (226), -- RF Qam Interface + lmp (227), -- Link Management Protocol + cblVectaStar (228), -- Cambridge Broadband Networks Limited VectaStar + docsCableMCmtsDownstream (229), -- CATV Modular CMTS Downstream Interface + adsl2 (230), -- Asymmetric Digital Subscriber Loop Version 2 + -- (DEPRECATED/OBSOLETED - please use adsl2plus 238 instead) + macSecControlledIF (231), -- MACSecControlled + macSecUncontrolledIF (232), -- MACSecUncontrolled + aviciOpticalEther (233), -- Avici Optical Ethernet Aggregate + atmbond (234), -- atmbond + voiceFGDOS (235), -- voice FGD Operator Services + mocaVersion1 (236), -- MultiMedia over Coax Alliance (MoCA) Interface + -- as documented in information provided privately to IANA + ieee80216WMAN (237), -- IEEE 802.16 WMAN interface + adsl2plus (238), -- Asymmetric Digital Subscriber Loop Version 2, + -- Version 2 Plus and all variants + dvbRcsMacLayer (239), -- DVB-RCS MAC Layer + dvbTdm (240), -- DVB Satellite TDM + dvbRcsTdma (241), -- DVB-RCS TDMA + x86Laps (242), -- LAPS based on ITU-T X.86/Y.1323 + wwanPP (243), -- 3GPP WWAN + wwanPP2 (244) -- 3GPP2 WWAN + } + +IANAtunnelType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The encapsulation method used by a tunnel. The value + direct indicates that a packet is encapsulated + directly within a normal IP header, with no + intermediate header, and unicast to the remote tunnel + endpoint (e.g., an RFC 2003 IP-in-IP tunnel, or an RFC + 1933 IPv6-in-IPv4 tunnel). The value minimal indicates + that a Minimal Forwarding Header (RFC 2004) is + inserted between the outer header and the payload + packet. The value UDP indicates that the payload + packet is encapsulated within a normal UDP packet + (e.g., RFC 1234). + + The values sixToFour, sixOverFour, and isatap + indicates that an IPv6 packet is encapsulated directly + within an IPv4 header, with no intermediate header, + and unicast to the destination determined by the 6to4, + 6over4, or ISATAP protocol. + + The remaining protocol-specific values indicate that a + header of the protocol of that name is inserted + between the outer header and the payload header. + + The assignment policy for IANAtunnelType values is + identical to the policy for assigning IANAifType + values." + SYNTAX INTEGER { + other(1), -- none of the following + direct(2), -- no intermediate header + gre(3), -- GRE encapsulation + minimal(4), -- Minimal encapsulation + l2tp(5), -- L2TP encapsulation + pptp(6), -- PPTP encapsulation + l2f(7), -- L2F encapsulation + udp(8), -- UDP encapsulation + atmp(9), -- ATMP encapsulation + msdp(10), -- MSDP encapsulation + sixToFour(11), -- 6to4 encapsulation + sixOverFour(12), -- 6over4 encapsulation + isatap(13), -- ISATAP encapsulation + teredo(14) -- Teredo encapsulation + } + + END + + + + + + + + + diff --git a/contrib/apps/LwipMibCompiler/Mibs/IF-MIB b/contrib/apps/LwipMibCompiler/Mibs/IF-MIB new file mode 100644 index 00000000..87138943 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IF-MIB @@ -0,0 +1,1899 @@ +IF-MIB DEFINITIONS ::= BEGIN + +IMPORTS + MODULE-IDENTITY, OBJECT-TYPE, Counter32, Gauge32, Counter64, + Integer32, TimeTicks, mib-2, + NOTIFICATION-TYPE FROM SNMPv2-SMI + TEXTUAL-CONVENTION, DisplayString, + PhysAddress, TruthValue, RowStatus, + TimeStamp, AutonomousType, TestAndIncr FROM SNMPv2-TC + MODULE-COMPLIANCE, OBJECT-GROUP, + NOTIFICATION-GROUP FROM SNMPv2-CONF + snmpTraps FROM SNMPv2-MIB + IANAifType FROM IANAifType-MIB; + + +ifMIB MODULE-IDENTITY + LAST-UPDATED "200006140000Z" + ORGANIZATION "IETF Interfaces MIB Working Group" + CONTACT-INFO + " Keith McCloghrie + Cisco Systems, Inc. + 170 West Tasman Drive + San Jose, CA 95134-1706 + US + + 408-526-5260 + kzm@cisco.com" + DESCRIPTION + "The MIB module to describe generic objects for network + interface sub-layers. This MIB is an updated version of + MIB-II's ifTable, and incorporates the extensions defined in + RFC 1229." + + + REVISION "200006140000Z" + DESCRIPTION + "Clarifications agreed upon by the Interfaces MIB WG, and + published as RFC 2863." + REVISION "199602282155Z" + DESCRIPTION + "Revisions made by the Interfaces MIB WG, and published in + RFC 2233." + REVISION "199311082155Z" + DESCRIPTION + "Initial revision, published as part of RFC 1573." + ::= { mib-2 31 } + + +ifMIBObjects OBJECT IDENTIFIER ::= { ifMIB 1 } + +interfaces OBJECT IDENTIFIER ::= { mib-2 2 } + +-- +-- Textual Conventions +-- + + +-- OwnerString has the same semantics as used in RFC 1271 + +OwnerString ::= TEXTUAL-CONVENTION + DISPLAY-HINT "255a" + STATUS deprecated + DESCRIPTION + "This data type is used to model an administratively + assigned name of the owner of a resource. This information + is taken from the NVT ASCII character set. It is suggested + that this name contain one or more of the following: ASCII + form of the manager station's transport address, management + station name (e.g., domain name), network management + personnel's name, location, or phone number. In some cases + the agent itself will be the owner of an entry. In these + cases, this string shall be set to a string starting with + 'agent'." + SYNTAX OCTET STRING (SIZE(0..255)) + +-- InterfaceIndex contains the semantics of ifIndex and should be used +-- for any objects defined in other MIB modules that need these semantics. + +InterfaceIndex ::= TEXTUAL-CONVENTION + DISPLAY-HINT "d" + STATUS current + DESCRIPTION + + + "A unique value, greater than zero, for each interface or + interface sub-layer in the managed system. It is + recommended that values are assigned contiguously starting + from 1. The value for each interface sub-layer must remain + constant at least from one re-initialization of the entity's + network management system to the next re-initialization." + SYNTAX Integer32 (1..2147483647) + +InterfaceIndexOrZero ::= TEXTUAL-CONVENTION + DISPLAY-HINT "d" + STATUS current + DESCRIPTION + "This textual convention is an extension of the + InterfaceIndex convention. The latter defines a greater + than zero value used to identify an interface or interface + sub-layer in the managed system. This extension permits the + additional value of zero. the value zero is object-specific + and must therefore be defined as part of the description of + any object which uses this syntax. Examples of the usage of + zero might include situations where interface was unknown, + or when none or all interfaces need to be referenced." + SYNTAX Integer32 (0..2147483647) + +ifNumber OBJECT-TYPE + SYNTAX Integer32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of network interfaces (regardless of their + current state) present on this system." + ::= { interfaces 1 } + +ifTableLastChange OBJECT-TYPE + SYNTAX TimeTicks + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime at the time of the last creation or + deletion of an entry in the ifTable. If the number of + entries has been unchanged since the last re-initialization + of the local network management subsystem, then this object + contains a zero value." + ::= { ifMIBObjects 5 } + + +-- the Interfaces table + +-- The Interfaces table contains information on the entity's + + +-- interfaces. Each sub-layer below the internetwork-layer +-- of a network interface is considered to be an interface. + +ifTable OBJECT-TYPE + SYNTAX SEQUENCE OF IfEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A list of interface entries. The number of entries is + given by the value of ifNumber." + ::= { interfaces 2 } + +ifEntry OBJECT-TYPE + SYNTAX IfEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An entry containing management information applicable to a + particular interface." + INDEX { ifIndex } + ::= { ifTable 1 } + +IfEntry ::= + SEQUENCE { + ifIndex InterfaceIndex, + ifDescr DisplayString, + ifType IANAifType, + ifMtu Integer32, + ifSpeed Gauge32, + ifPhysAddress PhysAddress, + ifAdminStatus INTEGER, + ifOperStatus INTEGER, + ifLastChange TimeTicks, + ifInOctets Counter32, + ifInUcastPkts Counter32, + ifInNUcastPkts Counter32, -- deprecated + ifInDiscards Counter32, + ifInErrors Counter32, + ifInUnknownProtos Counter32, + ifOutOctets Counter32, + ifOutUcastPkts Counter32, + ifOutNUcastPkts Counter32, -- deprecated + ifOutDiscards Counter32, + ifOutErrors Counter32, + ifOutQLen Gauge32, -- deprecated + ifSpecific OBJECT IDENTIFIER -- deprecated + } + + + +ifIndex OBJECT-TYPE + SYNTAX InterfaceIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "A unique value, greater than zero, for each interface. It + is recommended that values are assigned contiguously + starting from 1. The value for each interface sub-layer + must remain constant at least from one re-initialization of + the entity's network management system to the next re- + initialization." + ::= { ifEntry 1 } + +ifDescr OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "A textual string containing information about the + interface. This string should include the name of the + manufacturer, the product name and the version of the + interface hardware/software." + ::= { ifEntry 2 } + +ifType OBJECT-TYPE + SYNTAX IANAifType + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The type of interface. Additional values for ifType are + assigned by the Internet Assigned Numbers Authority (IANA), + through updating the syntax of the IANAifType textual + convention." + ::= { ifEntry 3 } + +ifMtu OBJECT-TYPE + SYNTAX Integer32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The size of the largest packet which can be sent/received + on the interface, specified in octets. For interfaces that + are used for transmitting network datagrams, this is the + size of the largest network datagram that can be sent on the + interface." + ::= { ifEntry 4 } + +ifSpeed OBJECT-TYPE + + + SYNTAX Gauge32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "An estimate of the interface's current bandwidth in bits + per second. For interfaces which do not vary in bandwidth + or for those where no accurate estimation can be made, this + object should contain the nominal bandwidth. If the + bandwidth of the interface is greater than the maximum value + reportable by this object then this object should report its + maximum value (4,294,967,295) and ifHighSpeed must be used + to report the interace's speed. For a sub-layer which has + no concept of bandwidth, this object should be zero." + ::= { ifEntry 5 } + +ifPhysAddress OBJECT-TYPE + SYNTAX PhysAddress + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The interface's address at its protocol sub-layer. For + example, for an 802.x interface, this object normally + contains a MAC address. The interface's media-specific MIB + must define the bit and byte ordering and the format of the + value of this object. For interfaces which do not have such + an address (e.g., a serial line), this object should contain + an octet string of zero length." + ::= { ifEntry 6 } + +ifAdminStatus OBJECT-TYPE + SYNTAX INTEGER { + up(1), -- ready to pass packets + down(2), + testing(3) -- in some test mode + } + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "The desired state of the interface. The testing(3) state + indicates that no operational packets can be passed. When a + managed system initializes, all interfaces start with + ifAdminStatus in the down(2) state. As a result of either + explicit management action or per configuration information + retained by the managed system, ifAdminStatus is then + changed to either the up(1) or testing(3) states (or remains + in the down(2) state)." + ::= { ifEntry 7 } + + + +ifOperStatus OBJECT-TYPE + SYNTAX INTEGER { + up(1), -- ready to pass packets + down(2), + testing(3), -- in some test mode + unknown(4), -- status can not be determined + -- for some reason. + dormant(5), + notPresent(6), -- some component is missing + lowerLayerDown(7) -- down due to state of + -- lower-layer interface(s) + } + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The current operational state of the interface. The + testing(3) state indicates that no operational packets can + be passed. If ifAdminStatus is down(2) then ifOperStatus + should be down(2). If ifAdminStatus is changed to up(1) + then ifOperStatus should change to up(1) if the interface is + ready to transmit and receive network traffic; it should + change to dormant(5) if the interface is waiting for + external actions (such as a serial line waiting for an + incoming connection); it should remain in the down(2) state + if and only if there is a fault that prevents it from going + to the up(1) state; it should remain in the notPresent(6) + state if the interface has missing (typically, hardware) + components." + ::= { ifEntry 8 } + +ifLastChange OBJECT-TYPE + SYNTAX TimeTicks + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime at the time the interface entered + its current operational state. If the current state was + entered prior to the last re-initialization of the local + network management subsystem, then this object contains a + zero value." + ::= { ifEntry 9 } + +ifInOctets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received on the interface, + + + including framing characters. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifEntry 10 } + +ifInUcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of packets, delivered by this sub-layer to a + higher (sub-)layer, which were not addressed to a multicast + or broadcast address at this sub-layer. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifEntry 11 } + +ifInNUcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of packets, delivered by this sub-layer to a + higher (sub-)layer, which were addressed to a multicast or + broadcast address at this sub-layer. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime. + + This object is deprecated in favour of ifInMulticastPkts and + ifInBroadcastPkts." + ::= { ifEntry 12 } + +ifInDiscards OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of inbound packets which were chosen to be + discarded even though no errors had been detected to prevent + + + their being deliverable to a higher-layer protocol. One + possible reason for discarding such a packet could be to + free up buffer space. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifEntry 13 } + +ifInErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "For packet-oriented interfaces, the number of inbound + packets that contained errors preventing them from being + deliverable to a higher-layer protocol. For character- + oriented or fixed-length interfaces, the number of inbound + transmission units that contained errors preventing them + from being deliverable to a higher-layer protocol. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifEntry 14 } + +ifInUnknownProtos OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "For packet-oriented interfaces, the number of packets + received via the interface which were discarded because of + an unknown or unsupported protocol. For character-oriented + or fixed-length interfaces that support protocol + multiplexing the number of transmission units received via + the interface which were discarded because of an unknown or + unsupported protocol. For any interface that does not + support protocol multiplexing, this counter will always be + 0. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifEntry 15 } + + +ifOutOctets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets transmitted out of the + interface, including framing characters. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifEntry 16 } + +ifOutUcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of packets that higher-level protocols + requested be transmitted, and which were not addressed to a + multicast or broadcast address at this sub-layer, including + those that were discarded or not sent. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifEntry 17 } + +ifOutNUcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The total number of packets that higher-level protocols + requested be transmitted, and which were addressed to a + multicast or broadcast address at this sub-layer, including + those that were discarded or not sent. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime. + + This object is deprecated in favour of ifOutMulticastPkts + and ifOutBroadcastPkts." + ::= { ifEntry 18 } + + +ifOutDiscards OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of outbound packets which were chosen to be + discarded even though no errors had been detected to prevent + their being transmitted. One possible reason for discarding + such a packet could be to free up buffer space. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifEntry 19 } + +ifOutErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "For packet-oriented interfaces, the number of outbound + packets that could not be transmitted because of errors. + For character-oriented or fixed-length interfaces, the + number of outbound transmission units that could not be + transmitted because of errors. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifEntry 20 } + +ifOutQLen OBJECT-TYPE + SYNTAX Gauge32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The length of the output packet queue (in packets)." + ::= { ifEntry 21 } + +ifSpecific OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "A reference to MIB definitions specific to the particular + media being used to realize the interface. It is + + + recommended that this value point to an instance of a MIB + object in the media-specific MIB, i.e., that this object + have the semantics associated with the InstancePointer + textual convention defined in RFC 2579. In fact, it is + recommended that the media-specific MIB specify what value + ifSpecific should/can take for values of ifType. If no MIB + definitions specific to the particular media are available, + the value should be set to the OBJECT IDENTIFIER { 0 0 }." + ::= { ifEntry 22 } + + + +-- +-- Extension to the interface table +-- +-- This table replaces the ifExtnsTable table. +-- + +ifXTable OBJECT-TYPE + SYNTAX SEQUENCE OF IfXEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A list of interface entries. The number of entries is + given by the value of ifNumber. This table contains + additional objects for the interface table." + ::= { ifMIBObjects 1 } + +ifXEntry OBJECT-TYPE + SYNTAX IfXEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An entry containing additional management information + applicable to a particular interface." + AUGMENTS { ifEntry } + ::= { ifXTable 1 } + +IfXEntry ::= + SEQUENCE { + ifName DisplayString, + ifInMulticastPkts Counter32, + ifInBroadcastPkts Counter32, + ifOutMulticastPkts Counter32, + ifOutBroadcastPkts Counter32, + ifHCInOctets Counter64, + ifHCInUcastPkts Counter64, + ifHCInMulticastPkts Counter64, + + + ifHCInBroadcastPkts Counter64, + ifHCOutOctets Counter64, + ifHCOutUcastPkts Counter64, + ifHCOutMulticastPkts Counter64, + ifHCOutBroadcastPkts Counter64, + ifLinkUpDownTrapEnable INTEGER, + ifHighSpeed Gauge32, + ifPromiscuousMode TruthValue, + ifConnectorPresent TruthValue, + ifAlias DisplayString, + ifCounterDiscontinuityTime TimeStamp + } + + +ifName OBJECT-TYPE + SYNTAX DisplayString + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The textual name of the interface. The value of this + object should be the name of the interface as assigned by + the local device and should be suitable for use in commands + entered at the device's `console'. This might be a text + name, such as `le0' or a simple port number, such as `1', + depending on the interface naming syntax of the device. If + several entries in the ifTable together represent a single + interface as named by the device, then each will have the + same value of ifName. Note that for an agent which responds + to SNMP queries concerning an interface on some other + (proxied) device, then the value of ifName for such an + interface is the proxied device's local name for it. + + If there is no local name, or this object is otherwise not + applicable, then this object contains a zero-length string." + ::= { ifXEntry 1 } + +ifInMulticastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of packets, delivered by this sub-layer to a + higher (sub-)layer, which were addressed to a multicast + address at this sub-layer. For a MAC layer protocol, this + includes both Group and Functional addresses. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + + + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 2 } + +ifInBroadcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of packets, delivered by this sub-layer to a + higher (sub-)layer, which were addressed to a broadcast + address at this sub-layer. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 3 } + +ifOutMulticastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of packets that higher-level protocols + requested be transmitted, and which were addressed to a + multicast address at this sub-layer, including those that + were discarded or not sent. For a MAC layer protocol, this + includes both Group and Functional addresses. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 4 } + +ifOutBroadcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of packets that higher-level protocols + requested be transmitted, and which were addressed to a + broadcast address at this sub-layer, including those that + were discarded or not sent. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + + + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 5 } + +-- +-- High Capacity Counter objects. These objects are all +-- 64 bit versions of the "basic" ifTable counters. These +-- objects all have the same basic semantics as their 32-bit +-- counterparts, however, their syntax has been extended +-- to 64 bits. +-- + +ifHCInOctets OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received on the interface, + including framing characters. This object is a 64-bit + version of ifInOctets. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 6 } + +ifHCInUcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of packets, delivered by this sub-layer to a + higher (sub-)layer, which were not addressed to a multicast + or broadcast address at this sub-layer. This object is a + 64-bit version of ifInUcastPkts. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 7 } + +ifHCInMulticastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + + + "The number of packets, delivered by this sub-layer to a + higher (sub-)layer, which were addressed to a multicast + address at this sub-layer. For a MAC layer protocol, this + includes both Group and Functional addresses. This object + is a 64-bit version of ifInMulticastPkts. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 8 } + +ifHCInBroadcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of packets, delivered by this sub-layer to a + higher (sub-)layer, which were addressed to a broadcast + address at this sub-layer. This object is a 64-bit version + of ifInBroadcastPkts. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 9 } + +ifHCOutOctets OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets transmitted out of the + interface, including framing characters. This object is a + 64-bit version of ifOutOctets. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 10 } + +ifHCOutUcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + + + "The total number of packets that higher-level protocols + requested be transmitted, and which were not addressed to a + multicast or broadcast address at this sub-layer, including + those that were discarded or not sent. This object is a + 64-bit version of ifOutUcastPkts. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 11 } + +ifHCOutMulticastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of packets that higher-level protocols + requested be transmitted, and which were addressed to a + multicast address at this sub-layer, including those that + were discarded or not sent. For a MAC layer protocol, this + includes both Group and Functional addresses. This object + is a 64-bit version of ifOutMulticastPkts. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 12 } + +ifHCOutBroadcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of packets that higher-level protocols + requested be transmitted, and which were addressed to a + broadcast address at this sub-layer, including those that + were discarded or not sent. This object is a 64-bit version + of ifOutBroadcastPkts. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ifCounterDiscontinuityTime." + ::= { ifXEntry 13 } + +ifLinkUpDownTrapEnable OBJECT-TYPE + + + SYNTAX INTEGER { enabled(1), disabled(2) } + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "Indicates whether linkUp/linkDown traps should be generated + for this interface. + + By default, this object should have the value enabled(1) for + interfaces which do not operate on 'top' of any other + interface (as defined in the ifStackTable), and disabled(2) + otherwise." + ::= { ifXEntry 14 } + +ifHighSpeed OBJECT-TYPE + SYNTAX Gauge32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "An estimate of the interface's current bandwidth in units + of 1,000,000 bits per second. If this object reports a + value of `n' then the speed of the interface is somewhere in + the range of `n-500,000' to `n+499,999'. For interfaces + which do not vary in bandwidth or for those where no + accurate estimation can be made, this object should contain + the nominal bandwidth. For a sub-layer which has no concept + of bandwidth, this object should be zero." + ::= { ifXEntry 15 } + +ifPromiscuousMode OBJECT-TYPE + SYNTAX TruthValue + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "This object has a value of false(2) if this interface only + accepts packets/frames that are addressed to this station. + This object has a value of true(1) when the station accepts + all packets/frames transmitted on the media. The value + true(1) is only legal on certain types of media. If legal, + setting this object to a value of true(1) may require the + interface to be reset before becoming effective. + + The value of ifPromiscuousMode does not affect the reception + of broadcast and multicast packets/frames by the interface." + ::= { ifXEntry 16 } + +ifConnectorPresent OBJECT-TYPE + SYNTAX TruthValue + MAX-ACCESS read-only + + + STATUS current + DESCRIPTION + "This object has the value 'true(1)' if the interface + sublayer has a physical connector and the value 'false(2)' + otherwise." + ::= { ifXEntry 17 } + +ifAlias OBJECT-TYPE + SYNTAX DisplayString (SIZE(0..64)) + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "This object is an 'alias' name for the interface as + specified by a network manager, and provides a non-volatile + 'handle' for the interface. + + On the first instantiation of an interface, the value of + ifAlias associated with that interface is the zero-length + string. As and when a value is written into an instance of + ifAlias through a network management set operation, then the + agent must retain the supplied value in the ifAlias instance + associated with the same interface for as long as that + interface remains instantiated, including across all re- + initializations/reboots of the network management system, + including those which result in a change of the interface's + ifIndex value. + + An example of the value which a network manager might store + in this object for a WAN interface is the (Telco's) circuit + number/identifier of the interface. + + Some agents may support write-access only for interfaces + having particular values of ifType. An agent which supports + write access to this object is required to keep the value in + non-volatile storage, but it may limit the length of new + values depending on how much storage is already occupied by + the current values for other interfaces." + ::= { ifXEntry 18 } + +ifCounterDiscontinuityTime OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime on the most recent occasion at which + any one or more of this interface's counters suffered a + discontinuity. The relevant counters are the specific + instances associated with this interface of any Counter32 or + + + Counter64 object contained in the ifTable or ifXTable. If + no such discontinuities have occurred since the last re- + initialization of the local management subsystem, then this + object contains a zero value." + ::= { ifXEntry 19 } + +-- The Interface Stack Group +-- +-- Implementation of this group is optional, but strongly recommended +-- for all systems +-- + +ifStackTable OBJECT-TYPE + SYNTAX SEQUENCE OF IfStackEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table containing information on the relationships + between the multiple sub-layers of network interfaces. In + particular, it contains information on which sub-layers run + 'on top of' which other sub-layers, where each sub-layer + corresponds to a conceptual row in the ifTable. For + example, when the sub-layer with ifIndex value x runs over + the sub-layer with ifIndex value y, then this table + contains: + + ifStackStatus.x.y=active + + For each ifIndex value, I, which identifies an active + interface, there are always at least two instantiated rows + in this table associated with I. For one of these rows, I + is the value of ifStackHigherLayer; for the other, I is the + value of ifStackLowerLayer. (If I is not involved in + multiplexing, then these are the only two rows associated + with I.) + + For example, two rows exist even for an interface which has + no others stacked on top or below it: + + ifStackStatus.0.x=active + ifStackStatus.x.0=active " + ::= { ifMIBObjects 2 } + + +ifStackEntry OBJECT-TYPE + SYNTAX IfStackEntry + MAX-ACCESS not-accessible + STATUS current + + + DESCRIPTION + "Information on a particular relationship between two sub- + layers, specifying that one sub-layer runs on 'top' of the + other sub-layer. Each sub-layer corresponds to a conceptual + row in the ifTable." + INDEX { ifStackHigherLayer, ifStackLowerLayer } + ::= { ifStackTable 1 } + + +IfStackEntry ::= + SEQUENCE { + ifStackHigherLayer InterfaceIndexOrZero, + ifStackLowerLayer InterfaceIndexOrZero, + ifStackStatus RowStatus + } + + +ifStackHigherLayer OBJECT-TYPE + SYNTAX InterfaceIndexOrZero + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The value of ifIndex corresponding to the higher sub-layer + of the relationship, i.e., the sub-layer which runs on 'top' + of the sub-layer identified by the corresponding instance of + ifStackLowerLayer. If there is no higher sub-layer (below + the internetwork layer), then this object has the value 0." + ::= { ifStackEntry 1 } + + +ifStackLowerLayer OBJECT-TYPE + SYNTAX InterfaceIndexOrZero + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The value of ifIndex corresponding to the lower sub-layer + of the relationship, i.e., the sub-layer which runs 'below' + the sub-layer identified by the corresponding instance of + ifStackHigherLayer. If there is no lower sub-layer, then + this object has the value 0." + ::= { ifStackEntry 2 } + + +ifStackStatus OBJECT-TYPE + SYNTAX RowStatus + MAX-ACCESS read-create + STATUS current + DESCRIPTION + + + "The status of the relationship between two sub-layers. + + Changing the value of this object from 'active' to + 'notInService' or 'destroy' will likely have consequences up + and down the interface stack. Thus, write access to this + object is likely to be inappropriate for some types of + interfaces, and many implementations will choose not to + support write-access for any type of interface." + ::= { ifStackEntry 3 } + +ifStackLastChange OBJECT-TYPE + SYNTAX TimeTicks + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime at the time of the last change of + the (whole) interface stack. A change of the interface + stack is defined to be any creation, deletion, or change in + value of any instance of ifStackStatus. If the interface + stack has been unchanged since the last re-initialization of + the local network management subsystem, then this object + contains a zero value." + ::= { ifMIBObjects 6 } + + +-- Generic Receive Address Table +-- +-- This group of objects is mandatory for all types of +-- interfaces which can receive packets/frames addressed to +-- more than one address. +-- +-- This table replaces the ifExtnsRcvAddr table. The main +-- difference is that this table makes use of the RowStatus +-- textual convention, while ifExtnsRcvAddr did not. + +ifRcvAddressTable OBJECT-TYPE + SYNTAX SEQUENCE OF IfRcvAddressEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "This table contains an entry for each address (broadcast, + multicast, or uni-cast) for which the system will receive + packets/frames on a particular interface, except as follows: + + - for an interface operating in promiscuous mode, entries + are only required for those addresses for which the system + would receive frames were it not operating in promiscuous + mode. + + + - for 802.5 functional addresses, only one entry is + required, for the address which has the functional address + bit ANDed with the bit mask of all functional addresses for + which the interface will accept frames. + + A system is normally able to use any unicast address which + corresponds to an entry in this table as a source address." + ::= { ifMIBObjects 4 } + +ifRcvAddressEntry OBJECT-TYPE + SYNTAX IfRcvAddressEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A list of objects identifying an address for which the + system will accept packets/frames on the particular + interface identified by the index value ifIndex." + INDEX { ifIndex, ifRcvAddressAddress } + ::= { ifRcvAddressTable 1 } + +IfRcvAddressEntry ::= + SEQUENCE { + ifRcvAddressAddress PhysAddress, + ifRcvAddressStatus RowStatus, + ifRcvAddressType INTEGER + } + +ifRcvAddressAddress OBJECT-TYPE + SYNTAX PhysAddress + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An address for which the system will accept packets/frames + on this entry's interface." + ::= { ifRcvAddressEntry 1 } + +ifRcvAddressStatus OBJECT-TYPE + SYNTAX RowStatus + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "This object is used to create and delete rows in the + ifRcvAddressTable." + + ::= { ifRcvAddressEntry 2 } + +ifRcvAddressType OBJECT-TYPE + SYNTAX INTEGER { + + + other(1), + volatile(2), + nonVolatile(3) + } + + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "This object has the value nonVolatile(3) for those entries + in the table which are valid and will not be deleted by the + next restart of the managed system. Entries having the + value volatile(2) are valid and exist, but have not been + saved, so that will not exist after the next restart of the + managed system. Entries having the value other(1) are valid + and exist but are not classified as to whether they will + continue to exist after the next restart." + + DEFVAL { volatile } + ::= { ifRcvAddressEntry 3 } + +-- definition of interface-related traps. + +linkDown NOTIFICATION-TYPE + OBJECTS { ifIndex, ifAdminStatus, ifOperStatus } + STATUS current + DESCRIPTION + "A linkDown trap signifies that the SNMP entity, acting in + an agent role, has detected that the ifOperStatus object for + one of its communication links is about to enter the down + state from some other state (but not from the notPresent + state). This other state is indicated by the included value + of ifOperStatus." + ::= { snmpTraps 3 } + +linkUp NOTIFICATION-TYPE + OBJECTS { ifIndex, ifAdminStatus, ifOperStatus } + STATUS current + DESCRIPTION + "A linkUp trap signifies that the SNMP entity, acting in an + agent role, has detected that the ifOperStatus object for + one of its communication links left the down state and + transitioned into some other state (but not into the + notPresent state). This other state is indicated by the + included value of ifOperStatus." + ::= { snmpTraps 4 } + +-- conformance information + + + +ifConformance OBJECT IDENTIFIER ::= { ifMIB 2 } + +ifGroups OBJECT IDENTIFIER ::= { ifConformance 1 } +ifCompliances OBJECT IDENTIFIER ::= { ifConformance 2 } + + +-- compliance statements + +ifCompliance3 MODULE-COMPLIANCE + STATUS current + DESCRIPTION + "The compliance statement for SNMP entities which have + network interfaces." + + MODULE -- this module + MANDATORY-GROUPS { ifGeneralInformationGroup, + linkUpDownNotificationsGroup } + +-- The groups: +-- ifFixedLengthGroup +-- ifHCFixedLengthGroup +-- ifPacketGroup +-- ifHCPacketGroup +-- ifVHCPacketGroup +-- are mutually exclusive; at most one of these groups is implemented +-- for a particular interface. When any of these groups is implemented +-- for a particular interface, then ifCounterDiscontinuityGroup must +-- also be implemented for that interface. + + + GROUP ifFixedLengthGroup + DESCRIPTION + "This group is mandatory for those network interfaces which + are character-oriented or transmit data in fixed-length + transmission units, and for which the value of the + corresponding instance of ifSpeed is less than or equal to + 20,000,000 bits/second." + + GROUP ifHCFixedLengthGroup + DESCRIPTION + "This group is mandatory for those network interfaces which + are character-oriented or transmit data in fixed-length + transmission units, and for which the value of the + corresponding instance of ifSpeed is greater than 20,000,000 + bits/second." + + GROUP ifPacketGroup + DESCRIPTION + + + "This group is mandatory for those network interfaces which + are packet-oriented, and for which the value of the + corresponding instance of ifSpeed is less than or equal to + 20,000,000 bits/second." + + GROUP ifHCPacketGroup + DESCRIPTION + "This group is mandatory only for those network interfaces + which are packet-oriented and for which the value of the + corresponding instance of ifSpeed is greater than 20,000,000 + bits/second but less than or equal to 650,000,000 + bits/second." + + GROUP ifVHCPacketGroup + DESCRIPTION + "This group is mandatory only for those network interfaces + which are packet-oriented and for which the value of the + corresponding instance of ifSpeed is greater than + 650,000,000 bits/second." + + + GROUP ifCounterDiscontinuityGroup + DESCRIPTION + "This group is mandatory for those network interfaces that + are required to maintain counters (i.e., those for which one + of the ifFixedLengthGroup, ifHCFixedLengthGroup, + ifPacketGroup, ifHCPacketGroup, or ifVHCPacketGroup is + mandatory)." + + + GROUP ifRcvAddressGroup + DESCRIPTION + "The applicability of this group MUST be defined by the + media-specific MIBs. Media-specific MIBs must define the + exact meaning, use, and semantics of the addresses in this + group." + + OBJECT ifLinkUpDownTrapEnable + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required." + + OBJECT ifPromiscuousMode + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required." + + OBJECT ifAdminStatus + + + SYNTAX INTEGER { up(1), down(2) } + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required, nor is support for the value + testing(3)." + + OBJECT ifAlias + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required." + + ::= { ifCompliances 3 } + +-- units of conformance + +ifGeneralInformationGroup OBJECT-GROUP + OBJECTS { ifIndex, ifDescr, ifType, ifSpeed, ifPhysAddress, + ifAdminStatus, ifOperStatus, ifLastChange, + ifLinkUpDownTrapEnable, ifConnectorPresent, + ifHighSpeed, ifName, ifNumber, ifAlias, + ifTableLastChange } + STATUS current + DESCRIPTION + "A collection of objects providing information applicable to + all network interfaces." + ::= { ifGroups 10 } + +-- the following five groups are mutually exclusive; at most +-- one of these groups is implemented for any interface + +ifFixedLengthGroup OBJECT-GROUP + OBJECTS { ifInOctets, ifOutOctets, ifInUnknownProtos, + ifInErrors, ifOutErrors } + STATUS current + DESCRIPTION + "A collection of objects providing information specific to + non-high speed (non-high speed interfaces transmit and + receive at speeds less than or equal to 20,000,000 + bits/second) character-oriented or fixed-length-transmission + network interfaces." + ::= { ifGroups 2 } + +ifHCFixedLengthGroup OBJECT-GROUP + OBJECTS { ifHCInOctets, ifHCOutOctets, + ifInOctets, ifOutOctets, ifInUnknownProtos, + ifInErrors, ifOutErrors } + STATUS current + DESCRIPTION + + + "A collection of objects providing information specific to + high speed (greater than 20,000,000 bits/second) character- + oriented or fixed-length-transmission network interfaces." + ::= { ifGroups 3 } + +ifPacketGroup OBJECT-GROUP + OBJECTS { ifInOctets, ifOutOctets, ifInUnknownProtos, + ifInErrors, ifOutErrors, + ifMtu, ifInUcastPkts, ifInMulticastPkts, + ifInBroadcastPkts, ifInDiscards, + ifOutUcastPkts, ifOutMulticastPkts, + ifOutBroadcastPkts, ifOutDiscards, + ifPromiscuousMode } + STATUS current + DESCRIPTION + "A collection of objects providing information specific to + non-high speed (non-high speed interfaces transmit and + receive at speeds less than or equal to 20,000,000 + bits/second) packet-oriented network interfaces." + ::= { ifGroups 4 } + +ifHCPacketGroup OBJECT-GROUP + OBJECTS { ifHCInOctets, ifHCOutOctets, + ifInOctets, ifOutOctets, ifInUnknownProtos, + ifInErrors, ifOutErrors, + ifMtu, ifInUcastPkts, ifInMulticastPkts, + ifInBroadcastPkts, ifInDiscards, + ifOutUcastPkts, ifOutMulticastPkts, + ifOutBroadcastPkts, ifOutDiscards, + ifPromiscuousMode } + STATUS current + DESCRIPTION + "A collection of objects providing information specific to + high speed (greater than 20,000,000 bits/second but less + than or equal to 650,000,000 bits/second) packet-oriented + network interfaces." + ::= { ifGroups 5 } + +ifVHCPacketGroup OBJECT-GROUP + OBJECTS { ifHCInUcastPkts, ifHCInMulticastPkts, + ifHCInBroadcastPkts, ifHCOutUcastPkts, + ifHCOutMulticastPkts, ifHCOutBroadcastPkts, + ifHCInOctets, ifHCOutOctets, + ifInOctets, ifOutOctets, ifInUnknownProtos, + ifInErrors, ifOutErrors, + ifMtu, ifInUcastPkts, ifInMulticastPkts, + ifInBroadcastPkts, ifInDiscards, + ifOutUcastPkts, ifOutMulticastPkts, + + + ifOutBroadcastPkts, ifOutDiscards, + ifPromiscuousMode } + STATUS current + DESCRIPTION + "A collection of objects providing information specific to + higher speed (greater than 650,000,000 bits/second) packet- + oriented network interfaces." + ::= { ifGroups 6 } + +ifRcvAddressGroup OBJECT-GROUP + OBJECTS { ifRcvAddressStatus, ifRcvAddressType } + STATUS current + DESCRIPTION + "A collection of objects providing information on the + multiple addresses which an interface receives." + ::= { ifGroups 7 } + +ifStackGroup2 OBJECT-GROUP + OBJECTS { ifStackStatus, ifStackLastChange } + STATUS current + DESCRIPTION + "A collection of objects providing information on the + layering of MIB-II interfaces." + ::= { ifGroups 11 } + +ifCounterDiscontinuityGroup OBJECT-GROUP + OBJECTS { ifCounterDiscontinuityTime } + STATUS current + DESCRIPTION + "A collection of objects providing information specific to + interface counter discontinuities." + ::= { ifGroups 13 } + +linkUpDownNotificationsGroup NOTIFICATION-GROUP + NOTIFICATIONS { linkUp, linkDown } + STATUS current + DESCRIPTION + "The notifications which indicate specific changes in the + value of ifOperStatus." + ::= { ifGroups 14 } + +-- Deprecated Definitions - Objects + + +-- +-- The Interface Test Table +-- +-- This group of objects is optional. However, a media-specific + + +-- MIB may make implementation of this group mandatory. +-- +-- This table replaces the ifExtnsTestTable +-- + +ifTestTable OBJECT-TYPE + SYNTAX SEQUENCE OF IfTestEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "This table contains one entry per interface. It defines + objects which allow a network manager to instruct an agent + to test an interface for various faults. Tests for an + interface are defined in the media-specific MIB for that + interface. After invoking a test, the object ifTestResult + can be read to determine the outcome. If an agent can not + perform the test, ifTestResult is set to so indicate. The + object ifTestCode can be used to provide further test- + specific or interface-specific (or even enterprise-specific) + information concerning the outcome of the test. Only one + test can be in progress on each interface at any one time. + If one test is in progress when another test is invoked, the + second test is rejected. Some agents may reject a test when + a prior test is active on another interface. + + Before starting a test, a manager-station must first obtain + 'ownership' of the entry in the ifTestTable for the + interface to be tested. This is accomplished with the + ifTestId and ifTestStatus objects as follows: + + try_again: + get (ifTestId, ifTestStatus) + while (ifTestStatus != notInUse) + /* + * Loop while a test is running or some other + * manager is configuring a test. + */ + short delay + get (ifTestId, ifTestStatus) + } + + /* + * Is not being used right now -- let's compete + * to see who gets it. + */ + lock_value = ifTestId + + if ( set(ifTestId = lock_value, ifTestStatus = inUse, + + + ifTestOwner = 'my-IP-address') == FAILURE) + /* + * Another manager got the ifTestEntry -- go + * try again + */ + goto try_again; + + /* + * I have the lock + */ + set up any test parameters. + + /* + * This starts the test + */ + set(ifTestType = test_to_run); + + wait for test completion by polling ifTestResult + + when test completes, agent sets ifTestResult + agent also sets ifTestStatus = 'notInUse' + + retrieve any additional test results, and ifTestId + + if (ifTestId == lock_value+1) results are valid + + A manager station first retrieves the value of the + appropriate ifTestId and ifTestStatus objects, periodically + repeating the retrieval if necessary, until the value of + ifTestStatus is 'notInUse'. The manager station then tries + to set the same ifTestId object to the value it just + retrieved, the same ifTestStatus object to 'inUse', and the + corresponding ifTestOwner object to a value indicating + itself. If the set operation succeeds then the manager has + obtained ownership of the ifTestEntry, and the value of the + ifTestId object is incremented by the agent (per the + semantics of TestAndIncr). Failure of the set operation + indicates that some other manager has obtained ownership of + the ifTestEntry. + + Once ownership is obtained, any test parameters can be + setup, and then the test is initiated by setting ifTestType. + On completion of the test, the agent sets ifTestStatus to + 'notInUse'. Once this occurs, the manager can retrieve the + results. In the (rare) event that the invocation of tests + by two network managers were to overlap, then there would be + a possibility that the first test's results might be + overwritten by the second test's results prior to the first + + + results being read. This unlikely circumstance can be + detected by a network manager retrieving ifTestId at the + same time as retrieving the test results, and ensuring that + the results are for the desired request. + + If ifTestType is not set within an abnormally long period of + time after ownership is obtained, the agent should time-out + the manager, and reset the value of the ifTestStatus object + back to 'notInUse'. It is suggested that this time-out + period be 5 minutes. + + In general, a management station must not retransmit a + request to invoke a test for which it does not receive a + response; instead, it properly inspects an agent's MIB to + determine if the invocation was successful. Only if the + invocation was unsuccessful, is the invocation request + retransmitted. + + Some tests may require the interface to be taken off-line in + order to execute them, or may even require the agent to + reboot after completion of the test. In these + circumstances, communication with the management station + invoking the test may be lost until after completion of the + test. An agent is not required to support such tests. + However, if such tests are supported, then the agent should + make every effort to transmit a response to the request + which invoked the test prior to losing communication. When + the agent is restored to normal service, the results of the + test are properly made available in the appropriate objects. + Note that this requires that the ifIndex value assigned to + an interface must be unchanged even if the test causes a + reboot. An agent must reject any test for which it cannot, + perhaps due to resource constraints, make available at least + the minimum amount of information after that test + completes." + ::= { ifMIBObjects 3 } + +ifTestEntry OBJECT-TYPE + SYNTAX IfTestEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "An entry containing objects for invoking tests on an + interface." + AUGMENTS { ifEntry } + ::= { ifTestTable 1 } + +IfTestEntry ::= + + + SEQUENCE { + ifTestId TestAndIncr, + ifTestStatus INTEGER, + ifTestType AutonomousType, + ifTestResult INTEGER, + ifTestCode OBJECT IDENTIFIER, + ifTestOwner OwnerString + } + +ifTestId OBJECT-TYPE + SYNTAX TestAndIncr + MAX-ACCESS read-write + STATUS deprecated + DESCRIPTION + "This object identifies the current invocation of the + interface's test." + ::= { ifTestEntry 1 } + +ifTestStatus OBJECT-TYPE + SYNTAX INTEGER { notInUse(1), inUse(2) } + MAX-ACCESS read-write + STATUS deprecated + DESCRIPTION + "This object indicates whether or not some manager currently + has the necessary 'ownership' required to invoke a test on + this interface. A write to this object is only successful + when it changes its value from 'notInUse(1)' to 'inUse(2)'. + After completion of a test, the agent resets the value back + to 'notInUse(1)'." + ::= { ifTestEntry 2 } + +ifTestType OBJECT-TYPE + SYNTAX AutonomousType + MAX-ACCESS read-write + STATUS deprecated + DESCRIPTION + "A control variable used to start and stop operator- + initiated interface tests. Most OBJECT IDENTIFIER values + assigned to tests are defined elsewhere, in association with + specific types of interface. However, this document assigns + a value for a full-duplex loopback test, and defines the + special meanings of the subject identifier: + + noTest OBJECT IDENTIFIER ::= { 0 0 } + + When the value noTest is written to this object, no action + is taken unless a test is in progress, in which case the + test is aborted. Writing any other value to this object is + + + only valid when no test is currently in progress, in which + case the indicated test is initiated. + + When read, this object always returns the most recent value + that ifTestType was set to. If it has not been set since + the last initialization of the network management subsystem + on the agent, a value of noTest is returned." + ::= { ifTestEntry 3 } + +ifTestResult OBJECT-TYPE + SYNTAX INTEGER { + none(1), -- no test yet requested + success(2), + inProgress(3), + notSupported(4), + unAbleToRun(5), -- due to state of system + aborted(6), + failed(7) + } + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "This object contains the result of the most recently + requested test, or the value none(1) if no tests have been + requested since the last reset. Note that this facility + provides no provision for saving the results of one test + when starting another, as could be required if used by + multiple managers concurrently." + ::= { ifTestEntry 4 } + +ifTestCode OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "This object contains a code which contains more specific + information on the test result, for example an error-code + after a failed test. Error codes and other values this + object may take are specific to the type of interface and/or + test. The value may have the semantics of either the + AutonomousType or InstancePointer textual conventions as + defined in RFC 2579. The identifier: + + testCodeUnknown OBJECT IDENTIFIER ::= { 0 0 } + + is defined for use if no additional result code is + available." + ::= { ifTestEntry 5 } + + +ifTestOwner OBJECT-TYPE + SYNTAX OwnerString + MAX-ACCESS read-write + STATUS deprecated + DESCRIPTION + "The entity which currently has the 'ownership' required to + invoke a test on this interface." + ::= { ifTestEntry 6 } + +-- Deprecated Definitions - Groups + + +ifGeneralGroup OBJECT-GROUP + OBJECTS { ifDescr, ifType, ifSpeed, ifPhysAddress, + ifAdminStatus, ifOperStatus, ifLastChange, + ifLinkUpDownTrapEnable, ifConnectorPresent, + ifHighSpeed, ifName } + STATUS deprecated + DESCRIPTION + "A collection of objects deprecated in favour of + ifGeneralInformationGroup." + ::= { ifGroups 1 } + + +ifTestGroup OBJECT-GROUP + OBJECTS { ifTestId, ifTestStatus, ifTestType, + ifTestResult, ifTestCode, ifTestOwner } + STATUS deprecated + DESCRIPTION + "A collection of objects providing the ability to invoke + tests on an interface." + ::= { ifGroups 8 } + + +ifStackGroup OBJECT-GROUP + OBJECTS { ifStackStatus } + STATUS deprecated + DESCRIPTION + "The previous collection of objects providing information on + the layering of MIB-II interfaces." + ::= { ifGroups 9 } + + +ifOldObjectsGroup OBJECT-GROUP + OBJECTS { ifInNUcastPkts, ifOutNUcastPkts, + ifOutQLen, ifSpecific } + STATUS deprecated + DESCRIPTION + + + "The collection of objects deprecated from the original MIB- + II interfaces group." + ::= { ifGroups 12 } + +-- Deprecated Definitions - Compliance + +ifCompliance MODULE-COMPLIANCE + STATUS deprecated + DESCRIPTION + "A compliance statement defined in a previous version of + this MIB module, for SNMP entities which have network + interfaces." + + MODULE -- this module + MANDATORY-GROUPS { ifGeneralGroup, ifStackGroup } + + GROUP ifFixedLengthGroup + DESCRIPTION + "This group is mandatory for all network interfaces which + are character-oriented or transmit data in fixed-length + transmission units." + + GROUP ifHCFixedLengthGroup + DESCRIPTION + "This group is mandatory only for those network interfaces + which are character-oriented or transmit data in fixed- + length transmission units, and for which the value of the + corresponding instance of ifSpeed is greater than 20,000,000 + bits/second." + + GROUP ifPacketGroup + DESCRIPTION + "This group is mandatory for all network interfaces which + are packet-oriented." + + GROUP ifHCPacketGroup + DESCRIPTION + "This group is mandatory only for those network interfaces + which are packet-oriented and for which the value of the + corresponding instance of ifSpeed is greater than + 650,000,000 bits/second." + + GROUP ifTestGroup + DESCRIPTION + "This group is optional. Media-specific MIBs which require + interface tests are strongly encouraged to use this group + for invoking tests and reporting results. A medium specific + MIB which has mandatory tests may make implementation of + + + this group mandatory." + + GROUP ifRcvAddressGroup + DESCRIPTION + "The applicability of this group MUST be defined by the + media-specific MIBs. Media-specific MIBs must define the + exact meaning, use, and semantics of the addresses in this + group." + + OBJECT ifLinkUpDownTrapEnable + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required." + + OBJECT ifPromiscuousMode + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required." + + OBJECT ifStackStatus + SYNTAX INTEGER { active(1) } -- subset of RowStatus + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required, and only one of the six + enumerated values for the RowStatus textual convention need + be supported, specifically: active(1)." + + OBJECT ifAdminStatus + SYNTAX INTEGER { up(1), down(2) } + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required, nor is support for the value + testing(3)." + ::= { ifCompliances 1 } + +ifCompliance2 MODULE-COMPLIANCE + STATUS deprecated + DESCRIPTION + "A compliance statement defined in a previous version of + this MIB module, for SNMP entities which have network + interfaces." + + MODULE -- this module + MANDATORY-GROUPS { ifGeneralInformationGroup, ifStackGroup2, + ifCounterDiscontinuityGroup } + + GROUP ifFixedLengthGroup + DESCRIPTION + + + "This group is mandatory for all network interfaces which + are character-oriented or transmit data in fixed-length + transmission units." + + GROUP ifHCFixedLengthGroup + DESCRIPTION + "This group is mandatory only for those network interfaces + which are character-oriented or transmit data in fixed- + length transmission units, and for which the value of the + corresponding instance of ifSpeed is greater than 20,000,000 + bits/second." + + GROUP ifPacketGroup + DESCRIPTION + "This group is mandatory for all network interfaces which + are packet-oriented." + + GROUP ifHCPacketGroup + DESCRIPTION + "This group is mandatory only for those network interfaces + which are packet-oriented and for which the value of the + corresponding instance of ifSpeed is greater than + 650,000,000 bits/second." + + GROUP ifRcvAddressGroup + DESCRIPTION + "The applicability of this group MUST be defined by the + media-specific MIBs. Media-specific MIBs must define the + exact meaning, use, and semantics of the addresses in this + group." + + OBJECT ifLinkUpDownTrapEnable + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required." + + OBJECT ifPromiscuousMode + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required." + + OBJECT ifStackStatus + SYNTAX INTEGER { active(1) } -- subset of RowStatus + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required, and only one of the six + enumerated values for the RowStatus textual convention need + be supported, specifically: active(1)." + + + OBJECT ifAdminStatus + SYNTAX INTEGER { up(1), down(2) } + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required, nor is support for the value + testing(3)." + + OBJECT ifAlias + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required." + + ::= { ifCompliances 2 } + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/INET-ADDRESS-MIB b/contrib/apps/LwipMibCompiler/Mibs/INET-ADDRESS-MIB new file mode 100644 index 00000000..a19b8d22 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/INET-ADDRESS-MIB @@ -0,0 +1,421 @@ +INET-ADDRESS-MIB DEFINITIONS ::= BEGIN + +IMPORTS + MODULE-IDENTITY, mib-2, Unsigned32 FROM SNMPv2-SMI + TEXTUAL-CONVENTION FROM SNMPv2-TC; + +inetAddressMIB MODULE-IDENTITY + LAST-UPDATED "200502040000Z" + ORGANIZATION + "IETF Operations and Management Area" + CONTACT-INFO + "Juergen Schoenwaelder (Editor) + International University Bremen + P.O. Box 750 561 + 28725 Bremen, Germany + + Phone: +49 421 200-3587 + EMail: j.schoenwaelder@iu-bremen.de + + Send comments to ." + DESCRIPTION + "This MIB module defines textual conventions for + representing Internet addresses. An Internet + address can be an IPv4 address, an IPv6 address, + or a DNS domain name. This module also defines + textual conventions for Internet port numbers, + autonomous system numbers, and the length of an + Internet address prefix. + + Copyright (C) The Internet Society (2005). This version + of this MIB module is part of RFC 4001, see the RFC + itself for full legal notices." + REVISION "200502040000Z" + DESCRIPTION + "Third version, published as RFC 4001. This revision + introduces the InetZoneIndex, InetScopeType, and + InetVersion textual conventions." + REVISION "200205090000Z" + DESCRIPTION + "Second version, published as RFC 3291. This + revision contains several clarifications and + introduces several new textual conventions: + InetAddressPrefixLength, InetPortNumber, + InetAutonomousSystemNumber, InetAddressIPv4z, + and InetAddressIPv6z." + REVISION "200006080000Z" + + + + DESCRIPTION + "Initial version, published as RFC 2851." + ::= { mib-2 76 } + +InetAddressType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "A value that represents a type of Internet address. + + unknown(0) An unknown address type. This value MUST + be used if the value of the corresponding + InetAddress object is a zero-length string. + It may also be used to indicate an IP address + that is not in one of the formats defined + below. + + ipv4(1) An IPv4 address as defined by the + InetAddressIPv4 textual convention. + + ipv6(2) An IPv6 address as defined by the + InetAddressIPv6 textual convention. + + ipv4z(3) A non-global IPv4 address including a zone + index as defined by the InetAddressIPv4z + textual convention. + + ipv6z(4) A non-global IPv6 address including a zone + index as defined by the InetAddressIPv6z + textual convention. + + dns(16) A DNS domain name as defined by the + InetAddressDNS textual convention. + + Each definition of a concrete InetAddressType value must be + accompanied by a definition of a textual convention for use + with that InetAddressType. + + To support future extensions, the InetAddressType textual + convention SHOULD NOT be sub-typed in object type definitions. + It MAY be sub-typed in compliance statements in order to + require only a subset of these address types for a compliant + implementation. + + Implementations must ensure that InetAddressType objects + and any dependent objects (e.g., InetAddress objects) are + consistent. An inconsistentValue error must be generated + if an attempt to change an InetAddressType object would, + for example, lead to an undefined InetAddress value. In + + + + particular, InetAddressType/InetAddress pairs must be + changed together if the address type changes (e.g., from + ipv6(2) to ipv4(1))." + SYNTAX INTEGER { + unknown(0), + ipv4(1), + ipv6(2), + ipv4z(3), + ipv6z(4), + dns(16) + } + +InetAddress ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Denotes a generic Internet address. + + An InetAddress value is always interpreted within the context + of an InetAddressType value. Every usage of the InetAddress + textual convention is required to specify the InetAddressType + object that provides the context. It is suggested that the + InetAddressType object be logically registered before the + object(s) that use the InetAddress textual convention, if + they appear in the same logical row. + + The value of an InetAddress object must always be + consistent with the value of the associated InetAddressType + object. Attempts to set an InetAddress object to a value + inconsistent with the associated InetAddressType + must fail with an inconsistentValue error. + + When this textual convention is used as the syntax of an + index object, there may be issues with the limit of 128 + sub-identifiers specified in SMIv2, STD 58. In this case, + the object definition MUST include a 'SIZE' clause to + limit the number of potential instance sub-identifiers; + otherwise the applicable constraints MUST be stated in + the appropriate conceptual row DESCRIPTION clauses, or + in the surrounding documentation if there is no single + DESCRIPTION clause that is appropriate." + SYNTAX OCTET STRING (SIZE (0..255)) + +InetAddressIPv4 ::= TEXTUAL-CONVENTION + DISPLAY-HINT "1d.1d.1d.1d" + STATUS current + DESCRIPTION + "Represents an IPv4 network address: + + + + + Octets Contents Encoding + 1-4 IPv4 address network-byte order + + The corresponding InetAddressType value is ipv4(1). + + This textual convention SHOULD NOT be used directly in object + definitions, as it restricts addresses to a specific format. + However, if it is used, it MAY be used either on its own or in + conjunction with InetAddressType, as a pair." + SYNTAX OCTET STRING (SIZE (4)) + +InetAddressIPv6 ::= TEXTUAL-CONVENTION + DISPLAY-HINT "2x:2x:2x:2x:2x:2x:2x:2x" + STATUS current + DESCRIPTION + "Represents an IPv6 network address: + + Octets Contents Encoding + 1-16 IPv6 address network-byte order + + The corresponding InetAddressType value is ipv6(2). + + This textual convention SHOULD NOT be used directly in object + definitions, as it restricts addresses to a specific format. + However, if it is used, it MAY be used either on its own or in + conjunction with InetAddressType, as a pair." + SYNTAX OCTET STRING (SIZE (16)) + +InetAddressIPv4z ::= TEXTUAL-CONVENTION + DISPLAY-HINT "1d.1d.1d.1d%4d" + STATUS current + DESCRIPTION + "Represents a non-global IPv4 network address, together + with its zone index: + + Octets Contents Encoding + 1-4 IPv4 address network-byte order + 5-8 zone index network-byte order + + The corresponding InetAddressType value is ipv4z(3). + + The zone index (bytes 5-8) is used to disambiguate identical + address values on nodes that have interfaces attached to + different zones of the same scope. The zone index may contain + the special value 0, which refers to the default zone for each + scope. + + This textual convention SHOULD NOT be used directly in object + + + + definitions, as it restricts addresses to a specific format. + However, if it is used, it MAY be used either on its own or in + conjunction with InetAddressType, as a pair." + SYNTAX OCTET STRING (SIZE (8)) + +InetAddressIPv6z ::= TEXTUAL-CONVENTION + DISPLAY-HINT "2x:2x:2x:2x:2x:2x:2x:2x%4d" + STATUS current + DESCRIPTION + "Represents a non-global IPv6 network address, together + with its zone index: + + Octets Contents Encoding + 1-16 IPv6 address network-byte order + 17-20 zone index network-byte order + + The corresponding InetAddressType value is ipv6z(4). + + The zone index (bytes 17-20) is used to disambiguate + identical address values on nodes that have interfaces + attached to different zones of the same scope. The zone index + may contain the special value 0, which refers to the default + zone for each scope. + + This textual convention SHOULD NOT be used directly in object + definitions, as it restricts addresses to a specific format. + However, if it is used, it MAY be used either on its own or in + conjunction with InetAddressType, as a pair." + SYNTAX OCTET STRING (SIZE (20)) + +InetAddressDNS ::= TEXTUAL-CONVENTION + DISPLAY-HINT "255a" + STATUS current + DESCRIPTION + "Represents a DNS domain name. The name SHOULD be fully + qualified whenever possible. + + The corresponding InetAddressType is dns(16). + + The DESCRIPTION clause of InetAddress objects that may have + InetAddressDNS values MUST fully describe how (and when) + these names are to be resolved to IP addresses. + + The resolution of an InetAddressDNS value may require to + query multiple DNS records (e.g., A for IPv4 and AAAA for + IPv6). The order of the resolution process and which DNS + record takes precedence depends on the configuration of the + resolver. + + + + This textual convention SHOULD NOT be used directly in object + definitions, as it restricts addresses to a specific format. + However, if it is used, it MAY be used either on its own or in + conjunction with InetAddressType, as a pair." + SYNTAX OCTET STRING (SIZE (1..255)) + +InetAddressPrefixLength ::= TEXTUAL-CONVENTION + DISPLAY-HINT "d" + STATUS current + DESCRIPTION + "Denotes the length of a generic Internet network address + prefix. A value of n corresponds to an IP address mask + that has n contiguous 1-bits from the most significant + bit (MSB), with all other bits set to 0. + + An InetAddressPrefixLength value is always interpreted within + the context of an InetAddressType value. Every usage of the + InetAddressPrefixLength textual convention is required to + specify the InetAddressType object that provides the + context. It is suggested that the InetAddressType object be + logically registered before the object(s) that use the + InetAddressPrefixLength textual convention, if they appear + in the same logical row. + + InetAddressPrefixLength values larger than + the maximum length of an IP address for a specific + InetAddressType are treated as the maximum significant + value applicable for the InetAddressType. The maximum + significant value is 32 for the InetAddressType + 'ipv4(1)' and 'ipv4z(3)' and 128 for the InetAddressType + 'ipv6(2)' and 'ipv6z(4)'. The maximum significant value + for the InetAddressType 'dns(16)' is 0. + + The value zero is object-specific and must be defined as + part of the description of any object that uses this + syntax. Examples of the usage of zero might include + situations where the Internet network address prefix + is unknown or does not apply. + + The upper bound of the prefix length has been chosen to + be consistent with the maximum size of an InetAddress." + SYNTAX Unsigned32 (0..2040) + +InetPortNumber ::= TEXTUAL-CONVENTION + DISPLAY-HINT "d" + STATUS current + DESCRIPTION + "Represents a 16 bit port number of an Internet transport + + + + layer protocol. Port numbers are assigned by IANA. A + current list of all assignments is available from + . + + The value zero is object-specific and must be defined as + part of the description of any object that uses this + syntax. Examples of the usage of zero might include + situations where a port number is unknown, or when the + value zero is used as a wildcard in a filter." + REFERENCE "STD 6 (RFC 768), STD 7 (RFC 793) and RFC 2960" + SYNTAX Unsigned32 (0..65535) + +InetAutonomousSystemNumber ::= TEXTUAL-CONVENTION + DISPLAY-HINT "d" + STATUS current + DESCRIPTION + "Represents an autonomous system number that identifies an + Autonomous System (AS). An AS is a set of routers under a + single technical administration, using an interior gateway + protocol and common metrics to route packets within the AS, + and using an exterior gateway protocol to route packets to + other ASes'. IANA maintains the AS number space and has + delegated large parts to the regional registries. + + Autonomous system numbers are currently limited to 16 bits + (0..65535). There is, however, work in progress to enlarge the + autonomous system number space to 32 bits. Therefore, this + textual convention uses an Unsigned32 value without a + range restriction in order to support a larger autonomous + system number space." + REFERENCE "RFC 1771, RFC 1930" + SYNTAX Unsigned32 + +InetScopeType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Represents a scope type. This textual convention can be used + in cases where a MIB has to represent different scope types + and there is no context information, such as an InetAddress + object, that implicitly defines the scope type. + + Note that not all possible values have been assigned yet, but + they may be assigned in future revisions of this specification. + Applications should therefore be able to deal with values + not yet assigned." + REFERENCE "RFC 3513" + SYNTAX INTEGER { + -- reserved(0), + + + + interfaceLocal(1), + linkLocal(2), + subnetLocal(3), + adminLocal(4), + siteLocal(5), -- site-local unicast addresses + -- have been deprecated by RFC 3879 + -- unassigned(6), + -- unassigned(7), + organizationLocal(8), + -- unassigned(9), + -- unassigned(10), + -- unassigned(11), + -- unassigned(12), + -- unassigned(13), + global(14) + -- reserved(15) + } + +InetZoneIndex ::= TEXTUAL-CONVENTION + DISPLAY-HINT "d" + STATUS current + DESCRIPTION + "A zone index identifies an instance of a zone of a + specific scope. + + The zone index MUST disambiguate identical address + values. For link-local addresses, the zone index will + typically be the interface index (ifIndex as defined in the + IF-MIB) of the interface on which the address is configured. + + The zone index may contain the special value 0, which refers + to the default zone. The default zone may be used in cases + where the valid zone index is not known (e.g., when a + management application has to write a link-local IPv6 + address without knowing the interface index value). The + default zone SHOULD NOT be used as an easy way out in + cases where the zone index for a non-global IPv6 address + is known." + REFERENCE "RFC4007" + SYNTAX Unsigned32 + +InetVersion ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "A value representing a version of the IP protocol. + + unknown(0) An unknown or unspecified version of the IP + protocol. + + + + ipv4(1) The IPv4 protocol as defined in RFC 791 (STD 5). + + ipv6(2) The IPv6 protocol as defined in RFC 2460. + + Note that this textual convention SHOULD NOT be used to + distinguish different address types associated with IP + protocols. The InetAddressType has been designed for this + purpose." + REFERENCE "RFC 791, RFC 2460" + SYNTAX INTEGER { + unknown(0), + ipv4(1), + ipv6(2) + } +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/IP-MIB b/contrib/apps/LwipMibCompiler/Mibs/IP-MIB new file mode 100644 index 00000000..0a93501b --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/IP-MIB @@ -0,0 +1,5254 @@ +IP-MIB DEFINITIONS ::= BEGIN + +IMPORTS + MODULE-IDENTITY, OBJECT-TYPE, + Integer32, Counter32, IpAddress, + mib-2, Unsigned32, Counter64, + zeroDotZero FROM SNMPv2-SMI + PhysAddress, TruthValue, + TimeStamp, RowPointer, + TEXTUAL-CONVENTION, TestAndIncr, + RowStatus, StorageType FROM SNMPv2-TC + MODULE-COMPLIANCE, OBJECT-GROUP FROM SNMPv2-CONF + InetAddress, InetAddressType, + InetAddressPrefixLength, + InetVersion, InetZoneIndex FROM INET-ADDRESS-MIB + InterfaceIndex FROM IF-MIB; + +ipMIB MODULE-IDENTITY + LAST-UPDATED "200602020000Z" + ORGANIZATION "IETF IPv6 MIB Revision Team" + CONTACT-INFO + "Editor: + + + + Shawn A. Routhier + Interworking Labs + 108 Whispering Pines Dr. Suite 235 + Scotts Valley, CA 95066 + USA + EMail: " + DESCRIPTION + "The MIB module for managing IP and ICMP implementations, but + excluding their management of IP routes. + + Copyright (C) The Internet Society (2006). This version of + this MIB module is part of RFC 4293; see the RFC itself for + full legal notices." + + REVISION "200602020000Z" + DESCRIPTION + "The IP version neutral revision with added IPv6 objects for + ND, default routers, and router advertisements. As well as + being the successor to RFC 2011, this MIB is also the + successor to RFCs 2465 and 2466. Published as RFC 4293." + + REVISION "199411010000Z" + DESCRIPTION + "A separate MIB module (IP-MIB) for IP and ICMP management + objects. Published as RFC 2011." + + REVISION "199103310000Z" + DESCRIPTION + "The initial revision of this MIB module was part of MIB-II, + which was published as RFC 1213." + ::= { mib-2 48} + +-- +-- The textual conventions we define and use in this MIB. +-- + +IpAddressOriginTC ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The origin of the address. + + manual(2) indicates that the address was manually configured + to a specified address, e.g., by user configuration. + + dhcp(4) indicates an address that was assigned to this + system by a DHCP server. + + linklayer(5) indicates an address created by IPv6 stateless + + + + auto-configuration. + + random(6) indicates an address chosen by the system at + random, e.g., an IPv4 address within 169.254/16, or an RFC + 3041 privacy address." + SYNTAX INTEGER { + other(1), + manual(2), + dhcp(4), + linklayer(5), + random(6) + } + +IpAddressStatusTC ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The status of an address. Most of the states correspond to + states from the IPv6 Stateless Address Autoconfiguration + protocol. + + The preferred(1) state indicates that this is a valid + address that can appear as the destination or source address + of a packet. + + The deprecated(2) state indicates that this is a valid but + deprecated address that should no longer be used as a source + address in new communications, but packets addressed to such + an address are processed as expected. + + The invalid(3) state indicates that this isn't a valid + address and it shouldn't appear as the destination or source + address of a packet. + + The inaccessible(4) state indicates that the address is not + accessible because the interface to which this address is + assigned is not operational. + + The unknown(5) state indicates that the status cannot be + determined for some reason. + + The tentative(6) state indicates that the uniqueness of the + address on the link is being verified. Addresses in this + state should not be used for general communication and + should only be used to determine the uniqueness of the + address. + + The duplicate(7) state indicates the address has been + determined to be non-unique on the link and so must not be + + + + used. + + The optimistic(8) state indicates the address is available + for use, subject to restrictions, while its uniqueness on + a link is being verified. + + In the absence of other information, an IPv4 address is + always preferred(1)." + REFERENCE "RFC 2462" + SYNTAX INTEGER { + preferred(1), + deprecated(2), + invalid(3), + inaccessible(4), + unknown(5), + tentative(6), + duplicate(7), + optimistic(8) + } + +IpAddressPrefixOriginTC ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The origin of this prefix. + + manual(2) indicates a prefix that was manually configured. + + wellknown(3) indicates a well-known prefix, e.g., 169.254/16 + for IPv4 auto-configuration or fe80::/10 for IPv6 link-local + addresses. Well known prefixes may be assigned by IANA, + the address registries, or by specification in a standards + track RFC. + + dhcp(4) indicates a prefix that was assigned by a DHCP + server. + + routeradv(5) indicates a prefix learned from a router + advertisement. + + Note: while IpAddressOriginTC and IpAddressPrefixOriginTC + are similar, they are not identical. The first defines how + an address was created, while the second defines how a + prefix was found." + SYNTAX INTEGER { + other(1), + manual(2), + wellknown(3), + dhcp(4), + + + + routeradv(5) + } + +Ipv6AddressIfIdentifierTC ::= TEXTUAL-CONVENTION + DISPLAY-HINT "2x:" + STATUS current + DESCRIPTION + "This data type is used to model IPv6 address + interface identifiers. This is a binary string + of up to 8 octets in network byte-order." + SYNTAX OCTET STRING (SIZE (0..8)) + +-- +-- the IP general group +-- some objects that affect all of IPv4 +-- + +ip OBJECT IDENTIFIER ::= { mib-2 4 } + +ipForwarding OBJECT-TYPE + SYNTAX INTEGER { + forwarding(1), -- acting as a router + notForwarding(2) -- NOT acting as a router + } + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "The indication of whether this entity is acting as an IPv4 + router in respect to the forwarding of datagrams received + by, but not addressed to, this entity. IPv4 routers forward + datagrams. IPv4 hosts do not (except those source-routed + via the host). + + When this object is written, the entity should save the + change to non-volatile storage and restore the object from + non-volatile storage upon re-initialization of the system. + Note: a stronger requirement is not used because this object + was previously defined." + ::= { ip 1 } + +ipDefaultTTL OBJECT-TYPE + SYNTAX Integer32 (1..255) + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "The default value inserted into the Time-To-Live field of + the IPv4 header of datagrams originated at this entity, + whenever a TTL value is not supplied by the transport layer + + + + protocol. + + When this object is written, the entity should save the + change to non-volatile storage and restore the object from + non-volatile storage upon re-initialization of the system. + Note: a stronger requirement is not used because this object + was previously defined." + ::= { ip 2 } + +ipReasmTimeout OBJECT-TYPE + SYNTAX Integer32 + UNITS "seconds" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The maximum number of seconds that received fragments are + held while they are awaiting reassembly at this entity." + ::= { ip 13 } + +-- +-- the IPv6 general group +-- Some objects that affect all of IPv6 +-- + +ipv6IpForwarding OBJECT-TYPE + SYNTAX INTEGER { + forwarding(1), -- acting as a router + notForwarding(2) -- NOT acting as a router + } + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "The indication of whether this entity is acting as an IPv6 + router on any interface in respect to the forwarding of + datagrams received by, but not addressed to, this entity. + IPv6 routers forward datagrams. IPv6 hosts do not (except + those source-routed via the host). + + When this object is written, the entity SHOULD save the + change to non-volatile storage and restore the object from + non-volatile storage upon re-initialization of the system." + ::= { ip 25 } + +ipv6IpDefaultHopLimit OBJECT-TYPE + SYNTAX Integer32 (0..255) + MAX-ACCESS read-write + STATUS current + DESCRIPTION + + + + "The default value inserted into the Hop Limit field of the + IPv6 header of datagrams originated at this entity whenever + a Hop Limit value is not supplied by the transport layer + protocol. + + When this object is written, the entity SHOULD save the + change to non-volatile storage and restore the object from + non-volatile storage upon re-initialization of the system." + REFERENCE "RFC 2461 Section 6.3.2" + ::= { ip 26 } + +-- +-- IPv4 Interface Table +-- + +ipv4InterfaceTableLastChange OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime on the most recent occasion at which + a row in the ipv4InterfaceTable was added or deleted, or + when an ipv4InterfaceReasmMaxSize or an + ipv4InterfaceEnableStatus object was modified. + + If new objects are added to the ipv4InterfaceTable that + require the ipv4InterfaceTableLastChange to be updated when + they are modified, they must specify that requirement in + their description clause." + ::= { ip 27 } + +ipv4InterfaceTable OBJECT-TYPE + SYNTAX SEQUENCE OF Ipv4InterfaceEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table containing per-interface IPv4-specific + information." + ::= { ip 28 } + +ipv4InterfaceEntry OBJECT-TYPE + SYNTAX Ipv4InterfaceEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An entry containing IPv4-specific information for a specific + interface." + INDEX { ipv4InterfaceIfIndex } + + + + ::= { ipv4InterfaceTable 1 } + +Ipv4InterfaceEntry ::= SEQUENCE { + ipv4InterfaceIfIndex InterfaceIndex, + ipv4InterfaceReasmMaxSize Integer32, + ipv4InterfaceEnableStatus INTEGER, + ipv4InterfaceRetransmitTime Unsigned32 + } + +ipv4InterfaceIfIndex OBJECT-TYPE + SYNTAX InterfaceIndex + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The index value that uniquely identifies the interface to + which this entry is applicable. The interface identified by + a particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipv4InterfaceEntry 1 } + +ipv4InterfaceReasmMaxSize OBJECT-TYPE + SYNTAX Integer32 (0..65535) + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The size of the largest IPv4 datagram that this entity can + re-assemble from incoming IPv4 fragmented datagrams received + on this interface." + ::= { ipv4InterfaceEntry 2 } + +ipv4InterfaceEnableStatus OBJECT-TYPE + SYNTAX INTEGER { + up(1), + down(2) + } + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "The indication of whether IPv4 is enabled (up) or disabled + (down) on this interface. This object does not affect the + state of the interface itself, only its connection to an + IPv4 stack. The IF-MIB should be used to control the state + of the interface." + ::= { ipv4InterfaceEntry 3 } + +ipv4InterfaceRetransmitTime OBJECT-TYPE + SYNTAX Unsigned32 + UNITS "milliseconds" + + + + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The time between retransmissions of ARP requests to a + neighbor when resolving the address or when probing the + reachability of a neighbor." + REFERENCE "RFC 1122" + DEFVAL { 1000 } + ::= { ipv4InterfaceEntry 4 } + +-- +-- v6 interface table +-- + +ipv6InterfaceTableLastChange OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime on the most recent occasion at which + a row in the ipv6InterfaceTable was added or deleted or when + an ipv6InterfaceReasmMaxSize, ipv6InterfaceIdentifier, + ipv6InterfaceEnableStatus, ipv6InterfaceReachableTime, + ipv6InterfaceRetransmitTime, or ipv6InterfaceForwarding + object was modified. + + If new objects are added to the ipv6InterfaceTable that + require the ipv6InterfaceTableLastChange to be updated when + they are modified, they must specify that requirement in + their description clause." + ::= { ip 29 } + +ipv6InterfaceTable OBJECT-TYPE + SYNTAX SEQUENCE OF Ipv6InterfaceEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table containing per-interface IPv6-specific + information." + ::= { ip 30 } + +ipv6InterfaceEntry OBJECT-TYPE + SYNTAX Ipv6InterfaceEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An entry containing IPv6-specific information for a given + interface." + + + + INDEX { ipv6InterfaceIfIndex } + ::= { ipv6InterfaceTable 1 } + +Ipv6InterfaceEntry ::= SEQUENCE { + ipv6InterfaceIfIndex InterfaceIndex, + ipv6InterfaceReasmMaxSize Unsigned32, + ipv6InterfaceIdentifier Ipv6AddressIfIdentifierTC, + ipv6InterfaceEnableStatus INTEGER, + ipv6InterfaceReachableTime Unsigned32, + ipv6InterfaceRetransmitTime Unsigned32, + ipv6InterfaceForwarding INTEGER + } + +ipv6InterfaceIfIndex OBJECT-TYPE + SYNTAX InterfaceIndex + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The index value that uniquely identifies the interface to + which this entry is applicable. The interface identified by + a particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipv6InterfaceEntry 1 } + +ipv6InterfaceReasmMaxSize OBJECT-TYPE + SYNTAX Unsigned32 (1500..65535) + UNITS "octets" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The size of the largest IPv6 datagram that this entity can + re-assemble from incoming IPv6 fragmented datagrams received + on this interface." + ::= { ipv6InterfaceEntry 2 } + +ipv6InterfaceIdentifier OBJECT-TYPE + SYNTAX Ipv6AddressIfIdentifierTC + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The Interface Identifier for this interface. The Interface + Identifier is combined with an address prefix to form an + interface address. + + By default, the Interface Identifier is auto-configured + according to the rules of the link type to which this + interface is attached. + + + + + A zero length identifier may be used where appropriate. One + possible example is a loopback interface." + ::= { ipv6InterfaceEntry 3 } + +-- This object ID is reserved as it was used in earlier versions of +-- the MIB module. In theory, OIDs are not assigned until the +-- specification is released as an RFC; however, as some companies +-- may have shipped code based on earlier versions of the MIB, it +-- seems best to reserve this OID. This OID had been +-- ipv6InterfacePhysicalAddress. +-- ::= { ipv6InterfaceEntry 4} + +ipv6InterfaceEnableStatus OBJECT-TYPE + SYNTAX INTEGER { + up(1), + down(2) + } + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "The indication of whether IPv6 is enabled (up) or disabled + (down) on this interface. This object does not affect the + state of the interface itself, only its connection to an + IPv6 stack. The IF-MIB should be used to control the state + of the interface. + + When this object is written, the entity SHOULD save the + change to non-volatile storage and restore the object from + non-volatile storage upon re-initialization of the system." + ::= { ipv6InterfaceEntry 5 } + +ipv6InterfaceReachableTime OBJECT-TYPE + SYNTAX Unsigned32 + UNITS "milliseconds" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The time a neighbor is considered reachable after receiving + a reachability confirmation." + REFERENCE "RFC 2461, Section 6.3.2" + ::= { ipv6InterfaceEntry 6 } + +ipv6InterfaceRetransmitTime OBJECT-TYPE + SYNTAX Unsigned32 + UNITS "milliseconds" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + + + + "The time between retransmissions of Neighbor Solicitation + messages to a neighbor when resolving the address or when + probing the reachability of a neighbor." + REFERENCE "RFC 2461, Section 6.3.2" + ::= { ipv6InterfaceEntry 7 } + +ipv6InterfaceForwarding OBJECT-TYPE + SYNTAX INTEGER { + forwarding(1), -- acting as a router + notForwarding(2) -- NOT acting as a router + } + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "The indication of whether this entity is acting as an IPv6 + router on this interface with respect to the forwarding of + datagrams received by, but not addressed to, this entity. + IPv6 routers forward datagrams. IPv6 hosts do not (except + those source-routed via the host). + + This object is constrained by ipv6IpForwarding and is + ignored if ipv6IpForwarding is set to notForwarding. Those + systems that do not provide per-interface control of the + forwarding function should set this object to forwarding for + all interfaces and allow the ipv6IpForwarding object to + control the forwarding capability. + + When this object is written, the entity SHOULD save the + change to non-volatile storage and restore the object from + non-volatile storage upon re-initialization of the system." + ::= { ipv6InterfaceEntry 8 } + +-- +-- Per-Interface or System-Wide IP statistics. +-- +-- The following two tables, ipSystemStatsTable and ipIfStatsTable, +-- are intended to provide the same counters at different granularities. +-- The ipSystemStatsTable provides system wide counters aggregating +-- the traffic counters for all interfaces for a given address type. +-- The ipIfStatsTable provides the same counters but for specific +-- interfaces rather than as an aggregate. +-- +-- Note well: If a system provides both system-wide and interface- +-- specific values, the system-wide value may not be equal to the sum +-- of the interface-specific values across all interfaces due to e.g., +-- dynamic interface creation/deletion. +-- +-- Note well: Both of these tables contain some items that are + + + +-- represented by two objects, representing the value in either 32 +-- or 64 bits. For those objects, the 32-bit value MUST be the low +-- order 32 bits of the 64-bit value. Also note that the 32-bit +-- counters must be included when the 64-bit counters are included. + +ipTrafficStats OBJECT IDENTIFIER ::= { ip 31 } + +ipSystemStatsTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpSystemStatsEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table containing system wide, IP version specific + traffic statistics. This table and the ipIfStatsTable + contain similar objects whose difference is in their + granularity. Where this table contains system wide traffic + statistics, the ipIfStatsTable contains the same statistics + but counted on a per-interface basis." + ::= { ipTrafficStats 1 } + +ipSystemStatsEntry OBJECT-TYPE + SYNTAX IpSystemStatsEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A statistics entry containing system-wide objects for a + particular IP version." + INDEX { ipSystemStatsIPVersion } + ::= { ipSystemStatsTable 1 } + +IpSystemStatsEntry ::= SEQUENCE { + ipSystemStatsIPVersion InetVersion, + ipSystemStatsInReceives Counter32, + ipSystemStatsHCInReceives Counter64, + ipSystemStatsInOctets Counter32, + ipSystemStatsHCInOctets Counter64, + ipSystemStatsInHdrErrors Counter32, + ipSystemStatsInNoRoutes Counter32, + ipSystemStatsInAddrErrors Counter32, + ipSystemStatsInUnknownProtos Counter32, + ipSystemStatsInTruncatedPkts Counter32, + ipSystemStatsInForwDatagrams Counter32, + ipSystemStatsHCInForwDatagrams Counter64, + ipSystemStatsReasmReqds Counter32, + ipSystemStatsReasmOKs Counter32, + ipSystemStatsReasmFails Counter32, + ipSystemStatsInDiscards Counter32, + ipSystemStatsInDelivers Counter32, + + + + ipSystemStatsHCInDelivers Counter64, + ipSystemStatsOutRequests Counter32, + ipSystemStatsHCOutRequests Counter64, + ipSystemStatsOutNoRoutes Counter32, + ipSystemStatsOutForwDatagrams Counter32, + ipSystemStatsHCOutForwDatagrams Counter64, + ipSystemStatsOutDiscards Counter32, + ipSystemStatsOutFragReqds Counter32, + ipSystemStatsOutFragOKs Counter32, + ipSystemStatsOutFragFails Counter32, + ipSystemStatsOutFragCreates Counter32, + ipSystemStatsOutTransmits Counter32, + ipSystemStatsHCOutTransmits Counter64, + ipSystemStatsOutOctets Counter32, + ipSystemStatsHCOutOctets Counter64, + ipSystemStatsInMcastPkts Counter32, + ipSystemStatsHCInMcastPkts Counter64, + ipSystemStatsInMcastOctets Counter32, + ipSystemStatsHCInMcastOctets Counter64, + ipSystemStatsOutMcastPkts Counter32, + ipSystemStatsHCOutMcastPkts Counter64, + ipSystemStatsOutMcastOctets Counter32, + ipSystemStatsHCOutMcastOctets Counter64, + ipSystemStatsInBcastPkts Counter32, + ipSystemStatsHCInBcastPkts Counter64, + ipSystemStatsOutBcastPkts Counter32, + ipSystemStatsHCOutBcastPkts Counter64, + ipSystemStatsDiscontinuityTime TimeStamp, + ipSystemStatsRefreshRate Unsigned32 + } + +ipSystemStatsIPVersion OBJECT-TYPE + SYNTAX InetVersion + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The IP version of this row." + ::= { ipSystemStatsEntry 1 } + +-- This object ID is reserved to allow the IDs for this table's objects +-- to align with the objects in the ipIfStatsTable. +-- ::= { ipSystemStatsEntry 2 } + +ipSystemStatsInReceives OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + + + + "The total number of input IP datagrams received, including + those received in error. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 3 } + +ipSystemStatsHCInReceives OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of input IP datagrams received, including + those received in error. This object counts the same + datagrams as ipSystemStatsInReceives, but allows for larger + values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 4 } + +ipSystemStatsInOctets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received in input IP datagrams, + including those received in error. Octets from datagrams + counted in ipSystemStatsInReceives MUST be counted here. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 5 } + +ipSystemStatsHCInOctets OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received in input IP datagrams, + including those received in error. This object counts the + same octets as ipSystemStatsInOctets, but allows for larger + + + + values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 6 } + +ipSystemStatsInHdrErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams discarded due to errors in + their IP headers, including version number mismatch, other + format errors, hop count exceeded, errors discovered in + processing their IP options, etc. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 7 } + +ipSystemStatsInNoRoutes OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams discarded because no route + could be found to transmit them to their destination. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 8 } + +ipSystemStatsInAddrErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams discarded because the IP + address in their IP header's destination field was not a + valid address to be received at this entity. This count + includes invalid addresses (e.g., ::0). For entities + that are not IP routers and therefore do not forward + + + + datagrams, this counter includes datagrams discarded + because the destination address was not a local address. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 9 } + +ipSystemStatsInUnknownProtos OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of locally-addressed IP datagrams received + successfully but discarded because of an unknown or + unsupported protocol. + + When tracking interface statistics, the counter of the + interface to which these datagrams were addressed is + incremented. This interface might not be the same as the + input interface for some of the datagrams. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 10 } + +ipSystemStatsInTruncatedPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams discarded because the + datagram frame didn't carry enough data. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 11 } + +ipSystemStatsInForwDatagrams OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + + + + "The number of input datagrams for which this entity was not + their final IP destination and for which this entity + attempted to find a route to forward them to that final + destination. In entities that do not act as IP routers, + this counter will include only those datagrams that were + Source-Routed via this entity, and the Source-Route + processing was successful. + + When tracking interface statistics, the counter of the + incoming interface is incremented for each datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 12 } + +ipSystemStatsHCInForwDatagrams OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input datagrams for which this entity was not + their final IP destination and for which this entity + attempted to find a route to forward them to that final + destination. This object counts the same packets as + ipSystemStatsInForwDatagrams, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 13 } + +ipSystemStatsReasmReqds OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP fragments received that needed to be + reassembled at this interface. + + When tracking interface statistics, the counter of the + interface to which these fragments were addressed is + incremented. This interface might not be the same as the + input interface for some of the fragments. + + Discontinuities in the value of this counter can occur at + + + + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 14 } + +ipSystemStatsReasmOKs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP datagrams successfully reassembled. + + When tracking interface statistics, the counter of the + interface to which these datagrams were addressed is + incremented. This interface might not be the same as the + input interface for some of the datagrams. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 15 } + +ipSystemStatsReasmFails OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of failures detected by the IP re-assembly + algorithm (for whatever reason: timed out, errors, etc.). + Note that this is not necessarily a count of discarded IP + fragments since some algorithms (notably the algorithm in + RFC 815) can lose track of the number of fragments by + combining them as they are received. + + When tracking interface statistics, the counter of the + interface to which these fragments were addressed is + incremented. This interface might not be the same as the + input interface for some of the fragments. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 16 } + +ipSystemStatsInDiscards OBJECT-TYPE + SYNTAX Counter32 + + + + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams for which no problems were + encountered to prevent their continued processing, but + were discarded (e.g., for lack of buffer space). Note that + this counter does not include any datagrams discarded while + awaiting re-assembly. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 17 } + +ipSystemStatsInDelivers OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of datagrams successfully delivered to IP + user-protocols (including ICMP). + + When tracking interface statistics, the counter of the + interface to which these datagrams were addressed is + incremented. This interface might not be the same as the + input interface for some of the datagrams. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 18 } + +ipSystemStatsHCInDelivers OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of datagrams successfully delivered to IP + user-protocols (including ICMP). This object counts the + same packets as ipSystemStatsInDelivers, but allows for + larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + + + + ::= { ipSystemStatsEntry 19 } + +ipSystemStatsOutRequests OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of IP datagrams that local IP user- + protocols (including ICMP) supplied to IP in requests for + transmission. Note that this counter does not include any + datagrams counted in ipSystemStatsOutForwDatagrams. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 20 } + +ipSystemStatsHCOutRequests OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of IP datagrams that local IP user- + protocols (including ICMP) supplied to IP in requests for + transmission. This object counts the same packets as + ipSystemStatsOutRequests, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 21 } + +ipSystemStatsOutNoRoutes OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of locally generated IP datagrams discarded + because no route could be found to transmit them to their + destination. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 22 } + + + +ipSystemStatsOutForwDatagrams OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of datagrams for which this entity was not their + final IP destination and for which it was successful in + finding a path to their final destination. In entities + that do not act as IP routers, this counter will include + only those datagrams that were Source-Routed via this + entity, and the Source-Route processing was successful. + + When tracking interface statistics, the counter of the + outgoing interface is incremented for a successfully + forwarded datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 23 } + +ipSystemStatsHCOutForwDatagrams OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of datagrams for which this entity was not their + final IP destination and for which it was successful in + finding a path to their final destination. This object + counts the same packets as ipSystemStatsOutForwDatagrams, + but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 24 } + +ipSystemStatsOutDiscards OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of output IP datagrams for which no problem was + encountered to prevent their transmission to their + destination, but were discarded (e.g., for lack of + buffer space). Note that this counter would include + + + + datagrams counted in ipSystemStatsOutForwDatagrams if any + such datagrams met this (discretionary) discard criterion. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 25 } + +ipSystemStatsOutFragReqds OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP datagrams that would require fragmentation + in order to be transmitted. + + When tracking interface statistics, the counter of the + outgoing interface is incremented for a successfully + fragmented datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 26 } + +ipSystemStatsOutFragOKs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP datagrams that have been successfully + fragmented. + + When tracking interface statistics, the counter of the + outgoing interface is incremented for a successfully + fragmented datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 27 } + +ipSystemStatsOutFragFails OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + + + + STATUS current + DESCRIPTION + "The number of IP datagrams that have been discarded because + they needed to be fragmented but could not be. This + includes IPv4 packets that have the DF bit set and IPv6 + packets that are being forwarded and exceed the outgoing + link MTU. + + When tracking interface statistics, the counter of the + outgoing interface is incremented for an unsuccessfully + fragmented datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 28 } + +ipSystemStatsOutFragCreates OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of output datagram fragments that have been + generated as a result of IP fragmentation. + + When tracking interface statistics, the counter of the + outgoing interface is incremented for a successfully + fragmented datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 29 } + +ipSystemStatsOutTransmits OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of IP datagrams that this entity supplied + to the lower layers for transmission. This includes + datagrams generated locally and those forwarded by this + entity. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + + + + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 30 } + +ipSystemStatsHCOutTransmits OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of IP datagrams that this entity supplied + to the lower layers for transmission. This object counts + the same datagrams as ipSystemStatsOutTransmits, but allows + for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 31 } + +ipSystemStatsOutOctets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets in IP datagrams delivered to the + lower layers for transmission. Octets from datagrams + counted in ipSystemStatsOutTransmits MUST be counted here. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 32 } + +ipSystemStatsHCOutOctets OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets in IP datagrams delivered to the + lower layers for transmission. This objects counts the same + octets as ipSystemStatsOutOctets, but allows for larger + values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + + + + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 33 } + +ipSystemStatsInMcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP multicast datagrams received. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 34 } + +ipSystemStatsHCInMcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP multicast datagrams received. This object + counts the same datagrams as ipSystemStatsInMcastPkts but + allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 35 } + +ipSystemStatsInMcastOctets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received in IP multicast + datagrams. Octets from datagrams counted in + ipSystemStatsInMcastPkts MUST be counted here. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 36 } + +ipSystemStatsHCInMcastOctets OBJECT-TYPE + SYNTAX Counter64 + + + + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received in IP multicast + datagrams. This object counts the same octets as + ipSystemStatsInMcastOctets, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 37 } + +ipSystemStatsOutMcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP multicast datagrams transmitted. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 38 } + +ipSystemStatsHCOutMcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP multicast datagrams transmitted. This + object counts the same datagrams as + ipSystemStatsOutMcastPkts, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 39 } + +ipSystemStatsOutMcastOctets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets transmitted in IP multicast + datagrams. Octets from datagrams counted in + + + + ipSystemStatsOutMcastPkts MUST be counted here. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 40 } + +ipSystemStatsHCOutMcastOctets OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets transmitted in IP multicast + datagrams. This object counts the same octets as + ipSystemStatsOutMcastOctets, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 41 } + +ipSystemStatsInBcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP broadcast datagrams received. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 42 } + +ipSystemStatsHCInBcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP broadcast datagrams received. This object + counts the same datagrams as ipSystemStatsInBcastPkts but + allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + + + + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 43 } + +ipSystemStatsOutBcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP broadcast datagrams transmitted. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 44 } + +ipSystemStatsHCOutBcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP broadcast datagrams transmitted. This + object counts the same datagrams as + ipSystemStatsOutBcastPkts, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipSystemStatsDiscontinuityTime." + ::= { ipSystemStatsEntry 45 } + +ipSystemStatsDiscontinuityTime OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime on the most recent occasion at which + any one or more of this entry's counters suffered a + discontinuity. + + If no such discontinuities have occurred since the last re- + initialization of the local management subsystem, then this + object contains a zero value." + ::= { ipSystemStatsEntry 46 } + +ipSystemStatsRefreshRate OBJECT-TYPE + SYNTAX Unsigned32 + UNITS "milli-seconds" + + + + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The minimum reasonable polling interval for this entry. + This object provides an indication of the minimum amount of + time required to update the counters in this entry." + ::= { ipSystemStatsEntry 47 } + +ipIfStatsTableLastChange OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime on the most recent occasion at which + a row in the ipIfStatsTable was added or deleted. + + If new objects are added to the ipIfStatsTable that require + the ipIfStatsTableLastChange to be updated when they are + modified, they must specify that requirement in their + description clause." + ::= { ipTrafficStats 2 } + +ipIfStatsTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpIfStatsEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table containing per-interface traffic statistics. This + table and the ipSystemStatsTable contain similar objects + whose difference is in their granularity. Where this table + contains per-interface statistics, the ipSystemStatsTable + contains the same statistics, but counted on a system wide + basis." + ::= { ipTrafficStats 3 } + +ipIfStatsEntry OBJECT-TYPE + SYNTAX IpIfStatsEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An interface statistics entry containing objects for a + particular interface and version of IP." + INDEX { ipIfStatsIPVersion, ipIfStatsIfIndex } + ::= { ipIfStatsTable 1 } + +IpIfStatsEntry ::= SEQUENCE { + ipIfStatsIPVersion InetVersion, + ipIfStatsIfIndex InterfaceIndex, + + + + ipIfStatsInReceives Counter32, + ipIfStatsHCInReceives Counter64, + ipIfStatsInOctets Counter32, + ipIfStatsHCInOctets Counter64, + ipIfStatsInHdrErrors Counter32, + ipIfStatsInNoRoutes Counter32, + ipIfStatsInAddrErrors Counter32, + ipIfStatsInUnknownProtos Counter32, + ipIfStatsInTruncatedPkts Counter32, + ipIfStatsInForwDatagrams Counter32, + ipIfStatsHCInForwDatagrams Counter64, + ipIfStatsReasmReqds Counter32, + ipIfStatsReasmOKs Counter32, + ipIfStatsReasmFails Counter32, + ipIfStatsInDiscards Counter32, + ipIfStatsInDelivers Counter32, + ipIfStatsHCInDelivers Counter64, + ipIfStatsOutRequests Counter32, + ipIfStatsHCOutRequests Counter64, + ipIfStatsOutForwDatagrams Counter32, + ipIfStatsHCOutForwDatagrams Counter64, + ipIfStatsOutDiscards Counter32, + ipIfStatsOutFragReqds Counter32, + ipIfStatsOutFragOKs Counter32, + ipIfStatsOutFragFails Counter32, + ipIfStatsOutFragCreates Counter32, + ipIfStatsOutTransmits Counter32, + ipIfStatsHCOutTransmits Counter64, + ipIfStatsOutOctets Counter32, + ipIfStatsHCOutOctets Counter64, + ipIfStatsInMcastPkts Counter32, + ipIfStatsHCInMcastPkts Counter64, + ipIfStatsInMcastOctets Counter32, + ipIfStatsHCInMcastOctets Counter64, + ipIfStatsOutMcastPkts Counter32, + ipIfStatsHCOutMcastPkts Counter64, + ipIfStatsOutMcastOctets Counter32, + ipIfStatsHCOutMcastOctets Counter64, + ipIfStatsInBcastPkts Counter32, + ipIfStatsHCInBcastPkts Counter64, + ipIfStatsOutBcastPkts Counter32, + ipIfStatsHCOutBcastPkts Counter64, + ipIfStatsDiscontinuityTime TimeStamp, + ipIfStatsRefreshRate Unsigned32 + } + +ipIfStatsIPVersion OBJECT-TYPE + SYNTAX InetVersion + + + + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The IP version of this row." + ::= { ipIfStatsEntry 1 } + +ipIfStatsIfIndex OBJECT-TYPE + SYNTAX InterfaceIndex + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The index value that uniquely identifies the interface to + which this entry is applicable. The interface identified by + a particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipIfStatsEntry 2 } + +ipIfStatsInReceives OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of input IP datagrams received, including + those received in error. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 3 } + +ipIfStatsHCInReceives OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of input IP datagrams received, including + those received in error. This object counts the same + datagrams as ipIfStatsInReceives, but allows for larger + values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 4 } + +ipIfStatsInOctets OBJECT-TYPE + + + + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received in input IP datagrams, + including those received in error. Octets from datagrams + counted in ipIfStatsInReceives MUST be counted here. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 5 } + +ipIfStatsHCInOctets OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received in input IP datagrams, + including those received in error. This object counts the + same octets as ipIfStatsInOctets, but allows for larger + values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 6 } + +ipIfStatsInHdrErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams discarded due to errors in + their IP headers, including version number mismatch, other + format errors, hop count exceeded, errors discovered in + processing their IP options, etc. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 7 } + +ipIfStatsInNoRoutes OBJECT-TYPE + SYNTAX Counter32 + + + + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams discarded because no route + could be found to transmit them to their destination. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 8 } + +ipIfStatsInAddrErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams discarded because the IP + address in their IP header's destination field was not a + valid address to be received at this entity. This count + includes invalid addresses (e.g., ::0). For entities that + are not IP routers and therefore do not forward datagrams, + this counter includes datagrams discarded because the + destination address was not a local address. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 9 } + +ipIfStatsInUnknownProtos OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of locally-addressed IP datagrams received + successfully but discarded because of an unknown or + unsupported protocol. + + When tracking interface statistics, the counter of the + interface to which these datagrams were addressed is + incremented. This interface might not be the same as the + input interface for some of the datagrams. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + + + + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 10 } + +ipIfStatsInTruncatedPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams discarded because the + datagram frame didn't carry enough data. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 11 } + +ipIfStatsInForwDatagrams OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input datagrams for which this entity was not + their final IP destination and for which this entity + attempted to find a route to forward them to that final + destination. In entities that do not act as IP routers, + this counter will include only those datagrams that were + Source-Routed via this entity, and the Source-Route + processing was successful. + + When tracking interface statistics, the counter of the + incoming interface is incremented for each datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 12 } + +ipIfStatsHCInForwDatagrams OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input datagrams for which this entity was not + their final IP destination and for which this entity + attempted to find a route to forward them to that final + destination. This object counts the same packets as + + + + ipIfStatsInForwDatagrams, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 13 } + +ipIfStatsReasmReqds OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP fragments received that needed to be + reassembled at this interface. + + When tracking interface statistics, the counter of the + interface to which these fragments were addressed is + incremented. This interface might not be the same as the + input interface for some of the fragments. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 14 } + +ipIfStatsReasmOKs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP datagrams successfully reassembled. + + When tracking interface statistics, the counter of the + interface to which these datagrams were addressed is + incremented. This interface might not be the same as the + input interface for some of the datagrams. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 15 } + +ipIfStatsReasmFails OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + + + + STATUS current + DESCRIPTION + "The number of failures detected by the IP re-assembly + algorithm (for whatever reason: timed out, errors, etc.). + Note that this is not necessarily a count of discarded IP + fragments since some algorithms (notably the algorithm in + RFC 815) can lose track of the number of fragments by + combining them as they are received. + + When tracking interface statistics, the counter of the + interface to which these fragments were addressed is + incremented. This interface might not be the same as the + input interface for some of the fragments. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 16 } + +ipIfStatsInDiscards OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input IP datagrams for which no problems were + encountered to prevent their continued processing, but + were discarded (e.g., for lack of buffer space). Note that + this counter does not include any datagrams discarded while + awaiting re-assembly. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 17 } + +ipIfStatsInDelivers OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of datagrams successfully delivered to IP + user-protocols (including ICMP). + + When tracking interface statistics, the counter of the + interface to which these datagrams were addressed is + incremented. This interface might not be the same as the + + + + input interface for some of the datagrams. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 18 } + +ipIfStatsHCInDelivers OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of datagrams successfully delivered to IP + user-protocols (including ICMP). This object counts the + same packets as ipIfStatsInDelivers, but allows for larger + values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 19 } + +ipIfStatsOutRequests OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of IP datagrams that local IP user- + protocols (including ICMP) supplied to IP in requests for + transmission. Note that this counter does not include any + datagrams counted in ipIfStatsOutForwDatagrams. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 20 } + +ipIfStatsHCOutRequests OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of IP datagrams that local IP user- + protocols (including ICMP) supplied to IP in requests for + transmission. This object counts the same packets as + + + + ipIfStatsOutRequests, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 21 } + +-- This object ID is reserved to allow the IDs for this table's objects +-- to align with the objects in the ipSystemStatsTable. +-- ::= {ipIfStatsEntry 22} + +ipIfStatsOutForwDatagrams OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of datagrams for which this entity was not their + final IP destination and for which it was successful in + finding a path to their final destination. In entities + that do not act as IP routers, this counter will include + only those datagrams that were Source-Routed via this + entity, and the Source-Route processing was successful. + + When tracking interface statistics, the counter of the + outgoing interface is incremented for a successfully + forwarded datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 23 } + +ipIfStatsHCOutForwDatagrams OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of datagrams for which this entity was not their + final IP destination and for which it was successful in + finding a path to their final destination. This object + counts the same packets as ipIfStatsOutForwDatagrams, but + allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + + + + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 24 } + +ipIfStatsOutDiscards OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of output IP datagrams for which no problem was + encountered to prevent their transmission to their + destination, but were discarded (e.g., for lack of + buffer space). Note that this counter would include + datagrams counted in ipIfStatsOutForwDatagrams if any such + datagrams met this (discretionary) discard criterion. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 25 } + +ipIfStatsOutFragReqds OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP datagrams that would require fragmentation + in order to be transmitted. + + When tracking interface statistics, the counter of the + outgoing interface is incremented for a successfully + fragmented datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 26 } + +ipIfStatsOutFragOKs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP datagrams that have been successfully + fragmented. + + When tracking interface statistics, the counter of the + + + + outgoing interface is incremented for a successfully + fragmented datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 27 } + +ipIfStatsOutFragFails OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP datagrams that have been discarded because + they needed to be fragmented but could not be. This + includes IPv4 packets that have the DF bit set and IPv6 + packets that are being forwarded and exceed the outgoing + link MTU. + + When tracking interface statistics, the counter of the + outgoing interface is incremented for an unsuccessfully + fragmented datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 28 } + +ipIfStatsOutFragCreates OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of output datagram fragments that have been + generated as a result of IP fragmentation. + + When tracking interface statistics, the counter of the + outgoing interface is incremented for a successfully + fragmented datagram. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 29 } + + + + +ipIfStatsOutTransmits OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of IP datagrams that this entity supplied + to the lower layers for transmission. This includes + datagrams generated locally and those forwarded by this + entity. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 30 } + +ipIfStatsHCOutTransmits OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of IP datagrams that this entity supplied + to the lower layers for transmission. This object counts + the same datagrams as ipIfStatsOutTransmits, but allows for + larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 31 } + +ipIfStatsOutOctets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets in IP datagrams delivered to the + lower layers for transmission. Octets from datagrams + counted in ipIfStatsOutTransmits MUST be counted here. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 32 } + +ipIfStatsHCOutOctets OBJECT-TYPE + + + + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets in IP datagrams delivered to the + lower layers for transmission. This objects counts the same + octets as ipIfStatsOutOctets, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 33 } + +ipIfStatsInMcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP multicast datagrams received. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 34 } + +ipIfStatsHCInMcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP multicast datagrams received. This object + counts the same datagrams as ipIfStatsInMcastPkts, but + allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 35 } + +ipIfStatsInMcastOctets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received in IP multicast + + + + datagrams. Octets from datagrams counted in + ipIfStatsInMcastPkts MUST be counted here. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 36 } + +ipIfStatsHCInMcastOctets OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets received in IP multicast + datagrams. This object counts the same octets as + ipIfStatsInMcastOctets, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 37 } + +ipIfStatsOutMcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP multicast datagrams transmitted. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 38 } + +ipIfStatsHCOutMcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP multicast datagrams transmitted. This + object counts the same datagrams as ipIfStatsOutMcastPkts, + but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + + + + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 39 } + +ipIfStatsOutMcastOctets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets transmitted in IP multicast + datagrams. Octets from datagrams counted in + ipIfStatsOutMcastPkts MUST be counted here. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 40 } + +ipIfStatsHCOutMcastOctets OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of octets transmitted in IP multicast + datagrams. This object counts the same octets as + ipIfStatsOutMcastOctets, but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 41 } + +ipIfStatsInBcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP broadcast datagrams received. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 42 } + +ipIfStatsHCInBcastPkts OBJECT-TYPE + + + + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP broadcast datagrams received. This object + counts the same datagrams as ipIfStatsInBcastPkts, but + allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 43 } + +ipIfStatsOutBcastPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP broadcast datagrams transmitted. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 44 } + +ipIfStatsHCOutBcastPkts OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of IP broadcast datagrams transmitted. This + object counts the same datagrams as ipIfStatsOutBcastPkts, + but allows for larger values. + + Discontinuities in the value of this counter can occur at + re-initialization of the management system, and at other + times as indicated by the value of + ipIfStatsDiscontinuityTime." + ::= { ipIfStatsEntry 45 } + +ipIfStatsDiscontinuityTime OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime on the most recent occasion at which + + + + any one or more of this entry's counters suffered a + discontinuity. + + If no such discontinuities have occurred since the last re- + initialization of the local management subsystem, then this + object contains a zero value." + ::= { ipIfStatsEntry 46 } + +ipIfStatsRefreshRate OBJECT-TYPE + SYNTAX Unsigned32 + UNITS "milli-seconds" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The minimum reasonable polling interval for this entry. + This object provides an indication of the minimum amount of + time required to update the counters in this entry." + ::= { ipIfStatsEntry 47 } + +-- +-- Internet Address Prefix table +-- + +ipAddressPrefixTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpAddressPrefixEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "This table allows the user to determine the source of an IP + address or set of IP addresses, and allows other tables to + share the information via pointer rather than by copying. + + For example, when the node configures both a unicast and + anycast address for a prefix, the ipAddressPrefix objects + for those addresses will point to a single row in this + table. + + This table primarily provides support for IPv6 prefixes, and + several of the objects are less meaningful for IPv4. The + table continues to allow IPv4 addresses to allow future + flexibility. In order to promote a common configuration, + this document includes suggestions for default values for + IPv4 prefixes. Each of these values may be overridden if an + object is meaningful to the node. + + All prefixes used by this entity should be included in this + table independent of how the entity learned the prefix. + (This table isn't limited to prefixes learned from router + + + + advertisements.)" + ::= { ip 32 } + +ipAddressPrefixEntry OBJECT-TYPE + SYNTAX IpAddressPrefixEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An entry in the ipAddressPrefixTable." + INDEX { ipAddressPrefixIfIndex, ipAddressPrefixType, + ipAddressPrefixPrefix, ipAddressPrefixLength } + ::= { ipAddressPrefixTable 1 } + +IpAddressPrefixEntry ::= SEQUENCE { + ipAddressPrefixIfIndex InterfaceIndex, + ipAddressPrefixType InetAddressType, + ipAddressPrefixPrefix InetAddress, + ipAddressPrefixLength InetAddressPrefixLength, + ipAddressPrefixOrigin IpAddressPrefixOriginTC, + ipAddressPrefixOnLinkFlag TruthValue, + ipAddressPrefixAutonomousFlag TruthValue, + ipAddressPrefixAdvPreferredLifetime Unsigned32, + ipAddressPrefixAdvValidLifetime Unsigned32 + } + +ipAddressPrefixIfIndex OBJECT-TYPE + SYNTAX InterfaceIndex + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The index value that uniquely identifies the interface on + which this prefix is configured. The interface identified + by a particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipAddressPrefixEntry 1 } + +ipAddressPrefixType OBJECT-TYPE + SYNTAX InetAddressType + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The address type of ipAddressPrefix." + ::= { ipAddressPrefixEntry 2 } + +ipAddressPrefixPrefix OBJECT-TYPE + SYNTAX InetAddress + MAX-ACCESS not-accessible + STATUS current + + + + DESCRIPTION + "The address prefix. The address type of this object is + specified in ipAddressPrefixType. The length of this object + is the standard length for objects of that type (4 or 16 + bytes). Any bits after ipAddressPrefixLength must be zero. + + Implementors need to be aware that, if the size of + ipAddressPrefixPrefix exceeds 114 octets, then OIDS of + instances of columns in this row will have more than 128 + sub-identifiers and cannot be accessed using SNMPv1, + SNMPv2c, or SNMPv3." + ::= { ipAddressPrefixEntry 3 } + +ipAddressPrefixLength OBJECT-TYPE + SYNTAX InetAddressPrefixLength + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The prefix length associated with this prefix. + + The value 0 has no special meaning for this object. It + simply refers to address '::/0'." + ::= { ipAddressPrefixEntry 4 } + +ipAddressPrefixOrigin OBJECT-TYPE + SYNTAX IpAddressPrefixOriginTC + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The origin of this prefix." + ::= { ipAddressPrefixEntry 5 } + +ipAddressPrefixOnLinkFlag OBJECT-TYPE + SYNTAX TruthValue + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "This object has the value 'true(1)', if this prefix can be + used for on-link determination; otherwise, the value is + 'false(2)'. + + The default for IPv4 prefixes is 'true(1)'." + REFERENCE "For IPv6 RFC 2461, especially sections 2 and 4.6.2 and + RFC 2462" + ::= { ipAddressPrefixEntry 6 } + +ipAddressPrefixAutonomousFlag OBJECT-TYPE + SYNTAX TruthValue + + + + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "Autonomous address configuration flag. When true(1), + indicates that this prefix can be used for autonomous + address configuration (i.e., can be used to form a local + interface address). If false(2), it is not used to auto- + configure a local interface address. + + The default for IPv4 prefixes is 'false(2)'." + REFERENCE "For IPv6 RFC 2461, especially sections 2 and 4.6.2 and + RFC 2462" + ::= { ipAddressPrefixEntry 7 } + +ipAddressPrefixAdvPreferredLifetime OBJECT-TYPE + SYNTAX Unsigned32 + UNITS "seconds" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The remaining length of time, in seconds, that this prefix + will continue to be preferred, i.e., time until deprecation. + + A value of 4,294,967,295 represents infinity. + + The address generated from a deprecated prefix should no + longer be used as a source address in new communications, + but packets received on such an interface are processed as + expected. + + The default for IPv4 prefixes is 4,294,967,295 (infinity)." + REFERENCE "For IPv6 RFC 2461, especially sections 2 and 4.6.2 and + RFC 2462" + ::= { ipAddressPrefixEntry 8 } + +ipAddressPrefixAdvValidLifetime OBJECT-TYPE + SYNTAX Unsigned32 + UNITS "seconds" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The remaining length of time, in seconds, that this prefix + will continue to be valid, i.e., time until invalidation. A + value of 4,294,967,295 represents infinity. + + The address generated from an invalidated prefix should not + appear as the destination or source address of a packet. + + + + + The default for IPv4 prefixes is 4,294,967,295 (infinity)." + REFERENCE "For IPv6 RFC 2461, especially sections 2 and 4.6.2 and + RFC 2462" + ::= { ipAddressPrefixEntry 9 } + +-- +-- Internet Address Table +-- + +ipAddressSpinLock OBJECT-TYPE + SYNTAX TestAndIncr + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "An advisory lock used to allow cooperating SNMP managers to + coordinate their use of the set operation in creating or + modifying rows within this table. + + In order to use this lock to coordinate the use of set + operations, managers should first retrieve + ipAddressTableSpinLock. They should then determine the + appropriate row to create or modify. Finally, they should + issue the appropriate set command, including the retrieved + value of ipAddressSpinLock. If another manager has altered + the table in the meantime, then the value of + ipAddressSpinLock will have changed, and the creation will + fail as it will be specifying an incorrect value for + ipAddressSpinLock. It is suggested, but not required, that + the ipAddressSpinLock be the first var bind for each set of + objects representing a 'row' in a PDU." + ::= { ip 33 } + +ipAddressTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpAddressEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "This table contains addressing information relevant to the + entity's interfaces. + + This table does not contain multicast address information. + Tables for such information should be contained in multicast + specific MIBs, such as RFC 3019. + + While this table is writable, the user will note that + several objects, such as ipAddressOrigin, are not. The + intention in allowing a user to write to this table is to + allow them to add or remove any entry that isn't + + + + permanent. The user should be allowed to modify objects + and entries when that would not cause inconsistencies + within the table. Allowing write access to objects, such + as ipAddressOrigin, could allow a user to insert an entry + and then label it incorrectly. + + Note well: When including IPv6 link-local addresses in this + table, the entry must use an InetAddressType of 'ipv6z' in + order to differentiate between the possible interfaces." + ::= { ip 34 } + +ipAddressEntry OBJECT-TYPE + SYNTAX IpAddressEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An address mapping for a particular interface." + INDEX { ipAddressAddrType, ipAddressAddr } + ::= { ipAddressTable 1 } + +IpAddressEntry ::= SEQUENCE { + ipAddressAddrType InetAddressType, + ipAddressAddr InetAddress, + ipAddressIfIndex InterfaceIndex, + ipAddressType INTEGER, + ipAddressPrefix RowPointer, + ipAddressOrigin IpAddressOriginTC, + ipAddressStatus IpAddressStatusTC, + ipAddressCreated TimeStamp, + ipAddressLastChanged TimeStamp, + ipAddressRowStatus RowStatus, + ipAddressStorageType StorageType + } + +ipAddressAddrType OBJECT-TYPE + SYNTAX InetAddressType + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The address type of ipAddressAddr." + ::= { ipAddressEntry 1 } + +ipAddressAddr OBJECT-TYPE + SYNTAX InetAddress + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The IP address to which this entry's addressing information + + + + pertains. The address type of this object is specified in + ipAddressAddrType. + + Implementors need to be aware that if the size of + ipAddressAddr exceeds 116 octets, then OIDS of instances of + columns in this row will have more than 128 sub-identifiers + and cannot be accessed using SNMPv1, SNMPv2c, or SNMPv3." + ::= { ipAddressEntry 2 } + +ipAddressIfIndex OBJECT-TYPE + SYNTAX InterfaceIndex + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The index value that uniquely identifies the interface to + which this entry is applicable. The interface identified by + a particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipAddressEntry 3 } + +ipAddressType OBJECT-TYPE + SYNTAX INTEGER { + unicast(1), + anycast(2), + broadcast(3) + } + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The type of address. broadcast(3) is not a valid value for + IPv6 addresses (RFC 3513)." + DEFVAL { unicast } + ::= { ipAddressEntry 4 } + +ipAddressPrefix OBJECT-TYPE + SYNTAX RowPointer + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "A pointer to the row in the prefix table to which this + address belongs. May be { 0 0 } if there is no such row." + DEFVAL { zeroDotZero } + ::= { ipAddressEntry 5 } + +ipAddressOrigin OBJECT-TYPE + SYNTAX IpAddressOriginTC + MAX-ACCESS read-only + STATUS current + + + + DESCRIPTION + "The origin of the address." + ::= { ipAddressEntry 6 } + +ipAddressStatus OBJECT-TYPE + SYNTAX IpAddressStatusTC + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The status of the address, describing if the address can be + used for communication. + + In the absence of other information, an IPv4 address is + always preferred(1)." + DEFVAL { preferred } + ::= { ipAddressEntry 7 } + +ipAddressCreated OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime at the time this entry was created. + If this entry was created prior to the last re- + initialization of the local network management subsystem, + then this object contains a zero value." + ::= { ipAddressEntry 8 } + +ipAddressLastChanged OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime at the time this entry was last + updated. If this entry was updated prior to the last re- + initialization of the local network management subsystem, + then this object contains a zero value." + ::= { ipAddressEntry 9 } + +ipAddressRowStatus OBJECT-TYPE + SYNTAX RowStatus + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The status of this conceptual row. + + The RowStatus TC requires that this DESCRIPTION clause + states under which circumstances other objects in this row + + + + can be modified. The value of this object has no effect on + whether other objects in this conceptual row can be + modified. + + A conceptual row can not be made active until the + ipAddressIfIndex has been set to a valid index." + ::= { ipAddressEntry 10 } + +ipAddressStorageType OBJECT-TYPE + SYNTAX StorageType + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The storage type for this conceptual row. If this object + has a value of 'permanent', then no other objects are + required to be able to be modified." + DEFVAL { volatile } + ::= { ipAddressEntry 11 } + +-- +-- the Internet Address Translation table +-- + +ipNetToPhysicalTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpNetToPhysicalEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The IP Address Translation table used for mapping from IP + addresses to physical addresses. + + The Address Translation tables contain the IP address to + 'physical' address equivalences. Some interfaces do not use + translation tables for determining address equivalences + (e.g., DDN-X.25 has an algorithmic method); if all + interfaces are of this type, then the Address Translation + table is empty, i.e., has zero entries. + + While many protocols may be used to populate this table, ARP + and Neighbor Discovery are the most likely + options." + REFERENCE "RFC 826 and RFC 2461" + ::= { ip 35 } + +ipNetToPhysicalEntry OBJECT-TYPE + SYNTAX IpNetToPhysicalEntry + MAX-ACCESS not-accessible + STATUS current + + + + DESCRIPTION + "Each entry contains one IP address to `physical' address + equivalence." + INDEX { ipNetToPhysicalIfIndex, + ipNetToPhysicalNetAddressType, + ipNetToPhysicalNetAddress } + ::= { ipNetToPhysicalTable 1 } + +IpNetToPhysicalEntry ::= SEQUENCE { + ipNetToPhysicalIfIndex InterfaceIndex, + ipNetToPhysicalNetAddressType InetAddressType, + ipNetToPhysicalNetAddress InetAddress, + ipNetToPhysicalPhysAddress PhysAddress, + ipNetToPhysicalLastUpdated TimeStamp, + ipNetToPhysicalType INTEGER, + ipNetToPhysicalState INTEGER, + ipNetToPhysicalRowStatus RowStatus + } + +ipNetToPhysicalIfIndex OBJECT-TYPE + SYNTAX InterfaceIndex + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The index value that uniquely identifies the interface to + which this entry is applicable. The interface identified by + a particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipNetToPhysicalEntry 1 } + +ipNetToPhysicalNetAddressType OBJECT-TYPE + SYNTAX InetAddressType + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The type of ipNetToPhysicalNetAddress." + ::= { ipNetToPhysicalEntry 2 } + +ipNetToPhysicalNetAddress OBJECT-TYPE + SYNTAX InetAddress + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The IP Address corresponding to the media-dependent + `physical' address. The address type of this object is + specified in ipNetToPhysicalAddressType. + + Implementors need to be aware that if the size of + + + + ipNetToPhysicalNetAddress exceeds 115 octets, then OIDS of + instances of columns in this row will have more than 128 + sub-identifiers and cannot be accessed using SNMPv1, + SNMPv2c, or SNMPv3." + ::= { ipNetToPhysicalEntry 3 } + +ipNetToPhysicalPhysAddress OBJECT-TYPE + SYNTAX PhysAddress (SIZE(0..65535)) + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The media-dependent `physical' address. + + As the entries in this table are typically not persistent + when this object is written the entity SHOULD NOT save the + change to non-volatile storage." + ::= { ipNetToPhysicalEntry 4 } + +ipNetToPhysicalLastUpdated OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime at the time this entry was last + updated. If this entry was updated prior to the last re- + initialization of the local network management subsystem, + then this object contains a zero value." + ::= { ipNetToPhysicalEntry 5 } + +ipNetToPhysicalType OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + invalid(2), -- an invalidated mapping + dynamic(3), + static(4), + local(5) -- local interface + } + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The type of mapping. + + Setting this object to the value invalid(2) has the effect + of invalidating the corresponding entry in the + ipNetToPhysicalTable. That is, it effectively dis- + associates the interface identified with said entry from the + mapping identified with said entry. It is an + implementation-specific matter as to whether the agent + + + + removes an invalidated entry from the table. Accordingly, + management stations must be prepared to receive tabular + information from agents that corresponds to entries not + currently in use. Proper interpretation of such entries + requires examination of the relevant ipNetToPhysicalType + object. + + The 'dynamic(3)' type indicates that the IP address to + physical addresses mapping has been dynamically resolved + using e.g., IPv4 ARP or the IPv6 Neighbor Discovery + protocol. + + The 'static(4)' type indicates that the mapping has been + statically configured. Both of these refer to entries that + provide mappings for other entities addresses. + + The 'local(5)' type indicates that the mapping is provided + for an entity's own interface address. + + As the entries in this table are typically not persistent + when this object is written the entity SHOULD NOT save the + change to non-volatile storage." + DEFVAL { static } + ::= { ipNetToPhysicalEntry 6 } + +ipNetToPhysicalState OBJECT-TYPE + SYNTAX INTEGER { + reachable(1), -- confirmed reachability + + stale(2), -- unconfirmed reachability + + delay(3), -- waiting for reachability + -- confirmation before entering + -- the probe state + + probe(4), -- actively probing + + invalid(5), -- an invalidated mapping + + unknown(6), -- state can not be determined + -- for some reason. + + incomplete(7) -- address resolution is being + -- performed. + } + MAX-ACCESS read-only + STATUS current + DESCRIPTION + + + + "The Neighbor Unreachability Detection state for the + interface when the address mapping in this entry is used. + If Neighbor Unreachability Detection is not in use (e.g. for + IPv4), this object is always unknown(6)." + REFERENCE "RFC 2461" + ::= { ipNetToPhysicalEntry 7 } + +ipNetToPhysicalRowStatus OBJECT-TYPE + SYNTAX RowStatus + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The status of this conceptual row. + + The RowStatus TC requires that this DESCRIPTION clause + states under which circumstances other objects in this row + can be modified. The value of this object has no effect on + whether other objects in this conceptual row can be + modified. + + A conceptual row can not be made active until the + ipNetToPhysicalPhysAddress object has been set. + + Note that if the ipNetToPhysicalType is set to 'invalid', + the managed node may delete the entry independent of the + state of this object." + ::= { ipNetToPhysicalEntry 8 } + +-- +-- The IPv6 Scope Zone Index Table. +-- + +ipv6ScopeZoneIndexTable OBJECT-TYPE + SYNTAX SEQUENCE OF Ipv6ScopeZoneIndexEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table used to describe IPv6 unicast and multicast scope + zones. + + For those objects that have names rather than numbers, the + names were chosen to coincide with the names used in the + IPv6 address architecture document. " + REFERENCE "Section 2.7 of RFC 4291" + ::= { ip 36 } + +ipv6ScopeZoneIndexEntry OBJECT-TYPE + SYNTAX Ipv6ScopeZoneIndexEntry + + + + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "Each entry contains the list of scope identifiers on a given + interface." + INDEX { ipv6ScopeZoneIndexIfIndex } + ::= { ipv6ScopeZoneIndexTable 1 } + +Ipv6ScopeZoneIndexEntry ::= SEQUENCE { + ipv6ScopeZoneIndexIfIndex InterfaceIndex, + ipv6ScopeZoneIndexLinkLocal InetZoneIndex, + ipv6ScopeZoneIndex3 InetZoneIndex, + ipv6ScopeZoneIndexAdminLocal InetZoneIndex, + ipv6ScopeZoneIndexSiteLocal InetZoneIndex, + ipv6ScopeZoneIndex6 InetZoneIndex, + ipv6ScopeZoneIndex7 InetZoneIndex, + ipv6ScopeZoneIndexOrganizationLocal InetZoneIndex, + ipv6ScopeZoneIndex9 InetZoneIndex, + ipv6ScopeZoneIndexA InetZoneIndex, + ipv6ScopeZoneIndexB InetZoneIndex, + ipv6ScopeZoneIndexC InetZoneIndex, + ipv6ScopeZoneIndexD InetZoneIndex + } + +ipv6ScopeZoneIndexIfIndex OBJECT-TYPE + SYNTAX InterfaceIndex + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The index value that uniquely identifies the interface to + which these scopes belong. The interface identified by a + particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipv6ScopeZoneIndexEntry 1 } + +ipv6ScopeZoneIndexLinkLocal OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for the link-local scope on this interface." + ::= { ipv6ScopeZoneIndexEntry 2 } + +ipv6ScopeZoneIndex3 OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + + + + "The zone index for scope 3 on this interface." + ::= { ipv6ScopeZoneIndexEntry 3 } + +ipv6ScopeZoneIndexAdminLocal OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for the admin-local scope on this interface." + ::= { ipv6ScopeZoneIndexEntry 4 } + +ipv6ScopeZoneIndexSiteLocal OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for the site-local scope on this interface." + ::= { ipv6ScopeZoneIndexEntry 5 } + +ipv6ScopeZoneIndex6 OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for scope 6 on this interface." + ::= { ipv6ScopeZoneIndexEntry 6 } + +ipv6ScopeZoneIndex7 OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for scope 7 on this interface." + ::= { ipv6ScopeZoneIndexEntry 7 } + +ipv6ScopeZoneIndexOrganizationLocal OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for the organization-local scope on this + interface." + ::= { ipv6ScopeZoneIndexEntry 8 } + +ipv6ScopeZoneIndex9 OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + + + + DESCRIPTION + "The zone index for scope 9 on this interface." + ::= { ipv6ScopeZoneIndexEntry 9 } + +ipv6ScopeZoneIndexA OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for scope A on this interface." + ::= { ipv6ScopeZoneIndexEntry 10 } + +ipv6ScopeZoneIndexB OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for scope B on this interface." + ::= { ipv6ScopeZoneIndexEntry 11 } + +ipv6ScopeZoneIndexC OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for scope C on this interface." + ::= { ipv6ScopeZoneIndexEntry 12 } + +ipv6ScopeZoneIndexD OBJECT-TYPE + SYNTAX InetZoneIndex + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The zone index for scope D on this interface." + ::= { ipv6ScopeZoneIndexEntry 13 } + +-- +-- The Default Router Table +-- This table simply lists the default routers; for more information +-- about routing tables, see the routing MIBs +-- + +ipDefaultRouterTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpDefaultRouterEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table used to describe the default routers known to this + + + + entity." + ::= { ip 37 } + +ipDefaultRouterEntry OBJECT-TYPE + SYNTAX IpDefaultRouterEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "Each entry contains information about a default router known + to this entity." + INDEX {ipDefaultRouterAddressType, ipDefaultRouterAddress, + ipDefaultRouterIfIndex} + ::= { ipDefaultRouterTable 1 } + +IpDefaultRouterEntry ::= SEQUENCE { + ipDefaultRouterAddressType InetAddressType, + ipDefaultRouterAddress InetAddress, + ipDefaultRouterIfIndex InterfaceIndex, + ipDefaultRouterLifetime Unsigned32, + ipDefaultRouterPreference INTEGER + } + +ipDefaultRouterAddressType OBJECT-TYPE + SYNTAX InetAddressType + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The address type for this row." + ::= { ipDefaultRouterEntry 1 } + +ipDefaultRouterAddress OBJECT-TYPE + SYNTAX InetAddress + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The IP address of the default router represented by this + row. The address type of this object is specified in + ipDefaultRouterAddressType. + + Implementers need to be aware that if the size of + ipDefaultRouterAddress exceeds 115 octets, then OIDS of + instances of columns in this row will have more than 128 + sub-identifiers and cannot be accessed using SNMPv1, + SNMPv2c, or SNMPv3." + ::= { ipDefaultRouterEntry 2 } + +ipDefaultRouterIfIndex OBJECT-TYPE + SYNTAX InterfaceIndex + + + + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The index value that uniquely identifies the interface by + which the router can be reached. The interface identified + by a particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipDefaultRouterEntry 3 } + +ipDefaultRouterLifetime OBJECT-TYPE + SYNTAX Unsigned32 (0..65535) + UNITS "seconds" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The remaining length of time, in seconds, that this router + will continue to be useful as a default router. A value of + zero indicates that it is no longer useful as a default + router. It is left to the implementer of the MIB as to + whether a router with a lifetime of zero is removed from the + list. + + For IPv6, this value should be extracted from the router + advertisement messages." + REFERENCE "For IPv6 RFC 2462 sections 4.2 and 6.3.4" + ::= { ipDefaultRouterEntry 4 } + +ipDefaultRouterPreference OBJECT-TYPE + SYNTAX INTEGER { + reserved (-2), + low (-1), + medium (0), + high (1) + } + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "An indication of preference given to this router as a + default router as described in he Default Router + Preferences document. Treating the value as a + 2 bit signed integer allows for simple arithmetic + comparisons. + + For IPv4 routers or IPv6 routers that are not using the + updated router advertisement format, this object is set to + medium (0)." + REFERENCE "RFC 4291, section 2.1" + ::= { ipDefaultRouterEntry 5 } + + + +-- +-- Configuration information for constructing router advertisements +-- + +ipv6RouterAdvertSpinLock OBJECT-TYPE + SYNTAX TestAndIncr + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "An advisory lock used to allow cooperating SNMP managers to + coordinate their use of the set operation in creating or + modifying rows within this table. + + In order to use this lock to coordinate the use of set + operations, managers should first retrieve + ipv6RouterAdvertSpinLock. They should then determine the + appropriate row to create or modify. Finally, they should + issue the appropriate set command including the retrieved + value of ipv6RouterAdvertSpinLock. If another manager has + altered the table in the meantime, then the value of + ipv6RouterAdvertSpinLock will have changed and the creation + will fail as it will be specifying an incorrect value for + ipv6RouterAdvertSpinLock. It is suggested, but not + required, that the ipv6RouterAdvertSpinLock be the first var + bind for each set of objects representing a 'row' in a PDU." + ::= { ip 38 } + +ipv6RouterAdvertTable OBJECT-TYPE + SYNTAX SEQUENCE OF Ipv6RouterAdvertEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table containing information used to construct router + advertisements." + ::= { ip 39 } + +ipv6RouterAdvertEntry OBJECT-TYPE + SYNTAX Ipv6RouterAdvertEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An entry containing information used to construct router + advertisements. + + Information in this table is persistent, and when this + object is written, the entity SHOULD save the change to + non-volatile storage." + INDEX { ipv6RouterAdvertIfIndex } + + + + ::= { ipv6RouterAdvertTable 1 } + +Ipv6RouterAdvertEntry ::= SEQUENCE { + ipv6RouterAdvertIfIndex InterfaceIndex, + ipv6RouterAdvertSendAdverts TruthValue, + ipv6RouterAdvertMaxInterval Unsigned32, + ipv6RouterAdvertMinInterval Unsigned32, + ipv6RouterAdvertManagedFlag TruthValue, + ipv6RouterAdvertOtherConfigFlag TruthValue, + ipv6RouterAdvertLinkMTU Unsigned32, + ipv6RouterAdvertReachableTime Unsigned32, + ipv6RouterAdvertRetransmitTime Unsigned32, + ipv6RouterAdvertCurHopLimit Unsigned32, + ipv6RouterAdvertDefaultLifetime Unsigned32, + ipv6RouterAdvertRowStatus RowStatus + } + +ipv6RouterAdvertIfIndex OBJECT-TYPE + SYNTAX InterfaceIndex + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The index value that uniquely identifies the interface on + which router advertisements constructed with this + information will be transmitted. The interface identified + by a particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipv6RouterAdvertEntry 1 } + +ipv6RouterAdvertSendAdverts OBJECT-TYPE + SYNTAX TruthValue + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "A flag indicating whether the router sends periodic + router advertisements and responds to router solicitations + on this interface." + REFERENCE "RFC 2461 Section 6.2.1" + DEFVAL { false } + ::= { ipv6RouterAdvertEntry 2 } + +ipv6RouterAdvertMaxInterval OBJECT-TYPE + SYNTAX Unsigned32 (4..1800) + UNITS "seconds" + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The maximum time allowed between sending unsolicited router + + + + advertisements from this interface." + REFERENCE "RFC 2461 Section 6.2.1" + DEFVAL { 600 } + ::= { ipv6RouterAdvertEntry 3 } + +ipv6RouterAdvertMinInterval OBJECT-TYPE + SYNTAX Unsigned32 (3..1350) + UNITS "seconds" + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The minimum time allowed between sending unsolicited router + advertisements from this interface. + + The default is 0.33 * ipv6RouterAdvertMaxInterval, however, + in the case of a low value for ipv6RouterAdvertMaxInterval, + the minimum value for this object is restricted to 3." + REFERENCE "RFC 2461 Section 6.2.1" + ::= { ipv6RouterAdvertEntry 4 } + +ipv6RouterAdvertManagedFlag OBJECT-TYPE + SYNTAX TruthValue + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The true/false value to be placed into the 'managed address + configuration' flag field in router advertisements sent from + this interface." + REFERENCE "RFC 2461 Section 6.2.1" + DEFVAL { false } + ::= { ipv6RouterAdvertEntry 5 } + +ipv6RouterAdvertOtherConfigFlag OBJECT-TYPE + SYNTAX TruthValue + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The true/false value to be placed into the 'other stateful + configuration' flag field in router advertisements sent from + this interface." + REFERENCE "RFC 2461 Section 6.2.1" + DEFVAL { false } + ::= { ipv6RouterAdvertEntry 6 } + +ipv6RouterAdvertLinkMTU OBJECT-TYPE + SYNTAX Unsigned32 + MAX-ACCESS read-create + STATUS current + + + + DESCRIPTION + "The value to be placed in MTU options sent by the router on + this interface. + + A value of zero indicates that no MTU options are sent." + REFERENCE "RFC 2461 Section 6.2.1" + DEFVAL { 0 } + ::= { ipv6RouterAdvertEntry 7 } + +ipv6RouterAdvertReachableTime OBJECT-TYPE + SYNTAX Unsigned32 (0..3600000) + UNITS "milliseconds" + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The value to be placed in the reachable time field in router + advertisement messages sent from this interface. + + A value of zero in the router advertisement indicates that + the advertisement isn't specifying a value for reachable + time." + REFERENCE "RFC 2461 Section 6.2.1" + DEFVAL { 0 } + ::= { ipv6RouterAdvertEntry 8 } + +ipv6RouterAdvertRetransmitTime OBJECT-TYPE + SYNTAX Unsigned32 + UNITS "milliseconds" + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The value to be placed in the retransmit timer field in + router advertisements sent from this interface. + + A value of zero in the router advertisement indicates that + the advertisement isn't specifying a value for retrans + time." + REFERENCE "RFC 2461 Section 6.2.1" + DEFVAL { 0 } + ::= { ipv6RouterAdvertEntry 9 } + +ipv6RouterAdvertCurHopLimit OBJECT-TYPE + SYNTAX Unsigned32 (0..255) + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The default value to be placed in the current hop limit + field in router advertisements sent from this interface. + + + + The value should be set to the current diameter of the + Internet. + + A value of zero in the router advertisement indicates that + the advertisement isn't specifying a value for curHopLimit. + + The default should be set to the value specified in the IANA + web pages (www.iana.org) at the time of implementation." + REFERENCE "RFC 2461 Section 6.2.1" + ::= { ipv6RouterAdvertEntry 10 } + +ipv6RouterAdvertDefaultLifetime OBJECT-TYPE + SYNTAX Unsigned32 (0|4..9000) + UNITS "seconds" + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The value to be placed in the router lifetime field of + router advertisements sent from this interface. This value + MUST be either 0 or between ipv6RouterAdvertMaxInterval and + 9000 seconds. + + A value of zero indicates that the router is not to be used + as a default router. + + The default is 3 * ipv6RouterAdvertMaxInterval." + REFERENCE "RFC 2461 Section 6.2.1" + ::= { ipv6RouterAdvertEntry 11 } + +ipv6RouterAdvertRowStatus OBJECT-TYPE + SYNTAX RowStatus + MAX-ACCESS read-create + STATUS current + DESCRIPTION + "The status of this conceptual row. + + As all objects in this conceptual row have default values, a + row can be created and made active by setting this object + appropriately. + + The RowStatus TC requires that this DESCRIPTION clause + states under which circumstances other objects in this row + can be modified. The value of this object has no effect on + whether other objects in this conceptual row can be + modified." + ::= { ipv6RouterAdvertEntry 12 } + +-- + + + +-- ICMP section +-- + +icmp OBJECT IDENTIFIER ::= { mib-2 5 } + +-- +-- ICMP non-message-specific counters +-- + +-- These object IDs are reserved, as they were used in earlier +-- versions of the MIB module. In theory, OIDs are not assigned +-- until the specification is released as an RFC; however, as some +-- companies may have shipped code based on earlier versions of +-- the MIB, it seems best to reserve these OIDs. +-- ::= { icmp 27 } +-- ::= { icmp 28 } + +icmpStatsTable OBJECT-TYPE + SYNTAX SEQUENCE OF IcmpStatsEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table of generic system-wide ICMP counters." + ::= { icmp 29 } + +icmpStatsEntry OBJECT-TYPE + SYNTAX IcmpStatsEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A conceptual row in the icmpStatsTable." + INDEX { icmpStatsIPVersion } + ::= { icmpStatsTable 1 } + +IcmpStatsEntry ::= SEQUENCE { + icmpStatsIPVersion InetVersion, + icmpStatsInMsgs Counter32, + icmpStatsInErrors Counter32, + icmpStatsOutMsgs Counter32, + icmpStatsOutErrors Counter32 + } + +icmpStatsIPVersion OBJECT-TYPE + SYNTAX InetVersion + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The IP version of the statistics." + + + + ::= { icmpStatsEntry 1 } + +icmpStatsInMsgs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of ICMP messages that the entity received. + Note that this counter includes all those counted by + icmpStatsInErrors." + ::= { icmpStatsEntry 2 } + +icmpStatsInErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of ICMP messages that the entity received but + determined as having ICMP-specific errors (bad ICMP + checksums, bad length, etc.)." + ::= { icmpStatsEntry 3 } + +icmpStatsOutMsgs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of ICMP messages that the entity attempted + to send. Note that this counter includes all those counted + by icmpStatsOutErrors." + ::= { icmpStatsEntry 4 } + +icmpStatsOutErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of ICMP messages that this entity did not send + due to problems discovered within ICMP, such as a lack of + buffers. This value should not include errors discovered + outside the ICMP layer, such as the inability of IP to route + the resultant datagram. In some implementations, there may + be no types of error that contribute to this counter's + value." + ::= { icmpStatsEntry 5 } + +-- +-- per-version, per-message type ICMP counters + + + +-- + +icmpMsgStatsTable OBJECT-TYPE + SYNTAX SEQUENCE OF IcmpMsgStatsEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The table of system-wide per-version, per-message type ICMP + counters." + ::= { icmp 30 } + +icmpMsgStatsEntry OBJECT-TYPE + SYNTAX IcmpMsgStatsEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A conceptual row in the icmpMsgStatsTable. + + The system should track each ICMP type value, even if that + ICMP type is not supported by the system. However, a + given row need not be instantiated unless a message of that + type has been processed, i.e., the row for + icmpMsgStatsType=X MAY be instantiated before but MUST be + instantiated after the first message with Type=X is + received or transmitted. After receiving or transmitting + any succeeding messages with Type=X, the relevant counter + must be incremented." + INDEX { icmpMsgStatsIPVersion, icmpMsgStatsType } + ::= { icmpMsgStatsTable 1 } + +IcmpMsgStatsEntry ::= SEQUENCE { + icmpMsgStatsIPVersion InetVersion, + icmpMsgStatsType Integer32, + icmpMsgStatsInPkts Counter32, + icmpMsgStatsOutPkts Counter32 + } + +icmpMsgStatsIPVersion OBJECT-TYPE + SYNTAX InetVersion + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The IP version of the statistics." + ::= { icmpMsgStatsEntry 1 } + +icmpMsgStatsType OBJECT-TYPE + SYNTAX Integer32 (0..255) + MAX-ACCESS not-accessible + + + + STATUS current + DESCRIPTION + "The ICMP type field of the message type being counted by + this row. + + Note that ICMP message types are scoped by the address type + in use." + REFERENCE "http://www.iana.org/assignments/icmp-parameters and + http://www.iana.org/assignments/icmpv6-parameters" + ::= { icmpMsgStatsEntry 2 } + +icmpMsgStatsInPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of input packets for this AF and type." + ::= { icmpMsgStatsEntry 3 } + +icmpMsgStatsOutPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of output packets for this AF and type." + ::= { icmpMsgStatsEntry 4 } +-- +-- conformance information +-- + +ipMIBConformance OBJECT IDENTIFIER ::= { ipMIB 2 } + +ipMIBCompliances OBJECT IDENTIFIER ::= { ipMIBConformance 1 } +ipMIBGroups OBJECT IDENTIFIER ::= { ipMIBConformance 2 } + +-- compliance statements +ipMIBCompliance2 MODULE-COMPLIANCE + STATUS current + DESCRIPTION + "The compliance statement for systems that implement IP - + either IPv4 or IPv6. + + There are a number of INDEX objects that cannot be + represented in the form of OBJECT clauses in SMIv2, but + for which we have the following compliance requirements, + expressed in OBJECT clause form in this description + clause: + + + + + -- OBJECT ipSystemStatsIPVersion + -- SYNTAX InetVersion {ipv4(1), ipv6(2)} + -- DESCRIPTION + -- This MIB requires support for only IPv4 and IPv6 + -- versions. + -- + -- OBJECT ipIfStatsIPVersion + -- SYNTAX InetVersion {ipv4(1), ipv6(2)} + -- DESCRIPTION + -- This MIB requires support for only IPv4 and IPv6 + -- versions. + -- + -- OBJECT icmpStatsIPVersion + -- SYNTAX InetVersion {ipv4(1), ipv6(2)} + -- DESCRIPTION + -- This MIB requires support for only IPv4 and IPv6 + -- versions. + -- + -- OBJECT icmpMsgStatsIPVersion + -- SYNTAX InetVersion {ipv4(1), ipv6(2)} + -- DESCRIPTION + -- This MIB requires support for only IPv4 and IPv6 + -- versions. + -- + -- OBJECT ipAddressPrefixType + -- SYNTAX InetAddressType {ipv4(1), ipv6(2)} + -- DESCRIPTION + -- This MIB requires support for only global IPv4 and + -- IPv6 address types. + -- + -- OBJECT ipAddressPrefixPrefix + -- SYNTAX InetAddress (Size(4 | 16)) + -- DESCRIPTION + -- This MIB requires support for only global IPv4 and + -- IPv6 addresses and so the size can be either 4 or + -- 16 bytes. + -- + -- OBJECT ipAddressAddrType + -- SYNTAX InetAddressType {ipv4(1), ipv6(2), + -- ipv4z(3), ipv6z(4)} + -- DESCRIPTION + -- This MIB requires support for only global and + -- non-global IPv4 and IPv6 address types. + -- + -- OBJECT ipAddressAddr + -- SYNTAX InetAddress (Size(4 | 8 | 16 | 20)) + -- DESCRIPTION + -- This MIB requires support for only global and + + + + -- non-global IPv4 and IPv6 addresses and so the size + -- can be 4, 8, 16, or 20 bytes. + -- + -- OBJECT ipNetToPhysicalNetAddressType + -- SYNTAX InetAddressType {ipv4(1), ipv6(2), + -- ipv4z(3), ipv6z(4)} + -- DESCRIPTION + -- This MIB requires support for only global and + -- non-global IPv4 and IPv6 address types. + -- + -- OBJECT ipNetToPhysicalNetAddress + -- SYNTAX InetAddress (Size(4 | 8 | 16 | 20)) + -- DESCRIPTION + -- This MIB requires support for only global and + -- non-global IPv4 and IPv6 addresses and so the size + -- can be 4, 8, 16, or 20 bytes. + -- + -- OBJECT ipDefaultRouterAddressType + -- SYNTAX InetAddressType {ipv4(1), ipv6(2), + -- ipv4z(3), ipv6z(4)} + -- DESCRIPTION + -- This MIB requires support for only global and + -- non-global IPv4 and IPv6 address types. + -- + -- OBJECT ipDefaultRouterAddress + -- SYNTAX InetAddress (Size(4 | 8 | 16 | 20)) + -- DESCRIPTION + -- This MIB requires support for only global and + -- non-global IPv4 and IPv6 addresses and so the size + -- can be 4, 8, 16, or 20 bytes." + + MODULE -- this module + + MANDATORY-GROUPS { ipSystemStatsGroup, ipAddressGroup, + ipNetToPhysicalGroup, ipDefaultRouterGroup, + icmpStatsGroup } + + GROUP ipSystemStatsHCOctetGroup + DESCRIPTION + "This group is mandatory for systems that have an aggregate + bandwidth of greater than 20MB. Including this group does + not allow an entity to neglect the 32 bit versions of these + objects." + + GROUP ipSystemStatsHCPacketGroup + DESCRIPTION + "This group is mandatory for systems that have an aggregate + bandwidth of greater than 650MB. Including this group + + + + does not allow an entity to neglect the 32 bit versions of + these objects." + + GROUP ipIfStatsGroup + DESCRIPTION + "This group is optional for all systems." + + GROUP ipIfStatsHCOctetGroup + DESCRIPTION + "This group is mandatory for systems that include the + ipIfStatsGroup and include links with bandwidths of greater + than 20MB. Including this group does not allow an entity to + neglect the 32 bit versions of these objects." + + GROUP ipIfStatsHCPacketGroup + DESCRIPTION + "This group is mandatory for systems that include the + ipIfStatsGroup and include links with bandwidths of greater + than 650MB. Including this group does not allow an entity + to neglect the 32 bit versions of these objects." + + GROUP ipv4GeneralGroup + DESCRIPTION + "This group is mandatory for all systems supporting IPv4." + + GROUP ipv4IfGroup + DESCRIPTION + "This group is mandatory for all systems supporting IPv4." + + GROUP ipv4SystemStatsGroup + DESCRIPTION + "This group is mandatory for all systems supporting IPv4." + + GROUP ipv4SystemStatsHCPacketGroup + DESCRIPTION + "This group is mandatory for all systems supporting IPv4 and + that have an aggregate bandwidth of greater than 650MB. + Including this group does not allow an entity to neglect the + 32 bit versions of these objects." + + GROUP ipv4IfStatsGroup + DESCRIPTION + "This group is mandatory for all systems supporting IPv4 and + including the ipIfStatsGroup." + + GROUP ipv4IfStatsHCPacketGroup + DESCRIPTION + "This group is mandatory for all systems supporting IPv4 and + + + + including the ipIfStatsHCPacketGroup. Including this group + does not allow an entity to neglect the 32 bit versions of + these objects." + + GROUP ipv6GeneralGroup2 + DESCRIPTION + "This group is mandatory for all systems supporting IPv6." + + GROUP ipv6IfGroup + DESCRIPTION + "This group is mandatory for all systems supporting IPv6." + + GROUP ipAddressPrefixGroup + DESCRIPTION + "This group is mandatory for all systems supporting IPv6." + + GROUP ipv6ScopeGroup + DESCRIPTION + "This group is mandatory for all systems supporting IPv6." + + GROUP ipv6RouterAdvertGroup + DESCRIPTION + "This group is mandatory for all IPv6 routers." + + GROUP ipLastChangeGroup + DESCRIPTION + "This group is optional for all agents." + + OBJECT ipv6IpForwarding + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6IpDefaultHopLimit + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv4InterfaceEnableStatus + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6InterfaceEnableStatus + MIN-ACCESS read-only + + + + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6InterfaceForwarding + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipAddressSpinLock + MIN-ACCESS not-accessible + DESCRIPTION + "An agent is not required to provide write access to this + object. However, if an agent provides write access to any + of the other objects in the ipAddressGroup, it SHOULD + provide write access to this object as well." + + OBJECT ipAddressIfIndex + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write or create access + to this object." + + OBJECT ipAddressType + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write or create access + to this object." + + OBJECT ipAddressStatus + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write or create access + to this object." + + OBJECT ipAddressRowStatus + SYNTAX RowStatus { active(1) } + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write or create access + to this object." + + OBJECT ipAddressStorageType + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write or create access + to this object. + + + + If an agent allows this object to be written or created, it + is not required to allow this object to be set to readOnly, + permanent, or nonVolatile." + + OBJECT ipNetToPhysicalPhysAddress + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write or create access + to this object." + + OBJECT ipNetToPhysicalType + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write or create access + to this object." + + OBJECT ipv6RouterAdvertSpinLock + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object. However, if an agent provides write access to + any of the other objects in the ipv6RouterAdvertGroup, it + SHOULD provide write access to this object as well." + + OBJECT ipv6RouterAdvertSendAdverts + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6RouterAdvertMaxInterval + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6RouterAdvertMinInterval + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6RouterAdvertManagedFlag + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + + + + OBJECT ipv6RouterAdvertOtherConfigFlag + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6RouterAdvertLinkMTU + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6RouterAdvertReachableTime + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6RouterAdvertRetransmitTime + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6RouterAdvertCurHopLimit + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6RouterAdvertDefaultLifetime + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write access to this + object." + + OBJECT ipv6RouterAdvertRowStatus + MIN-ACCESS read-only + DESCRIPTION + "An agent is not required to provide write or create access + to this object." + + ::= { ipMIBCompliances 2 } + +-- units of conformance + +ipv4GeneralGroup OBJECT-GROUP + OBJECTS { ipForwarding, ipDefaultTTL, ipReasmTimeout } + + + + STATUS current + DESCRIPTION + "The group of IPv4-specific objects for basic management of + IPv4 entities." + ::= { ipMIBGroups 3 } + +ipv4IfGroup OBJECT-GROUP + OBJECTS { ipv4InterfaceReasmMaxSize, ipv4InterfaceEnableStatus, + ipv4InterfaceRetransmitTime } + STATUS current + DESCRIPTION + "The group of IPv4-specific objects for basic management of + IPv4 interfaces." + ::= { ipMIBGroups 4 } + +ipv6GeneralGroup2 OBJECT-GROUP + OBJECTS { ipv6IpForwarding, ipv6IpDefaultHopLimit } + STATUS current + DESCRIPTION + "The IPv6 group of objects providing for basic management of + IPv6 entities." + ::= { ipMIBGroups 5 } + +ipv6IfGroup OBJECT-GROUP + OBJECTS { ipv6InterfaceReasmMaxSize, ipv6InterfaceIdentifier, + ipv6InterfaceEnableStatus, ipv6InterfaceReachableTime, + ipv6InterfaceRetransmitTime, ipv6InterfaceForwarding } + STATUS current + DESCRIPTION + "The group of IPv6-specific objects for basic management of + IPv6 interfaces." + ::= { ipMIBGroups 6 } + +ipLastChangeGroup OBJECT-GROUP + OBJECTS { ipv4InterfaceTableLastChange, + ipv6InterfaceTableLastChange, + ipIfStatsTableLastChange } + STATUS current + DESCRIPTION + "The last change objects associated with this MIB. These + objects are optional for all agents. They SHOULD be + implemented on agents where it is possible to determine the + proper values. Where it is not possible to determine the + proper values, for example when the tables are split amongst + several sub-agents using AgentX, the agent MUST NOT + implement these objects to return an incorrect or static + value." + ::= { ipMIBGroups 7 } + + + +ipSystemStatsGroup OBJECT-GROUP + OBJECTS { ipSystemStatsInReceives, + ipSystemStatsInOctets, + ipSystemStatsInHdrErrors, + ipSystemStatsInNoRoutes, + ipSystemStatsInAddrErrors, + ipSystemStatsInUnknownProtos, + ipSystemStatsInTruncatedPkts, + ipSystemStatsInForwDatagrams, + ipSystemStatsReasmReqds, + ipSystemStatsReasmOKs, + ipSystemStatsReasmFails, + ipSystemStatsInDiscards, + ipSystemStatsInDelivers, + ipSystemStatsOutRequests, + ipSystemStatsOutNoRoutes, + ipSystemStatsOutForwDatagrams, + ipSystemStatsOutDiscards, + ipSystemStatsOutFragReqds, + ipSystemStatsOutFragOKs, + ipSystemStatsOutFragFails, + ipSystemStatsOutFragCreates, + ipSystemStatsOutTransmits, + ipSystemStatsOutOctets, + ipSystemStatsInMcastPkts, + ipSystemStatsInMcastOctets, + ipSystemStatsOutMcastPkts, + ipSystemStatsOutMcastOctets, + ipSystemStatsDiscontinuityTime, + ipSystemStatsRefreshRate } + STATUS current + DESCRIPTION + "IP system wide statistics." + ::= { ipMIBGroups 8 } + +ipv4SystemStatsGroup OBJECT-GROUP + OBJECTS { ipSystemStatsInBcastPkts, ipSystemStatsOutBcastPkts } + STATUS current + DESCRIPTION + "IPv4 only system wide statistics." + ::= { ipMIBGroups 9 } + +ipSystemStatsHCOctetGroup OBJECT-GROUP + OBJECTS { ipSystemStatsHCInOctets, + ipSystemStatsHCOutOctets, + ipSystemStatsHCInMcastOctets, + ipSystemStatsHCOutMcastOctets +} + + + + STATUS current + DESCRIPTION + "IP system wide statistics for systems that may overflow the + standard octet counters within 1 hour." + ::= { ipMIBGroups 10 } + +ipSystemStatsHCPacketGroup OBJECT-GROUP + OBJECTS { ipSystemStatsHCInReceives, + ipSystemStatsHCInForwDatagrams, + ipSystemStatsHCInDelivers, + ipSystemStatsHCOutRequests, + ipSystemStatsHCOutForwDatagrams, + ipSystemStatsHCOutTransmits, + ipSystemStatsHCInMcastPkts, + ipSystemStatsHCOutMcastPkts +} + STATUS current + DESCRIPTION + "IP system wide statistics for systems that may overflow the + standard packet counters within 1 hour." + ::= { ipMIBGroups 11 } + +ipv4SystemStatsHCPacketGroup OBJECT-GROUP + OBJECTS { ipSystemStatsHCInBcastPkts, + ipSystemStatsHCOutBcastPkts } + STATUS current + DESCRIPTION + "IPv4 only system wide statistics for systems that may + overflow the standard packet counters within 1 hour." + ::= { ipMIBGroups 12 } + +ipIfStatsGroup OBJECT-GROUP + OBJECTS { ipIfStatsInReceives, ipIfStatsInOctets, + ipIfStatsInHdrErrors, ipIfStatsInNoRoutes, + ipIfStatsInAddrErrors, ipIfStatsInUnknownProtos, + ipIfStatsInTruncatedPkts, ipIfStatsInForwDatagrams, + ipIfStatsReasmReqds, ipIfStatsReasmOKs, + ipIfStatsReasmFails, ipIfStatsInDiscards, + ipIfStatsInDelivers, ipIfStatsOutRequests, + ipIfStatsOutForwDatagrams, ipIfStatsOutDiscards, + ipIfStatsOutFragReqds, ipIfStatsOutFragOKs, + ipIfStatsOutFragFails, ipIfStatsOutFragCreates, + ipIfStatsOutTransmits, ipIfStatsOutOctets, + ipIfStatsInMcastPkts, ipIfStatsInMcastOctets, + ipIfStatsOutMcastPkts, ipIfStatsOutMcastOctets, + ipIfStatsDiscontinuityTime, ipIfStatsRefreshRate } + STATUS current + DESCRIPTION + + + + "IP per-interface statistics." + ::= { ipMIBGroups 13 } + +ipv4IfStatsGroup OBJECT-GROUP + OBJECTS { ipIfStatsInBcastPkts, ipIfStatsOutBcastPkts } + STATUS current + DESCRIPTION + "IPv4 only per-interface statistics." + ::= { ipMIBGroups 14 } + +ipIfStatsHCOctetGroup OBJECT-GROUP + OBJECTS { ipIfStatsHCInOctets, ipIfStatsHCOutOctets, + ipIfStatsHCInMcastOctets, ipIfStatsHCOutMcastOctets } + STATUS current + DESCRIPTION + "IP per-interfaces statistics for systems that include + interfaces that may overflow the standard octet + counters within 1 hour." + ::= { ipMIBGroups 15 } + +ipIfStatsHCPacketGroup OBJECT-GROUP + OBJECTS { ipIfStatsHCInReceives, ipIfStatsHCInForwDatagrams, + ipIfStatsHCInDelivers, ipIfStatsHCOutRequests, + ipIfStatsHCOutForwDatagrams, ipIfStatsHCOutTransmits, + ipIfStatsHCInMcastPkts, ipIfStatsHCOutMcastPkts } + STATUS current + DESCRIPTION + "IP per-interfaces statistics for systems that include + interfaces that may overflow the standard packet counters + within 1 hour." + ::= { ipMIBGroups 16 } + +ipv4IfStatsHCPacketGroup OBJECT-GROUP + OBJECTS { ipIfStatsHCInBcastPkts, ipIfStatsHCOutBcastPkts } + STATUS current + DESCRIPTION + "IPv4 only per-interface statistics for systems that include + interfaces that may overflow the standard packet counters + within 1 hour." + ::= { ipMIBGroups 17 } + +ipAddressPrefixGroup OBJECT-GROUP + OBJECTS { ipAddressPrefixOrigin, + ipAddressPrefixOnLinkFlag, + ipAddressPrefixAutonomousFlag, + ipAddressPrefixAdvPreferredLifetime, + ipAddressPrefixAdvValidLifetime } + STATUS current + + + + DESCRIPTION + "The group of objects for providing information about address + prefixes used by this node." + ::= { ipMIBGroups 18 } + +ipAddressGroup OBJECT-GROUP + OBJECTS { ipAddressSpinLock, ipAddressIfIndex, + ipAddressType, ipAddressPrefix, + ipAddressOrigin, ipAddressStatus, + ipAddressCreated, ipAddressLastChanged, + ipAddressRowStatus, ipAddressStorageType } + STATUS current + DESCRIPTION + "The group of objects for providing information about the + addresses relevant to this entity's interfaces." + ::= { ipMIBGroups 19 } + +ipNetToPhysicalGroup OBJECT-GROUP + OBJECTS { ipNetToPhysicalPhysAddress, ipNetToPhysicalLastUpdated, + ipNetToPhysicalType, ipNetToPhysicalState, + ipNetToPhysicalRowStatus } + STATUS current + DESCRIPTION + "The group of objects for providing information about the + mappings of network address to physical address known to + this node." + ::= { ipMIBGroups 20 } + +ipv6ScopeGroup OBJECT-GROUP + OBJECTS { ipv6ScopeZoneIndexLinkLocal, + ipv6ScopeZoneIndex3, + ipv6ScopeZoneIndexAdminLocal, + ipv6ScopeZoneIndexSiteLocal, + ipv6ScopeZoneIndex6, + ipv6ScopeZoneIndex7, + ipv6ScopeZoneIndexOrganizationLocal, + ipv6ScopeZoneIndex9, + ipv6ScopeZoneIndexA, + ipv6ScopeZoneIndexB, + ipv6ScopeZoneIndexC, + ipv6ScopeZoneIndexD } + STATUS current + DESCRIPTION + "The group of objects for managing IPv6 scope zones." + ::= { ipMIBGroups 21 } + +ipDefaultRouterGroup OBJECT-GROUP + OBJECTS { ipDefaultRouterLifetime, ipDefaultRouterPreference } + + + + STATUS current + DESCRIPTION + "The group of objects for providing information about default + routers known to this node." + ::= { ipMIBGroups 22 } + +ipv6RouterAdvertGroup OBJECT-GROUP + OBJECTS { ipv6RouterAdvertSpinLock, + ipv6RouterAdvertSendAdverts, + ipv6RouterAdvertMaxInterval, + ipv6RouterAdvertMinInterval, + ipv6RouterAdvertManagedFlag, + ipv6RouterAdvertOtherConfigFlag, + ipv6RouterAdvertLinkMTU, + ipv6RouterAdvertReachableTime, + ipv6RouterAdvertRetransmitTime, + ipv6RouterAdvertCurHopLimit, + ipv6RouterAdvertDefaultLifetime, + ipv6RouterAdvertRowStatus +} + STATUS current + DESCRIPTION + "The group of objects for controlling information advertised + by IPv6 routers." + ::= { ipMIBGroups 23 } + +icmpStatsGroup OBJECT-GROUP + OBJECTS {icmpStatsInMsgs, icmpStatsInErrors, + icmpStatsOutMsgs, icmpStatsOutErrors, + icmpMsgStatsInPkts, icmpMsgStatsOutPkts } + STATUS current + DESCRIPTION + "The group of objects providing ICMP statistics." + ::= { ipMIBGroups 24 } + +-- +-- Deprecated objects +-- + +ipInReceives OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The total number of input datagrams received from + interfaces, including those received in error. + + This object has been deprecated, as a new IP version-neutral + + + + table has been added. It is loosely replaced by + ipSystemStatsInRecieves." + ::= { ip 3 } + +ipInHdrErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of input datagrams discarded due to errors in + their IPv4 headers, including bad checksums, version number + mismatch, other format errors, time-to-live exceeded, errors + discovered in processing their IPv4 options, etc. + + This object has been deprecated as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsInHdrErrors." + ::= { ip 4 } + +ipInAddrErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of input datagrams discarded because the IPv4 + address in their IPv4 header's destination field was not a + valid address to be received at this entity. This count + includes invalid addresses (e.g., 0.0.0.0) and addresses of + unsupported Classes (e.g., Class E). For entities which are + not IPv4 routers, and therefore do not forward datagrams, + this counter includes datagrams discarded because the + destination address was not a local address. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsInAddrErrors." + ::= { ip 5 } + +ipForwDatagrams OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of input datagrams for which this entity was not + their final IPv4 destination, as a result of which an + attempt was made to find a route to forward them to that + final destination. In entities which do not act as IPv4 + routers, this counter will include only those packets which + + + + were Source-Routed via this entity, and the Source-Route + option processing was successful. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsInForwDatagrams." + ::= { ip 6 } + +ipInUnknownProtos OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of locally-addressed datagrams received + successfully but discarded because of an unknown or + unsupported protocol. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsInUnknownProtos." + ::= { ip 7 } + +ipInDiscards OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of input IPv4 datagrams for which no problems + were encountered to prevent their continued processing, but + which were discarded (e.g., for lack of buffer space). Note + that this counter does not include any datagrams discarded + while awaiting re-assembly. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsInDiscards." + ::= { ip 8 } + +ipInDelivers OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The total number of input datagrams successfully delivered + to IPv4 user-protocols (including ICMP). + + This object has been deprecated as a new IP version neutral + table has been added. It is loosely replaced by + + + + ipSystemStatsIndelivers." + ::= { ip 9 } + +ipOutRequests OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The total number of IPv4 datagrams which local IPv4 user + protocols (including ICMP) supplied to IPv4 in requests for + transmission. Note that this counter does not include any + datagrams counted in ipForwDatagrams. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsOutRequests." + ::= { ip 10 } + +ipOutDiscards OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of output IPv4 datagrams for which no problem was + encountered to prevent their transmission to their + destination, but which were discarded (e.g., for lack of + buffer space). Note that this counter would include + datagrams counted in ipForwDatagrams if any such packets met + this (discretionary) discard criterion. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsOutDiscards." + ::= { ip 11 } + +ipOutNoRoutes OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of IPv4 datagrams discarded because no route + could be found to transmit them to their destination. Note + that this counter includes any packets counted in + ipForwDatagrams which meet this `no-route' criterion. Note + that this includes any datagrams which a host cannot route + because all of its default routers are down. + + This object has been deprecated, as a new IP version-neutral + + + + table has been added. It is loosely replaced by + ipSystemStatsOutNoRoutes." + ::= { ip 12 } + +ipReasmReqds OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of IPv4 fragments received which needed to be + reassembled at this entity. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsReasmReqds." + ::= { ip 14 } + +ipReasmOKs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of IPv4 datagrams successfully re-assembled. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsReasmOKs." + ::= { ip 15 } + +ipReasmFails OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of failures detected by the IPv4 re-assembly + algorithm (for whatever reason: timed out, errors, etc). + Note that this is not necessarily a count of discarded IPv4 + fragments since some algorithms (notably the algorithm in + RFC 815) can lose track of the number of fragments by + combining them as they are received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsReasmFails." + ::= { ip 16 } + +ipFragOKs OBJECT-TYPE + SYNTAX Counter32 + + + + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of IPv4 datagrams that have been successfully + fragmented at this entity. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsOutFragOKs." + ::= { ip 17 } + +ipFragFails OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of IPv4 datagrams that have been discarded + because they needed to be fragmented at this entity but + could not be, e.g., because their Don't Fragment flag was + set. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + ipSystemStatsOutFragFails." + ::= { ip 18 } + +ipFragCreates OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of IPv4 datagram fragments that have been + generated as a result of fragmentation at this entity. + + This object has been deprecated as a new IP version neutral + table has been added. It is loosely replaced by + ipSystemStatsOutFragCreates." + ::= { ip 19 } + +ipRoutingDiscards OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of routing entries which were chosen to be + discarded even though they are valid. One possible reason + for discarding such an entry could be to free-up buffer + space for other routing entries. + + + + This object was defined in pre-IPv6 versions of the IP MIB. + It was implicitly IPv4 only, but the original specifications + did not indicate this protocol restriction. In order to + clarify the specifications, this object has been deprecated + and a similar, but more thoroughly clarified, object has + been added to the IP-FORWARD-MIB." + ::= { ip 23 } + +-- the deprecated IPv4 address table + +ipAddrTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpAddrEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "The table of addressing information relevant to this + entity's IPv4 addresses. + + This table has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by the + ipAddressTable although several objects that weren't deemed + useful weren't carried forward while another + (ipAdEntReasmMaxSize) was moved to the ipv4InterfaceTable." + ::= { ip 20 } + +ipAddrEntry OBJECT-TYPE + SYNTAX IpAddrEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "The addressing information for one of this entity's IPv4 + addresses." + INDEX { ipAdEntAddr } + ::= { ipAddrTable 1 } + +IpAddrEntry ::= SEQUENCE { + ipAdEntAddr IpAddress, + ipAdEntIfIndex INTEGER, + ipAdEntNetMask IpAddress, + ipAdEntBcastAddr INTEGER, + ipAdEntReasmMaxSize INTEGER + } + +ipAdEntAddr OBJECT-TYPE + SYNTAX IpAddress + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + + + + "The IPv4 address to which this entry's addressing + information pertains." + ::= { ipAddrEntry 1 } + +ipAdEntIfIndex OBJECT-TYPE + SYNTAX INTEGER (1..2147483647) + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The index value which uniquely identifies the interface to + which this entry is applicable. The interface identified by + a particular value of this index is the same interface as + identified by the same value of the IF-MIB's ifIndex." + ::= { ipAddrEntry 2 } + +ipAdEntNetMask OBJECT-TYPE + SYNTAX IpAddress + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The subnet mask associated with the IPv4 address of this + entry. The value of the mask is an IPv4 address with all + the network bits set to 1 and all the hosts bits set to 0." + ::= { ipAddrEntry 3 } + +ipAdEntBcastAddr OBJECT-TYPE + SYNTAX INTEGER (0..1) + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The value of the least-significant bit in the IPv4 broadcast + address used for sending datagrams on the (logical) + interface associated with the IPv4 address of this entry. + For example, when the Internet standard all-ones broadcast + address is used, the value will be 1. This value applies to + both the subnet and network broadcast addresses used by the + entity on this (logical) interface." + ::= { ipAddrEntry 4 } + +ipAdEntReasmMaxSize OBJECT-TYPE + SYNTAX INTEGER (0..65535) + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The size of the largest IPv4 datagram which this entity can + re-assemble from incoming IPv4 fragmented datagrams received + on this interface." + ::= { ipAddrEntry 5 } + + + +-- the deprecated IPv4 Address Translation table + +-- The Address Translation tables contain the IpAddress to +-- "physical" address equivalences. Some interfaces do not +-- use translation tables for determining address +-- equivalences (e.g., DDN-X.25 has an algorithmic method); +-- if all interfaces are of this type, then the Address +-- Translation table is empty, i.e., has zero entries. + +ipNetToMediaTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpNetToMediaEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "The IPv4 Address Translation table used for mapping from + IPv4 addresses to physical addresses. + + This table has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by the + ipNetToPhysicalTable." + ::= { ip 22 } + +ipNetToMediaEntry OBJECT-TYPE + SYNTAX IpNetToMediaEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "Each entry contains one IpAddress to `physical' address + equivalence." + INDEX { ipNetToMediaIfIndex, + ipNetToMediaNetAddress } + ::= { ipNetToMediaTable 1 } + +IpNetToMediaEntry ::= SEQUENCE { + ipNetToMediaIfIndex INTEGER, + ipNetToMediaPhysAddress PhysAddress, + ipNetToMediaNetAddress IpAddress, + ipNetToMediaType INTEGER + } + +ipNetToMediaIfIndex OBJECT-TYPE + SYNTAX INTEGER (1..2147483647) + MAX-ACCESS read-create + STATUS deprecated + DESCRIPTION + "The interface on which this entry's equivalence is + effective. The interface identified by a particular value + of this index is the same interface as identified by the + + + + same value of the IF-MIB's ifIndex. + + This object predates the rule limiting index objects to a + max access value of 'not-accessible' and so continues to use + a value of 'read-create'." + ::= { ipNetToMediaEntry 1 } + +ipNetToMediaPhysAddress OBJECT-TYPE + SYNTAX PhysAddress (SIZE(0..65535)) + MAX-ACCESS read-create + STATUS deprecated + DESCRIPTION + "The media-dependent `physical' address. This object should + return 0 when this entry is in the 'incomplete' state. + + As the entries in this table are typically not persistent + when this object is written the entity should not save the + change to non-volatile storage. Note: a stronger + requirement is not used because this object was previously + defined." + ::= { ipNetToMediaEntry 2 } + +ipNetToMediaNetAddress OBJECT-TYPE + SYNTAX IpAddress + MAX-ACCESS read-create + STATUS deprecated + DESCRIPTION + "The IpAddress corresponding to the media-dependent + `physical' address. + + This object predates the rule limiting index objects to a + max access value of 'not-accessible' and so continues to use + a value of 'read-create'." + ::= { ipNetToMediaEntry 3 } + +ipNetToMediaType OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + invalid(2), -- an invalidated mapping + dynamic(3), + static(4) + } + MAX-ACCESS read-create + STATUS deprecated + DESCRIPTION + "The type of mapping. + + Setting this object to the value invalid(2) has the effect + + + + of invalidating the corresponding entry in the + ipNetToMediaTable. That is, it effectively dis-associates + the interface identified with said entry from the mapping + identified with said entry. It is an implementation- + specific matter as to whether the agent removes an + invalidated entry from the table. Accordingly, management + stations must be prepared to receive tabular information + from agents that corresponds to entries not currently in + use. Proper interpretation of such entries requires + examination of the relevant ipNetToMediaType object. + + As the entries in this table are typically not persistent + when this object is written the entity should not save the + change to non-volatile storage. Note: a stronger + requirement is not used because this object was previously + defined." + ::= { ipNetToMediaEntry 4 } + +-- the deprecated ICMP group + +icmpInMsgs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The total number of ICMP messages which the entity received. + Note that this counter includes all those counted by + icmpInErrors. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + icmpStatsInMsgs." + ::= { icmp 1 } + +icmpInErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP messages which the entity received but + determined as having ICMP-specific errors (bad ICMP + checksums, bad length, etc.). + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + icmpStatsInErrors." + ::= { icmp 2 } + + + + +icmpInDestUnreachs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Destination Unreachable messages + received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 3 } + +icmpInTimeExcds OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Time Exceeded messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 4 } + +icmpInParmProbs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Parameter Problem messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 5 } + +icmpInSrcQuenchs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Source Quench messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 6 } + + + +icmpInRedirects OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Redirect messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 7 } + +icmpInEchos OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Echo (request) messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 8 } + +icmpInEchoReps OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Echo Reply messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 9 } + +icmpInTimestamps OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Timestamp (request) messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 10 } + + + + +icmpInTimestampReps OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Timestamp Reply messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 11 } + +icmpInAddrMasks OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Address Mask Request messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 12 } + +icmpInAddrMaskReps OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Address Mask Reply messages received. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 13 } + +icmpOutMsgs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The total number of ICMP messages which this entity + attempted to send. Note that this counter includes all + those counted by icmpOutErrors. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + icmpStatsOutMsgs." + + + + ::= { icmp 14 } + +icmpOutErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP messages which this entity did not send + due to problems discovered within ICMP, such as a lack of + buffers. This value should not include errors discovered + outside the ICMP layer, such as the inability of IP to route + the resultant datagram. In some implementations, there may + be no types of error which contribute to this counter's + value. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by + icmpStatsOutErrors." + ::= { icmp 15 } + +icmpOutDestUnreachs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Destination Unreachable messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 16 } + +icmpOutTimeExcds OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Time Exceeded messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 17 } + +icmpOutParmProbs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + + + + DESCRIPTION + "The number of ICMP Parameter Problem messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 18 } + +icmpOutSrcQuenchs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Source Quench messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 19 } + +icmpOutRedirects OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Redirect messages sent. For a host, this + object will always be zero, since hosts do not send + redirects. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 20 } + +icmpOutEchos OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Echo (request) messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 21 } + +icmpOutEchoReps OBJECT-TYPE + SYNTAX Counter32 + + + + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Echo Reply messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 22 } + +icmpOutTimestamps OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Timestamp (request) messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 23 } + +icmpOutTimestampReps OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Timestamp Reply messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 24 } + +icmpOutAddrMasks OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Address Mask Request messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 25 } + +icmpOutAddrMaskReps OBJECT-TYPE + SYNTAX Counter32 + + + + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The number of ICMP Address Mask Reply messages sent. + + This object has been deprecated, as a new IP version-neutral + table has been added. It is loosely replaced by a column in + the icmpMsgStatsTable." + ::= { icmp 26 } + +-- deprecated conformance information +-- deprecated compliance statements + +ipMIBCompliance MODULE-COMPLIANCE + STATUS deprecated + DESCRIPTION + "The compliance statement for systems that implement only + IPv4. For version-independence, this compliance statement + is deprecated in favor of ipMIBCompliance2." + MODULE -- this module + MANDATORY-GROUPS { ipGroup, + icmpGroup } + ::= { ipMIBCompliances 1 } + +-- deprecated units of conformance + +ipGroup OBJECT-GROUP + OBJECTS { ipForwarding, ipDefaultTTL, + ipInReceives, ipInHdrErrors, + ipInAddrErrors, ipForwDatagrams, + ipInUnknownProtos, ipInDiscards, + ipInDelivers, ipOutRequests, + ipOutDiscards, ipOutNoRoutes, + ipReasmTimeout, ipReasmReqds, + ipReasmOKs, ipReasmFails, + ipFragOKs, ipFragFails, + ipFragCreates, ipAdEntAddr, + ipAdEntIfIndex, ipAdEntNetMask, + ipAdEntBcastAddr, ipAdEntReasmMaxSize, + ipNetToMediaIfIndex, ipNetToMediaPhysAddress, + ipNetToMediaNetAddress, ipNetToMediaType, + ipRoutingDiscards +} + STATUS deprecated + DESCRIPTION + "The ip group of objects providing for basic management of IP + entities, exclusive of the management of IP routes. + + + + + As part of the version independence, this group has been + deprecated. " + ::= { ipMIBGroups 1 } + +icmpGroup OBJECT-GROUP + OBJECTS { icmpInMsgs, icmpInErrors, + icmpInDestUnreachs, icmpInTimeExcds, + icmpInParmProbs, icmpInSrcQuenchs, + icmpInRedirects, icmpInEchos, + icmpInEchoReps, icmpInTimestamps, + icmpInTimestampReps, icmpInAddrMasks, + icmpInAddrMaskReps, icmpOutMsgs, + icmpOutErrors, icmpOutDestUnreachs, + icmpOutTimeExcds, icmpOutParmProbs, + icmpOutSrcQuenchs, icmpOutRedirects, + icmpOutEchos, icmpOutEchoReps, + icmpOutTimestamps, icmpOutTimestampReps, + icmpOutAddrMasks, icmpOutAddrMaskReps } + STATUS deprecated + DESCRIPTION + "The icmp group of objects providing ICMP statistics. + + As part of the version independence, this group has been + deprecated. " + ::= { ipMIBGroups 2 } + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/RFC-1212 b/contrib/apps/LwipMibCompiler/Mibs/RFC-1212 new file mode 100644 index 00000000..4b1bdcfd --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/RFC-1212 @@ -0,0 +1,75 @@ +RFC-1212 DEFINITIONS ::= BEGIN + + IMPORTS + ObjectName + FROM RFC1155-SMI; +-- DisplayString +-- FROM RFC1158-MIB; + + OBJECT-TYPE MACRO ::= + BEGIN + TYPE NOTATION ::= + -- must conform to + -- RFC1155's ObjectSyntax + "SYNTAX" type(ObjectSyntax) + "ACCESS" Access + "STATUS" Status + DescrPart + ReferPart + IndexPart + DefValPart + VALUE NOTATION ::= value (VALUE ObjectName) + + Access ::= "read-only" + | "read-write" + | "write-only" + | "not-accessible" + Status ::= "mandatory" + | "optional" + | "obsolete" + | "deprecated" + + DescrPart ::= + "DESCRIPTION" value (description DisplayString) + | empty + + ReferPart ::= + "REFERENCE" value (reference DisplayString) + | empty + + IndexPart ::= + "INDEX" "{" IndexTypes "}" + | empty + IndexTypes ::= + IndexType | IndexTypes "," IndexType + IndexType ::= + -- if indexobject, use the SYNTAX + -- value of the correspondent + -- OBJECT-TYPE invocation + value (indexobject ObjectName) + -- otherwise use named SMI type + -- must conform to IndexSyntax below + | type (indextype) + + DefValPart ::= + "DEFVAL" "{" value (defvalue ObjectSyntax) "}" + | empty + + END + + IndexSyntax ::= + CHOICE { + number + INTEGER (0..MAX), + string + OCTET STRING, + object + OBJECT IDENTIFIER, + address + NetworkAddress, + ipAddress + IpAddress + } + +END + diff --git a/contrib/apps/LwipMibCompiler/Mibs/RFC-1215 b/contrib/apps/LwipMibCompiler/Mibs/RFC-1215 new file mode 100644 index 00000000..3cdcfdf3 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/RFC-1215 @@ -0,0 +1,34 @@ +RFC-1215 DEFINITIONS ::= BEGIN + + IMPORTS + ObjectName + FROM RFC1155-SMI; + + TRAP-TYPE MACRO ::= + BEGIN + TYPE NOTATION ::= "ENTERPRISE" value + (enterprise OBJECT IDENTIFIER) + VarPart + DescrPart + ReferPart + VALUE NOTATION ::= value (VALUE INTEGER) + + VarPart ::= + "VARIABLES" "{" VarTypes "}" + | empty + VarTypes ::= + VarType | VarTypes "," VarType + VarType ::= + value (vartype ObjectName) + + DescrPart ::= + "DESCRIPTION" value (description DisplayString) + | empty + + ReferPart ::= + "REFERENCE" value (reference DisplayString) + | empty + + END + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/RFC1065-SMI b/contrib/apps/LwipMibCompiler/Mibs/RFC1065-SMI new file mode 100644 index 00000000..40e55d70 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/RFC1065-SMI @@ -0,0 +1,132 @@ +RFC1065-SMI DEFINITIONS ::= BEGIN + +EXPORTS -- EVERYTHING + internet, directory, mgmt, + experimental, private, enterprises, + OBJECT-TYPE, ObjectName, ObjectSyntax, SimpleSyntax, + ApplicationSyntax, NetworkAddress, IpAddress, + Counter, Gauge, TimeTicks, Opaque; + + -- the path to the root + + internet OBJECT IDENTIFIER ::= { iso org(3) dod(6) 1 } + + directory OBJECT IDENTIFIER ::= { internet 1 } + + mgmt OBJECT IDENTIFIER ::= { internet 2 } + + experimental OBJECT IDENTIFIER ::= { internet 3 } + + private OBJECT IDENTIFIER ::= { internet 4 } + enterprises OBJECT IDENTIFIER ::= { private 1 } + + + -- definition of object types + + OBJECT-TYPE MACRO ::= + BEGIN + TYPE NOTATION ::= "SYNTAX" type (TYPE ObjectSyntax) + "ACCESS" Access + "STATUS" Status + VALUE NOTATION ::= value (VALUE ObjectName) + + Access ::= "read-only" + | "read-write" + | "write-only" + | "not-accessible" + Status ::= "mandatory" + | "optional" + | "obsolete" + END + + -- names of objects in the MIB + + ObjectName ::= + OBJECT IDENTIFIER + + + + -- syntax of objects in the MIB + + ObjectSyntax ::= + CHOICE { + simple + SimpleSyntax, + + -- note that simple SEQUENCEs are not directly + -- mentioned here to keep things simple (i.e., + -- prevent mis-use). However, application-wide + -- types which are IMPLICITly encoded simple + -- SEQUENCEs may appear in the following CHOICE + + application-wide + ApplicationSyntax + } + + SimpleSyntax ::= + CHOICE { + number + INTEGER, + + string + OCTET STRING, + + object + OBJECT IDENTIFIER, + + empty + NULL + } + + ApplicationSyntax ::= + CHOICE { + address + NetworkAddress, + + counter + Counter, + + gauge + Gauge, + + ticks + TimeTicks, + + arbitrary + Opaque + + + -- other application-wide types, as they are + -- defined, will be added here + } + + + -- application-wide types + + NetworkAddress ::= + CHOICE { + internet + IpAddress + } + + IpAddress ::= + [APPLICATION 0] -- in network-byte order + IMPLICIT OCTET STRING (SIZE (4)) + + Counter ::= + [APPLICATION 1] + IMPLICIT INTEGER (0..4294967295) + + Gauge ::= + [APPLICATION 2] + IMPLICIT INTEGER (0..4294967295) + + TimeTicks ::= + [APPLICATION 3] + IMPLICIT INTEGER + + Opaque ::= + [APPLICATION 4] -- arbitrary ASN.1 value, + IMPLICIT OCTET STRING -- "double-wrapped" + + END diff --git a/contrib/apps/LwipMibCompiler/Mibs/RFC1155-SMI b/contrib/apps/LwipMibCompiler/Mibs/RFC1155-SMI new file mode 100644 index 00000000..a6c3bf62 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/RFC1155-SMI @@ -0,0 +1,129 @@ +RFC1155-SMI DEFINITIONS ::= BEGIN + +EXPORTS -- EVERYTHING + internet, directory, mgmt, + experimental, private, enterprises, + OBJECT-TYPE, ObjectName, ObjectSyntax, SimpleSyntax, + ApplicationSyntax, NetworkAddress, IpAddress, + Counter, Gauge, TimeTicks, Opaque; + + -- the path to the root + + internet OBJECT IDENTIFIER ::= { iso org(3) dod(6) 1 } + + directory OBJECT IDENTIFIER ::= { internet 1 } + + mgmt OBJECT IDENTIFIER ::= { internet 2 } + + experimental OBJECT IDENTIFIER ::= { internet 3 } + + private OBJECT IDENTIFIER ::= { internet 4 } + enterprises OBJECT IDENTIFIER ::= { private 1 } + + + -- definition of object types + + OBJECT-TYPE MACRO ::= + BEGIN + TYPE NOTATION ::= "SYNTAX" type (TYPE ObjectSyntax) + "ACCESS" Access + "STATUS" Status + VALUE NOTATION ::= value (VALUE ObjectName) + + Access ::= "read-only" + | "read-write" + | "write-only" + | "not-accessible" + Status ::= "mandatory" + | "optional" + | "obsolete" + END + + -- names of objects in the MIB + + ObjectName ::= + OBJECT IDENTIFIER + + -- syntax of objects in the MIB + + ObjectSyntax ::= + CHOICE { + simple + SimpleSyntax, + + -- note that simple SEQUENCEs are not directly + -- mentioned here to keep things simple (i.e., + -- prevent mis-use). However, application-wide + -- types which are IMPLICITly encoded simple + -- SEQUENCEs may appear in the following CHOICE + + application-wide + ApplicationSyntax + } + + SimpleSyntax ::= + CHOICE { + number + INTEGER, + + string + OCTET STRING, + + object + OBJECT IDENTIFIER, + + empty + NULL + } + + ApplicationSyntax ::= + CHOICE { + address + NetworkAddress, + + counter + Counter, + + gauge + Gauge, + + ticks + TimeTicks, + + arbitrary + Opaque + + -- other application-wide types, as they are + -- defined, will be added here + } + + + -- application-wide types + + NetworkAddress ::= + CHOICE { + internet + IpAddress + } + + IpAddress ::= + [APPLICATION 0] -- in network-byte order + IMPLICIT OCTET STRING (SIZE (4)) + + Counter ::= + [APPLICATION 1] + IMPLICIT INTEGER (0..4294967295) + + Gauge ::= + [APPLICATION 2] + IMPLICIT INTEGER (0..4294967295) + + TimeTicks ::= + [APPLICATION 3] + IMPLICIT INTEGER (0..4294967295) + + Opaque ::= + [APPLICATION 4] -- arbitrary ASN.1 value, + IMPLICIT OCTET STRING -- "double-wrapped" + + END diff --git a/contrib/apps/LwipMibCompiler/Mibs/RFC1158-MIB b/contrib/apps/LwipMibCompiler/Mibs/RFC1158-MIB new file mode 100644 index 00000000..4acf34a0 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/RFC1158-MIB @@ -0,0 +1,1493 @@ +RFC1158-MIB DEFINITIONS ::= BEGIN + +IMPORTS + mgmt, OBJECT-TYPE, NetworkAddress, IpAddress, + Counter, Gauge, TimeTicks + FROM RFC1155-SMI; + +DisplayString ::= + OCTET STRING + +mib-2 OBJECT IDENTIFIER ::= { mgmt 1 } -- MIB-II + -- (same prefix as MIB-I) + +system OBJECT IDENTIFIER ::= { mib-2 1 } +interfaces OBJECT IDENTIFIER ::= { mib-2 2 } +at OBJECT IDENTIFIER ::= { mib-2 3 } +ip OBJECT IDENTIFIER ::= { mib-2 4 } +icmp OBJECT IDENTIFIER ::= { mib-2 5 } +tcp OBJECT IDENTIFIER ::= { mib-2 6 } +udp OBJECT IDENTIFIER ::= { mib-2 7 } +egp OBJECT IDENTIFIER ::= { mib-2 8 } +-- cmot OBJECT IDENTIFIER ::= { mib-2 9 } +transmission OBJECT IDENTIFIER ::= { mib-2 10 } +snmp OBJECT IDENTIFIER ::= { mib-2 11 } + + +-- object types + +-- the System group + +sysDescr OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-only + STATUS mandatory + ::= { system 1 } + +sysObjectID OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + ACCESS read-only + STATUS mandatory + ::= { system 2 } + +sysUpTime OBJECT-TYPE + SYNTAX TimeTicks + ACCESS read-only + STATUS mandatory + ::= { system 3 } + +sysContact OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-write + STATUS mandatory + ::= { system 4 } + +sysName OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-write + STATUS mandatory + ::= { system 5 } + +sysLocation OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-only + STATUS mandatory + ::= { system 6 } + +sysServices OBJECT-TYPE + SYNTAX INTEGER (0..127) + ACCESS read-only + STATUS mandatory + ::= { system 7 } + + +-- the Interfaces group + +ifNumber OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { interfaces 1 } + +-- the Interfaces table + +ifTable OBJECT-TYPE + SYNTAX SEQUENCE OF IfEntry + ACCESS read-only + STATUS mandatory + ::= { interfaces 2 } + +ifEntry OBJECT-TYPE + SYNTAX IfEntry + ACCESS read-only + STATUS mandatory + ::= { ifTable 1 } + +IfEntry ::= SEQUENCE { + ifIndex + INTEGER, + ifDescr + DisplayString, + ifType + INTEGER, + ifMtu + INTEGER, + ifSpeed + Gauge, + ifPhysAddress + OCTET STRING, + ifAdminStatus + INTEGER, + ifOperStatus + INTEGER, + ifLastChange + TimeTicks, + ifInOctets + Counter, + ifInUcastPkts + Counter, + ifInNUcastPkts + Counter, + ifInDiscards + Counter, + ifInErrors + Counter, + ifInUnknownProtos + Counter, + ifOutOctets + Counter, + ifOutUcastPkts + Counter, + ifOutNUcastPkts + Counter, + ifOutDiscards + Counter, + ifOutErrors + Counter, + ifOutQLen + Gauge, + ifSpecific + OBJECT IDENTIFIER +} + +ifIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { ifEntry 1 } + +ifDescr OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-only + STATUS mandatory + ::= { ifEntry 2 } + +ifType OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the + -- following + regular1822(2), + hdh1822(3), + ddn-x25(4), + rfc877-x25(5), + ethernet-csmacd(6), + iso88023-csmacd(7), + iso88024-tokenBus(8), + iso88025-tokenRing(9), + iso88026-man(10), + starLan(11), + proteon-10Mbit(12), + proteon-80Mbit(13), + hyperchannel(14), + fddi(15), + lapb(16), + sdlc(17), + t1-carrier(18), + cept(19), -- european + --equivalent of T-1 + basicISDN(20), + primaryISDN(21), + -- proprietary + -- serial + propPointToPointSerial(22), + terminalServer-asyncPort(23), + softwareLoopback(24), + eon(25), -- CLNP over IP + ethernet-3Mbit(26), + nsip(27), -- XNS over IP + slip(28) -- generic SLIP + } + ACCESS read-only + STATUS mandatory + ::= { ifEntry 3 } + +ifMtu OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { ifEntry 4 } + +ifSpeed OBJECT-TYPE + SYNTAX Gauge + ACCESS read-only + STATUS mandatory + ::= { ifEntry 5 } + +ifPhysAddress OBJECT-TYPE + SYNTAX OCTET STRING + ACCESS read-only + STATUS mandatory + ::= { ifEntry 6 } + +ifAdminStatus OBJECT-TYPE + SYNTAX INTEGER { + up(1), -- ready to pass packets + down(2), + testing(3) -- in some test mode + } + ACCESS read-write + STATUS mandatory + ::= { ifEntry 7 } + +ifOperStatus OBJECT-TYPE + SYNTAX INTEGER { + up(1), -- ready to pass packets + down(2), + testing(3) -- in some test mode + } + ACCESS read-only + STATUS mandatory + ::= { ifEntry 8 } + +ifLastChange OBJECT-TYPE + SYNTAX TimeTicks + ACCESS read-only + STATUS mandatory + ::= { ifEntry 9 } + +ifInOctets OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 10 } + +ifInUcastPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 11 } + +ifInNUcastPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 12 } + +ifInDiscards OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 13 } + +ifInErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 14 } + +ifInUnknownProtos OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 15 } + +ifOutOctets OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 16 } + +ifOutUcastPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 17 } + +ifOutNUcastPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 18 } + +ifOutDiscards OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 19 } + +ifOutErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ifEntry 20 } + +ifOutQLen OBJECT-TYPE + SYNTAX Gauge + ACCESS read-only + STATUS mandatory + ::= { ifEntry 21 } + +ifSpecific OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + ACCESS read-only + STATUS mandatory + ::= { ifEntry 22 } + +nullSpecific OBJECT IDENTIFIER ::= { 0 0 } + +-- the Address Translation group (deprecated) + +atTable OBJECT-TYPE + SYNTAX SEQUENCE OF AtEntry + ACCESS read-write + STATUS deprecated + ::= { at 1 } + +atEntry OBJECT-TYPE + SYNTAX AtEntry + ACCESS read-write + STATUS deprecated + ::= { atTable 1 } + +AtEntry ::= SEQUENCE { + atIfIndex + INTEGER, + atPhysAddress + OCTET STRING, + atNetAddress + NetworkAddress +} + +atIfIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS deprecated + ::= { atEntry 1 } + +atPhysAddress OBJECT-TYPE + SYNTAX OCTET STRING + ACCESS read-write + STATUS deprecated + ::= { atEntry 2 } + +atNetAddress OBJECT-TYPE + SYNTAX NetworkAddress + ACCESS read-write + STATUS deprecated + ::= { atEntry 3 } + + +-- the IP group + +ipForwarding OBJECT-TYPE + SYNTAX INTEGER { + gateway(1), -- entity forwards + -- datagrams + host(2) -- entity does NOT + -- forward datagrams + } + ACCESS read-write + STATUS mandatory + ::= { ip 1 } + +ipDefaultTTL OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + ::= { ip 2 } + +ipInReceives OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 3 } + +ipInHdrErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 4 } + +ipInAddrErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 5 } + +ipForwDatagrams OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 6 } + +ipInUnknownProtos OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 7 } + +ipInDiscards OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 8 } + +ipInDelivers OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 9 } + +ipOutRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 10 } + +ipOutDiscards OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 11 } + +ipOutNoRoutes OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 12 } + +ipReasmTimeout OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { ip 13 } + +ipReasmReqds OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 14 } + +ipReasmOKs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 15 } + +ipReasmFails OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 16 } + +ipFragOKs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 17 } + +ipFragFails OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 18 } + +ipFragCreates OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { ip 19 } + +-- the IP Interface table + +ipAddrTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpAddrEntry + ACCESS read-only + STATUS mandatory + ::= { ip 20 } + +ipAddrEntry OBJECT-TYPE + SYNTAX IpAddrEntry + ACCESS read-only + STATUS mandatory + ::= { ipAddrTable 1 } + +IpAddrEntry ::= SEQUENCE { + ipAdEntAddr + IpAddress, + ipAdEntIfIndex + INTEGER, + ipAdEntNetMask + IpAddress, + ipAdEntBcastAddr + INTEGER, + ipAdEntReasmMaxSize + INTEGER (0..65535) +} + +ipAdEntAddr OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + ::= { ipAddrEntry 1 } + +ipAdEntIfIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { ipAddrEntry 2 } + +ipAdEntNetMask OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + ::= { ipAddrEntry 3 } + +ipAdEntBcastAddr OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { ipAddrEntry 4 } + +ipAdEntReasmMaxSize OBJECT-TYPE + SYNTAX INTEGER (0..65535) + ACCESS read-only + STATUS mandatory + ::= { ipAddrEntry 5 } + +-- the IP Routing table + +ipRoutingTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpRouteEntry + ACCESS read-write + STATUS mandatory + ::= { ip 21 } + +ipRouteEntry OBJECT-TYPE + SYNTAX IpRouteEntry + ACCESS read-write + STATUS mandatory + ::= { ipRoutingTable 1 } + +IpRouteEntry ::= SEQUENCE { + ipRouteDest + IpAddress, + ipRouteIfIndex + INTEGER, + ipRouteMetric1 + INTEGER, + ipRouteMetric2 + INTEGER, + ipRouteMetric3 + INTEGER, + ipRouteMetric4 + INTEGER, + ipRouteNextHop + IpAddress, + ipRouteType + INTEGER, + ipRouteProto + INTEGER, + ipRouteAge + INTEGER, + ipRouteMask + IpAddress +} + +ipRouteDest OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 1 } + +ipRouteIfIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 2 } + +ipRouteMetric1 OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 3 } + +ipRouteMetric2 OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 4 } + +ipRouteMetric3 OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 5 } + +ipRouteMetric4 OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 6 } + +ipRouteNextHop OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 7 } + +ipRouteType OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + + invalid(2), -- an invalidated route + + -- route to directly + direct(3), -- connected + -- (sub-)network + + -- route to a non-local + remote(4) -- host/network/ + -- sub-network + } + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 8 } + +ipRouteProto OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + + -- non-protocol + -- information + + -- e.g., manually + local(2), -- configured entries + + -- set via a network + netmgmt(3), -- management protocol + + -- obtained via ICMP, + icmp(4), -- e.g., Redirect + + -- the following are + -- gateway routing + -- protocols + egp(5), + ggp(6), + hello(7), + rip(8), + is-is(9), + es-is(10), + ciscoIgrp(11), + bbnSpfIgp(12), + ospf(13), + bgp(14) + } + ACCESS read-only + STATUS mandatory + ::= { ipRouteEntry 9 } + +ipRouteAge OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 10 } + +ipRouteMask OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-write + STATUS mandatory + ::= { ipRouteEntry 11 } + +-- the IP Address Translation tables + +ipNetToMediaTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpNetToMediaEntry + ACCESS read-write + STATUS mandatory + ::= { ip 22 } + +ipNetToMediaEntry OBJECT-TYPE + SYNTAX IpNetToMediaEntry + ACCESS read-write + STATUS mandatory + ::= { ipNetToMediaTable 1 } + +IpNetToMediaEntry ::= SEQUENCE { + ipNetToMediaIfIndex + INTEGER, + ipNetToMediaPhysAddress + OCTET STRING, + ipNetToMediaNetAddress + IpAddress, + ipNetToMediaType + INTEGER +} + +ipNetToMediaIfIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + ::= { ipNetToMediaEntry 1 } + +ipNetToMediaPhysAddress OBJECT-TYPE + SYNTAX OCTET STRING + ACCESS read-write + STATUS mandatory + ::= { ipNetToMediaEntry 2 } + +ipNetToMediaNetAddress OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-write + STATUS mandatory + ::= { ipNetToMediaEntry 3 } + +ipNetToMediaType OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + + invalid(2), -- an invalidated mapping + dynamic(3), -- connected (sub-)network + + static(4) + } + ACCESS read-write + STATUS mandatory + ::= { ipNetToMediaEntry 4 } + +-- the ICMP group + +icmpInMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 1 } + +icmpInErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 2 } + +icmpInDestUnreachs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 3 } + +icmpInTimeExcds OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 4 } + +icmpInParmProbs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 5 } + +icmpInSrcQuenchs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 6 } + +icmpInRedirects OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 7 } + +icmpInEchos OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 8 } + +icmpInEchoReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 9 } + +icmpInTimestamps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 10 } + +icmpInTimestampReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 11 } + +icmpInAddrMasks OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 12 } + +icmpInAddrMaskReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 13 } + +icmpOutMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 14 } + +icmpOutErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 15 } + +icmpOutDestUnreachs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 16 } + +icmpOutTimeExcds OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 17 } + +icmpOutParmProbs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 18 } + +icmpOutSrcQuenchs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 19 } + +icmpOutRedirects OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 20 } + +icmpOutEchos OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 21 } + +icmpOutEchoReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 22 } + +icmpOutTimestamps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 23 } + +icmpOutTimestampReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 24 } + +icmpOutAddrMasks OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 25 } + +icmpOutAddrMaskReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { icmp 26 } + + +-- the TCP group + +tcpRtoAlgorithm OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + constant(2), -- a constant rto + rsre(3), -- MIL-STD-1778, + -- Appendix B + vanj(4) -- Van Jacobson's + -- algorithm + } + ACCESS read-only + STATUS mandatory + ::= { tcp 1 } + +tcpRtoMin OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { tcp 2 } + +tcpRtoMax OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { tcp 3 } + +tcpMaxConn OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { tcp 4 } + +tcpActiveOpens OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { tcp 5 } + +tcpPassiveOpens OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { tcp 6 } + +tcpAttemptFails OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { tcp 7 } + +tcpEstabResets OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { tcp 8 } + +tcpCurrEstab OBJECT-TYPE + SYNTAX Gauge + ACCESS read-only + STATUS mandatory + ::= { tcp 9 } + +tcpInSegs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { tcp 10 } + +tcpOutSegs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { tcp 11 } + +tcpRetransSegs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { tcp 12 } + +-- the TCP connections table + +tcpConnTable OBJECT-TYPE + SYNTAX SEQUENCE OF TcpConnEntry + ACCESS read-only + STATUS mandatory + ::= { tcp 13 } + +tcpConnEntry OBJECT-TYPE + SYNTAX TcpConnEntry + ACCESS read-only + STATUS mandatory + ::= { tcpConnTable 1 } + +TcpConnEntry ::= SEQUENCE { + tcpConnState + INTEGER, + tcpConnLocalAddress + IpAddress, + tcpConnLocalPort + INTEGER (0..65535), + tcpConnRemAddress + IpAddress, + tcpConnRemPort + INTEGER (0..65535) +} + +tcpConnState OBJECT-TYPE + SYNTAX INTEGER { + closed(1), + listen(2), + synSent(3), + synReceived(4), + established(5), + finWait1(6), + finWait2(7), + closeWait(8), + lastAck(9), + closing(10), + timeWait(11) + } + ACCESS read-only + STATUS mandatory + ::= { tcpConnEntry 1 } + +tcpConnLocalAddress OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + ::= { tcpConnEntry 2 } + +tcpConnLocalPort OBJECT-TYPE + SYNTAX INTEGER (0..65535) + ACCESS read-only + STATUS mandatory + ::= { tcpConnEntry 3 } + +tcpConnRemAddress OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + ::= { tcpConnEntry 4 } + +tcpConnRemPort OBJECT-TYPE + SYNTAX INTEGER (0..65535) + ACCESS read-only + STATUS mandatory + ::= { tcpConnEntry 5 } + +-- additional TCP variables + +tcpInErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { tcp 14 } + +tcpOutRsts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { tcp 15 } + + +-- the UDP group + +udpInDatagrams OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { udp 1 } + +udpNoPorts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { udp 2 } + +udpInErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { udp 3 } + +udpOutDatagrams OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { udp 4 } + +-- the UDP listener table + +udpTable OBJECT-TYPE + SYNTAX SEQUENCE OF UdpEntry + ACCESS read-only + STATUS mandatory + ::= { udp 5 } + +udpEntry OBJECT-TYPE + SYNTAX UdpEntry + ACCESS read-only + STATUS mandatory + ::= { udpTable 1 } + +UdpEntry ::= SEQUENCE { + udpLocalAddress + IpAddress, + udpLocalPort + INTEGER (0..65535) +} + +udpLocalAddress OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + ::= { udpEntry 1 } + +udpLocalPort OBJECT-TYPE + SYNTAX INTEGER (0..65535) + ACCESS read-only + STATUS mandatory + ::= { udpEntry 2 } + +-- the EGP group + +egpInMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egp 1 } + +egpInErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egp 2 } + +egpOutMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egp 3 } + +egpOutErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egp 4 } + +-- the EGP Neighbor table + +egpNeighTable OBJECT-TYPE + SYNTAX SEQUENCE OF EgpNeighEntry + ACCESS read-only + STATUS mandatory + ::= { egp 5 } + +egpNeighEntry OBJECT-TYPE + SYNTAX EgpNeighEntry + ACCESS read-only + STATUS mandatory + ::= { egpNeighTable 1 } + +EgpNeighEntry ::= SEQUENCE { + egpNeighState + INTEGER, + egpNeighAddr + IpAddress, + egpNeighAs + INTEGER, + egpNeighInMsgs + Counter, + egpNeighInErrs + Counter, + egpNeighOutMsgs + Counter, + egpNeighOutErrs + Counter, + egpNeighInErrMsgs + Counter, + egpNeighOutErrMsgs + Counter, + egpNeighStateUps + Counter, + egpNeighStateDowns + Counter, + egpNeighIntervalHello + INTEGER, + egpNeighIntervalPoll + INTEGER, + egpNeighMode + INTEGER, + egpNeighEventTrigger + INTEGER +} + +egpNeighState OBJECT-TYPE + SYNTAX INTEGER { + idle(1), + acquisition(2), + down(3), + up(4), + cease(5) + } + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 1 } + +egpNeighAddr OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 2 } + +egpNeighAs OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 3 } + +egpNeighInMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 4 } + +egpNeighInErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 5 } + +egpNeighOutMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 6 } + +egpNeighOutErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 7 } + +egpNeighInErrMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 8 } + +egpNeighOutErrMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 9 } + +egpNeighStateUps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 10 } + +egpNeighStateDowns OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 11 } + +egpNeighIntervalHello OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 12 } + +egpNeighIntervalPoll OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 13 } + +egpNeighMode OBJECT-TYPE + SYNTAX INTEGER { + active(1), + passive(2) + } + ACCESS read-only + STATUS mandatory + ::= { egpNeighEntry 14 } + +egpNeighEventTrigger OBJECT-TYPE + SYNTAX INTEGER { + start(1), + stop(2) + } + ACCESS read-write + STATUS mandatory + ::= { egpNeighEntry 15 } + +-- additional EGP variables + +egpAs OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + ::= { egp 6 } + + +-- the Transmission group (empty at present) + +-- the SNMP group + +snmpInPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 1 } + +snmpOutPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 2 } + +snmpInBadVersions OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 3 } + +snmpInBadCommunityNames OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 4 } + +snmpInBadCommunityUses OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 5 } + +snmpInASNParseErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 6 } + +snmpInBadTypes OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 7 } + +snmpInTooBigs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 8 } + +snmpInNoSuchNames OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 9 } + +snmpInBadValues OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 10 } + +snmpInReadOnlys OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 11 } + +snmpInGenErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 12 } + +snmpInTotalReqVars OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 13 } + +snmpInTotalSetVars OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 14 } + +snmpInGetRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 15 } + +snmpInGetNexts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 16 } + +snmpInSetRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 17 } + +snmpInGetResponses OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 18 } + +snmpInTraps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 19 } + +snmpOutTooBigs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 20 } + +snmpOutNoSuchNames OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 21 } + +snmpOutBadValues OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 22 } + +snmpOutReadOnlys OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 23 } + +snmpOutGenErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 24 } + +snmpOutGetRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 25 } + +snmpOutGetNexts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 26 } + +snmpOutSetRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 27 } + +snmpOutGetResponses OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 28 } + +snmpOutTraps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + ::= { snmp 29 } + +snmpEnableAuthTraps OBJECT-TYPE + SYNTAX INTEGER { + enabled(1), + disabled(2) + } + ACCESS read-write + STATUS mandatory + ::= { snmp 30 } + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/RFC1213-MIB b/contrib/apps/LwipMibCompiler/Mibs/RFC1213-MIB new file mode 100644 index 00000000..2a849ded --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/RFC1213-MIB @@ -0,0 +1,2621 @@ +RFC1213-MIB DEFINITIONS ::= BEGIN + +IMPORTS + mgmt, NetworkAddress, IpAddress, Counter, Gauge, + TimeTicks + FROM RFC1155-SMI + OBJECT-TYPE + FROM RFC-1212; + +-- This MIB module uses the extended OBJECT-TYPE macro as +-- defined in [14]; + + +-- MIB-II (same prefix as MIB-I) + +mib-2 OBJECT IDENTIFIER ::= { mgmt 1 } + +-- textual conventions + +DisplayString ::= + OCTET STRING +-- This data type is used to model textual information taken +-- from the NVT ASCII character set. By convention, objects +-- with this syntax are declared as having + +-- +-- SIZE (0..255) + +PhysAddress ::= + OCTET STRING +-- This data type is used to model media addresses. For many +-- types of media, this will be in a binary representation. +-- For example, an ethernet address would be represented as +-- a string of 6 octets. + + +-- groups in MIB-II + +system OBJECT IDENTIFIER ::= { mib-2 1 } + +interfaces OBJECT IDENTIFIER ::= { mib-2 2 } + +at OBJECT IDENTIFIER ::= { mib-2 3 } + +ip OBJECT IDENTIFIER ::= { mib-2 4 } + +icmp OBJECT IDENTIFIER ::= { mib-2 5 } + +tcp OBJECT IDENTIFIER ::= { mib-2 6 } + +udp OBJECT IDENTIFIER ::= { mib-2 7 } + +egp OBJECT IDENTIFIER ::= { mib-2 8 } + +-- historical (some say hysterical) +-- cmot OBJECT IDENTIFIER ::= { mib-2 9 } + +transmission OBJECT IDENTIFIER ::= { mib-2 10 } + +snmp OBJECT IDENTIFIER ::= { mib-2 11 } + + +-- the System group + +-- Implementation of the System group is mandatory for all +-- systems. If an agent is not configured to have a value +-- for any of these variables, a string of length 0 is +-- returned. + +sysDescr OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-only + STATUS mandatory + DESCRIPTION + "A textual description of the entity. This value + should include the full name and version + identification of the system's hardware type, + software operating-system, and networking + software. It is mandatory that this only contain + printable ASCII characters." + ::= { system 1 } + +sysObjectID OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The vendor's authoritative identification of the + network management subsystem contained in the + entity. This value is allocated within the SMI + enterprises subtree (1.3.6.1.4.1) and provides an + easy and unambiguous means for determining `what + kind of box' is being managed. For example, if + vendor `Flintstones, Inc.' was assigned the + subtree 1.3.6.1.4.1.4242, it could assign the + identifier 1.3.6.1.4.1.4242.1.1 to its `Fred + Router'." + ::= { system 2 } + +sysUpTime OBJECT-TYPE + SYNTAX TimeTicks + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The time (in hundredths of a second) since the + network management portion of the system was last + re-initialized." + ::= { system 3 } + +sysContact OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The textual identification of the contact person + for this managed node, together with information + on how to contact this person." + ::= { system 4 } + +sysName OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-write + STATUS mandatory + DESCRIPTION + "An administratively-assigned name for this + managed node. By convention, this is the node's + fully-qualified domain name." + ::= { system 5 } + +sysLocation OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The physical location of this node (e.g., + `telephone closet, 3rd floor')." + ::= { system 6 } + +sysServices OBJECT-TYPE + SYNTAX INTEGER (0..127) + ACCESS read-only + STATUS mandatory + DESCRIPTION + "A value which indicates the set of services that + this entity primarily offers. + + The value is a sum. This sum initially takes the + value zero, Then, for each layer, L, in the range + 1 through 7, that this node performs transactions + for, 2 raised to (L - 1) is added to the sum. For + example, a node which performs primarily routing + functions would have a value of 4 (2^(3-1)). In + contrast, a node which is a host offering + application services would have a value of 72 + (2^(4-1) + 2^(7-1)). Note that in the context of + the Internet suite of protocols, values should be + calculated accordingly: + + layer functionality + 1 physical (e.g., repeaters) + 2 datalink/subnetwork (e.g., bridges) + 3 internet (e.g., IP gateways) + 4 end-to-end (e.g., IP hosts) + 7 applications (e.g., mail relays) + + For systems including OSI protocols, layers 5 and + 6 may also be counted." + ::= { system 7 } + +-- the Interfaces group + +-- Implementation of the Interfaces group is mandatory for +-- all systems. + +ifNumber OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of network interfaces (regardless of + their current state) present on this system." + ::= { interfaces 1 } + + +-- the Interfaces table + +-- The Interfaces table contains information on the entity's +-- interfaces. Each interface is thought of as being +-- attached to a `subnetwork'. Note that this term should +-- not be confused with `subnet' which refers to an +-- addressing partitioning scheme used in the Internet suite +-- of protocols. + +ifTable OBJECT-TYPE + SYNTAX SEQUENCE OF IfEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "A list of interface entries. The number of + entries is given by the value of ifNumber." + ::= { interfaces 2 } + +ifEntry OBJECT-TYPE + SYNTAX IfEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "An interface entry containing objects at the + subnetwork layer and below for a particular + interface." + INDEX { ifIndex } + ::= { ifTable 1 } + +IfEntry ::= + SEQUENCE { + ifIndex + INTEGER, + ifDescr + DisplayString, + ifType + INTEGER, + ifMtu + INTEGER, + ifSpeed + Gauge, + ifPhysAddress + PhysAddress, + ifAdminStatus + INTEGER, + ifOperStatus + INTEGER, + ifLastChange + TimeTicks, + ifInOctets + Counter, + ifInUcastPkts + Counter, + ifInNUcastPkts + Counter, + ifInDiscards + Counter, + ifInErrors + Counter, + ifInUnknownProtos + Counter, + ifOutOctets + Counter, + ifOutUcastPkts + Counter, + ifOutNUcastPkts + Counter, + ifOutDiscards + Counter, + ifOutErrors + Counter, + ifOutQLen + Gauge, + ifSpecific + OBJECT IDENTIFIER + } + +ifIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "A unique value for each interface. Its value + ranges between 1 and the value of ifNumber. The + value for each interface must remain constant at + least from one re-initialization of the entity's + network management system to the next re- + initialization." + ::= { ifEntry 1 } + +ifDescr OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + ACCESS read-only + STATUS mandatory + DESCRIPTION + "A textual string containing information about the + interface. This string should include the name of + the manufacturer, the product name and the version + of the hardware interface." + ::= { ifEntry 2 } + +ifType OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + regular1822(2), + hdh1822(3), + ddn-x25(4), + rfc877-x25(5), + ethernet-csmacd(6), + iso88023-csmacd(7), + iso88024-tokenBus(8), + iso88025-tokenRing(9), + iso88026-man(10), + starLan(11), + proteon-10Mbit(12), + proteon-80Mbit(13), + hyperchannel(14), + fddi(15), + lapb(16), + sdlc(17), + ds1(18), -- T-1 + e1(19), -- european equiv. of T-1 + basicISDN(20), + primaryISDN(21), -- proprietary serial + propPointToPointSerial(22), + ppp(23), + softwareLoopback(24), + eon(25), -- CLNP over IP [11] + ethernet-3Mbit(26), + nsip(27), -- XNS over IP + slip(28), -- generic SLIP + ultra(29), -- ULTRA technologies + ds3(30), -- T-3 + sip(31), -- SMDS + frame-relay(32) + } + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The type of interface, distinguished according to + the physical/link protocol(s) immediately `below' + the network layer in the protocol stack." + ::= { ifEntry 3 } + +ifMtu OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The size of the largest datagram which can be + sent/received on the interface, specified in + octets. For interfaces that are used for + transmitting network datagrams, this is the size + of the largest network datagram that can be sent + on the interface." + ::= { ifEntry 4 } + +ifSpeed OBJECT-TYPE + SYNTAX Gauge + ACCESS read-only + STATUS mandatory + DESCRIPTION + "An estimate of the interface's current bandwidth + in bits per second. For interfaces which do not + vary in bandwidth or for those where no accurate + estimation can be made, this object should contain + the nominal bandwidth." + ::= { ifEntry 5 } + +ifPhysAddress OBJECT-TYPE + SYNTAX PhysAddress + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The interface's address at the protocol layer + immediately `below' the network layer in the + protocol stack. For interfaces which do not have + such an address (e.g., a serial line), this object + should contain an octet string of zero length." + ::= { ifEntry 6 } + +ifAdminStatus OBJECT-TYPE + SYNTAX INTEGER { + up(1), -- ready to pass packets + down(2), + testing(3) -- in some test mode + } + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The desired state of the interface. The + testing(3) state indicates that no operational + packets can be passed." + ::= { ifEntry 7 } + +ifOperStatus OBJECT-TYPE + SYNTAX INTEGER { + up(1), -- ready to pass packets + down(2), + testing(3) -- in some test mode + } + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The current operational state of the interface. + The testing(3) state indicates that no operational + packets can be passed." + ::= { ifEntry 8 } + +ifLastChange OBJECT-TYPE + SYNTAX TimeTicks + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The value of sysUpTime at the time the interface + entered its current operational state. If the + current state was entered prior to the last re- + initialization of the local network management + subsystem, then this object contains a zero + value." + ::= { ifEntry 9 } + +ifInOctets OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of octets received on the + interface, including framing characters." + ::= { ifEntry 10 } + +ifInUcastPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of subnetwork-unicast packets + delivered to a higher-layer protocol." + ::= { ifEntry 11 } + +ifInNUcastPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of non-unicast (i.e., subnetwork- + broadcast or subnetwork-multicast) packets + delivered to a higher-layer protocol." + ::= { ifEntry 12 } + +ifInDiscards OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of inbound packets which were chosen + to be discarded even though no errors had been + detected to prevent their being deliverable to a + higher-layer protocol. One possible reason for + discarding such a packet could be to free up + buffer space." + ::= { ifEntry 13 } + +ifInErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of inbound packets that contained + errors preventing them from being deliverable to a + higher-layer protocol." + ::= { ifEntry 14 } + +ifInUnknownProtos OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of packets received via the interface + which were discarded because of an unknown or + unsupported protocol." + ::= { ifEntry 15 } + +ifOutOctets OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of octets transmitted out of the + interface, including framing characters." + ::= { ifEntry 16 } + +ifOutUcastPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of packets that higher-level + protocols requested be transmitted to a + subnetwork-unicast address, including those that + were discarded or not sent." + ::= { ifEntry 17 } + +ifOutNUcastPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of packets that higher-level + protocols requested be transmitted to a non- + unicast (i.e., a subnetwork-broadcast or + subnetwork-multicast) address, including those + that were discarded or not sent." + ::= { ifEntry 18 } + +ifOutDiscards OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of outbound packets which were chosen + to be discarded even though no errors had been + detected to prevent their being transmitted. One + possible reason for discarding such a packet could + be to free up buffer space." + ::= { ifEntry 19 } + +ifOutErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of outbound packets that could not be + transmitted because of errors." + ::= { ifEntry 20 } + +ifOutQLen OBJECT-TYPE + SYNTAX Gauge + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The length of the output packet queue (in + packets)." + ::= { ifEntry 21 } + +ifSpecific OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "A reference to MIB definitions specific to the + particular media being used to realize the + interface. For example, if the interface is + realized by an ethernet, then the value of this + object refers to a document defining objects + specific to ethernet. If this information is not + present, its value should be set to the OBJECT + IDENTIFIER { 0 0 }, which is a syntatically valid + object identifier, and any conformant + implementation of ASN.1 and BER must be able to + generate and recognize this value." + ::= { ifEntry 22 } + + +-- the Address Translation group + +-- Implementation of the Address Translation group is +-- mandatory for all systems. Note however that this group +-- is deprecated by MIB-II. That is, it is being included + +-- solely for compatibility with MIB-I nodes, and will most +-- likely be excluded from MIB-III nodes. From MIB-II and +-- onwards, each network protocol group contains its own +-- address translation tables. + +-- The Address Translation group contains one table which is +-- the union across all interfaces of the translation tables +-- for converting a NetworkAddress (e.g., an IP address) into +-- a subnetwork-specific address. For lack of a better term, +-- this document refers to such a subnetwork-specific address +-- as a `physical' address. + +-- Examples of such translation tables are: for broadcast +-- media where ARP is in use, the translation table is +-- equivalent to the ARP cache; or, on an X.25 network where +-- non-algorithmic translation to X.121 addresses is +-- required, the translation table contains the +-- NetworkAddress to X.121 address equivalences. + +atTable OBJECT-TYPE + SYNTAX SEQUENCE OF AtEntry + ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "The Address Translation tables contain the + NetworkAddress to `physical' address equivalences. + Some interfaces do not use translation tables for + determining address equivalences (e.g., DDN-X.25 + has an algorithmic method); if all interfaces are + of this type, then the Address Translation table + is empty, i.e., has zero entries." + ::= { at 1 } + +atEntry OBJECT-TYPE + SYNTAX AtEntry + ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "Each entry contains one NetworkAddress to + `physical' address equivalence." + INDEX { atIfIndex, + atNetAddress } + ::= { atTable 1 } + +AtEntry ::= + SEQUENCE { + atIfIndex + INTEGER, + atPhysAddress + PhysAddress, + atNetAddress + NetworkAddress + } + +atIfIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS deprecated + DESCRIPTION + "The interface on which this entry's equivalence + is effective. The interface identified by a + particular value of this index is the same + interface as identified by the same value of + ifIndex." + ::= { atEntry 1 } + +atPhysAddress OBJECT-TYPE + SYNTAX PhysAddress + ACCESS read-write + STATUS deprecated + DESCRIPTION + "The media-dependent `physical' address. + + Setting this object to a null string (one of zero + length) has the effect of invaliding the + corresponding entry in the atTable object. That + is, it effectively dissasociates the interface + identified with said entry from the mapping + identified with said entry. It is an + implementation-specific matter as to whether the + agent removes an invalidated entry from the table. + Accordingly, management stations must be prepared + to receive tabular information from agents that + corresponds to entries not currently in use. + Proper interpretation of such entries requires + examination of the relevant atPhysAddress object." + ::= { atEntry 2 } + +atNetAddress OBJECT-TYPE + SYNTAX NetworkAddress + ACCESS read-write + STATUS deprecated + DESCRIPTION + "The NetworkAddress (e.g., the IP address) + corresponding to the media-dependent `physical' + address." + ::= { atEntry 3 } + + +-- the IP group + +-- Implementation of the IP group is mandatory for all +-- systems. + +ipForwarding OBJECT-TYPE + SYNTAX INTEGER { + forwarding(1), -- acting as a gateway + not-forwarding(2) -- NOT acting as a gateway + } + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The indication of whether this entity is acting + as an IP gateway in respect to the forwarding of + datagrams received by, but not addressed to, this + entity. IP gateways forward datagrams. IP hosts + do not (except those source-routed via the host). + + Note that for some managed nodes, this object may + take on only a subset of the values possible. + Accordingly, it is appropriate for an agent to + return a `badValue' response if a management + station attempts to change this object to an + inappropriate value." + ::= { ip 1 } + +ipDefaultTTL OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The default value inserted into the Time-To-Live + field of the IP header of datagrams originated at + this entity, whenever a TTL value is not supplied + by the transport layer protocol." + ::= { ip 2 } + +ipInReceives OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of input datagrams received from + interfaces, including those received in error." + ::= { ip 3 } + +ipInHdrErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of input datagrams discarded due to + errors in their IP headers, including bad + checksums, version number mismatch, other format + errors, time-to-live exceeded, errors discovered + in processing their IP options, etc." + ::= { ip 4 } + +ipInAddrErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of input datagrams discarded because + the IP address in their IP header's destination + field was not a valid address to be received at + this entity. This count includes invalid + addresses (e.g., 0.0.0.0) and addresses of + unsupported Classes (e.g., Class E). For entities + which are not IP Gateways and therefore do not + forward datagrams, this counter includes datagrams + discarded because the destination address was not + a local address." + ::= { ip 5 } + +ipForwDatagrams OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of input datagrams for which this + entity was not their final IP destination, as a + result of which an attempt was made to find a + route to forward them to that final destination. + In entities which do not act as IP Gateways, this + counter will include only those packets which were + Source-Routed via this entity, and the Source- + Route option processing was successful." + ::= { ip 6 } + +ipInUnknownProtos OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of locally-addressed datagrams + received successfully but discarded because of an + unknown or unsupported protocol." + ::= { ip 7 } + +ipInDiscards OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of input IP datagrams for which no + problems were encountered to prevent their + continued processing, but which were discarded + (e.g., for lack of buffer space). Note that this + counter does not include any datagrams discarded + while awaiting re-assembly." + ::= { ip 8 } + +ipInDelivers OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of input datagrams successfully + delivered to IP user-protocols (including ICMP)." + ::= { ip 9 } + +ipOutRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of IP datagrams which local IP + user-protocols (including ICMP) supplied to IP in + requests for transmission. Note that this counter + does not include any datagrams counted in + ipForwDatagrams." + ::= { ip 10 } + +ipOutDiscards OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of output IP datagrams for which no + problem was encountered to prevent their + transmission to their destination, but which were + discarded (e.g., for lack of buffer space). Note + that this counter would include datagrams counted + in ipForwDatagrams if any such packets met this + (discretionary) discard criterion." + ::= { ip 11 } + +ipOutNoRoutes OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of IP datagrams discarded because no + route could be found to transmit them to their + destination. Note that this counter includes any + packets counted in ipForwDatagrams which meet this + `no-route' criterion. Note that this includes any + datagarms which a host cannot route because all of + its default gateways are down." + ::= { ip 12 } + +ipReasmTimeout OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The maximum number of seconds which received + fragments are held while they are awaiting + reassembly at this entity." + ::= { ip 13 } + +ipReasmReqds OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of IP fragments received which needed + to be reassembled at this entity." + ::= { ip 14 } + +ipReasmOKs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of IP datagrams successfully re- + assembled." + ::= { ip 15 } + +ipReasmFails OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of failures detected by the IP re- + assembly algorithm (for whatever reason: timed + out, errors, etc). Note that this is not + necessarily a count of discarded IP fragments + since some algorithms (notably the algorithm in + RFC 815) can lose track of the number of fragments + by combining them as they are received." + ::= { ip 16 } + +ipFragOKs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of IP datagrams that have been + successfully fragmented at this entity." + ::= { ip 17 } + +ipFragFails OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of IP datagrams that have been + discarded because they needed to be fragmented at + this entity but could not be, e.g., because their + Don't Fragment flag was set." + ::= { ip 18 } + +ipFragCreates OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of IP datagram fragments that have + been generated as a result of fragmentation at + this entity." + ::= { ip 19 } + +-- the IP address table + +-- The IP address table contains this entity's IP addressing +-- information. + +ipAddrTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpAddrEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "The table of addressing information relevant to + this entity's IP addresses." + ::= { ip 20 } + +ipAddrEntry OBJECT-TYPE + SYNTAX IpAddrEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "The addressing information for one of this + entity's IP addresses." + INDEX { ipAdEntAddr } + ::= { ipAddrTable 1 } + +IpAddrEntry ::= + SEQUENCE { + ipAdEntAddr + IpAddress, + ipAdEntIfIndex + INTEGER, + ipAdEntNetMask + IpAddress, + ipAdEntBcastAddr + INTEGER, + ipAdEntReasmMaxSize + INTEGER (0..65535) + } + +ipAdEntAddr OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The IP address to which this entry's addressing + information pertains." + ::= { ipAddrEntry 1 } + +ipAdEntIfIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The index value which uniquely identifies the + interface to which this entry is applicable. The + interface identified by a particular value of this + index is the same interface as identified by the + same value of ifIndex." + ::= { ipAddrEntry 2 } + +ipAdEntNetMask OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The subnet mask associated with the IP address of + this entry. The value of the mask is an IP + address with all the network bits set to 1 and all + the hosts bits set to 0." + ::= { ipAddrEntry 3 } + +ipAdEntBcastAddr OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The value of the least-significant bit in the IP + broadcast address used for sending datagrams on + the (logical) interface associated with the IP + address of this entry. For example, when the + Internet standard all-ones broadcast address is + used, the value will be 1. This value applies to + both the subnet and network broadcasts addresses + used by the entity on this (logical) interface." + ::= { ipAddrEntry 4 } + +ipAdEntReasmMaxSize OBJECT-TYPE + SYNTAX INTEGER (0..65535) + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The size of the largest IP datagram which this + entity can re-assemble from incoming IP fragmented + datagrams received on this interface." + ::= { ipAddrEntry 5 } + +-- the IP routing table + +-- The IP routing table contains an entry for each route +-- presently known to this entity. + +ipRouteTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpRouteEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "This entity's IP Routing table." + ::= { ip 21 } + +ipRouteEntry OBJECT-TYPE + SYNTAX IpRouteEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "A route to a particular destination." + INDEX { ipRouteDest } + ::= { ipRouteTable 1 } + +IpRouteEntry ::= + SEQUENCE { + ipRouteDest + IpAddress, + ipRouteIfIndex + INTEGER, + ipRouteMetric1 + INTEGER, + ipRouteMetric2 + INTEGER, + ipRouteMetric3 + INTEGER, + ipRouteMetric4 + INTEGER, + ipRouteNextHop + IpAddress, + ipRouteType + INTEGER, + ipRouteProto + INTEGER, + ipRouteAge + INTEGER, + ipRouteMask + IpAddress, + ipRouteMetric5 + INTEGER, + ipRouteInfo + OBJECT IDENTIFIER + } + +ipRouteDest OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The destination IP address of this route. An + entry with a value of 0.0.0.0 is considered a + default route. Multiple routes to a single + destination can appear in the table, but access to + such multiple entries is dependent on the table- + access mechanisms defined by the network + management protocol in use." + ::= { ipRouteEntry 1 } + +ipRouteIfIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The index value which uniquely identifies the + local interface through which the next hop of this + route should be reached. The interface identified + by a particular value of this index is the same + interface as identified by the same value of + ifIndex." + ::= { ipRouteEntry 2 } + +ipRouteMetric1 OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The primary routing metric for this route. The + semantics of this metric are determined by the + routing-protocol specified in the route's + ipRouteProto value. If this metric is not used, + its value should be set to -1." + ::= { ipRouteEntry 3 } + +ipRouteMetric2 OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + DESCRIPTION + "An alternate routing metric for this route. The + semantics of this metric are determined by the + routing-protocol specified in the route's + ipRouteProto value. If this metric is not used, + its value should be set to -1." + ::= { ipRouteEntry 4 } + +ipRouteMetric3 OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + DESCRIPTION + "An alternate routing metric for this route. The + semantics of this metric are determined by the + routing-protocol specified in the route's + ipRouteProto value. If this metric is not used, + its value should be set to -1." + ::= { ipRouteEntry 5 } + +ipRouteMetric4 OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + DESCRIPTION + "An alternate routing metric for this route. The + semantics of this metric are determined by the + routing-protocol specified in the route's + ipRouteProto value. If this metric is not used, + its value should be set to -1." + ::= { ipRouteEntry 6 } + +ipRouteNextHop OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The IP address of the next hop of this route. + (In the case of a route bound to an interface + which is realized via a broadcast media, the value + of this field is the agent's IP address on that + interface.)" + ::= { ipRouteEntry 7 } + +ipRouteType OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + + invalid(2), -- an invalidated route + + -- route to directly + direct(3), -- connected (sub-)network + + -- route to a non-local + indirect(4) -- host/network/sub-network + } + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The type of route. Note that the values + direct(3) and indirect(4) refer to the notion of + direct and indirect routing in the IP + architecture. + + Setting this object to the value invalid(2) has + the effect of invalidating the corresponding entry + in the ipRouteTable object. That is, it + effectively dissasociates the destination + identified with said entry from the route + identified with said entry. It is an + implementation-specific matter as to whether the + agent removes an invalidated entry from the table. + Accordingly, management stations must be prepared + to receive tabular information from agents that + corresponds to entries not currently in use. + Proper interpretation of such entries requires + examination of the relevant ipRouteType object." + ::= { ipRouteEntry 8 } + +ipRouteProto OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + + -- non-protocol information, + -- e.g., manually configured + local(2), -- entries + + -- set via a network + netmgmt(3), -- management protocol + + -- obtained via ICMP, + icmp(4), -- e.g., Redirect + + -- the remaining values are + -- all gateway routing + -- protocols + egp(5), + ggp(6), + hello(7), + rip(8), + is-is(9), + es-is(10), + ciscoIgrp(11), + bbnSpfIgp(12), + ospf(13), + bgp(14) + } + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The routing mechanism via which this route was + learned. Inclusion of values for gateway routing + protocols is not intended to imply that hosts + should support those protocols." + ::= { ipRouteEntry 9 } + +ipRouteAge OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The number of seconds since this route was last + updated or otherwise determined to be correct. + Note that no semantics of `too old' can be implied + except through knowledge of the routing protocol + by which the route was learned." + ::= { ipRouteEntry 10 } + +ipRouteMask OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-write + STATUS mandatory + DESCRIPTION + "Indicate the mask to be logical-ANDed with the + destination address before being compared to the + value in the ipRouteDest field. For those systems + that do not support arbitrary subnet masks, an + agent constructs the value of the ipRouteMask by + determining whether the value of the correspondent + ipRouteDest field belong to a class-A, B, or C + network, and then using one of: + + mask network + 255.0.0.0 class-A + 255.255.0.0 class-B + 255.255.255.0 class-C + If the value of the ipRouteDest is 0.0.0.0 (a + default route), then the mask value is also + 0.0.0.0. It should be noted that all IP routing + subsystems implicitly use this mechanism." + ::= { ipRouteEntry 11 } + +ipRouteMetric5 OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + DESCRIPTION + "An alternate routing metric for this route. The + semantics of this metric are determined by the + routing-protocol specified in the route's + ipRouteProto value. If this metric is not used, + its value should be set to -1." + ::= { ipRouteEntry 12 } + +ipRouteInfo OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "A reference to MIB definitions specific to the + particular routing protocol which is responsible + for this route, as determined by the value + specified in the route's ipRouteProto value. If + this information is not present, its value should + be set to the OBJECT IDENTIFIER { 0 0 }, which is + a syntatically valid object identifier, and any + conformant implementation of ASN.1 and BER must be + able to generate and recognize this value." + ::= { ipRouteEntry 13 } + + +-- the IP Address Translation table + +-- The IP address translation table contain the IpAddress to +-- `physical' address equivalences. Some interfaces do not +-- use translation tables for determining address +-- equivalences (e.g., DDN-X.25 has an algorithmic method); +-- if all interfaces are of this type, then the Address +-- Translation table is empty, i.e., has zero entries. + +ipNetToMediaTable OBJECT-TYPE + SYNTAX SEQUENCE OF IpNetToMediaEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "The IP Address Translation table used for mapping + from IP addresses to physical addresses." + ::= { ip 22 } + +ipNetToMediaEntry OBJECT-TYPE + SYNTAX IpNetToMediaEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "Each entry contains one IpAddress to `physical' + address equivalence." + INDEX { ipNetToMediaIfIndex, + ipNetToMediaNetAddress } + ::= { ipNetToMediaTable 1 } + +IpNetToMediaEntry ::= + SEQUENCE { + ipNetToMediaIfIndex + INTEGER, + ipNetToMediaPhysAddress + PhysAddress, + ipNetToMediaNetAddress + IpAddress, + ipNetToMediaType + INTEGER + } + +ipNetToMediaIfIndex OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The interface on which this entry's equivalence + is effective. The interface identified by a + particular value of this index is the same + interface as identified by the same value of + ifIndex." + ::= { ipNetToMediaEntry 1 } + +ipNetToMediaPhysAddress OBJECT-TYPE + SYNTAX PhysAddress + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The media-dependent `physical' address." + ::= { ipNetToMediaEntry 2 } + +ipNetToMediaNetAddress OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The IpAddress corresponding to the media- + dependent `physical' address." + ::= { ipNetToMediaEntry 3 } + +ipNetToMediaType OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + invalid(2), -- an invalidated mapping + dynamic(3), + static(4) + } + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The type of mapping. + + Setting this object to the value invalid(2) has + the effect of invalidating the corresponding entry + in the ipNetToMediaTable. That is, it effectively + dissasociates the interface identified with said + entry from the mapping identified with said entry. + It is an implementation-specific matter as to + whether the agent removes an invalidated entry + from the table. Accordingly, management stations + must be prepared to receive tabular information + from agents that corresponds to entries not + currently in use. Proper interpretation of such + entries requires examination of the relevant + ipNetToMediaType object." + ::= { ipNetToMediaEntry 4 } + + +-- additional IP objects + +ipRoutingDiscards OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of routing entries which were chosen + to be discarded even though they are valid. One + possible reason for discarding such an entry could + be to free-up buffer space for other routing + entries." + ::= { ip 23 } + + +-- the ICMP group + +-- Implementation of the ICMP group is mandatory for all +-- systems. + +icmpInMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of ICMP messages which the + entity received. Note that this counter includes + all those counted by icmpInErrors." + ::= { icmp 1 } + +icmpInErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP messages which the entity + received but determined as having ICMP-specific + errors (bad ICMP checksums, bad length, etc.)." + ::= { icmp 2 } + +icmpInDestUnreachs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Destination Unreachable + messages received." + ::= { icmp 3 } + +icmpInTimeExcds OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Time Exceeded messages + received." + ::= { icmp 4 } + +icmpInParmProbs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Parameter Problem messages + received." + ::= { icmp 5 } + +icmpInSrcQuenchs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Source Quench messages + received." + ::= { icmp 6 } + +icmpInRedirects OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Redirect messages received." + ::= { icmp 7 } + +icmpInEchos OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Echo (request) messages + received." + ::= { icmp 8 } + +icmpInEchoReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Echo Reply messages received." + ::= { icmp 9 } + +icmpInTimestamps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Timestamp (request) messages + received." + ::= { icmp 10 } + +icmpInTimestampReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Timestamp Reply messages + received." + ::= { icmp 11 } + +icmpInAddrMasks OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Address Mask Request messages + received." + ::= { icmp 12 } + +icmpInAddrMaskReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Address Mask Reply messages + received." + ::= { icmp 13 } + +icmpOutMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of ICMP messages which this + entity attempted to send. Note that this counter + includes all those counted by icmpOutErrors." + ::= { icmp 14 } + +icmpOutErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP messages which this entity did + not send due to problems discovered within ICMP + such as a lack of buffers. This value should not + include errors discovered outside the ICMP layer + such as the inability of IP to route the resultant + datagram. In some implementations there may be no + types of error which contribute to this counter's + value." + ::= { icmp 15 } + +icmpOutDestUnreachs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Destination Unreachable + messages sent." + ::= { icmp 16 } + +icmpOutTimeExcds OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Time Exceeded messages sent." + ::= { icmp 17 } + +icmpOutParmProbs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Parameter Problem messages + sent." + ::= { icmp 18 } + +icmpOutSrcQuenchs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Source Quench messages sent." + ::= { icmp 19 } + +icmpOutRedirects OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Redirect messages sent. For a + host, this object will always be zero, since hosts + do not send redirects." + ::= { icmp 20 } + +icmpOutEchos OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Echo (request) messages sent." + ::= { icmp 21 } + +icmpOutEchoReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Echo Reply messages sent." + ::= { icmp 22 } + +icmpOutTimestamps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Timestamp (request) messages + sent." + ::= { icmp 23 } + +icmpOutTimestampReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Timestamp Reply messages + sent." + ::= { icmp 24 } + +icmpOutAddrMasks OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Address Mask Request messages + sent." + ::= { icmp 25 } + +icmpOutAddrMaskReps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of ICMP Address Mask Reply messages + sent." + ::= { icmp 26 } + + +-- the TCP group + +-- Implementation of the TCP group is mandatory for all +-- systems that implement the TCP. + +-- Note that instances of object types that represent +-- information about a particular TCP connection are +-- transient; they persist only as long as the connection +-- in question. + +tcpRtoAlgorithm OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + + constant(2), -- a constant rto + rsre(3), -- MIL-STD-1778, Appendix B + vanj(4) -- Van Jacobson's algorithm [10] + } + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The algorithm used to determine the timeout value + used for retransmitting unacknowledged octets." + ::= { tcp 1 } + +tcpRtoMin OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The minimum value permitted by a TCP + implementation for the retransmission timeout, + measured in milliseconds. More refined semantics + for objects of this type depend upon the algorithm + used to determine the retransmission timeout. In + particular, when the timeout algorithm is rsre(3), + an object of this type has the semantics of the + LBOUND quantity described in RFC 793." + ::= { tcp 2 } + + +tcpRtoMax OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The maximum value permitted by a TCP + implementation for the retransmission timeout, + measured in milliseconds. More refined semantics + for objects of this type depend upon the algorithm + used to determine the retransmission timeout. In + particular, when the timeout algorithm is rsre(3), + an object of this type has the semantics of the + UBOUND quantity described in RFC 793." + ::= { tcp 3 } + +tcpMaxConn OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The limit on the total number of TCP connections + the entity can support. In entities where the + maximum number of connections is dynamic, this + object should contain the value -1." + ::= { tcp 4 } + +tcpActiveOpens OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of times TCP connections have made a + direct transition to the SYN-SENT state from the + CLOSED state." + ::= { tcp 5 } + +tcpPassiveOpens OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of times TCP connections have made a + direct transition to the SYN-RCVD state from the + LISTEN state." + ::= { tcp 6 } + +tcpAttemptFails OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of times TCP connections have made a + direct transition to the CLOSED state from either + the SYN-SENT state or the SYN-RCVD state, plus the + number of times TCP connections have made a direct + transition to the LISTEN state from the SYN-RCVD + state." + ::= { tcp 7 } + +tcpEstabResets OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of times TCP connections have made a + direct transition to the CLOSED state from either + the ESTABLISHED state or the CLOSE-WAIT state." + ::= { tcp 8 } + +tcpCurrEstab OBJECT-TYPE + SYNTAX Gauge + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of TCP connections for which the + current state is either ESTABLISHED or CLOSE- + WAIT." + ::= { tcp 9 } + +tcpInSegs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of segments received, including + those received in error. This count includes + segments received on currently established + connections." + ::= { tcp 10 } + +tcpOutSegs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of segments sent, including + those on current connections but excluding those + containing only retransmitted octets." + ::= { tcp 11 } + +tcpRetransSegs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of segments retransmitted - that + is, the number of TCP segments transmitted + containing one or more previously transmitted + octets." + ::= { tcp 12 } + + +-- the TCP Connection table + +-- The TCP connection table contains information about this +-- entity's existing TCP connections. + +tcpConnTable OBJECT-TYPE + SYNTAX SEQUENCE OF TcpConnEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "A table containing TCP connection-specific + information." + ::= { tcp 13 } + +tcpConnEntry OBJECT-TYPE + SYNTAX TcpConnEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "Information about a particular current TCP + connection. An object of this type is transient, + in that it ceases to exist when (or soon after) + the connection makes the transition to the CLOSED + state." + INDEX { tcpConnLocalAddress, + tcpConnLocalPort, + tcpConnRemAddress, + tcpConnRemPort } + ::= { tcpConnTable 1 } + +TcpConnEntry ::= + SEQUENCE { + tcpConnState + INTEGER, + tcpConnLocalAddress + IpAddress, + tcpConnLocalPort + INTEGER (0..65535), + tcpConnRemAddress + IpAddress, + tcpConnRemPort + INTEGER (0..65535) + } + +tcpConnState OBJECT-TYPE + SYNTAX INTEGER { + closed(1), + listen(2), + synSent(3), + synReceived(4), + established(5), + finWait1(6), + finWait2(7), + closeWait(8), + lastAck(9), + closing(10), + timeWait(11), + deleteTCB(12) + } + ACCESS read-write + STATUS mandatory + DESCRIPTION + "The state of this TCP connection. + + The only value which may be set by a management + station is deleteTCB(12). Accordingly, it is + appropriate for an agent to return a `badValue' + response if a management station attempts to set + this object to any other value. + + If a management station sets this object to the + value deleteTCB(12), then this has the effect of + deleting the TCB (as defined in RFC 793) of the + corresponding connection on the managed node, + resulting in immediate termination of the + connection. + + As an implementation-specific option, a RST + segment may be sent from the managed node to the + other TCP endpoint (note however that RST segments + are not sent reliably)." + ::= { tcpConnEntry 1 } + +tcpConnLocalAddress OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The local IP address for this TCP connection. In + the case of a connection in the listen state which + is willing to accept connections for any IP + interface associated with the node, the value + 0.0.0.0 is used." + ::= { tcpConnEntry 2 } + +tcpConnLocalPort OBJECT-TYPE + SYNTAX INTEGER (0..65535) + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The local port number for this TCP connection." + ::= { tcpConnEntry 3 } + +tcpConnRemAddress OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The remote IP address for this TCP connection." + ::= { tcpConnEntry 4 } + +tcpConnRemPort OBJECT-TYPE + SYNTAX INTEGER (0..65535) + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The remote port number for this TCP connection." + ::= { tcpConnEntry 5 } + + +-- additional TCP objects + +tcpInErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of segments received in error + (e.g., bad TCP checksums)." + ::= { tcp 14 } + +tcpOutRsts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of TCP segments sent containing the + RST flag." + ::= { tcp 15 } + + +-- the UDP group + +-- Implementation of the UDP group is mandatory for all +-- systems which implement the UDP. + +udpInDatagrams OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of UDP datagrams delivered to + UDP users." + ::= { udp 1 } + +udpNoPorts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of received UDP datagrams for + which there was no application at the destination + port." + ::= { udp 2 } + +udpInErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of received UDP datagrams that could + not be delivered for reasons other than the lack + of an application at the destination port." + ::= { udp 3 } + +udpOutDatagrams OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of UDP datagrams sent from this + entity." + ::= { udp 4 } + + +-- the UDP Listener table + +-- The UDP listener table contains information about this +-- entity's UDP end-points on which a local application is +-- currently accepting datagrams. + +udpTable OBJECT-TYPE + SYNTAX SEQUENCE OF UdpEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "A table containing UDP listener information." + ::= { udp 5 } + +udpEntry OBJECT-TYPE + SYNTAX UdpEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "Information about a particular current UDP + listener." + INDEX { udpLocalAddress, udpLocalPort } + ::= { udpTable 1 } + +UdpEntry ::= + SEQUENCE { + udpLocalAddress + IpAddress, + udpLocalPort + INTEGER (0..65535) + } + +udpLocalAddress OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The local IP address for this UDP listener. In + the case of a UDP listener which is willing to + accept datagrams for any IP interface associated + with the node, the value 0.0.0.0 is used." + ::= { udpEntry 1 } + +udpLocalPort OBJECT-TYPE + SYNTAX INTEGER (0..65535) + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The local port number for this UDP listener." + ::= { udpEntry 2 } + + +-- the EGP group + +-- Implementation of the EGP group is mandatory for all +-- systems which implement the EGP. + +egpInMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of EGP messages received without + error." + ::= { egp 1 } + +egpInErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of EGP messages received that proved + to be in error." + ::= { egp 2 } + +egpOutMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of locally generated EGP + messages." + ::= { egp 3 } + +egpOutErrors OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of locally generated EGP messages not + sent due to resource limitations within an EGP + entity." + ::= { egp 4 } + + +-- the EGP Neighbor table + +-- The EGP neighbor table contains information about this +-- entity's EGP neighbors. + +egpNeighTable OBJECT-TYPE + SYNTAX SEQUENCE OF EgpNeighEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "The EGP neighbor table." + ::= { egp 5 } + +egpNeighEntry OBJECT-TYPE + SYNTAX EgpNeighEntry + ACCESS not-accessible + STATUS mandatory + DESCRIPTION + "Information about this entity's relationship with + a particular EGP neighbor." + INDEX { egpNeighAddr } + ::= { egpNeighTable 1 } + +EgpNeighEntry ::= + SEQUENCE { + egpNeighState + INTEGER, + egpNeighAddr + IpAddress, + egpNeighAs + INTEGER, + egpNeighInMsgs + Counter, + egpNeighInErrs + Counter, + egpNeighOutMsgs + Counter, + egpNeighOutErrs + Counter, + egpNeighInErrMsgs + Counter, + egpNeighOutErrMsgs + Counter, + egpNeighStateUps + Counter, + egpNeighStateDowns + Counter, + egpNeighIntervalHello + INTEGER, + egpNeighIntervalPoll + INTEGER, + egpNeighMode + INTEGER, + egpNeighEventTrigger + INTEGER + } + +egpNeighState OBJECT-TYPE + SYNTAX INTEGER { + idle(1), + acquisition(2), + down(3), + up(4), + cease(5) + } + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The EGP state of the local system with respect to + this entry's EGP neighbor. Each EGP state is + represented by a value that is one greater than + the numerical value associated with said state in + RFC 904." + ::= { egpNeighEntry 1 } + +egpNeighAddr OBJECT-TYPE + SYNTAX IpAddress + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The IP address of this entry's EGP neighbor." + ::= { egpNeighEntry 2 } + +egpNeighAs OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The autonomous system of this EGP peer. Zero + should be specified if the autonomous system + number of the neighbor is not yet known." + ::= { egpNeighEntry 3 } + +egpNeighInMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of EGP messages received without error + from this EGP peer." + ::= { egpNeighEntry 4 } + +egpNeighInErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of EGP messages received from this EGP + peer that proved to be in error (e.g., bad EGP + checksum)." + ::= { egpNeighEntry 5 } + +egpNeighOutMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of locally generated EGP messages to + this EGP peer." + ::= { egpNeighEntry 6 } + +egpNeighOutErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of locally generated EGP messages not + sent to this EGP peer due to resource limitations + within an EGP entity." + ::= { egpNeighEntry 7 } + +egpNeighInErrMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of EGP-defined error messages received + from this EGP peer." + ::= { egpNeighEntry 8 } + +egpNeighOutErrMsgs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of EGP-defined error messages sent to + this EGP peer." + ::= { egpNeighEntry 9 } + +egpNeighStateUps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of EGP state transitions to the UP + state with this EGP peer." + ::= { egpNeighEntry 10 } + +egpNeighStateDowns OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The number of EGP state transitions from the UP + state to any other state with this EGP peer." + ::= { egpNeighEntry 11 } + +egpNeighIntervalHello OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The interval between EGP Hello command + retransmissions (in hundredths of a second). This + represents the t1 timer as defined in RFC 904." + ::= { egpNeighEntry 12 } + +egpNeighIntervalPoll OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The interval between EGP poll command + retransmissions (in hundredths of a second). This + represents the t3 timer as defined in RFC 904." + ::= { egpNeighEntry 13 } + +egpNeighMode OBJECT-TYPE + SYNTAX INTEGER { active(1), passive(2) } + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The polling mode of this EGP entity, either + passive or active." + ::= { egpNeighEntry 14 } + +egpNeighEventTrigger OBJECT-TYPE + SYNTAX INTEGER { start(1), stop(2) } + ACCESS read-write + STATUS mandatory + DESCRIPTION + "A control variable used to trigger operator- + initiated Start and Stop events. When read, this + variable always returns the most recent value that + egpNeighEventTrigger was set to. If it has not + been set since the last initialization of the + network management subsystem on the node, it + returns a value of `stop'. + + When set, this variable causes a Start or Stop + event on the specified neighbor, as specified on + pages 8-10 of RFC 904. Briefly, a Start event + causes an Idle peer to begin neighbor acquisition + and a non-Idle peer to reinitiate neighbor + acquisition. A stop event causes a non-Idle peer + to return to the Idle state until a Start event + occurs, either via egpNeighEventTrigger or + otherwise." + ::= { egpNeighEntry 15 } + + +-- additional EGP objects + +egpAs OBJECT-TYPE + SYNTAX INTEGER + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The autonomous system number of this EGP entity." + ::= { egp 6 } + +-- the Transmission group + +-- Based on the transmission media underlying each interface +-- on a system, the corresponding portion of the Transmission +-- group is mandatory for that system. + +-- When Internet-standard definitions for managing +-- transmission media are defined, the transmission group is +-- used to provide a prefix for the names of those objects. + +-- Typically, such definitions reside in the experimental +-- portion of the MIB until they are "proven", then as a +-- part of the Internet standardization process, the +-- definitions are accordingly elevated and a new object +-- identifier, under the transmission group is defined. By +-- convention, the name assigned is: +-- +-- type OBJECT IDENTIFIER ::= { transmission number } +-- +-- where "type" is the symbolic value used for the media in +-- the ifType column of the ifTable object, and "number" is +-- the actual integer value corresponding to the symbol. + + +-- the SNMP group + +-- Implementation of the SNMP group is mandatory for all +-- systems which support an SNMP protocol entity. Some of +-- the objects defined below will be zero-valued in those +-- SNMP implementations that are optimized to support only +-- those functions specific to either a management agent or +-- a management station. In particular, it should be +-- observed that the objects below refer to an SNMP entity, +-- and there may be several SNMP entities residing on a +-- managed node (e.g., if the node is hosting acting as +-- a management station). + +snmpInPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of Messages delivered to the + SNMP entity from the transport service." + ::= { snmp 1 } + +snmpOutPkts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Messages which were + passed from the SNMP protocol entity to the + transport service." + ::= { snmp 2 } + +snmpInBadVersions OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Messages which were + delivered to the SNMP protocol entity and were for + an unsupported SNMP version." + ::= { snmp 3 } + +snmpInBadCommunityNames OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Messages delivered to + the SNMP protocol entity which used a SNMP + community name not known to said entity." + ::= { snmp 4 } + +snmpInBadCommunityUses OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Messages delivered to + the SNMP protocol entity which represented an SNMP + operation which was not allowed by the SNMP + community named in the Message." + ::= { snmp 5 } + +snmpInASNParseErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of ASN.1 or BER errors + encountered by the SNMP protocol entity when + decoding received SNMP Messages." + ::= { snmp 6 } + +-- { snmp 7 } is not used + +snmpInTooBigs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP PDUs which were + delivered to the SNMP protocol entity and for + which the value of the error-status field is + `tooBig'." + ::= { snmp 8 } + +snmpInNoSuchNames OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP PDUs which were + delivered to the SNMP protocol entity and for + which the value of the error-status field is + `noSuchName'." + ::= { snmp 9 } + +snmpInBadValues OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP PDUs which were + delivered to the SNMP protocol entity and for + which the value of the error-status field is + `badValue'." + ::= { snmp 10 } + +snmpInReadOnlys OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number valid SNMP PDUs which were + delivered to the SNMP protocol entity and for + which the value of the error-status field is + `readOnly'. It should be noted that it is a + protocol error to generate an SNMP PDU which + contains the value `readOnly' in the error-status + field, as such this object is provided as a means + of detecting incorrect implementations of the + SNMP." + ::= { snmp 11 } + +snmpInGenErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP PDUs which were + delivered to the SNMP protocol entity and for + which the value of the error-status field is + `genErr'." + ::= { snmp 12 } + +snmpInTotalReqVars OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of MIB objects which have been + retrieved successfully by the SNMP protocol entity + as the result of receiving valid SNMP Get-Request + and Get-Next PDUs." + ::= { snmp 13 } + +snmpInTotalSetVars OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of MIB objects which have been + altered successfully by the SNMP protocol entity + as the result of receiving valid SNMP Set-Request + PDUs." + ::= { snmp 14 } + +snmpInGetRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Get-Request PDUs which + have been accepted and processed by the SNMP + protocol entity." + ::= { snmp 15 } + +snmpInGetNexts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Get-Next PDUs which have + been accepted and processed by the SNMP protocol + entity." + ::= { snmp 16 } + +snmpInSetRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Set-Request PDUs which + have been accepted and processed by the SNMP + protocol entity." + ::= { snmp 17 } + +snmpInGetResponses OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Get-Response PDUs which + have been accepted and processed by the SNMP + protocol entity." + ::= { snmp 18 } + +snmpInTraps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Trap PDUs which have + been accepted and processed by the SNMP protocol + entity." + ::= { snmp 19 } + +snmpOutTooBigs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP PDUs which were + generated by the SNMP protocol entity and for + which the value of the error-status field is + `tooBig.'" + ::= { snmp 20 } + +snmpOutNoSuchNames OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP PDUs which were + generated by the SNMP protocol entity and for + which the value of the error-status is + `noSuchName'." + ::= { snmp 21 } + +snmpOutBadValues OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP PDUs which were + generated by the SNMP protocol entity and for + which the value of the error-status field is + `badValue'." + ::= { snmp 22 } + +-- { snmp 23 } is not used + +snmpOutGenErrs OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP PDUs which were + generated by the SNMP protocol entity and for + which the value of the error-status field is + `genErr'." + ::= { snmp 24 } + +snmpOutGetRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Get-Request PDUs which + have been generated by the SNMP protocol entity." + ::= { snmp 25 } + +snmpOutGetNexts OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Get-Next PDUs which have + been generated by the SNMP protocol entity." + ::= { snmp 26 } + +snmpOutSetRequests OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Set-Request PDUs which + have been generated by the SNMP protocol entity." + ::= { snmp 27 } + +snmpOutGetResponses OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Get-Response PDUs which + have been generated by the SNMP protocol entity." + ::= { snmp 28 } + +snmpOutTraps OBJECT-TYPE + SYNTAX Counter + ACCESS read-only + STATUS mandatory + DESCRIPTION + "The total number of SNMP Trap PDUs which have + been generated by the SNMP protocol entity." + ::= { snmp 29 } + +snmpEnableAuthenTraps OBJECT-TYPE + SYNTAX INTEGER { enabled(1), disabled(2) } + ACCESS read-write + STATUS mandatory + DESCRIPTION + "Indicates whether the SNMP agent process is + permitted to generate authentication-failure + traps. The value of this object overrides any + configuration information; as such, it provides a + means whereby all authentication-failure traps may + be disabled. + + Note that it is strongly recommended that this + object be stored in non-volatile memory so that it + remains constant between re-initializations of the + network management system." + ::= { snmp 30 } + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-CONF b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-CONF new file mode 100644 index 00000000..904dbbb2 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-CONF @@ -0,0 +1,318 @@ +SNMPv2-CONF DEFINITIONS ::= BEGIN + +IMPORTS ObjectName, NotificationName, ObjectSyntax + FROM SNMPv2-SMI; + +-- definitions for conformance groups + +OBJECT-GROUP MACRO ::= +BEGIN + TYPE NOTATION ::= + ObjectsPart + "STATUS" Status + "DESCRIPTION" Text + ReferPart + + VALUE NOTATION ::= + value(VALUE OBJECT IDENTIFIER) + + ObjectsPart ::= + "OBJECTS" "{" Objects "}" + Objects ::= + Object + | Objects "," Object + Object ::= + value(ObjectName) + + Status ::= + "current" + | "deprecated" + | "obsolete" + + ReferPart ::= + "REFERENCE" Text + | empty + + -- a character string as defined in [2] + Text ::= value(IA5String) +END + +-- more definitions for conformance groups + +NOTIFICATION-GROUP MACRO ::= +BEGIN + TYPE NOTATION ::= + NotificationsPart + "STATUS" Status + "DESCRIPTION" Text + ReferPart + + VALUE NOTATION ::= + value(VALUE OBJECT IDENTIFIER) + + NotificationsPart ::= + "NOTIFICATIONS" "{" Notifications "}" + Notifications ::= + Notification + | Notifications "," Notification + Notification ::= + value(NotificationName) + + Status ::= + "current" + | "deprecated" + | "obsolete" + + ReferPart ::= + "REFERENCE" Text + | empty + + -- a character string as defined in [2] + Text ::= value(IA5String) +END + +-- definitions for compliance statements + +MODULE-COMPLIANCE MACRO ::= +BEGIN + TYPE NOTATION ::= + "STATUS" Status + "DESCRIPTION" Text + ReferPart + ModulePart + + VALUE NOTATION ::= + value(VALUE OBJECT IDENTIFIER) + + Status ::= + "current" + | "deprecated" + | "obsolete" + + ReferPart ::= + "REFERENCE" Text + | empty + + ModulePart ::= + Modules + Modules ::= + Module + | Modules Module + Module ::= + -- name of module -- + "MODULE" ModuleName + MandatoryPart + CompliancePart + + ModuleName ::= + -- identifier must start with uppercase letter + identifier ModuleIdentifier + -- must not be empty unless contained + -- in MIB Module + | empty + ModuleIdentifier ::= + value(OBJECT IDENTIFIER) + | empty + + MandatoryPart ::= + "MANDATORY-GROUPS" "{" Groups "}" + | empty + + Groups ::= + Group + | Groups "," Group + Group ::= + value(OBJECT IDENTIFIER) + + CompliancePart ::= + Compliances + | empty + + Compliances ::= + Compliance + | Compliances Compliance + Compliance ::= + ComplianceGroup + | Object + + ComplianceGroup ::= + "GROUP" value(OBJECT IDENTIFIER) + "DESCRIPTION" Text + + Object ::= + "OBJECT" value(ObjectName) + SyntaxPart + WriteSyntaxPart + AccessPart + "DESCRIPTION" Text + + -- must be a refinement for object's SYNTAX clause + SyntaxPart ::= "SYNTAX" Syntax + | empty + + -- must be a refinement for object's SYNTAX clause + WriteSyntaxPart ::= "WRITE-SYNTAX" Syntax + | empty + + Syntax ::= -- Must be one of the following: + -- a base type (or its refinement), + -- a textual convention (or its refinement), or + -- a BITS pseudo-type + type + | "BITS" "{" NamedBits "}" + + NamedBits ::= NamedBit + | NamedBits "," NamedBit + + NamedBit ::= identifier "(" number ")" -- number is nonnegative + + AccessPart ::= + "MIN-ACCESS" Access + | empty + Access ::= + "not-accessible" + | "accessible-for-notify" + | "read-only" + | "read-write" + | "read-create" + + -- a character string as defined in [2] + Text ::= value(IA5String) +END + +-- definitions for capabilities statements + +AGENT-CAPABILITIES MACRO ::= +BEGIN + TYPE NOTATION ::= + "PRODUCT-RELEASE" Text + "STATUS" Status + "DESCRIPTION" Text + ReferPart + ModulePart + + VALUE NOTATION ::= + value(VALUE OBJECT IDENTIFIER) + + Status ::= + "current" + | "obsolete" + + ReferPart ::= + "REFERENCE" Text + | empty + + ModulePart ::= + Modules + | empty + Modules ::= + Module + | Modules Module + Module ::= + -- name of module -- + "SUPPORTS" ModuleName + "INCLUDES" "{" Groups "}" + VariationPart + + ModuleName ::= + -- identifier must start with uppercase letter + identifier ModuleIdentifier + ModuleIdentifier ::= + value(OBJECT IDENTIFIER) + | empty + + Groups ::= + Group + | Groups "," Group + Group ::= + value(OBJECT IDENTIFIER) + + VariationPart ::= + Variations + | empty + Variations ::= + Variation + | Variations Variation + + Variation ::= + ObjectVariation + | NotificationVariation + + NotificationVariation ::= + "VARIATION" value(NotificationName) + AccessPart + "DESCRIPTION" Text + + ObjectVariation ::= + "VARIATION" value(ObjectName) + SyntaxPart + WriteSyntaxPart + AccessPart + CreationPart + DefValPart + "DESCRIPTION" Text + + -- must be a refinement for object's SYNTAX clause + SyntaxPart ::= "SYNTAX" Syntax + | empty + + WriteSyntaxPart ::= "WRITE-SYNTAX" Syntax + | empty + + Syntax ::= -- Must be one of the following: + -- a base type (or its refinement), + -- a textual convention (or its refinement), or + -- a BITS pseudo-type + type + | "BITS" "{" NamedBits "}" + + NamedBits ::= NamedBit + | NamedBits "," NamedBit + + NamedBit ::= identifier "(" number ")" -- number is nonnegative + + AccessPart ::= + "ACCESS" Access + | empty + + Access ::= + "not-implemented" + -- only "not-implemented" for notifications + | "accessible-for-notify" + | "read-only" + | "read-write" + | "read-create" + -- following is for backward-compatibility only + | "write-only" + + CreationPart ::= + "CREATION-REQUIRES" "{" Cells "}" + | empty + Cells ::= + Cell + | Cells "," Cell + Cell ::= + value(ObjectName) + + DefValPart ::= "DEFVAL" "{" Defvalue "}" + | empty + + Defvalue ::= -- must be valid for the object's syntax + -- in this macro's SYNTAX clause, if present, + -- or if not, in object's OBJECT-TYPE macro + value(ObjectSyntax) + | "{" BitsValue "}" + + BitsValue ::= BitNames + | empty + + BitNames ::= BitName + | BitNames "," BitName + + BitName ::= identifier + + -- a character string as defined in [2] + Text ::= value(IA5String) +END + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-MIB b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-MIB new file mode 100644 index 00000000..9494e42c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-MIB @@ -0,0 +1,903 @@ +SNMPv2-MIB DEFINITIONS ::= BEGIN + +IMPORTS + MODULE-IDENTITY, OBJECT-TYPE, NOTIFICATION-TYPE, + TimeTicks, Counter32, snmpModules, mib-2 + FROM SNMPv2-SMI + DisplayString, TestAndIncr, TimeStamp + + + + FROM SNMPv2-TC + MODULE-COMPLIANCE, OBJECT-GROUP, NOTIFICATION-GROUP + FROM SNMPv2-CONF; + +snmpMIB MODULE-IDENTITY + LAST-UPDATED "200210160000Z" + ORGANIZATION "IETF SNMPv3 Working Group" + CONTACT-INFO + "WG-EMail: snmpv3@lists.tislabs.com + Subscribe: snmpv3-request@lists.tislabs.com + + Co-Chair: Russ Mundy + Network Associates Laboratories + postal: 15204 Omega Drive, Suite 300 + Rockville, MD 20850-4601 + USA + EMail: mundy@tislabs.com + phone: +1 301 947-7107 + + Co-Chair: David Harrington + Enterasys Networks + postal: 35 Industrial Way + P. O. Box 5005 + Rochester, NH 03866-5005 + USA + EMail: dbh@enterasys.com + phone: +1 603 337-2614 + + Editor: Randy Presuhn + BMC Software, Inc. + postal: 2141 North First Street + San Jose, CA 95131 + USA + EMail: randy_presuhn@bmc.com + phone: +1 408 546-1006" + DESCRIPTION + "The MIB module for SNMP entities. + + Copyright (C) The Internet Society (2002). This + version of this MIB module is part of RFC 3418; + see the RFC itself for full legal notices. + " + REVISION "200210160000Z" + DESCRIPTION + "This revision of this MIB module was published as + RFC 3418." + REVISION "199511090000Z" + DESCRIPTION + + + + "This revision of this MIB module was published as + RFC 1907." + REVISION "199304010000Z" + DESCRIPTION + "The initial revision of this MIB module was published + as RFC 1450." + ::= { snmpModules 1 } + +snmpMIBObjects OBJECT IDENTIFIER ::= { snmpMIB 1 } + +-- ::= { snmpMIBObjects 1 } this OID is obsolete +-- ::= { snmpMIBObjects 2 } this OID is obsolete +-- ::= { snmpMIBObjects 3 } this OID is obsolete + +-- the System group +-- +-- a collection of objects common to all managed systems. + +system OBJECT IDENTIFIER ::= { mib-2 1 } + +sysDescr OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "A textual description of the entity. This value should + include the full name and version identification of + the system's hardware type, software operating-system, + and networking software." + ::= { system 1 } + +sysObjectID OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The vendor's authoritative identification of the + network management subsystem contained in the entity. + This value is allocated within the SMI enterprises + subtree (1.3.6.1.4.1) and provides an easy and + unambiguous means for determining `what kind of box' is + being managed. For example, if vendor `Flintstones, + Inc.' was assigned the subtree 1.3.6.1.4.1.424242, + it could assign the identifier 1.3.6.1.4.1.424242.1.1 + to its `Fred Router'." + ::= { system 2 } + +sysUpTime OBJECT-TYPE + + + + SYNTAX TimeTicks + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The time (in hundredths of a second) since the + network management portion of the system was last + re-initialized." + ::= { system 3 } + +sysContact OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "The textual identification of the contact person for + this managed node, together with information on how + to contact this person. If no contact information is + known, the value is the zero-length string." + ::= { system 4 } + +sysName OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "An administratively-assigned name for this managed + node. By convention, this is the node's fully-qualified + domain name. If the name is unknown, the value is + the zero-length string." + ::= { system 5 } + +sysLocation OBJECT-TYPE + SYNTAX DisplayString (SIZE (0..255)) + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "The physical location of this node (e.g., 'telephone + closet, 3rd floor'). If the location is unknown, the + value is the zero-length string." + ::= { system 6 } + +sysServices OBJECT-TYPE + SYNTAX INTEGER (0..127) + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "A value which indicates the set of services that this + entity may potentially offer. The value is a sum. + + + + This sum initially takes the value zero. Then, for + each layer, L, in the range 1 through 7, that this node + performs transactions for, 2 raised to (L - 1) is added + to the sum. For example, a node which performs only + routing functions would have a value of 4 (2^(3-1)). + In contrast, a node which is a host offering application + services would have a value of 72 (2^(4-1) + 2^(7-1)). + Note that in the context of the Internet suite of + protocols, values should be calculated accordingly: + + layer functionality + 1 physical (e.g., repeaters) + 2 datalink/subnetwork (e.g., bridges) + 3 internet (e.g., supports the IP) + 4 end-to-end (e.g., supports the TCP) + 7 applications (e.g., supports the SMTP) + + For systems including OSI protocols, layers 5 and 6 + may also be counted." + ::= { system 7 } + +-- object resource information +-- +-- a collection of objects which describe the SNMP entity's +-- (statically and dynamically configurable) support of +-- various MIB modules. + +sysORLastChange OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The value of sysUpTime at the time of the most recent + change in state or value of any instance of sysORID." + ::= { system 8 } + +sysORTable OBJECT-TYPE + SYNTAX SEQUENCE OF SysOREntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The (conceptual) table listing the capabilities of + the local SNMP application acting as a command + responder with respect to various MIB modules. + SNMP entities having dynamically-configurable support + of MIB modules will have a dynamically-varying number + of conceptual rows." + ::= { system 9 } + + + +sysOREntry OBJECT-TYPE + SYNTAX SysOREntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "An entry (conceptual row) in the sysORTable." + INDEX { sysORIndex } + ::= { sysORTable 1 } + +SysOREntry ::= SEQUENCE { + sysORIndex INTEGER, + sysORID OBJECT IDENTIFIER, + sysORDescr DisplayString, + sysORUpTime TimeStamp +} + +sysORIndex OBJECT-TYPE + SYNTAX INTEGER (1..2147483647) + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The auxiliary variable used for identifying instances + of the columnar objects in the sysORTable." + ::= { sysOREntry 1 } + +sysORID OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "An authoritative identification of a capabilities + statement with respect to various MIB modules supported + by the local SNMP application acting as a command + responder." + ::= { sysOREntry 2 } + +sysORDescr OBJECT-TYPE + SYNTAX DisplayString + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "A textual description of the capabilities identified + by the corresponding instance of sysORID." + ::= { sysOREntry 3 } + +sysORUpTime OBJECT-TYPE + SYNTAX TimeStamp + MAX-ACCESS read-only + + + + STATUS current + DESCRIPTION + "The value of sysUpTime at the time this conceptual + row was last instantiated." + ::= { sysOREntry 4 } + + +-- the SNMP group +-- +-- a collection of objects providing basic instrumentation and +-- control of an SNMP entity. + +snmp OBJECT IDENTIFIER ::= { mib-2 11 } + +snmpInPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of messages delivered to the SNMP + entity from the transport service." + ::= { snmp 1 } + +snmpInBadVersions OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of SNMP messages which were delivered + to the SNMP entity and were for an unsupported SNMP + version." + ::= { snmp 3 } + +snmpInBadCommunityNames OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of community-based SNMP messages (for + example, SNMPv1) delivered to the SNMP entity which + used an SNMP community name not known to said entity. + Also, implementations which authenticate community-based + SNMP messages using check(s) in addition to matching + the community name (for example, by also checking + whether the message originated from a transport address + allowed to use a specified community name) MAY include + in this value the number of messages which failed the + additional check(s). It is strongly RECOMMENDED that + + + + the documentation for any security model which is used + to authenticate community-based SNMP messages specify + the precise conditions that contribute to this value." + ::= { snmp 4 } + +snmpInBadCommunityUses OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of community-based SNMP messages (for + example, SNMPv1) delivered to the SNMP entity which + represented an SNMP operation that was not allowed for + the SNMP community named in the message. The precise + conditions under which this counter is incremented + (if at all) depend on how the SNMP entity implements + its access control mechanism and how its applications + interact with that access control mechanism. It is + strongly RECOMMENDED that the documentation for any + access control mechanism which is used to control access + to and visibility of MIB instrumentation specify the + precise conditions that contribute to this value." + ::= { snmp 5 } + +snmpInASNParseErrs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of ASN.1 or BER errors encountered by + the SNMP entity when decoding received SNMP messages." + ::= { snmp 6 } + +snmpEnableAuthenTraps OBJECT-TYPE + SYNTAX INTEGER { enabled(1), disabled(2) } + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "Indicates whether the SNMP entity is permitted to + generate authenticationFailure traps. The value of this + object overrides any configuration information; as such, + it provides a means whereby all authenticationFailure + traps may be disabled. + + Note that it is strongly recommended that this object + be stored in non-volatile memory so that it remains + constant across re-initializations of the network + management system." + + + + ::= { snmp 30 } + +snmpSilentDrops OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of Confirmed Class PDUs (such as + GetRequest-PDUs, GetNextRequest-PDUs, + GetBulkRequest-PDUs, SetRequest-PDUs, and + InformRequest-PDUs) delivered to the SNMP entity which + were silently dropped because the size of a reply + containing an alternate Response Class PDU (such as a + Response-PDU) with an empty variable-bindings field + was greater than either a local constraint or the + maximum message size associated with the originator of + the request." + ::= { snmp 31 } + +snmpProxyDrops OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of Confirmed Class PDUs + (such as GetRequest-PDUs, GetNextRequest-PDUs, + GetBulkRequest-PDUs, SetRequest-PDUs, and + InformRequest-PDUs) delivered to the SNMP entity which + were silently dropped because the transmission of + the (possibly translated) message to a proxy target + failed in a manner (other than a time-out) such that + no Response Class PDU (such as a Response-PDU) could + be returned." + ::= { snmp 32 } + +-- information for notifications +-- +-- a collection of objects which allow the SNMP entity, when +-- supporting a notification originator application, +-- to be configured to generate SNMPv2-Trap-PDUs. + +snmpTrap OBJECT IDENTIFIER ::= { snmpMIBObjects 4 } + +snmpTrapOID OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + MAX-ACCESS accessible-for-notify + STATUS current + DESCRIPTION + + + + "The authoritative identification of the notification + currently being sent. This variable occurs as + the second varbind in every SNMPv2-Trap-PDU and + InformRequest-PDU." + ::= { snmpTrap 1 } + +-- ::= { snmpTrap 2 } this OID is obsolete + +snmpTrapEnterprise OBJECT-TYPE + SYNTAX OBJECT IDENTIFIER + MAX-ACCESS accessible-for-notify + STATUS current + DESCRIPTION + "The authoritative identification of the enterprise + associated with the trap currently being sent. When an + SNMP proxy agent is mapping an RFC1157 Trap-PDU + into a SNMPv2-Trap-PDU, this variable occurs as the + last varbind." + ::= { snmpTrap 3 } + +-- ::= { snmpTrap 4 } this OID is obsolete + + +-- well-known traps + +snmpTraps OBJECT IDENTIFIER ::= { snmpMIBObjects 5 } + +coldStart NOTIFICATION-TYPE + STATUS current + DESCRIPTION + "A coldStart trap signifies that the SNMP entity, + supporting a notification originator application, is + reinitializing itself and that its configuration may + have been altered." + ::= { snmpTraps 1 } + +warmStart NOTIFICATION-TYPE + STATUS current + DESCRIPTION + "A warmStart trap signifies that the SNMP entity, + supporting a notification originator application, + is reinitializing itself such that its configuration + is unaltered." + ::= { snmpTraps 2 } + +-- Note the linkDown NOTIFICATION-TYPE ::= { snmpTraps 3 } +-- and the linkUp NOTIFICATION-TYPE ::= { snmpTraps 4 } +-- are defined in RFC 2863 [RFC2863] + + + +authenticationFailure NOTIFICATION-TYPE + STATUS current + DESCRIPTION + "An authenticationFailure trap signifies that the SNMP + entity has received a protocol message that is not + properly authenticated. While all implementations + of SNMP entities MAY be capable of generating this + trap, the snmpEnableAuthenTraps object indicates + whether this trap will be generated." + ::= { snmpTraps 5 } + +-- Note the egpNeighborLoss notification is defined +-- as { snmpTraps 6 } in RFC 1213 + +-- the set group +-- +-- a collection of objects which allow several cooperating +-- command generator applications to coordinate their use of the +-- set operation. + +snmpSet OBJECT IDENTIFIER ::= { snmpMIBObjects 6 } + +snmpSetSerialNo OBJECT-TYPE + SYNTAX TestAndIncr + MAX-ACCESS read-write + STATUS current + DESCRIPTION + "An advisory lock used to allow several cooperating + command generator applications to coordinate their + use of the SNMP set operation. + + This object is used for coarse-grain coordination. + To achieve fine-grain coordination, one or more similar + objects might be defined within each MIB group, as + appropriate." + ::= { snmpSet 1 } + +-- conformance information + +snmpMIBConformance + OBJECT IDENTIFIER ::= { snmpMIB 2 } + +snmpMIBCompliances + OBJECT IDENTIFIER ::= { snmpMIBConformance 1 } +snmpMIBGroups OBJECT IDENTIFIER ::= { snmpMIBConformance 2 } + +-- compliance statements + + + + +-- ::= { snmpMIBCompliances 1 } this OID is obsolete +snmpBasicCompliance MODULE-COMPLIANCE + STATUS deprecated + DESCRIPTION + "The compliance statement for SNMPv2 entities which + implement the SNMPv2 MIB. + + This compliance statement is replaced by + snmpBasicComplianceRev2." + MODULE -- this module + MANDATORY-GROUPS { snmpGroup, snmpSetGroup, systemGroup, + snmpBasicNotificationsGroup } + + GROUP snmpCommunityGroup + DESCRIPTION + "This group is mandatory for SNMPv2 entities which + support community-based authentication." + + ::= { snmpMIBCompliances 2 } + +snmpBasicComplianceRev2 MODULE-COMPLIANCE + STATUS current + DESCRIPTION + "The compliance statement for SNMP entities which + implement this MIB module." + MODULE -- this module + MANDATORY-GROUPS { snmpGroup, snmpSetGroup, systemGroup, + snmpBasicNotificationsGroup } + + GROUP snmpCommunityGroup + DESCRIPTION + "This group is mandatory for SNMP entities which + support community-based authentication." + + GROUP snmpWarmStartNotificationGroup + DESCRIPTION + "This group is mandatory for an SNMP entity which + supports command responder applications, and is + able to reinitialize itself such that its + configuration is unaltered." + + ::= { snmpMIBCompliances 3 } + +-- units of conformance + +-- ::= { snmpMIBGroups 1 } this OID is obsolete +-- ::= { snmpMIBGroups 2 } this OID is obsolete +-- ::= { snmpMIBGroups 3 } this OID is obsolete + + + +-- ::= { snmpMIBGroups 4 } this OID is obsolete + +snmpGroup OBJECT-GROUP + OBJECTS { snmpInPkts, + snmpInBadVersions, + snmpInASNParseErrs, + snmpSilentDrops, + snmpProxyDrops, + snmpEnableAuthenTraps } + STATUS current + DESCRIPTION + "A collection of objects providing basic instrumentation + and control of an SNMP entity." + ::= { snmpMIBGroups 8 } + +snmpCommunityGroup OBJECT-GROUP + OBJECTS { snmpInBadCommunityNames, + snmpInBadCommunityUses } + STATUS current + DESCRIPTION + "A collection of objects providing basic instrumentation + of a SNMP entity which supports community-based + authentication." + ::= { snmpMIBGroups 9 } + +snmpSetGroup OBJECT-GROUP + OBJECTS { snmpSetSerialNo } + STATUS current + DESCRIPTION + "A collection of objects which allow several cooperating + command generator applications to coordinate their + use of the set operation." + ::= { snmpMIBGroups 5 } + +systemGroup OBJECT-GROUP + OBJECTS { sysDescr, sysObjectID, sysUpTime, + sysContact, sysName, sysLocation, + sysServices, + sysORLastChange, sysORID, + sysORUpTime, sysORDescr } + STATUS current + DESCRIPTION + "The system group defines objects which are common to all + managed systems." + ::= { snmpMIBGroups 6 } + +snmpBasicNotificationsGroup NOTIFICATION-GROUP + NOTIFICATIONS { coldStart, authenticationFailure } + + + + STATUS current + DESCRIPTION + "The basic notifications implemented by an SNMP entity + supporting command responder applications." + ::= { snmpMIBGroups 7 } + +snmpWarmStartNotificationGroup NOTIFICATION-GROUP + NOTIFICATIONS { warmStart } + STATUS current + DESCRIPTION + "An additional notification for an SNMP entity supporting + command responder applications, if it is able to reinitialize + itself such that its configuration is unaltered." + ::= { snmpMIBGroups 11 } + +snmpNotificationGroup OBJECT-GROUP + OBJECTS { snmpTrapOID, snmpTrapEnterprise } + STATUS current + DESCRIPTION + "These objects are required for entities + which support notification originator applications." + ::= { snmpMIBGroups 12 } + +-- definitions in RFC 1213 made obsolete by the inclusion of a +-- subset of the snmp group in this MIB + +snmpOutPkts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Messages which were + passed from the SNMP protocol entity to the + transport service." + ::= { snmp 2 } + +-- { snmp 7 } is not used + +snmpInTooBigs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP PDUs which were + delivered to the SNMP protocol entity and for + which the value of the error-status field was + `tooBig'." + ::= { snmp 8 } + + + +snmpInNoSuchNames OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP PDUs which were + delivered to the SNMP protocol entity and for + which the value of the error-status field was + `noSuchName'." + ::= { snmp 9 } + +snmpInBadValues OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP PDUs which were + delivered to the SNMP protocol entity and for + which the value of the error-status field was + `badValue'." + ::= { snmp 10 } + +snmpInReadOnlys OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number valid SNMP PDUs which were delivered + to the SNMP protocol entity and for which the value + of the error-status field was `readOnly'. It should + be noted that it is a protocol error to generate an + SNMP PDU which contains the value `readOnly' in the + error-status field, as such this object is provided + as a means of detecting incorrect implementations of + the SNMP." + ::= { snmp 11 } + +snmpInGenErrs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP PDUs which were delivered + to the SNMP protocol entity and for which the value + of the error-status field was `genErr'." + ::= { snmp 12 } + +snmpInTotalReqVars OBJECT-TYPE + + + + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of MIB objects which have been + retrieved successfully by the SNMP protocol entity + as the result of receiving valid SNMP Get-Request + and Get-Next PDUs." + ::= { snmp 13 } + +snmpInTotalSetVars OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of MIB objects which have been + altered successfully by the SNMP protocol entity as + the result of receiving valid SNMP Set-Request PDUs." + ::= { snmp 14 } + +snmpInGetRequests OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Get-Request PDUs which + have been accepted and processed by the SNMP + protocol entity." + ::= { snmp 15 } + +snmpInGetNexts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Get-Next PDUs which have been + accepted and processed by the SNMP protocol entity." + ::= { snmp 16 } + +snmpInSetRequests OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Set-Request PDUs which + have been accepted and processed by the SNMP protocol + entity." + ::= { snmp 17 } + + + +snmpInGetResponses OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Get-Response PDUs which + have been accepted and processed by the SNMP protocol + entity." + ::= { snmp 18 } + +snmpInTraps OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Trap PDUs which have been + accepted and processed by the SNMP protocol entity." + ::= { snmp 19 } + +snmpOutTooBigs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP PDUs which were generated + by the SNMP protocol entity and for which the value + of the error-status field was `tooBig.'" + ::= { snmp 20 } + +snmpOutNoSuchNames OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP PDUs which were generated + by the SNMP protocol entity and for which the value + of the error-status was `noSuchName'." + ::= { snmp 21 } + +snmpOutBadValues OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP PDUs which were generated + by the SNMP protocol entity and for which the value + of the error-status field was `badValue'." + ::= { snmp 22 } + + + +-- { snmp 23 } is not used + +snmpOutGenErrs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP PDUs which were generated + by the SNMP protocol entity and for which the value + of the error-status field was `genErr'." + ::= { snmp 24 } + +snmpOutGetRequests OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Get-Request PDUs which + have been generated by the SNMP protocol entity." + ::= { snmp 25 } + +snmpOutGetNexts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Get-Next PDUs which have + been generated by the SNMP protocol entity." + ::= { snmp 26 } + +snmpOutSetRequests OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Set-Request PDUs which + have been generated by the SNMP protocol entity." + ::= { snmp 27 } + +snmpOutGetResponses OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Get-Response PDUs which + have been generated by the SNMP protocol entity." + ::= { snmp 28 } + + + + +snmpOutTraps OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS obsolete + DESCRIPTION + "The total number of SNMP Trap PDUs which have + been generated by the SNMP protocol entity." + ::= { snmp 29 } + +snmpObsoleteGroup OBJECT-GROUP + OBJECTS { snmpOutPkts, snmpInTooBigs, snmpInNoSuchNames, + snmpInBadValues, snmpInReadOnlys, snmpInGenErrs, + snmpInTotalReqVars, snmpInTotalSetVars, + snmpInGetRequests, snmpInGetNexts, snmpInSetRequests, + snmpInGetResponses, snmpInTraps, snmpOutTooBigs, + snmpOutNoSuchNames, snmpOutBadValues, + snmpOutGenErrs, snmpOutGetRequests, snmpOutGetNexts, + snmpOutSetRequests, snmpOutGetResponses, snmpOutTraps + } + STATUS obsolete + DESCRIPTION + "A collection of objects from RFC 1213 made obsolete + by this MIB module." + ::= { snmpMIBGroups 10 } + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-SMI b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-SMI new file mode 100644 index 00000000..2132646c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-SMI @@ -0,0 +1,352 @@ +SNMPv2-SMI DEFINITIONS ::= BEGIN + + +-- the path to the root + +org OBJECT IDENTIFIER ::= { iso 3 } -- "iso" = 1 +dod OBJECT IDENTIFIER ::= { org 6 } +internet OBJECT IDENTIFIER ::= { dod 1 } + +directory OBJECT IDENTIFIER ::= { internet 1 } + +mgmt OBJECT IDENTIFIER ::= { internet 2 } +mib-2 OBJECT IDENTIFIER ::= { mgmt 1 } +transmission OBJECT IDENTIFIER ::= { mib-2 10 } + +experimental OBJECT IDENTIFIER ::= { internet 3 } + +private OBJECT IDENTIFIER ::= { internet 4 } +enterprises OBJECT IDENTIFIER ::= { private 1 } + +security OBJECT IDENTIFIER ::= { internet 5 } + +snmpV2 OBJECT IDENTIFIER ::= { internet 6 } + +-- transport domains +snmpDomains OBJECT IDENTIFIER ::= { snmpV2 1 } + +-- transport proxies +snmpProxys OBJECT IDENTIFIER ::= { snmpV2 2 } + +-- module identities +snmpModules OBJECT IDENTIFIER ::= { snmpV2 3 } + +-- Extended UTCTime, to allow dates with four-digit years +-- (Note that this definition of ExtUTCTime is not to be IMPORTed +-- by MIB modules.) +ExtUTCTime ::= OCTET STRING(SIZE(11 | 13)) + -- format is YYMMDDHHMMZ or YYYYMMDDHHMMZ + -- where: YY - last two digits of year (only years + -- between 1900-1999) + -- YYYY - last four digits of the year (any year) + -- MM - month (01 through 12) + -- DD - day of month (01 through 31) + -- HH - hours (00 through 23) + -- MM - minutes (00 through 59) + -- Z - denotes GMT (the ASCII character Z) + -- + -- For example, "9502192015Z" and "199502192015Z" represent + -- 8:15pm GMT on 19 February 1995. Years after 1999 must use + -- the four digit year format. Years 1900-1999 may use the + -- two or four digit format. + +-- definitions for information modules + +MODULE-IDENTITY MACRO ::= +BEGIN + TYPE NOTATION ::= + "LAST-UPDATED" value(Update ExtUTCTime) + "ORGANIZATION" Text + "CONTACT-INFO" Text + "DESCRIPTION" Text + RevisionPart + + VALUE NOTATION ::= + value(VALUE OBJECT IDENTIFIER) + + RevisionPart ::= + Revisions + | empty + Revisions ::= + Revision + | Revisions Revision + Revision ::= + "REVISION" value(Update ExtUTCTime) + "DESCRIPTION" Text + + -- a character string as defined in section 3.1.1 + Text ::= value(IA5String) +END + + +OBJECT-IDENTITY MACRO ::= +BEGIN + TYPE NOTATION ::= + "STATUS" Status + "DESCRIPTION" Text + ReferPart + + VALUE NOTATION ::= + value(VALUE OBJECT IDENTIFIER) + + Status ::= + "current" + | "deprecated" + | "obsolete" + + ReferPart ::= + "REFERENCE" Text + | empty + + -- a character string as defined in section 3.1.1 + Text ::= value(IA5String) +END + + +-- names of objects +-- (Note that these definitions of ObjectName and NotificationName +-- are not to be IMPORTed by MIB modules.) + +ObjectName ::= + OBJECT IDENTIFIER + +NotificationName ::= + OBJECT IDENTIFIER + +-- syntax of objects + +-- the "base types" defined here are: +-- 3 built-in ASN.1 types: INTEGER, OCTET STRING, OBJECT IDENTIFIER +-- 8 application-defined types: Integer32, IpAddress, Counter32, +-- Gauge32, Unsigned32, TimeTicks, Opaque, and Counter64 + +ObjectSyntax ::= + CHOICE { + simple + SimpleSyntax, + + -- note that SEQUENCEs for conceptual tables and + -- rows are not mentioned here... + + application-wide + ApplicationSyntax + } + +-- built-in ASN.1 types + +SimpleSyntax ::= + CHOICE { + -- INTEGERs with a more restrictive range + -- may also be used + integer-value -- includes Integer32 + INTEGER (-2147483648..2147483647), + + -- OCTET STRINGs with a more restrictive size + -- may also be used + string-value + OCTET STRING (SIZE (0..65535)), + + objectID-value + OBJECT IDENTIFIER + } + +-- indistinguishable from INTEGER, but never needs more than +-- 32-bits for a two's complement representation +Integer32 ::= + INTEGER (-2147483648..2147483647) + + +-- application-wide types + +ApplicationSyntax ::= + CHOICE { + ipAddress-value + IpAddress, + + counter-value + Counter32, + + timeticks-value + TimeTicks, + + arbitrary-value + Opaque, + + big-counter-value + Counter64, + + unsigned-integer-value -- includes Gauge32 + Unsigned32 + } + +-- in network-byte order +-- (this is a tagged type for historical reasons) +IpAddress ::= + [APPLICATION 0] + IMPLICIT OCTET STRING (SIZE (4)) + +-- this wraps +Counter32 ::= + [APPLICATION 1] + IMPLICIT INTEGER (0..4294967295) + +-- this doesn't wrap +Gauge32 ::= + [APPLICATION 2] + IMPLICIT INTEGER (0..4294967295) + +-- an unsigned 32-bit quantity +-- indistinguishable from Gauge32 +Unsigned32 ::= + [APPLICATION 2] + IMPLICIT INTEGER (0..4294967295) + +-- hundredths of seconds since an epoch +TimeTicks ::= + [APPLICATION 3] + IMPLICIT INTEGER (0..4294967295) + +-- for backward-compatibility only +Opaque ::= + [APPLICATION 4] + IMPLICIT OCTET STRING + +-- for counters that wrap in less than one hour with only 32 bits +Counter64 ::= + [APPLICATION 6] + IMPLICIT INTEGER (0..18446744073709551615) + + +-- definition for objects + +OBJECT-TYPE MACRO ::= +BEGIN + TYPE NOTATION ::= + "SYNTAX" Syntax + UnitsPart + "MAX-ACCESS" Access + "STATUS" Status + "DESCRIPTION" Text + ReferPart + IndexPart + DefValPart + + VALUE NOTATION ::= + value(VALUE ObjectName) + + Syntax ::= -- Must be one of the following: + -- a base type (or its refinement), + -- a textual convention (or its refinement), or + -- a BITS pseudo-type + type + | "BITS" "{" NamedBits "}" + + NamedBits ::= NamedBit + | NamedBits "," NamedBit + + NamedBit ::= identifier "(" number ")" -- number is nonnegative + + UnitsPart ::= + "UNITS" Text + | empty + + Access ::= + "not-accessible" + | "accessible-for-notify" + | "read-only" + | "read-write" + | "read-create" + + Status ::= + "current" + | "deprecated" + | "obsolete" + + ReferPart ::= + "REFERENCE" Text + | empty + + IndexPart ::= + "INDEX" "{" IndexTypes "}" + | "AUGMENTS" "{" Entry "}" + | empty + IndexTypes ::= + IndexType + | IndexTypes "," IndexType + IndexType ::= + "IMPLIED" Index + | Index + Index ::= + -- use the SYNTAX value of the + -- correspondent OBJECT-TYPE invocation + value(ObjectName) + Entry ::= + -- use the INDEX value of the + -- correspondent OBJECT-TYPE invocation + value(ObjectName) + + DefValPart ::= "DEFVAL" "{" Defvalue "}" + | empty + + Defvalue ::= -- must be valid for the type specified in + -- SYNTAX clause of same OBJECT-TYPE macro + value(ObjectSyntax) + | "{" BitsValue "}" + + BitsValue ::= BitNames + | empty + + BitNames ::= BitName + | BitNames "," BitName + + BitName ::= identifier + + -- a character string as defined in section 3.1.1 + Text ::= value(IA5String) +END + + +-- definitions for notifications + +NOTIFICATION-TYPE MACRO ::= +BEGIN + TYPE NOTATION ::= + ObjectsPart + "STATUS" Status + "DESCRIPTION" Text + ReferPart + + VALUE NOTATION ::= + value(VALUE NotificationName) + + ObjectsPart ::= + "OBJECTS" "{" Objects "}" + | empty + Objects ::= + Object + | Objects "," Object + Object ::= + value(ObjectName) + + Status ::= + "current" + | "deprecated" + | "obsolete" + + ReferPart ::= + "REFERENCE" Text + | empty + + -- a character string as defined in section 3.1.1 + Text ::= value(IA5String) +END + +-- definitions of administrative identifiers + +zeroDotZero OBJECT-IDENTITY + STATUS current + DESCRIPTION + "A value used for null identifiers." + ::= { 0 0 } + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TC b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TC new file mode 100644 index 00000000..a68f9690 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TC @@ -0,0 +1,786 @@ +SNMPv2-TC DEFINITIONS ::= BEGIN + +IMPORTS + TimeTicks FROM SNMPv2-SMI; + + +-- definition of textual conventions + +TEXTUAL-CONVENTION MACRO ::= +BEGIN + TYPE NOTATION ::= + DisplayPart + "STATUS" Status + "DESCRIPTION" Text + ReferPart + "SYNTAX" Syntax + + VALUE NOTATION ::= + value(VALUE Syntax) -- adapted ASN.1 + + DisplayPart ::= + "DISPLAY-HINT" Text + | empty + + Status ::= + "current" + | "deprecated" + | "obsolete" + + ReferPart ::= + "REFERENCE" Text + | empty + + -- a character string as defined in [2] + Text ::= value(IA5String) + + Syntax ::= -- Must be one of the following: + -- a base type (or its refinement), or + -- a BITS pseudo-type + type + | "BITS" "{" NamedBits "}" + + NamedBits ::= NamedBit + | NamedBits "," NamedBit + + NamedBit ::= identifier "(" number ")" -- number is nonnegative + +END + + + + +DisplayString ::= TEXTUAL-CONVENTION + DISPLAY-HINT "255a" + STATUS current + DESCRIPTION + "Represents textual information taken from the NVT ASCII + character set, as defined in pages 4, 10-11 of RFC 854. + + To summarize RFC 854, the NVT ASCII repertoire specifies: + + - the use of character codes 0-127 (decimal) + + - the graphics characters (32-126) are interpreted as + US ASCII + + - NUL, LF, CR, BEL, BS, HT, VT and FF have the special + meanings specified in RFC 854 + + - the other 25 codes have no standard interpretation + + - the sequence 'CR LF' means newline + + - the sequence 'CR NUL' means carriage-return + + - an 'LF' not preceded by a 'CR' means moving to the + same column on the next line. + + - the sequence 'CR x' for any x other than LF or NUL is + illegal. (Note that this also means that a string may + end with either 'CR LF' or 'CR NUL', but not with CR.) + + Any object defined using this syntax may not exceed 255 + characters in length." + SYNTAX OCTET STRING (SIZE (0..255)) + +PhysAddress ::= TEXTUAL-CONVENTION + DISPLAY-HINT "1x:" + STATUS current + DESCRIPTION + "Represents media- or physical-level addresses." + SYNTAX OCTET STRING + + +MacAddress ::= TEXTUAL-CONVENTION + DISPLAY-HINT "1x:" + STATUS current + DESCRIPTION + "Represents an 802 MAC address represented in the + `canonical' order defined by IEEE 802.1a, i.e., as if it + were transmitted least significant bit first, even though + 802.5 (in contrast to other 802.x protocols) requires MAC + addresses to be transmitted most significant bit first." + SYNTAX OCTET STRING (SIZE (6)) + +TruthValue ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Represents a boolean value." + SYNTAX INTEGER { true(1), false(2) } + +TestAndIncr ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Represents integer-valued information used for atomic + operations. When the management protocol is used to specify + that an object instance having this syntax is to be + modified, the new value supplied via the management protocol + must precisely match the value presently held by the + instance. If not, the management protocol set operation + fails with an error of `inconsistentValue'. Otherwise, if + the current value is the maximum value of 2^31-1 (2147483647 + decimal), then the value held by the instance is wrapped to + zero; otherwise, the value held by the instance is + incremented by one. (Note that regardless of whether the + management protocol set operation succeeds, the variable- + binding in the request and response PDUs are identical.) + + The value of the ACCESS clause for objects having this + syntax is either `read-write' or `read-create'. When an + instance of a columnar object having this syntax is created, + any value may be supplied via the management protocol. + + When the network management portion of the system is re- + initialized, the value of every object instance having this + syntax must either be incremented from its value prior to + the re-initialization, or (if the value prior to the re- + initialization is unknown) be set to a pseudo-randomly + generated value." + SYNTAX INTEGER (0..2147483647) + +AutonomousType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Represents an independently extensible type identification + value. It may, for example, indicate a particular sub-tree + with further MIB definitions, or define a particular type of + protocol or hardware." + SYNTAX OBJECT IDENTIFIER + + +InstancePointer ::= TEXTUAL-CONVENTION + STATUS obsolete + DESCRIPTION + "A pointer to either a specific instance of a MIB object or + a conceptual row of a MIB table in the managed device. In + the latter case, by convention, it is the name of the + particular instance of the first accessible columnar object + in the conceptual row. + + The two uses of this textual convention are replaced by + VariablePointer and RowPointer, respectively." + SYNTAX OBJECT IDENTIFIER + + +VariablePointer ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "A pointer to a specific object instance. For example, + sysContact.0 or ifInOctets.3." + SYNTAX OBJECT IDENTIFIER + + +RowPointer ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Represents a pointer to a conceptual row. The value is the + name of the instance of the first accessible columnar object + in the conceptual row. + + For example, ifIndex.3 would point to the 3rd row in the + ifTable (note that if ifIndex were not-accessible, then + ifDescr.3 would be used instead)." + SYNTAX OBJECT IDENTIFIER + +RowStatus ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The RowStatus textual convention is used to manage the + creation and deletion of conceptual rows, and is used as the + value of the SYNTAX clause for the status column of a + conceptual row (as described in Section 7.7.1 of [2].) + The status column has six defined values: + + - `active', which indicates that the conceptual row is + available for use by the managed device; + + - `notInService', which indicates that the conceptual + row exists in the agent, but is unavailable for use by + the managed device (see NOTE below); 'notInService' has + no implication regarding the internal consistency of + the row, availability of resources, or consistency with + the current state of the managed device; + + - `notReady', which indicates that the conceptual row + exists in the agent, but is missing information + necessary in order to be available for use by the + managed device (i.e., one or more required columns in + the conceptual row have not been instanciated); + + - `createAndGo', which is supplied by a management + station wishing to create a new instance of a + conceptual row and to have its status automatically set + to active, making it available for use by the managed + device; + + - `createAndWait', which is supplied by a management + station wishing to create a new instance of a + conceptual row (but not make it available for use by + the managed device); and, + + - `destroy', which is supplied by a management station + wishing to delete all of the instances associated with + an existing conceptual row. + + Whereas five of the six values (all except `notReady') may + be specified in a management protocol set operation, only + three values will be returned in response to a management + protocol retrieval operation: `notReady', `notInService' or + `active'. That is, when queried, an existing conceptual row + has only three states: it is either available for use by + the managed device (the status column has value `active'); + it is not available for use by the managed device, though + the agent has sufficient information to attempt to make it + so (the status column has value `notInService'); or, it is + not available for use by the managed device, and an attempt + to make it so would fail because the agent has insufficient + information (the state column has value `notReady'). + + NOTE WELL + + This textual convention may be used for a MIB table, + irrespective of whether the values of that table's + conceptual rows are able to be modified while it is + active, or whether its conceptual rows must be taken + out of service in order to be modified. That is, it is + the responsibility of the DESCRIPTION clause of the + status column to specify whether the status column must + not be `active' in order for the value of some other + column of the same conceptual row to be modified. If + such a specification is made, affected columns may be + changed by an SNMP set PDU if the RowStatus would not + be equal to `active' either immediately before or after + processing the PDU. In other words, if the PDU also + contained a varbind that would change the RowStatus + value, the column in question may be changed if the + RowStatus was not equal to `active' as the PDU was + received, or if the varbind sets the status to a value + other than 'active'. + + + Also note that whenever any elements of a row exist, the + RowStatus column must also exist. + + To summarize the effect of having a conceptual row with a + status column having a SYNTAX clause value of RowStatus, + consider the following state diagram: + + + STATE + +--------------+-----------+-------------+------------- + | A | B | C | D + | |status col.|status column| + |status column | is | is |status column + ACTION |does not exist| notReady | notInService| is active +--------------+--------------+-----------+-------------+------------- +set status |noError ->D|inconsist- |inconsistent-|inconsistent- +column to | or | entValue| Value| Value +createAndGo |inconsistent- | | | + | Value| | | +--------------+--------------+-----------+-------------+------------- +set status |noError see 1|inconsist- |inconsistent-|inconsistent- +column to | or | entValue| Value| Value +createAndWait |wrongValue | | | +--------------+--------------+-----------+-------------+------------- +set status |inconsistent- |inconsist- |noError |noError +column to | Value| entValue| | +active | | | | + | | or | | + | | | | + | |see 2 ->D|see 8 ->D| ->D +--------------+--------------+-----------+-------------+------------- +set status |inconsistent- |inconsist- |noError |noError ->C +column to | Value| entValue| | +notInService | | | | + | | or | | or + | | | | + | |see 3 ->C| ->C|see 6 +--------------+--------------+-----------+-------------+------------- +set status |noError |noError |noError |noError ->A +column to | | | | or +destroy | ->A| ->A| ->A|see 7 +--------------+--------------+-----------+-------------+------------- +set any other |see 4 |noError |noError |see 5 +column to some| | | | +value | | see 1| ->C| ->D +--------------+--------------+-----------+-------------+------------- + + (1) goto B or C, depending on information available to the + agent. + + (2) if other variable bindings included in the same PDU, + provide values for all columns which are missing but + required, and all columns have acceptable values, then + return noError and goto D. + + (3) if other variable bindings included in the same PDU, + provide legal values for all columns which are missing but + required, then return noError and goto C. + + (4) at the discretion of the agent, the return value may be + either: + + inconsistentName: because the agent does not choose to + create such an instance when the corresponding + RowStatus instance does not exist, or + + inconsistentValue: if the supplied value is + inconsistent with the state of some other MIB object's + value, or + + noError: because the agent chooses to create the + instance. + + If noError is returned, then the instance of the status + column must also be created, and the new state is B or C, + depending on the information available to the agent. If + inconsistentName or inconsistentValue is returned, the row + remains in state A. + + (5) depending on the MIB definition for the column/table, + either noError or inconsistentValue may be returned. + + (6) the return value can indicate one of the following + errors: + + wrongValue: because the agent does not support + notInService (e.g., an agent which does not support + createAndWait), or + + inconsistentValue: because the agent is unable to take + the row out of service at this time, perhaps because it + is in use and cannot be de-activated. + + (7) the return value can indicate the following error: + + inconsistentValue: because the agent is unable to + remove the row at this time, perhaps because it is in + use and cannot be de-activated. + + (8) the transition to D can fail, e.g., if the values of the + conceptual row are inconsistent, then the error code would + be inconsistentValue. + + NOTE: Other processing of (this and other varbinds of) the + set request may result in a response other than noError + being returned, e.g., wrongValue, noCreation, etc. + + + Conceptual Row Creation + + There are four potential interactions when creating a + conceptual row: selecting an instance-identifier which is + not in use; creating the conceptual row; initializing any + objects for which the agent does not supply a default; and, + making the conceptual row available for use by the managed + device. + + Interaction 1: Selecting an Instance-Identifier + + The algorithm used to select an instance-identifier varies + for each conceptual row. In some cases, the instance- + identifier is semantically significant, e.g., the + destination address of a route, and a management station + selects the instance-identifier according to the semantics. + + In other cases, the instance-identifier is used solely to + distinguish conceptual rows, and a management station + without specific knowledge of the conceptual row might + examine the instances present in order to determine an + unused instance-identifier. (This approach may be used, but + it is often highly sub-optimal; however, it is also a + questionable practice for a naive management station to + attempt conceptual row creation.) + + Alternately, the MIB module which defines the conceptual row + might provide one or more objects which provide assistance + in determining an unused instance-identifier. For example, + if the conceptual row is indexed by an integer-value, then + an object having an integer-valued SYNTAX clause might be + defined for such a purpose, allowing a management station to + issue a management protocol retrieval operation. In order + to avoid unnecessary collisions between competing management + stations, `adjacent' retrievals of this object should be + different. + + Finally, the management station could select a pseudo-random + number to use as the index. In the event that this index + was already in use and an inconsistentValue was returned in + response to the management protocol set operation, the + management station should simply select a new pseudo-random + number and retry the operation. + + A MIB designer should choose between the two latter + algorithms based on the size of the table (and therefore the + efficiency of each algorithm). For tables in which a large + number of entries are expected, it is recommended that a MIB + object be defined that returns an acceptable index for + creation. For tables with small numbers of entries, it is + recommended that the latter pseudo-random index mechanism be + used. + + Interaction 2: Creating the Conceptual Row + + Once an unused instance-identifier has been selected, the + management station determines if it wishes to create and + activate the conceptual row in one transaction or in a + negotiated set of interactions. + + Interaction 2a: Creating and Activating the Conceptual Row + + The management station must first determine the column + requirements, i.e., it must determine those columns for + which it must or must not provide values. Depending on the + complexity of the table and the management station's + knowledge of the agent's capabilities, this determination + can be made locally by the management station. Alternately, + the management station issues a management protocol get + operation to examine all columns in the conceptual row that + it wishes to create. In response, for each column, there + are three possible outcomes: + + - a value is returned, indicating that some other + management station has already created this conceptual + row. We return to interaction 1. + + - the exception `noSuchInstance' is returned, + indicating that the agent implements the object-type + associated with this column, and that this column in at + least one conceptual row would be accessible in the MIB + view used by the retrieval were it to exist. For those + columns to which the agent provides read-create access, + the `noSuchInstance' exception tells the management + station that it should supply a value for this column + when the conceptual row is to be created. + + - the exception `noSuchObject' is returned, indicating + that the agent does not implement the object-type + associated with this column or that there is no + conceptual row for which this column would be + accessible in the MIB view used by the retrieval. As + such, the management station can not issue any + management protocol set operations to create an + instance of this column. + + Once the column requirements have been determined, a + management protocol set operation is accordingly issued. + This operation also sets the new instance of the status + column to `createAndGo'. + + When the agent processes the set operation, it verifies that + it has sufficient information to make the conceptual row + available for use by the managed device. The information + available to the agent is provided by two sources: the + management protocol set operation which creates the + conceptual row, and, implementation-specific defaults + supplied by the agent (note that an agent must provide + implementation-specific defaults for at least those objects + which it implements as read-only). If there is sufficient + information available, then the conceptual row is created, a + `noError' response is returned, the status column is set to + `active', and no further interactions are necessary (i.e., + interactions 3 and 4 are skipped). If there is insufficient + information, then the conceptual row is not created, and the + set operation fails with an error of `inconsistentValue'. + On this error, the management station can issue a management + protocol retrieval operation to determine if this was + because it failed to specify a value for a required column, + or, because the selected instance of the status column + already existed. In the latter case, we return to + interaction 1. In the former case, the management station + can re-issue the set operation with the additional + information, or begin interaction 2 again using + `createAndWait' in order to negotiate creation of the + conceptual row. + + NOTE WELL + + Regardless of the method used to determine the column + requirements, it is possible that the management + station might deem a column necessary when, in fact, + the agent will not allow that particular columnar + instance to be created or written. In this case, the + management protocol set operation will fail with an + error such as `noCreation' or `notWritable'. In this + case, the management station decides whether it needs + to be able to set a value for that particular columnar + instance. If not, the management station re-issues the + management protocol set operation, but without setting + a value for that particular columnar instance; + otherwise, the management station aborts the row + creation algorithm. + + Interaction 2b: Negotiating the Creation of the Conceptual + Row + + The management station issues a management protocol set + operation which sets the desired instance of the status + column to `createAndWait'. If the agent is unwilling to + process a request of this sort, the set operation fails with + an error of `wrongValue'. (As a consequence, such an agent + must be prepared to accept a single management protocol set + operation, i.e., interaction 2a above, containing all of the + columns indicated by its column requirements.) Otherwise, + the conceptual row is created, a `noError' response is + returned, and the status column is immediately set to either + `notInService' or `notReady', depending on whether it has + sufficient information to (attempt to) make the conceptual + row available for use by the managed device. If there is + sufficient information available, then the status column is + set to `notInService'; otherwise, if there is insufficient + information, then the status column is set to `notReady'. + Regardless, we proceed to interaction 3. + + Interaction 3: Initializing non-defaulted Objects + + The management station must now determine the column + requirements. It issues a management protocol get operation + to examine all columns in the created conceptual row. In + the response, for each column, there are three possible + outcomes: + + - a value is returned, indicating that the agent + implements the object-type associated with this column + and had sufficient information to provide a value. For + those columns to which the agent provides read-create + access (and for which the agent allows their values to + be changed after their creation), a value return tells + the management station that it may issue additional + management protocol set operations, if it desires, in + order to change the value associated with this column. + + - the exception `noSuchInstance' is returned, + indicating that the agent implements the object-type + associated with this column, and that this column in at + least one conceptual row would be accessible in the MIB + view used by the retrieval were it to exist. However, + the agent does not have sufficient information to + provide a value, and until a value is provided, the + conceptual row may not be made available for use by the + managed device. For those columns to which the agent + provides read-create access, the `noSuchInstance' + exception tells the management station that it must + issue additional management protocol set operations, in + order to provide a value associated with this column. + + - the exception `noSuchObject' is returned, indicating + that the agent does not implement the object-type + associated with this column or that there is no + conceptual row for which this column would be + accessible in the MIB view used by the retrieval. As + such, the management station can not issue any + management protocol set operations to create an + instance of this column. + + If the value associated with the status column is + `notReady', then the management station must first deal with + all `noSuchInstance' columns, if any. Having done so, the + value of the status column becomes `notInService', and we + proceed to interaction 4. + + Interaction 4: Making the Conceptual Row Available + + Once the management station is satisfied with the values + associated with the columns of the conceptual row, it issues + a management protocol set operation to set the status column + to `active'. If the agent has sufficient information to + make the conceptual row available for use by the managed + device, the management protocol set operation succeeds (a + `noError' response is returned). Otherwise, the management + protocol set operation fails with an error of + `inconsistentValue'. + + NOTE WELL + + A conceptual row having a status column with value + `notInService' or `notReady' is unavailable to the + managed device. As such, it is possible for the + managed device to create its own instances during the + time between the management protocol set operation + which sets the status column to `createAndWait' and the + management protocol set operation which sets the status + column to `active'. In this case, when the management + protocol set operation is issued to set the status + column to `active', the values held in the agent + supersede those used by the managed device. + + If the management station is prevented from setting the + status column to `active' (e.g., due to management station + or network failure) the conceptual row will be left in the + `notInService' or `notReady' state, consuming resources + indefinitely. The agent must detect conceptual rows that + have been in either state for an abnormally long period of + time and remove them. It is the responsibility of the + DESCRIPTION clause of the status column to indicate what an + abnormally long period of time would be. This period of + time should be long enough to allow for human response time + (including `think time') between the creation of the + conceptual row and the setting of the status to `active'. + In the absence of such information in the DESCRIPTION + clause, it is suggested that this period be approximately 5 + minutes in length. This removal action applies not only to + newly-created rows, but also to previously active rows which + are set to, and left in, the notInService state for a + prolonged period exceeding that which is considered normal + for such a conceptual row. + + Conceptual Row Suspension + + When a conceptual row is `active', the management station + may issue a management protocol set operation which sets the + instance of the status column to `notInService'. If the + agent is unwilling to do so, the set operation fails with an + error of `wrongValue' or `inconsistentValue'. Otherwise, + the conceptual row is taken out of service, and a `noError' + response is returned. It is the responsibility of the + DESCRIPTION clause of the status column to indicate under + what circumstances the status column should be taken out of + service (e.g., in order for the value of some other column + of the same conceptual row to be modified). + + + Conceptual Row Deletion + + For deletion of conceptual rows, a management protocol set + operation is issued which sets the instance of the status + column to `destroy'. This request may be made regardless of + the current value of the status column (e.g., it is possible + to delete conceptual rows which are either `notReady', + `notInService' or `active'.) If the operation succeeds, + then all instances associated with the conceptual row are + immediately removed." + SYNTAX INTEGER { + -- the following two values are states: + -- these values may be read or written + active(1), + notInService(2), + + -- the following value is a state: + -- this value may be read, but not written + notReady(3), + + -- the following three values are + -- actions: these values may be written, + -- but are never read + createAndGo(4), + createAndWait(5), + destroy(6) + } + +TimeStamp ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "The value of the sysUpTime object at which a specific + occurrence happened. The specific occurrence must be + defined in the description of any object defined using this + type. + + If sysUpTime is reset to zero as a result of a re- + initialization of the network management (sub)system, then + the values of all TimeStamp objects are also reset. + However, after approximately 497 days without a re- + initialization, the sysUpTime object will reach 2^^32-1 and + then increment around to zero; in this case, existing values + of TimeStamp objects do not change. This can lead to + ambiguities in the value of TimeStamp objects." + SYNTAX TimeTicks + + +TimeInterval ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "A period of time, measured in units of 0.01 seconds." + SYNTAX INTEGER (0..2147483647) + +DateAndTime ::= TEXTUAL-CONVENTION + DISPLAY-HINT "2d-1d-1d,1d:1d:1d.1d,1a1d:1d" + STATUS current + DESCRIPTION + "A date-time specification. + + field octets contents range + ----- ------ -------- ----- + 1 1-2 year* 0..65536 + 2 3 month 1..12 + 3 4 day 1..31 + 4 5 hour 0..23 + 5 6 minutes 0..59 + 6 7 seconds 0..60 + (use 60 for leap-second) + 7 8 deci-seconds 0..9 + 8 9 direction from UTC '+' / '-' + 9 10 hours from UTC* 0..13 + 10 11 minutes from UTC 0..59 + + * Notes: + - the value of year is in network-byte order + - daylight saving time in New Zealand is +13 + + For example, Tuesday May 26, 1992 at 1:30:15 PM EDT would be + displayed as: + + 1992-5-26,13:30:15.0,-4:0 + + Note that if only local time is known, then timezone + information (fields 8-10) is not present." + SYNTAX OCTET STRING (SIZE (8 | 11)) + + +StorageType ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Describes the memory realization of a conceptual row. A + row which is volatile(2) is lost upon reboot. A row which + is either nonVolatile(3), permanent(4) or readOnly(5), is + backed up by stable storage. A row which is permanent(4) + can be changed but not deleted. A row which is readOnly(5) + cannot be changed nor deleted. + + If the value of an object with this syntax is either + permanent(4) or readOnly(5), it cannot be written. + Conversely, if the value is either other(1), volatile(2) or + nonVolatile(3), it cannot be modified to be permanent(4) or + readOnly(5). (All illegal modifications result in a + 'wrongValue' error.) + + Every usage of this textual convention is required to + specify the columnar objects which a permanent(4) row must + at a minimum allow to be writable." + SYNTAX INTEGER { + other(1), -- eh? + volatile(2), -- e.g., in RAM + nonVolatile(3), -- e.g., in NVRAM + permanent(4), -- e.g., partially in ROM + readOnly(5) -- e.g., completely in ROM + } + +TDomain ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Denotes a kind of transport service. + + Some possible values, such as snmpUDPDomain, are defined in + the SNMPv2-TM MIB module. Other possible values are defined + in other MIB modules." + REFERENCE "The SNMPv2-TM MIB module is defined in RFC 1906." + SYNTAX OBJECT IDENTIFIER + + +TAddress ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Denotes a transport service address. + + A TAddress value is always interpreted within the context of a + TDomain value. Thus, each definition of a TDomain value must + be accompanied by a definition of a textual convention for use + with that TDomain. Some possible textual conventions, such as + SnmpUDPAddress for snmpUDPDomain, are defined in the SNMPv2-TM + MIB module. Other possible textual conventions are defined in + other MIB modules." + REFERENCE "The SNMPv2-TM MIB module is defined in RFC 1906." + SYNTAX OCTET STRING (SIZE (1..255)) + + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TM b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TM new file mode 100644 index 00000000..dadbc4a8 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/SNMPv2-TM @@ -0,0 +1,194 @@ +SNMPv2-TM DEFINITIONS ::= BEGIN + +IMPORTS + MODULE-IDENTITY, OBJECT-IDENTITY, + snmpModules, snmpDomains, snmpProxys + FROM SNMPv2-SMI + TEXTUAL-CONVENTION + FROM SNMPv2-TC; + +snmpv2tm MODULE-IDENTITY + LAST-UPDATED "200210160000Z" + ORGANIZATION "IETF SNMPv3 Working Group" + CONTACT-INFO + "WG-EMail: snmpv3@lists.tislabs.com + Subscribe: snmpv3-request@lists.tislabs.com + + Co-Chair: Russ Mundy + Network Associates Laboratories + postal: 15204 Omega Drive, Suite 300 + Rockville, MD 20850-4601 + USA + EMail: mundy@tislabs.com + phone: +1 301 947-7107 + + + + Co-Chair: David Harrington + Enterasys Networks + postal: 35 Industrial Way + P. O. Box 5005 + Rochester, NH 03866-5005 + USA + EMail: dbh@enterasys.com + phone: +1 603 337-2614 + + Editor: Randy Presuhn + BMC Software, Inc. + postal: 2141 North First Street + San Jose, CA 95131 + USA + EMail: randy_presuhn@bmc.com + phone: +1 408 546-1006" + DESCRIPTION + "The MIB module for SNMP transport mappings. + + Copyright (C) The Internet Society (2002). This + version of this MIB module is part of RFC 3417; + see the RFC itself for full legal notices. + " + REVISION "200210160000Z" + DESCRIPTION + "Clarifications, published as RFC 3417." + REVISION "199601010000Z" + DESCRIPTION + "Clarifications, published as RFC 1906." + REVISION "199304010000Z" + DESCRIPTION + "The initial version, published as RFC 1449." + ::= { snmpModules 19 } + +-- SNMP over UDP over IPv4 + +snmpUDPDomain OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The SNMP over UDP over IPv4 transport domain. + The corresponding transport address is of type + SnmpUDPAddress." + ::= { snmpDomains 1 } + + + + + + + + +SnmpUDPAddress ::= TEXTUAL-CONVENTION + DISPLAY-HINT "1d.1d.1d.1d/2d" + STATUS current + DESCRIPTION + "Represents a UDP over IPv4 address: + + octets contents encoding + 1-4 IP-address network-byte order + 5-6 UDP-port network-byte order + " + SYNTAX OCTET STRING (SIZE (6)) + +-- SNMP over OSI + +snmpCLNSDomain OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The SNMP over CLNS transport domain. + The corresponding transport address is of type + SnmpOSIAddress." + ::= { snmpDomains 2 } + +snmpCONSDomain OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The SNMP over CONS transport domain. + The corresponding transport address is of type + SnmpOSIAddress." + ::= { snmpDomains 3 } + +SnmpOSIAddress ::= TEXTUAL-CONVENTION + DISPLAY-HINT "*1x:/1x:" + STATUS current + DESCRIPTION + "Represents an OSI transport-address: + + octets contents encoding + 1 length of NSAP 'n' as an unsigned-integer + (either 0 or from 3 to 20) + 2..(n+1) NSAP concrete binary representation + (n+2)..m TSEL string of (up to 64) octets + " + SYNTAX OCTET STRING (SIZE (1 | 4..85)) + + + + + + + + +-- SNMP over DDP + +snmpDDPDomain OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The SNMP over DDP transport domain. The corresponding + transport address is of type SnmpNBPAddress." + ::= { snmpDomains 4 } + +SnmpNBPAddress ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Represents an NBP name: + + octets contents encoding + 1 length of object 'n' as an unsigned integer + 2..(n+1) object string of (up to 32) octets + n+2 length of type 'p' as an unsigned integer + (n+3)..(n+2+p) type string of (up to 32) octets + n+3+p length of zone 'q' as an unsigned integer + (n+4+p)..(n+3+p+q) zone string of (up to 32) octets + + For comparison purposes, strings are + case-insensitive. All strings may contain any octet + other than 255 (hex ff)." + SYNTAX OCTET STRING (SIZE (3..99)) + +-- SNMP over IPX + +snmpIPXDomain OBJECT-IDENTITY + STATUS current + DESCRIPTION + "The SNMP over IPX transport domain. The corresponding + transport address is of type SnmpIPXAddress." + ::= { snmpDomains 5 } + +SnmpIPXAddress ::= TEXTUAL-CONVENTION + DISPLAY-HINT "4x.1x:1x:1x:1x:1x:1x.2d" + STATUS current + DESCRIPTION + "Represents an IPX address: + + octets contents encoding + 1-4 network-number network-byte order + 5-10 physical-address network-byte order + 11-12 socket-number network-byte order + " + SYNTAX OCTET STRING (SIZE (12)) + + + +-- for proxy to SNMPv1 (RFC 1157) + +rfc1157Proxy OBJECT IDENTIFIER ::= { snmpProxys 1 } + +rfc1157Domain OBJECT-IDENTITY + STATUS deprecated + DESCRIPTION + "The transport domain for SNMPv1 over UDP over IPv4. + The corresponding transport address is of type + SnmpUDPAddress." + ::= { rfc1157Proxy 1 } + +-- ::= { rfc1157Proxy 2 } this OID is obsolete + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/TCP-MIB b/contrib/apps/LwipMibCompiler/Mibs/TCP-MIB new file mode 100644 index 00000000..5b9e0bf3 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/TCP-MIB @@ -0,0 +1,829 @@ +TCP-MIB DEFINITIONS ::= BEGIN + +IMPORTS + MODULE-IDENTITY, OBJECT-TYPE, Integer32, Unsigned32, + Gauge32, Counter32, Counter64, IpAddress, mib-2 + FROM SNMPv2-SMI + MODULE-COMPLIANCE, OBJECT-GROUP FROM SNMPv2-CONF + InetAddress, InetAddressType, + InetPortNumber FROM INET-ADDRESS-MIB; + +tcpMIB MODULE-IDENTITY + LAST-UPDATED "200502180000Z" -- 18 February 2005 + ORGANIZATION + "IETF IPv6 MIB Revision Team + http://www.ietf.org/html.charters/ipv6-charter.html" + CONTACT-INFO + "Rajiv Raghunarayan (editor) + + Cisco Systems Inc. + 170 West Tasman Drive + San Jose, CA 95134 + + Phone: +1 408 853 9612 + Email: + + Send comments to " + DESCRIPTION + "The MIB module for managing TCP implementations. + + Copyright (C) The Internet Society (2005). This version + of this MIB module is a part of RFC 4022; see the RFC + itself for full legal notices." + REVISION "200502180000Z" -- 18 February 2005 + DESCRIPTION + "IP version neutral revision, published as RFC 4022." + REVISION "9411010000Z" + DESCRIPTION + "Initial SMIv2 version, published as RFC 2012." + REVISION "9103310000Z" + DESCRIPTION + "The initial revision of this MIB module was part of + MIB-II." + ::= { mib-2 49 } + +-- the TCP base variables group + + + + +tcp OBJECT IDENTIFIER ::= { mib-2 6 } + +-- Scalars + +tcpRtoAlgorithm OBJECT-TYPE + SYNTAX INTEGER { + other(1), -- none of the following + constant(2), -- a constant rto + rsre(3), -- MIL-STD-1778, Appendix B + vanj(4), -- Van Jacobson's algorithm + rfc2988(5) -- RFC 2988 + } + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The algorithm used to determine the timeout value used for + retransmitting unacknowledged octets." + ::= { tcp 1 } + +tcpRtoMin OBJECT-TYPE + SYNTAX Integer32 (0..2147483647) + UNITS "milliseconds" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The minimum value permitted by a TCP implementation for + the retransmission timeout, measured in milliseconds. + More refined semantics for objects of this type depend + on the algorithm used to determine the retransmission + timeout; in particular, the IETF standard algorithm + rfc2988(5) provides a minimum value." + ::= { tcp 2 } + +tcpRtoMax OBJECT-TYPE + SYNTAX Integer32 (0..2147483647) + UNITS "milliseconds" + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The maximum value permitted by a TCP implementation for + the retransmission timeout, measured in milliseconds. + More refined semantics for objects of this type depend + on the algorithm used to determine the retransmission + timeout; in particular, the IETF standard algorithm + rfc2988(5) provides an upper bound (as part of an + adaptive backoff algorithm)." + ::= { tcp 3 } + + + + +tcpMaxConn OBJECT-TYPE + SYNTAX Integer32 (-1 | 0..2147483647) + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The limit on the total number of TCP connections the entity + can support. In entities where the maximum number of + connections is dynamic, this object should contain the + value -1." + ::= { tcp 4 } + +tcpActiveOpens OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of times that TCP connections have made a direct + transition to the SYN-SENT state from the CLOSED state. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + ::= { tcp 5 } + +tcpPassiveOpens OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of times TCP connections have made a direct + transition to the SYN-RCVD state from the LISTEN state. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + ::= { tcp 6 } + +tcpAttemptFails OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of times that TCP connections have made a direct + transition to the CLOSED state from either the SYN-SENT + state or the SYN-RCVD state, plus the number of times that + TCP connections have made a direct transition to the + LISTEN state from the SYN-RCVD state. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + + + + ::= { tcp 7 } + +tcpEstabResets OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of times that TCP connections have made a direct + transition to the CLOSED state from either the ESTABLISHED + state or the CLOSE-WAIT state. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + ::= { tcp 8 } + +tcpCurrEstab OBJECT-TYPE + SYNTAX Gauge32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of TCP connections for which the current state + is either ESTABLISHED or CLOSE-WAIT." + ::= { tcp 9 } + +tcpInSegs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of segments received, including those + received in error. This count includes segments received + on currently established connections. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + ::= { tcp 10 } + +tcpOutSegs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of segments sent, including those on + current connections but excluding those containing only + retransmitted octets. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + + + + ::= { tcp 11 } + +tcpRetransSegs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of segments retransmitted; that is, the + number of TCP segments transmitted containing one or more + previously transmitted octets. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + ::= { tcp 12 } + +tcpInErrs OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of segments received in error (e.g., bad + TCP checksums). + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + ::= { tcp 14 } + +tcpOutRsts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of TCP segments sent containing the RST flag. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + ::= { tcp 15 } + +-- { tcp 16 } was used to represent the ipv6TcpConnTable in RFC 2452, +-- which has since been obsoleted. It MUST not be used. + +tcpHCInSegs OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of segments received, including those + received in error. This count includes segments received + + + + on currently established connections. This object is + the 64-bit equivalent of tcpInSegs. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + ::= { tcp 17 } + +tcpHCOutSegs OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of segments sent, including those on + current connections but excluding those containing only + retransmitted octets. This object is the 64-bit + equivalent of tcpOutSegs. + + Discontinuities in the value of this counter are + indicated via discontinuities in the value of sysUpTime." + ::= { tcp 18 } + + +-- The TCP Connection table + +tcpConnectionTable OBJECT-TYPE + SYNTAX SEQUENCE OF TcpConnectionEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A table containing information about existing TCP + connections. Note that unlike earlier TCP MIBs, there + is a separate table for connections in the LISTEN state." + ::= { tcp 19 } + +tcpConnectionEntry OBJECT-TYPE + SYNTAX TcpConnectionEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A conceptual row of the tcpConnectionTable containing + information about a particular current TCP connection. + Each row of this table is transient in that it ceases to + exist when (or soon after) the connection makes the + transition to the CLOSED state." + INDEX { tcpConnectionLocalAddressType, + tcpConnectionLocalAddress, + tcpConnectionLocalPort, + tcpConnectionRemAddressType, + + + + tcpConnectionRemAddress, + tcpConnectionRemPort } + ::= { tcpConnectionTable 1 } + +TcpConnectionEntry ::= SEQUENCE { + tcpConnectionLocalAddressType InetAddressType, + tcpConnectionLocalAddress InetAddress, + tcpConnectionLocalPort InetPortNumber, + tcpConnectionRemAddressType InetAddressType, + tcpConnectionRemAddress InetAddress, + tcpConnectionRemPort InetPortNumber, + tcpConnectionState INTEGER, + tcpConnectionProcess Unsigned32 + } + +tcpConnectionLocalAddressType OBJECT-TYPE + SYNTAX InetAddressType + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The address type of tcpConnectionLocalAddress." + ::= { tcpConnectionEntry 1 } + +tcpConnectionLocalAddress OBJECT-TYPE + SYNTAX InetAddress + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The local IP address for this TCP connection. The type + of this address is determined by the value of + tcpConnectionLocalAddressType. + + As this object is used in the index for the + tcpConnectionTable, implementors should be + careful not to create entries that would result in OIDs + with more than 128 subidentifiers; otherwise the information + cannot be accessed by using SNMPv1, SNMPv2c, or SNMPv3." + ::= { tcpConnectionEntry 2 } + +tcpConnectionLocalPort OBJECT-TYPE + SYNTAX InetPortNumber + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The local port number for this TCP connection." + ::= { tcpConnectionEntry 3 } + +tcpConnectionRemAddressType OBJECT-TYPE + + + + SYNTAX InetAddressType + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The address type of tcpConnectionRemAddress." + ::= { tcpConnectionEntry 4 } + +tcpConnectionRemAddress OBJECT-TYPE + SYNTAX InetAddress + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The remote IP address for this TCP connection. The type + of this address is determined by the value of + tcpConnectionRemAddressType. + + As this object is used in the index for the + tcpConnectionTable, implementors should be + careful not to create entries that would result in OIDs + with more than 128 subidentifiers; otherwise the information + cannot be accessed by using SNMPv1, SNMPv2c, or SNMPv3." + ::= { tcpConnectionEntry 5 } + +tcpConnectionRemPort OBJECT-TYPE + SYNTAX InetPortNumber + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The remote port number for this TCP connection." + ::= { tcpConnectionEntry 6 } + +tcpConnectionState OBJECT-TYPE + SYNTAX INTEGER { + closed(1), + listen(2), + synSent(3), + synReceived(4), + established(5), + finWait1(6), + finWait2(7), + closeWait(8), + lastAck(9), + closing(10), + timeWait(11), + deleteTCB(12) + } + MAX-ACCESS read-write + STATUS current + + + + DESCRIPTION + "The state of this TCP connection. + + The value listen(2) is included only for parallelism to the + old tcpConnTable and should not be used. A connection in + LISTEN state should be present in the tcpListenerTable. + + The only value that may be set by a management station is + deleteTCB(12). Accordingly, it is appropriate for an agent + to return a `badValue' response if a management station + attempts to set this object to any other value. + + If a management station sets this object to the value + deleteTCB(12), then the TCB (as defined in [RFC793]) of + the corresponding connection on the managed node is + deleted, resulting in immediate termination of the + connection. + + As an implementation-specific option, a RST segment may be + sent from the managed node to the other TCP endpoint (note, + however, that RST segments are not sent reliably)." + ::= { tcpConnectionEntry 7 } + +tcpConnectionProcess OBJECT-TYPE + SYNTAX Unsigned32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The system's process ID for the process associated with + this connection, or zero if there is no such process. This + value is expected to be the same as HOST-RESOURCES-MIB:: + hrSWRunIndex or SYSAPPL-MIB::sysApplElmtRunIndex for some + row in the appropriate tables." + ::= { tcpConnectionEntry 8 } + +-- The TCP Listener table + +tcpListenerTable OBJECT-TYPE + SYNTAX SEQUENCE OF TcpListenerEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A table containing information about TCP listeners. A + listening application can be represented in three + possible ways: + + 1. An application that is willing to accept both IPv4 and + IPv6 datagrams is represented by + + + + a tcpListenerLocalAddressType of unknown (0) and + a tcpListenerLocalAddress of ''h (a zero-length + octet-string). + + 2. An application that is willing to accept only IPv4 or + IPv6 datagrams is represented by a + tcpListenerLocalAddressType of the appropriate address + type and a tcpListenerLocalAddress of '0.0.0.0' or '::' + respectively. + + 3. An application that is listening for data destined + only to a specific IP address, but from any remote + system, is represented by a tcpListenerLocalAddressType + of an appropriate address type, with + tcpListenerLocalAddress as the specific local address. + + NOTE: The address type in this table represents the + address type used for the communication, irrespective + of the higher-layer abstraction. For example, an + application using IPv6 'sockets' to communicate via + IPv4 between ::ffff:10.0.0.1 and ::ffff:10.0.0.2 would + use InetAddressType ipv4(1))." + ::= { tcp 20 } + +tcpListenerEntry OBJECT-TYPE + SYNTAX TcpListenerEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A conceptual row of the tcpListenerTable containing + information about a particular TCP listener." + INDEX { tcpListenerLocalAddressType, + tcpListenerLocalAddress, + tcpListenerLocalPort } + ::= { tcpListenerTable 1 } + +TcpListenerEntry ::= SEQUENCE { + tcpListenerLocalAddressType InetAddressType, + tcpListenerLocalAddress InetAddress, + tcpListenerLocalPort InetPortNumber, + tcpListenerProcess Unsigned32 + } + +tcpListenerLocalAddressType OBJECT-TYPE + SYNTAX InetAddressType + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + + + + "The address type of tcpListenerLocalAddress. The value + should be unknown (0) if connection initiations to all + local IP addresses are accepted." + ::= { tcpListenerEntry 1 } + +tcpListenerLocalAddress OBJECT-TYPE + SYNTAX InetAddress + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The local IP address for this TCP connection. + + The value of this object can be represented in three + possible ways, depending on the characteristics of the + listening application: + + 1. For an application willing to accept both IPv4 and + IPv6 datagrams, the value of this object must be + ''h (a zero-length octet-string), with the value + of the corresponding tcpListenerLocalAddressType + object being unknown (0). + + 2. For an application willing to accept only IPv4 or + IPv6 datagrams, the value of this object must be + '0.0.0.0' or '::' respectively, with + tcpListenerLocalAddressType representing the + appropriate address type. + + 3. For an application which is listening for data + destined only to a specific IP address, the value + of this object is the specific local address, with + tcpListenerLocalAddressType representing the + appropriate address type. + + As this object is used in the index for the + tcpListenerTable, implementors should be + careful not to create entries that would result in OIDs + with more than 128 subidentifiers; otherwise the information + cannot be accessed, using SNMPv1, SNMPv2c, or SNMPv3." + ::= { tcpListenerEntry 2 } + +tcpListenerLocalPort OBJECT-TYPE + SYNTAX InetPortNumber + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The local port number for this TCP connection." + ::= { tcpListenerEntry 3 } + + + +tcpListenerProcess OBJECT-TYPE + SYNTAX Unsigned32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The system's process ID for the process associated with + this listener, or zero if there is no such process. This + value is expected to be the same as HOST-RESOURCES-MIB:: + hrSWRunIndex or SYSAPPL-MIB::sysApplElmtRunIndex for some + row in the appropriate tables." + ::= { tcpListenerEntry 4 } + + +-- The deprecated TCP Connection table + +tcpConnTable OBJECT-TYPE + SYNTAX SEQUENCE OF TcpConnEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "A table containing information about existing IPv4-specific + TCP connections or listeners. This table has been + deprecated in favor of the version neutral + tcpConnectionTable." + ::= { tcp 13 } + +tcpConnEntry OBJECT-TYPE + SYNTAX TcpConnEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "A conceptual row of the tcpConnTable containing information + about a particular current IPv4 TCP connection. Each row + of this table is transient in that it ceases to exist when + (or soon after) the connection makes the transition to the + CLOSED state." + INDEX { tcpConnLocalAddress, + tcpConnLocalPort, + tcpConnRemAddress, + tcpConnRemPort } + ::= { tcpConnTable 1 } + +TcpConnEntry ::= SEQUENCE { + tcpConnState INTEGER, + tcpConnLocalAddress IpAddress, + tcpConnLocalPort Integer32, + tcpConnRemAddress IpAddress, + tcpConnRemPort Integer32 + + + + } + +tcpConnState OBJECT-TYPE + SYNTAX INTEGER { + closed(1), + listen(2), + synSent(3), + synReceived(4), + established(5), + finWait1(6), + finWait2(7), + closeWait(8), + lastAck(9), + closing(10), + timeWait(11), + deleteTCB(12) + } + MAX-ACCESS read-write + STATUS deprecated + DESCRIPTION + "The state of this TCP connection. + + The only value that may be set by a management station is + deleteTCB(12). Accordingly, it is appropriate for an agent + to return a `badValue' response if a management station + attempts to set this object to any other value. + + If a management station sets this object to the value + deleteTCB(12), then the TCB (as defined in [RFC793]) of + the corresponding connection on the managed node is + deleted, resulting in immediate termination of the + connection. + + As an implementation-specific option, a RST segment may be + sent from the managed node to the other TCP endpoint (note, + however, that RST segments are not sent reliably)." + ::= { tcpConnEntry 1 } + +tcpConnLocalAddress OBJECT-TYPE + SYNTAX IpAddress + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The local IP address for this TCP connection. In the case + of a connection in the listen state willing to + accept connections for any IP interface associated with the + node, the value 0.0.0.0 is used." + ::= { tcpConnEntry 2 } + + + +tcpConnLocalPort OBJECT-TYPE + SYNTAX Integer32 (0..65535) + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The local port number for this TCP connection." + ::= { tcpConnEntry 3 } + +tcpConnRemAddress OBJECT-TYPE + SYNTAX IpAddress + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The remote IP address for this TCP connection." + ::= { tcpConnEntry 4 } + +tcpConnRemPort OBJECT-TYPE + SYNTAX Integer32 (0..65535) + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The remote port number for this TCP connection." + ::= { tcpConnEntry 5 } + +-- conformance information + +tcpMIBConformance OBJECT IDENTIFIER ::= { tcpMIB 2 } + +tcpMIBCompliances OBJECT IDENTIFIER ::= { tcpMIBConformance 1 } +tcpMIBGroups OBJECT IDENTIFIER ::= { tcpMIBConformance 2 } + +-- compliance statements + +tcpMIBCompliance2 MODULE-COMPLIANCE + STATUS current + DESCRIPTION + "The compliance statement for systems that implement TCP. + + A number of INDEX objects cannot be + represented in the form of OBJECT clauses in SMIv2 but + have the following compliance requirements, + expressed in OBJECT clause form in this description + clause: + + -- OBJECT tcpConnectionLocalAddressType + -- SYNTAX InetAddressType { ipv4(1), ipv6(2) } + -- DESCRIPTION + -- This MIB requires support for only global IPv4 + + + + -- and IPv6 address types. + -- + -- OBJECT tcpConnectionRemAddressType + -- SYNTAX InetAddressType { ipv4(1), ipv6(2) } + -- DESCRIPTION + -- This MIB requires support for only global IPv4 + -- and IPv6 address types. + -- + -- OBJECT tcpListenerLocalAddressType + -- SYNTAX InetAddressType { unknown(0), ipv4(1), + -- ipv6(2) } + -- DESCRIPTION + -- This MIB requires support for only global IPv4 + -- and IPv6 address types. The type unknown also + -- needs to be supported to identify a special + -- case in the listener table: a listen using + -- both IPv4 and IPv6 addresses on the device. + -- + " + MODULE -- this module + MANDATORY-GROUPS { tcpBaseGroup, tcpConnectionGroup, + tcpListenerGroup } + GROUP tcpHCGroup + DESCRIPTION + "This group is mandatory for systems that are capable + of receiving or transmitting more than 1 million TCP + segments per second. 1 million segments per second will + cause a Counter32 to wrap in just over an hour." + OBJECT tcpConnectionState + SYNTAX INTEGER { closed(1), listen(2), synSent(3), + synReceived(4), established(5), + finWait1(6), finWait2(7), closeWait(8), + lastAck(9), closing(10), timeWait(11) } + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required, nor is support for the value + deleteTCB (12)." + ::= { tcpMIBCompliances 2 } + +tcpMIBCompliance MODULE-COMPLIANCE + STATUS deprecated + DESCRIPTION + "The compliance statement for IPv4-only systems that + implement TCP. In order to be IP version independent, this + compliance statement is deprecated in favor of + tcpMIBCompliance2. However, agents are still encouraged + to implement these objects in order to interoperate with + the deployed base of managers." + + + + MODULE -- this module + MANDATORY-GROUPS { tcpGroup } + OBJECT tcpConnState + MIN-ACCESS read-only + DESCRIPTION + "Write access is not required." + ::= { tcpMIBCompliances 1 } + + +-- units of conformance + +tcpGroup OBJECT-GROUP + OBJECTS { tcpRtoAlgorithm, tcpRtoMin, tcpRtoMax, + tcpMaxConn, tcpActiveOpens, + tcpPassiveOpens, tcpAttemptFails, + tcpEstabResets, tcpCurrEstab, tcpInSegs, + tcpOutSegs, tcpRetransSegs, tcpConnState, + tcpConnLocalAddress, tcpConnLocalPort, + tcpConnRemAddress, tcpConnRemPort, + tcpInErrs, tcpOutRsts } + STATUS deprecated + DESCRIPTION + "The tcp group of objects providing for management of TCP + entities." + ::= { tcpMIBGroups 1 } + +tcpBaseGroup OBJECT-GROUP + OBJECTS { tcpRtoAlgorithm, tcpRtoMin, tcpRtoMax, + tcpMaxConn, tcpActiveOpens, + tcpPassiveOpens, tcpAttemptFails, + tcpEstabResets, tcpCurrEstab, tcpInSegs, + tcpOutSegs, tcpRetransSegs, + tcpInErrs, tcpOutRsts } + STATUS current + DESCRIPTION + "The group of counters common to TCP entities." + ::= { tcpMIBGroups 2 } + +tcpConnectionGroup OBJECT-GROUP + OBJECTS { tcpConnectionState, tcpConnectionProcess } + STATUS current + DESCRIPTION + "The group provides general information about TCP + connections." + ::= { tcpMIBGroups 3 } + +tcpListenerGroup OBJECT-GROUP + OBJECTS { tcpListenerProcess } + + + + STATUS current + DESCRIPTION + "This group has objects providing general information about + TCP listeners." + ::= { tcpMIBGroups 4 } + +tcpHCGroup OBJECT-GROUP + OBJECTS { tcpHCInSegs, tcpHCOutSegs } + STATUS current + DESCRIPTION + "The group of objects providing for counters of high speed + TCP implementations." + ::= { tcpMIBGroups 5 } + +END diff --git a/contrib/apps/LwipMibCompiler/Mibs/UDP-MIB b/contrib/apps/LwipMibCompiler/Mibs/UDP-MIB new file mode 100644 index 00000000..b947b812 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/Mibs/UDP-MIB @@ -0,0 +1,579 @@ +UDP-MIB DEFINITIONS ::= BEGIN + +IMPORTS + MODULE-IDENTITY, OBJECT-TYPE, Integer32, Counter32, Counter64, + Unsigned32, IpAddress, mib-2 FROM SNMPv2-SMI + MODULE-COMPLIANCE, OBJECT-GROUP FROM SNMPv2-CONF + InetAddress, InetAddressType, + InetPortNumber FROM INET-ADDRESS-MIB; + +udpMIB MODULE-IDENTITY + LAST-UPDATED "200505200000Z" -- May 20, 2005 + ORGANIZATION + "IETF IPv6 Working Group + http://www.ietf.org/html.charters/ipv6-charter.html" + CONTACT-INFO + "Bill Fenner (editor) + + AT&T Labs -- Research + 75 Willow Rd. + Menlo Park, CA 94025 + + Phone: +1 650 330-7893 + Email: + + John Flick (editor) + + Hewlett-Packard Company + 8000 Foothills Blvd. M/S 5557 + Roseville, CA 95747 + + Phone: +1 916 785 4018 + Email: + + Send comments to " + + + + DESCRIPTION + "The MIB module for managing UDP implementations. + Copyright (C) The Internet Society (2005). This + version of this MIB module is part of RFC 4113; + see the RFC itself for full legal notices." + REVISION "200505200000Z" -- May 20, 2005 + DESCRIPTION + "IP version neutral revision, incorporating the + following revisions: + + - Added udpHCInDatagrams and udpHCOutDatagrams in order + to provide high-capacity counters for fast networks. + - Added text to the descriptions of all counter objects + to indicate how discontinuities are detected. + - Deprecated the IPv4-specific udpTable and replaced it + with the version neutral udpEndpointTable. This + table includes support for connected UDP endpoints + and support for identification of the operating + system process associated with a UDP endpoint. + - Deprecated the udpGroup and replaced it with object + groups representing the current set of objects. + - Deprecated udpMIBCompliance and replaced it with + udpMIBCompliance2, which includes the compliance + information for the new object groups. + + This version published as RFC 4113." + REVISION "199411010000Z" -- November 1, 1994 + DESCRIPTION + "Initial SMIv2 version, published as RFC 2013." + REVISION "199103310000Z" -- March 31, 1991 + DESCRIPTION + "The initial revision of this MIB module was part of + MIB-II, published as RFC 1213." + ::= { mib-2 50 } + +-- the UDP group + +udp OBJECT IDENTIFIER ::= { mib-2 7 } + +udpInDatagrams OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of UDP datagrams delivered to UDP + users. + + + + + + Discontinuities in the value of this counter can occur + at re-initialization of the management system, and at + other times as indicated by discontinuities in the + value of sysUpTime." + ::= { udp 1 } + +udpNoPorts OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of received UDP datagrams for which + there was no application at the destination port. + + Discontinuities in the value of this counter can occur + at re-initialization of the management system, and at + other times as indicated by discontinuities in the + value of sysUpTime." + ::= { udp 2 } + +udpInErrors OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The number of received UDP datagrams that could not be + delivered for reasons other than the lack of an + application at the destination port. + + Discontinuities in the value of this counter can occur + at re-initialization of the management system, and at + other times as indicated by discontinuities in the + value of sysUpTime." + ::= { udp 3 } + +udpOutDatagrams OBJECT-TYPE + SYNTAX Counter32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of UDP datagrams sent from this + entity. + + Discontinuities in the value of this counter can occur + at re-initialization of the management system, and at + other times as indicated by discontinuities in the + value of sysUpTime." + ::= { udp 4 } + + + +udpHCInDatagrams OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of UDP datagrams delivered to UDP + users, for devices that can receive more than 1 + million UDP datagrams per second. + + Discontinuities in the value of this counter can occur + at re-initialization of the management system, and at + other times as indicated by discontinuities in the + value of sysUpTime." + ::= { udp 8 } + +udpHCOutDatagrams OBJECT-TYPE + SYNTAX Counter64 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The total number of UDP datagrams sent from this + entity, for devices that can transmit more than 1 + million UDP datagrams per second. + + Discontinuities in the value of this counter can occur + at re-initialization of the management system, and at + other times as indicated by discontinuities in the + value of sysUpTime." + ::= { udp 9 } + +-- +-- { udp 6 } was defined as the ipv6UdpTable in RFC2454's +-- IPV6-UDP-MIB. This RFC obsoletes RFC 2454, so { udp 6 } is +-- obsoleted. +-- + +-- The UDP "Endpoint" table. + +udpEndpointTable OBJECT-TYPE + SYNTAX SEQUENCE OF UdpEndpointEntry + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "A table containing information about this entity's UDP + endpoints on which a local application is currently + accepting or sending datagrams. + + + + + + The address type in this table represents the address + type used for the communication, irrespective of the + higher-layer abstraction. For example, an application + using IPv6 'sockets' to communicate via IPv4 between + ::ffff:10.0.0.1 and ::ffff:10.0.0.2 would use + InetAddressType ipv4(1). + + Unlike the udpTable in RFC 2013, this table also allows + the representation of an application that completely + specifies both local and remote addresses and ports. A + listening application is represented in three possible + ways: + + 1) An application that is willing to accept both IPv4 + and IPv6 datagrams is represented by a + udpEndpointLocalAddressType of unknown(0) and a + udpEndpointLocalAddress of ''h (a zero-length + octet-string). + + 2) An application that is willing to accept only IPv4 + or only IPv6 datagrams is represented by a + udpEndpointLocalAddressType of the appropriate + address type and a udpEndpointLocalAddress of + '0.0.0.0' or '::' respectively. + + 3) An application that is listening for datagrams only + for a specific IP address but from any remote + system is represented by a + udpEndpointLocalAddressType of the appropriate + address type, with udpEndpointLocalAddress + specifying the local address. + + In all cases where the remote is a wildcard, the + udpEndpointRemoteAddressType is unknown(0), the + udpEndpointRemoteAddress is ''h (a zero-length + octet-string), and the udpEndpointRemotePort is 0. + + If the operating system is demultiplexing UDP packets + by remote address and port, or if the application has + 'connected' the socket specifying a default remote + address and port, the udpEndpointRemote* values should + be used to reflect this." + ::= { udp 7 } + +udpEndpointEntry OBJECT-TYPE + SYNTAX UdpEndpointEntry + MAX-ACCESS not-accessible + STATUS current + + + + DESCRIPTION + "Information about a particular current UDP endpoint. + + Implementers need to be aware that if the total number + of elements (octets or sub-identifiers) in + udpEndpointLocalAddress and udpEndpointRemoteAddress + exceeds 111, then OIDs of column instances in this table + will have more than 128 sub-identifiers and cannot be + accessed using SNMPv1, SNMPv2c, or SNMPv3." + INDEX { udpEndpointLocalAddressType, + udpEndpointLocalAddress, + udpEndpointLocalPort, + udpEndpointRemoteAddressType, + udpEndpointRemoteAddress, + udpEndpointRemotePort, + udpEndpointInstance } + ::= { udpEndpointTable 1 } + +UdpEndpointEntry ::= SEQUENCE { + udpEndpointLocalAddressType InetAddressType, + udpEndpointLocalAddress InetAddress, + udpEndpointLocalPort InetPortNumber, + udpEndpointRemoteAddressType InetAddressType, + udpEndpointRemoteAddress InetAddress, + udpEndpointRemotePort InetPortNumber, + udpEndpointInstance Unsigned32, + udpEndpointProcess Unsigned32 + } + +udpEndpointLocalAddressType OBJECT-TYPE + SYNTAX InetAddressType + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The address type of udpEndpointLocalAddress. Only + IPv4, IPv4z, IPv6, and IPv6z addresses are expected, or + unknown(0) if datagrams for all local IP addresses are + accepted." + ::= { udpEndpointEntry 1 } + +udpEndpointLocalAddress OBJECT-TYPE + SYNTAX InetAddress + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The local IP address for this UDP endpoint. + + The value of this object can be represented in three + + + + possible ways, depending on the characteristics of the + listening application: + + 1. For an application that is willing to accept both + IPv4 and IPv6 datagrams, the value of this object + must be ''h (a zero-length octet-string), with + the value of the corresponding instance of the + udpEndpointLocalAddressType object being unknown(0). + + 2. For an application that is willing to accept only IPv4 + or only IPv6 datagrams, the value of this object + must be '0.0.0.0' or '::', respectively, while the + corresponding instance of the + udpEndpointLocalAddressType object represents the + appropriate address type. + + 3. For an application that is listening for data + destined only to a specific IP address, the value + of this object is the specific IP address for which + this node is receiving packets, with the + corresponding instance of the + udpEndpointLocalAddressType object representing the + appropriate address type. + + As this object is used in the index for the + udpEndpointTable, implementors of this table should be + careful not to create entries that would result in OIDs + with more than 128 subidentifiers; else the information + cannot be accessed using SNMPv1, SNMPv2c, or SNMPv3." + ::= { udpEndpointEntry 2 } + +udpEndpointLocalPort OBJECT-TYPE + SYNTAX InetPortNumber + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The local port number for this UDP endpoint." + ::= { udpEndpointEntry 3 } + +udpEndpointRemoteAddressType OBJECT-TYPE + SYNTAX InetAddressType + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The address type of udpEndpointRemoteAddress. Only + IPv4, IPv4z, IPv6, and IPv6z addresses are expected, or + unknown(0) if datagrams for all remote IP addresses are + accepted. Also, note that some combinations of + + + + udpEndpointLocalAdressType and + udpEndpointRemoteAddressType are not supported. In + particular, if the value of this object is not + unknown(0), it is expected to always refer to the + same IP version as udpEndpointLocalAddressType." + ::= { udpEndpointEntry 4 } + +udpEndpointRemoteAddress OBJECT-TYPE + SYNTAX InetAddress + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The remote IP address for this UDP endpoint. If + datagrams from any remote system are to be accepted, + this value is ''h (a zero-length octet-string). + Otherwise, it has the type described by + udpEndpointRemoteAddressType and is the address of the + remote system from which datagrams are to be accepted + (or to which all datagrams will be sent). + + As this object is used in the index for the + udpEndpointTable, implementors of this table should be + careful not to create entries that would result in OIDs + with more than 128 subidentifiers; else the information + cannot be accessed using SNMPv1, SNMPv2c, or SNMPv3." + ::= { udpEndpointEntry 5 } + +udpEndpointRemotePort OBJECT-TYPE + SYNTAX InetPortNumber + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The remote port number for this UDP endpoint. If + datagrams from any remote system are to be accepted, + this value is zero." + ::= { udpEndpointEntry 6 } + +udpEndpointInstance OBJECT-TYPE + SYNTAX Unsigned32 (1..'ffffffff'h) + MAX-ACCESS not-accessible + STATUS current + DESCRIPTION + "The instance of this tuple. This object is used to + distinguish among multiple processes 'connected' to + the same UDP endpoint. For example, on a system + implementing the BSD sockets interface, this would be + used to support the SO_REUSEADDR and SO_REUSEPORT + socket options." + + + + ::= { udpEndpointEntry 7 } + +udpEndpointProcess OBJECT-TYPE + SYNTAX Unsigned32 + MAX-ACCESS read-only + STATUS current + DESCRIPTION + "The system's process ID for the process associated with + this endpoint, or zero if there is no such process. + This value is expected to be the same as + HOST-RESOURCES-MIB::hrSWRunIndex or SYSAPPL-MIB:: + sysApplElmtRunIndex for some row in the appropriate + tables." + ::= { udpEndpointEntry 8 } + +-- The deprecated UDP Listener table + +-- The deprecated UDP listener table only contains information +-- about this entity's IPv4 UDP end-points on which a local +-- application is currently accepting datagrams. It does not +-- provide more detailed connection information, or information +-- about IPv6 endpoints. + +udpTable OBJECT-TYPE + SYNTAX SEQUENCE OF UdpEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "A table containing IPv4-specific UDP listener + information. It contains information about all local + IPv4 UDP end-points on which an application is + currently accepting datagrams. This table has been + deprecated in favor of the version neutral + udpEndpointTable." + ::= { udp 5 } + +udpEntry OBJECT-TYPE + SYNTAX UdpEntry + MAX-ACCESS not-accessible + STATUS deprecated + DESCRIPTION + "Information about a particular current UDP listener." + INDEX { udpLocalAddress, udpLocalPort } + ::= { udpTable 1 } + +UdpEntry ::= SEQUENCE { + udpLocalAddress IpAddress, + udpLocalPort Integer32 + + + +} + +udpLocalAddress OBJECT-TYPE + SYNTAX IpAddress + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The local IP address for this UDP listener. In the + case of a UDP listener that is willing to accept + datagrams for any IP interface associated with the + node, the value 0.0.0.0 is used." + ::= { udpEntry 1 } + +udpLocalPort OBJECT-TYPE + SYNTAX Integer32 (0..65535) + MAX-ACCESS read-only + STATUS deprecated + DESCRIPTION + "The local port number for this UDP listener." + ::= { udpEntry 2 } + +-- conformance information + +udpMIBConformance OBJECT IDENTIFIER ::= { udpMIB 2 } +udpMIBCompliances OBJECT IDENTIFIER ::= { udpMIBConformance 1 } +udpMIBGroups OBJECT IDENTIFIER ::= { udpMIBConformance 2 } + +-- compliance statements + +udpMIBCompliance2 MODULE-COMPLIANCE + STATUS current + DESCRIPTION + "The compliance statement for systems that implement + UDP. + + There are a number of INDEX objects that cannot be + represented in the form of OBJECT clauses in SMIv2, but + for which we have the following compliance + requirements, expressed in OBJECT clause form in this + description clause: + + -- OBJECT udpEndpointLocalAddressType + -- SYNTAX InetAddressType { unknown(0), ipv4(1), + -- ipv6(2), ipv4z(3), + -- ipv6z(4) } + -- DESCRIPTION + -- Support for dns(5) is not required. + -- OBJECT udpEndpointLocalAddress + + + + -- SYNTAX InetAddress (SIZE(0|4|8|16|20)) + -- DESCRIPTION + -- Support is only required for zero-length + -- octet-strings, and for scoped and unscoped + -- IPv4 and IPv6 addresses. + -- OBJECT udpEndpointRemoteAddressType + -- SYNTAX InetAddressType { unknown(0), ipv4(1), + -- ipv6(2), ipv4z(3), + -- ipv6z(4) } + -- DESCRIPTION + -- Support for dns(5) is not required. + -- OBJECT udpEndpointRemoteAddress + -- SYNTAX InetAddress (SIZE(0|4|8|16|20)) + -- DESCRIPTION + -- Support is only required for zero-length + -- octet-strings, and for scoped and unscoped + -- IPv4 and IPv6 addresses. + " + MODULE -- this module + MANDATORY-GROUPS { udpBaseGroup, udpEndpointGroup } + GROUP udpHCGroup + DESCRIPTION + "This group is mandatory for systems that + are capable of receiving or transmitting more than + 1 million UDP datagrams per second. 1 million + datagrams per second will cause a Counter32 to + wrap in just over an hour." + ::= { udpMIBCompliances 2 } + +udpMIBCompliance MODULE-COMPLIANCE + STATUS deprecated + DESCRIPTION + "The compliance statement for IPv4-only systems that + implement UDP. For IP version independence, this + compliance statement is deprecated in favor of + udpMIBCompliance2. However, agents are still + encouraged to implement these objects in order to + interoperate with the deployed base of managers." + MODULE -- this module + MANDATORY-GROUPS { udpGroup } + ::= { udpMIBCompliances 1 } + +-- units of conformance + +udpGroup OBJECT-GROUP + OBJECTS { udpInDatagrams, udpNoPorts, + udpInErrors, udpOutDatagrams, + udpLocalAddress, udpLocalPort } + + + + STATUS deprecated + DESCRIPTION + "The deprecated group of objects providing for + management of UDP over IPv4." + ::= { udpMIBGroups 1 } + +udpBaseGroup OBJECT-GROUP + OBJECTS { udpInDatagrams, udpNoPorts, udpInErrors, + udpOutDatagrams } + STATUS current + DESCRIPTION + "The group of objects providing for counters of UDP + statistics." + ::= { udpMIBGroups 2 } + +udpHCGroup OBJECT-GROUP + OBJECTS { udpHCInDatagrams, udpHCOutDatagrams } + STATUS current + DESCRIPTION + "The group of objects providing for counters of high + speed UDP implementations." + ::= { udpMIBGroups 3 } + +udpEndpointGroup OBJECT-GROUP + OBJECTS { udpEndpointProcess } + STATUS current + DESCRIPTION + "The group of objects providing for the IP version + independent management of UDP 'endpoints'." + ::= { udpMIBGroups 4 } + +END diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/DisplayHint.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/DisplayHint.cs new file mode 100644 index 00000000..831f1177 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/DisplayHint.cs @@ -0,0 +1,84 @@ +using System; +using System.Collections.Generic; +using System.Collections; + +namespace Lextm.SharpSnmpLib.Mib +{ + public class DisplayHint + { + private enum NumType { + dec, + hex, + oct, + bin, + str + } + + private string _str; + private NumType _type; + private int _decimalPoints = 0; + + public DisplayHint(string str) + { + _str = str; + if (str.StartsWith("d")) + { + _type = NumType.dec; + if (str.StartsWith("d-")) + { + _decimalPoints = Convert.ToInt32(str.Substring(2)); + } + } + else if (str.StartsWith("o")) + { + _type = NumType.oct; + } + else if (str.StartsWith("h")) + { + _type = NumType.hex; + } + else if (str.StartsWith("b")) + { + _type = NumType.bin; + } + else + { + _type = NumType.str; + foreach (char c in str) + { + + } + } + + } + + public override string ToString() + { + return _str; + } + + internal object Decode(int i) + { + switch (_type) + { + case NumType.dec: + if (_decimalPoints == 0) + { + return i; + } + else + { + return i / Math.Pow(10.0, _decimalPoints); + } + case NumType.hex: + return System.Convert.ToString(i, 16); + case NumType.oct: + return System.Convert.ToString(i, 8); + case NumType.bin: + return System.Convert.ToString(i, 2); + default: + return null; + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/AgentCapabilities.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/AgentCapabilities.cs new file mode 100644 index 00000000..2f79cce5 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/AgentCapabilities.cs @@ -0,0 +1,29 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/31 + * Time: 13:18 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + /// + /// The AGENT-CAPABILITIES construct is used to specify implementation characteristics of an SNMP agent sub-system with respect to object types and events. + /// + public sealed class AgentCapabilities : EntityBase + { + /// + /// Creates an instance. + /// + /// + /// + /// + public AgentCapabilities(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + : base(module, preAssignSymbols, symbols) + { + } + + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/EntityBase.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/EntityBase.cs new file mode 100644 index 00000000..6da9b18c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/EntityBase.cs @@ -0,0 +1,46 @@ +using System; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + public abstract class EntityBase: IEntity + { + private readonly IModule _module; + private string _parent; + private readonly uint _value; + private readonly string _name; + + public EntityBase(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + { + _module = module; + _name = preAssignSymbols[0].ToString(); + + Lexer.ParseOidValue(symbols, out _parent, out _value); + } + + public IModule Module + { + get { return _module; } + } + + public string Parent + { + get { return _parent; } + set { _parent = value; } + } + + public uint Value + { + get { return _value; } + } + + public string Name + { + get { return _name; } + } + + public virtual string Description + { + get { return string.Empty; } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/IEntity.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/IEntity.cs new file mode 100644 index 00000000..7360a472 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/IEntity.cs @@ -0,0 +1,62 @@ +// Entity interface. +// Copyright (C) 2008-2010 Malcolm Crowe, Lex Li, and other contributors. +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License, or (at your option) any later version. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/19 + * Time: 20:10 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + /// + /// Basic interface for all elements building up the MIB tree, thus having an OID as value. + /// + public interface IEntity : IDeclaration + { + /// + /// Parent name. + /// + string Parent + { + get; + set; + } + + /// + /// Value. + /// + uint Value + { + get; + } + + /// + /// Gets the description. + /// + /// The description. + string Description + { + get; + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ModuleCompliance.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ModuleCompliance.cs new file mode 100644 index 00000000..008c3545 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ModuleCompliance.cs @@ -0,0 +1,23 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/21 + * Time: 19:35 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + /// + /// Description of ModuleComplianceNode. + /// + public sealed class ModuleCompliance : EntityBase + { + public ModuleCompliance(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + : base(module, preAssignSymbols, symbols) + { + } + + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ModuleIdentity.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ModuleIdentity.cs new file mode 100644 index 00000000..6de28ce6 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ModuleIdentity.cs @@ -0,0 +1,10 @@ +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + public sealed class ModuleIdentity : EntityBase + { + public ModuleIdentity(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + : base(module, preAssignSymbols, symbols) + { + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/NotificationGroup.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/NotificationGroup.cs new file mode 100644 index 00000000..27d3e4ce --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/NotificationGroup.cs @@ -0,0 +1,22 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/21 + * Time: 19:34 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + /// + /// Description of NotificationGroupNode. + /// + public sealed class NotificationGroup : EntityBase + { + public NotificationGroup(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + : base(module, preAssignSymbols, symbols) + { + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/NotificationType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/NotificationType.cs new file mode 100644 index 00000000..7386e217 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/NotificationType.cs @@ -0,0 +1,11 @@ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + public sealed class NotificationType : EntityBase + { + public NotificationType(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + : base(module, preAssignSymbols, symbols) + { + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectGroup.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectGroup.cs new file mode 100644 index 00000000..d846cdbb --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectGroup.cs @@ -0,0 +1,22 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/21 + * Time: 19:27 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + /// + /// Description of ObjectGroupNode. + /// + public sealed class ObjectGroup : EntityBase + { + public ObjectGroup(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + : base(module, preAssignSymbols, symbols) + { + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectIdentity.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectIdentity.cs new file mode 100644 index 00000000..9c1e0848 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectIdentity.cs @@ -0,0 +1,21 @@ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + /// + /// Object identifier node. + /// + public sealed class ObjectIdentity : EntityBase + { + + /// + /// Creates a . + /// + /// Module name + /// Header + /// Lexer + public ObjectIdentity(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + : base(module, preAssignSymbols, symbols) + { + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectType.cs new file mode 100644 index 00000000..3a8b567a --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/ObjectType.cs @@ -0,0 +1,336 @@ +using System; +using System.Collections.Generic; +using Lextm.SharpSnmpLib.Mib.Elements.Types; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + public sealed class ObjectType : EntityBase, ITypeReferrer + { + private ITypeAssignment _syntax; + private string _units; + private MaxAccess _access; + private Status _status; + private string _description; + private string _reference; + private IList _indices; + private string _augments; + private string _defVal; + + public ObjectType(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + : base(module, preAssignSymbols, symbols) + { + ParseProperties(preAssignSymbols); + } + + private void ParseProperties(SymbolList header) + { + ISymbolEnumerator headerSymbols = header.GetSymbolEnumerator(); + Symbol temp = headerSymbols.NextNonEOLSymbol(); + + // Skip name + temp = headerSymbols.NextNonEOLSymbol(); + temp.Expect(Symbol.ObjectType); + + _syntax = ParseSyntax (Module, headerSymbols); + _units = ParseUnits (headerSymbols); + _access = ParseAccess (headerSymbols); + _status = ParseStatus (headerSymbols); + _description = ParseDescription (headerSymbols); + _reference = ParseReference (headerSymbols); + _indices = ParseIndices (headerSymbols); + _augments = ParseAugments (headerSymbols); + _defVal = ParseDefVal (headerSymbols); + } + + private static string ParseAugments(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.Augments) + { + string augment = null; + + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.OpenBracket); + + current = symbols.NextNonEOLSymbol(); + augment = current.ToString(); + + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.CloseBracket); + + return augment; + } + else if (current != null) + { + symbols.PutBack(current); + } + + return null; + } + + private static string ParseDefVal(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.DefVal) + { + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.OpenBracket); + + string defVal = null; + current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.OpenBracket) + { + int depth = 1; + // TODO: decode this. + while (depth > 0) + { + current = symbols.NextNonEOLSymbol(); + if (current == Symbol.OpenBracket) + { + depth++; + } + else if (current == Symbol.CloseBracket) + { + depth--; + } + } + } + else + { + defVal = current.ToString(); + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.CloseBracket); + } + + return defVal; + } + else if (current != null) + { + symbols.PutBack(current); + } + + return null; + } + + private static IList ParseIndices(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.Index) + { + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.OpenBracket); + + List indices = new List(); + + while (current != Symbol.CloseBracket) + { + current = symbols.NextNonEOLSymbol(); + + bool lastIndex = false; + if (current == Symbol.Implied) + { + current = symbols.NextNonEOLSymbol(); + lastIndex = true; // 'IMPLIED' may only be used for last index + } + + current.Assert((current != Symbol.Comma) && (current != Symbol.CloseBracket), "Expected index name but found symbol!"); + indices.Add(current.ToString()); + + current = symbols.NextNonEOLSymbol(); + if (lastIndex) + { + current.Expect(Symbol.CloseBracket); + } + else + { + current.Expect(Symbol.Comma, Symbol.CloseBracket); + } + } + + return indices; + } + else if (current != null) + { + symbols.PutBack(current); + } + + return null; + } + + private static string ParseReference(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.Reference) + { + return symbols.NextNonEOLSymbol().ToString(); + } + else if (current != null) + { + symbols.PutBack(current); + } + + return null; + } + + private static string ParseDescription(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.Description) + { + return symbols.NextNonEOLSymbol().ToString().Trim(new char[] { '"' }); + } + else if (current != null) + { + symbols.PutBack(current); + } + + return null; + } + + private static Status ParseStatus(ISymbolEnumerator symbols) + { + Status status = Status.obsolete; + + Symbol current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.Status); + + current = symbols.NextNonEOLSymbol(); + try + { + status = (Status)Enum.Parse(typeof(Status), current.ToString()); + } + catch (ArgumentException) + { + current.Assert(false, "Invalid/Unknown status"); + } + + return status; + } + + private static MaxAccess ParseAccess(ISymbolEnumerator symbols) + { + MaxAccess access = MaxAccess.notAccessible; + + Symbol current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.MaxAccess, Symbol.Access); + + current = symbols.NextNonEOLSymbol(); + switch (current.ToString()) + { + case "not-accessible": + access = MaxAccess.notAccessible; + break; + case "accessible-for-notify": + access = MaxAccess.accessibleForNotify; + break; + case "read-only": + access = MaxAccess.readOnly; + break; + case "read-write": + access = MaxAccess.readWrite; + break; + case "read-create": + access = MaxAccess.readCreate; + break; + case "write-only": + access = MaxAccess.readWrite; + break; + default: + current.Assert(false, "Invalid/Unknown access"); + break; + } + + return access; + } + + private static string ParseUnits(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.Units) + { + return symbols.NextNonEOLSymbol().ToString(); + } + else if (current != null) + { + symbols.PutBack(current); + } + + return null; + } + + private static ITypeAssignment ParseSyntax(IModule module, ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.Syntax); + + return Lexer.ParseBasicTypeDef(module, String.Empty, symbols, isMacroSyntax: true); + } + + private static bool IsProperty(Symbol sym) + { + string s = sym.ToString(); + return s == "SYNTAX" || s == "MAX-ACCESS" || s == "STATUS" || s == "DESCRIPTION"; + } + + public ITypeAssignment Syntax + { + get { return _syntax; } + internal set { _syntax = value; } + } + + public override string Description + { + get { return _description; } + } + + public MaxAccess Access + { + get { return _access; } + } + + public IList Indices + { + get { return _indices; } + } + + public string Augments + { + get { return _augments; } + } + + #region ITypeReferrer Member + + public ITypeAssignment ReferredType + { + get { return _syntax; } + set { _syntax = value; } + } + + public ITypeAssignment BaseType + { + get + { + ITypeReferrer tr = this; + ITypeAssignment result = null; + + while ((tr != null) && (tr.ReferredType != null)) + { + result = tr.ReferredType; + tr = tr.ReferredType as ITypeReferrer; + } + + return result; + } + } + + #endregion + + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/OidValueAssignment.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/OidValueAssignment.cs new file mode 100644 index 00000000..3c659407 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Entities/OidValueAssignment.cs @@ -0,0 +1,30 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/17 + * Time: 20:49 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Entities +{ + /// + /// Object identifier node. + /// + public sealed class OidValueAssignment : EntityBase + { + /// + /// Creates a . + /// + /// Module + /// Name + /// Lexer + public OidValueAssignment(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + : base(module, preAssignSymbols, symbols) + { + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Exports.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Exports.cs new file mode 100644 index 00000000..c1e66e32 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Exports.cs @@ -0,0 +1,56 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/6/7 + * Time: 17:34 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib.Elements +{ + /// + /// Description of Exports. + /// + public sealed class Exports: IElement + { + private IModule _module; + private readonly IList _types = new List(); + + public Exports(IModule module, ISymbolEnumerator s) + { + _module = module; + + Symbol previous = null; + Symbol current; + do + { + current = s.NextSymbol(); + + if (current == Symbol.EOL) + { + continue; + } + else if (((current == Symbol.Comma) || (current == Symbol.Semicolon)) && (previous != null)) + { + previous.AssertIsValidIdentifier(); + _types.Add(previous.ToString()); + } + + previous = current; + } + while (current != Symbol.Semicolon); + } + + #region IElement Member + + public IModule Module + { + get { return _module; } + } + + #endregion + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/IDeclaration.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/IDeclaration.cs new file mode 100644 index 00000000..0958ac61 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/IDeclaration.cs @@ -0,0 +1,18 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Text; + +namespace Lextm.SharpSnmpLib.Mib.Elements +{ + public interface IDeclaration: IElement + { + /// + /// Name. + /// + string Name + { + get; + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/IElement.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/IElement.cs new file mode 100644 index 00000000..e2db7fd3 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/IElement.cs @@ -0,0 +1,35 @@ +// Construct interface. +// Copyright (C) 2008-2010 Malcolm Crowe, Lex Li, and other contributors. +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License, or (at your option) any later version. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + +namespace Lextm.SharpSnmpLib.Mib.Elements +{ + /// + /// Construct interface. + /// + [System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Design", "CA1040:AvoidEmptyInterfaces")] + public interface IElement + { + /// + /// Containing module. + /// + IModule Module + { + get; + } + + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/ITypeReferrer.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/ITypeReferrer.cs new file mode 100644 index 00000000..f0f57056 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/ITypeReferrer.cs @@ -0,0 +1,10 @@ +using Lextm.SharpSnmpLib.Mib.Elements.Types; + +namespace Lextm.SharpSnmpLib.Mib.Elements +{ + public interface ITypeReferrer + { + ITypeAssignment ReferredType { get; set; } + ITypeAssignment BaseType { get; } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Imports.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Imports.cs new file mode 100644 index 00000000..3a4ec6ec --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Imports.cs @@ -0,0 +1,81 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/31 + * Time: 12:07 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib.Elements +{ + /// + /// The IMPORTS construct is used to specify items used in the current MIB module which are defined in another MIB module or ASN.1 module. + /// + public sealed class Imports : List, IElement + { + private IModule _module; + + /// + /// Creates an instance. + /// + /// + public Imports(IModule module, ISymbolEnumerator symbols) + { + _module = module; + + Symbol current; + while ((current = symbols.NextSymbol()) != Symbol.Semicolon) + { + if (current == Symbol.EOL) + { + continue; + } + + ImportsFrom imports = new ImportsFrom(current, symbols); + + this.Add(imports); + } + } + + public IList Dependents + { + get + { + List result = new List(); + + foreach (ImportsFrom import in this) + { + result.Add(import.Module); + } + + return result; + } + } + + public ImportsFrom GetImportFromType(string type) + { + foreach (ImportsFrom import in this) + { + if (import.Types.Contains(type)) + { + return import; + } + } + + return null; + } + + #region IElement Member + + public IModule Module + { + get { return _module; } + } + + #endregion + + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/ImportsFrom.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/ImportsFrom.cs new file mode 100644 index 00000000..cd5154bd --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/ImportsFrom.cs @@ -0,0 +1,60 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/31 + * Time: 12:07 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib.Elements +{ + public sealed class ImportsFrom + { + private readonly string _module; + private readonly List _types = new List(); + + public ImportsFrom(Symbol last, ISymbolEnumerator symbols) + { + Symbol previous = last; + Symbol current; + while ((current = symbols.NextSymbol()) != Symbol.From) + { + if (current == Symbol.EOL) + { + continue; + } + + if (current == Symbol.Comma) + { + previous.AssertIsValidIdentifier(); + _types.Add(previous.ToString()); + } + + previous = current; + } + + previous.AssertIsValidIdentifier(); + _types.Add(previous.ToString()); + + _module = symbols.NextSymbol().ToString().ToUpperInvariant(); // module names are uppercase + } + + public string Module + { + get { return _module; } + } + + public IList Types + { + get { return _types; } + } + + public override string ToString() + { + return string.Join(", ", _types.ToArray()) + " FROM " + _module; + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/TrapType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/TrapType.cs new file mode 100644 index 00000000..9c5ca457 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/TrapType.cs @@ -0,0 +1,48 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/31 + * Time: 12:20 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +namespace Lextm.SharpSnmpLib.Mib.Elements +{ + public sealed class TrapType : IDeclaration + { + private readonly IModule _module; + private readonly string _name; + private readonly int _value; + + public TrapType(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + { + _module = module; + _name = preAssignSymbols[0].ToString(); + + Symbol valueSymbol = symbols.NextNonEOLSymbol(); + + bool succeeded = int.TryParse(valueSymbol.ToString(), out _value); + valueSymbol.Assert(succeeded, "not a decimal"); + } + + public int Value + { + get { return _value; } + } + + #region IDeclaration Member + + public IModule Module + { + get { return _module; } + } + + public string Name + { + get { return _name; } + } + + #endregion + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/BaseType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/BaseType.cs new file mode 100644 index 00000000..a4412812 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/BaseType.cs @@ -0,0 +1,54 @@ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + public abstract class BaseType : ITypeAssignment + { + private IModule _module; + private string _name; + + protected BaseType(IModule module, string name) + { + _module = module; + _name = name; + } + + public virtual IModule Module + { + // differentiate between: + // FddiTimeNano ::= INTEGER (0..2147483647) + // which is an IntegerType which appears under Types in a MibModule and therefore has a name and module + // and + // SYNTAX INTEGER (0..2147483647) + // which is also an IntegerType but not defined as a separate type and therefore has NO name and NO module + get + { + if (!string.IsNullOrEmpty(_name)) + { + return _module; + } + else + { + return null; + } + } + protected set { _module = value; } + } + + public virtual string Name + { + get + { + if (!string.IsNullOrEmpty(_name)) + { + return _name; + } + else + { + return "{ Implicit Base Type }"; + } + } + protected set { _name = value; } + } + + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/BitsType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/BitsType.cs new file mode 100644 index 00000000..a64c8dbe --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/BitsType.cs @@ -0,0 +1,26 @@ +using System; +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + public class BitsType : BaseType + { + private ValueMap _map; + + public BitsType(IModule module, string name, ISymbolEnumerator symbols) + : base(module, name) + { + _map = Lexer.DecodeEnumerations(symbols); + } + + public ValueMap Map + { + get { return _map; } + } + + public string this[int value] + { + get { return _map[value]; } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Choice.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Choice.cs new file mode 100644 index 00000000..c66d1f3f --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Choice.cs @@ -0,0 +1,35 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/31 + * Time: 11:39 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + /// + /// The CHOICE type represents a list of alternatives.. + /// + public sealed class Choice : BaseType + { + /// + /// Creates a instance. + /// + /// + /// + /// + public Choice(IModule module, string name, ISymbolEnumerator symbols) + : base(module, name) + { + while (symbols.NextNonEOLSymbol() != Symbol.OpenBracket) + { + } + + while (symbols.NextNonEOLSymbol() != Symbol.CloseBracket) + { + } + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/ITypeAssignment.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/ITypeAssignment.cs new file mode 100644 index 00000000..e962f9df --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/ITypeAssignment.cs @@ -0,0 +1,6 @@ +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + public interface ITypeAssignment : IDeclaration + { + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/IntegerType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/IntegerType.cs new file mode 100644 index 00000000..4841ad51 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/IntegerType.cs @@ -0,0 +1,117 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/7/25 + * Time: 20:41 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System; +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + /// + /// The INTEGER type represents a list of alternatives, or a range of numbers.. + /// Includes Integer32 as it's indistinguishable from INTEGER. + /// + /** + * As this type is used for Integer32 as well as INTEGER it incorrectly + * allows enumeration sub-typing of Integer32. This is ok as currently we + * do not care about detecting incorrect MIBs and this doesn't block the + * decoding of correct MIBs. + */ + public sealed class IntegerType : BaseType + { + public enum Types + { + Integer, + Integer32 + } + + private Types _type; + private bool _isEnumeration; + private ValueMap _map; + private ValueRanges _ranges; + + /// + /// Creates an instance. + /// + /// + /// + /// + public IntegerType(IModule module, string name, Symbol type, ISymbolEnumerator symbols) + : base (module, name) + { + Types? t = GetExactType(type); + type.Assert(t.HasValue, "Unknown symbol for unsigned type!"); + _type = t.Value; + + _isEnumeration = false; + + Symbol current = symbols.NextNonEOLSymbol(); + if (current == Symbol.OpenBracket) + { + _isEnumeration = true; + symbols.PutBack(current); + _map = Lexer.DecodeEnumerations(symbols); + } + else if (current == Symbol.OpenParentheses) + { + symbols.PutBack(current); + _ranges = Lexer.DecodeRanges(symbols); + current.Assert(!_ranges.IsSizeDeclaration, "SIZE keyword is not allowed for ranges of integer types!"); + } + else + { + symbols.PutBack(current); + } + } + + public Types Type + { + get { return _type; } + } + + public ValueRanges Ranges + { + get { return _ranges; } + } + + public bool IsEnumeration + { + get + { + return _isEnumeration; + } + } + + public ValueMap Enumeration + { + get { return _isEnumeration ? _map : null; } + } + + internal static Types? GetExactType(Symbol symbol) + { + if (symbol == Symbol.Integer) + { + // represents the ASN.1 builtin INTEGER type: + // may be represent any arbitrary (signed/unsigned) integer (in theory may have any size) + return Types.Integer; + } + else if (symbol == Symbol.Integer32) + { + // Integer32 ::= INTEGER (-2147483648..2147483647) // from SNMPv2-SMI + return Types.Integer32; + } + + return null; + } + + internal static bool IsIntegerType(Symbol symbol) + { + return GetExactType(symbol).HasValue; + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/IpAddressType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/IpAddressType.cs new file mode 100644 index 00000000..84d78d66 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/IpAddressType.cs @@ -0,0 +1,21 @@ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + public class IpAddressType : OctetStringType + { + public IpAddressType(IModule module, string name, ISymbolEnumerator symbols) + : base(module, name, symbols) + { + if (this.Size.Count != 0) + { + throw new MibException("Size definition not allowed for IpAddress type!"); + } + + // IpAddress type is defined as: + // IpAddress ::= + // [APPLICATION 0] + // IMPLICIT OCTET STRING (SIZE (4)) + this.Size.Add(new ValueRange(4, null)); + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Macro.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Macro.cs new file mode 100644 index 00000000..9f911ac9 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Macro.cs @@ -0,0 +1,34 @@ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + public sealed class Macro : ITypeAssignment + { + private IModule _module; + private string _name; + + [System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Performance", "CA1804:RemoveUnusedLocals", MessageId = "temp")] + public Macro(IModule module, SymbolList preAssignSymbols, ISymbolEnumerator symbols) + { + _module = module; + _name = preAssignSymbols[0].ToString(); + + while (symbols.NextNonEOLSymbol() != Symbol.Begin) + { + } + + while (symbols.NextNonEOLSymbol() != Symbol.End) + { + } + } + + public IModule Module + { + get { return _module; } + } + + public string Name + { + get { return _name; } + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/ObjectIdentifierType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/ObjectIdentifierType.cs new file mode 100644 index 00000000..cacd415a --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/ObjectIdentifierType.cs @@ -0,0 +1,11 @@ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + public class ObjectIdentifierType : BaseType + { + public ObjectIdentifierType(IModule module, string name, ISymbolEnumerator symbols) + : base(module, name) + { + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/OctetStringType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/OctetStringType.cs new file mode 100644 index 00000000..f6453ce8 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/OctetStringType.cs @@ -0,0 +1,31 @@ +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + public class OctetStringType : BaseType + { + private ValueRanges _size; + + public OctetStringType(IModule module, string name, ISymbolEnumerator symbols) + : base(module, name) + { + Symbol current = symbols.NextNonEOLSymbol(); + if (current == Symbol.OpenParentheses) + { + symbols.PutBack(current); + _size = Lexer.DecodeRanges(symbols); + current.Assert(_size.IsSizeDeclaration, "SIZE keyword is required for ranges of octet string!"); + } + else + { + symbols.PutBack(current); + _size = new ValueRanges(isSizeDecl: true); + } + } + + public ValueRanges Size + { + get { return _size; } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/OpaqueType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/OpaqueType.cs new file mode 100644 index 00000000..5a7eda33 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/OpaqueType.cs @@ -0,0 +1,11 @@ + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + public class OpaqueType : OctetStringType + { + public OpaqueType(IModule module, string name, ISymbolEnumerator symbols) + : base(module, name, symbols) + { + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Sequence.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Sequence.cs new file mode 100644 index 00000000..0162de30 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/Sequence.cs @@ -0,0 +1,46 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/21 + * Time: 19:43 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + /// + /// The SEQUENCE type represents a set of specified types. This is roughtly analogous to a struct in C. + /// + public sealed class Sequence : BaseType + { + /// + /// Creates a instance. + /// + /// The module. + /// The name. + /// The enumerator. + public Sequence(IModule module, string name, ISymbolEnumerator symbols) + : base(module, name) + { + // parse between ( ) + Symbol temp = symbols.NextNonEOLSymbol(); + int bracketSection = 0; + temp.Expect(Symbol.OpenBracket); + bracketSection++; + while (bracketSection > 0) + { + temp = symbols.NextNonEOLSymbol(); + if (temp == Symbol.OpenBracket) + { + bracketSection++; + } + else if (temp == Symbol.CloseBracket) + { + bracketSection--; + } + } + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/SequenceOf.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/SequenceOf.cs new file mode 100644 index 00000000..4160ca40 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/SequenceOf.cs @@ -0,0 +1,23 @@ +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + /// + /// The SEQUENCE OF type represents a list of data sets.. + /// + public sealed class SequenceOf : BaseType + { + private string _type; + + public SequenceOf(IModule module, string name, ISymbolEnumerator sym) + : base(module, name) + { + _type = sym.NextNonEOLSymbol().ToString(); + } + + public string Type + { + get { return _type; } + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/TextualConvention.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/TextualConvention.cs new file mode 100644 index 00000000..ab477315 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/TextualConvention.cs @@ -0,0 +1,238 @@ +using System; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + public sealed class TextualConvention : ITypeAssignment, ITypeReferrer + { + private IModule _module; + private string _name; + private DisplayHint _displayHint; + private Status _status; + private string _description; + private string _reference; + private ITypeAssignment _syntax; + + [System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Usage", "CA1801:ReviewUnusedParameters", MessageId = "module")] + public TextualConvention(IModule module, string name, ISymbolEnumerator symbols) + { + _module = module; + _name = name; + + _displayHint = ParseDisplayHint(symbols); + _status = ParseStatus(symbols); + _description = ParseDescription(symbols); + _reference = ParseReference(symbols); + _syntax = ParseSyntax(module, symbols); + } + + private static DisplayHint ParseDisplayHint(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.DisplayHint) + { + return new DisplayHint(symbols.NextNonEOLSymbol().ToString().Trim(new char[] { '"' })); + } + + symbols.PutBack(current); + return null; + } + + private static Status ParseStatus(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.Status); + + try + { + return (Status)Enum.Parse(typeof(Status), symbols.NextNonEOLSymbol().ToString()); + } + catch (ArgumentException) + { + current.Assert(false, "Invalid/Unknown status"); + } + + return Status.current; + } + + private static string ParseDescription(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.Description); + + return symbols.NextNonEOLSymbol().ToString().Trim(new char[] { '"' }); + } + + private static string ParseReference(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.Reference) + { + string reference = symbols.NextNonEOLSymbol().ToString(); + if ((reference.Length >= 2) && reference.StartsWith("\"") && reference.EndsWith("\"")) + { + return reference.Substring(1, reference.Length-2); + } + + return reference; + } + + symbols.PutBack(current); + return null; + } + + private static ITypeAssignment ParseSyntax(IModule module, ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.Syntax); + + /* + * RFC2579 definition: + * Syntax ::= -- Must be one of the following: + * -- a base type (or its refinement), or + * -- a BITS pseudo-type + * type + * | "BITS" "{" NamedBits "}" + * + * From section 3.5: + * The data structure must be one of the alternatives defined + * in the ObjectSyntax CHOICE or the BITS construct. Note + * that this means that the SYNTAX clause of a Textual + * Convention can not refer to a previously defined Textual + * Convention. + * + * The SYNTAX clause of a TEXTUAL CONVENTION macro may be + * sub-typed in the same way as the SYNTAX clause of an + * OBJECT-TYPE macro. + * + * Therefore the possible values are (grouped by underlying type): + * INTEGER, Integer32 + * OCTET STRING, Opaque + * OBJECT IDENTIFIER + * IpAddress + * Counter64 + * Unsigned32, Counter32, Gauge32, TimeTicks + * BITS + * With appropriate sub-typing. + */ + + return Lexer.ParseBasicTypeDef(module, String.Empty, symbols, isMacroSyntax: true); + } + + public IModule Module + { + get { return _module; } + } + + public string Name + { + get { return _name; } + } + + public string DisplayHint + { + get { return _displayHint == null ? null : _displayHint.ToString(); } + } + + public Status Status + { + get { return _status; } + } + + public string Description + { + get { return _description; } + } + + public string Reference + { + get { return _reference; } + } + + public ITypeAssignment Syntax + { + get { return _syntax; } + } + + //internal object Decode(Variable v) + //{ + // if (_syntax is IntegerType) + // { + // Integer32 i = v.Data as Integer32; + // if (i == null || (_syntax as IntegerType).IsEnumeration) + // { + // return null; + // } + // else if (_displayHint != null) + // { + // return _displayHint.Decode(i.ToInt32()); + // } + // else + // { + // return i.ToInt32(); + // } + // } + // else if (_syntax is UnsignedType) + // { + // Integer32 i = v.Data as Integer32; + // if (i == null) + // { + // return null; + // } + // else if (_displayHint != null) + // { + // return _displayHint.Decode(i.ToInt32()); + // } + // else + // { + // return i.ToInt32(); + // } + // } + // else if (_syntax is OctetStringType) + // { + // OctetString o = v.Data as OctetString; + // if (o == null) + // { + // return null; + // } + // else + // { + // // TODO: Follow the format specifier for octet strings. + // return null; + // } + // } + // else + // { + // return null; + // } + //} + + #region ITypeReferrer Member + + public ITypeAssignment ReferredType + { + get { return _syntax; } + set { _syntax = value; } + } + + public ITypeAssignment BaseType + { + get + { + ITypeReferrer tr = this; + ITypeAssignment result = this; + + while ((tr != null) && (tr.ReferredType != null)) + { + result = tr.ReferredType; + tr = tr.ReferredType as ITypeReferrer; + } + + return result; + } + } + + #endregion + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/TypeAssignment.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/TypeAssignment.cs new file mode 100644 index 00000000..b074ef62 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/TypeAssignment.cs @@ -0,0 +1,147 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/18 + * Time: 13:24 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ +using System; +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + /* Please be aware of the following possible constructs: + * + * isnsRegEntityIndex OBJECT-TYPE + * SYNTAX IsnsEntityIndexIdOrZero + * ( 1 .. 4294967295 ) + * MAX-ACCESS not-accessible + * + * + */ + + /// + /// + public sealed class TypeAssignment : ITypeAssignment + { + private IModule _module; + private string _name; + private string _type; + private ValueRanges _ranges; + private ValueMap _map; + + /// + /// Creates an . + /// + /// The module. + /// The name. + /// The type. + /// The symbols. + /// if set to true indicates that the syntax clause of a macro is parsed (e.g. OBJECT-TYPE, TEXTUAL-CONVENTION). + public TypeAssignment(IModule module, string name, Symbol type, ISymbolEnumerator symbols, bool isMacroSyntax) + { + _module = module; + _name = name; + + SymbolList typeSymbols = new SymbolList(); + typeSymbols.Add(type); + + Symbol current = symbols.NextSymbol(); + while (current != Symbol.EOL) + { + if (current == Symbol.OpenParentheses) + { + // parse range of unknown type + symbols.PutBack(current); + _ranges = Lexer.DecodeRanges(symbols); + break; + } + else if (current == Symbol.OpenBracket) + { + symbols.PutBack(current); + _map = Lexer.DecodeEnumerations(symbols); + break; + } + + typeSymbols.Add(current); + current = symbols.NextSymbol(); + } + + _type = typeSymbols.Join(" "); + + if ((_ranges == null) && (_map == null)) + { + current = symbols.NextNonEOLSymbol(); + if (current == Symbol.OpenParentheses) + { + // parse range of unknown type + symbols.PutBack(current); + _ranges = Lexer.DecodeRanges(symbols); + } + else if (current == Symbol.OpenBracket) + { + symbols.PutBack(current); + _map = Lexer.DecodeEnumerations(symbols); + } + else if (current != null) + { + symbols.PutBack(current); + } + } + + if (isMacroSyntax) + { + // inside a macro the syntax is limited to one line, except there are brackets used for ranges/enums + return; + } + + // outside macro Syntax clause we wait for two consecutive linebreaks with a following valid identifier as end condition + Symbol previous = current; + Symbol veryPrevious = null; + + while ((current = symbols.NextSymbol()) != null) + { + if ((veryPrevious == Symbol.EOL) && (previous == Symbol.EOL) && current.IsValidIdentifier()) + { + symbols.PutBack(current); + return; + } + + veryPrevious = previous; + previous = current; + } + + previous.Assert(false, "end of file reached"); + } + + public string Type + { + get { return _type; } + } + + public ValueRanges Ranges + { + get { return _ranges; } + } + + public IDictionary Map + { + get { return _map; } + } + + #region ITypeAssignment Member + + public IModule Module + { + get { return _module; } + } + + public string Name + { + get { return _name; } + } + + #endregion + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/UnsignedType.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/UnsignedType.cs new file mode 100644 index 00000000..4866fc90 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Elements/Types/UnsignedType.cs @@ -0,0 +1,103 @@ +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib.Elements.Types +{ + /** + * As this type is used for Counter32 and TimeTicks as well as Unsigned32 + * and Gauge32 it incorrectly allows range restrictions of Counter32 and + * TimeTicks. This is ok as currently we do not care about detecting + * incorrect MIBs and this doesn't block the decoding of correct MIBs. + */ + public class UnsignedType : BaseType + { + public enum Types + { + Unsigned32, + Gauge32, + Counter32, + TimeTicks, + Counter64, + } + + private Types _type; + private ValueRanges _ranges; + + public UnsignedType(IModule module, string name, Symbol type, ISymbolEnumerator symbols) + : base(module, name) + { + Types? t = GetExactType(type); + type.Assert(t.HasValue, "Unknown symbol for unsigned type!"); + _type = t.Value; + + Symbol current = symbols.NextNonEOLSymbol(); + if (current == Symbol.OpenParentheses) + { + current.Assert((_type != Types.Counter64), "Ranges are not supported for Counter64 type!"); // our internal struct can only hold int64 values + + symbols.PutBack(current); + _ranges = Lexer.DecodeRanges(symbols); + current.Assert(!_ranges.IsSizeDeclaration, "SIZE keyword is not allowed for ranges of unsigned types!"); + } + else + { + symbols.PutBack(current); + } + } + + public Types Type + { + get { return _type; } + } + + public ValueRanges Ranges + { + get { return _ranges; } + } + + internal static Types? GetExactType(Symbol symbol) + { + if (symbol == Symbol.Unsigned32) + { + // [APPLICATION 2] IMPLICIT INTEGER (0..4294967295) // from SNMPv2-SMI + return Types.Unsigned32; + } + else if (symbol == Symbol.Gauge32) + { + // [APPLICATION 2] IMPLICIT INTEGER (0..4294967295) // from SNMPv2-SMI + return Types.Gauge32; + } + else if (symbol == Symbol.Counter32) + { + // [APPLICATION 1] IMPLICIT INTEGER (0..4294967295) // from SNMPv2-SMI + return Types.Counter32; + } + else if (symbol == Symbol.TimeTicks) + { + // [APPLICATION 3] IMPLICIT INTEGER (0..4294967295) // from SNMPv2-SMI + RFC1155-SMI + return Types.TimeTicks; + } + else if (symbol == Symbol.Gauge) + { + // [APPLICATION 2] IMPLICIT INTEGER (0..4294967295) // from RFC1155-SMI + return Types.Gauge32; + } + else if (symbol == Symbol.Counter) + { + // [APPLICATION 1] IMPLICIT INTEGER (0..4294967295) // from RFC1155-SMI + return Types.Counter32; + } + else if (symbol == Symbol.Counter64) + { + // [APPLICATION 6] IMPLICIT INTEGER (0..18446744073709551615) // from SNMPv2-SMI + return Types.Counter64; + } + + return null; + } + + internal static bool IsUnsignedType(Symbol symbol) + { + return GetExactType(symbol).HasValue; + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/IModule.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/IModule.cs new file mode 100644 index 00000000..d41ab129 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/IModule.cs @@ -0,0 +1,81 @@ +// Module interface. +// Copyright (C) 2008-2010 Malcolm Crowe, Lex Li, and other contributors. +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License, or (at your option) any later version. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + +/* + * Created by SharpDevelop. + * User: lextm + * Date: 5/1/2009 + * Time: 10:40 AM + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ +using System.Collections.Generic; +using Lextm.SharpSnmpLib.Mib.Elements.Entities; +using Lextm.SharpSnmpLib.Mib.Elements.Types; +using Lextm.SharpSnmpLib.Mib.Elements; + +namespace Lextm.SharpSnmpLib.Mib +{ + /// + /// MIB Module interface. + /// + public interface IModule + { + /// + /// Module name. + /// + string Name + { + get; + } + + Exports Exports + { + get; + } + + Imports Imports + { + get; + } + + /// + /// Entities + Types + all other elements implementing IDeclaration + /// + IList Declarations + { + get; + } + + /// + /// Entities. + /// + IList Entities + { + get; + } + + /// + /// Known types. + /// + IList Types + { + get; + } + + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ISymbolEnumerator.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ISymbolEnumerator.cs new file mode 100644 index 00000000..e9dd5920 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ISymbolEnumerator.cs @@ -0,0 +1,9 @@ +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib +{ + public interface ISymbolEnumerator: IEnumerator + { + bool PutBack(Symbol item); + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Lexer.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Lexer.cs new file mode 100644 index 00000000..d54b9b93 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Lexer.cs @@ -0,0 +1,581 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/17 + * Time: 16:50 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System; +using System.Collections.Generic; +using System.IO; +using System.Text; +using Lextm.SharpSnmpLib.Mib.Elements.Types; + +namespace Lextm.SharpSnmpLib.Mib +{ + /// + /// Lexer class that parses MIB files into symbol list. + /// + public sealed class Lexer + { + private readonly SymbolList _symbols = new SymbolList(); + + public Lexer(string file) + : this(file, new StreamReader(file)) + { + } + + public Lexer(string file, TextReader stream) + { + this.Parse(file, stream); + } + + + public ISymbolEnumerator GetEnumerator() + { + return _symbols.GetSymbolEnumerator(); + } + + + #region Parsing of MIB File + + private class ParseParams + { + public string File; + public StringBuilder Temp = new StringBuilder(); + public bool StringSection = false; + public bool AssignSection = false; + public bool AssignAhead = false; + public bool DotSection = false; + + } + + /// + /// Parses MIB file to symbol list. + /// + /// File + /// File stream + private void Parse(string file, TextReader stream) + { + if (stream == null) + { + throw new ArgumentNullException("stream"); + } + + ParseParams pp = new ParseParams(); + pp.File = file; + + string line; + int row = 0; + while ((line = stream.ReadLine()) != null) + { + if (!pp.StringSection && line.TrimStart().StartsWith("--", StringComparison.Ordinal)) + { + row++; + continue; // commented line + } + + ParseLine(pp, line, row); + row++; + } + } + + private void ParseLine(ParseParams pp, string line, int row) + { + line = line + "\n"; + int count = line.Length; + for (int i = 0; i < count; i++) + { + char current = line[i]; + bool moveNext = Parse(pp, current, row, i); + if (moveNext) + { + break; + } + } + } + + private bool Parse(ParseParams pp, char current, int row, int column) + { + switch (current) + { + case '\n': + case '{': + case '}': + case '(': + case ')': + case '[': + case ']': + case ';': + case ',': + case '|': + if (!pp.StringSection) + { + bool moveNext = ParseLastSymbol(pp, row, column); + if (moveNext) + { + _symbols.Add(CreateSpecialSymbol(pp.File, '\n', row, column)); + return true; + } + + _symbols.Add(CreateSpecialSymbol(pp.File, current, row, column)); + return false; + } + + break; + case '"': + pp.StringSection = !pp.StringSection; + break; + case '\r': + return false; + default: + if ((int)current == 0x1A) + { + // IMPORTANT: ignore invisible characters such as SUB. + return false; + } + + if (Char.IsWhiteSpace(current) && !pp.AssignSection && !pp.StringSection) + { + bool moveNext = ParseLastSymbol(pp, row, column); + if (moveNext) + { + _symbols.Add(CreateSpecialSymbol(pp.File, '\n', row, column)); + return true; + } + + return false; + } + + if (pp.AssignAhead) + { + pp.AssignAhead = false; + ParseLastSymbol(pp, row, column); + break; + } + + if (pp.DotSection && current != '.') + { + ParseLastSymbol(pp, row, column); + pp.DotSection = false; + } + + if (current == '.' && !pp.StringSection) + { + if (!pp.DotSection) + { + ParseLastSymbol(pp, row, column); + pp.DotSection = true; + } + } + + if (current == ':' && !pp.StringSection) + { + if (!pp.AssignSection) + { + ParseLastSymbol(pp, row, column); + } + + pp.AssignSection = true; + } + + if (current == '=' && !pp.StringSection) + { + pp.AssignSection = false; + pp.AssignAhead = true; + } + + break; + } + + pp.Temp.Append(current); + return false; + } + + private bool ParseLastSymbol(ParseParams pp, int row, int column) + { + if (pp.Temp.Length > 0) + { + Symbol s = new Symbol(pp.File, pp.Temp.ToString(), row, column); + + pp.Temp.Length = 0; + + if (s.ToString().StartsWith(Symbol.Comment.ToString())) + { + // ignore the rest symbols on this line because they are in comment. + return true; + } + + _symbols.Add(s); + } + + return false; + } + + private static Symbol CreateSpecialSymbol(string file, char value, int row, int column) + { + string str; + switch (value) + { + case '\n': + str = Environment.NewLine; + break; + case '{': + str = "{"; + break; + case '}': + str = "}"; + break; + case '(': + str = "("; + break; + case ')': + str = ")"; + break; + case '[': + str = "["; + break; + case ']': + str = "]"; + break; + case ';': + str = ";"; + break; + case ',': + str = ","; + break; + case '|': + str = "|"; + break; + default: + throw new ArgumentException("value is not a special character"); + } + + return new Symbol(file, str, row, column); + } + + #endregion + + #region Static Parse Helper + + public static ITypeAssignment ParseBasicTypeDef(IModule module, string name, ISymbolEnumerator symbols, bool isMacroSyntax = false) + { + Symbol current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.Bits) + { + return new BitsType(module, name, symbols); + } + if (IntegerType.IsIntegerType(current)) + { + return new IntegerType(module, name, current, symbols); + } + if (UnsignedType.IsUnsignedType(current)) + { + return new UnsignedType(module, name, current, symbols); + } + if (current == Symbol.Opaque) + { + return new OpaqueType(module, name, symbols); + } + if (current == Symbol.IpAddress) + { + return new IpAddressType(module, name, symbols); + } + if (current == Symbol.TextualConvention) + { + return new TextualConvention(module, name, symbols); + } + if (current == Symbol.Octet) + { + Symbol next = symbols.NextNonEOLSymbol(); + + if (next == Symbol.String) + { + return new OctetStringType(module, name, symbols); + } + + symbols.PutBack(next); + } + if (current == Symbol.Object) + { + Symbol next = symbols.NextNonEOLSymbol(); + + if (next == Symbol.Identifier) + { + return new ObjectIdentifierType(module, name, symbols); + } + + symbols.PutBack(next); + } + if (current == Symbol.Sequence) + { + Symbol next = symbols.NextNonEOLSymbol(); + + if (next == Symbol.Of) + { + return new SequenceOf(module, name, symbols); + } + else + { + symbols.PutBack(next); + return new Sequence(module, name, symbols); + } + } + if (current == Symbol.Choice) + { + return new Choice(module, name, symbols); + } + + + return new TypeAssignment(module, name, current, symbols, isMacroSyntax); + } + + public static void ParseOidValue(ISymbolEnumerator symbols, out string parent, out uint value) + { + parent = null; + value = 0; + + Symbol current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.OpenBracket); + + Symbol previous = null; + StringBuilder longParent = new StringBuilder(); + + current = symbols.NextNonEOLSymbol(); + longParent.Append(current); + + while ((current = symbols.NextNonEOLSymbol()) != null) + { + bool succeeded; + + if (current == Symbol.OpenParentheses) + { + longParent.Append(current); + + current = symbols.NextNonEOLSymbol(); + succeeded = UInt32.TryParse(current.ToString(), out value); + current.Assert(succeeded, "not a decimal"); + longParent.Append(current); + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.CloseParentheses); + longParent.Append(current); + continue; + } + + if (current == Symbol.CloseBracket) + { + parent = longParent.ToString(); + return; + } + + succeeded = UInt32.TryParse(current.ToString(), out value); + if (succeeded) + { + // numerical way + while ((current = symbols.NextNonEOLSymbol()) != Symbol.CloseBracket) + { + longParent.Append(".").Append(value); + succeeded = UInt32.TryParse(current.ToString(), out value); + current.Assert(succeeded, "not a decimal"); + } + + current.Expect(Symbol.CloseBracket); + parent = longParent.ToString(); + return; + } + + longParent.Append("."); + longParent.Append(current); + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.OpenParentheses); + longParent.Append(current); + current = symbols.NextNonEOLSymbol(); + succeeded = UInt32.TryParse(current.ToString(), out value); + current.Assert(succeeded, "not a decimal"); + longParent.Append(current); + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.CloseParentheses); + longParent.Append(current); + previous = current; + } + + throw MibException.Create("end of file reached", previous); + } + + + public static ValueRanges DecodeRanges(ISymbolEnumerator symbols) + { + ValueRanges result = new ValueRanges(); + + Symbol startSymbol = symbols.NextNonEOLSymbol(); + Symbol current = startSymbol; + current.Expect(Symbol.OpenParentheses); + + while (current != Symbol.CloseParentheses) + { + Symbol value1Symbol = symbols.NextNonEOLSymbol(); + + if ((value1Symbol == Symbol.Size) && !result.IsSizeDeclaration) + { + result.IsSizeDeclaration = true; + symbols.NextNonEOLSymbol().Expect(Symbol.OpenParentheses); + continue; + } + + // check for valid number + Int64? value1 = DecodeNumber(value1Symbol); + if (!value1.HasValue) + { + value1Symbol.Assert(false, "Invalid range declaration!"); + } + + // process next symbol + ValueRange range; + current = symbols.NextNonEOLSymbol(); + + if (current == Symbol.DoubleDot) + { + // its a continous range + Symbol value2Symbol = symbols.NextNonEOLSymbol(); + Int64? value2 = DecodeNumber(value2Symbol); + value2Symbol.Assert(value2.HasValue && (value2.Value >= value1.Value), "Invalid range declaration!"); + + if (value2.Value == value1.Value) + { + range = new ValueRange(value1.Value, null); + } + else + { + range = new ValueRange(value1.Value, value2.Value); + } + + current = symbols.NextNonEOLSymbol(); + } + else + { + // its a single number + range = new ValueRange(value1.Value, null); + } + + // validate range + if (result.IsSizeDeclaration) + { + value1Symbol.Assert(range.Start >= 0, "Invalid range declaration! Size must be greater than 0"); + } + + result.Add(range); + + // check next symbol + current.Expect(Symbol.Pipe, Symbol.CloseParentheses); + } + + if (result.IsSizeDeclaration) + { + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.CloseParentheses); + } + + // validate ranges in between + for (int i=0; i 3)) + { + // search second apostrophe + int end = numString.IndexOf('\'', 1); + if (end == (numString.Length - 2)) + { + try + { + switch (numString[numString.Length - 1]) + { + case 'b': + case 'B': + result = Convert.ToInt64(numString.Substring(1, numString.Length - 3), 2); + return result; + case 'h': + case 'H': + result = Convert.ToInt64(numString.Substring(1, numString.Length - 3), 16); + return result; + } + } + catch + { + } + } + } + else if (Int64.TryParse(numString, out result)) + { + return result; + } + } + + return null; + } + + public static ValueMap DecodeEnumerations(ISymbolEnumerator symbols) + { + Symbol current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.OpenBracket); + + ValueMap map = new ValueMap(); + do + { + current = symbols.NextNonEOLSymbol(); + string identifier = current.ToString(); + + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.OpenParentheses); + + current = symbols.NextNonEOLSymbol(); + Int64 enumValue; + if (Int64.TryParse(current.ToString(), out enumValue)) + { + try + { + // Have to include the number as it seems repeated identifiers are allowed ?? + map.Add(enumValue, String.Format("{0}({1})", identifier, enumValue)); + } + catch (ArgumentException ex) + { + current.Assert(false, ex.Message); + } + } + else + { + // Need to get "DefinedValue". + } + + current = symbols.NextNonEOLSymbol(); + current.Expect(Symbol.CloseParentheses); + + current = symbols.NextNonEOLSymbol(); + } while (current == Symbol.Comma); + + current.Expect(Symbol.CloseBracket); + + return map; + } + + #endregion + + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MaxAccess.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MaxAccess.cs new file mode 100644 index 00000000..f8029900 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MaxAccess.cs @@ -0,0 +1,17 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Text; + +namespace Lextm.SharpSnmpLib.Mib +{ + public enum MaxAccess + { + notAccessible, + accessibleForNotify, + readOnly, + readWrite, + readCreate + } + +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibDocument.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibDocument.cs new file mode 100644 index 00000000..aac3b280 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibDocument.cs @@ -0,0 +1,57 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/17 + * Time: 17:38 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib +{ + /// + /// MIB document. + /// + public sealed class MibDocument + { + private readonly List _modules = new List(); + + /// + /// Initializes a new instance of the class. + /// + /// The file. + public MibDocument(string file) + : this(new Lexer(file)) + { + } + + /// + /// Initializes a new instance of the class. + /// + /// The lexer. + public MibDocument(Lexer lexer) + { + ISymbolEnumerator symbols = lexer.GetEnumerator(); + + Symbol current; + while ((current = symbols.NextNonEOLSymbol()) != null) + { + symbols.PutBack(current); + _modules.Add(new MibModule(symbols)); + } + } + + /// + /// containing in this document. + /// + public IList Modules + { + get + { + return _modules; + } + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibException.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibException.cs new file mode 100644 index 00000000..efd89b3f --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibException.cs @@ -0,0 +1,113 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/17 + * Time: 16:33 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System; +using System.Globalization; +#if (!SILVERLIGHT) +using System.Runtime.Serialization; +using System.Security.Permissions; +#endif + +namespace Lextm.SharpSnmpLib.Mib +{ + /// + /// Description of MibException. + /// + [Serializable] + [System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Naming", "CA1704:IdentifiersShouldBeSpelledCorrectly", MessageId = "Mib")] + public sealed class MibException : Exception + { + /// + /// Symbol. + /// + public Symbol Symbol { get; private set; } + + /// + /// Creates a . + /// + public MibException() + { + } + + /// + /// Creates a instance with a specific . + /// + /// Message + public MibException(string message) : base(message) + { + } + + /// + /// Creates a instance with a specific and an . + /// + /// Message + /// Inner exception + public MibException(string message, Exception inner) + : base(message, inner) + { + } +#if (!SILVERLIGHT) + /// + /// Creates a instance. + /// + /// Info + /// Context + private MibException(SerializationInfo info, StreamingContext context) : base(info, context) + { + if (info == null) + { + throw new ArgumentNullException("info"); + } + + Symbol = (Symbol)info.GetValue("Symbol", typeof(Symbol)); + } + + /// + /// Gets object data. + /// + /// Info + /// Context + [SecurityPermission(SecurityAction.Demand, SerializationFormatter = true)] + public override void GetObjectData(SerializationInfo info, StreamingContext context) + { + base.GetObjectData(info, context); + info.AddValue("Symbol", Symbol); + } +#endif + + /// + /// Creates a with a specific . + /// + /// Message + /// Symbol + /// + public static MibException Create(string message, Symbol symbol) + { + if (symbol == null) + { + throw new ArgumentNullException("symbol"); + } + + if (String.IsNullOrEmpty(message)) + { + message = "Unknown MIB Exception"; + } + + message = String.Format( + "{0} (file: \"{1}\"; row: {2}; column: {3})", + message, + symbol.File, + symbol.Row + 1, + symbol.Column + 1); + + MibException ex = new MibException(message) { Symbol = symbol }; + return ex; + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibModule.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibModule.cs new file mode 100644 index 00000000..3c6b7707 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibModule.cs @@ -0,0 +1,294 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/17 + * Time: 17:38 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System; +using System.Collections.Generic; +using Lextm.SharpSnmpLib.Mib.Elements; +using Lextm.SharpSnmpLib.Mib.Elements.Entities; +using Lextm.SharpSnmpLib.Mib.Elements.Types; + +namespace Lextm.SharpSnmpLib.Mib +{ + /// + /// MIB module class. + /// + [System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Naming", "CA1704:IdentifiersShouldBeSpelledCorrectly", MessageId = "Mib")] + public sealed class MibModule : IModule + { + private readonly string _name; + private readonly Imports _imports; + private readonly Exports _exports; + private readonly List _tokens = new List(); + + /// + /// Creates a with a specific . + /// + /// Module name + /// Lexer + [System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Naming", "CA1704:IdentifiersShouldBeSpelledCorrectly", MessageId = "lexer")] + public MibModule(ISymbolEnumerator symbols) + { + if (symbols == null) + { + throw new ArgumentNullException("lexer"); + } + + Symbol temp = symbols.NextNonEOLSymbol(); + temp.AssertIsValidIdentifier(); + _name = temp.ToString().ToUpperInvariant(); // all module names are uppercase + + temp = symbols.NextNonEOLSymbol(); + temp.Expect(Symbol.Definitions); + + temp = symbols.NextNonEOLSymbol(); + temp.Expect(Symbol.Assign); + + temp = symbols.NextSymbol(); + temp.Expect(Symbol.Begin); + + temp = symbols.NextNonEOLSymbol(); + if (temp == Symbol.Imports) + { + _imports = ParseDependents(symbols); + } + else if (temp == Symbol.Exports) + { + _exports = ParseExports(symbols); + } + else + { + symbols.PutBack(temp); + } + + ParseEntities(symbols); + } + + #region Accessors + + /// + /// Module name. + /// + public string Name + { + get { return _name; } + } + + public Exports Exports + { + get { return _exports; } + } + + public Imports Imports + { + get { return _imports; } + } + + public List Tokens + { + get { return this._tokens; } + } + + /// + /// Entities + Types + all other elements implementing IDeclaration + /// + public IList Declarations + { + get + { + IList result = new List(); + foreach (IElement e in _tokens) + { + IDeclaration decl = e as IDeclaration; + if (decl != null) + { + result.Add(decl); + } + } + + return result; + } + } + + /// + /// OID nodes. + /// + public IList Entities + { + get + { + IList result = new List(); + foreach (IElement e in _tokens) + { + IEntity entity = e as IEntity; + if (entity != null) + { + result.Add(entity); + } + } + + return result; + } + } + + public IList Types + { + get + { + IList result = new List(); + foreach (IElement e in _tokens) + { + ITypeAssignment type = e as ITypeAssignment; + if (type != null) + { + result.Add(type); + } + } + + return result; + } + } + + #endregion + + #region Parsing of Symbols + + private Exports ParseExports(ISymbolEnumerator symbols) + { + return new Exports(this, symbols); + } + + private Imports ParseDependents(ISymbolEnumerator symbols) + { + return new Imports(this, symbols); + } + + private void ParseEntities(ISymbolEnumerator symbols) + { + Symbol temp = symbols.NextNonEOLSymbol(); + SymbolList buffer = new SymbolList(); + + while (temp != Symbol.End) + { + if (temp == Symbol.Assign) + { + ParseEntity(buffer, symbols); + buffer.Clear(); + // skip linebreaks behind an entity + temp = symbols.NextNonEOLSymbol(); + } + else + { + buffer.Add(temp); + temp = symbols.NextSymbol(); + } + } + } + + private void ParseEntity(SymbolList preAssignSymbols, ISymbolEnumerator symbols) + { + if ((preAssignSymbols == null) || (preAssignSymbols.Count == 0)) + { + Symbol s = symbols.NextSymbol(); + if (s != null) + { + s.Assert(false, "Invalid Entitiy declaration"); + } + else + { + throw new MibException("Invalid Entitiy declaration"); + } + } + + // check for a valid identifier + preAssignSymbols[0].AssertIsValidIdentifier(); + + if (preAssignSymbols.Count == 1) + { + // its a typedef + _tokens.Add(Lexer.ParseBasicTypeDef(this, preAssignSymbols[0].ToString(), symbols, isMacroSyntax: false)); + return; + } + + ISymbolEnumerator preAssignSymbolsEnumerator = preAssignSymbols.GetSymbolEnumerator(); + preAssignSymbolsEnumerator.NextNonEOLSymbol(); // returns identifier + Symbol type = preAssignSymbolsEnumerator.NextNonEOLSymbol(); + + // parse declarations + if (type == Symbol.Object) + { + Symbol next = preAssignSymbolsEnumerator.NextNonEOLSymbol(); + + if (next == Symbol.Identifier) + { + _tokens.Add(new OidValueAssignment(this, preAssignSymbols, symbols)); + return; + } + else if (next != null) + { + preAssignSymbolsEnumerator.PutBack(next); + } + } + if (type == Symbol.ModuleIdentity) + { + _tokens.Add(new ModuleIdentity(this, preAssignSymbols, symbols)); + return; + } + if (type == Symbol.ObjectType) + { + _tokens.Add(new ObjectType(this, preAssignSymbols, symbols)); + return; + } + if (type == Symbol.ObjectGroup) + { + _tokens.Add(new ObjectGroup(this, preAssignSymbols, symbols)); + return; + } + if (type == Symbol.NotificationGroup) + { + _tokens.Add(new NotificationGroup(this, preAssignSymbols, symbols)); + return; + } + if (type == Symbol.ModuleCompliance) + { + _tokens.Add(new ModuleCompliance(this, preAssignSymbols, symbols)); + return; + } + if (type == Symbol.NotificationType) + { + _tokens.Add(new NotificationType(this, preAssignSymbols, symbols)); + return; + } + if (type == Symbol.ObjectIdentity) + { + _tokens.Add(new ObjectIdentity(this, preAssignSymbols, symbols)); + return; + } + if (type == Symbol.Macro) + { + _tokens.Add(new Macro(this, preAssignSymbols, symbols)); + return; + } + if (type == Symbol.TrapType) + { + _tokens.Add(new TrapType(this, preAssignSymbols, symbols)); + return; + } + if (type == Symbol.AgentCapabilities) + { + _tokens.Add(new AgentCapabilities(this, preAssignSymbols, symbols)); + return; + } + + preAssignSymbols[1].Assert(false, "Unknown/Invalid declaration"); + } + + #endregion + + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibResolver.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibResolver.cs new file mode 100644 index 00000000..96978e1a --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibResolver.cs @@ -0,0 +1,97 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Text; +using System.IO; +using System.Reflection; + +namespace Lextm.SharpSnmpLib.Mib +{ + public interface IMibResolver + { + IModule Resolve(string moduleName); + } + + public class FileSystemMibResolver : IMibResolver + { + private string _path; + private bool _recursive; + + public FileSystemMibResolver(string path, bool recursive) + { + _path = path; + _recursive = recursive; + } + + #region IMibResolver Member + + public IModule Resolve(string moduleName) + { + if (Directory.Exists(_path)) + { + string[] matchedFiles = Directory.GetFiles( + _path, + "*", + (_recursive) ? SearchOption.AllDirectories : SearchOption.TopDirectoryOnly); + + if ((matchedFiles != null) && (matchedFiles.Length >= 1)) + { + foreach (string matchedFile in matchedFiles) + { + if (Path.GetFileNameWithoutExtension(matchedFile.ToLowerInvariant()) == moduleName.ToLowerInvariant()) + { + try + { + MibDocument md = new MibDocument (matchedFile); + if (md.Modules.Count > 0) + { + return md.Modules [0]; + } + } catch + { + } + } + } + } + } + + return null; + } + + #endregion + + } + + // earlier code for search of versioned MIBs: + // + //private const string Pattern = "-V[0-9]+$"; + //public static bool AllDependentsAvailable(MibModule module, IDictionary modules) + //{ + // foreach (string dependent in module.Dependents) + // { + // if (!DependentFound(dependent, modules)) + // { + // return false; + // } + // } + + // return true; + //} + + //private static bool DependentFound(string dependent, IDictionary modules) + //{ + // if (!Regex.IsMatch(dependent, Pattern)) + // { + // return modules.ContainsKey(dependent); + // } + + // if (modules.ContainsKey(dependent)) + // { + // return true; + // } + + // string dependentNonVersion = Regex.Replace(dependent, Pattern, string.Empty); + // return modules.ContainsKey(dependentNonVersion); + //} + +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTree.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTree.cs new file mode 100644 index 00000000..a5174bc1 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTree.cs @@ -0,0 +1,130 @@ +using System.Collections.Generic; +using Lextm.SharpSnmpLib.Mib.Elements.Entities; + +namespace Lextm.SharpSnmpLib.Mib +{ + /// + /// Builds up a tree from a single MIB + /// + public class MibTree + { + private readonly List _root = new List(); + + public MibTree(MibModule module) + { + IList entities = module.Entities; + + if (entities.Count > 0) + { + // try to find module identity as root + foreach (IEntity element in entities) + { + ModuleIdentity mi = element as ModuleIdentity; + + if (mi != null) + { + _root.Add(new MibTreeNode(null, mi)); + } + } + + // find OID assignments as root, if there are any that are not below ModuleIdentity + foreach (IEntity element in entities) + { + OidValueAssignment oa = element as OidValueAssignment; + + if (oa != null) + { + _root.Add(new MibTreeNode(null, oa)); + } + } + + FilterRealRoots (entities); + + foreach (MibTreeNode mibTreeNode in _root) + { + entities.Remove (mibTreeNode.Entity); + } + + if (_root.Count == 0) + { + //no module identity, assume first entity is root + _root.Add(new MibTreeNode(null, entities[0])); + } + + foreach (MibTreeNode mibTreeNode in _root) + { + if (entities.Contains (mibTreeNode.Entity)) + { + entities.Remove (mibTreeNode.Entity); + } + BuildTree(mibTreeNode, entities); + UpdateTreeNodeTypes(mibTreeNode); + } + } + } + + public IList Root + { + get { return _root; } + } + + private bool EntityExists(IList entities, string name) + { + foreach(IEntity entity in entities) + { + if (entity.Name == name) + { + return true; + } + } + return false; + } + + private void FilterRealRoots(IList entities) + { + int i = 0; + while (i < _root.Count) + { + if (EntityExists(entities, _root[i].Entity.Parent)) + { + _root.RemoveAt(i); + } + else + { + i++; + } + } + } + + private void BuildTree(MibTreeNode node, IList entities) + { + int i = 0; + while (i < entities.Count) + { + if (entities[i].Parent == node.Entity.Name) + { + node.AddChild(entities[i]); + entities.RemoveAt(i); + } + else + { + i++; + } + } + + foreach (MibTreeNode childNode in node.ChildNodes) + { + BuildTree(childNode, entities); + } + } + + private void UpdateTreeNodeTypes(MibTreeNode node) + { + node.UpdateNodeType(); + foreach (MibTreeNode childNode in node.ChildNodes) + { + UpdateTreeNodeTypes(childNode); + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTreeNode.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTreeNode.cs new file mode 100644 index 00000000..386c8e5c --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTreeNode.cs @@ -0,0 +1,112 @@ +using System; +using System.Collections.Generic; +using Lextm.SharpSnmpLib.Mib.Elements.Entities; +using Lextm.SharpSnmpLib.Mib.Elements.Types; + +namespace Lextm.SharpSnmpLib.Mib +{ + [Flags] + public enum MibTreeNodeType + { + Unknown = 0, + Container = (1 << 0), + Scalar = (1 << 1), + Table = (1 << 2), + TableRow = (1 << 3), + TableCell = (1 << 4), + NotificationRelated = (1 << 5), + ConformanceRelated = (1 << 6) + } + + + public class MibTreeNode + { + private MibTreeNode _parent = null; + private List _childNodes = new List(); + private IEntity _entity = null; + private MibTreeNodeType _nodeType = MibTreeNodeType.Unknown; + + public MibTreeNode(MibTreeNode parent, IEntity entity) + { + _parent = parent; + _entity = entity; + } + + public MibTreeNode Parent + { + get { return _parent; } + } + + public IEntity Entity + { + get { return _entity; } + } + + public MibTreeNodeType NodeType + { + get { return _nodeType; } + } + + public List ChildNodes + { + get { return _childNodes; } + } + + public MibTreeNode AddChild(IEntity element) + { + MibTreeNode result = new MibTreeNode(this, element); + this.ChildNodes.Add(result); + + return result; + } + + public void UpdateNodeType() + { + _nodeType = MibTreeNodeType.Unknown; + + if (_entity != null) + { + if ((_entity is OidValueAssignment) || (_entity is ObjectIdentity)) + { + _nodeType |= MibTreeNodeType.Container; + return; + } + else if (_childNodes.Count > 0) + { + _nodeType |= MibTreeNodeType.Container; + } + + if (_entity is ObjectType) + { + ObjectType ot = _entity as ObjectType; + + if (ot.Syntax is SequenceOf) + { + _nodeType |= MibTreeNodeType.Table; + } + else if (ot.Syntax is Sequence) + { + _nodeType |= MibTreeNodeType.TableRow; + } + else if ((_parent != null) && ((_parent.NodeType & MibTreeNodeType.TableRow) != 0)) + { + _nodeType |= MibTreeNodeType.TableCell; + _nodeType |= MibTreeNodeType.Scalar; + } + else + { + _nodeType |= MibTreeNodeType.Scalar; + } + } + else if ((_entity is ModuleCompliance) || (_entity is ObjectGroup) || (_entity is NotificationGroup)) + { + _nodeType |= MibTreeNodeType.ConformanceRelated; + } + else if ((_entity is NotificationGroup) || (_entity is NotificationType)) + { + _nodeType |= MibTreeNodeType.NotificationRelated; + } + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTypesResolver.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTypesResolver.cs new file mode 100644 index 00000000..1e7529af --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/MibTypesResolver.cs @@ -0,0 +1,216 @@ +using System; +using System.Collections.Generic; +using System.Text.RegularExpressions; +using Lextm.SharpSnmpLib.Mib.Elements; +using Lextm.SharpSnmpLib.Mib.Elements.Entities; +using Lextm.SharpSnmpLib.Mib.Elements.Types; + +namespace Lextm.SharpSnmpLib.Mib +{ + public static class MibTypesResolver + { + private static readonly Regex _namedOidPathRegex = new Regex(@"^(?[^\(]+)\((?\d+)\)$"); + private static readonly List _resolver = new List(); + private static readonly List _cachedModules = new List(); + + public static void RegisterResolver(IMibResolver resolver) + { + if (resolver != null) + { + _resolver.Add(resolver); + } + } + + public static IModule ResolveModule(string moduleName) + { + // check if module is already cached + foreach (MibModule cachedModule in _cachedModules) + { + if (cachedModule.Name == moduleName) + { + return cachedModule; + } + } + + foreach (IMibResolver resolver in _resolver) + { + IModule resolvedModule = resolver.Resolve(moduleName); + if (resolvedModule != null) + { + ResolveTypes(resolvedModule); + _cachedModules.Add(resolvedModule); + return resolvedModule; + } + } + + return null; + } + + public static void ResolveTypes(IModule module) + { + foreach (IEntity entity in module.Entities) + { + ITypeReferrer typeReferringEntity = entity as ITypeReferrer; + + if (typeReferringEntity != null) + { + CheckTypeReferrer(module, typeReferringEntity); + } + } + + if (!_cachedModules.Contains(module)) + { + _cachedModules.Add(module); + } + } + + private static void CheckTypeReferrer(IModule module, ITypeReferrer typeReferringEntity) + { + TypeAssignment unknownType = typeReferringEntity.ReferredType as TypeAssignment; + if (unknownType != null) + { + typeReferringEntity.ReferredType = ResolveType(module, unknownType); + + if (typeReferringEntity.ReferredType is TypeAssignment) + { + Console.WriteLine(String.Format("Could not resolve type '{0}' declared in module '{1}'", (typeReferringEntity.ReferredType as TypeAssignment).Type, typeReferringEntity.ReferredType.Module.Name)); + } + } + + ITypeReferrer nextTypeReferringEntity = typeReferringEntity.ReferredType as ITypeReferrer; + if (nextTypeReferringEntity != null) + { + CheckTypeReferrer(module, nextTypeReferringEntity); + } + } + + public static ITypeAssignment ResolveType(IModule module, TypeAssignment type) + { + ITypeAssignment result = ResolveDeclaration(module, type.Type) as ITypeAssignment; + + return (result != null) ? result : type; + } + + public static IDeclaration ResolveDeclaration(IModule module, string name) + { + if ((module == null) || String.IsNullOrEmpty(name)) + { + return null; + } + + // check module internal types + foreach (IDeclaration decl in module.Declarations) + { + if (decl.Name == name) + { + return decl; + } + } + + // check if type is imported + if (module.Imports != null) + { + ImportsFrom imports = module.Imports.GetImportFromType(name); + if (imports != null) + { + IModule importedModule = ResolveModule(imports.Module); + if (importedModule != null) + { + return ResolveDeclaration(importedModule, name); + } + } + } + + return null; + } + + public static ObjectIdentifier ResolveOid(IEntity entity) + { + ObjectIdentifier result = new ObjectIdentifier(); + + if (entity != null) + { + ResolveOid(entity, result); + } + + return result; + } + + private static void ResolveOid(IEntity entity, ObjectIdentifier result) + { + result.Prepend(entity.Name, entity.Value); + + // check parent + if (!String.IsNullOrEmpty(entity.Parent)) + { + string[] pathParts = entity.Parent.Split('.'); + uint value; + + // all parts except the first should have their value directly or indirectly with them + if (pathParts.Length > 1) + { + for (int i=pathParts.Length-1; i>=1; i--) + { + if (uint.TryParse(pathParts[i], out value)) + { + result.Prepend("", value); + } + else + { + Match m = _namedOidPathRegex.Match(pathParts[i]); + if (m.Success) + { + result.Prepend(m.Groups["Name"].Value, uint.Parse(m.Groups["Value"].Value)); + } + else + { + throw new MibException("Invalid OID path detected for entity '" + entity.Name + "' in module '" + entity.Module + "'!"); + } + } + } + } + + // parse root part: either another entity or a standard root object + if (IsOidRoot(pathParts[0], out value)) + { + result.Prepend(pathParts[0], value); + } + else + { + // try to find entity inside this module + if (entity.Module != null) + { + entity = ResolveDeclaration(entity.Module, pathParts[0]) as IEntity; + + if (entity != null) + { + ResolveOid(entity, result); + } + else + { + result.Prepend("", uint.MaxValue); + } + } + else + { + result.Prepend("", uint.MaxValue); + } + } + } + } + + public static bool IsOidRoot(string name, out uint value) + { + value = uint.MaxValue; + + switch (name) + { + case "ccitt": value = 0; return true; + case "iso": value = 1; return true; + case "joint-iso-ccitt": value = 2; return true; + } + + return false; + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ObjectIdentifier.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ObjectIdentifier.cs new file mode 100644 index 00000000..04248043 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ObjectIdentifier.cs @@ -0,0 +1,54 @@ +using System.Collections.Generic; +using System.Text; + +namespace Lextm.SharpSnmpLib.Mib +{ + public class ObjectIdentifier: List> + { + public void Add(string name, uint oid) + { + this.Add(new KeyValuePair(name, oid)); + } + + public void Prepend(string name, uint oid) + { + this.Insert(0, new KeyValuePair(name, oid)); + } + + public void Insert(int index, string name, uint oid) + { + this.Insert(index, new KeyValuePair(name, oid)); + } + + public string GetOidString() + { + StringBuilder result = new StringBuilder(); + + foreach (KeyValuePair level in this) + { + result.Append(level.Value); + result.Append('.'); + } + + if (result.Length > 0) + { + result.Length--; + } + + return result.ToString(); + } + + public uint[] GetOidValues() + { + List result = new List(); + + foreach (KeyValuePair level in this) + { + result.Add(level.Value); + } + + return result.ToArray(); + } + + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Status.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Status.cs new file mode 100644 index 00000000..4ddd3bab --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Status.cs @@ -0,0 +1,17 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Text; + +namespace Lextm.SharpSnmpLib.Mib +{ + public enum Status + { + current, + deprecated, + obsolete, + mandatory, + optional + } + +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Symbol.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Symbol.cs new file mode 100644 index 00000000..b11386d8 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/Symbol.cs @@ -0,0 +1,357 @@ +/* + * Created by SharpDevelop. + * User: lextm + * Date: 2008/5/17 + * Time: 17:14 + * + * To change this template use Tools | Options | Coding | Edit Standard Headers. + */ + +using System; +using System.Configuration; +using System.Globalization; +using System.Text; + +namespace Lextm.SharpSnmpLib.Mib +{ + /// + /// Description of Symbol. + /// + public sealed class Symbol : IEquatable + { + private readonly string _text; + private readonly int _row; + private readonly int _column; + private readonly string _file; + + private Symbol(string text) : this(null, text, -1, -1) + { + } + + /// + /// Creates a . + /// + /// File + /// Text + /// Row number + /// column number + public Symbol(string file, string text, int row, int column) + { + _file = file; + _text = text; + _row = row; + _column = column; + } + + /// + /// File. + /// + public string File + { + get + { + return _file; + } + } + + /// + /// Row number. + /// + public int Row + { + get + { + return _row; + } + } + + /// + /// Column number. + /// + public int Column + { + get + { + return _column; + } + } + + /// + /// Returns a that represents this . + /// + /// + public override string ToString() + { + return _text; + } + + /// + /// Determines whether the specified is equal to the current . + /// + /// The to compare with the current . + /// true if the specified is equal to the current ; otherwise, false. + /// + public override bool Equals(object obj) + { + if (obj == null) + { + return false; + } + + if (ReferenceEquals(this, obj)) + { + return true; + } + + return GetType() == obj.GetType() && Equals((Symbol)obj); + } + + /// + /// Serves as a hash function for a particular type. + /// + /// A hash code for the current . + public override int GetHashCode() + { + return _text.GetHashCode(); + } + + /// + /// The equality operator. + /// + /// Left object + /// Right object + /// + /// Returns true if the values of its operands are equal, false otherwise. + public static bool operator ==(Symbol left, Symbol right) + { + return Equals(left, right); + } + + /// + /// Determines whether the specified is equal to the current . + /// + /// Left object + /// Right object + /// + /// Returns true if the values of its operands are equal, false otherwise. + public static bool Equals(Symbol left, Symbol right) + { + object l = left; + object r = right; + if (l == r) + { + return true; + } + + if (l == null || r == null) + { + return false; + } + + return left._text.Equals(right._text); + } + + /// + /// The inequality operator. + /// + /// Left object + /// Right object + /// + /// Returns true if the values of its operands are not equal, false otherwise. + public static bool operator !=(Symbol left, Symbol right) + { + return !(left == right); + } + + #region IEquatable Members + /// + /// Indicates whether the current object is equal to another object of the same type. + /// + /// An object to compare with this object. + /// true if the current object is equal to the parameter; otherwise, false. + /// + public bool Equals(Symbol other) + { + return Equals(this, other); + } + + #endregion + + public static readonly Symbol Definitions = new Symbol("DEFINITIONS"); + public static readonly Symbol Begin = new Symbol("BEGIN"); + public static readonly Symbol Object = new Symbol("OBJECT"); + public static readonly Symbol Identifier = new Symbol("IDENTIFIER"); + public static readonly Symbol Assign = new Symbol("::="); + public static readonly Symbol OpenBracket = new Symbol("{"); + public static readonly Symbol CloseBracket = new Symbol("}"); + public static readonly Symbol Comment = new Symbol("--"); + public static readonly Symbol Imports = new Symbol("IMPORTS"); + public static readonly Symbol Semicolon = new Symbol(";"); + public static readonly Symbol From = new Symbol("FROM"); + public static readonly Symbol ModuleIdentity = new Symbol("MODULE-IDENTITY"); + public static readonly Symbol ObjectType = new Symbol("OBJECT-TYPE"); + public static readonly Symbol ObjectGroup = new Symbol("OBJECT-GROUP"); + public static readonly Symbol NotificationGroup = new Symbol("NOTIFICATION-GROUP"); + public static readonly Symbol ModuleCompliance = new Symbol("MODULE-COMPLIANCE"); + public static readonly Symbol Sequence = new Symbol("SEQUENCE"); + public static readonly Symbol NotificationType = new Symbol("NOTIFICATION-TYPE"); + public static readonly Symbol EOL = new Symbol(Environment.NewLine); + public static readonly Symbol ObjectIdentity = new Symbol("OBJECT-IDENTITY"); + public static readonly Symbol End = new Symbol("END"); + public static readonly Symbol Macro = new Symbol("MACRO"); + public static readonly Symbol Choice = new Symbol("CHOICE"); + public static readonly Symbol TrapType = new Symbol("TRAP-TYPE"); + public static readonly Symbol AgentCapabilities = new Symbol("AGENT-CAPABILITIES"); + public static readonly Symbol Comma = new Symbol(","); + public static readonly Symbol TextualConvention = new Symbol("TEXTUAL-CONVENTION"); + public static readonly Symbol Syntax = new Symbol("SYNTAX"); + public static readonly Symbol Bits = new Symbol("BITS"); + public static readonly Symbol Octet = new Symbol("OCTET"); + public static readonly Symbol String = new Symbol("STRING"); + public static readonly Symbol OpenParentheses = new Symbol("("); + public static readonly Symbol CloseParentheses = new Symbol(")"); + public static readonly Symbol Exports = new Symbol("EXPORTS"); + public static readonly Symbol DisplayHint = new Symbol("DISPLAY-HINT"); + public static readonly Symbol Status = new Symbol("STATUS"); + public static readonly Symbol Description = new Symbol("DESCRIPTION"); + public static readonly Symbol Reference = new Symbol("REFERENCE"); + public static readonly Symbol DoubleDot = new Symbol(".."); + public static readonly Symbol Pipe = new Symbol("|"); + public static readonly Symbol Size = new Symbol("SIZE"); + public static readonly Symbol Units = new Symbol("UNITS"); + public static readonly Symbol MaxAccess = new Symbol("MAX-ACCESS"); + public static readonly Symbol Access = new Symbol("ACCESS"); + public static readonly Symbol Index = new Symbol("INDEX"); + public static readonly Symbol Augments = new Symbol("AUGMENTS"); + public static readonly Symbol DefVal = new Symbol("DEFVAL"); + public static readonly Symbol Of = new Symbol("OF"); + public static readonly Symbol Integer = new Symbol("INTEGER"); + public static readonly Symbol Integer32 = new Symbol("Integer32"); + public static readonly Symbol IpAddress = new Symbol("IpAddress"); + public static readonly Symbol Counter32 = new Symbol("Counter32"); + public static readonly Symbol Counter = new Symbol("Counter"); + public static readonly Symbol TimeTicks = new Symbol("TimeTicks"); + public static readonly Symbol Opaque = new Symbol("Opaque"); + public static readonly Symbol Counter64 = new Symbol("Counter64"); + public static readonly Symbol Unsigned32 = new Symbol("Unsigned32"); + public static readonly Symbol Gauge32 = new Symbol("Gauge32"); + public static readonly Symbol Gauge = new Symbol("Gauge"); + public static readonly Symbol TruthValue = new Symbol("TruthValue"); + public static readonly Symbol Implied = new Symbol("IMPLIED"); + + internal void Expect(Symbol expected, params Symbol[] orExpected) + { + bool isExpected = (this == expected); + + if (!isExpected && (orExpected != null) && (orExpected.Length > 0)) + { + // check the alternatives + for (int i=0; i 64)) + { + message = "an identifier must consist of 1 to 64 letters, digits, and hyphens"; + return false; + } + + if (!Char.IsLetter(name[0])) + { + message = "the initial character must be a letter"; + return false; + } + + if (name.EndsWith("-", StringComparison.Ordinal)) + { + message = "a hyphen cannot be the last character of an identifier"; + return false; + } + + if (name.Contains("--")) + { + message = "a hyphen cannot be immediately followed by another hyphen in an identifier"; + return false; + } + + if (UseStricterValidation && name.Contains("_")) + { + message = "underscores are not allowed in identifiers"; + return false; + } + + // TODO: SMIv2 forbids "-" except in module names and keywords + message = null; + return true; + } + + private static bool? _useStricterValidation; + + private static bool UseStricterValidation + { + get + { + if (_useStricterValidation == null) + { + object setting = ConfigurationManager.AppSettings["StricterValidationEnabled"]; + _useStricterValidation = setting != null && Convert.ToBoolean(setting.ToString(), CultureInfo.InvariantCulture); + } + + return _useStricterValidation.Value; + } + } + } +} \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/SymbolList.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/SymbolList.cs new file mode 100644 index 00000000..5b2218e8 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/SymbolList.cs @@ -0,0 +1,146 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Text; + +namespace Lextm.SharpSnmpLib.Mib +{ + public class SymbolList : List + { + public class SymbolEnumerator : ISymbolEnumerator + { + private SymbolList _list = null; + private int _index = -1; + + internal SymbolEnumerator(SymbolList list) + { + if (list == null) + { + throw new ArgumentNullException("lexer"); + } + + _list = list; + } + + #region ISymbolEnumerator Member + + public bool PutBack(Symbol item) + { + if ((_index < 0) || (_index >= _list.Count) || (item != _list[_index])) + { + throw new ArgumentException(@"wrong last symbol", "last"); + //return false; + } + + _index--; + return true; + } + + #endregion + + #region IEnumerator Member + + public Symbol Current + { + get + { + if ((_index >= 0) && (_index <= _list.Count)) + { + return _list[_index]; + } + + return null; + } + } + + #endregion + + #region IDisposable Member + + public void Dispose() + { + } + + #endregion + + #region IEnumerator Member + + object System.Collections.IEnumerator.Current + { + get { return this.Current; } + } + + public bool MoveNext() + { + _index++; + return (_index >= 0) && (_index < _list.Count); + } + + public void Reset() + { + _index = -1; + } + + #endregion + } + + /// + /// Initializes a new instance of the class. + /// + public SymbolList() + { + } + + public ISymbolEnumerator GetSymbolEnumerator() + { + return new SymbolEnumerator(this); + } + + public string Join(string separator) + { + if (separator == null) + separator = ""; + + StringBuilder result = new StringBuilder(); + + foreach (Symbol s in this) + { + result.Append(s); + result.Append(separator); + } + + if (result.Length > 0) + { + result.Length -= separator.Length; + } + + return result.ToString(); + } + } + + public static class SymbolEnumeratorExtension + { + public static Symbol NextSymbol(this IEnumerator enumerator) + { + if (enumerator.MoveNext()) + { + return enumerator.Current; + } + + return null; + } + + public static Symbol NextNonEOLSymbol(this IEnumerator enumerator) + { + while (enumerator.MoveNext()) + { + if (enumerator.Current != Symbol.EOL) + { + return enumerator.Current; + } + } + + return null; + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ValueMap.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ValueMap.cs new file mode 100644 index 00000000..184dd580 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ValueMap.cs @@ -0,0 +1,103 @@ +using System; +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib +{ + public class ValueMap : Dictionary + { + public ValueMap() + { + } + + /// + /// Returns the values of the map as continous range. At best as one range. + /// + /// + public ValueRanges GetContinousRanges() + { + ValueRanges result = new ValueRanges(); + + if (this.Count > 0) + { + List values = new List(this.Keys); + values.Sort(); + + Int64 last = values[0]; + Int64 offset = values[0]; + for (int i=1; i + /// Gets the highest value contained in this value map. + /// + /// + public Int64 GetHighestValue() + { + Int64 result = 0; + + foreach (Int64 value in this.Keys) + { + if (value > result) + { + result = value; + } + } + + return result; + } + + /// + /// Interprets the single values as bit positions and creates a mask of it. + /// + /// + public UInt32 GetBitMask() + { + UInt32 result = 0; + + foreach (Int64 key in this.Keys) + { + if (key < 0) + { + throw new NotSupportedException("Negative numbers are not allowed for Bits!"); + } + if (key > 31) + { + throw new NotSupportedException("Bits with more than 32 bits are not supported!"); + } + + result |= (UInt32)(1 << (int)key); + } + + return result; + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ValueRange.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ValueRange.cs new file mode 100644 index 00000000..3ff5bcb7 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Mib/ValueRange.cs @@ -0,0 +1,76 @@ +using System; +using System.Collections.Generic; + +namespace Lextm.SharpSnmpLib.Mib +{ + public class ValueRanges: List + { + public bool IsSizeDeclaration { get; internal set; } + + public ValueRanges(bool isSizeDecl = false) + { + IsSizeDeclaration = isSizeDecl; + } + + public bool Contains(Int64 value) + { + foreach (ValueRange range in this) + { + if (range.Contains(value)) + { + return true; + } + } + + return false; + } + } + + public class ValueRange + { + private readonly Int64 _start; + private readonly Int64? _end; + + public ValueRange(Int64 first, Int64? second) + { + _start = first; + _end = second; + } + + public Int64 Start + { + get { return _start; } + } + + public Int64? End + { + get { return _end; } + } + + public bool IntersectsWith(ValueRange other) + { + if (this._end == null) + { + return other.Contains(this._start); + } + else if (other._end == null) + { + return this.Contains(other._start); + } + + return (this._start <= other.End) && (this._end >= other._start); + } + + public bool Contains(Int64 value) + { + if (_end == null) + { + return value == _start; + } + else + { + return (_start <= value) && (value <= _end); + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/AssemblyInfo.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/AssemblyInfo.cs new file mode 100644 index 00000000..f96080d0 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/AssemblyInfo.cs @@ -0,0 +1,61 @@ +// #SNMP Library. An open source SNMP implementation for .NET. +// Copyright (C) 2008 Lex Y. Li +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License, or (at your option) any later version. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + +#region Using directives + +using System; +using System.Reflection; +using System.Resources; +using System.Runtime.CompilerServices; +using System.Runtime.InteropServices; + +#endregion + +// General Information about an assembly is controlled through the following +// set of attributes. Change these attribute values to modify the information +// associated with an assembly. +[assembly: AssemblyTitle("SharpSnmpLib")] +[assembly: AssemblyDescription("#SNMP Library for .NET")] +[assembly: AssemblyConfiguration("Lesser GPL 2.1+")] +[assembly: AssemblyCompany("LeXtudio")] +[assembly: AssemblyProduct("#SNMPLib")] +[assembly: AssemblyCopyright("(C) 2008-2010 Malcolm Crowe, Lex Li, Steve Santacroce, and other contributors.")] +[assembly: AssemblyTrademark("")] +[assembly: AssemblyCulture("")] + +// This sets the default COM visibility of types in the assembly to invisible. +// If you need to expose index type to COM, use [ComVisible(true)] on that type. +[assembly: ComVisible(false)] + +// The assembly version has following format : +// +// Major.Minor.Build.Revision +// +// You can specify all the values or you can use the default the Revision and +// Build Numbers by using the '*' as shown below: +[assembly: AssemblyVersion("7.0.011207.31")] +#if (!CF) +[assembly: AssemblyFileVersion("7.0.011207.31")] +#endif +[assembly: NeutralResourcesLanguage("en-US")] +[assembly: System.Diagnostics.CodeAnalysis.SuppressMessage("Microsoft.Naming", "CA1704:IdentifiersShouldBeSpelledCorrectly", MessageId = "Lextm")] + +[assembly: InternalsVisibleTo("SharpSnmpLib.Tests, PublicKey=0024000004800000940000000602000000240000525341310004000001000100f7030532c52524" ++ "993841a0d09420340f3814e1b65473851bdcd18815510b035a2ae9ecee69c4cd2d9e4d6e6d5fbf" ++ "a564e86c4a4cddc9597619a31c060846ebb2e99511a0323ff82b1ebd95d6a4912502945f0e769f" ++ "190a69a439dbfb969ebad72a6f7e2e047907da4a7b9c08c6e98d5f1be8b8cafaf3eb978914059a" ++ "245d4bc1")] diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/Resources.Designer.cs b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/Resources.Designer.cs new file mode 100644 index 00000000..38bc6bb9 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/Resources.Designer.cs @@ -0,0 +1,63 @@ +//------------------------------------------------------------------------------ +// +// Dieser Code wurde von einem Tool generiert. +// Laufzeitversion:4.0.30319.225 +// +// Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn +// der Code erneut generiert wird. +// +//------------------------------------------------------------------------------ + +namespace Lextm.SharpSnmpLib.Mib { + using System; + + + /// + /// Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw. + /// + // Diese Klasse wurde von der StronglyTypedResourceBuilder automatisch generiert + // -Klasse über ein Tool wie ResGen oder Visual Studio automatisch generiert. + // Um einen Member hinzuzufügen oder zu entfernen, bearbeiten Sie die .ResX-Datei und führen dann ResGen + // mit der /str-Option erneut aus, oder Sie erstellen Ihr VS-Projekt neu. + [global::System.CodeDom.Compiler.GeneratedCodeAttribute("System.Resources.Tools.StronglyTypedResourceBuilder", "4.0.0.0")] + [global::System.Diagnostics.DebuggerNonUserCodeAttribute()] + [global::System.Runtime.CompilerServices.CompilerGeneratedAttribute()] + internal class Resources { + + private static global::System.Resources.ResourceManager resourceMan; + + private static global::System.Globalization.CultureInfo resourceCulture; + + [global::System.Diagnostics.CodeAnalysis.SuppressMessageAttribute("Microsoft.Performance", "CA1811:AvoidUncalledPrivateCode")] + internal Resources() { + } + + /// + /// Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird. + /// + [global::System.ComponentModel.EditorBrowsableAttribute(global::System.ComponentModel.EditorBrowsableState.Advanced)] + internal static global::System.Resources.ResourceManager ResourceManager { + get { + if (object.ReferenceEquals(resourceMan, null)) { + global::System.Resources.ResourceManager temp = new global::System.Resources.ResourceManager("Lextm.SharpSnmpLib.Properties.Resources", typeof(Resources).Assembly); + resourceMan = temp; + } + return resourceMan; + } + } + + /// + /// Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle + /// Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden. + /// + [global::System.ComponentModel.EditorBrowsableAttribute(global::System.ComponentModel.EditorBrowsableState.Advanced)] + internal static global::System.Globalization.CultureInfo Culture { + get { + return resourceCulture; + } + set { + resourceCulture = value; + } + } + } +} diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/Resources.resx b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/Resources.resx new file mode 100644 index 00000000..7080a7d1 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/Properties/Resources.resx @@ -0,0 +1,120 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + text/microsoft-resx + + + 2.0 + + + System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089 + + + System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089 + + \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/SharpSnmpLib.Mib.csproj b/contrib/apps/LwipMibCompiler/SharpSnmpLib/SharpSnmpLib.Mib.csproj new file mode 100644 index 00000000..2cf86578 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/SharpSnmpLib.Mib.csproj @@ -0,0 +1,140 @@ + + + + Debug + AnyCPU + 8.0.30703 + 2.0 + {CBE20411-5DB7-487D-825D-7694267BB6F5} + Library + Properties + Lextm.SharpSnmpLib + SharpSnmpLib.Mib + ..\bin\SharpSnmpLib.Mib.xml + 512 + + True + sharpsnmplib.snk + False + File + + + + + + + + + False + v4.0 + + + true + full + false + bin\Debug\ + DEBUG;TRACE + prompt + 4 + + + + + pdbonly + true + bin\Release\ + TRACE + prompt + 4 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + True + True + Resources.resx + + + + + + + + + + + ResXFileCodeGenerator + Resources.Designer.cs + Lextm.SharpSnmpLib.Mib + Designer + + + + + + + + \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/license.txt b/contrib/apps/LwipMibCompiler/SharpSnmpLib/license.txt new file mode 100644 index 00000000..27946de2 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/SharpSnmpLib/license.txt @@ -0,0 +1,458 @@ + GNU LESSER GENERAL PUBLIC LICENSE + Version 2.1, February 1999 + + Copyright (C) 1991, 1999 Free Software Foundation, Inc. + 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + +[This is the first released version of the Lesser GPL. It also counts + as the successor of the GNU Library Public License, version 2, hence + the version number 2.1.] + + Preamble + + The licenses for most software are designed to take away your +freedom to share and change it. By contrast, the GNU General Public +Licenses are intended to guarantee your freedom to share and change +free software--to make sure the software is free for all its users. + + This license, the Lesser General Public License, applies to some +specially designated software packages--typically libraries--of the +Free Software Foundation and other authors who decide to use it. You +can use it too, but we suggest you first think carefully about whether +this license or the ordinary General Public License is the better +strategy to use in any particular case, based on the explanations below. + + When we speak of free software, we are referring to freedom of use, +not price. Our General Public Licenses are designed to make sure that +you have the freedom to distribute copies of free software (and charge +for this service if you wish); that you receive source code or can get +it if you want it; that you can change the software and use pieces of +it in new free programs; and that you are informed that you can do +these things. + + To protect your rights, we need to make restrictions that forbid +distributors to deny you these rights or to ask you to surrender these +rights. These restrictions translate to certain responsibilities for +you if you distribute copies of the library or if you modify it. + + For example, if you distribute copies of the library, whether gratis +or for a fee, you must give the recipients all the rights that we gave +you. You must make sure that they, too, receive or can get the source +code. If you link other code with the library, you must provide +complete object files to the recipients, so that they can relink them +with the library after making changes to the library and recompiling +it. And you must show them these terms so they know their rights. + + We protect your rights with a two-step method: (1) we copyright the +library, and (2) we offer you this license, which gives you legal +permission to copy, distribute and/or modify the library. + + To protect each distributor, we want to make it very clear that +there is no warranty for the free library. Also, if the library is +modified by someone else and passed on, the recipients should know +that what they have is not the original version, so that the original +author's reputation will not be affected by problems that might be +introduced by others. + + Finally, software patents pose a constant threat to the existence of +any free program. We wish to make sure that a company cannot +effectively restrict the users of a free program by obtaining a +restrictive license from a patent holder. Therefore, we insist that +any patent license obtained for a version of the library must be +consistent with the full freedom of use specified in this license. + + Most GNU software, including some libraries, is covered by the +ordinary GNU General Public License. This license, the GNU Lesser +General Public License, applies to certain designated libraries, and +is quite different from the ordinary General Public License. We use +this license for certain libraries in order to permit linking those +libraries into non-free programs. + + When a program is linked with a library, whether statically or using +a shared library, the combination of the two is legally speaking a +combined work, a derivative of the original library. The ordinary +General Public License therefore permits such linking only if the +entire combination fits its criteria of freedom. The Lesser General +Public License permits more lax criteria for linking other code with +the library. + + We call this license the "Lesser" General Public License because it +does Less to protect the user's freedom than the ordinary General +Public License. It also provides other free software developers Less +of an advantage over competing non-free programs. These disadvantages +are the reason we use the ordinary General Public License for many +libraries. However, the Lesser license provides advantages in certain +special circumstances. + + For example, on rare occasions, there may be a special need to +encourage the widest possible use of a certain library, so that it becomes +a de-facto standard. To achieve this, non-free programs must be +allowed to use the library. A more frequent case is that a free +library does the same job as widely used non-free libraries. In this +case, there is little to gain by limiting the free library to free +software only, so we use the Lesser General Public License. + + In other cases, permission to use a particular library in non-free +programs enables a greater number of people to use a large body of +free software. For example, permission to use the GNU C Library in +non-free programs enables many more people to use the whole GNU +operating system, as well as its variant, the GNU/Linux operating +system. + + Although the Lesser General Public License is Less protective of the +users' freedom, it does ensure that the user of a program that is +linked with the Library has the freedom and the wherewithal to run +that program using a modified version of the Library. + + The precise terms and conditions for copying, distribution and +modification follow. Pay close attention to the difference between a +"work based on the library" and a "work that uses the library". The +former contains code derived from the library, whereas the latter must +be combined with the library in order to run. + + GNU LESSER GENERAL PUBLIC LICENSE + TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION + + 0. This License Agreement applies to any software library or other +program which contains a notice placed by the copyright holder or +other authorized party saying it may be distributed under the terms of +this Lesser General Public License (also called "this License"). +Each licensee is addressed as "you". + + A "library" means a collection of software functions and/or data +prepared so as to be conveniently linked with application programs +(which use some of those functions and data) to form executables. + + The "Library", below, refers to any such software library or work +which has been distributed under these terms. A "work based on the +Library" means either the Library or any derivative work under +copyright law: that is to say, a work containing the Library or a +portion of it, either verbatim or with modifications and/or translated +straightforwardly into another language. (Hereinafter, translation is +included without limitation in the term "modification".) + + "Source code" for a work means the preferred form of the work for +making modifications to it. For a library, complete source code means +all the source code for all modules it contains, plus any associated +interface definition files, plus the scripts used to control compilation +and installation of the library. + + Activities other than copying, distribution and modification are not +covered by this License; they are outside its scope. The act of +running a program using the Library is not restricted, and output from +such a program is covered only if its contents constitute a work based +on the Library (independent of the use of the Library in a tool for +writing it). Whether that is true depends on what the Library does +and what the program that uses the Library does. + + 1. You may copy and distribute verbatim copies of the Library's +complete source code as you receive it, in any medium, provided that +you conspicuously and appropriately publish on each copy an +appropriate copyright notice and disclaimer of warranty; keep intact +all the notices that refer to this License and to the absence of any +warranty; and distribute a copy of this License along with the +Library. + + You may charge a fee for the physical act of transferring a copy, +and you may at your option offer warranty protection in exchange for a +fee. + + 2. You may modify your copy or copies of the Library or any portion +of it, thus forming a work based on the Library, and copy and +distribute such modifications or work under the terms of Section 1 +above, provided that you also meet all of these conditions: + + a) The modified work must itself be a software library. + + b) You must cause the files modified to carry prominent notices + stating that you changed the files and the date of any change. + + c) You must cause the whole of the work to be licensed at no + charge to all third parties under the terms of this License. + + d) If a facility in the modified Library refers to a function or a + table of data to be supplied by an application program that uses + the facility, other than as an argument passed when the facility + is invoked, then you must make a good faith effort to ensure that, + in the event an application does not supply such function or + table, the facility still operates, and performs whatever part of + its purpose remains meaningful. + + (For example, a function in a library to compute square roots has + a purpose that is entirely well-defined independent of the + application. Therefore, Subsection 2d requires that any + application-supplied function or table used by this function must + be optional: if the application does not supply it, the square + root function must still compute square roots.) + +These requirements apply to the modified work as a whole. If +identifiable sections of that work are not derived from the Library, +and can be reasonably considered independent and separate works in +themselves, then this License, and its terms, do not apply to those +sections when you distribute them as separate works. But when you +distribute the same sections as part of a whole which is a work based +on the Library, the distribution of the whole must be on the terms of +this License, whose permissions for other licensees extend to the +entire whole, and thus to each and every part regardless of who wrote +it. + +Thus, it is not the intent of this section to claim rights or contest +your rights to work written entirely by you; rather, the intent is to +exercise the right to control the distribution of derivative or +collective works based on the Library. + +In addition, mere aggregation of another work not based on the Library +with the Library (or with a work based on the Library) on a volume of +a storage or distribution medium does not bring the other work under +the scope of this License. + + 3. You may opt to apply the terms of the ordinary GNU General Public +License instead of this License to a given copy of the Library. To do +this, you must alter all the notices that refer to this License, so +that they refer to the ordinary GNU General Public License, version 2, +instead of to this License. (If a newer version than version 2 of the +ordinary GNU General Public License has appeared, then you can specify +that version instead if you wish.) Do not make any other change in +these notices. + + Once this change is made in a given copy, it is irreversible for +that copy, so the ordinary GNU General Public License applies to all +subsequent copies and derivative works made from that copy. + + This option is useful when you wish to copy part of the code of +the Library into a program that is not a library. + + 4. You may copy and distribute the Library (or a portion or +derivative of it, under Section 2) in object code or executable form +under the terms of Sections 1 and 2 above provided that you accompany +it with the complete corresponding machine-readable source code, which +must be distributed under the terms of Sections 1 and 2 above on a +medium customarily used for software interchange. + + If distribution of object code is made by offering access to copy +from a designated place, then offering equivalent access to copy the +source code from the same place satisfies the requirement to +distribute the source code, even though third parties are not +compelled to copy the source along with the object code. + + 5. A program that contains no derivative of any portion of the +Library, but is designed to work with the Library by being compiled or +linked with it, is called a "work that uses the Library". Such a +work, in isolation, is not a derivative work of the Library, and +therefore falls outside the scope of this License. + + However, linking a "work that uses the Library" with the Library +creates an executable that is a derivative of the Library (because it +contains portions of the Library), rather than a "work that uses the +library". The executable is therefore covered by this License. +Section 6 states terms for distribution of such executables. + + When a "work that uses the Library" uses material from a header file +that is part of the Library, the object code for the work may be a +derivative work of the Library even though the source code is not. +Whether this is true is especially significant if the work can be +linked without the Library, or if the work is itself a library. The +threshold for this to be true is not precisely defined by law. + + If such an object file uses only numerical parameters, data +structure layouts and accessors, and small macros and small inline +functions (ten lines or less in length), then the use of the object +file is unrestricted, regardless of whether it is legally a derivative +work. (Executables containing this object code plus portions of the +Library will still fall under Section 6.) + + Otherwise, if the work is a derivative of the Library, you may +distribute the object code for the work under the terms of Section 6. +Any executables containing that work also fall under Section 6, +whether or not they are linked directly with the Library itself. + + 6. As an exception to the Sections above, you may also combine or +link a "work that uses the Library" with the Library to produce a +work containing portions of the Library, and distribute that work +under terms of your choice, provided that the terms permit +modification of the work for the customer's own use and reverse +engineering for debugging such modifications. + + You must give prominent notice with each copy of the work that the +Library is used in it and that the Library and its use are covered by +this License. You must supply a copy of this License. If the work +during execution displays copyright notices, you must include the +copyright notice for the Library among them, as well as a reference +directing the user to the copy of this License. Also, you must do one +of these things: + + a) Accompany the work with the complete corresponding + machine-readable source code for the Library including whatever + changes were used in the work (which must be distributed under + Sections 1 and 2 above); and, if the work is an executable linked + with the Library, with the complete machine-readable "work that + uses the Library", as object code and/or source code, so that the + user can modify the Library and then relink to produce a modified + executable containing the modified Library. (It is understood + that the user who changes the contents of definitions files in the + Library will not necessarily be able to recompile the application + to use the modified definitions.) + + b) Use a suitable shared library mechanism for linking with the + Library. A suitable mechanism is one that (1) uses at run time a + copy of the library already present on the user's computer system, + rather than copying library functions into the executable, and (2) + will operate properly with a modified version of the library, if + the user installs one, as long as the modified version is + interface-compatible with the version that the work was made with. + + c) Accompany the work with a written offer, valid for at + least three years, to give the same user the materials + specified in Subsection 6a, above, for a charge no more + than the cost of performing this distribution. + + d) If distribution of the work is made by offering access to copy + from a designated place, offer equivalent access to copy the above + specified materials from the same place. + + e) Verify that the user has already received a copy of these + materials or that you have already sent this user a copy. + + For an executable, the required form of the "work that uses the +Library" must include any data and utility programs needed for +reproducing the executable from it. However, as a special exception, +the materials to be distributed need not include anything that is +normally distributed (in either source or binary form) with the major +components (compiler, kernel, and so on) of the operating system on +which the executable runs, unless that component itself accompanies +the executable. + + It may happen that this requirement contradicts the license +restrictions of other proprietary libraries that do not normally +accompany the operating system. Such a contradiction means you cannot +use both them and the Library together in an executable that you +distribute. + + 7. You may place library facilities that are a work based on the +Library side-by-side in a single library together with other library +facilities not covered by this License, and distribute such a combined +library, provided that the separate distribution of the work based on +the Library and of the other library facilities is otherwise +permitted, and provided that you do these two things: + + a) Accompany the combined library with a copy of the same work + based on the Library, uncombined with any other library + facilities. This must be distributed under the terms of the + Sections above. + + b) Give prominent notice with the combined library of the fact + that part of it is a work based on the Library, and explaining + where to find the accompanying uncombined form of the same work. + + 8. You may not copy, modify, sublicense, link with, or distribute +the Library except as expressly provided under this License. Any +attempt otherwise to copy, modify, sublicense, link with, or +distribute the Library is void, and will automatically terminate your +rights under this License. However, parties who have received copies, +or rights, from you under this License will not have their licenses +terminated so long as such parties remain in full compliance. + + 9. You are not required to accept this License, since you have not +signed it. However, nothing else grants you permission to modify or +distribute the Library or its derivative works. These actions are +prohibited by law if you do not accept this License. Therefore, by +modifying or distributing the Library (or any work based on the +Library), you indicate your acceptance of this License to do so, and +all its terms and conditions for copying, distributing or modifying +the Library or works based on it. + + 10. Each time you redistribute the Library (or any work based on the +Library), the recipient automatically receives a license from the +original licensor to copy, distribute, link with or modify the Library +subject to these terms and conditions. You may not impose any further +restrictions on the recipients' exercise of the rights granted herein. +You are not responsible for enforcing compliance by third parties with +this License. + + 11. If, as a consequence of a court judgment or allegation of patent +infringement or for any other reason (not limited to patent issues), +conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot +distribute so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you +may not distribute the Library at all. For example, if a patent +license would not permit royalty-free redistribution of the Library by +all those who receive copies directly or indirectly through you, then +the only way you could satisfy both it and this License would be to +refrain entirely from distribution of the Library. + +If any portion of this section is held invalid or unenforceable under any +particular circumstance, the balance of the section is intended to apply, +and the section as a whole is intended to apply in other circumstances. + +It is not the purpose of this section to induce you to infringe any +patents or other property right claims or to contest validity of any +such claims; this section has the sole purpose of protecting the +integrity of the free software distribution system which is +implemented by public license practices. Many people have made +generous contributions to the wide range of software distributed +through that system in reliance on consistent application of that +system; it is up to the author/donor to decide if he or she is willing +to distribute software through any other system and a licensee cannot +impose that choice. + +This section is intended to make thoroughly clear what is believed to +be a consequence of the rest of this License. + + 12. If the distribution and/or use of the Library is restricted in +certain countries either by patents or by copyrighted interfaces, the +original copyright holder who places the Library under this License may add +an explicit geographical distribution limitation excluding those countries, +so that distribution is permitted only in or among countries not thus +excluded. In such case, this License incorporates the limitation as if +written in the body of this License. + + 13. The Free Software Foundation may publish revised and/or new +versions of the Lesser General Public License from time to time. +Such new versions will be similar in spirit to the present version, +but may differ in detail to address new problems or concerns. + +Each version is given a distinguishing version number. If the Library +specifies a version number of this License which applies to it and +"any later version", you have the option of following the terms and +conditions either of that version or of any later version published by +the Free Software Foundation. If the Library does not specify a +license version number, you may choose any version ever published by +the Free Software Foundation. + + 14. If you wish to incorporate parts of the Library into other free +programs whose distribution conditions are incompatible with these, +write to the author to ask for permission. For software which is +copyrighted by the Free Software Foundation, write to the Free +Software Foundation; we sometimes make exceptions for this. Our +decision will be guided by the two goals of preserving the free status +of all derivatives of our free software and of promoting the sharing +and reuse of software generally. + + NO WARRANTY + + 15. BECAUSE THE LIBRARY IS LICENSED FREE OF CHARGE, THERE IS NO +WARRANTY FOR THE LIBRARY, TO THE EXTENT PERMITTED BY APPLICABLE LAW. +EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR +OTHER PARTIES PROVIDE THE LIBRARY "AS IS" WITHOUT WARRANTY OF ANY +KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE +LIBRARY IS WITH YOU. SHOULD THE LIBRARY PROVE DEFECTIVE, YOU ASSUME +THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN +WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY +AND/OR REDISTRIBUTE THE LIBRARY AS PERMITTED ABOVE, BE LIABLE TO YOU +FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR +CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE +LIBRARY (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING +RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A +FAILURE OF THE LIBRARY TO OPERATE WITH ANY OTHER SOFTWARE), EVEN IF +SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH +DAMAGES. + + END OF TERMS AND CONDITIONS \ No newline at end of file diff --git a/contrib/apps/LwipMibCompiler/SharpSnmpLib/sharpsnmplib.snk b/contrib/apps/LwipMibCompiler/SharpSnmpLib/sharpsnmplib.snk new file mode 100644 index 0000000000000000000000000000000000000000..fe6f345af4820b6758f6909a2d489ac524eaf889 GIT binary patch literal 596 zcmV-a0;~N80ssI2Bme+XQ$aES1ONa50098^0|he0B_x?RL7>o-AT$p+6ydg1bA=n+ z(TEjM3jFn-l#LX?9O>S*pzolg8Y)VYs$ys(8qZ|eZM(eWal@XvaKlm#iy_MFa zktG6@Uk-Mk8478nIotb|p1Rj6Z+5X3-=(x)I^Xr$16a|_jT}#2q z4>os95Q>xdhUx6jI|K!RX~hw1f!(|e#!5;$P6^h;CwzlPPCzNSv5=EJ`&INw3Z=7z zpCl>Gkp_CX1_JoM)uqwp7RO;18$@HiTuXhh8G#I(lCQ>caMi|5DbsK=Ij`BFCHTSV z)k^SjW~pvk&&IH|pd-nVVYBt0_=U$ArZ<6G8WE6Fm+B494}Ss(+%Lc_4Ia8yP8XWx z#8OMKTbAeI*{B6YjJi>DVo}}N8VwM^Q}Dt#D!-QYa4P@XO=Y9CSTeQ4?wa literal 0 HcmV?d00001 diff --git a/contrib/apps/LwipMibCompiler/example/compile_udp_mib.cmd b/contrib/apps/LwipMibCompiler/example/compile_udp_mib.cmd new file mode 100644 index 00000000..1c84dbfe --- /dev/null +++ b/contrib/apps/LwipMibCompiler/example/compile_udp_mib.cmd @@ -0,0 +1 @@ +..\LwipMibCompiler\bin\Debug\LwipMibCompiler.exe ..\Mibs\UDP-MIB .\ ..\Mibs\ diff --git a/contrib/apps/LwipMibCompiler/example/compile_udp_mib.sh b/contrib/apps/LwipMibCompiler/example/compile_udp_mib.sh new file mode 100644 index 00000000..93798c01 --- /dev/null +++ b/contrib/apps/LwipMibCompiler/example/compile_udp_mib.sh @@ -0,0 +1 @@ +../LwipMibCompiler/bin/Debug/LwipMibCompiler.exe ../Mibs/UDP-MIB ./ ../Mibs/ diff --git a/contrib/apps/chargen/README b/contrib/apps/chargen/README new file mode 100644 index 00000000..7dc2ee52 --- /dev/null +++ b/contrib/apps/chargen/README @@ -0,0 +1,52 @@ + + CHARGEN + +This file implements a nice example of handling multiple tcp sockets in a +server environment. Just call chargen_init() from your application after +you have initialized lwip and added your network interfaces. Change the +MAX_SERV option to increase or decrease the number of sessions supported. + +chargen will jam as much data as possible into the output socket, so it +will take up a lot of CPU time. Therefore it will be a good idea to run it +as the lowest possible priority (just ahead of any idle task). + +This is also a good example of how to support multiple sessions in an +embedded system where you might not have fork(). The multiple sessions are +all handled by the same thread and select() is used for demultiplexing. + +No makefile is provided, just add chargen to the makefile for your +application. It is OS and HW independent. + +Once the chargen server is running in your application, go to another system +and open a telnet session to your lwip platform at port 19. You should see an +ASCII pattern start to stream on you screen. + +As an example, lets say that your system running lwip is at IP address +192.168.10.244 and you have a linux system connected to it at IP address +192.168.10.59. Issue the following command at a terminal prompt on the linux system: + +telnet 192.168.10.244 19 + +You will see a pattern similar to the following on streaming by on your +screen: + +ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{ +BCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{| +CDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|} +DEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~ +EFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~! +FGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~!" +GHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~!"# +HIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~!"#$ +IJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~!"#$% +JKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~!"#$%& +KLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~!"#$%&' +LMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~!"#$%&'( + +It even works from windows: At a dos prompt you can also issue the same +telnet command and you will get a similar (but much slower, at least on W98) +data stream. + +David Haas + + diff --git a/contrib/apps/chargen/chargen.c b/contrib/apps/chargen/chargen.c new file mode 100644 index 00000000..1e10ecc6 --- /dev/null +++ b/contrib/apps/chargen/chargen.c @@ -0,0 +1,274 @@ +/** @file + * + * chargen server for lwip + */ +/* + * Copyright (c) 2003 NBS Card Technology, Paramus, NJ. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: David Haas + * + * Purpose: chargen server for testing and demonstration purposes + * + * This file implements a nice example of handling multiple tcp sockets in a + * server environment. Just call chargen_init() from your application after + * you have initialized lwip and added your network interfaces. Change the + * MAX_SERV option to increase or decrease the number of sessions supported. + * + * chargen will jam as much data as possible into the output socket, so it + * will take up a lot of CPU time. Therefore it will be a good idea to run it + * as the lowest possible priority (just ahead of any idle task). + * + * This is also a good example of how to support multiple sessions in an + * embedded system where you might not have fork(). + */ + +#include "lwip/opt.h" +#include "lwip/sys.h" +#include "lwip/sockets.h" +#include "lwip/mem.h" + +#include + +#include "chargen.h" + +#if LWIP_SOCKET && LWIP_SOCKET_SELECT + +#define MAX_SERV 5 /* Maximum number of chargen services. Don't need too many */ +#define CHARGEN_THREAD_NAME "chargen" +#define CHARGEN_PRIORITY 254 /* Really low priority */ +#define CHARGEN_THREAD_STACKSIZE 0 +#define SEND_SIZE TCP_SNDLOWAT /* If we only send this much, then when select + says we can send, we know we won't block */ + +struct charcb { + struct charcb *next; + int socket; + struct sockaddr_storage cliaddr; + socklen_t clilen; + char nextchar; +}; + +static struct charcb *charcb_list = 0; + +/************************************************************** + * void close_chargen(struct charcb *p_charcb) + * + * Close the socket and remove this charcb from the list. + **************************************************************/ +static void +close_chargen(struct charcb *p_charcb) +{ + struct charcb *p_search_charcb; + + /* Either an error or tcp connection closed on other + * end. Close here */ + lwip_close(p_charcb->socket); + /* Free charcb */ + if (charcb_list == p_charcb) { + charcb_list = p_charcb->next; + } else { + for (p_search_charcb = charcb_list; p_search_charcb; p_search_charcb = p_search_charcb->next) { + if (p_search_charcb->next == p_charcb) { + p_search_charcb->next = p_charcb->next; + break; + } + } + } + mem_free(p_charcb); +} + +/************************************************************** + * void do_read(struct charcb *p_charcb) + * + * Socket definitely is ready for reading. Read a buffer from the socket and + * discard the data. If no data is read, then the socket is closed and the + * charcb is removed from the list and freed. + **************************************************************/ +static int +do_read(struct charcb *p_charcb) +{ + char buffer[80]; + int readcount; + + /* Read some data */ + readcount = lwip_read(p_charcb->socket, &buffer, 80); + if (readcount <= 0) { + close_chargen(p_charcb); + return -1; + } + return 0; +} + +/************************************************************** + * void chargen_thread(void *arg) + * + * chargen task. This server will wait for connections on well + * known TCP port number: 19. For every connection, the server will + * write as much data as possible to the tcp port. + **************************************************************/ +static void +chargen_thread(void *arg) +{ + int listenfd; +#if LWIP_IPV6 + struct sockaddr_in6 chargen_saddr; +#else /* LWIP_IPV6 */ + struct sockaddr_in chargen_saddr; +#endif /* LWIP_IPV6 */ + fd_set readset; + fd_set writeset; + int i, maxfdp1; + struct charcb *p_charcb; + LWIP_UNUSED_ARG(arg); + + memset(&chargen_saddr, 0, sizeof (chargen_saddr)); +#if LWIP_IPV6 + /* First acquire our socket for listening for connections */ + listenfd = lwip_socket(AF_INET6, SOCK_STREAM, 0); + chargen_saddr.sin6_family = AF_INET6; + chargen_saddr.sin6_addr = in6addr_any; + chargen_saddr.sin6_port = lwip_htons(19); /* Chargen server port */ +#else /* LWIP_IPV6 */ + /* First acquire our socket for listening for connections */ + listenfd = lwip_socket(AF_INET, SOCK_STREAM, 0); + chargen_saddr.sin_family = AF_INET; + chargen_saddr.sin_addr.s_addr = PP_HTONL(INADDR_ANY); + chargen_saddr.sin_port = lwip_htons(19); /* Chargen server port */ +#endif /* LWIP_IPV6 */ + + LWIP_ASSERT("chargen_thread(): Socket create failed.", listenfd >= 0); + + if (lwip_bind(listenfd, (struct sockaddr *) &chargen_saddr, sizeof (chargen_saddr)) == -1) { + LWIP_ASSERT("chargen_thread(): Socket bind failed.", 0); + } + + /* Put socket into listening mode */ + if (lwip_listen(listenfd, MAX_SERV) == -1) { + LWIP_ASSERT("chargen_thread(): Listen failed.", 0); + } + + + /* Wait forever for network input: This could be connections or data */ + for (;;) { + maxfdp1 = listenfd + 1; + + /* Determine what sockets need to be in readset */ + FD_ZERO(&readset); + FD_ZERO(&writeset); + FD_SET(listenfd, &readset); + for (p_charcb = charcb_list; p_charcb; p_charcb = p_charcb->next) { + if (maxfdp1 < p_charcb->socket + 1) { + maxfdp1 = p_charcb->socket + 1; + } + FD_SET(p_charcb->socket, &readset); + FD_SET(p_charcb->socket, &writeset); + } + + /* Wait for data or a new connection */ + i = lwip_select(maxfdp1, &readset, &writeset, 0, 0); + + if (i == 0) { + continue; + } + /* At least one descriptor is ready */ + if (FD_ISSET(listenfd, &readset)) { + /* We have a new connection request!!! */ + /* Lets create a new control block */ + p_charcb = (struct charcb *) mem_malloc(sizeof (struct charcb)); + if (p_charcb) { + p_charcb->socket = lwip_accept(listenfd, + (struct sockaddr *) &p_charcb->cliaddr, + &p_charcb->clilen); + if (p_charcb->socket < 0) { + mem_free(p_charcb); + } else { + /* Keep this tecb in our list */ + p_charcb->next = charcb_list; + charcb_list = p_charcb; + p_charcb->nextchar = 0x21; + } + } else { + /* No memory to accept connection. Just accept and then close */ + int sock; + struct sockaddr cliaddr; + socklen_t clilen; + + sock = lwip_accept(listenfd, &cliaddr, &clilen); + if (sock >= 0) { + lwip_close(sock); + } + } + } + /* Go through list of connected clients and process data */ + for (p_charcb = charcb_list; p_charcb; p_charcb = p_charcb->next) { + if (FD_ISSET(p_charcb->socket, &readset)) { + /* This socket is ready for reading. This could be because someone typed + * some characters or it could be because the socket is now closed. Try reading + * some data to see. */ + if (do_read(p_charcb) < 0) { + break; + } + } + if (FD_ISSET(p_charcb->socket, &writeset)) { + char line[80]; + char setchar = p_charcb->nextchar; + + for (i = 0; i < 59; i++) { + line[i] = setchar; + if (++setchar == 0x7f) { + setchar = 0x21; + } + } + line[i] = 0; + strcat(line, "\n\r"); + if (lwip_write(p_charcb->socket, line, strlen(line)) < 0) { + close_chargen(p_charcb); + break; + } + if (++p_charcb->nextchar == 0x7f) { + p_charcb->nextchar = 0x21; + } + } + } + } +} + + +/************************************************************** + * void chargen_init(void) + * + * This function initializes the chargen service. This function + * may only be called either before or after tasking has started. + **************************************************************/ +void +chargen_init(void) +{ + sys_thread_new(CHARGEN_THREAD_NAME, chargen_thread, 0, CHARGEN_THREAD_STACKSIZE, CHARGEN_PRIORITY); +} + +#endif /* LWIP_SOCKET && LWIP_SOCKET_SELECT */ diff --git a/contrib/apps/chargen/chargen.h b/contrib/apps/chargen/chargen.h new file mode 100644 index 00000000..eb83e4f4 --- /dev/null +++ b/contrib/apps/chargen/chargen.h @@ -0,0 +1,12 @@ +#ifndef LWIP_CHARGEN_H +#define LWIP_CHARGEN_H + +#include "lwip/opt.h" + +#if LWIP_SOCKET + +void chargen_init(void); + +#endif /* LWIP_SOCKET */ + +#endif /* LWIP_CHARGEN_H */ diff --git a/contrib/apps/httpserver/README b/contrib/apps/httpserver/README new file mode 100644 index 00000000..1f18bb81 --- /dev/null +++ b/contrib/apps/httpserver/README @@ -0,0 +1,12 @@ +HTTPSERVER + +This is a demonstration of how to make the most basic kind +of server using lWIP. + +* httpserver-raw.c - uses raw TCP calls (coming soon!) + +* httpserver-netconn.c - uses netconn and netbuf API + +This code updates the examples in Adam Dunkel's original +lwIP documentation to match changes in the code since that +PDF release. diff --git a/contrib/apps/httpserver/httpserver-netconn.c b/contrib/apps/httpserver/httpserver-netconn.c new file mode 100644 index 00000000..bdb1cc03 --- /dev/null +++ b/contrib/apps/httpserver/httpserver-netconn.c @@ -0,0 +1,103 @@ + +#include "lwip/opt.h" +#include "lwip/arch.h" +#include "lwip/api.h" + +#include "httpserver-netconn.h" + +#if LWIP_NETCONN + +#ifndef HTTPD_DEBUG +#define HTTPD_DEBUG LWIP_DBG_OFF +#endif + +static const char http_html_hdr[] = "HTTP/1.1 200 OK\r\nContent-type: text/html\r\n\r\n"; +static const char http_index_html[] = "Congrats!

Welcome to our lwIP HTTP server!

This is a small test page, served by httpserver-netconn."; + +/** Serve one HTTP connection accepted in the http thread */ +static void +http_server_netconn_serve(struct netconn *conn) +{ + struct netbuf *inbuf; + char *buf; + u16_t buflen; + err_t err; + + /* Read the data from the port, blocking if nothing yet there. + We assume the request (the part we care about) is in one netbuf */ + err = netconn_recv(conn, &inbuf); + + if (err == ERR_OK) { + netbuf_data(inbuf, (void**)&buf, &buflen); + + /* Is this an HTTP GET command? (only check the first 5 chars, since + there are other formats for GET, and we're keeping it very simple )*/ + if (buflen>=5 && + buf[0]=='G' && + buf[1]=='E' && + buf[2]=='T' && + buf[3]==' ' && + buf[4]=='/' ) { + + /* Send the HTML header + * subtract 1 from the size, since we dont send the \0 in the string + * NETCONN_NOCOPY: our data is const static, so no need to copy it + */ + netconn_write(conn, http_html_hdr, sizeof(http_html_hdr)-1, NETCONN_NOCOPY); + + /* Send our HTML page */ + netconn_write(conn, http_index_html, sizeof(http_index_html)-1, NETCONN_NOCOPY); + } + } + /* Close the connection (server closes in HTTP) */ + netconn_close(conn); + + /* Delete the buffer (netconn_recv gives us ownership, + so we have to make sure to deallocate the buffer) */ + netbuf_delete(inbuf); +} + +/** The main function, never returns! */ +static void +http_server_netconn_thread(void *arg) +{ + struct netconn *conn, *newconn; + err_t err; + LWIP_UNUSED_ARG(arg); + + /* Create a new TCP connection handle */ + /* Bind to port 80 (HTTP) with default IP address */ +#if LWIP_IPV6 + conn = netconn_new(NETCONN_TCP_IPV6); + netconn_bind(conn, IP6_ADDR_ANY, 80); +#else /* LWIP_IPV6 */ + conn = netconn_new(NETCONN_TCP); + netconn_bind(conn, IP_ADDR_ANY, 80); +#endif /* LWIP_IPV6 */ + LWIP_ERROR("http_server: invalid conn", (conn != NULL), return;); + + /* Put the connection into LISTEN state */ + netconn_listen(conn); + + do { + err = netconn_accept(conn, &newconn); + if (err == ERR_OK) { + http_server_netconn_serve(newconn); + netconn_delete(newconn); + } + } while(err == ERR_OK); + LWIP_DEBUGF(HTTPD_DEBUG, + ("http_server_netconn_thread: netconn_accept received error %d, shutting down", + err)); + netconn_close(conn); + netconn_delete(conn); +} + +/** Initialize the HTTP server (start its thread) */ +void +http_server_netconn_init(void) +{ + sys_thread_new("http_server_netconn", http_server_netconn_thread, NULL, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); +} + +#endif /* LWIP_NETCONN*/ diff --git a/contrib/apps/httpserver/httpserver-netconn.h b/contrib/apps/httpserver/httpserver-netconn.h new file mode 100644 index 00000000..d84b1036 --- /dev/null +++ b/contrib/apps/httpserver/httpserver-netconn.h @@ -0,0 +1,6 @@ +#ifndef LWIP_HTTPSERVER_NETCONN_H +#define LWIP_HTTPSERVER_NETCONN_H + +void http_server_netconn_init(void); + +#endif /* LWIP_HTTPSERVER_NETCONN_H */ diff --git a/contrib/apps/netio/netio.c b/contrib/apps/netio/netio.c new file mode 100644 index 00000000..7d12ac87 --- /dev/null +++ b/contrib/apps/netio/netio.c @@ -0,0 +1,55 @@ +#include "netio.h" + +#include "lwip/opt.h" +#include "lwip/tcp.h" + +/* See http://www.nwlab.net/art/netio/netio.html to get the netio tool */ + +#if LWIP_TCP && LWIP_CALLBACK_API +static err_t +netio_recv(void *arg, struct tcp_pcb *pcb, struct pbuf *p, err_t err) +{ + LWIP_UNUSED_ARG(arg); + + if (err == ERR_OK && p != NULL) { + tcp_recved(pcb, p->tot_len); + pbuf_free(p); + } else { + pbuf_free(p); + } + + if (err == ERR_OK && p == NULL) { + tcp_arg(pcb, NULL); + tcp_sent(pcb, NULL); + tcp_recv(pcb, NULL); + tcp_close(pcb); + } + + return ERR_OK; +} + +static err_t +netio_accept(void *arg, struct tcp_pcb *pcb, err_t err) +{ + LWIP_UNUSED_ARG(arg); + LWIP_UNUSED_ARG(err); + + if (pcb != NULL) { + tcp_arg(pcb, NULL); + tcp_sent(pcb, NULL); + tcp_recv(pcb, netio_recv); + } + return ERR_OK; +} + +void +netio_init(void) +{ + struct tcp_pcb *pcb; + + pcb = tcp_new_ip_type(IPADDR_TYPE_ANY); + tcp_bind(pcb, IP_ANY_TYPE, 18767); + pcb = tcp_listen(pcb); + tcp_accept(pcb, netio_accept); +} +#endif /* LWIP_TCP && LWIP_CALLBACK_API */ diff --git a/contrib/apps/netio/netio.h b/contrib/apps/netio/netio.h new file mode 100644 index 00000000..11d7730f --- /dev/null +++ b/contrib/apps/netio/netio.h @@ -0,0 +1,6 @@ +#ifndef LWIP_NETIO_H +#define LWIP_NETIO_H + +void netio_init(void); + +#endif /* LWIP_NETIO_H */ diff --git a/contrib/apps/ping/ping.c b/contrib/apps/ping/ping.c new file mode 100644 index 00000000..069fadf2 --- /dev/null +++ b/contrib/apps/ping/ping.c @@ -0,0 +1,396 @@ +/** + * @file + * Ping sender module + * + */ + +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + */ + +/** + * This is an example of a "ping" sender (with raw API and socket API). + * It can be used as a start point to maintain opened a network connection, or + * like a network "watchdog" for your device. + * + */ + +#include "lwip/opt.h" + +#if LWIP_RAW /* don't build if not configured for use in lwipopts.h */ + +#include "ping.h" + +#include "lwip/mem.h" +#include "lwip/raw.h" +#include "lwip/icmp.h" +#include "lwip/netif.h" +#include "lwip/sys.h" +#include "lwip/timeouts.h" +#include "lwip/inet_chksum.h" +#include "lwip/prot/ip4.h" + +#if PING_USE_SOCKETS +#include "lwip/sockets.h" +#include "lwip/inet.h" +#include +#endif /* PING_USE_SOCKETS */ + + +/** + * PING_DEBUG: Enable debugging for PING. + */ +#ifndef PING_DEBUG +#define PING_DEBUG LWIP_DBG_ON +#endif + +/** ping receive timeout - in milliseconds */ +#ifndef PING_RCV_TIMEO +#define PING_RCV_TIMEO 1000 +#endif + +/** ping delay - in milliseconds */ +#ifndef PING_DELAY +#define PING_DELAY 1000 +#endif + +/** ping identifier - must fit on a u16_t */ +#ifndef PING_ID +#define PING_ID 0xAFAF +#endif + +/** ping additional data size to include in the packet */ +#ifndef PING_DATA_SIZE +#define PING_DATA_SIZE 32 +#endif + +/** ping result action - no default action */ +#ifndef PING_RESULT +#define PING_RESULT(ping_ok) +#endif + +/* ping variables */ +static const ip_addr_t* ping_target; +static u16_t ping_seq_num; +#ifdef LWIP_DEBUG +static u32_t ping_time; +#endif /* LWIP_DEBUG */ +#if !PING_USE_SOCKETS +static struct raw_pcb *ping_pcb; +#endif /* PING_USE_SOCKETS */ + +/** Prepare a echo ICMP request */ +static void +ping_prepare_echo( struct icmp_echo_hdr *iecho, u16_t len) +{ + size_t i; + size_t data_len = len - sizeof(struct icmp_echo_hdr); + + ICMPH_TYPE_SET(iecho, ICMP_ECHO); + ICMPH_CODE_SET(iecho, 0); + iecho->chksum = 0; + iecho->id = PING_ID; + iecho->seqno = lwip_htons(++ping_seq_num); + + /* fill the additional data buffer with some data */ + for(i = 0; i < data_len; i++) { + ((char*)iecho)[sizeof(struct icmp_echo_hdr) + i] = (char)i; + } + + iecho->chksum = inet_chksum(iecho, len); +} + +#if PING_USE_SOCKETS + +/* Ping using the socket ip */ +static err_t +ping_send(int s, const ip_addr_t *addr) +{ + int err; + struct icmp_echo_hdr *iecho; + struct sockaddr_storage to; + size_t ping_size = sizeof(struct icmp_echo_hdr) + PING_DATA_SIZE; + LWIP_ASSERT("ping_size is too big", ping_size <= 0xffff); + +#if LWIP_IPV6 + if(IP_IS_V6(addr) && !ip6_addr_isipv4mappedipv6(ip_2_ip6(addr))) { + /* todo: support ICMP6 echo */ + return ERR_VAL; + } +#endif /* LWIP_IPV6 */ + + iecho = (struct icmp_echo_hdr *)mem_malloc((mem_size_t)ping_size); + if (!iecho) { + return ERR_MEM; + } + + ping_prepare_echo(iecho, (u16_t)ping_size); + +#if LWIP_IPV4 + if(IP_IS_V4(addr)) { + struct sockaddr_in *to4 = (struct sockaddr_in*)&to; + to4->sin_len = sizeof(to4); + to4->sin_family = AF_INET; + inet_addr_from_ip4addr(&to4->sin_addr, ip_2_ip4(addr)); + } +#endif /* LWIP_IPV4 */ + +#if LWIP_IPV6 + if(IP_IS_V6(addr)) { + struct sockaddr_in6 *to6 = (struct sockaddr_in6*)&to; + to6->sin6_len = sizeof(to6); + to6->sin6_family = AF_INET6; + inet6_addr_from_ip6addr(&to6->sin6_addr, ip_2_ip6(addr)); + } +#endif /* LWIP_IPV6 */ + + err = lwip_sendto(s, iecho, ping_size, 0, (struct sockaddr*)&to, sizeof(to)); + + mem_free(iecho); + + return (err ? ERR_OK : ERR_VAL); +} + +static void +ping_recv(int s) +{ + char buf[64]; + int len; + struct sockaddr_storage from; + int fromlen = sizeof(from); + + while((len = lwip_recvfrom(s, buf, sizeof(buf), 0, (struct sockaddr*)&from, (socklen_t*)&fromlen)) > 0) { + if (len >= (int)(sizeof(struct ip_hdr)+sizeof(struct icmp_echo_hdr))) { + ip_addr_t fromaddr; + memset(&fromaddr, 0, sizeof(fromaddr)); + +#if LWIP_IPV4 + if(from.ss_family == AF_INET) { + struct sockaddr_in *from4 = (struct sockaddr_in*)&from; + inet_addr_to_ip4addr(ip_2_ip4(&fromaddr), &from4->sin_addr); + IP_SET_TYPE_VAL(fromaddr, IPADDR_TYPE_V4); + } +#endif /* LWIP_IPV4 */ + +#if LWIP_IPV6 + if(from.ss_family == AF_INET6) { + struct sockaddr_in6 *from6 = (struct sockaddr_in6*)&from; + inet6_addr_to_ip6addr(ip_2_ip6(&fromaddr), &from6->sin6_addr); + IP_SET_TYPE_VAL(fromaddr, IPADDR_TYPE_V6); + } +#endif /* LWIP_IPV6 */ + + LWIP_DEBUGF( PING_DEBUG, ("ping: recv ")); + ip_addr_debug_print_val(PING_DEBUG, fromaddr); + LWIP_DEBUGF( PING_DEBUG, (" %"U32_F" ms\n", (sys_now() - ping_time))); + + /* todo: support ICMP6 echo */ +#if LWIP_IPV4 + if (IP_IS_V4_VAL(fromaddr)) { + struct ip_hdr *iphdr; + struct icmp_echo_hdr *iecho; + + iphdr = (struct ip_hdr *)buf; + iecho = (struct icmp_echo_hdr *)(buf + (IPH_HL(iphdr) * 4)); + if ((iecho->id == PING_ID) && (iecho->seqno == lwip_htons(ping_seq_num))) { + /* do some ping result processing */ + PING_RESULT((ICMPH_TYPE(iecho) == ICMP_ER)); + return; + } else { + LWIP_DEBUGF( PING_DEBUG, ("ping: drop\n")); + } + } +#endif /* LWIP_IPV4 */ + } + fromlen = sizeof(from); + } + + if (len == 0) { + LWIP_DEBUGF( PING_DEBUG, ("ping: recv - %"U32_F" ms - timeout\n", (sys_now()-ping_time))); + } + + /* do some ping result processing */ + PING_RESULT(0); +} + +static void +ping_thread(void *arg) +{ + int s; + int ret; + +#if LWIP_SO_SNDRCVTIMEO_NONSTANDARD + int timeout = PING_RCV_TIMEO; +#else + struct timeval timeout; + timeout.tv_sec = PING_RCV_TIMEO/1000; + timeout.tv_usec = (PING_RCV_TIMEO%1000)*1000; +#endif + LWIP_UNUSED_ARG(arg); + +#if LWIP_IPV6 + if(IP_IS_V4(ping_target) || ip6_addr_isipv4mappedipv6(ip_2_ip6(ping_target))) { + s = lwip_socket(AF_INET6, SOCK_RAW, IP_PROTO_ICMP); + } else { + s = lwip_socket(AF_INET6, SOCK_RAW, IP6_NEXTH_ICMP6); + } +#else + s = lwip_socket(AF_INET, SOCK_RAW, IP_PROTO_ICMP); +#endif + if (s < 0) { + return; + } + + ret = lwip_setsockopt(s, SOL_SOCKET, SO_RCVTIMEO, &timeout, sizeof(timeout)); + LWIP_ASSERT("setting receive timeout failed", ret == 0); + LWIP_UNUSED_ARG(ret); + + while (1) { + if (ping_send(s, ping_target) == ERR_OK) { + LWIP_DEBUGF( PING_DEBUG, ("ping: send ")); + ip_addr_debug_print(PING_DEBUG, ping_target); + LWIP_DEBUGF( PING_DEBUG, ("\n")); + +#ifdef LWIP_DEBUG + ping_time = sys_now(); +#endif /* LWIP_DEBUG */ + ping_recv(s); + } else { + LWIP_DEBUGF( PING_DEBUG, ("ping: send ")); + ip_addr_debug_print(PING_DEBUG, ping_target); + LWIP_DEBUGF( PING_DEBUG, (" - error\n")); + } + sys_msleep(PING_DELAY); + } +} + +#else /* PING_USE_SOCKETS */ + +/* Ping using the raw ip */ +static u8_t +ping_recv(void *arg, struct raw_pcb *pcb, struct pbuf *p, const ip_addr_t *addr) +{ + struct icmp_echo_hdr *iecho; + LWIP_UNUSED_ARG(arg); + LWIP_UNUSED_ARG(pcb); + LWIP_UNUSED_ARG(addr); + LWIP_ASSERT("p != NULL", p != NULL); + + if ((p->tot_len >= (PBUF_IP_HLEN + sizeof(struct icmp_echo_hdr))) && + pbuf_remove_header(p, PBUF_IP_HLEN) == 0) { + iecho = (struct icmp_echo_hdr *)p->payload; + + if ((iecho->id == PING_ID) && (iecho->seqno == lwip_htons(ping_seq_num))) { + LWIP_DEBUGF( PING_DEBUG, ("ping: recv ")); + ip_addr_debug_print(PING_DEBUG, addr); + LWIP_DEBUGF( PING_DEBUG, (" %"U32_F" ms\n", (sys_now()-ping_time))); + + /* do some ping result processing */ + PING_RESULT(1); + pbuf_free(p); + return 1; /* eat the packet */ + } + /* not eaten, restore original packet */ + pbuf_add_header(p, PBUF_IP_HLEN); + } + + return 0; /* don't eat the packet */ +} + +static void +ping_send(struct raw_pcb *raw, const ip_addr_t *addr) +{ + struct pbuf *p; + struct icmp_echo_hdr *iecho; + size_t ping_size = sizeof(struct icmp_echo_hdr) + PING_DATA_SIZE; + + LWIP_DEBUGF( PING_DEBUG, ("ping: send ")); + ip_addr_debug_print(PING_DEBUG, addr); + LWIP_DEBUGF( PING_DEBUG, ("\n")); + LWIP_ASSERT("ping_size <= 0xffff", ping_size <= 0xffff); + + p = pbuf_alloc(PBUF_IP, (u16_t)ping_size, PBUF_RAM); + if (!p) { + return; + } + if ((p->len == p->tot_len) && (p->next == NULL)) { + iecho = (struct icmp_echo_hdr *)p->payload; + + ping_prepare_echo(iecho, (u16_t)ping_size); + + raw_sendto(raw, p, addr); +#ifdef LWIP_DEBUG + ping_time = sys_now(); +#endif /* LWIP_DEBUG */ + } + pbuf_free(p); +} + +static void +ping_timeout(void *arg) +{ + struct raw_pcb *pcb = (struct raw_pcb*)arg; + + LWIP_ASSERT("ping_timeout: no pcb given!", pcb != NULL); + + ping_send(pcb, ping_target); + + sys_timeout(PING_DELAY, ping_timeout, pcb); +} + +static void +ping_raw_init(void) +{ + ping_pcb = raw_new(IP_PROTO_ICMP); + LWIP_ASSERT("ping_pcb != NULL", ping_pcb != NULL); + + raw_recv(ping_pcb, ping_recv, NULL); + raw_bind(ping_pcb, IP_ADDR_ANY); + sys_timeout(PING_DELAY, ping_timeout, ping_pcb); +} + +void +ping_send_now(void) +{ + LWIP_ASSERT("ping_pcb != NULL", ping_pcb != NULL); + ping_send(ping_pcb, ping_target); +} + +#endif /* PING_USE_SOCKETS */ + +void +ping_init(const ip_addr_t* ping_addr) +{ + ping_target = ping_addr; + +#if PING_USE_SOCKETS + sys_thread_new("ping_thread", ping_thread, NULL, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); +#else /* PING_USE_SOCKETS */ + ping_raw_init(); +#endif /* PING_USE_SOCKETS */ +} + +#endif /* LWIP_RAW */ diff --git a/contrib/apps/ping/ping.h b/contrib/apps/ping/ping.h new file mode 100644 index 00000000..1f21c7b0 --- /dev/null +++ b/contrib/apps/ping/ping.h @@ -0,0 +1,19 @@ +#ifndef LWIP_PING_H +#define LWIP_PING_H + +#include "lwip/ip_addr.h" + +/** + * PING_USE_SOCKETS: Set to 1 to use sockets, otherwise the raw api is used + */ +#ifndef PING_USE_SOCKETS +#define PING_USE_SOCKETS LWIP_SOCKET +#endif + +void ping_init(const ip_addr_t* ping_addr); + +#if !PING_USE_SOCKETS +void ping_send_now(void); +#endif /* !PING_USE_SOCKETS */ + +#endif /* LWIP_PING_H */ diff --git a/contrib/apps/rtp/rtp.c b/contrib/apps/rtp/rtp.c new file mode 100644 index 00000000..2c4b5b93 --- /dev/null +++ b/contrib/apps/rtp/rtp.c @@ -0,0 +1,308 @@ +/** + * @file + * RTP client/server module + * + */ + +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + */ + +#include "lwip/opt.h" + +#if LWIP_SOCKET && LWIP_IGMP /* don't build if not configured for use in lwipopts.h */ + +#include "lwip/sys.h" +#include "lwip/sockets.h" + +#include "rtp.h" + +#include "rtpdata.h" + +#include + +/** This is an example of a "RTP" client/server based on a MPEG4 bitstream (with socket API). + */ + +/** + * RTP_DEBUG: Enable debugging for RTP. + */ +#ifndef RTP_DEBUG +#define RTP_DEBUG LWIP_DBG_ON +#endif + +/** RTP stream port */ +#ifndef RTP_STREAM_PORT +#define RTP_STREAM_PORT 4000 +#endif + +/** RTP stream multicast address as IPv4 address in "u32_t" format */ +#ifndef RTP_STREAM_ADDRESS +#define RTP_STREAM_ADDRESS inet_addr("232.0.0.0") +#endif + +/** RTP send delay - in milliseconds */ +#ifndef RTP_SEND_DELAY +#define RTP_SEND_DELAY 40 +#endif + +/** RTP receive timeout - in milliseconds */ +#ifndef RTP_RECV_TIMEOUT +#define RTP_RECV_TIMEOUT 2000 +#endif + +/** RTP stats display period - in received packets */ +#ifndef RTP_RECV_STATS +#define RTP_RECV_STATS 50 +#endif + +/** RTP macro to let the application process the data */ +#ifndef RTP_RECV_PROCESSING +#define RTP_RECV_PROCESSING(p,s) +#endif + +/** RTP packet/payload size */ +#define RTP_PACKET_SIZE 1500 +#define RTP_PAYLOAD_SIZE 1024 + +/** RTP header constants */ +#define RTP_VERSION 0x80 +#define RTP_TIMESTAMP_INCREMENT 3600 +#define RTP_SSRC 0 +#define RTP_PAYLOADTYPE 96 +#define RTP_MARKER_MASK 0x80 + +/** RTP message header */ +#ifdef PACK_STRUCT_USE_INCLUDES +# include "arch/bpstruct.h" +#endif +PACK_STRUCT_BEGIN +struct rtp_hdr { + PACK_STRUCT_FLD_8(u8_t version); + PACK_STRUCT_FLD_8(u8_t payloadtype); + PACK_STRUCT_FIELD(u16_t seqNum); + PACK_STRUCT_FIELD(u32_t timestamp); + PACK_STRUCT_FIELD(u32_t ssrc); +} PACK_STRUCT_STRUCT; +PACK_STRUCT_END +#ifdef PACK_STRUCT_USE_INCLUDES +# include "arch/epstruct.h" +#endif + +/** RTP packets */ +static u8_t rtp_send_packet[RTP_PACKET_SIZE]; +static u8_t rtp_recv_packet[RTP_PACKET_SIZE]; + +/** + * RTP send packets + */ +static void +rtp_send_packets( int sock, struct sockaddr_in* to) +{ + struct rtp_hdr* rtphdr; + u8_t* rtp_payload; + size_t rtp_payload_size; + size_t rtp_data_index; + + /* prepare RTP packet */ + rtphdr = (struct rtp_hdr*)rtp_send_packet; + rtphdr->version = RTP_VERSION; + rtphdr->payloadtype = 0; + rtphdr->ssrc = PP_HTONL(RTP_SSRC); + rtphdr->timestamp = lwip_htonl(lwip_ntohl(rtphdr->timestamp) + RTP_TIMESTAMP_INCREMENT); + + /* send RTP stream packets */ + rtp_data_index = 0; + do { + rtp_payload = rtp_send_packet+sizeof(struct rtp_hdr); + rtp_payload_size = LWIP_MIN(RTP_PAYLOAD_SIZE, sizeof(rtp_data) - rtp_data_index); + + MEMCPY(rtp_payload, rtp_data + rtp_data_index, rtp_payload_size); + + /* set MARKER bit in RTP header on the last packet of an image */ + if ((rtp_data_index + rtp_payload_size) >= sizeof(rtp_data)) { + rtphdr->payloadtype = RTP_PAYLOADTYPE | RTP_MARKER_MASK; + } else { + rtphdr->payloadtype = RTP_PAYLOADTYPE; + } + + /* send RTP stream packet */ + if (lwip_sendto(sock, rtp_send_packet, sizeof(struct rtp_hdr) + rtp_payload_size, + 0, (struct sockaddr *)to, sizeof(struct sockaddr)) >= 0) { + rtphdr->seqNum = lwip_htons((u16_t)(lwip_ntohs(rtphdr->seqNum) + 1)); + rtp_data_index += rtp_payload_size; + } else { + LWIP_DEBUGF(RTP_DEBUG, ("rtp_sender: not sendto==%i\n", errno)); + } + }while (rtp_data_index < sizeof(rtp_data)); +} + +/** + * RTP send thread + */ +static void +rtp_send_thread(void *arg) +{ + int sock; + struct sockaddr_in local; + struct sockaddr_in to; + u32_t rtp_stream_address; + + LWIP_UNUSED_ARG(arg); + + /* initialize RTP stream address */ + rtp_stream_address = RTP_STREAM_ADDRESS; + + /* if we got a valid RTP stream address... */ + if (rtp_stream_address != 0) { + /* create new socket */ + sock = lwip_socket(AF_INET, SOCK_DGRAM, 0); + if (sock >= 0) { + /* prepare local address */ + memset(&local, 0, sizeof(local)); + local.sin_family = AF_INET; + local.sin_port = PP_HTONS(INADDR_ANY); + local.sin_addr.s_addr = PP_HTONL(INADDR_ANY); + + /* bind to local address */ + if (lwip_bind(sock, (struct sockaddr *)&local, sizeof(local)) == 0) { + /* prepare RTP stream address */ + memset(&to, 0, sizeof(to)); + to.sin_family = AF_INET; + to.sin_port = PP_HTONS(RTP_STREAM_PORT); + to.sin_addr.s_addr = rtp_stream_address; + + /* send RTP packets */ + memset(rtp_send_packet, 0, sizeof(rtp_send_packet)); + while (1) { + rtp_send_packets( sock, &to); + sys_msleep(RTP_SEND_DELAY); + } + } + + /* close the socket */ + lwip_close(sock); + } + } +} + +/** + * RTP recv thread + */ +static void +rtp_recv_thread(void *arg) +{ + int sock; + struct sockaddr_in local; + struct sockaddr_in from; + int fromlen; + struct ip_mreq ipmreq; + struct rtp_hdr* rtphdr; + u32_t rtp_stream_address; + int timeout; + int result; + int recvrtppackets = 0; + int lostrtppackets = 0; + u16_t lastrtpseq = 0; + + LWIP_UNUSED_ARG(arg); + + /* initialize RTP stream address */ + rtp_stream_address = RTP_STREAM_ADDRESS; + + /* if we got a valid RTP stream address... */ + if (rtp_stream_address != 0) { + /* create new socket */ + sock = lwip_socket(AF_INET, SOCK_DGRAM, 0); + if (sock >= 0) { + /* prepare local address */ + memset(&local, 0, sizeof(local)); + local.sin_family = AF_INET; + local.sin_port = PP_HTONS(RTP_STREAM_PORT); + local.sin_addr.s_addr = PP_HTONL(INADDR_ANY); + + /* bind to local address */ + if (lwip_bind(sock, (struct sockaddr *)&local, sizeof(local)) == 0) { + /* set recv timeout */ + timeout = RTP_RECV_TIMEOUT; + result = lwip_setsockopt(sock, SOL_SOCKET, SO_RCVTIMEO, (char *)&timeout, sizeof(timeout)); + if (result) { + LWIP_DEBUGF(RTP_DEBUG, ("rtp_recv_thread: setsockopt(SO_RCVTIMEO) failed: errno=%d\n", errno)); + } + + /* prepare multicast "ip_mreq" struct */ + ipmreq.imr_multiaddr.s_addr = rtp_stream_address; + ipmreq.imr_interface.s_addr = PP_HTONL(INADDR_ANY); + + /* join multicast group */ + if (lwip_setsockopt(sock, IPPROTO_IP, IP_ADD_MEMBERSHIP, &ipmreq, sizeof(ipmreq)) == 0) { + /* receive RTP packets */ + while(1) { + fromlen = sizeof(from); + result = lwip_recvfrom(sock, rtp_recv_packet, sizeof(rtp_recv_packet), 0, + (struct sockaddr *)&from, (socklen_t *)&fromlen); + if ((result > 0) && ((size_t)result >= sizeof(struct rtp_hdr))) { + size_t recved = (size_t)result; + rtphdr = (struct rtp_hdr *)rtp_recv_packet; + recvrtppackets++; + if ((lastrtpseq == 0) || ((lastrtpseq + 1) == lwip_ntohs(rtphdr->seqNum))) { + RTP_RECV_PROCESSING((rtp_recv_packet + sizeof(rtp_hdr)), (recved-sizeof(rtp_hdr))); + LWIP_UNUSED_ARG(recved); /* just in case... */ + } else { + lostrtppackets++; + } + lastrtpseq = lwip_ntohs(rtphdr->seqNum); + if ((recvrtppackets % RTP_RECV_STATS) == 0) { + LWIP_DEBUGF(RTP_DEBUG, ("rtp_recv_thread: recv %6i packet(s) / lost %4i packet(s) (%.4f%%)...\n", recvrtppackets, lostrtppackets, (lostrtppackets*100.0)/recvrtppackets)); + } + } else { + LWIP_DEBUGF(RTP_DEBUG, ("rtp_recv_thread: recv timeout...\n")); + } + } + + /* leave multicast group */ + /* TODO: this code is never reached + result = lwip_setsockopt(sock, IPPROTO_IP, IP_DROP_MEMBERSHIP, &ipmreq, sizeof(ipmreq)); + if (result) { + LWIP_DEBUGF(RTP_DEBUG, ("rtp_recv_thread: setsockopt(IP_DROP_MEMBERSHIP) failed: errno=%d\n", errno)); + }*/ + } + } + + /* close the socket */ + lwip_close(sock); + } + } +} + +void +rtp_init(void) +{ + sys_thread_new("rtp_send_thread", rtp_send_thread, NULL, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); + sys_thread_new("rtp_recv_thread", rtp_recv_thread, NULL, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); +} + +#endif /* LWIP_SOCKET && LWIP_IGMP */ diff --git a/contrib/apps/rtp/rtp.h b/contrib/apps/rtp/rtp.h new file mode 100644 index 00000000..c53d89bd --- /dev/null +++ b/contrib/apps/rtp/rtp.h @@ -0,0 +1,8 @@ +#ifndef LWIP_RTP_H +#define LWIP_RTP_H + +#if LWIP_SOCKET && LWIP_IGMP +void rtp_init(void); +#endif /* LWIP_SOCKET && LWIP_IGMP */ + +#endif /* LWIP_RTP_H */ diff --git a/contrib/apps/rtp/rtpdata.h b/contrib/apps/rtp/rtpdata.h new file mode 100644 index 00000000..d52bff12 --- /dev/null +++ b/contrib/apps/rtp/rtpdata.h @@ -0,0 +1,2040 @@ +const unsigned char rtp_data[] = { + 0x00, 0x00, 0x01, 0xb0, 0xf5, 0x00, 0x00, 0x01, + 0xb5, 0x09, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, + 0x01, 0x20, 0x00, 0x86, 0x84, 0x00, 0x67, 0x0c, + 0x2c, 0x10, 0x90, 0x51, 0x8f, 0x00, 0x00, 0x01, + 0xb2, 0x44, 0x69, 0x76, 0x58, 0x35, 0x30, 0x33, + 0x62, 0x31, 0x33, 0x39, 0x33, 0x70, 0x00, 0x00, + 0x01, 0xb2, 0x58, 0x76, 0x69, 0x44, 0x30, 0x30, + 0x33, 0x39, 0x00, 0x00, 0x01, 0xb6, 0x18, 0x60, + 0xab, 0x94, 0x03, 0xc0, 0xca, 0xc0, 0x3e, 0xd0, + 0x78, 0x4f, 0xf9, 0x44, 0x91, 0xe9, 0xfa, 0xc9, + 0xfe, 0xa1, 0xa4, 0xc1, 0x66, 0x03, 0x2e, 0x39, + 0x0c, 0x7e, 0x0e, 0xaa, 0x02, 0x92, 0xf8, 0xd5, + 0xec, 0xe2, 0x35, 0xb9, 0x35, 0x0c, 0xb3, 0x82, + 0xa6, 0xad, 0xd0, 0xd1, 0xca, 0xb8, 0xe8, 0x10, + 0x55, 0x78, 0x03, 0xc0, 0x38, 0x15, 0xba, 0xce, + 0xe2, 0xea, 0x00, 0xc3, 0x60, 0xb1, 0x70, 0xf4, + 0x14, 0x6c, 0x35, 0x4d, 0xe8, 0x5a, 0x1e, 0x58, + 0xdf, 0x03, 0x01, 0xfd, 0x2a, 0x45, 0x54, 0xca, + 0x0f, 0x05, 0x00, 0xbd, 0xd0, 0xcc, 0xb4, 0x90, + 0x4c, 0x24, 0x6b, 0x20, 0x30, 0x95, 0xf1, 0x2f, + 0xb4, 0xa7, 0x83, 0xdc, 0xce, 0x03, 0x05, 0x02, + 0x1a, 0x5d, 0x1a, 0x2c, 0xbf, 0x51, 0x28, 0x8b, + 0xd7, 0x6b, 0xdd, 0xf9, 0x44, 0xbb, 0x0e, 0x91, + 0x64, 0xb9, 0xa6, 0x33, 0xd3, 0x6e, 0x34, 0xa4, + 0xac, 0xac, 0x53, 0x0d, 0x79, 0xbe, 0xae, 0x5b, + 0x47, 0x2e, 0xde, 0x62, 0xa1, 0x53, 0xcd, 0x7d, + 0xfe, 0x66, 0xa1, 0x2b, 0x9c, 0xe1, 0xca, 0xbc, + 0xea, 0x84, 0x1c, 0x68, 0xff, 0xbb, 0x28, 0xa1, + 0x26, 0x18, 0x99, 0xb1, 0x4f, 0x68, 0x80, 0x28, + 0x0e, 0x20, 0xc3, 0xbf, 0x0f, 0x80, 0xf8, 0x90, + 0x3b, 0x1f, 0x16, 0xe4, 0xb0, 0x6f, 0x44, 0x16, + 0x38, 0xb8, 0xc3, 0x81, 0x22, 0xfa, 0xe3, 0x09, + 0xf6, 0x61, 0x6d, 0xef, 0x67, 0x56, 0x3b, 0x57, + 0xb5, 0x23, 0x03, 0x1f, 0x6d, 0x0d, 0xb9, 0x08, + 0xc6, 0x43, 0xba, 0xd1, 0x40, 0x5a, 0xe8, 0xca, + 0x9e, 0x17, 0x1f, 0x6d, 0x5d, 0x16, 0x98, 0xab, + 0xe6, 0x99, 0xf6, 0x37, 0xc6, 0x1b, 0xdc, 0xb9, + 0xb3, 0xfe, 0x9a, 0x4b, 0x1e, 0xec, 0xf9, 0x5f, + 0xb8, 0xc7, 0xfc, 0xbe, 0x6c, 0xd5, 0xf3, 0x9b, + 0x17, 0x8b, 0x89, 0x82, 0xff, 0x30, 0x19, 0x20, + 0x30, 0xe6, 0x29, 0x96, 0x75, 0x75, 0xeb, 0x00, + 0x3f, 0xa1, 0x20, 0x5b, 0x06, 0x11, 0x98, 0x1f, + 0xb2, 0xad, 0x3a, 0x59, 0xe6, 0x7d, 0x38, 0xa4, + 0xb1, 0x4f, 0xfe, 0xdf, 0x3a, 0x4b, 0xdb, 0x69, + 0xc3, 0x93, 0xcc, 0xdf, 0x5e, 0xf7, 0x2a, 0x38, + 0x2a, 0x89, 0x84, 0x80, 0x6c, 0x12, 0x44, 0x95, + 0x78, 0xd8, 0x7e, 0x3f, 0x4e, 0xcf, 0x3f, 0x39, + 0xba, 0x9f, 0xfa, 0x8f, 0x2f, 0x62, 0xfa, 0xf0, + 0xb6, 0x20, 0xa7, 0x06, 0x02, 0x3f, 0x28, 0x96, + 0x80, 0xf0, 0x99, 0x8e, 0x82, 0x15, 0x11, 0x87, + 0x35, 0xa4, 0xfd, 0x53, 0xcb, 0xcd, 0x68, 0x38, + 0xe8, 0xdb, 0x8d, 0xc2, 0x71, 0xbc, 0x65, 0x3e, + 0xac, 0x5b, 0x0d, 0xae, 0xc0, 0x3c, 0x77, 0xfe, + 0xe8, 0xde, 0x3c, 0xbd, 0xdb, 0xb3, 0x39, 0x09, + 0x56, 0x0a, 0xa2, 0xfe, 0x40, 0xd7, 0x6f, 0x56, + 0x07, 0x02, 0xec, 0xd6, 0xed, 0x06, 0x5e, 0x2f, + 0xb6, 0xce, 0xf1, 0x4f, 0x16, 0x88, 0x04, 0x41, + 0x79, 0x0e, 0x98, 0xbe, 0x54, 0x75, 0x1a, 0xd6, + 0x50, 0xcf, 0x82, 0x6a, 0xf7, 0xaf, 0x7f, 0xfb, + 0x6d, 0x88, 0x97, 0x24, 0x40, 0x68, 0xa0, 0x57, + 0x79, 0x57, 0xe9, 0x6b, 0xaa, 0xe5, 0xe4, 0x2b, + 0xaa, 0x14, 0x64, 0x90, 0x6c, 0x50, 0x4a, 0xe3, + 0x97, 0x43, 0xf6, 0x81, 0x90, 0xa9, 0xa6, 0xba, + 0xb1, 0x21, 0x12, 0x5f, 0xe0, 0xdf, 0x88, 0x86, + 0x03, 0x30, 0x94, 0xb2, 0x6d, 0xd2, 0xdc, 0x45, + 0x14, 0x54, 0x1d, 0xe8, 0x38, 0x8d, 0xbe, 0x8a, + 0xaf, 0x20, 0xa2, 0x3e, 0xa2, 0x5c, 0xc6, 0xae, + 0xe6, 0xc4, 0x48, 0xec, 0xea, 0xc7, 0x4e, 0x17, + 0xb2, 0x91, 0x52, 0xb4, 0xe9, 0x8b, 0x15, 0xfb, + 0x99, 0x7c, 0xda, 0xb8, 0xad, 0x57, 0x31, 0x5b, + 0x5b, 0x67, 0xaa, 0x1e, 0x93, 0x76, 0xa5, 0x25, + 0xd9, 0x0d, 0x70, 0xd8, 0xb9, 0x11, 0x34, 0xfd, + 0xaf, 0x0e, 0x0d, 0x42, 0x57, 0x97, 0x26, 0x06, + 0xdf, 0x29, 0x7e, 0x79, 0x72, 0x22, 0x36, 0xa5, + 0x9f, 0x6a, 0x16, 0x24, 0x6f, 0x10, 0x56, 0xec, + 0x5b, 0x46, 0x50, 0x94, 0x88, 0xc4, 0xfa, 0x9e, + 0xd8, 0x5b, 0xb7, 0x50, 0x72, 0x62, 0x25, 0xaa, + 0x39, 0x84, 0x69, 0xaa, 0xfc, 0xbf, 0x9b, 0x45, + 0xf7, 0xc5, 0x41, 0x97, 0x41, 0xc7, 0xac, 0x7f, + 0x68, 0x92, 0xab, 0x64, 0xaa, 0x46, 0x32, 0x84, + 0x77, 0x1b, 0xfc, 0xbc, 0x5a, 0x42, 0x28, 0xfa, + 0x3e, 0x55, 0xf4, 0xe9, 0x44, 0xac, 0xc5, 0x4a, + 0x6c, 0x93, 0xde, 0x03, 0x6d, 0xdc, 0xb8, 0x5b, + 0xb7, 0x83, 0x7e, 0xc2, 0xaa, 0x33, 0x70, 0x34, + 0x41, 0x46, 0x25, 0xa5, 0x6f, 0xdb, 0x96, 0x0f, + 0xd3, 0xab, 0xd4, 0x17, 0x65, 0x96, 0x0c, 0x1e, + 0x39, 0x4c, 0x9d, 0x90, 0x3f, 0x5b, 0x8d, 0xaa, + 0xce, 0xac, 0xa6, 0x50, 0xf0, 0x66, 0xb2, 0x30, + 0xce, 0x42, 0x61, 0xaa, 0xb6, 0x7e, 0xca, 0xbf, + 0xfd, 0xbf, 0xef, 0x51, 0xed, 0xdf, 0x95, 0x0b, + 0xa7, 0x34, 0x24, 0x13, 0x62, 0x44, 0x81, 0xdf, + 0x3a, 0x8e, 0x95, 0x91, 0x67, 0xd7, 0x57, 0x54, + 0x92, 0x1d, 0x79, 0xa3, 0x2a, 0xf3, 0x0c, 0x7a, + 0x12, 0xa8, 0x33, 0xf9, 0x05, 0x02, 0x7b, 0xef, + 0x12, 0x18, 0xab, 0x8b, 0x40, 0x38, 0x7e, 0x0c, + 0x1f, 0x04, 0x30, 0x62, 0xa8, 0xd5, 0xd9, 0x78, + 0xdd, 0x1c, 0xb4, 0x57, 0xc1, 0x83, 0xc4, 0x41, + 0x08, 0x72, 0x5c, 0xc2, 0xb6, 0xd3, 0xd4, 0x85, + 0x4a, 0x7e, 0x58, 0xc3, 0x19, 0xfa, 0xdd, 0x51, + 0x03, 0x85, 0x1d, 0xe9, 0x10, 0x5e, 0x8c, 0x8f, + 0x41, 0x03, 0xe9, 0xbc, 0xa8, 0xba, 0xeb, 0x73, + 0x7d, 0x85, 0x69, 0xc7, 0x3b, 0xd9, 0x49, 0x0b, + 0x39, 0x03, 0x12, 0x11, 0x8b, 0x72, 0x97, 0x62, + 0x5f, 0xfe, 0x59, 0x4d, 0xc0, 0x3a, 0xdf, 0xcb, + 0x3e, 0x80, 0x39, 0xd5, 0x7a, 0xb1, 0x45, 0x86, + 0x06, 0xf6, 0xb6, 0xda, 0x98, 0xa1, 0x41, 0xae, + 0x12, 0xd3, 0xd1, 0x71, 0x5a, 0xa5, 0x40, 0xc0, + 0x8a, 0x3f, 0x4e, 0xac, 0x78, 0x93, 0x55, 0x31, + 0xfc, 0xcf, 0x67, 0x93, 0x52, 0xc4, 0x53, 0x0d, + 0xdf, 0x49, 0xd7, 0x83, 0x00, 0x18, 0x4b, 0xcd, + 0x65, 0xaf, 0xb5, 0xd5, 0x6c, 0xc4, 0x14, 0xb7, + 0xdb, 0x9d, 0x06, 0x17, 0xca, 0xe1, 0x60, 0x07, + 0x6d, 0x57, 0xd0, 0xfb, 0x1a, 0xf5, 0xb2, 0x56, + 0xca, 0xea, 0x21, 0x77, 0x41, 0xc0, 0x46, 0xc8, + 0x85, 0xe3, 0x15, 0x6a, 0xdb, 0x80, 0x47, 0x6d, + 0x05, 0x44, 0x06, 0x04, 0xf6, 0x92, 0x24, 0xdb, + 0x9b, 0x6f, 0xfa, 0x8d, 0x72, 0x2d, 0x75, 0x7e, + 0x33, 0x9c, 0xe7, 0x06, 0xbb, 0x3d, 0xa4, 0xb7, + 0xee, 0x31, 0x46, 0x4b, 0x91, 0xe2, 0xb0, 0x54, + 0x5c, 0x78, 0x9e, 0x45, 0x90, 0xe4, 0x76, 0xbe, + 0xe1, 0x4c, 0xae, 0x89, 0x20, 0x6e, 0x77, 0x76, + 0x94, 0x63, 0x93, 0xaa, 0x62, 0x0e, 0x28, 0x7b, + 0xec, 0xc9, 0xc5, 0x25, 0x64, 0x5a, 0xe9, 0xcc, + 0x91, 0x1a, 0x9c, 0xcf, 0x91, 0x47, 0x32, 0x12, + 0x9f, 0x8b, 0x36, 0x07, 0x33, 0x4c, 0x45, 0x06, + 0x19, 0xdb, 0x61, 0xc5, 0x68, 0xb7, 0xab, 0x2e, + 0x7b, 0x5c, 0xa6, 0x4c, 0x6e, 0x08, 0x5f, 0xc1, + 0xc4, 0x99, 0x64, 0xef, 0xd8, 0x05, 0x5c, 0x0f, + 0x76, 0xdd, 0xab, 0x4f, 0x8e, 0x29, 0x54, 0x59, + 0x1d, 0x30, 0x33, 0xfb, 0x3b, 0x43, 0x96, 0xf4, + 0x52, 0x47, 0x2c, 0x66, 0x81, 0xca, 0xa6, 0x73, + 0x51, 0xc1, 0xc0, 0x32, 0x98, 0xa3, 0x41, 0x1c, + 0x40, 0x5e, 0x22, 0x05, 0xa0, 0xdb, 0xb0, 0x88, + 0xdf, 0xee, 0x2f, 0x3a, 0xbb, 0xe2, 0xef, 0x79, + 0x09, 0xa6, 0x0c, 0x0f, 0x4c, 0xdc, 0x81, 0xcc, + 0x3d, 0x36, 0x52, 0x4e, 0xbd, 0x44, 0x0d, 0x0d, + 0x84, 0xf5, 0x74, 0x33, 0x14, 0x1a, 0x87, 0xcb, + 0xcc, 0x93, 0xa3, 0x69, 0x21, 0x20, 0x26, 0x23, + 0xd9, 0x95, 0x0c, 0x22, 0x2b, 0x2f, 0x0d, 0xf4, + 0x34, 0x74, 0x53, 0x16, 0x5d, 0x60, 0x96, 0x3e, + 0x53, 0xd3, 0xcc, 0xc5, 0x72, 0x49, 0xc2, 0x4d, + 0xea, 0x02, 0x21, 0x7f, 0xbd, 0x80, 0x1d, 0xf0, + 0x87, 0xe6, 0xdb, 0xcc, 0x92, 0xdd, 0xfe, 0x78, + 0x4a, 0xd2, 0xf9, 0x77, 0x24, 0xed, 0x5a, 0x31, + 0x6c, 0xec, 0x71, 0x5d, 0x85, 0xad, 0xb3, 0xb9, + 0x6f, 0x11, 0x2d, 0xfa, 0x42, 0x2b, 0xcb, 0x01, + 0x08, 0x18, 0x11, 0x56, 0xcb, 0x01, 0xe1, 0xe0, + 0x1f, 0x06, 0xe8, 0x3c, 0x6c, 0x01, 0xaa, 0x49, + 0x86, 0xbf, 0x63, 0x79, 0x03, 0xbe, 0xd8, 0x47, + 0x4f, 0x26, 0x0d, 0x11, 0xe3, 0x76, 0x27, 0x0e, + 0xf1, 0x79, 0x44, 0x46, 0xc3, 0x3b, 0x4f, 0x05, + 0x20, 0x40, 0xff, 0x59, 0x6f, 0xaa, 0x17, 0xf4, + 0x40, 0xa1, 0x15, 0x0a, 0x4c, 0x0f, 0x94, 0x81, + 0xb8, 0x0c, 0x8e, 0x8d, 0xc3, 0x80, 0xc1, 0xeb, + 0x02, 0x16, 0xf4, 0xbe, 0xca, 0xa4, 0x3a, 0xa8, + 0xec, 0x0c, 0x89, 0xc4, 0x59, 0xe4, 0x8b, 0x9a, + 0x40, 0x7e, 0xae, 0xea, 0xa0, 0xeb, 0x6a, 0x99, + 0x95, 0x73, 0x79, 0x62, 0x18, 0xb8, 0x38, 0x64, + 0x73, 0x97, 0xb7, 0x58, 0xd1, 0x2d, 0x8d, 0xbe, + 0xf3, 0x13, 0x2f, 0x7c, 0xc0, 0x1d, 0x61, 0x4e, + 0x4c, 0xe6, 0x95, 0xce, 0x97, 0xf9, 0xbc, 0xf4, + 0x5a, 0xce, 0xa1, 0x3b, 0x39, 0xef, 0xc5, 0x39, + 0x4b, 0x72, 0x1b, 0xa5, 0x41, 0x92, 0x27, 0xda, + 0x72, 0xc2, 0xbb, 0xd4, 0x8d, 0x34, 0x97, 0x9d, + 0xb7, 0xde, 0xe7, 0xb0, 0x64, 0x8a, 0x0a, 0x0c, + 0x0e, 0x60, 0x30, 0x62, 0xb8, 0xbb, 0x9f, 0x96, + 0x05, 0x31, 0x33, 0xfa, 0x3c, 0x1f, 0xf4, 0x3d, + 0x04, 0x3c, 0x5c, 0x1e, 0x1b, 0xfe, 0xf1, 0xfe, + 0xa1, 0xb1, 0x03, 0x54, 0x99, 0x50, 0x61, 0xc5, + 0xbc, 0x2d, 0x00, 0xfe, 0xaf, 0x01, 0xe1, 0x7f, + 0xeb, 0xd4, 0x77, 0x0d, 0xb4, 0x0a, 0x9c, 0x18, + 0x92, 0x3d, 0x5a, 0xbf, 0xc0, 0x98, 0x66, 0xcc, + 0x06, 0x09, 0x6a, 0x50, 0xe9, 0x18, 0x32, 0x00, + 0x78, 0xc8, 0x06, 0x68, 0xac, 0x8b, 0x3f, 0x38, + 0xbf, 0x4a, 0x33, 0x30, 0x1c, 0x4f, 0xae, 0x16, + 0x44, 0x98, 0x24, 0x08, 0xc9, 0x07, 0xed, 0x62, + 0xbb, 0x89, 0x15, 0xca, 0x0f, 0x09, 0x00, 0x7a, + 0x51, 0xc5, 0x93, 0x54, 0x45, 0xfb, 0x73, 0xdf, + 0xe9, 0x42, 0x07, 0x90, 0x10, 0xcb, 0xdb, 0x2b, + 0x47, 0x20, 0x2b, 0xaa, 0xf4, 0x5c, 0xa4, 0x28, + 0x38, 0x9d, 0x5a, 0x44, 0x22, 0x0d, 0x54, 0x81, + 0x1d, 0x07, 0x0a, 0x37, 0xee, 0x49, 0x8b, 0xfb, + 0x3a, 0x8d, 0x7e, 0x83, 0x84, 0xfd, 0xf7, 0x98, + 0xad, 0xac, 0xa7, 0x46, 0x07, 0x62, 0x72, 0x56, + 0x1c, 0x03, 0x05, 0x4d, 0x70, 0xd8, 0x60, 0x62, + 0x8a, 0x8d, 0xe8, 0x23, 0x03, 0x04, 0x6d, 0x60, + 0xdc, 0x2a, 0x27, 0x92, 0x08, 0x8f, 0x65, 0xed, + 0xbd, 0xca, 0xa5, 0x1d, 0x80, 0x8d, 0x11, 0x03, + 0x83, 0xc7, 0x05, 0x04, 0x85, 0xcd, 0x2f, 0x3a, + 0xd4, 0x83, 0x02, 0x91, 0x91, 0xc5, 0x76, 0xb5, + 0x79, 0xcb, 0xfb, 0x29, 0x22, 0x90, 0x1e, 0x09, + 0x9f, 0x2c, 0x07, 0x77, 0xa0, 0x38, 0xf8, 0x63, + 0xf5, 0x2a, 0xd4, 0xc5, 0x0f, 0xd7, 0x43, 0x38, + 0xb5, 0xe8, 0x38, 0x94, 0x29, 0x71, 0x68, 0xb4, + 0x99, 0x0a, 0x4d, 0xf6, 0x94, 0x9d, 0x8e, 0x96, + 0x58, 0x88, 0x63, 0x46, 0x02, 0x9d, 0x64, 0x83, + 0x70, 0x72, 0x32, 0x6f, 0x90, 0x1d, 0x0e, 0xd5, + 0xf5, 0xd9, 0x0d, 0xe8, 0x0f, 0xa3, 0x20, 0x5f, + 0x26, 0x59, 0xc3, 0x50, 0x33, 0x04, 0xc9, 0x0c, + 0xc8, 0xa2, 0xce, 0x12, 0x43, 0x44, 0xa3, 0x55, + 0xe5, 0x07, 0x05, 0x1a, 0x69, 0xa8, 0xc4, 0x39, + 0x92, 0xa2, 0x44, 0x0e, 0x08, 0xe0, 0xa2, 0x4a, + 0x28, 0xd7, 0x80, 0xe1, 0x37, 0x96, 0x0c, 0x49, + 0x28, 0x0f, 0x3c, 0xc8, 0xe2, 0xc1, 0x5d, 0x4f, + 0xd4, 0x48, 0xa2, 0x21, 0x59, 0xf1, 0x0d, 0x9f, + 0xaa, 0xc6, 0x77, 0xc8, 0xe5, 0xce, 0x0d, 0xca, + 0x02, 0x87, 0x4a, 0x49, 0x01, 0xc8, 0x48, 0xc8, + 0xf3, 0x1b, 0x2f, 0xdf, 0x6c, 0xcb, 0x88, 0x66, + 0xf1, 0x40, 0xbd, 0x6a, 0x34, 0xfc, 0xb0, 0x89, + 0xde, 0x11, 0xc5, 0xc6, 0xa2, 0x44, 0xc6, 0xdb, + 0x67, 0xff, 0xd1, 0x79, 0x01, 0xa4, 0x9e, 0xf0, + 0x1f, 0x10, 0x57, 0x2b, 0x24, 0xc5, 0x1c, 0x09, + 0x45, 0x7e, 0xcc, 0x55, 0xe5, 0x0d, 0x64, 0xe2, + 0x2c, 0xe4, 0xea, 0xe4, 0x81, 0x31, 0xfd, 0x61, + 0x38, 0x8f, 0xba, 0x1f, 0xb4, 0xd9, 0x6c, 0xa8, + 0xac, 0xe4, 0xe8, 0xca, 0x9e, 0xee, 0xa9, 0x51, + 0xd7, 0xe9, 0x9d, 0xcc, 0xb0, 0x7c, 0x24, 0xc5, + 0x13, 0xa0, 0x89, 0x78, 0x0b, 0x15, 0xd1, 0x09, + 0xe4, 0xbf, 0x34, 0x6f, 0xcf, 0x0b, 0x82, 0x51, + 0xb3, 0x70, 0x7d, 0x83, 0xe1, 0x24, 0x0d, 0x33, + 0xad, 0xda, 0x5d, 0xfe, 0xe7, 0x38, 0x54, 0x52, + 0x0e, 0x3d, 0xd5, 0xec, 0xef, 0x0b, 0x05, 0xe1, + 0x16, 0xa9, 0x45, 0xec, 0x5f, 0x81, 0xb9, 0xc8, + 0xff, 0x36, 0x0e, 0x0e, 0x01, 0x81, 0x31, 0xae, + 0x4b, 0x35, 0xd8, 0x18, 0x17, 0x8c, 0x33, 0x7a, + 0xa2, 0xee, 0x06, 0x5b, 0xd8, 0x0b, 0x07, 0xb0, + 0x52, 0xbe, 0xf6, 0xf4, 0x38, 0xec, 0x35, 0x6e, + 0x45, 0xc1, 0x5e, 0x51, 0xd3, 0x67, 0x93, 0x6d, + 0xaf, 0xd0, 0xe0, 0x2a, 0xea, 0x6a, 0x1e, 0x03, + 0x0c, 0x38, 0xa4, 0x38, 0xea, 0x34, 0x41, 0x99, + 0xcb, 0xe0, 0xcd, 0xda, 0xf2, 0xee, 0x86, 0x28, + 0x83, 0x38, 0x0b, 0x13, 0xd1, 0x73, 0x1e, 0x4f, + 0xb5, 0x18, 0x7d, 0xef, 0xed, 0x09, 0xdf, 0xf7, + 0x4a, 0x91, 0xdb, 0x41, 0x84, 0xf7, 0x07, 0x14, + 0x15, 0x3b, 0x01, 0xc5, 0x28, 0x41, 0x78, 0x9f, + 0xf6, 0x92, 0xce, 0x06, 0xe0, 0xb9, 0x9d, 0xa0, + 0xee, 0xf0, 0x25, 0xa9, 0xd4, 0xe0, 0x71, 0xb4, + 0x66, 0x0c, 0x11, 0x47, 0x01, 0x89, 0x34, 0x62, + 0x11, 0x60, 0x27, 0xa0, 0xfb, 0x1f, 0xfe, 0xd1, + 0x50, 0x6e, 0x0e, 0x23, 0xc3, 0xd8, 0x0e, 0xe8, + 0x53, 0xa7, 0x94, 0x03, 0x12, 0x41, 0x9a, 0x90, + 0x97, 0xce, 0x87, 0x0d, 0x42, 0x9d, 0x07, 0xce, + 0xff, 0xef, 0x4e, 0x07, 0x1a, 0x31, 0x08, 0x92, + 0x98, 0x0c, 0x49, 0x46, 0x74, 0x22, 0x2a, 0xf1, + 0x01, 0x51, 0x48, 0x26, 0xe9, 0xf5, 0xcd, 0xb0, + 0x0c, 0x2e, 0xa1, 0x3d, 0x29, 0x05, 0x4f, 0xa0, + 0x12, 0x06, 0x08, 0x9c, 0x94, 0x08, 0x60, 0xce, + 0xd0, 0x96, 0x81, 0x81, 0x18, 0x62, 0x03, 0xcc, + 0xba, 0x15, 0xd6, 0x91, 0x11, 0x14, 0x7e, 0xb2, + 0x7e, 0xd4, 0x56, 0x74, 0x37, 0xdc, 0x82, 0xfb, + 0x21, 0xa1, 0x93, 0x91, 0x60, 0x3d, 0xcb, 0x28, + 0x4b, 0x52, 0xe9, 0x26, 0x4a, 0x0c, 0x32, 0xca, + 0x31, 0xab, 0x10, 0x19, 0x6e, 0x76, 0x50, 0x1e, + 0x7c, 0x89, 0x2f, 0x42, 0x4a, 0x46, 0xf8, 0xb1, + 0x5e, 0xdc, 0xbe, 0x81, 0x4a, 0x0c, 0x4e, 0x6a, + 0x31, 0x70, 0xd4, 0x17, 0x62, 0x30, 0xf8, 0xbb, + 0xaa, 0xba, 0x06, 0x98, 0xf4, 0x05, 0x40, 0x7c, + 0x8e, 0x81, 0x22, 0xc7, 0x8b, 0xf2, 0x67, 0x49, + 0x64, 0x58, 0x1c, 0xb8, 0xa0, 0x6d, 0xb9, 0xea, + 0x5b, 0x11, 0x47, 0x18, 0xe7, 0xd0, 0xbc, 0xce, + 0xf3, 0x9d, 0x19, 0x10, 0x92, 0x95, 0x45, 0x47, + 0x78, 0x87, 0x81, 0x32, 0x6b, 0xc0, 0xe5, 0x7a, + 0x79, 0x25, 0x37, 0x0d, 0x05, 0x06, 0x73, 0x39, + 0x50, 0x9f, 0x8f, 0x5d, 0x09, 0x24, 0x34, 0x32, + 0x18, 0x04, 0x62, 0x9c, 0xe8, 0x1e, 0x06, 0x52, + 0x88, 0x1e, 0x26, 0x01, 0x30, 0x36, 0x81, 0x60, + 0x63, 0x41, 0x6a, 0x77, 0xa8, 0x42, 0xd4, 0xba, + 0x1f, 0x0e, 0x79, 0x06, 0x2d, 0x16, 0x83, 0x00, + 0xe3, 0xe6, 0xcb, 0xba, 0x82, 0x4a, 0x27, 0xd7, + 0x5e, 0xdc, 0x58, 0x44, 0x19, 0x28, 0x0c, 0xc7, + 0x2f, 0x57, 0xb2, 0x83, 0x83, 0x40, 0xcc, 0x1c, + 0xb8, 0x99, 0x41, 0xb9, 0xb0, 0xc8, 0x1f, 0x36, + 0x00, 0x75, 0x14, 0xa9, 0x25, 0x34, 0x87, 0x83, + 0x05, 0x13, 0x16, 0x7d, 0x91, 0x40, 0x3b, 0x9c, + 0xe8, 0x38, 0x57, 0x17, 0xd2, 0x03, 0xc0, 0xff, + 0x4e, 0x0c, 0x1f, 0x16, 0x96, 0xc0, 0xe3, 0x8d, + 0x62, 0x75, 0xb8, 0x04, 0xae, 0x03, 0x80, 0x88, + 0xa1, 0x56, 0x31, 0x57, 0x66, 0x2d, 0x8a, 0xef, + 0x11, 0x6f, 0xca, 0xe9, 0x47, 0x79, 0xd0, 0x9d, + 0x0c, 0xb0, 0x18, 0x47, 0x06, 0x03, 0x57, 0x2c, + 0xda, 0x8f, 0x4a, 0x80, 0xd9, 0xa0, 0x62, 0x80, + 0x60, 0x4d, 0x95, 0x18, 0x8c, 0x18, 0x45, 0xcb, + 0x17, 0xad, 0x34, 0xa3, 0xd2, 0xa1, 0xb5, 0xd3, + 0x32, 0xd9, 0xdb, 0xd1, 0x82, 0x98, 0x18, 0x83, + 0xa9, 0xcd, 0xb5, 0x20, 0x77, 0x03, 0x5c, 0x5f, + 0xa6, 0xdb, 0x48, 0x12, 0xd7, 0x46, 0xc8, 0xd1, + 0x78, 0x1c, 0x1d, 0x17, 0x04, 0x91, 0xe8, 0xbc, + 0x2a, 0xa0, 0x53, 0x83, 0x11, 0x29, 0xff, 0x18, + 0xfe, 0x8d, 0x98, 0x6e, 0xad, 0x11, 0x65, 0xa0, + 0xc8, 0x3c, 0x48, 0x48, 0x13, 0x55, 0x28, 0xf5, + 0x61, 0x9d, 0xe0, 0x38, 0x5e, 0x12, 0xc0, 0x70, + 0x44, 0xbf, 0x6f, 0x25, 0x9d, 0x2b, 0xcf, 0xb6, + 0x79, 0x3d, 0xcf, 0x45, 0x32, 0xa8, 0x19, 0x67, + 0x3a, 0x14, 0x43, 0x6d, 0x7d, 0xa1, 0x04, 0xb7, + 0x3e, 0xd3, 0x75, 0x45, 0x2a, 0x6a, 0x6d, 0xb2, + 0x12, 0x87, 0x90, 0xa0, 0x6b, 0xbf, 0x1a, 0x5b, + 0xb7, 0x14, 0xd0, 0x26, 0x88, 0x5e, 0xb8, 0x4d, + 0x70, 0x19, 0x65, 0x36, 0xdd, 0x9c, 0x40, 0x7a, + 0xbf, 0x21, 0xc8, 0x38, 0x38, 0x01, 0xca, 0x1e, + 0xc5, 0xee, 0xb3, 0x40, 0xc0, 0x9a, 0xd6, 0x24, + 0xa7, 0xb4, 0x6b, 0x06, 0x18, 0xfc, 0x1c, 0x11, + 0xaf, 0x6d, 0xcc, 0xbd, 0x5e, 0xc8, 0x8e, 0x07, + 0xbc, 0xe0, 0x52, 0x8f, 0x9a, 0xb1, 0x74, 0x40, + 0xe4, 0x63, 0x20, 0x99, 0x4f, 0xa8, 0xbc, 0x0e, + 0xf2, 0x86, 0x80, 0xea, 0x09, 0x8a, 0xec, 0xdd, + 0xe7, 0x39, 0x49, 0x6e, 0xc4, 0x5c, 0x5d, 0x0d, + 0x45, 0xd1, 0x7b, 0x8b, 0xd5, 0xaf, 0x43, 0x17, + 0xe9, 0x49, 0xac, 0x6d, 0x10, 0xa6, 0x4e, 0x5e, + 0xa8, 0xc8, 0x20, 0xca, 0x54, 0x8e, 0xa1, 0x15, + 0xb5, 0x0d, 0xa0, 0x66, 0x70, 0x93, 0x6f, 0x01, + 0xc4, 0x2b, 0xc1, 0x46, 0xbd, 0x74, 0x96, 0x05, + 0x75, 0x50, 0xc0, 0xc3, 0x8b, 0x22, 0x25, 0x07, + 0x1d, 0xf6, 0x70, 0x92, 0x2d, 0x17, 0x09, 0xcb, + 0xef, 0xbd, 0x88, 0xd6, 0x46, 0x7b, 0xbd, 0xa0, + 0xe7, 0xe9, 0xc7, 0x09, 0x01, 0xc0, 0xb1, 0x29, + 0x3a, 0xc1, 0xdd, 0x05, 0xd2, 0x6a, 0x60, 0x73, + 0x06, 0x54, 0x26, 0x84, 0x0b, 0x22, 0x42, 0x7e, + 0x0d, 0x62, 0xfe, 0xc5, 0xb8, 0x30, 0x3a, 0xa2, + 0x5f, 0x5b, 0xee, 0x6c, 0xc2, 0x50, 0x7a, 0x18, + 0x00, 0xdf, 0x86, 0x41, 0x97, 0x16, 0x3d, 0xd9, + 0xcb, 0x09, 0x46, 0x40, 0xb0, 0x04, 0xe5, 0xa0, + 0xbb, 0xa9, 0x8d, 0x84, 0xa6, 0xd4, 0xb7, 0x53, + 0xb2, 0xdf, 0x33, 0x16, 0x41, 0x38, 0x2f, 0x3c, + 0xa8, 0x21, 0xef, 0x3e, 0xd6, 0xcd, 0x8b, 0xf9, + 0x1f, 0x03, 0x7a, 0x29, 0x18, 0x84, 0x26, 0x7f, + 0xe1, 0xdf, 0x98, 0x1c, 0x36, 0x58, 0xdc, 0x51, + 0xde, 0x2d, 0x35, 0x1f, 0x69, 0xa7, 0x0a, 0x82, + 0x08, 0xe9, 0x59, 0x7f, 0x2b, 0x4a, 0x39, 0x25, + 0x96, 0x5f, 0xf1, 0x08, 0xa6, 0x5b, 0x4b, 0x67, + 0x51, 0x12, 0xf0, 0xf2, 0xae, 0x68, 0xbb, 0x72, + 0xef, 0x0a, 0xb6, 0x02, 0xbd, 0x14, 0x42, 0x37, + 0x1b, 0x80, 0xe2, 0x3a, 0xb7, 0xb4, 0x1c, 0x0a, + 0x9b, 0xa0, 0xea, 0x11, 0x21, 0x4b, 0x07, 0xc9, + 0x93, 0xb7, 0x7b, 0xd1, 0x13, 0x8d, 0x62, 0xfd, + 0x28, 0xbd, 0x44, 0x0e, 0x0f, 0x4e, 0x49, 0xb4, + 0x43, 0x11, 0xc0, 0x38, 0x38, 0x08, 0xd2, 0xd9, + 0x2e, 0x2c, 0x03, 0x9f, 0xa7, 0xd6, 0x37, 0x46, + 0x01, 0x1f, 0x58, 0x56, 0xc0, 0x9c, 0x07, 0x0c, + 0x9d, 0xba, 0x0a, 0x9a, 0x15, 0xd4, 0x63, 0x6a, + 0x13, 0x69, 0xe0, 0x6f, 0x4c, 0xd0, 0x53, 0xc0, + 0xf6, 0x6f, 0x3c, 0xb7, 0x7d, 0xcb, 0x3b, 0x40, + 0x8e, 0xfa, 0x04, 0x48, 0x16, 0x35, 0x8b, 0x7d, + 0xbc, 0x81, 0xaa, 0xb2, 0xe8, 0xbf, 0x7a, 0x0c, + 0x1c, 0xfe, 0x86, 0x26, 0x8e, 0x86, 0x25, 0x83, + 0x9d, 0x07, 0x11, 0xcf, 0xb8, 0x5b, 0x88, 0xe9, + 0x5e, 0x12, 0x21, 0x13, 0xed, 0xb1, 0xfa, 0x0c, + 0x87, 0xf0, 0xa3, 0x96, 0x05, 0x75, 0x33, 0x7a, + 0x3d, 0x1f, 0x09, 0x49, 0x58, 0x56, 0x9d, 0x95, + 0x5e, 0x52, 0x9b, 0x30, 0x3d, 0x64, 0x3d, 0xe4, + 0xde, 0xcb, 0x3c, 0x59, 0x56, 0x0d, 0xd4, 0x94, + 0x43, 0xf6, 0x24, 0xb7, 0x19, 0x1f, 0xa5, 0x6f, + 0xd7, 0xc5, 0x9f, 0x56, 0xde, 0xe7, 0x38, 0x8a, + 0xed, 0x3c, 0x15, 0xc1, 0x9b, 0x6b, 0x55, 0xab, + 0x11, 0xa4, 0xce, 0xef, 0xd2, 0x4c, 0x88, 0x00, + 0xad, 0x15, 0x18, 0xff, 0xb5, 0xad, 0xdf, 0x6f, + 0xa4, 0xdc, 0xbc, 0xab, 0x84, 0x65, 0x30, 0xab, + 0x09, 0x6b, 0xf4, 0xff, 0x43, 0x78, 0x30, 0x08, + 0xa7, 0xa0, 0xa9, 0xa2, 0xf0, 0x8b, 0x72, 0x82, + 0xa0, 0x5c, 0x12, 0xb0, 0x27, 0xe1, 0x84, 0x09, + 0x27, 0x6e, 0x2d, 0x62, 0xc6, 0xd1, 0x85, 0x1a, + 0x72, 0xb1, 0xbf, 0x83, 0xcc, 0x7f, 0xfa, 0x13, + 0x54, 0xe0, 0x71, 0xfa, 0x0e, 0x23, 0x7d, 0x06, + 0x25, 0x18, 0x4a, 0x11, 0x69, 0x43, 0x76, 0xe8, + 0xc8, 0x18, 0x23, 0x96, 0x15, 0x2c, 0x7f, 0x4e, + 0x8b, 0x01, 0x83, 0x6d, 0x18, 0x83, 0x04, 0x5b, + 0x80, 0xa8, 0xc1, 0x9d, 0x01, 0xfa, 0xe2, 0xa3, + 0x8d, 0x4f, 0xe9, 0x63, 0x0d, 0xfe, 0xe7, 0x7b, + 0xcc, 0x5e, 0x86, 0xf5, 0x1b, 0xae, 0x0e, 0x93, + 0xa0, 0x1f, 0x36, 0x33, 0xe8, 0x0e, 0x74, 0xcf, + 0xa0, 0x43, 0x11, 0x82, 0x6d, 0x5a, 0xa8, 0xa6, + 0x1a, 0xcb, 0xa1, 0xb4, 0x99, 0x6a, 0x08, 0x8f, + 0x68, 0x30, 0x2c, 0x5f, 0x51, 0xfd, 0x10, 0x1a, + 0xff, 0xd6, 0xec, 0xe7, 0x7a, 0xc7, 0xaf, 0x49, + 0x16, 0xbb, 0x51, 0x50, 0xad, 0xbf, 0x8b, 0x76, + 0x86, 0x20, 0x9b, 0x11, 0x81, 0xc5, 0x1b, 0x6f, + 0x06, 0xdf, 0xfc, 0x28, 0xda, 0xe9, 0x03, 0x6a, + 0xc1, 0x83, 0x96, 0xc1, 0x86, 0x3a, 0x12, 0xd2, + 0x8a, 0x8c, 0x83, 0x85, 0xd0, 0xa0, 0xf3, 0x2e, + 0x86, 0xee, 0xe1, 0xb7, 0xa1, 0x6d, 0x16, 0x2e, + 0xf4, 0x46, 0xc1, 0x45, 0x99, 0xd2, 0x6d, 0x72, + 0xd2, 0xe6, 0x52, 0x84, 0x07, 0x84, 0xf3, 0xc0, + 0xe0, 0x0e, 0xa2, 0x1f, 0x6c, 0xce, 0xf6, 0x83, + 0xc1, 0xc0, 0x3f, 0x47, 0xb9, 0x68, 0xc8, 0x11, + 0x04, 0x14, 0x40, 0xc3, 0x43, 0x13, 0xa0, 0xf3, + 0xff, 0xff, 0xbe, 0xfe, 0x58, 0xd4, 0x51, 0x7b, + 0x0a, 0x01, 0x62, 0x48, 0xe1, 0x9b, 0x6b, 0x65, + 0x8b, 0x54, 0x41, 0xc8, 0x9d, 0x57, 0x57, 0x64, + 0xf7, 0x51, 0x83, 0x0c, 0x47, 0x25, 0x01, 0xc8, + 0xad, 0x4a, 0x58, 0x4b, 0x05, 0xe0, 0xc0, 0x3d, + 0x10, 0x4e, 0xb5, 0x85, 0xb8, 0xbc, 0xb0, 0x1e, + 0x2a, 0x00, 0xb0, 0x58, 0xbd, 0x5e, 0xca, 0x4a, + 0x0c, 0x2e, 0x19, 0x82, 0xe5, 0x3e, 0x8b, 0xa0, + 0xe0, 0xc8, 0x8a, 0xae, 0xe7, 0xbe, 0x55, 0xbc, + 0x45, 0x4a, 0x60, 0x60, 0x09, 0xcb, 0x89, 0x4c, + 0x32, 0x08, 0x6d, 0x09, 0x0d, 0xb4, 0xd2, 0x54, + 0xf8, 0xa8, 0xab, 0xca, 0x6f, 0xc4, 0xbf, 0x00, + 0xe6, 0xb6, 0x8c, 0x4f, 0xc6, 0x16, 0xf7, 0x67, + 0x1a, 0x9b, 0x2a, 0x1c, 0xe0, 0x0e, 0x44, 0x80, + 0x80, 0x34, 0xb2, 0x9d, 0x59, 0x58, 0x17, 0xd1, + 0x87, 0x81, 0x60, 0x2c, 0xf8, 0x0a, 0xad, 0x69, + 0x49, 0x5d, 0x40, 0x43, 0x1b, 0x4e, 0x83, 0x7c, + 0x48, 0x88, 0x92, 0x09, 0x3f, 0x05, 0x78, 0xf6, + 0xc0, 0x60, 0xc9, 0xea, 0xd0, 0x66, 0xd3, 0x20, + 0x08, 0x5b, 0xa0, 0xaf, 0x1d, 0xb3, 0xa1, 0x35, + 0x2e, 0x1c, 0xc8, 0x33, 0x09, 0x1a, 0x34, 0x6d, + 0x83, 0x06, 0x61, 0x21, 0x5a, 0x99, 0x57, 0xd1, + 0xcc, 0xa2, 0x96, 0xed, 0x05, 0xc3, 0x61, 0x84, + 0x1e, 0x07, 0xfc, 0x3e, 0x55, 0x2d, 0x01, 0xe4, + 0x92, 0xc4, 0x56, 0xd6, 0xff, 0xc0, 0xa0, 0x6a, + 0x23, 0x89, 0x29, 0xc4, 0x76, 0x43, 0xf6, 0x7c, + 0xd6, 0x55, 0x0a, 0x0a, 0xb1, 0x00, 0x13, 0xaf, + 0xa2, 0xa0, 0xe4, 0x5c, 0x11, 0xb2, 0xa2, 0x51, + 0x80, 0x46, 0x98, 0xc3, 0x1e, 0x1b, 0x35, 0xc2, + 0x5c, 0xb5, 0xf4, 0xfb, 0xf2, 0x1c, 0x83, 0x83, + 0x80, 0x7c, 0xf8, 0x01, 0xfd, 0x9a, 0x85, 0x49, + 0x69, 0xc7, 0xd8, 0x1a, 0xc3, 0x0f, 0xa3, 0x27, + 0xb5, 0xa6, 0xc5, 0xdb, 0x3a, 0x15, 0x6e, 0x5e, + 0xdb, 0x93, 0x60, 0x8b, 0x28, 0x31, 0x48, 0xc0, + 0x35, 0x09, 0x3b, 0x5f, 0x28, 0x18, 0x54, 0x01, + 0x80, 0x66, 0x8c, 0x8e, 0x7e, 0xd6, 0xaa, 0x8d, + 0xa9, 0x9c, 0xa6, 0xe3, 0x10, 0xb6, 0x8c, 0x16, + 0xd0, 0x97, 0x4f, 0x78, 0x15, 0x21, 0x88, 0xb8, + 0x85, 0xb9, 0x01, 0xd1, 0x67, 0x69, 0xfd, 0xbe, + 0xe4, 0x52, 0xd6, 0xc4, 0x6a, 0x24, 0x07, 0x54, + 0x28, 0x08, 0xa6, 0x6f, 0x94, 0x03, 0x22, 0xf8, + 0x67, 0x46, 0x20, 0x9a, 0x4c, 0x93, 0x90, 0x1c, + 0x09, 0x90, 0x32, 0x46, 0x32, 0x0a, 0x2d, 0xe8, + 0x27, 0xc5, 0xdc, 0xf6, 0xc9, 0xde, 0x4e, 0x1a, + 0x45, 0x02, 0x5b, 0xab, 0xeb, 0x4a, 0x2f, 0x4d, + 0x95, 0x29, 0xe8, 0x0f, 0x04, 0xcc, 0xb8, 0xbc, + 0x6b, 0x32, 0x06, 0x08, 0x0d, 0xc0, 0x5f, 0xdb, + 0x24, 0x46, 0xb1, 0xbe, 0x85, 0x5a, 0xeb, 0x4a, + 0xa0, 0x40, 0x42, 0x48, 0x59, 0x37, 0xbd, 0x18, + 0x82, 0x72, 0x63, 0xfd, 0xa5, 0x12, 0x83, 0x90, + 0x85, 0x1e, 0xd5, 0x83, 0x35, 0xe0, 0xb9, 0x02, + 0xc7, 0xcd, 0x88, 0x23, 0x86, 0xe7, 0xc7, 0x12, + 0x4b, 0xcd, 0x1c, 0x59, 0x51, 0x29, 0x0c, 0x3b, + 0xc9, 0xd0, 0x4d, 0xf9, 0x6a, 0x33, 0xba, 0xef, + 0x2e, 0xe5, 0xd8, 0x69, 0x1a, 0x14, 0x44, 0x29, + 0xe6, 0xcb, 0xee, 0x7f, 0xd6, 0x9b, 0x25, 0x0c, + 0x51, 0x05, 0x48, 0xe4, 0xf9, 0x6a, 0xfd, 0xc9, + 0x9d, 0x8b, 0xd9, 0xd1, 0x3a, 0x14, 0x7d, 0xa9, + 0x38, 0x5a, 0x55, 0xd4, 0x57, 0x7f, 0xfb, 0x62, + 0x11, 0x80, 0x30, 0x61, 0x1d, 0x6a, 0x00, 0x92, + 0x2e, 0x9a, 0x7b, 0x82, 0x4a, 0x75, 0x77, 0x3b, + 0x61, 0xb6, 0xbe, 0x36, 0xa1, 0x87, 0x67, 0x46, + 0x0f, 0x30, 0xaf, 0x70, 0xbd, 0x8d, 0xc8, 0x31, + 0x53, 0x37, 0xc0, 0xc1, 0x8c, 0x15, 0x1d, 0x4d, + 0x38, 0xb5, 0x5c, 0x1c, 0x0b, 0xc1, 0x53, 0x17, + 0xe0, 0x75, 0xb6, 0x68, 0x19, 0x9d, 0x2b, 0xf4, + 0xe2, 0x09, 0x41, 0x30, 0xbe, 0xd0, 0xf7, 0xb2, + 0x2c, 0x69, 0xd1, 0x33, 0x83, 0xa6, 0x59, 0x66, + 0x17, 0xcb, 0x59, 0x6c, 0x18, 0x0c, 0x27, 0x1b, + 0xfe, 0xd4, 0x72, 0xac, 0x75, 0x25, 0x65, 0xca, + 0xfa, 0x0c, 0x05, 0xac, 0x29, 0x06, 0x04, 0xe1, + 0x78, 0xe8, 0x79, 0x4a, 0xf2, 0xa9, 0xe6, 0xfb, + 0xf1, 0x0e, 0x7e, 0xcd, 0x95, 0x6c, 0xed, 0x5a, + 0x9a, 0xa6, 0xc5, 0x01, 0x4d, 0x38, 0x36, 0x24, + 0x6b, 0xac, 0xe8, 0xf0, 0x77, 0xb9, 0xe9, 0x6f, + 0x55, 0x8f, 0x52, 0x48, 0xb2, 0xeb, 0xe6, 0x29, + 0xb7, 0xa6, 0xa5, 0x71, 0xbe, 0x57, 0x9e, 0xd0, + 0xda, 0xa1, 0xe5, 0x08, 0xaa, 0x65, 0xc1, 0x13, + 0xe8, 0x43, 0xef, 0x06, 0xac, 0xf8, 0x1f, 0x37, + 0xff, 0xb7, 0x53, 0x7e, 0x65, 0xd9, 0xf4, 0xdf, + 0x99, 0xc5, 0x25, 0x9b, 0x9b, 0x5c, 0x71, 0x90, + 0x6c, 0x49, 0xbe, 0x55, 0xff, 0x69, 0x70, 0xfa, + 0xff, 0xca, 0x7f, 0xe4, 0xe2, 0x4c, 0x42, 0x84, + 0x3a, 0x7d, 0xb0, 0x07, 0x07, 0x8c, 0x29, 0x80, + 0xc5, 0xa3, 0xc6, 0xee, 0xe1, 0x66, 0xe3, 0x1f, + 0xdf, 0xd5, 0x15, 0x08, 0x89, 0x16, 0x3c, 0x30, + 0x39, 0xcf, 0xaf, 0x35, 0x10, 0x2a, 0x38, 0x19, + 0xbe, 0x26, 0xb8, 0x13, 0x83, 0x00, 0x1c, 0xe4, + 0xda, 0xc5, 0x2b, 0xcf, 0xd2, 0xad, 0xc2, 0xa9, + 0x37, 0xb7, 0xb5, 0x01, 0x41, 0x0d, 0x40, 0x38, + 0x01, 0x9d, 0xe5, 0x12, 0x7f, 0xb4, 0x38, 0x54, + 0x5c, 0xdb, 0x7c, 0x02, 0x73, 0x7e, 0x2c, 0x17, + 0x2a, 0x1e, 0x09, 0x0a, 0xb3, 0x7c, 0x5d, 0x07, + 0xbb, 0xf5, 0xfb, 0xff, 0xa6, 0x9e, 0xef, 0x29, + 0xb5, 0x0b, 0x70, 0x6a, 0xa0, 0x6d, 0x01, 0x67, + 0xe9, 0x2d, 0x98, 0x72, 0xa6, 0x44, 0x47, 0x12, + 0xa2, 0x58, 0x25, 0x2b, 0xdc, 0x67, 0x71, 0xa5, + 0x57, 0x0b, 0x15, 0x65, 0xba, 0xa6, 0x07, 0xb3, + 0xb6, 0x22, 0x35, 0xde, 0x13, 0x09, 0xda, 0x08, + 0x0d, 0xb3, 0xad, 0x83, 0xc1, 0x40, 0x42, 0x3b, + 0xb7, 0x22, 0x90, 0xf5, 0xbe, 0x5d, 0xea, 0xcb, + 0x01, 0x88, 0xa5, 0x72, 0x60, 0xbe, 0x23, 0x64, + 0x6d, 0x57, 0xbb, 0x10, 0x7f, 0x94, 0x41, 0xac, + 0x73, 0x84, 0xb1, 0x75, 0xc1, 0x38, 0xeb, 0x25, + 0xbe, 0x6e, 0xf4, 0xb9, 0x8f, 0xa9, 0xd5, 0x84, + 0x14, 0xad, 0xfe, 0xc3, 0x48, 0x11, 0x52, 0x99, + 0x3a, 0x4e, 0x70, 0xe7, 0x65, 0x5a, 0x29, 0x85, + 0x2a, 0x02, 0x68, 0x99, 0xaf, 0xaa, 0xfa, 0xad, + 0x2c, 0xd1, 0x09, 0x46, 0xc4, 0x0d, 0xfd, 0xba, + 0x0c, 0x18, 0x98, 0x6d, 0x97, 0x5a, 0xd3, 0x0d, + 0xf9, 0x57, 0xbd, 0x75, 0x4e, 0x7f, 0x3b, 0xd5, + 0xf2, 0xa3, 0x9d, 0xde, 0xaf, 0x10, 0x13, 0x97, + 0xd5, 0x1c, 0xdb, 0xa3, 0xa2, 0xe9, 0x50, 0x7d, + 0x44, 0xdd, 0xe4, 0x0d, 0xea, 0x08, 0x27, 0x33, + 0x41, 0xba, 0xd5, 0xda, 0xc4, 0x2c, 0xec, 0xe7, + 0x66, 0x35, 0xc9, 0x3b, 0xd9, 0x27, 0x73, 0x83, + 0x17, 0x0d, 0x08, 0x3d, 0x35, 0x34, 0xa6, 0x9e, + 0xd7, 0xea, 0x84, 0xb2, 0xcf, 0x87, 0x95, 0x94, + 0xd5, 0x8b, 0x2e, 0x11, 0x89, 0x02, 0x06, 0x25, + 0x6a, 0x46, 0xd5, 0xe5, 0xa5, 0xb9, 0x54, 0x67, + 0x22, 0x9d, 0x2b, 0x92, 0xa0, 0x3c, 0x5e, 0xc5, + 0x78, 0x38, 0xac, 0xc2, 0xff, 0xe1, 0x57, 0xbc, + 0xb2, 0xd5, 0x48, 0xc7, 0x85, 0x10, 0x81, 0x54, + 0x89, 0x3d, 0xbb, 0xdc, 0xb8, 0xd8, 0xf5, 0x9c, + 0x8c, 0xa7, 0xe9, 0x46, 0x45, 0xd7, 0x40, 0x88, + 0x8c, 0xdc, 0x56, 0xdc, 0x46, 0xa3, 0x06, 0xfc, + 0xce, 0x91, 0x69, 0x8a, 0x55, 0x02, 0x8b, 0x72, + 0xe7, 0xdb, 0x1f, 0xa5, 0x2b, 0x06, 0x40, 0x55, + 0x31, 0x45, 0x9d, 0x40, 0xdd, 0x90, 0x54, 0x9a, + 0x70, 0x64, 0x89, 0x15, 0xc9, 0xbe, 0x4f, 0xb3, + 0x6d, 0xe5, 0x1c, 0xab, 0xc2, 0xc8, 0x30, 0x94, + 0xea, 0x5e, 0x54, 0xab, 0x14, 0x7b, 0xfe, 0xce, + 0x9b, 0xe6, 0xae, 0x50, 0xa6, 0xe9, 0x18, 0xb6, + 0xb1, 0x95, 0x44, 0x53, 0xcf, 0x7b, 0x96, 0x7b, + 0x98, 0x59, 0x43, 0x8e, 0x95, 0x0c, 0x21, 0x3b, + 0x95, 0xc2, 0xb5, 0xe1, 0x42, 0x80, 0xc0, 0xf6, + 0x99, 0xa4, 0xe0, 0x19, 0x83, 0xe1, 0x29, 0x28, + 0xf3, 0xd4, 0x72, 0xdb, 0x77, 0xd4, 0x3c, 0xaa, + 0x70, 0x3c, 0x45, 0xbd, 0x1b, 0x76, 0xf4, 0x80, + 0x30, 0x60, 0x34, 0x12, 0x6f, 0xe2, 0x84, 0x96, + 0xaf, 0x36, 0x29, 0xfb, 0x52, 0x73, 0xa8, 0xff, + 0x2d, 0xe9, 0xe3, 0x3f, 0xf4, 0xa8, 0xb2, 0xf7, + 0x4d, 0x15, 0x45, 0x83, 0x9b, 0x38, 0x33, 0x8b, + 0x8a, 0xf0, 0x80, 0xd4, 0x5e, 0x79, 0x7e, 0xf2, + 0xd1, 0xb8, 0xbe, 0x2f, 0xb2, 0x94, 0x9e, 0x24, + 0x73, 0xfe, 0x02, 0x63, 0x26, 0x79, 0xa4, 0xdd, + 0x4a, 0xda, 0x4a, 0xb5, 0xbb, 0x7c, 0x55, 0xdb, + 0xee, 0xca, 0x1b, 0x4b, 0xd9, 0xd8, 0x02, 0x0e, + 0xfd, 0xaa, 0xd7, 0xee, 0x6c, 0xb3, 0x86, 0xfb, + 0x28, 0x56, 0x0c, 0x1a, 0xab, 0xf8, 0x24, 0xb3, + 0xf5, 0x51, 0x46, 0xc6, 0x5b, 0xbd, 0x5a, 0xc9, + 0x26, 0xd9, 0xb5, 0x75, 0xb9, 0xc3, 0x7c, 0x3c, + 0x48, 0x43, 0x08, 0x5a, 0x3f, 0x6f, 0x4b, 0xfb, + 0x41, 0x86, 0xc5, 0xad, 0xf1, 0x78, 0xa7, 0x24, + 0xce, 0x45, 0xe8, 0xa4, 0x5e, 0x33, 0xcb, 0x3b, + 0x39, 0xd4, 0x67, 0x55, 0x72, 0x63, 0xc2, 0xd6, + 0x1b, 0x45, 0x29, 0xbb, 0xd8, 0x81, 0x00, 0xcc, + 0x63, 0xd3, 0xc5, 0x12, 0x73, 0xfe, 0xf6, 0xde, + 0x6e, 0x41, 0x89, 0x5f, 0xaf, 0x65, 0x5a, 0x9b, + 0x21, 0x59, 0x5c, 0xc1, 0x0b, 0xc5, 0x7a, 0xbe, + 0x28, 0xdf, 0x40, 0xf6, 0x2c, 0x8a, 0xc2, 0xa5, + 0x2b, 0x74, 0xf9, 0x3d, 0x63, 0x13, 0xd8, 0x98, + 0x71, 0x6f, 0x73, 0xb6, 0x88, 0x0d, 0xb3, 0x66, + 0x5a, 0x56, 0x22, 0x77, 0x9b, 0x88, 0x08, 0x64, + 0x2d, 0xff, 0x50, 0x42, 0x0d, 0x35, 0x47, 0x1b, + 0x93, 0x2d, 0x42, 0x88, 0x50, 0x2f, 0x06, 0xcf, + 0x29, 0x4a, 0x3e, 0xa5, 0x5d, 0xc4, 0xea, 0xbb, + 0x03, 0xde, 0xf0, 0x73, 0x2f, 0x51, 0xa8, 0x13, + 0x11, 0x64, 0x03, 0x14, 0xfb, 0xb3, 0xe1, 0xe2, + 0x65, 0x18, 0xcd, 0xd9, 0x51, 0x72, 0xf3, 0x72, + 0xd1, 0x12, 0xa3, 0x42, 0x8c, 0x4d, 0x00, 0x79, + 0x9f, 0x36, 0x24, 0x8e, 0x95, 0x2a, 0xcc, 0x06, + 0x02, 0xea, 0xad, 0x2b, 0xaa, 0x43, 0xcf, 0xe5, + 0xd3, 0x4b, 0x2c, 0x4a, 0x34, 0x76, 0xdb, 0x9b, + 0x97, 0x80, 0xe1, 0x56, 0xba, 0x6d, 0xe5, 0xf7, + 0x40, 0x70, 0x3a, 0x05, 0x91, 0xca, 0x8f, 0x9b, + 0xc1, 0x88, 0x2c, 0x0f, 0x0b, 0xb2, 0x50, 0x42, + 0x06, 0x2d, 0xbb, 0x98, 0x4b, 0xc6, 0x22, 0x90, + 0x78, 0xcf, 0xfd, 0xe6, 0x50, 0x60, 0x9d, 0x16, + 0xda, 0xd1, 0xd2, 0x6f, 0xb3, 0xf9, 0x21, 0xab, + 0x38, 0xc2, 0x30, 0xd4, 0xb7, 0xea, 0x1d, 0xfa, + 0xf6, 0xe7, 0x01, 0xc1, 0xde, 0xc0, 0xb3, 0x4f, + 0x03, 0x0f, 0xe7, 0x40, 0x39, 0x3a, 0x3a, 0xbb, + 0x08, 0x81, 0x5f, 0x10, 0x10, 0x94, 0x4c, 0x5d, + 0x3f, 0x9f, 0xd0, 0x34, 0x9d, 0x3e, 0xad, 0x31, + 0x8f, 0x66, 0xf6, 0xf4, 0x45, 0x2a, 0x9b, 0x78, + 0xe2, 0x02, 0x3f, 0xbc, 0x3f, 0x2e, 0xfb, 0x01, + 0xf8, 0x1a, 0x9b, 0xc0, 0xf6, 0xe5, 0xb5, 0x65, + 0xf8, 0xa2, 0xce, 0x3c, 0x23, 0xb4, 0x25, 0x17, + 0x2a, 0xb5, 0xa0, 0x60, 0xfd, 0x5f, 0x2f, 0xa5, + 0x0f, 0xd5, 0x28, 0x6b, 0xf6, 0xf4, 0x3a, 0xe4, + 0xf2, 0x28, 0x8c, 0xd8, 0xac, 0xe4, 0xdf, 0x51, + 0x0b, 0x14, 0x6a, 0x32, 0x5e, 0x0b, 0x9d, 0x5f, + 0xf8, 0x9d, 0x27, 0xfd, 0x36, 0xfb, 0xfa, 0x59, + 0xe0, 0x33, 0xce, 0xf1, 0x63, 0xb6, 0xd9, 0x6f, + 0x41, 0xe1, 0x20, 0x15, 0xba, 0x5e, 0x42, 0x57, + 0xed, 0x09, 0x1a, 0x59, 0xed, 0x1e, 0x8f, 0x4b, + 0xea, 0x56, 0x94, 0x6f, 0x33, 0xba, 0x2f, 0x14, + 0x74, 0x9e, 0x08, 0x51, 0x08, 0x8d, 0xbf, 0xf3, + 0x7d, 0x57, 0x2a, 0xf1, 0x01, 0xf2, 0x59, 0xd2, + 0xd9, 0xce, 0xe4, 0x97, 0xa4, 0xf8, 0x3f, 0x9c, + 0x00, 0x6b, 0xa3, 0x1a, 0xfe, 0x82, 0x26, 0xd6, + 0x26, 0x67, 0xb6, 0xf2, 0xab, 0xad, 0x7c, 0x3d, + 0x9c, 0x06, 0x34, 0xa3, 0x61, 0x55, 0x29, 0x42, + 0xe3, 0xac, 0xea, 0x52, 0x4a, 0xc6, 0x1c, 0x32, + 0x21, 0xa5, 0x69, 0xbf, 0x7f, 0x1a, 0xc6, 0x04, + 0xaa, 0x92, 0x0e, 0x54, 0x79, 0xac, 0xa5, 0xbb, + 0xe4, 0x32, 0xc5, 0x2a, 0x38, 0x69, 0x67, 0x91, + 0x57, 0xf1, 0xfa, 0xa0, 0xe9, 0xa5, 0x43, 0xea, + 0x9e, 0x6c, 0xe4, 0x1b, 0x72, 0xef, 0x1c, 0x5a, + 0xac, 0xcc, 0xf7, 0xae, 0x41, 0xcc, 0xa6, 0xcf, + 0xaa, 0xe5, 0xd5, 0x77, 0xc1, 0xdc, 0x6e, 0x7f, + 0xb9, 0xad, 0x62, 0xe5, 0x56, 0xf0, 0xd3, 0xca, + 0x35, 0x1a, 0x55, 0x3f, 0xa0, 0xc1, 0xef, 0x9b, + 0x6a, 0x59, 0xba, 0x59, 0x35, 0x6f, 0x72, 0xd3, + 0x48, 0x86, 0xa5, 0x41, 0x4e, 0x25, 0xa3, 0x06, + 0x0f, 0x55, 0xa6, 0x9b, 0xb3, 0x26, 0x03, 0x8e, + 0x2d, 0xe6, 0x75, 0x3b, 0x38, 0xd4, 0xe7, 0xfe, + 0xa3, 0xdd, 0xe5, 0xd9, 0x2a, 0x20, 0x71, 0x29, + 0x39, 0xec, 0xab, 0xdc, 0xda, 0xa5, 0x47, 0xae, + 0x59, 0x05, 0xb5, 0x71, 0x2b, 0x0a, 0x84, 0x25, + 0x51, 0x9f, 0xa9, 0x6d, 0x2f, 0x9b, 0x8a, 0x1b, + 0x4f, 0xc9, 0xfd, 0xe6, 0x4e, 0x74, 0x3b, 0x5c, + 0x8b, 0xf3, 0x6e, 0x4a, 0x18, 0xc0, 0x74, 0x3f, + 0x72, 0xee, 0x48, 0xa7, 0x75, 0xb6, 0x7f, 0x6a, + 0x2e, 0x49, 0x6a, 0xd3, 0xa1, 0x40, 0xd4, 0x47, + 0xd8, 0xce, 0x59, 0x2c, 0x43, 0xc5, 0xe5, 0x5d, + 0xfa, 0x66, 0x3f, 0xfa, 0x86, 0xf5, 0x7c, 0x3d, + 0x17, 0x32, 0xa2, 0x0f, 0xf1, 0xa5, 0x3d, 0xb4, + 0x11, 0xf8, 0x6c, 0x96, 0x22, 0x18, 0xb9, 0xe9, + 0x56, 0xee, 0x15, 0x28, 0x44, 0x84, 0x91, 0x11, + 0x09, 0xab, 0x75, 0xb6, 0x3d, 0xd9, 0x38, 0xb9, + 0x6a, 0x10, 0x1c, 0x35, 0x19, 0xb3, 0x89, 0xd9, + 0x95, 0x16, 0xfa, 0x92, 0x2f, 0x45, 0xdc, 0x3f, + 0x25, 0x2c, 0xd0, 0x74, 0xd0, 0xc8, 0xf6, 0x9a, + 0x31, 0x3f, 0xb8, 0x5a, 0x80, 0xd2, 0xc8, 0x39, + 0x10, 0x04, 0xb1, 0x12, 0xf9, 0x19, 0x5a, 0xe6, + 0xa0, 0xd1, 0x7d, 0x00, 0xdd, 0xed, 0x2b, 0x49, + 0xa0, 0x48, 0x07, 0x3c, 0x69, 0x00, 0x34, 0x43, + 0x5e, 0xc6, 0xf1, 0xa4, 0x12, 0x73, 0x06, 0xc8, + 0x0e, 0x97, 0x18, 0xdb, 0xd5, 0x82, 0xbd, 0x78, + 0xf2, 0x3f, 0x5e, 0xa1, 0x5f, 0x88, 0x88, 0x92, + 0xfe, 0x5f, 0x5b, 0xe9, 0xda, 0x04, 0xe5, 0x04, + 0xc2, 0x23, 0xf6, 0x95, 0x49, 0x92, 0x40, 0xfd, + 0x58, 0x31, 0xbd, 0xc8, 0x83, 0xd2, 0xd4, 0x76, + 0x21, 0x0a, 0x82, 0x40, 0xf0, 0x21, 0x26, 0x69, + 0x40, 0x19, 0x12, 0xcb, 0x95, 0x37, 0xd1, 0xc6, + 0x82, 0xbb, 0x56, 0xab, 0x8d, 0x86, 0xcf, 0xb2, + 0x83, 0xba, 0x43, 0x53, 0xa6, 0x95, 0x7e, 0x52, + 0xb6, 0x6e, 0xac, 0x8a, 0xa1, 0x29, 0x38, 0x58, + 0x77, 0xbe, 0xf2, 0x46, 0x77, 0x65, 0x2c, 0xc8, + 0xa6, 0xac, 0xba, 0x88, 0x8e, 0xc3, 0x74, 0x5c, + 0x41, 0x70, 0x20, 0x8f, 0xf6, 0x16, 0x87, 0xc3, + 0xa4, 0xc6, 0xe1, 0x78, 0x97, 0xef, 0x51, 0x87, + 0x17, 0xea, 0xc8, 0xe9, 0xc5, 0x04, 0x31, 0xe9, + 0x68, 0x84, 0xde, 0x26, 0x56, 0x3a, 0xf8, 0xfc, + 0xb3, 0x8a, 0x12, 0x33, 0xe6, 0x57, 0x43, 0x32, + 0x6f, 0xd1, 0x0d, 0x6a, 0x8d, 0x83, 0x7e, 0x70, + 0x1c, 0x7a, 0x26, 0xbe, 0x02, 0x94, 0x03, 0x98, + 0x6e, 0x6b, 0x0c, 0x0e, 0xdb, 0xdc, 0x44, 0x55, + 0x80, 0xc0, 0x3c, 0x26, 0x33, 0xf0, 0x41, 0xd6, + 0xdb, 0x97, 0xc3, 0xa5, 0x77, 0xd7, 0x26, 0xf7, + 0x6e, 0x79, 0x47, 0x67, 0x78, 0xbe, 0x55, 0xc5, + 0x41, 0x9d, 0x5a, 0xb0, 0x65, 0x6a, 0x0a, 0xd2, + 0x0f, 0xfd, 0xe0, 0xe7, 0xc3, 0xa5, 0x00, 0xf1, + 0x5f, 0xfb, 0xb4, 0xc0, 0x30, 0x4e, 0x3d, 0x6d, + 0x94, 0xb6, 0x83, 0x2f, 0xf6, 0xed, 0x06, 0x25, + 0xbb, 0xd0, 0x60, 0xaf, 0xea, 0x64, 0x2b, 0x86, + 0x9b, 0x68, 0x66, 0x79, 0x91, 0x8f, 0x7c, 0x10, + 0xd5, 0x8e, 0x73, 0xaa, 0x8b, 0x95, 0x67, 0x54, + 0x52, 0xd1, 0xeb, 0x5d, 0x9e, 0x42, 0x22, 0xf9, + 0x73, 0xd0, 0x3d, 0x11, 0xc1, 0x09, 0xa1, 0x15, + 0x33, 0x7f, 0x99, 0x54, 0x28, 0xdf, 0xb7, 0xcb, + 0x50, 0x8d, 0xff, 0x0f, 0xad, 0xd7, 0xf3, 0x37, + 0xed, 0x20, 0xf6, 0x82, 0x3a, 0x80, 0xc8, 0xfe, + 0x91, 0x1a, 0x0d, 0xa0, 0xa0, 0xc9, 0x20, 0x2a, + 0xa3, 0x76, 0x64, 0x9d, 0x04, 0x4f, 0x5e, 0x83, + 0x0c, 0x78, 0xf1, 0x82, 0x70, 0x66, 0x47, 0xd6, + 0x71, 0x50, 0x8d, 0x06, 0x31, 0x89, 0xd4, 0x05, + 0x4d, 0x4b, 0xde, 0x03, 0x0a, 0x59, 0x46, 0x04, + 0x81, 0x2d, 0x38, 0x30, 0xd8, 0x74, 0x3f, 0x64, + 0x18, 0xa1, 0x33, 0x3f, 0x83, 0x1c, 0xc7, 0x8f, + 0xd6, 0xf8, 0x49, 0x09, 0x7f, 0xfa, 0x19, 0x99, + 0xd7, 0x30, 0xd8, 0x41, 0x4a, 0xc2, 0x6e, 0x35, + 0x3d, 0xac, 0xfe, 0xd2, 0xa6, 0xa1, 0xbb, 0x33, + 0x3c, 0xe3, 0x7c, 0xc0, 0x60, 0x3f, 0x3c, 0xdc, + 0x5a, 0x02, 0xa5, 0x26, 0x37, 0x94, 0x11, 0xbb, + 0xf6, 0xb4, 0x91, 0x1c, 0xc8, 0xe1, 0x60, 0x28, + 0x04, 0x36, 0x15, 0x2b, 0x0f, 0x23, 0x05, 0xe5, + 0xcc, 0xe3, 0x6c, 0x36, 0x15, 0x98, 0xbf, 0x07, + 0x81, 0x81, 0xcd, 0xb0, 0x51, 0xe8, 0x3c, 0x6c, + 0x01, 0x63, 0xcf, 0xc1, 0x88, 0x7f, 0x75, 0xa1, + 0x70, 0xe3, 0xe6, 0x4c, 0xb1, 0x4d, 0xaa, 0x4b, + 0x1a, 0x6b, 0x39, 0x02, 0x9d, 0x31, 0xe8, 0x8c, + 0x08, 0x21, 0x09, 0x9c, 0xf7, 0x9b, 0x1e, 0xb4, + 0xab, 0x85, 0xb7, 0xf1, 0x9c, 0xe7, 0x50, 0xe4, + 0xee, 0xf2, 0x0c, 0x00, 0x58, 0xb9, 0xa4, 0xf1, + 0xbf, 0xcd, 0x62, 0x2a, 0xf8, 0xe6, 0x8e, 0x65, + 0x94, 0xb5, 0x4e, 0xcb, 0xcc, 0x2c, 0x34, 0x6c, + 0x44, 0x88, 0x09, 0xd4, 0x68, 0x1e, 0x02, 0x08, + 0x32, 0xfe, 0x75, 0x58, 0x43, 0x63, 0xc4, 0x9e, + 0x4d, 0xbf, 0x17, 0xeb, 0x6c, 0x0c, 0x78, 0x78, + 0xd2, 0x40, 0x60, 0x0e, 0x2e, 0x4d, 0xfb, 0xa0, + 0xc1, 0xf8, 0xee, 0x56, 0x8a, 0xee, 0xaa, 0x6f, + 0xc9, 0x29, 0x4e, 0x07, 0x8d, 0xac, 0x1b, 0x96, + 0x9c, 0x2b, 0x13, 0xe7, 0x78, 0xba, 0xe8, 0x79, + 0xb6, 0x40, 0x71, 0xdd, 0x34, 0x1b, 0x4c, 0x9e, + 0x5e, 0xa9, 0x53, 0xba, 0xba, 0xc1, 0xd4, 0x81, + 0xc0, 0x15, 0x51, 0x50, 0xed, 0xbc, 0xef, 0x24, + 0x3c, 0x2b, 0xba, 0x39, 0x2a, 0xef, 0x27, 0xa7, + 0x2f, 0x27, 0x7b, 0x62, 0x3a, 0x6d, 0x70, 0xdf, + 0x86, 0xcf, 0x16, 0xf0, 0x18, 0x63, 0xf8, 0xd6, + 0x37, 0xb6, 0x4b, 0x23, 0x6a, 0xdb, 0x6d, 0xbb, + 0x7f, 0x9c, 0x5b, 0x79, 0x24, 0xe5, 0xe9, 0xae, + 0x22, 0xa7, 0x6c, 0x3e, 0x4b, 0x36, 0x58, 0xa3, + 0xd8, 0xcb, 0x15, 0x49, 0x6e, 0xef, 0x3b, 0x11, + 0xac, 0xb4, 0xd5, 0x8d, 0xd0, 0xa5, 0x56, 0x0e, + 0x65, 0x07, 0x13, 0x54, 0xff, 0xb3, 0x7f, 0x3e, + 0xa2, 0xee, 0xf0, 0xac, 0xd0, 0xc9, 0x79, 0x87, + 0xd5, 0x52, 0xa5, 0x49, 0x65, 0x44, 0x55, 0xaa, + 0x2c, 0x96, 0x1b, 0xe9, 0x36, 0x1f, 0x5c, 0x54, + 0xdb, 0x7e, 0x6e, 0x8e, 0x7f, 0x99, 0xd9, 0x24, + 0x51, 0x67, 0xaf, 0x64, 0x2a, 0xbc, 0xbc, 0xff, + 0x16, 0xe4, 0x40, 0x42, 0x4f, 0x5a, 0x92, 0x29, + 0x69, 0x15, 0x6f, 0xbb, 0x16, 0xe1, 0xbb, 0xd5, + 0x39, 0x38, 0xa0, 0x97, 0xa2, 0x65, 0x15, 0xe9, + 0xa6, 0x59, 0xec, 0x92, 0xed, 0xd5, 0x1b, 0x79, + 0x2d, 0x51, 0x2f, 0x56, 0x37, 0xbd, 0x24, 0x36, + 0x52, 0x43, 0x76, 0x28, 0xeb, 0x6a, 0x24, 0x6f, + 0x79, 0xd0, 0xe4, 0xaa, 0xf3, 0x27, 0x6a, 0xc8, + 0x91, 0xa2, 0xa6, 0x8e, 0xab, 0x92, 0xb3, 0xed, + 0xd0, 0xef, 0x11, 0xb4, 0xa0, 0xab, 0x60, 0xcb, + 0x3a, 0x52, 0xbd, 0x1a, 0xae, 0xc8, 0xe7, 0x56, + 0x9c, 0x53, 0x85, 0x8a, 0x77, 0x57, 0xcd, 0xa2, + 0xe5, 0xe1, 0xb3, 0x67, 0xa0, 0x9f, 0x4c, 0xbc, + 0xda, 0x39, 0xc2, 0xb9, 0x27, 0x11, 0xc3, 0x7a, + 0xb7, 0x17, 0xec, 0x1a, 0xc7, 0xf7, 0x3c, 0xd4, + 0xdf, 0xe6, 0x95, 0xf3, 0x25, 0x37, 0xb5, 0x04, + 0x50, 0xb7, 0x45, 0xc2, 0x72, 0x49, 0xb9, 0xbe, + 0xb3, 0xeb, 0x6e, 0x64, 0x8a, 0x6d, 0x80, 0xc1, + 0x9d, 0xe0, 0xc5, 0xf4, 0xad, 0x86, 0xdb, 0x51, + 0x2d, 0xbf, 0x68, 0xa9, 0x78, 0x83, 0x22, 0x1b, + 0xab, 0x9b, 0x28, 0x26, 0x36, 0xac, 0x84, 0xe6, + 0x98, 0x56, 0xf8, 0x84, 0x05, 0xdb, 0x94, 0x71, + 0x9d, 0xba, 0xdc, 0x5f, 0xcb, 0x2f, 0xbc, 0xd8, + 0x8e, 0xed, 0x24, 0x51, 0xd5, 0xfa, 0x4e, 0x2f, + 0x08, 0x5a, 0xc8, 0x96, 0x5c, 0xad, 0x86, 0x36, + 0xcd, 0x80, 0x60, 0xb7, 0x67, 0x3f, 0xc5, 0x25, + 0x45, 0x9d, 0x11, 0x26, 0x20, 0xed, 0xe7, 0x7a, + 0x7c, 0x4e, 0x3d, 0x51, 0x07, 0x29, 0x33, 0xfd, + 0xad, 0xa3, 0xc5, 0x02, 0x09, 0x62, 0xd9, 0x3a, + 0x55, 0x66, 0xd9, 0x16, 0x5e, 0x45, 0xad, 0x5d, + 0xe6, 0xc7, 0x43, 0xcd, 0x1e, 0x36, 0xdf, 0xcb, + 0x51, 0x4c, 0xf6, 0x60, 0x7b, 0x3b, 0x14, 0xa3, + 0x8b, 0xf1, 0x4a, 0x0b, 0x3a, 0x54, 0x46, 0x38, + 0xa7, 0x14, 0x1a, 0xe1, 0x3a, 0xa6, 0xa4, 0x08, + 0x5f, 0xf3, 0x3d, 0x6b, 0xf6, 0x5c, 0xc2, 0xc5, + 0x16, 0xdb, 0x69, 0xb5, 0x30, 0xac, 0x0b, 0xaf, + 0x56, 0xe1, 0x24, 0x3c, 0x2f, 0x69, 0x33, 0x3b, + 0xbd, 0xd6, 0x14, 0x28, 0x5b, 0x24, 0x9d, 0x46, + 0xb5, 0x5e, 0xa0, 0xb2, 0x73, 0x51, 0x0d, 0x04, + 0x6c, 0x0f, 0x38, 0x97, 0xed, 0xcd, 0xaa, 0x55, + 0xa3, 0xb5, 0x7e, 0x96, 0x22, 0xc1, 0x16, 0x2d, + 0xd4, 0x7c, 0xe9, 0xd4, 0xd9, 0xf3, 0x63, 0x86, + 0xfc, 0xd2, 0x82, 0xdd, 0x44, 0x86, 0xf5, 0x05, + 0xe5, 0x5f, 0x82, 0xe2, 0x47, 0xb9, 0x69, 0xb5, + 0x03, 0x4d, 0x31, 0xc0, 0x43, 0xa3, 0xb0, 0xfa, + 0xcb, 0x6b, 0x09, 0x23, 0x3f, 0x6b, 0x72, 0x28, + 0x97, 0xf2, 0xaf, 0x9c, 0x9c, 0x1b, 0x48, 0xb4, + 0x8b, 0x1f, 0x3a, 0x0d, 0x15, 0x2b, 0x82, 0x18, + 0xf9, 0x96, 0x0a, 0xfc, 0x06, 0xf3, 0x3e, 0x89, + 0x4c, 0x8a, 0x64, 0xaa, 0x43, 0x84, 0x7d, 0x82, + 0xe3, 0xa2, 0xc5, 0x62, 0x32, 0x51, 0xda, 0xa1, + 0xc0, 0xe0, 0xac, 0x73, 0x91, 0x9b, 0xfe, 0x49, + 0x9a, 0xc7, 0x43, 0xd9, 0x32, 0xd0, 0x2f, 0x2a, + 0x25, 0xa8, 0x99, 0x22, 0xe5, 0x4d, 0x08, 0xcc, + 0xa4, 0xf4, 0x6a, 0x34, 0x1f, 0x8f, 0xd8, 0x5f, + 0x8a, 0x57, 0xad, 0xc8, 0x8d, 0x4f, 0x27, 0x50, + 0x05, 0x12, 0xb6, 0x83, 0x83, 0x35, 0x82, 0x2d, + 0x30, 0x89, 0x78, 0x68, 0x5c, 0x09, 0x95, 0xd1, + 0x90, 0x38, 0x17, 0xb6, 0x88, 0xa0, 0x1c, 0x30, + 0x0a, 0x6c, 0x94, 0x16, 0x20, 0xb0, 0x0a, 0x8f, + 0x0c, 0xc9, 0xaa, 0xe6, 0x84, 0x82, 0xff, 0x6a, + 0x25, 0xc1, 0x1c, 0x1c, 0xbc, 0x05, 0xc1, 0x61, + 0xeb, 0x63, 0xce, 0x2b, 0x1e, 0x2a, 0x4b, 0x04, + 0x7c, 0x61, 0x9f, 0x8e, 0x99, 0xfd, 0x49, 0xa0, + 0x78, 0x43, 0xff, 0xb2, 0xe1, 0x5f, 0x3d, 0xec, + 0x06, 0xe8, 0x94, 0xbf, 0x67, 0x43, 0xdb, 0xfc, + 0xf3, 0x7c, 0xed, 0xc3, 0xf8, 0xa5, 0x11, 0xa0, + 0x58, 0x04, 0x5e, 0xab, 0x54, 0x99, 0x29, 0x53, + 0x0a, 0x87, 0xf1, 0x20, 0x78, 0xac, 0x18, 0x3d, + 0x2e, 0x12, 0xc4, 0x86, 0xd1, 0x28, 0xfc, 0x03, + 0x71, 0x38, 0xf8, 0x15, 0xb1, 0xad, 0x47, 0x03, + 0xa6, 0xcc, 0x7d, 0x53, 0x16, 0x94, 0x1d, 0x17, + 0x22, 0xdf, 0xe3, 0xef, 0x89, 0x77, 0xa3, 0xd6, + 0x87, 0x98, 0x9b, 0xf7, 0x1a, 0x1f, 0xb3, 0xad, + 0xb0, 0x5c, 0x23, 0x24, 0x4e, 0xca, 0x46, 0x13, + 0xeb, 0x71, 0xaa, 0x23, 0x46, 0x5a, 0xf8, 0x93, + 0xf6, 0x37, 0xf7, 0x26, 0x82, 0xb5, 0x3b, 0x7d, + 0xf4, 0xf5, 0xc9, 0x98, 0x01, 0x65, 0xb5, 0x50, + 0xf5, 0x4d, 0xcf, 0x36, 0xad, 0xb1, 0xd4, 0xff, + 0x9b, 0x4c, 0xc7, 0xef, 0x80, 0xcb, 0x0a, 0xd3, + 0x2b, 0xf3, 0x6c, 0x7f, 0x22, 0xd7, 0x2e, 0x01, + 0x5f, 0x59, 0xb9, 0x2c, 0xbf, 0xf6, 0xc8, 0xf3, + 0xd1, 0x85, 0x40, 0x7d, 0x30, 0x06, 0x08, 0x0c, + 0xb5, 0x78, 0xc0, 0x2a, 0xc4, 0xb4, 0xad, 0x80, + 0x69, 0x7a, 0x95, 0x69, 0xc7, 0xa9, 0xd4, 0x33, + 0x57, 0xf1, 0x74, 0x12, 0xfc, 0xd3, 0x4d, 0x62, + 0x96, 0x94, 0xef, 0x44, 0x81, 0xbd, 0x1b, 0x78, + 0xc0, 0xb9, 0x20, 0xf8, 0x79, 0x07, 0x89, 0xc4, + 0x06, 0x87, 0xc9, 0x32, 0xf1, 0xa6, 0x1b, 0xd4, + 0x81, 0x01, 0x5c, 0x54, 0xad, 0x9f, 0xd0, 0x61, + 0x04, 0x77, 0xf9, 0x32, 0xcd, 0x69, 0xb4, 0xac, + 0x78, 0x72, 0x94, 0x40, 0x4d, 0xee, 0xa9, 0xb3, + 0xc9, 0x98, 0xda, 0xd9, 0x91, 0x8f, 0x2e, 0xa4, + 0x18, 0x07, 0xd9, 0xc8, 0x03, 0xc9, 0x45, 0x38, + 0x38, 0x89, 0xff, 0xb3, 0x57, 0x69, 0x46, 0x37, + 0x37, 0xcd, 0xb5, 0xf5, 0x4c, 0xf7, 0x92, 0xa7, + 0x48, 0xad, 0xa9, 0x57, 0x93, 0x7b, 0xef, 0xae, + 0x59, 0xf6, 0xb6, 0x15, 0xca, 0x22, 0x3e, 0x58, + 0x65, 0x26, 0x4a, 0x39, 0xf0, 0xf4, 0x4a, 0x4a, + 0xd4, 0xff, 0x8a, 0x94, 0x75, 0x9f, 0x29, 0xf5, + 0xdf, 0x36, 0xa3, 0x6e, 0x07, 0xbe, 0xec, 0x2d, + 0xcf, 0xc9, 0xb7, 0xb1, 0x6e, 0xf5, 0xc1, 0x88, + 0x43, 0xf1, 0x7f, 0x81, 0xc0, 0xa4, 0x04, 0x50, + 0x6e, 0x16, 0x7c, 0x3f, 0x05, 0x58, 0x30, 0xe4, + 0x7a, 0x0e, 0x05, 0x58, 0x30, 0x29, 0xc1, 0x8b, + 0x4b, 0x01, 0x4c, 0x0c, 0xa4, 0x18, 0x41, 0x10, + 0x41, 0x10, 0x18, 0x6c, 0xa4, 0x3f, 0x02, 0xe0, + 0xaa, 0x06, 0x0e, 0x41, 0xf0, 0x7f, 0xed, 0x0b, + 0x69, 0x44, 0xb4, 0xe5, 0xcd, 0x5c, 0x1f, 0xb4, + 0x3f, 0xd5, 0x7c, 0x6d, 0xa2, 0xf6, 0x8b, 0xc4, + 0x88, 0x24, 0x2b, 0x4f, 0xac, 0xec, 0xff, 0xc7, + 0x20, 0x64, 0x78, 0xa9, 0x20, 0x32, 0x96, 0x1b, + 0x8a, 0xfc, 0xac, 0xaf, 0xf5, 0xac, 0x6f, 0x14, + 0xe5, 0x6d, 0xa6, 0xcc, 0x45, 0x19, 0x2a, 0xe8, + 0xd0, 0x12, 0x9f, 0xc1, 0xe9, 0xa0, 0x03, 0xe0, + 0x52, 0x9a, 0x82, 0x27, 0xb7, 0x7e, 0x3e, 0xbd, + 0x60, 0xb5, 0xb5, 0x65, 0xcc, 0xf4, 0x42, 0xec, + 0xbb, 0x3f, 0xf4, 0x89, 0x55, 0xef, 0x41, 0x55, + 0x14, 0x03, 0x23, 0x65, 0xb5, 0xae, 0x33, 0xdd, + 0xe1, 0x87, 0x9b, 0xe6, 0xfa, 0x20, 0x27, 0x1f, + 0x27, 0x98, 0xa2, 0x6d, 0x2e, 0x2f, 0x48, 0x3f, + 0x51, 0xde, 0xdc, 0x8d, 0xd4, 0xcd, 0xb6, 0x58, + 0xa5, 0x46, 0xdc, 0x2d, 0xe1, 0x69, 0x67, 0xf8, + 0x36, 0xa7, 0x87, 0x23, 0xf9, 0x41, 0xe0, 0x60, + 0x43, 0x05, 0x14, 0x03, 0x05, 0x9d, 0x08, 0x00, + 0x8a, 0x08, 0xb5, 0x38, 0x2a, 0x80, 0xd6, 0xab, + 0x10, 0xe8, 0x3c, 0x17, 0xfd, 0x34, 0xb8, 0x15, + 0xa0, 0xaa, 0x8a, 0xc0, 0xd4, 0x6d, 0x42, 0xea, + 0x47, 0x0a, 0x03, 0xd0, 0xb1, 0x29, 0xed, 0x06, + 0xe9, 0x7b, 0x6a, 0x9b, 0x06, 0x62, 0x27, 0xf0, + 0x28, 0x84, 0x3c, 0x10, 0x01, 0x84, 0xa0, 0x62, + 0xd5, 0x0d, 0xeb, 0x2c, 0x37, 0x07, 0x9f, 0x57, + 0x73, 0xc0, 0xc2, 0x00, 0x7e, 0xc0, 0xec, 0x71, + 0x55, 0x4c, 0x67, 0xc3, 0xfa, 0xcd, 0x4c, 0x38, + 0xf3, 0x3f, 0x85, 0xd0, 0xc5, 0xba, 0x80, 0xf4, + 0x4d, 0x3f, 0x56, 0x9b, 0x64, 0x40, 0xc2, 0xf1, + 0xd6, 0xab, 0xed, 0xca, 0x93, 0x04, 0xb1, 0xf6, + 0x97, 0xf7, 0x03, 0xbf, 0x52, 0xec, 0x57, 0x53, + 0xcd, 0xf2, 0x8a, 0x5b, 0xea, 0xd2, 0x9c, 0x51, + 0xaa, 0x64, 0xe3, 0xd4, 0x08, 0x25, 0xe5, 0xc2, + 0x56, 0x84, 0x2c, 0x6f, 0xe5, 0xdd, 0x56, 0x24, + 0x97, 0x24, 0x6f, 0x13, 0xa7, 0x9e, 0xd6, 0x07, + 0xca, 0xc3, 0xf1, 0xc8, 0xef, 0x32, 0x2b, 0xf5, + 0x98, 0xab, 0x5a, 0xcc, 0x0f, 0xd9, 0x9f, 0x1f, + 0x78, 0xae, 0x7f, 0x2e, 0xf0, 0x2c, 0x61, 0x08, + 0x1e, 0x06, 0x04, 0x10, 0x53, 0x01, 0xe0, 0xfc, + 0x18, 0xb0, 0x6c, 0x5c, 0xa0, 0x3e, 0x1c, 0xd0, + 0x3b, 0x40, 0xf9, 0x65, 0x53, 0xd0, 0x61, 0x00, + 0x1e, 0x0b, 0xfc, 0xf9, 0x41, 0x56, 0x20, 0x88, + 0x0a, 0x41, 0x80, 0xc7, 0x40, 0xd0, 0xe0, 0x3c, + 0x07, 0xc1, 0x80, 0x54, 0x46, 0x0c, 0xad, 0x30, + 0xf0, 0x1e, 0x0a, 0x02, 0xf4, 0xe3, 0xf6, 0x87, + 0xdc, 0x07, 0x81, 0xff, 0x1c, 0x48, 0x61, 0x5a, + 0xb4, 0xbe, 0x63, 0x80, 0xaa, 0x50, 0x3f, 0xfb, + 0x2d, 0x7d, 0x96, 0x67, 0x01, 0x55, 0xd0, 0xf7, + 0xed, 0x6e, 0x87, 0xd6, 0x95, 0xeb, 0x9e, 0xda, + 0xb2, 0x0e, 0x1a, 0x0c, 0x6c, 0xa7, 0xaa, 0xe1, + 0x79, 0x84, 0xd9, 0x98, 0x23, 0x09, 0x6d, 0xf2, + 0x08, 0xbd, 0x68, 0x70, 0x3c, 0x1f, 0xb2, 0x1e, + 0x71, 0x48, 0x18, 0xef, 0x95, 0x32, 0xc8, 0x79, + 0xc5, 0x25, 0x43, 0x72, 0xa4, 0x6f, 0x7a, 0x3a, + 0xb9, 0x55, 0x27, 0xca, 0x5d, 0x55, 0x5b, 0x2c, + 0x2f, 0x2e, 0xdf, 0x5c, 0xff, 0x92, 0x25, 0x63, + 0x7f, 0x35, 0x4e, 0x76, 0x8d, 0xf2, 0x9b, 0x99, + 0xff, 0x7e, 0xf4, 0xb3, 0xe6, 0x03, 0x10, 0x32, + 0x70, 0x86, 0x0d, 0x85, 0x6a, 0x3a, 0x24, 0xb0, + 0x99, 0x6a, 0x06, 0xb8, 0x21, 0x02, 0x18, 0x32, + 0xe9, 0x18, 0xd0, 0x78, 0x48, 0x0a, 0xd2, 0x83, + 0x15, 0xb0, 0xba, 0x49, 0x67, 0x0b, 0x19, 0x06, + 0x41, 0xa1, 0x70, 0xe9, 0x57, 0x52, 0xe8, 0x85, + 0xf6, 0x1b, 0x55, 0x8a, 0xda, 0x10, 0x68, 0x33, + 0x09, 0x81, 0xe0, 0x7f, 0xb5, 0x04, 0x49, 0xff, + 0x08, 0x40, 0xaa, 0x6f, 0xa3, 0xcf, 0xb6, 0xac, + 0x21, 0x2a, 0x1d, 0xab, 0xf9, 0x6d, 0x2c, 0x6f, + 0xcd, 0xb4, 0x3e, 0xd4, 0x93, 0xfe, 0xf7, 0xd4, + 0xb2, 0x20, 0x99, 0xbb, 0xd3, 0x4a, 0x78, 0x88, + 0x1c, 0x41, 0xa6, 0x83, 0x65, 0xc0, 0x7b, 0xc3, + 0x81, 0xca, 0x41, 0x21, 0x50, 0x82, 0xde, 0x2a, + 0x68, 0xb7, 0xc9, 0xbc, 0x1f, 0xab, 0xfa, 0xde, + 0x55, 0xe2, 0xde, 0x0e, 0x59, 0xff, 0x2a, 0x86, + 0xb3, 0xbf, 0xd5, 0x15, 0x44, 0x59, 0xe6, 0x6d, + 0x06, 0x60, 0xab, 0x07, 0x20, 0xa0, 0x95, 0xb0, + 0x2d, 0x04, 0x11, 0x28, 0xb5, 0x92, 0xbd, 0x68, + 0x0c, 0x42, 0xde, 0xb6, 0x06, 0x73, 0x5a, 0x2a, + 0x5c, 0x73, 0x9b, 0xe0, 0xee, 0x58, 0xe0, 0xb8, + 0x07, 0x40, 0xf8, 0x42, 0x1d, 0xb2, 0x0c, 0x5c, + 0xc0, 0xf8, 0x7a, 0x98, 0xbd, 0xbf, 0x83, 0x2b, + 0x03, 0xc5, 0xf1, 0xa5, 0x5f, 0x9f, 0xdc, 0x63, + 0x2f, 0xfb, 0xac, 0xe6, 0x2e, 0x9b, 0x65, 0x4e, + 0xd0, 0x18, 0x4e, 0x58, 0xdd, 0xa5, 0xb2, 0x67, + 0x5a, 0x6c, 0x05, 0x1e, 0x06, 0x60, 0x1b, 0x00, + 0xf0, 0xec, 0x14, 0x1f, 0x4e, 0x9d, 0x24, 0x56, + 0xc8, 0x43, 0x64, 0x7e, 0x5a, 0xaf, 0x66, 0x6b, + 0x6a, 0xb1, 0x84, 0xec, 0xb1, 0xe0, 0x55, 0x6d, + 0xf5, 0x03, 0x56, 0x70, 0x73, 0x77, 0x3b, 0x7f, + 0xf5, 0x9b, 0x2d, 0x62, 0x40, 0x18, 0x6a, 0xf5, + 0x1f, 0xc5, 0xf7, 0xa3, 0x2e, 0x3f, 0x5c, 0x98, + 0x42, 0x08, 0x21, 0x09, 0x60, 0x78, 0x3f, 0xf8, + 0x47, 0x43, 0xf6, 0xa9, 0x27, 0x0a, 0x1e, 0x33, + 0x03, 0xea, 0xfc, 0x08, 0x61, 0x08, 0x7d, 0xa5, + 0xc9, 0xe6, 0xcd, 0xce, 0x7d, 0x81, 0xfb, 0x43, + 0xd1, 0xf8, 0x90, 0x3c, 0xaa, 0xaf, 0x53, 0x96, + 0x42, 0xfa, 0x98, 0xbc, 0x3c, 0x8c, 0x2f, 0xd2, + 0xc8, 0xa5, 0xaf, 0xa9, 0x93, 0xf9, 0x6b, 0x82, + 0x58, 0x28, 0xc0, 0xf8, 0xfd, 0x85, 0x4a, 0x95, + 0x0e, 0x59, 0xfe, 0xee, 0x16, 0xab, 0x6e, 0x30, + 0xc3, 0x4c, 0x4f, 0xb3, 0xfe, 0x37, 0xfe, 0x4d, + 0xcf, 0x66, 0x4d, 0x6f, 0x79, 0xfb, 0xc9, 0xc8, + 0xbf, 0x21, 0xc3, 0x03, 0xdf, 0x84, 0x0a, 0xc0, + 0xe5, 0x28, 0xf8, 0x0e, 0x8e, 0x83, 0xff, 0xcf, + 0x27, 0x2f, 0x54, 0xb8, 0xe5, 0x52, 0xae, 0xf9, + 0xb9, 0x37, 0x1b, 0x97, 0x62, 0x8f, 0x29, 0x96, + 0xe6, 0xac, 0x6e, 0x1c, 0xb6, 0xde, 0x21, 0xe4, + 0x34, 0xed, 0x71, 0x9b, 0x69, 0xfe, 0xac, 0x4a, + 0x4a, 0x07, 0x55, 0x2b, 0x08, 0x42, 0x1a, 0x46, + 0xe2, 0x51, 0x08, 0x7a, 0x21, 0x7c, 0x0e, 0x68, + 0x34, 0x11, 0x92, 0xd5, 0x6c, 0xf9, 0xa5, 0x4a, + 0x75, 0x52, 0x56, 0x04, 0x11, 0xfb, 0x55, 0x16, + 0xa8, 0xd5, 0x7e, 0xb8, 0x38, 0x93, 0x7f, 0xbb, + 0xa0, 0xb2, 0x28, 0xd0, 0x33, 0x62, 0x58, 0x94, + 0x9c, 0x78, 0x3f, 0x48, 0xa8, 0x4a, 0xa2, 0x1a, + 0x96, 0xb0, 0xb1, 0x52, 0x42, 0xf5, 0x49, 0xfd, + 0x36, 0x66, 0xea, 0xfe, 0x9e, 0x6f, 0xdb, 0x93, + 0x79, 0x6a, 0x25, 0xd7, 0xe3, 0xec, 0x03, 0x5b, + 0x1f, 0x0f, 0x47, 0x63, 0xe1, 0xf4, 0x1d, 0x0f, + 0x00, 0xe8, 0xf9, 0xaf, 0x26, 0x4e, 0xca, 0x7a, + 0x94, 0x7a, 0xc1, 0x77, 0xd5, 0x07, 0xdf, 0xd2, + 0xdf, 0x56, 0x9b, 0xfa, 0x5c, 0x61, 0x99, 0x65, + 0x6b, 0xc0, 0x65, 0x82, 0xbf, 0xa9, 0xa3, 0x89, + 0x02, 0xd4, 0xc2, 0x06, 0x0e, 0x80, 0x31, 0xa0, + 0x78, 0x2f, 0xf9, 0x44, 0x06, 0x18, 0x9b, 0x7e, + 0xac, 0x1e, 0x0b, 0xfd, 0x9f, 0x82, 0x85, 0x91, + 0x28, 0x18, 0x38, 0xf7, 0x04, 0x28, 0x23, 0xe8, + 0x30, 0x18, 0x10, 0x18, 0x51, 0xec, 0xe0, 0x2b, + 0x27, 0xc5, 0x7d, 0x51, 0xde, 0x75, 0x74, 0x27, + 0xb5, 0xc1, 0x66, 0xc0, 0x8e, 0x10, 0xcb, 0xd2, + 0x83, 0x32, 0x21, 0x26, 0x12, 0x07, 0xf1, 0x37, + 0xbe, 0xaf, 0x52, 0x44, 0xcd, 0x40, 0x6c, 0x12, + 0xfb, 0xcc, 0xef, 0x03, 0xfb, 0x90, 0x21, 0xa4, + 0xef, 0x74, 0x18, 0xd2, 0x9b, 0x3c, 0x22, 0x1f, + 0x14, 0x01, 0xe0, 0x51, 0x62, 0x66, 0x52, 0x40, + 0x3b, 0xa2, 0x4e, 0x09, 0x5e, 0x05, 0x3f, 0xc7, + 0xc0, 0xa7, 0xcb, 0x47, 0x20, 0xaa, 0x8c, 0x8e, + 0x14, 0xf0, 0xb7, 0xa3, 0x80, 0x23, 0xc2, 0xc0, + 0xe7, 0x87, 0xcd, 0x24, 0x6c, 0x49, 0x03, 0x82, + 0x18, 0x31, 0x5e, 0x17, 0xc6, 0x9a, 0xbc, 0x60, + 0x1e, 0x0b, 0xfd, 0xb1, 0x28, 0x10, 0xc2, 0x13, + 0x5f, 0xa3, 0x75, 0x05, 0x8d, 0x89, 0x25, 0xc5, + 0x5b, 0xf5, 0x0a, 0x78, 0x05, 0xbe, 0xf2, 0x1a, + 0xca, 0x86, 0x80, 0xc7, 0x9a, 0x55, 0xe9, 0x33, + 0xde, 0x2b, 0xfe, 0xff, 0x74, 0x45, 0xdb, 0x77, + 0x76, 0x95, 0xdf, 0xff, 0x6d, 0xaf, 0x35, 0x8f, + 0x79, 0x01, 0x64, 0x91, 0x10, 0xcc, 0x55, 0xae, + 0x68, 0x14, 0x00, 0xcd, 0x0f, 0x19, 0x56, 0x56, + 0x39, 0xc6, 0x2e, 0x79, 0xa6, 0xb5, 0x70, 0xe6, + 0x90, 0x6a, 0x0c, 0xb2, 0xa9, 0x3d, 0xde, 0x16, + 0xb6, 0xdf, 0xf5, 0x44, 0x59, 0x4d, 0xdb, 0xd7, + 0xc7, 0xd4, 0x06, 0xd0, 0x07, 0x03, 0x97, 0x3f, + 0xa1, 0xa4, 0x48, 0x81, 0xc7, 0x5a, 0x1b, 0x0f, + 0x6d, 0x33, 0xa6, 0x2d, 0xf0, 0xe8, 0xb9, 0x8e, + 0x0e, 0x13, 0x30, 0xd4, 0x35, 0xe6, 0xbd, 0x81, + 0x91, 0x84, 0x0b, 0x32, 0x2c, 0x2f, 0x09, 0x9d, + 0x9d, 0x3f, 0xe5, 0x34, 0x11, 0xce, 0x62, 0x19, + 0xd2, 0x9e, 0x3f, 0x4e, 0x78, 0x0e, 0x25, 0x19, + 0x11, 0xf5, 0x00, 0x3c, 0x94, 0x23, 0xdc, 0x07, + 0x23, 0x39, 0x91, 0xa3, 0xe1, 0xe5, 0x02, 0x43, + 0x4d, 0x3f, 0x51, 0x82, 0xc4, 0x1c, 0x2e, 0xeb, + 0xcf, 0xc1, 0xf3, 0x0d, 0x27, 0xb9, 0x93, 0x74, + 0x73, 0x37, 0x6d, 0xd0, 0x33, 0x9e, 0xea, 0x39, + 0x14, 0xa2, 0xea, 0x22, 0xce, 0x73, 0x88, 0x88, + 0x54, 0xa8, 0xc4, 0xc2, 0xd5, 0x0b, 0x2c, 0x37, + 0xe2, 0xdd, 0x88, 0x44, 0xc6, 0xc1, 0x5d, 0x5c, + 0xae, 0xec, 0xa8, 0xd4, 0x44, 0x1c, 0xaa, 0x3b, + 0xd5, 0x90, 0x20, 0x9d, 0x43, 0xc3, 0x83, 0x71, + 0xea, 0x82, 0xf6, 0xc4, 0x0b, 0x1a, 0xff, 0x40, + 0x87, 0xd8, 0x0f, 0x66, 0xf3, 0xf2, 0x72, 0x6a, + 0xd6, 0x11, 0xad, 0xef, 0xd9, 0xa0, 0xc1, 0xef, + 0xe1, 0x59, 0x56, 0x77, 0x95, 0x44, 0x88, 0x44, + 0x5e, 0xf2, 0x22, 0xea, 0xce, 0x15, 0x26, 0xf6, + 0x24, 0x9b, 0xb9, 0xb7, 0xa8, 0x54, 0xd6, 0x65, + 0xbc, 0xe2, 0xd1, 0x6f, 0x4e, 0x45, 0x90, 0x8c, + 0xce, 0xf6, 0x23, 0x8b, 0xc3, 0x43, 0x5a, 0x9a, + 0xde, 0xe2, 0x82, 0xd0, 0xfb, 0xed, 0xb2, 0x1e, + 0x41, 0xc2, 0x05, 0x08, 0x06, 0xd7, 0x54, 0xf1, + 0x1c, 0x95, 0x71, 0x41, 0x4a, 0xd3, 0x72, 0xc5, + 0xb9, 0x93, 0x6d, 0xd6, 0xb3, 0xa8, 0xaa, 0xc8, + 0xed, 0x8b, 0xc5, 0xd6, 0x97, 0x49, 0xd7, 0x9d, + 0x89, 0xe4, 0x91, 0x69, 0x2c, 0xda, 0xba, 0xd6, + 0x0d, 0x83, 0xde, 0xc5, 0xc6, 0x26, 0xfa, 0x81, + 0xe9, 0x56, 0xea, 0x9b, 0x27, 0x36, 0xa3, 0xe7, + 0x2a, 0xcb, 0x2c, 0x8b, 0xa3, 0x71, 0x99, 0xe5, + 0x9b, 0xc4, 0x10, 0x33, 0xa1, 0x5c, 0x4d, 0x45, + 0x62, 0x02, 0xab, 0x93, 0x9f, 0x51, 0x20, 0x77, + 0xe5, 0x37, 0x72, 0xa0, 0x95, 0x74, 0x5c, 0x5e, + 0xa9, 0x58, 0x6a, 0x33, 0xfa, 0xbf, 0x0f, 0xf9, + 0xa9, 0x8b, 0x75, 0xaf, 0x58, 0x5b, 0xcc, 0xfb, + 0x17, 0x43, 0xd2, 0xae, 0xf9, 0x47, 0xb6, 0x1b, + 0xde, 0xc5, 0xd1, 0xae, 0x8d, 0xeb, 0x37, 0xe5, + 0xf3, 0x3e, 0xc2, 0x9f, 0x69, 0x6e, 0xb7, 0xf0, + 0x21, 0x22, 0x2e, 0x76, 0x49, 0x57, 0x45, 0x56, + 0x40, 0x8d, 0xe2, 0x54, 0x8a, 0x8b, 0x4b, 0x6c, + 0x68, 0x70, 0xc2, 0x2f, 0x7b, 0x99, 0x16, 0xef, + 0x54, 0xc8, 0xa3, 0xa1, 0xea, 0x3e, 0xda, 0xb8, + 0x56, 0xa5, 0xbc, 0x20, 0xab, 0xa2, 0xaf, 0x27, + 0xa2, 0xeb, 0xa1, 0x9b, 0x32, 0x4d, 0xa6, 0xf8, + 0x1c, 0x68, 0x61, 0x45, 0x7a, 0xb3, 0x6b, 0x4d, + 0x0e, 0x3f, 0xfb, 0xb8, 0x8e, 0x7e, 0xf7, 0x85, + 0x8b, 0x55, 0x1c, 0xe6, 0x4e, 0x73, 0xbc, 0x8b, + 0x09, 0x88, 0xfe, 0x37, 0xa5, 0x9d, 0xb6, 0x5b, + 0x67, 0x38, 0x80, 0xd7, 0x7b, 0xc2, 0x53, 0xae, + 0x58, 0xb2, 0xd9, 0xb6, 0xae, 0x4b, 0x0d, 0xaf, + 0x4d, 0x94, 0x3b, 0x5c, 0xfe, 0x9a, 0xb8, 0x90, + 0x15, 0xbf, 0x56, 0xb6, 0xb7, 0x72, 0x2d, 0x7d, + 0x65, 0x96, 0x08, 0x90, 0xab, 0xba, 0xa4, 0xd1, + 0x11, 0x5a, 0x3c, 0xcd, 0x62, 0x59, 0x3e, 0xc4, + 0xe6, 0xf6, 0xac, 0xa4, 0xae, 0x59, 0xb3, 0xba, + 0xa7, 0x88, 0xfb, 0x28, 0xde, 0x72, 0x11, 0xd8, + 0xe3, 0xb2, 0x23, 0x95, 0x05, 0x5a, 0x8c, 0x16, + 0xea, 0xf0, 0xdc, 0x59, 0x01, 0x3c, 0xff, 0x54, + 0xe1, 0x65, 0xf5, 0xe5, 0x0f, 0x2d, 0x58, 0x63, + 0x7b, 0x9c, 0xe3, 0xd9, 0x7a, 0xb1, 0x2f, 0x7b, + 0x28, 0x4b, 0x13, 0x4d, 0x33, 0x03, 0x86, 0x2f, + 0xbc, 0x1e, 0xdc, 0x91, 0x1f, 0x7b, 0x79, 0x00, + 0xae, 0xad, 0xde, 0xf1, 0x18, 0x50, 0x4d, 0x80, + 0x33, 0x9d, 0xb9, 0xca, 0x50, 0x8f, 0x84, 0xab, + 0xf0, 0x99, 0x55, 0x73, 0x73, 0xdc, 0x6b, 0x2e, + 0x7f, 0x9c, 0x9f, 0x11, 0x20, 0x2b, 0xe2, 0x95, + 0xc9, 0xa1, 0xab, 0x24, 0x93, 0xb0, 0xd1, 0x51, + 0x52, 0x05, 0xd6, 0x0c, 0x5f, 0x78, 0x4b, 0x4f, + 0xd4, 0xc4, 0x6a, 0x92, 0xfa, 0x6b, 0x6a, 0x76, + 0xf4, 0x73, 0x62, 0x8e, 0x6a, 0xca, 0x16, 0x43, + 0x06, 0xd3, 0xa8, 0xc2, 0x9b, 0xb0, 0x72, 0xca, + 0xa9, 0xf8, 0xb4, 0x1f, 0xb0, 0xdf, 0xba, 0x49, + 0xb3, 0x96, 0x0d, 0xd1, 0x2e, 0x68, 0x4e, 0x83, + 0x10, 0x41, 0xad, 0xb7, 0x36, 0xde, 0xb7, 0xce, + 0xf0, 0xb7, 0x16, 0x5a, 0xe2, 0xd7, 0x96, 0x0a, + 0xcb, 0xe2, 0xac, 0xeb, 0x05, 0x57, 0x91, 0x99, + 0x78, 0x8f, 0x8b, 0xf7, 0x16, 0x5f, 0x90, 0x28, + 0x5b, 0x6b, 0xa2, 0xee, 0xf7, 0xa0, 0xf5, 0x30, + 0x01, 0x84, 0xbd, 0x05, 0xe0, 0x3a, 0x1b, 0x04, + 0xd5, 0x56, 0xd3, 0x61, 0x8c, 0xa0, 0xe0, 0x1e, + 0x72, 0xa9, 0xf9, 0x10, 0x1f, 0xd3, 0xa3, 0x68, + 0xca, 0x11, 0x1d, 0x2c, 0xa6, 0x9a, 0x88, 0xae, + 0x29, 0xe7, 0xaf, 0xfd, 0x3f, 0xc1, 0xce, 0x7b, + 0xfc, 0x53, 0xec, 0x6f, 0x90, 0x41, 0xcc, 0xb3, + 0x19, 0xe6, 0x0e, 0x66, 0xa8, 0x73, 0x52, 0xb1, + 0xa4, 0x20, 0xe4, 0x47, 0x0c, 0xb4, 0xad, 0x9b, + 0xf6, 0x73, 0xe9, 0xae, 0x7b, 0x2c, 0x2c, 0xf9, + 0x6c, 0x05, 0x6c, 0x0e, 0x54, 0x41, 0xb5, 0xe8, + 0xc5, 0x18, 0xa9, 0x4a, 0x81, 0xc2, 0x8a, 0x98, + 0xaa, 0xf2, 0xce, 0x7f, 0xde, 0xff, 0xaa, 0x36, + 0x99, 0xf7, 0x99, 0x6b, 0x79, 0x7a, 0x56, 0xc3, + 0x33, 0x5a, 0xde, 0x6c, 0x9b, 0x14, 0xe5, 0xe6, + 0xe6, 0x68, 0xdf, 0x23, 0xde, 0xef, 0x57, 0xed, + 0xb6, 0xdb, 0xd4, 0x3d, 0xb4, 0x96, 0xa1, 0xb4, + 0x8d, 0x05, 0x24, 0x80, 0xe2, 0x51, 0xaf, 0xe8, + 0x3f, 0x7c, 0x00, 0x72, 0x13, 0xc6, 0xc2, 0xd0, + 0x2b, 0x26, 0x8e, 0x74, 0x7c, 0x3c, 0xd6, 0x62, + 0x8b, 0x15, 0xfc, 0x74, 0x3c, 0xfa, 0x59, 0x73, + 0x85, 0x97, 0x13, 0xfd, 0x35, 0x57, 0x2b, 0x53, + 0x24, 0x6a, 0x96, 0xf5, 0xa5, 0x12, 0x7a, 0xe2, + 0x88, 0x79, 0x54, 0xe9, 0x07, 0x83, 0xf5, 0x10, + 0x7e, 0x93, 0xc9, 0x7d, 0x2a, 0x9e, 0x37, 0xaa, + 0xfd, 0x4b, 0x78, 0x37, 0x2d, 0x61, 0xb6, 0x1b, + 0x29, 0x0f, 0x54, 0x7d, 0x6b, 0xf9, 0xa5, 0x98, + 0x7a, 0xaf, 0x41, 0x63, 0xd0, 0xc0, 0xeb, 0x19, + 0x83, 0x81, 0x3a, 0xd9, 0x06, 0x24, 0xaf, 0xa3, + 0x44, 0xc4, 0x9b, 0xca, 0x37, 0xcc, 0x2c, 0x51, + 0x22, 0x8a, 0xd6, 0x56, 0x0b, 0x24, 0x92, 0x35, + 0x58, 0xb0, 0x70, 0x20, 0x4c, 0xc9, 0xe8, 0xc1, + 0x60, 0xe0, 0xb2, 0x4f, 0x28, 0x51, 0x0f, 0x29, + 0x31, 0xa9, 0xd8, 0xa9, 0xa4, 0xc9, 0xa6, 0xf3, + 0xb8, 0x3e, 0x1e, 0x24, 0x2e, 0x9b, 0x73, 0xaa, + 0x2b, 0x70, 0xb9, 0x86, 0x87, 0x3b, 0x93, 0x7f, + 0x30, 0xb5, 0x4a, 0x82, 0xdf, 0xa8, 0xe2, 0x9a, + 0x7c, 0xcf, 0x4f, 0x7e, 0x9b, 0x2b, 0x19, 0x05, + 0x5a, 0x8c, 0x24, 0x07, 0x12, 0x91, 0xe9, 0x8b, + 0x44, 0x84, 0x93, 0x47, 0x29, 0xd8, 0x1f, 0x09, + 0x54, 0x77, 0x36, 0x96, 0x27, 0x06, 0x50, 0x3e, + 0xf2, 0x59, 0xff, 0x87, 0x6c, 0xfd, 0x2e, 0x35, + 0x89, 0xef, 0xea, 0x9d, 0x2d, 0xbb, 0xf5, 0x2d, + 0xaf, 0x2d, 0xbd, 0x78, 0x95, 0x38, 0xe1, 0xb4, + 0xda, 0xc7, 0xd3, 0x34, 0x3f, 0x53, 0x24, 0xaa, + 0x93, 0xe3, 0x4c, 0xb1, 0xbf, 0xc1, 0xb5, 0xfb, + 0x5a, 0xa7, 0x0a, 0xbf, 0x26, 0xaf, 0x2f, 0x2a, + 0x24, 0x4e, 0x44, 0x4a, 0x49, 0x93, 0x1a, 0xf9, + 0x6b, 0x79, 0xac, 0xaf, 0xc5, 0x3c, 0xcb, 0xca, + 0x6e, 0x50, 0x60, 0xa5, 0x3d, 0xf3, 0x78, 0xb3, + 0x5c, 0x44, 0xa6, 0xfc, 0xd6, 0x8c, 0xba, 0x8c, + 0x1d, 0x48, 0x06, 0x10, 0x9a, 0x88, 0x10, 0x1e, + 0xd7, 0xb2, 0xe6, 0xf5, 0xa4, 0xe9, 0x15, 0x09, + 0x25, 0xed, 0x35, 0x93, 0x75, 0xb6, 0x5a, 0x92, + 0x22, 0x54, 0xd6, 0x78, 0x93, 0x39, 0xef, 0x01, + 0x49, 0x92, 0x39, 0x3d, 0x4d, 0xe6, 0x8b, 0xa7, + 0x8b, 0x92, 0x5b, 0xb3, 0x1a, 0x48, 0x93, 0xcd, + 0x5e, 0xed, 0xad, 0x7b, 0x22, 0x3d, 0xde, 0xcc, + 0xdb, 0xb7, 0x7b, 0x6f, 0x24, 0x99, 0x88, 0x0f, + 0x6f, 0xe1, 0x66, 0x45, 0x3d, 0x02, 0x74, 0xd2, + 0xc4, 0xa1, 0x57, 0x50, 0x8c, 0x95, 0x11, 0x40, + 0x2c, 0x45, 0x3c, 0x52, 0x85, 0xfa, 0x6a, 0xb4, + 0x21, 0x09, 0x0d, 0x72, 0xaa, 0x10, 0x84, 0x85, + 0x56, 0x7f, 0xcc, 0xe0, 0x80, 0x3a, 0x2e, 0x6a, + 0xc6, 0x58, 0xe8, 0xe1, 0x9c, 0xbe, 0x6b, 0x38, + 0xdb, 0x4a, 0x74, 0x70, 0xdc, 0x0f, 0x5a, 0x2d, + 0xd5, 0x16, 0x29, 0xd3, 0xe5, 0xfc, 0xc3, 0x49, + 0xb2, 0x34, 0xc3, 0x4d, 0x30, 0xd6, 0x5b, 0x71, + 0x86, 0x3d, 0x15, 0x7a, 0x5d, 0xbd, 0xfd, 0x9e, + 0xc9, 0x99, 0x3b, 0x7b, 0xbb, 0x79, 0xdb, 0xb6, + 0xed, 0x5e, 0x9f, 0x2a, 0x63, 0x5a, 0x2f, 0x25, + 0x42, 0x14, 0x42, 0x4a, 0x45, 0x13, 0x74, 0xa3, + 0x87, 0xc4, 0x7b, 0x99, 0xfc, 0xdf, 0x6f, 0xa3, + 0x7e, 0xfc, 0xb1, 0xbf, 0x7f, 0x33, 0xfe, 0xdf, + 0x55, 0xae, 0x7f, 0xdf, 0x53, 0x9b, 0x95, 0x0e, + 0x6f, 0x65, 0x21, 0xba, 0x88, 0x1d, 0xc0, 0x58, + 0x03, 0x9f, 0x81, 0xcb, 0xd4, 0x60, 0xe2, 0x17, + 0x18, 0xbe, 0xa6, 0xa2, 0x41, 0x28, 0x74, 0xd1, + 0x6b, 0x4d, 0x09, 0x43, 0xc5, 0x5e, 0x67, 0x2e, + 0x2b, 0xf2, 0xa1, 0xe2, 0x65, 0x58, 0xaf, 0x39, + 0xb1, 0x43, 0x38, 0xc3, 0x59, 0x8c, 0xe7, 0x3f, + 0xfc, 0xe7, 0xe6, 0xad, 0xfd, 0x82, 0x2b, 0xc5, + 0xad, 0x7b, 0xde, 0x6a, 0x34, 0xd7, 0xa3, 0x5e, + 0xcc, 0x99, 0xef, 0x35, 0x26, 0x67, 0xbd, 0x88, + 0xb3, 0x3d, 0xee, 0x66, 0x64, 0x85, 0x53, 0x24, + 0xe6, 0x49, 0xc8, 0x79, 0x0f, 0x55, 0xc6, 0x43, + 0x20, 0x1f, 0x0a, 0x02, 0xad, 0x88, 0x90, 0x84, + 0x56, 0x94, 0x85, 0x55, 0x1b, 0xe3, 0x0c, 0x7a, + 0xb7, 0xbe, 0x6b, 0x33, 0x59, 0xd2, 0xd6, 0x77, + 0xd9, 0x26, 0xb3, 0xfe, 0x70, 0xb5, 0xbb, 0xc9, + 0x5b, 0xff, 0x39, 0x85, 0xbb, 0xdd, 0x51, 0xc9, + 0xde, 0x3a, 0x38, 0xb0, 0xcc, 0x1d, 0xc0, 0x4e, + 0x4c, 0xe3, 0x5b, 0x62, 0x11, 0xae, 0xbe, 0xa8, + 0x86, 0x2f, 0xce, 0xdd, 0x19, 0x02, 0xc5, 0xee, + 0xc2, 0x9a, 0x0b, 0x96, 0x95, 0x63, 0x9a, 0xfa, + 0x83, 0x88, 0x74, 0x07, 0x1f, 0xd1, 0x02, 0x22, + 0x2a, 0x0c, 0x45, 0xcb, 0x42, 0x64, 0x42, 0x41, + 0xa7, 0x45, 0x21, 0x44, 0x83, 0x86, 0x03, 0x56, + 0x80, 0x31, 0x21, 0x7d, 0x59, 0x10, 0x64, 0x19, + 0x39, 0xd6, 0xe9, 0x1e, 0x9c, 0x5c, 0x44, 0xb1, + 0x28, 0x39, 0x71, 0x5a, 0x62, 0x78, 0x91, 0x60, + 0x7f, 0x2f, 0xff, 0xf0, 0x3d, 0x1c, 0x00, 0x60, + 0xe7, 0x67, 0x74, 0xcb, 0x8c, 0x21, 0x40, 0x2c, + 0x51, 0x0d, 0x75, 0x88, 0x40, 0x70, 0x38, 0x82, + 0x01, 0xc6, 0xba, 0x0e, 0x26, 0x68, 0x56, 0x44, + 0x0e, 0x34, 0xe6, 0x2b, 0x13, 0x69, 0x9a, 0x65, + 0x85, 0x28, 0x79, 0x10, 0xf0, 0x31, 0x91, 0x61, + 0x88, 0x54, 0xa2, 0xaf, 0x41, 0xcf, 0xef, 0x7b, + 0xcb, 0xcb, 0xd9, 0x54, 0xca, 0x22, 0x21, 0x40, + 0xe2, 0xfa, 0x8a, 0xf2, 0x03, 0x81, 0x72, 0x70, + 0x41, 0x9a, 0xd5, 0xdc, 0x8d, 0xf2, 0x76, 0x2e, + 0x55, 0xfb, 0xa8, 0x38, 0x6d, 0x70, 0x74, 0x7a, + 0x10, 0x54, 0xc5, 0xaa, 0x26, 0xa3, 0x44, 0x0b, + 0x00, 0x5f, 0x2c, 0xdc, 0xe0, 0x75, 0x11, 0xde, + 0x44, 0x7c, 0xec, 0x44, 0x75, 0x75, 0x43, 0x9a, + 0xc5, 0x0f, 0xed, 0xde, 0xed, 0x24, 0xd9, 0x10, + 0x62, 0xc8, 0xf8, 0x04, 0x56, 0xec, 0x46, 0x42, + 0x96, 0x15, 0xcb, 0x17, 0x5a, 0xc4, 0x38, 0xb1, + 0x22, 0xe8, 0xa1, 0x48, 0xc8, 0xe1, 0x92, 0xae, + 0x09, 0xd1, 0x34, 0xf3, 0x03, 0x9b, 0xd1, 0xb7, + 0x22, 0x05, 0x89, 0x29, 0x0e, 0xb9, 0x11, 0xf1, + 0x12, 0x14, 0x01, 0x8c, 0x0c, 0xa9, 0x3c, 0xcc, + 0x5e, 0x23, 0xec, 0x28, 0x0a, 0x67, 0x57, 0x36, + 0x0e, 0x28, 0x39, 0x22, 0x11, 0x71, 0xda, 0xbf, + 0x91, 0x7d, 0xd2, 0x85, 0xd7, 0x0c, 0xc6, 0x01, + 0x3d, 0x2b, 0xda, 0xcb, 0x52, 0x23, 0x88, 0x56, + 0xec, 0xe8, 0xc6, 0x20, 0x44, 0x4f, 0x8a, 0x14, + 0x12, 0x50, 0xc5, 0x12, 0xe4, 0x4c, 0xa4, 0xe7, + 0x46, 0x9a, 0x66, 0x72, 0x36, 0xde, 0x8e, 0x7e, + 0xc9, 0x50, 0x14, 0xf4, 0x5a, 0x12, 0x55, 0xa1, + 0x5d, 0x24, 0x22, 0x82, 0xc9, 0x51, 0xcb, 0xde, + 0x02, 0xc0, 0xa7, 0xa2, 0x92, 0x35, 0x44, 0x46, + 0x85, 0x11, 0x28, 0x30, 0x51, 0xa4, 0x43, 0x41, + 0x85, 0xe0, 0xe0, 0xae, 0xf5, 0x09, 0x06, 0x99, + 0x2f, 0x31, 0x99, 0x16, 0xc2, 0xc9, 0xc0, 0xd3, + 0xa3, 0x28, 0x43, 0xda, 0xbf, 0x9b, 0xe8, 0x1d, + 0xdb, 0xf5, 0xd0, 0x16, 0x60, 0x67, 0x49, 0x10, + 0xde, 0x9d, 0x9e, 0x14, 0x8c, 0x51, 0x82, 0xc0, + 0xd0, 0xa9, 0x55, 0x18, 0x5a, 0xd5, 0xb2, 0xd2, + 0xb9, 0xcd, 0x59, 0x65, 0xcd, 0xd4, 0x08, 0x14, + 0x41, 0x83, 0x9c, 0xdd, 0x5d, 0xfa, 0x6b, 0x29, + 0x05, 0xcb, 0x52, 0x32, 0x07, 0x06, 0x24, 0xe6, + 0xaf, 0xe9, 0x48, 0xa5, 0x45, 0x3a, 0x48, 0x0e, + 0x20, 0x5e, 0x70, 0x17, 0xba, 0x75, 0x69, 0x48, + 0x47, 0x1d, 0x36, 0x0e, 0x17, 0x11, 0x6e, 0xea, + 0x34, 0x63, 0x35, 0x86, 0x92, 0x5b, 0xa6, 0xa9, + 0x2c, 0xe8, 0x38, 0x16, 0x02, 0xa5, 0x59, 0xd1, + 0x75, 0x7b, 0xde, 0x70, 0x1f, 0xbe, 0x00, 0x3f, + 0xfa, 0xfa, 0xce, 0x9a, 0x90, 0x51, 0xe4, 0xea, + 0x0c, 0x22, 0x99, 0x57, 0x34, 0x4d, 0x57, 0xa3, + 0x8f, 0x86, 0xca, 0x0f, 0xdb, 0x6d, 0x37, 0x50, + 0x4a, 0xe5, 0x5b, 0x6a, 0xd8, 0xbf, 0x65, 0xec, + 0xd7, 0x2b, 0xb5, 0xff, 0x61, 0xc7, 0xe9, 0x7b, + 0xd3, 0x96, 0xcc, 0x9c, 0x5a, 0xb7, 0xed, 0x41, + 0x38, 0x73, 0x46, 0x53, 0x75, 0x6b, 0xfd, 0x30, + 0xd7, 0x84, 0xaf, 0xd3, 0x32, 0x07, 0x95, 0xfc, + 0x73, 0x5a, 0x1b, 0xf9, 0x42, 0x99, 0x03, 0x8e, + 0x10, 0xcc, 0xa0, 0xe1, 0xa0, 0xc4, 0x10, 0x8b, + 0xf7, 0xe3, 0xdc, 0xf0, 0x7d, 0x71, 0x4e, 0x7e, + 0x5d, 0xb4, 0x36, 0x14, 0x28, 0x83, 0x03, 0x00, + 0x58, 0x82, 0xc0, 0xfa, 0x7f, 0x39, 0x51, 0x9e, + 0x89, 0xbb, 0x20, 0xcd, 0x12, 0x01, 0x3d, 0xaf, + 0x50, 0x83, 0x85, 0xe8, 0x8a, 0x05, 0x29, 0xaf, + 0x4e, 0xe8, 0x84, 0x31, 0x08, 0x8c, 0x3f, 0xa7, + 0x22, 0xf5, 0x88, 0xea, 0x83, 0xba, 0x18, 0x0a, + 0xf4, 0x92, 0xa1, 0x44, 0x0e, 0x44, 0x12, 0x6a, + 0x0e, 0x90, 0x1c, 0x7a, 0xa0, 0x21, 0xa9, 0xb5, + 0xd1, 0x83, 0xba, 0x6d, 0x08, 0x4d, 0xdf, 0x97, + 0x35, 0x22, 0x30, 0x72, 0x03, 0xbf, 0x88, 0xc0, + 0x72, 0xe0, 0x38, 0x29, 0x9d, 0x34, 0xbd, 0x0a, + 0x34, 0xdf, 0x91, 0xf0, 0xa4, 0x53, 0x39, 0x09, + 0x2a, 0x30, 0x73, 0xdf, 0x91, 0xc4, 0x00, 0xe5, + 0xa7, 0x01, 0x39, 0xf9, 0x11, 0xa0, 0x8a, 0xbe, + 0x2f, 0xaa, 0x31, 0x90, 0xcc, 0x31, 0x27, 0xfd, + 0x34, 0xb1, 0xcf, 0x01, 0xfd, 0x7f, 0xff, 0xd2, + 0x74, 0xa0, 0x1d, 0x4a, 0x4e, 0x59, 0x0e, 0xe9, + 0xb4, 0x05, 0x00, 0xe3, 0x44, 0xf8, 0x31, 0x05, + 0xd3, 0x8b, 0x21, 0x7e, 0x5c, 0x1c, 0x03, 0xc1, + 0x3d, 0x51, 0x14, 0x0a, 0xea, 0x78, 0xa0, 0x31, + 0x09, 0x64, 0x1c, 0x12, 0xbe, 0x1b, 0x80, 0xe2, + 0x0c, 0x8b, 0x84, 0x85, 0x20, 0xb0, 0x09, 0x18, + 0x28, 0xd3, 0xe0, 0xe4, 0x20, 0xe0, 0x4d, 0xf6, + 0x9a, 0x07, 0x06, 0x4f, 0x60, 0xe4, 0x46, 0xdf, + 0xc6, 0x22, 0xe0, 0xc0, 0x28, 0xe2, 0x32, 0x0d, + 0x3f, 0xde, 0x00, 0xe0, 0x92, 0x01, 0x79, 0x54, + 0x6e, 0xec, 0xba, 0x02, 0x1a, 0x6c, 0xfc, 0x5f, + 0x8b, 0xc0, 0x77, 0x4f, 0x4a, 0x03, 0x61, 0x1b, + 0x50, 0x83, 0x84, 0x5f, 0xa3, 0x31, 0x45, 0xc5, + 0x81, 0xd4, 0xee, 0x9c, 0xda, 0x48, 0x31, 0xe2, + 0x32, 0x8a, 0xe2, 0xd2, 0x5b, 0xb7, 0x68, 0xcb, + 0x0d, 0x12, 0xa2, 0x42, 0x14, 0x65, 0xcd, 0x03, + 0x83, 0x20, 0x9d, 0x0e, 0x0b, 0x82, 0x96, 0xb4, + 0x64, 0xed, 0x34, 0xf9, 0xb5, 0x0d, 0x80, 0xfd, + 0xb0, 0x01, 0xd6, 0x62, 0x8d, 0x5d, 0x1d, 0x29, + 0xa1, 0x80, 0x66, 0x32, 0x7f, 0xe9, 0xb1, 0x33, + 0x17, 0x1a, 0x87, 0x59, 0x72, 0x0a, 0xba, 0x7a, + 0x88, 0x92, 0xf1, 0xf8, 0x31, 0x07, 0x40, 0x8f, + 0x12, 0xa0, 0x45, 0x3a, 0x88, 0x1c, 0x11, 0x30, + 0x72, 0xe4, 0x5a, 0x83, 0x61, 0x3c, 0x4e, 0xaa, + 0x00, 0xc9, 0x19, 0xf6, 0xb0, 0x38, 0x07, 0x04, + 0x93, 0x46, 0x62, 0x66, 0xb0, 0x2c, 0x08, 0xea, + 0x95, 0xc1, 0x3f, 0x48, 0x99, 0x3a, 0x8e, 0xf4, + 0xd2, 0xc0, 0xe0, 0xc4, 0x69, 0x34, 0x1e, 0x82, + 0x00, 0x30, 0x71, 0x4b, 0xdb, 0x0c, 0x45, 0x29, + 0xda, 0x4d, 0xa7, 0xf9, 0xde, 0x74, 0x5c, 0x0b, + 0xa4, 0xfc, 0xa6, 0xfc, 0x3d, 0x51, 0xc9, 0xf0, + 0xf3, 0x88, 0xcd, 0x4e, 0xd3, 0x60, 0xbb, 0xf3, + 0xaa, 0x17, 0xe4, 0xa2, 0xe0, 0x71, 0xf8, 0x8b, + 0x5c, 0x86, 0xa8, 0x3b, 0xa7, 0x64, 0x1a, 0x69, + 0x8e, 0x01, 0x14, 0x49, 0x41, 0x3c, 0x08, 0xd0, + 0x18, 0x07, 0xb9, 0x1c, 0x4e, 0x25, 0xd4, 0x71, + 0x80, 0x7d, 0x8f, 0xff, 0x52, 0xdd, 0x36, 0x14, + 0xd7, 0x4d, 0x38, 0xba, 0x36, 0x5a, 0x18, 0xa9, + 0xd2, 0x91, 0xda, 0x1f, 0xb5, 0x90, 0xa1, 0x71, + 0x7f, 0x48, 0x28, 0x19, 0x7a, 0x8c, 0xbc, 0x61, + 0xc8, 0x12, 0x7e, 0xae, 0x15, 0x60, 0xc8, 0x4d, + 0xe6, 0xea, 0x20, 0xc0, 0x13, 0x75, 0xe9, 0x52, + 0xaf, 0x74, 0x3d, 0xd6, 0x6d, 0xa2, 0xba, 0x69, + 0x32, 0xa4, 0x77, 0x65, 0x3d, 0x2b, 0x50, 0x75, + 0x05, 0xd5, 0xee, 0x1f, 0x55, 0xca, 0xd1, 0xbf, + 0x5e, 0x59, 0xbe, 0x06, 0x24, 0xc3, 0xe9, 0xff, + 0xeb, 0x20, 0x39, 0x41, 0xda, 0x80, 0x75, 0x07, + 0x0d, 0x56, 0x02, 0xe7, 0xaf, 0xa0, 0xcc, 0x8b, + 0x4e, 0x65, 0x91, 0x12, 0xc3, 0x49, 0x52, 0xe7, + 0x59, 0xa5, 0x01, 0x47, 0x2d, 0x06, 0x14, 0x4e, + 0x6a, 0x3a, 0x76, 0x2e, 0xbf, 0xfe, 0xd7, 0xc1, + 0x8d, 0xfa, 0xd4, 0x44, 0x27, 0x3e, 0x5a, 0x25, + 0xb0, 0xc5, 0x51, 0xd3, 0x54, 0xb2, 0xab, 0xf0, + 0x3c, 0x64, 0x01, 0xad, 0xb7, 0x8b, 0x85, 0x63, + 0x16, 0x67, 0x95, 0xc0, 0x64, 0x3e, 0xd9, 0x62, + 0x14, 0x41, 0x29, 0x6f, 0x5b, 0xc5, 0xba, 0x84, + 0xd0, 0xc4, 0x2b, 0x4d, 0x8a, 0x01, 0xd2, 0xe0, + 0x0f, 0x76, 0x9a, 0x02, 0x40, 0xed, 0xa1, 0x2e, + 0x37, 0x7d, 0x8c, 0xe4, 0xf5, 0x90, 0x15, 0xad, + 0x6b, 0x48, 0x10, 0x29, 0x40, 0xb1, 0x01, 0x1d, + 0xc3, 0x5c, 0x07, 0x1f, 0x24, 0xab, 0x4a, 0x90, + 0x14, 0x82, 0xc0, 0x27, 0x8d, 0x44, 0x18, 0x12, + 0x05, 0x1a, 0x24, 0x1c, 0x34, 0xbf, 0x42, 0xbd, + 0x3b, 0x15, 0x6d, 0x07, 0x12, 0x0b, 0x9e, 0xac, + 0x0c, 0x81, 0xcf, 0xf6, 0x03, 0xd0, 0x40, 0x06, + 0x30, 0x20, 0x61, 0x4e, 0x9d, 0x8c, 0xf8, 0x26, + 0x84, 0x43, 0x33, 0x74, 0x1c, 0x0b, 0xec, 0xb9, + 0x36, 0x41, 0x45, 0x5a, 0x28, 0xb9, 0xcd, 0x3f, + 0x9d, 0x2d, 0x80, 0xe9, 0x01, 0xc2, 0xfa, 0x34, + 0xde, 0x07, 0x1b, 0x73, 0xc1, 0xb8, 0xcf, 0xa5, + 0x23, 0x56, 0xd7, 0x41, 0xc8, 0xf8, 0x14, 0xe7, + 0x2a, 0xf0, 0x52, 0x0e, 0x0a, 0x3c, 0x43, 0x7a, + 0x8c, 0x4f, 0x89, 0x41, 0xd4, 0x13, 0x7d, 0xa0, + 0xe0, 0xc8, 0x89, 0xaa, 0x03, 0xd1, 0x3f, 0x3b, + 0xd2, 0x40, 0x71, 0xd6, 0x37, 0x01, 0xfc, 0x05, + 0xd3, 0x84, 0x39, 0x09, 0x03, 0x23, 0xa1, 0x1e, + 0x9e, 0x19, 0x83, 0x06, 0x41, 0x57, 0x07, 0x0c, + 0x09, 0x4f, 0x63, 0xfc, 0x66, 0xb8, 0x38, 0xf2, + 0xf0, 0x17, 0x71, 0x3c, 0x32, 0x0a, 0xba, 0x28, + 0x81, 0x72, 0x40, 0x5c, 0x35, 0xa9, 0x0b, 0x07, + 0x02, 0x6a, 0x12, 0x11, 0xe9, 0xea, 0x0e, 0x01, + 0xe0, 0xb8, 0xe8, 0x81, 0xc2, 0x8d, 0x46, 0x42, + 0x9c, 0x0f, 0x43, 0xff, 0xff, 0x02, 0x76, 0x22, + 0xa9, 0xcd, 0x07, 0x52, 0x3e, 0x0e, 0x04, 0xea, + 0xa0, 0xf3, 0xd0, 0x01, 0x83, 0x88, 0x9a, 0xe8, + 0xd1, 0x92, 0x03, 0x81, 0x3e, 0xf6, 0x54, 0x5d, + 0x58, 0x4d, 0x17, 0x66, 0xc3, 0x10, 0x5c, 0xf0, + 0xcc, 0x1c, 0x12, 0x3a, 0xe9, 0x05, 0x80, 0x54, + 0xc8, 0xc1, 0xd7, 0xa7, 0xaa, 0xf5, 0xd8, 0x6d, + 0x68, 0x8a, 0xba, 0x39, 0xc4, 0x08, 0xc8, 0x2c, + 0x07, 0x83, 0x84, 0xf5, 0x79, 0xa8, 0x45, 0xcb, + 0x82, 0xc3, 0x83, 0x17, 0xa6, 0x48, 0x48, 0x27, + 0xd3, 0xc2, 0xe1, 0x3f, 0x07, 0x04, 0xcc, 0x65, + 0xd0, 0xc8, 0x28, 0xc0, 0xe2, 0x40, 0x5c, 0x5b, + 0x38, 0x0b, 0xba, 0xbf, 0xa5, 0x72, 0x72, 0xca, + 0x8d, 0x1a, 0x21, 0x75, 0x8b, 0x13, 0xf2, 0x99, + 0x67, 0x10, 0x51, 0x81, 0x07, 0x15, 0x60, 0x75, + 0x58, 0x2a, 0xb6, 0x9e, 0xd3, 0xca, 0x54, 0xc5, + 0x8a, 0x41, 0xce, 0x65, 0x24, 0x4d, 0x15, 0x45, + 0xd0, 0xc0, 0x5c, 0x0b, 0xcc, 0xb1, 0xb1, 0x8f, + 0x20, 0x60, 0x13, 0x34, 0xee, 0x14, 0xbf, 0x5e, + 0x77, 0x4d, 0x03, 0xa0, 0x2c, 0x42, 0x6d, 0x2d, + 0xa7, 0x97, 0x2f, 0x98, 0xdb, 0x5c, 0x2d, 0xd5, + 0xd1, 0x77, 0xa8, 0x2e, 0x5e, 0x73, 0x81, 0x2d, + 0xef, 0xb1, 0xa5, 0x38, 0x38, 0xb9, 0x56, 0xec, + 0xd6, 0xb7, 0x64, 0x24, 0x41, 0x6a, 0x2a, 0x71, + 0x3d, 0x04, 0x5a, 0x28, 0xa9, 0x99, 0xd6, 0x49, + 0x01, 0xc4, 0x16, 0x20, 0xe8, 0xa0, 0xe5, 0x63, + 0xe8, 0x53, 0xe9, 0x2f, 0x14, 0x03, 0xb8, 0x35, + 0xa0, 0x44, 0x82, 0x2f, 0xdb, 0xd8, 0x1b, 0xeb, + 0xd0, 0x3c, 0x58, 0x3d, 0x19, 0x16, 0x1d, 0xd7, + 0xb5, 0x1b, 0x60, 0x54, 0xaf, 0xfd, 0xb4, 0x38, + 0xd7, 0x7a, 0xc2, 0xa0, 0x62, 0x49, 0x2a, 0xf5, + 0x61, 0x33, 0xfa, 0x25, 0xa7, 0xbc, 0x16, 0x27, + 0x7d, 0xd4, 0x3f, 0x76, 0xba, 0xbf, 0xcc, 0xb3, + 0x9d, 0xdc, 0xd9, 0xc3, 0xd5, 0x3e, 0xd2, 0x0b, + 0xfc, 0xb6, 0x58, 0xe8, 0x80, 0x52, 0x06, 0x07, + 0xb5, 0xfd, 0x15, 0xb1, 0x6e, 0x5e, 0xf4, 0xb3, + 0x76, 0x0a, 0xb5, 0xea, 0xfe, 0x4f, 0xd9, 0xe1, + 0xc2, 0x76, 0xbb, 0x02, 0xd9, 0x1e, 0x0f, 0x77, + 0xab, 0x4f, 0x79, 0xb5, 0x8c, 0xd2, 0xdc, 0x42, + 0x27, 0xef, 0xf5, 0x4e, 0x60, 0x31, 0xa9, 0x4d, + 0x54, 0x47, 0xf5, 0xdb, 0x4d, 0x25, 0xec, 0xee, + 0x7d, 0x56, 0x5b, 0x78, 0x2b, 0xd1, 0x25, 0xc4, + 0x75, 0x96, 0xf9, 0xc8, 0x08, 0xce, 0xfb, 0x9f, + 0xe2, 0xf3, 0x1f, 0x6d, 0xb5, 0xb6, 0x21, 0x95, + 0x01, 0xf4, 0xca, 0x8a, 0x87, 0xbb, 0x20, 0x49, + 0x53, 0x2e, 0x5c, 0xa9, 0xa8, 0x5e, 0xc3, 0x74, + 0xb4, 0xa9, 0x96, 0xb4, 0x3b, 0xf8, 0x73, 0x05, + 0x6b, 0x37, 0x79, 0x4a, 0x78, 0x2f, 0x82, 0x75, + 0xd3, 0x2b, 0x03, 0x6a, 0xda, 0x54, 0xc4, 0xfd, + 0xd6, 0xff, 0xef, 0x65, 0xe7, 0x17, 0xba, 0xb5, + 0x5c, 0xc9, 0xa8, 0x9a, 0x8f, 0x9a, 0x61, 0x8a, + 0xce, 0xa7, 0xdc, 0xc0, 0x2f, 0xf4, 0x21, 0x9a, + 0xc6, 0x85, 0x43, 0x2c, 0xe0, 0xca, 0x93, 0x69, + 0xae, 0x5d, 0x7b, 0xe3, 0x6b, 0x82, 0x71, 0x4a, + 0x8a, 0x91, 0xf1, 0x28, 0x3a, 0xbd, 0x05, 0xac, + 0x15, 0x22, 0xea, 0x04, 0x0e, 0xc8, 0xa2, 0xee, + 0xf4, 0x1c, 0x52, 0x0e, 0x40, 0x15, 0x4d, 0x8b, + 0x03, 0xa0, 0x0f, 0xe9, 0x1a, 0x0b, 0x43, 0x61, + 0x85, 0x39, 0xa6, 0x41, 0x78, 0x4b, 0x78, 0x88, + 0xf6, 0x9c, 0xf5, 0x70, 0x77, 0x02, 0x2c, 0x0f, + 0x4f, 0x00, 0x18, 0xd2, 0xc7, 0x08, 0x41, 0xc1, + 0x88, 0x4d, 0x40, 0xc7, 0x99, 0x19, 0x1e, 0x9e, + 0xf2, 0xd6, 0x02, 0xc7, 0x80, 0xe1, 0x93, 0xf7, + 0x91, 0x8c, 0x85, 0x73, 0x1a, 0x5c, 0xfc, 0x22, + 0x74, 0xa7, 0xb4, 0xd8, 0x39, 0x18, 0x4b, 0x97, + 0x01, 0xe8, 0xc1, 0x3f, 0xa2, 0x07, 0xf5, 0x80, + 0x0f, 0xf4, 0x13, 0x35, 0x02, 0xad, 0x7d, 0x20, + 0xc0, 0x1c, 0x14, 0xfa, 0x32, 0xef, 0x41, 0xc3, + 0x56, 0x19, 0x23, 0x21, 0x62, 0xe7, 0xf2, 0x02, + 0xeb, 0x4d, 0x83, 0x8a, 0x41, 0xc3, 0x07, 0x30, + 0x73, 0xf4, 0xea, 0x23, 0x40, 0xe0, 0x9d, 0xae, + 0x4a, 0x32, 0x05, 0xc4, 0xe9, 0x2f, 0x5d, 0xae, + 0xc1, 0xc5, 0x34, 0x51, 0x22, 0xad, 0xc0, 0x75, + 0xbc, 0x07, 0x1e, 0xb3, 0x47, 0xb7, 0x54, 0xf8, + 0x39, 0xcd, 0x08, 0x3a, 0x80, 0xea, 0x13, 0xb5, + 0xc1, 0xcb, 0x84, 0xac, 0x9b, 0x29, 0x0a, 0x34, + 0xfa, 0xe4, 0x83, 0x1a, 0x0e, 0x26, 0x90, 0x72, + 0xeb, 0x03, 0xa0, 0xd7, 0x23, 0xa1, 0x92, 0xc0, + 0xb1, 0x39, 0xd1, 0x03, 0x83, 0x32, 0x78, 0x09, + 0xf5, 0x7f, 0x17, 0x37, 0xd5, 0xa2, 0x31, 0xad, + 0xa2, 0xe8, 0x48, 0xa3, 0x3e, 0x6f, 0xec, 0x75, + 0xb6, 0xb3, 0xf2, 0xcb, 0x9a, 0x0e, 0xe0, 0x48, + 0x36, 0x08, 0x23, 0xe4, 0xa9, 0xd8, 0x5b, 0x6b, + 0x1b, 0x38, 0xdf, 0xbb, 0xc4, 0x7d, 0x86, 0x53, + 0x14, 0x44, 0x47, 0xf5, 0xf5, 0xca, 0x32, 0x17, + 0x86, 0x63, 0x43, 0x09, 0xeb, 0x06, 0x93, 0xfa, + 0xde, 0x08, 0xb1, 0x0c, 0x5a, 0xf4, 0x26, 0x1b, + 0xab, 0x12, 0xd5, 0x6e, 0xd2, 0xcc, 0x56, 0xc3, + 0x1f, 0xa6, 0xcd, 0x10, 0x18, 0x1e, 0x25, 0x65, + 0xb6, 0xf7, 0x7d, 0x1a, 0x56, 0x95, 0x8b, 0x22, + 0xdd, 0x18, 0x74, 0xe1, 0x53, 0xb0, 0x6f, 0xc1, + 0x5e, 0xb9, 0xe1, 0x1e, 0x17, 0x37, 0xe5, 0xbe, + 0x9f, 0x06, 0xf8, 0xb9, 0x49, 0x09, 0x94, 0xf7, + 0xfa, 0x88, 0x40, 0xde, 0x0d, 0xe5, 0xa4, 0xab, + 0x82, 0x4f, 0x48, 0x97, 0x8b, 0x45, 0x17, 0x31, + 0x4c, 0xd2, 0x81, 0x5a, 0x7b, 0x7d, 0x3a, 0xbb, + 0x02, 0x07, 0xfa, 0xf3, 0x1b, 0xcb, 0x56, 0xc5, + 0x0a, 0x62, 0x37, 0x6b, 0xab, 0xff, 0xde, 0x61, + 0x68, 0x1a, 0x6e, 0xf6, 0xc2, 0xb5, 0x91, 0x20, + 0x07, 0x05, 0x6a, 0x6e, 0x6e, 0xd8, 0xa3, 0x9c, + 0x80, 0x3c, 0x4e, 0x8c, 0xc6, 0x96, 0xef, 0x73, + 0x35, 0x08, 0x26, 0x2a, 0xdb, 0x0c, 0x2f, 0xdb, + 0x3d, 0xb3, 0x94, 0xf9, 0x72, 0xe4, 0x25, 0xca, + 0x41, 0xa6, 0x66, 0x83, 0x51, 0xfe, 0xf0, 0xb3, + 0xd7, 0x0a, 0x40, 0x77, 0x02, 0x7a, 0xa2, 0x18, + 0x43, 0x66, 0x22, 0xcb, 0x3a, 0x1c, 0x40, 0x70, + 0x26, 0xa7, 0x02, 0x09, 0x7d, 0x46, 0xd2, 0xab, + 0x41, 0x83, 0x41, 0x79, 0x1a, 0x30, 0x0f, 0xab, + 0x06, 0x0e, 0x18, 0xa0, 0xc0, 0x48, 0x23, 0xf2, + 0x06, 0xd0, 0x64, 0xfd, 0xfe, 0x5c, 0xd7, 0xed, + 0x2b, 0x53, 0xbb, 0x79, 0x0c, 0x49, 0x71, 0x70, + 0x37, 0x34, 0x7b, 0x77, 0xab, 0xa3, 0x80, 0xa6, + 0x89, 0xd7, 0x07, 0x8a, 0x80, 0x24, 0x2d, 0x4f, + 0x3c, 0xba, 0xe7, 0x4a, 0x35, 0x22, 0x4d, 0x4f, + 0x8b, 0xef, 0x10, 0x87, 0xda, 0xdc, 0xe2, 0x00, + 0x21, 0x5f, 0xdb, 0xb4, 0xdc, 0x19, 0xba, 0x11, + 0x26, 0x9d, 0x53, 0x50, 0x41, 0xad, 0x73, 0x50, + 0x85, 0x2f, 0x77, 0x50, 0x65, 0xa3, 0x20, 0x71, + 0x35, 0x71, 0x2e, 0xad, 0x8d, 0x6c, 0x17, 0x06, + 0x67, 0xaa, 0xdc, 0x5d, 0x6a, 0x6d, 0x49, 0xdd, + 0x7f, 0x32, 0xae, 0x8e, 0x04, 0x95, 0xb2, 0x71, + 0x7e, 0x2d, 0x0e, 0xc1, 0x70, 0x7f, 0x35, 0x7f, + 0x60, 0x73, 0x06, 0x11, 0xf0, 0xa8, 0x7d, 0xb2, + 0x87, 0xbf, 0x6d, 0x07, 0xa4, 0x0d, 0x0f, 0x99, + 0xc5, 0x3c, 0xe0, 0x66, 0x0e, 0x9d, 0x3f, 0xa6, + 0xae, 0xa7, 0x6b, 0x16, 0x47, 0x43, 0x87, 0x3e, + 0x17, 0xb6, 0x36, 0x68, 0x71, 0x00, 0x8b, 0x37, + 0x83, 0x08, 0x8c, 0x29, 0x2c, 0xd2, 0x46, 0x98, + 0x1b, 0x2a, 0xe1, 0x2c, 0x46, 0x31, 0xe0, 0x5b, + 0x1c, 0x86, 0xb0, 0x67, 0xd1, 0x7b, 0xe5, 0xe1, + 0xa0, 0xa3, 0x5d, 0x04, 0xc3, 0xe1, 0xeb, 0x50, + 0x15, 0xbf, 0xfc, 0x8b, 0x66, 0x4a, 0x85, 0x47, + 0x69, 0x16, 0x62, 0x2a, 0xff, 0xff, 0x7c, 0xa1, + 0x49, 0x5d, 0xde, 0x44, 0x60, 0xe2, 0x0b, 0xba, + 0x1a, 0xf2, 0x11, 0x56, 0x36, 0x85, 0x03, 0xe2, + 0x9f, 0xe4, 0x24, 0x14, 0xeb, 0xdd, 0xd6, 0x2b, + 0x5c, 0x9b, 0x9c, 0x85, 0x72, 0xae, 0x86, 0x74, + 0x89, 0x74, 0xfb, 0x6a, 0x0b, 0xee, 0xa3, 0x18, + 0xae, 0x47, 0x1c, 0xb0, 0xa6, 0x93, 0x44, 0xcb, + 0xd2, 0x51, 0x33, 0xf5, 0x4a, 0x90, 0x58, 0xba, + 0xa6, 0x50, 0x48, 0x60, 0xb1, 0x95, 0x4a, 0xc7, + 0x3c, 0xd6, 0x99, 0x9f, 0x51, 0xec, 0x61, 0x42, + 0xc8, 0x3b, 0xf6, 0xda, 0xc4, 0x4b, 0x53, 0x4b, + 0x1c, 0x44, 0x3f, 0x69, 0x2e, 0x79, 0xb6, 0xb6, + 0x55, 0xa7, 0x62, 0x9c, 0xd5, 0x14, 0xd5, 0xad, + 0x7f, 0x72, 0x89, 0xa0, 0x0c, 0xa2, 0xea, 0xc2, + 0x80, 0xd8, 0x3e, 0x11, 0xc4, 0x94, 0x9e, 0x1c, + 0x31, 0x18, 0x51, 0xde, 0xf0, 0x70, 0x7e, 0xee, + 0x16, 0x95, 0xa9, 0x2b, 0x0a, 0xa2, 0xeb, 0x25, + 0xa5, 0x55, 0x11, 0xb1, 0x49, 0xa6, 0xba, 0x4a, + 0x48, 0x1c, 0x00, 0xf0, 0xa0, 0x88, 0xf5, 0xbc, + 0xc9, 0x6f, 0x70, 0x3d, 0x93, 0xa7, 0x91, 0xd6, + 0x3d, 0x03, 0x8f, 0xfe, 0x8b, 0xd6, 0x05, 0xc1, + 0x76, 0x96, 0x6e, 0x83, 0xce, 0xff, 0xfb, 0xc3, + 0xda, 0xf0, 0xa1, 0x65, 0x97, 0xa2, 0x8b, 0xbf, + 0xa5, 0x10, 0x89, 0x02, 0xce, 0x23, 0x2d, 0xb2, + 0x55, 0x0e, 0x4f, 0x53, 0x78, 0xdf, 0xf7, 0x3d, + 0xab, 0x14, 0xbf, 0xc8, 0x0a, 0xe8, 0xfd, 0x79, + 0xb0, 0xa4, 0xa4, 0x1c, 0x41, 0x13, 0x64, 0x46, + 0x28, 0x4c, 0xb3, 0x24, 0x02, 0xba, 0x58, 0x50, + 0x14, 0xa7, 0x67, 0x35, 0x7e, 0xf2, 0xa2, 0x7b, + 0xb6, 0x0c, 0x33, 0xa8, 0x4e, 0xeb, 0xee, 0x74, + 0xb6, 0x03, 0xb8, 0x0b, 0x01, 0x71, 0x0d, 0x65, + 0x91, 0x7a, 0x0e, 0x05, 0x8f, 0x68, 0x48, 0x96, + 0x31, 0xb0, 0x39, 0xcc, 0xd4, 0x41, 0x4c, 0xec, + 0xfa, 0x22, 0xbc, 0xb5, 0x09, 0x07, 0x36, 0x77, + 0x8b, 0xe0, 0xaf, 0x5f, 0x58, 0xb1, 0xb9, 0x49, + 0x4d, 0x3b, 0xca, 0x87, 0xb6, 0x70, 0x92, 0x82, + 0xf1, 0xe5, 0xe8, 0xdb, 0x7b, 0x65, 0x2c, 0xd8, + 0xf1, 0x84, 0x08, 0x7f, 0x67, 0xf0, 0x40, 0x69, + 0x24, 0xd4, 0x6b, 0x53, 0x7c, 0x74, 0x9d, 0xe8, + 0x88, 0x2b, 0xab, 0xba, 0x49, 0xc4, 0x34, 0x55, + 0x81, 0x60, 0x0b, 0xb3, 0xc2, 0x30, 0x22, 0xa9, + 0xee, 0x82, 0x2b, 0x3a, 0x0b, 0x00, 0x5c, 0x6c, + 0x95, 0x04, 0xe5, 0xef, 0x46, 0x22, 0x74, 0x98, + 0x52, 0x2a, 0xd7, 0x6f, 0x68, 0x11, 0x85, 0x29, + 0xfd, 0xbd, 0x28, 0xc8, 0x4f, 0xb6, 0xde, 0x41, + 0x13, 0x17, 0x46, 0x46, 0xca, 0x3e, 0x69, 0xd5, + 0x3f, 0xde, 0x02, 0x69, 0x86, 0x47, 0xe3, 0xe6, + 0x03, 0xb6, 0x7d, 0x00, 0x9f, 0x68, 0xc1, 0x1b, + 0xd4, 0xd2, 0xf5, 0x7b, 0x2d, 0x6d, 0xb6, 0x74, + 0x09, 0xff, 0x46, 0x5c, 0x87, 0x15, 0x53, 0xd4, + 0x1a, 0x30, 0xe0, 0x60, 0x31, 0x0a, 0xf5, 0x03, + 0x38, 0x49, 0x0e, 0x6b, 0x9d, 0x12, 0x62, 0xaf, + 0xe1, 0x57, 0xd2, 0xb0, 0xb5, 0x86, 0x0f, 0x36, + 0x3b, 0x4c, 0xda, 0xcd, 0x46, 0x1b, 0xef, 0x0b, + 0x46, 0x07, 0xf6, 0x23, 0x41, 0x42, 0x69, 0xcb, + 0x91, 0x07, 0xaf, 0x78, 0xb9, 0x21, 0x20, 0x9c, + 0xb5, 0x00, 0x4c, 0x13, 0x35, 0xcf, 0x17, 0x08, + 0x62, 0x5e, 0xb6, 0x05, 0xb3, 0xd9, 0x28, 0x78, + 0x0c, 0x2f, 0x21, 0x32, 0x21, 0x30, 0xad, 0x4c, + 0xb6, 0xa5, 0x56, 0xda, 0xdc, 0x46, 0x4d, 0x3a, + 0xa6, 0x2d, 0xcb, 0x94, 0x16, 0x26, 0xc1, 0x75, + 0x0b, 0x8a, 0x6f, 0xf4, 0xaa, 0x0d, 0x9d, 0xae, + 0xb8, 0xf8, 0x78, 0x3c, 0x5d, 0x4f, 0xd5, 0x35, + 0x3a, 0x57, 0xd2, 0x97, 0xce, 0x79, 0x80, 0x24, + 0x0e, 0xed, 0x3e, 0x58, 0x39, 0x90, 0x16, 0x00, + 0x9d, 0x45, 0x74, 0x65, 0xc0, 0x1c, 0x48, 0x43, + 0xc4, 0x7d, 0xe6, 0xf4, 0x9b, 0x5e, 0x61, 0x6a, + 0xeb, 0x74, 0xd2, 0xc0, 0x9a, 0x9b, 0x3b, 0xb3, + 0x0d, 0x5b, 0xc0, 0x5d, 0x65, 0xba, 0x4a, 0x32, + 0x19, 0x02, 0xea, 0x7b, 0x21, 0xbb, 0x1f, 0x8c, + 0xce, 0x77, 0x0a, 0x25, 0x8b, 0x83, 0x81, 0x73, + 0x41, 0xf7, 0xa1, 0xb1, 0x9b, 0xfe, 0x4f, 0xc1, + 0x17, 0x51, 0x9b, 0xe1, 0x28, 0x2d, 0xa2, 0x4a, + 0x4b, 0x4d, 0xbc, 0xad, 0x33, 0x4a, 0x27, 0x10, + 0xd2, 0x50, 0x1c, 0xb1, 0x36, 0x50, 0x48, 0x65, + 0x35, 0xf8, 0x88, 0x28, 0x6b, 0x82, 0xc0, 0x1c, + 0x80, 0xa0, 0xfd, 0x5d, 0x17, 0x78, 0x13, 0xeb, + 0xcb, 0x5d, 0x85, 0x08, 0x51, 0x92, 0xf4, 0x1c, + 0xf4, 0xa4, 0xe2, 0x35, 0x9f, 0x08, 0xa9, 0xa4, + 0x08, 0x05, 0x32, 0x6d, 0x16, 0xf1, 0x7b, 0xc1, + 0x92, 0xc7, 0xd7, 0x8b, 0x2c, 0x27, 0xdf, 0x4e, + 0x9a, 0xe6, 0x54, 0x40, 0xe4, 0x21, 0x5a, 0xf9, + 0xc6, 0x24, 0xef, 0x65, 0x07, 0x2e, 0x2b, 0x4d, + 0x4f, 0x2a, 0x09, 0x6c, 0xe8, 0xc7, 0x88, 0x05, + 0xc7, 0x50, 0xb2, 0xde, 0xa2, 0xa1, 0x80, 0x64, + 0x0b, 0xb3, 0x36, 0xcd, 0x26, 0xde, 0x98, 0x8a, + 0xe4, 0x84, 0x17, 0x54, 0x2c, 0x54, 0x0e, 0x18, + 0x38, 0xa6, 0xb5, 0x0a, 0x46, 0x41, 0x2f, 0x1c, + 0x74, 0x80, 0xee, 0xf1, 0x7e, 0x74, 0x29, 0x8b, + 0xd4, 0xdd, 0xb5, 0x64, 0x74, 0x17, 0xcf, 0xcf, + 0xd8, 0x32, 0x34, 0xf9, 0xfc, 0x58, 0x64, 0xb5, + 0x44, 0x0e, 0x34, 0x41, 0x17, 0x15, 0xeb, 0xe0, + 0xa3, 0x49, 0x08, 0x3f, 0xe8, 0xc8, 0x8d, 0x5e, + 0xde, 0xa2, 0xb5, 0x00, 0x3a, 0x05, 0x78, 0xca, + 0x0a, 0xf5, 0xe5, 0x09, 0xb0, 0x5f, 0xea, 0x33, + 0x73, 0xce, 0x12, 0xde, 0x89, 0xa2, 0x49, 0x17, + 0x5a, 0x70, 0x07, 0xc1, 0x3b, 0xf5, 0x4c, 0x58, + 0xf6, 0xbe, 0x51, 0x49, 0x0f, 0xee, 0x8c, 0x11, + 0x03, 0x85, 0x5a, 0x29, 0x35, 0xd3, 0x44, 0x4c, + 0x63, 0x24, 0x0c, 0xc5, 0x2b, 0x2d, 0x9c, 0x46, + 0x50, 0x28, 0xd3, 0x88, 0xc4, 0x34, 0xbb, 0xb0, + 0x81, 0x41, 0x3d, 0xcf, 0x22, 0x58, 0x63, 0x43, + 0x13, 0xd3, 0x70, 0x64, 0x28, 0xc6, 0xcb, 0x90, + 0x6b, 0x9d, 0xd8, 0x38, 0x74, 0xfe, 0xf8, 0xa5, + 0x18, 0x0f, 0x08, 0xa3, 0x76, 0x8c, 0xa0, 0xbc, + 0x85, 0xc8, 0x2f, 0x0a, 0x16, 0x41, 0xc8, 0x3a, + 0x02, 0xe7, 0x5e, 0x03, 0xd2, 0x49, 0xde, 0x53, + 0x5c, 0x5c, 0x85, 0xf0, 0xa5, 0x69, 0x10, 0xf4, + 0x28, 0x65, 0x48, 0x38, 0x52, 0x11, 0x7b, 0x78, + 0x8b, 0x9d, 0x07, 0x04, 0x53, 0x3b, 0xd4, 0x75, + 0x41, 0xdd, 0x7c, 0xb1, 0xb4, 0x43, 0x21, 0x33, + 0xa0, 0xfd, 0xf0, 0x01, 0xee, 0x5e, 0x23, 0xd0, + 0x1e, 0x4c, 0xef, 0x05, 0xe2, 0xe1, 0x47, 0x8b, + 0x21, 0x84, 0x1a, 0x7b, 0xa8, 0x14, 0x03, 0x8e, + 0xb1, 0x5c, 0xf4, 0x92, 0x42, 0x55, 0x86, 0x92, + 0x69, 0x69, 0x42, 0x5b, 0x6a, 0xf1, 0x01, 0x20, + 0x4b, 0xa7, 0x0b, 0x03, 0x82, 0x36, 0x8b, 0xa8, + 0x0d, 0x10, 0xe1, 0x88, 0x38, 0x62, 0x2e, 0x13, + 0xe0, 0x7a, 0x48, 0x00, 0xc6, 0xb3, 0xbd, 0xe8, + 0x49, 0xaf, 0xb8, 0xed, 0x3b, 0x10, 0xa2, 0x15, + 0x4a, 0xd4, 0x30, 0x7e, 0x9c, 0xe9, 0xb0, 0x58, + 0x92, 0x04, 0x8d, 0x2a, 0xc8, 0xcf, 0xe9, 0xcc, + 0x8b, 0xa3, 0x0c, 0x89, 0xf5, 0x9c, 0xe5, 0xc5, + 0x08, 0xca, 0xd4, 0x95, 0x15, 0x21, 0xe2, 0xc8, + 0xc6, 0x93, 0xc2, 0x40, 0x70, 0x62, 0xf7, 0x20, + 0x39, 0x60, 0xaa, 0x5a, 0x48, 0x2e, 0x22, 0xd3, + 0x47, 0x26, 0x2c, 0xb8, 0xc8, 0x88, 0xaf, 0x11, + 0xf0, 0x32, 0x07, 0x02, 0x6c, 0xf1, 0x0f, 0x38, + 0x84, 0x1d, 0x5d, 0x96, 0x07, 0x70, 0x1c, 0x2b, + 0xb9, 0xc2, 0x50, 0x9b, 0x4e, 0x45, 0xe3, 0x25, + 0x8f, 0xee, 0x14, 0x72, 0x2c, 0x68, 0x29, 0x80, + 0x46, 0x58, 0xa1, 0x11, 0x20, 0x38, 0x9b, 0x70, + 0x90, 0x1c, 0x2e, 0x0c, 0x84, 0xcc, 0x7e, 0x27, + 0x2a, 0x16, 0x07, 0x0a, 0x1a, 0x88, 0x0f, 0x41, + 0xff, 0xf8, 0x61, 0x44, 0xd8, 0x60, 0x18, 0x85, + 0x53, 0x03, 0x20, 0x73, 0xa2, 0x07, 0x6b, 0xee, + 0x92, 0xc7, 0x4f, 0x0d, 0xf6, 0xf0, 0x17, 0x1a, + 0x59, 0xde, 0x9b, 0x28, 0x07, 0x04, 0xda, 0xca, + 0x2b, 0x6a, 0x37, 0x58, 0x6b, 0xaf, 0x83, 0x13, + 0x60, 0xe7, 0x6e, 0xc4, 0x48, 0x21, 0x0e, 0x58, + 0x92, 0x83, 0x82, 0x78, 0x8b, 0x23, 0x58, 0xd9, + 0x0d, 0x24, 0x7d, 0xb9, 0x2c, 0x07, 0x2c, 0x0e, + 0x42, 0x09, 0x98, 0xb0, 0xd8, 0x4d, 0x23, 0x10, + 0x70, 0xa7, 0x73, 0x86, 0xc6, 0x0b, 0x04, 0x9f, + 0xfb, 0x56, 0x29, 0x07, 0x23, 0x8f, 0x98, 0x0e, + 0x8f, 0x63, 0x0a, 0x50, 0x76, 0x29, 0x28, 0x26, + 0x3c, 0x5f, 0x02, 0xfb, 0x51, 0x9b, 0xb0, 0x61, + 0xc0, 0x70, 0xbc, 0x17, 0x29, 0xc0, 0xcc, 0x1d, + 0x08, 0x62, 0xca, 0x72, 0xf0, 0xa4, 0xfd, 0x5d, + 0x2c, 0x58, 0xd5, 0x5c, 0x1c, 0x2a, 0x4e, 0xf7, + 0x0a, 0x01, 0xfa, 0xff, 0xff, 0xd5, 0x09, 0xa8, + 0x8c, 0x1c, 0x30, 0x25, 0x09, 0xd3, 0xd9, 0x30, + 0xd3, 0xdb, 0x94, 0x13, 0x74, 0xc8, 0x71, 0x1a, + 0x21, 0x87, 0x43, 0x10, 0x89, 0x5a, 0x6b, 0x91, + 0xd5, 0x66, 0xa0, 0xb0, 0x1c, 0x30, 0x58, 0x64, + 0x15, 0xfe, 0x36, 0x04, 0x7b, 0x4d, 0x23, 0x07, + 0x3a, 0xf1, 0x0a, 0xc2, 0x7d, 0x3b, 0xa1, 0x91, + 0xa4, 0x62, 0x96, 0xb1, 0xae, 0x83, 0xf6, 0xc0, + 0x07, 0xae, 0x6c, 0x11, 0x45, 0xf4, 0x1c, 0x35, + 0x6a, 0x28, 0x39, 0x60, 0x71, 0x1b, 0xf4, 0x39, + 0x44, 0x41, 0xae, 0xf1, 0x07, 0x01, 0xd4, 0x89, + 0xf6, 0x94, 0x1f, 0x7d, 0xab, 0x1b, 0x20, 0xdb, + 0x22, 0x1e, 0xa2, 0x07, 0x09, 0x8b, 0xe3, 0xf4, + 0xda, 0x82, 0x8c, 0x25, 0x01, 0xc0, 0xe2, 0x36, + 0x59, 0xa0, 0xe2, 0x42, 0x82, 0x64, 0x78, 0xb0, + 0x66, 0x0e, 0x59, 0xdd, 0x63, 0x65, 0x0b, 0x02, + 0x6a, 0x8c, 0xc2, 0xad, 0x7a, 0x90, 0xa3, 0xa0, + 0xbd, 0xda, 0x53, 0xd9, 0xd5, 0x82, 0x4f, 0x2c, + 0x37, 0xd8, 0x50, 0x8c, 0xa0, 0x2a, 0x70, 0x5e, + 0x47, 0x4a, 0xa9, 0x28, 0xaf, 0x4f, 0x58, 0x88, + 0x31, 0x29, 0x19, 0x76, 0x8c, 0xc8, 0xbf, 0x0d, + 0xc1, 0x56, 0xe7, 0x0a, 0x05, 0xe5, 0x20, 0xe8, + 0xe6, 0xb0, 0x3b, 0xb7, 0xa0, 0xe1, 0x80, 0xaa, + 0xa0, 0x23, 0xd7, 0x74, 0xd5, 0x01, 0xfc, 0x19, + 0x85, 0x13, 0x01, 0xc1, 0x91, 0x1b, 0xec, 0x28, + 0x80, 0xb1, 0xe2, 0xc7, 0x6a, 0x74, 0x07, 0x2c, + 0x31, 0x15, 0xd8, 0xbd, 0xb7, 0x82, 0xe2, 0x1d, + 0x3c, 0xa2, 0x83, 0x97, 0x09, 0x3a, 0xc0, 0xb1, + 0x34, 0x50, 0x0b, 0x87, 0x6c, 0xc8, 0xa7, 0x6e, + 0x64, 0x37, 0xb7, 0x91, 0x1f, 0x09, 0x0a, 0x38, + 0x34, 0x8c, 0x97, 0x80, 0xe5, 0x8d, 0x94, 0x0a, + 0xd6, 0xe9, 0x24, 0x18, 0xae, 0x34, 0xd7, 0xd2, + 0x94, 0x20, 0x36, 0x34, 0x7c, 0x29, 0xe9, 0xb0, + 0x71, 0x3e, 0xe2, 0x08, 0x69, 0xde, 0x14, 0x8b, + 0xca, 0x01, 0x32, 0x67, 0x64, 0x43, 0x85, 0x07, + 0xf4, 0xdf, 0x04, 0xdb, 0x88, 0x38, 0xb0, 0xbc, + 0x32, 0x44, 0x14, 0x4f, 0x10, 0xa8, 0x34, 0x89, + 0x10, 0x38, 0x28, 0x7c, 0xe2, 0x0a, 0x0e, 0x17, + 0x04, 0xae, 0xfd, 0x78, 0x5d, 0x12, 0xdc, 0xde, + 0x73, 0x9c, 0x17, 0x85, 0x2f, 0x79, 0xc5, 0xbb, + 0x2c, 0x21, 0x6b, 0x92, 0x14, 0x92, 0x9f, 0x9e, + 0x0c, 0xd6, 0x20, 0x99, 0x28, 0xae, 0x27, 0x22, + 0x6d, 0xd9, 0xc4, 0x41, 0x99, 0xfd, 0x71, 0x42, + 0x25, 0x8a, 0x41, 0xd2, 0x1c, 0x60, 0xe3, 0xfa, + 0x14, 0x70, 0xa4, 0x8a, 0xaf, 0xa5, 0xd1, 0x90, + 0x26, 0x42, 0x2e, 0x53, 0x42, 0xe8, 0x0e, 0x0a, + 0x37, 0x27, 0x69, 0x29, 0x21, 0x41, 0x3c, 0xf6, + 0xf2, 0x21, 0xe5, 0x07, 0x48, 0x7a, 0x49, 0xd0, + 0x5c, 0xe9, 0xc9, 0x25, 0x0c, 0xa7, 0x02, 0xa9, + 0x9d, 0x17, 0x8c, 0x85, 0xdd, 0x05, 0xf6, 0x83, + 0x31, 0x8f, 0x41, 0xc2, 0xa8, 0x46, 0x0e, 0xa0, + 0xe0, 0x5f, 0x3c, 0x19, 0xd1, 0x4e, 0x9e, 0x40, + 0x89, 0x60, 0x5e, 0xcf, 0x60, 0x38, 0x07, 0xd4, + 0x20, 0xba, 0x7c, 0x28, 0xe8, 0x38, 0x62, 0xe9, + 0x25, 0xe1, 0xa1, 0x90, 0x38, 0x9a, 0xac, 0x45, + 0xaf, 0xa5, 0x8b, 0x21, 0xea, 0x23, 0x60, 0xe7, + 0x68, 0x8c, 0xa3, 0x81, 0x4c, 0xc3, 0x74, 0xd7, + 0x03, 0x22, 0x3e, 0xb8, 0xb8, 0x26, 0x64, 0x24, + 0xa4, 0xa7, 0xb4, 0xe6, 0x14, 0x12, 0x05, 0x52, + 0x0f, 0x45, 0x00, 0x19, 0xfc, 0x0e, 0x0a, 0x34, + 0x19, 0x03, 0x81, 0x7f, 0x8d, 0x34, 0xf7, 0x02, + 0x39, 0x8b, 0x8b, 0x90, 0x04, 0x52, 0x14, 0xb8, + 0xb8, 0x2c, 0x42, 0x58, 0x0b, 0x98, 0x9e, 0x51, + 0xc0, 0xc5, 0x68, 0x11, 0xe8, 0x03, 0x81, 0xc0, + 0xbf, 0x66, 0x81, 0xd5, 0xd2, 0xb9, 0x41, 0x27, + 0x02, 0x63, 0x11, 0xa3, 0x3f, 0x57, 0x9e, 0x73, + 0xbc, 0xb1, 0x09, 0x4f, 0x08, 0x37, 0x30, 0x94, + 0xe6, 0x93, 0x8b, 0xa3, 0x36, 0x6e, 0x00, 0xe1, + 0xae, 0xa8, 0x91, 0x83, 0x8d, 0x12, 0x85, 0x4a, + 0x8a, 0x1b, 0x27, 0xd3, 0xd3, 0x88, 0xc3, 0x07, + 0xcc, 0x80, 0xe0, 0x5c, 0xcc, 0xea, 0xc1, 0x90, + 0x2c, 0x5d, 0x3c, 0xa0, 0xe0, 0x9e, 0xad, 0x62, + 0x37, 0xc5, 0xe2, 0xa1, 0x40, 0x84, 0x2b, 0x82, + 0xb0, 0x5d, 0x3e, 0x73, 0xbd, 0x07, 0x0b, 0xc2, + 0x77, 0x16, 0x25, 0x17, 0x70, 0xd8, 0x38, 0x69, + 0x08, 0xb4, 0xcb, 0x0e, 0x05, 0x14, 0x38, 0x27, + 0x48, 0xaa, 0xa1, 0x85, 0x10, 0x07, 0xa3, 0x3d, + 0x54, 0x66, 0x18, 0x03, 0x8f, 0x1b, 0x3a, 0x4a, + 0x27, 0xd7, 0xbb, 0x01, 0xd0, 0xfe, 0xea, 0xf3, + 0xa6, 0xf8, 0x43, 0x86, 0x10, 0x1c, 0x76, 0x86, + 0x34, 0x62, 0x4a, 0x0b, 0xc4, 0xb9, 0xd3, 0x4e, + 0xd7, 0xf9, 0xa0, 0xb1, 0x24, 0x14, 0x50, 0xcf, + 0x86, 0x81, 0x3d, 0xe5, 0x42, 0xb7, 0x68, 0x2e, + 0xf4, 0x92, 0x14, 0x44, 0x63, 0x2e, 0x1d, 0x7e, + 0xaf, 0x42, 0x6d, 0x7f, 0x64, 0x29, 0x0a, 0xb5, + 0xec, 0x40, 0x0e, 0x04, 0xef, 0xbd, 0xe7, 0x56, + 0x40, 0x0b, 0x0a, 0x79, 0x8c, 0x7b, 0xc0, 0xa7, + 0x3d, 0xaf, 0x94, 0xde, 0x21, 0x45, 0xc0, 0xc0, + 0x17, 0x33, 0x31, 0x0a, 0xcb, 0x92, 0x03, 0x8f, + 0xb5, 0xd0, 0xf7, 0x9d, 0x3b, 0x56, 0x61, 0x21, + 0x25, 0x19, 0x82, 0xee, 0xf3, 0x92, 0xa3, 0x76, + 0xbd, 0xe7, 0xf6, 0x76, 0xf6, 0xe4, 0xc0, 0x29, + 0x81, 0xb5, 0xd0, 0x70, 0xad, 0xff, 0x3c, 0xba, + 0xd3, 0x6d, 0x96, 0xf5, 0x10, 0x2f, 0xe3, 0xb3, + 0x05, 0xc4, 0x53, 0xdb, 0x61, 0x20, 0x3a, 0x9f, + 0x9d, 0x35, 0xca, 0x4f, 0xa6, 0xe2, 0x90, 0x72, + 0xdd, 0x09, 0x21, 0x70, 0x7e, 0xe8, 0x00, 0xf2, + 0xe0, 0x3d, 0x60, 0x1d, 0x42, 0x5d, 0x20, 0x6d, + 0x82, 0xb6, 0xea, 0xe8, 0x04, 0xda, 0xfa, 0x48, + 0x8b, 0xb0, 0x96, 0xa0, 0x07, 0x2c, 0x4f, 0xed, + 0xbc, 0x5b, 0xa0, 0xe9, 0x05, 0x0f, 0x3a, 0x4a, + 0x82, 0x0a, 0xfe, 0x62, 0x13, 0xb1, 0x79, 0xde, + 0x8b, 0x88, 0x34, 0xe5, 0x1a, 0x01, 0x70, 0x57, + 0x2b, 0x82, 0xc3, 0x91, 0x72, 0x1a, 0xad, 0x62, + 0x0e, 0x83, 0x89, 0x57, 0x81, 0x27, 0x50, 0x2f, + 0x07, 0x3f, 0x07, 0x23, 0x3f, 0x17, 0xfc, 0xc4, + 0x1d, 0xda, 0x18, 0x11, 0x3b, 0x6f, 0x50, 0x62, + 0xc2, 0xf4, 0x40, 0x9d, 0xbc, 0x52, 0x88, 0x5c, + 0x2b, 0x77, 0x28, 0x6e, 0xb9, 0x20, 0x2e, 0xad, + 0x42, 0x68, 0x9f, 0x5e, 0x64, 0xbd, 0x36, 0x53, + 0x0a, 0x4a, 0x46, 0x8d, 0x64, 0x2b, 0x22, 0x3b, + 0xa6, 0xf5, 0x06, 0x76, 0x12, 0x89, 0xba, 0xc3, + 0x24, 0x23, 0x10, 0xc0, 0x87, 0x92, 0xf0, 0xe6, + 0xbe, 0x2b, 0x88, 0x6d, 0x34, 0x18, 0x1f, 0x95, + 0x89, 0x01, 0x7b, 0xed, 0x07, 0x20, 0x0c, 0x44, + 0xdb, 0x69, 0xae, 0x12, 0x20, 0x20, 0x8b, 0x40, + 0x9e, 0x2c, 0x4f, 0x10, 0x9b, 0x5c, 0x24, 0x79, + 0x78, 0x85, 0x12, 0x31, 0x98, 0x56, 0xf6, 0xde, + 0xa2, 0xb4, 0x66, 0x43, 0x54, 0xa9, 0x76, 0xbc, + 0xf0, 0x1c, 0x45, 0xba, 0x1a, 0x21, 0x28, 0x07, + 0x3f, 0x81, 0x1e, 0x83, 0x06, 0x5d, 0x0c, 0x89, + 0xa7, 0x94, 0x93, 0x80, 0xbd, 0xe9, 0xa0, 0xc3, + 0xa0, 0x3c, 0xee, 0x9c, 0xf2, 0x12, 0x03, 0x85, + 0x4f, 0x80, 0xea, 0x7a, 0xa2, 0xc8, 0x10, 0xae, + 0x8c, 0x82, 0x46, 0x28, 0xc1, 0xc2, 0xf0, 0x77, + 0x48, 0x69, 0xae, 0x48, 0x2b, 0xab, 0xe4, 0x0b, + 0x5e, 0xa3, 0x91, 0x61, 0x5e, 0x5c, 0xda, 0x34, + 0x44, 0xbd, 0xa4, 0x0d, 0x7e, 0x50, 0x73, 0xba, + 0xf4, 0x1f, 0xbf, 0xff, 0xff, 0x6a, 0x20, 0xa6, + 0x27, 0xf9, 0xc0, 0x7a, 0x0f, 0xff, 0xcf, 0xf5, + 0xd1, 0xae, 0x15, 0x65, 0x28, 0x90, 0x84, 0xd3, + 0x0a, 0x2f, 0x06, 0x00, 0xe2, 0x3f, 0x83, 0x4d, + 0x3f, 0x10, 0xac, 0x52, 0x0e, 0x3b, 0x81, 0xd1, + 0x7e, 0x06, 0x01, 0x14, 0x82, 0x3a, 0x04, 0x02, + 0xe4, 0x76, 0x1e, 0xe0, 0xe0, 0x5d, 0x52, 0x95, + 0xdd, 0xa7, 0xb8, 0x0b, 0x14, 0x00, 0xe0, 0xc8, + 0xeb, 0x58, 0xd8, 0xc4, 0x30, 0x21, 0xe0, 0xf4, + 0x30, 0x01, 0x84, 0xf4, 0x31, 0x18, 0x02, 0x7a, + 0x94, 0x2c, 0x15, 0xc4, 0xda, 0xc4, 0x78, 0x62, + 0x32, 0x8b, 0x42, 0x45, 0x81, 0xc5, 0x24, 0x71, + 0x01, 0x74, 0xe0, 0xc8, 0x90, 0x1c, 0x6c, 0x94, + 0x4d, 0x48, 0xb4, 0xf4, 0x37, 0x0d, 0x03, 0x89, + 0x0f, 0x38, 0x67, 0x60, 0x3f, 0xbc, 0x00, 0x6c, + 0x5e, 0x0e, 0x41, 0x4d, 0x85, 0x76, 0x02, 0xef, + 0x5e, 0x41, 0xcb, 0xd0, 0x70, 0x64, 0x85, 0x62, + 0x79, 0xd1, 0x80, 0xb8, 0x1c, 0x27, 0x70, 0x1f, + 0xdf, 0xff, 0xf7, 0x20, 0xa3, 0x25, 0x22, 0xd3, + 0x8b, 0x9e, 0x02, 0x1e, 0x5c, 0x1c, 0x11, 0xae, + 0xa3, 0x3a, 0xb7, 0xb2, 0x8b, 0xab, 0xe0, 0xb1, + 0x12, 0xf0, 0x1c, 0x2e, 0x0a, 0x12, 0xbc, 0x95, + 0x0f, 0x6a, 0x09, 0x2f, 0x45, 0xeb, 0x40, 0x1c, + 0x43, 0xcd, 0x59, 0x0b, 0xe2, 0x6a, 0x5f, 0x43, + 0x4a, 0x09, 0x54, 0xd3, 0x62, 0x9f, 0x65, 0x88, + 0x94, 0x8c, 0xaa, 0xc2, 0xfa, 0xfe, 0x55, 0x2c, + 0xe7, 0x82, 0xad, 0x6d, 0x41, 0xcc, 0x19, 0x22, + 0xe0, 0xa7, 0x31, 0x53, 0x91, 0x03, 0xf5, 0x17, + 0xfe, 0x2e, 0x29, 0x26, 0x4c, 0xb1, 0xb9, 0x2f, + 0x5b, 0x80, 0x8c, 0xb8, 0x61, 0x41, 0x77, 0x41, + 0xef, 0x11, 0xd4, 0x06, 0x86, 0x24, 0x5e, 0x44, + 0x2b, 0x8c, 0xd1, 0x14, 0x93, 0x32, 0xfc, 0x5b, + 0x51, 0x0a, 0xb4, 0xe5, 0x64, 0x3c, 0xb4, 0xd8, + 0x39, 0x18, 0x51, 0x48, 0x41, 0xcb, 0x70, 0x9f, + 0x70, 0x32, 0x40, 0x15, 0x4a, 0x88, 0x0e, 0x46, + 0x19, 0x84, 0x70, 0xd2, 0xe7, 0xf5, 0xe7, 0x81, + 0xaa, 0xe7, 0xdf, 0xe8, 0x69, 0x25, 0x36, 0x48, + 0x0e, 0x42, 0x14, 0x4d, 0xa6, 0xf2, 0x92, 0xac, + 0x49, 0xd2, 0x66, 0x85, 0x01, 0x28, 0xb8, 0x13, + 0x19, 0x6b, 0x78, 0x2e, 0x7e, 0xbf, 0xf8, 0x13, + 0xee, 0x50, 0x71, 0xcf, 0x20, 0x7f, 0x20, 0x30, + 0x2c, 0x34, 0x13, 0x5b, 0xb2, 0x31, 0x8a, 0xe2, + 0xf7, 0x34, 0x83, 0x31, 0xa6, 0xbe, 0x99, 0x56, + 0x1b, 0x6b, 0xb4, 0xa8, 0xf9, 0xca, 0x31, 0x1a, + 0x39, 0x50, 0x2c, 0x0e, 0x90, 0x1c, 0x73, 0xdc, + 0x9d, 0x5d, 0x6e, 0x22, 0xa6, 0x90, 0x9e, 0x5a, + 0xb2, 0x0e, 0x13, 0x45, 0xe7, 0xb3, 0xa0, 0xc4, + 0xcf, 0xbd, 0x43, 0x4d, 0x83, 0x06, 0x50, 0xe5, + 0x81, 0x6e, 0x00, 0xee, 0x00, 0xe8, 0xe9, 0xb8, + 0x52, 0x41, 0xec, 0x1b, 0x51, 0x75, 0x80, 0x99, + 0x57, 0xd1, 0x75, 0xd0, 0x94, 0x12, 0x0b, 0x89, + 0xfc, 0x17, 0x44, 0x25, 0x20, 0xb9, 0x53, 0x79, + 0x67, 0x3b, 0xf5, 0x22, 0x26, 0x69, 0x25, 0x42, + 0xe5, 0x71, 0x9c, 0xa1, 0xd0, 0x31, 0x5f, 0x6c, + 0x9b, 0x56, 0x35, 0x41, 0x71, 0x0b, 0x64, 0xe0, + 0x8a, 0x2b, 0xd3, 0xd7, 0x41, 0x63, 0x00, 0x79, + 0xdd, 0xd9, 0x2a, 0xe8, 0x51, 0x10, 0x40, 0x22, + 0x7d, 0x0b, 0x3b, 0xe2, 0x45, 0xe8, 0xbf, 0x54, + 0xf4, 0x60, 0xb0, 0xa5, 0x29, 0xe5, 0x11, 0x0d, + 0x29, 0xab, 0xde, 0xa2, 0x45, 0x20, 0x2f, 0xea, + 0xc8, 0xfa, 0x2e, 0x7e, 0x9c, 0x95, 0x12, 0x84, + 0xae, 0x23, 0x07, 0x09, 0x93, 0x24, 0x09, 0x38, + 0x3b, 0x86, 0x81, 0x35, 0x84, 0xda, 0xfb, 0x92, + 0x2f, 0x10, 0x83, 0x82, 0x2e, 0xba, 0x10, 0xc8, + 0xa4, 0x22, 0xdd, 0x07, 0x0d, 0x1f, 0x0d, 0xd9, + 0xd0, 0x4d, 0xd7, 0x21, 0xd7, 0x98, 0x03, 0x81, + 0x60, 0x7d, 0xd5, 0xe7, 0x21, 0x42, 0xe7, 0xe6, + 0xa0, 0xab, 0x83, 0x82, 0x7d, 0xc8, 0x32, 0xe5, + 0x07, 0x3e, 0x14, 0x9d, 0xd3, 0xf3, 0xa4, 0xa3, + 0x10, 0xca, 0x83, 0x8e, 0xa6, 0xb1, 0x4a, 0xc4, + 0xed, 0x74, 0x7d, 0x07, 0x02, 0xeb, 0xc3, 0x17, + 0x9c, 0xa8, 0xc2, 0x4a, 0x9f, 0x5c, 0x5c, 0x69, + 0x01, 0x36, 0x9d, 0xa4, 0xa0, 0xf3, 0xff, 0xff, + 0xa0, 0x39, 0x32, 0x52, 0x45, 0x91, 0x2f, 0xc0, + 0x9f, 0x06, 0x60, 0xe2, 0x5a, 0x77, 0x0a, 0x3f, + 0x89, 0x24, 0x28, 0x5c, 0x22, 0xac, 0xc5, 0xf8, + 0xb7, 0x6c, 0x40, 0x33, 0x7d, 0x58, 0x89, 0x72, + 0x69, 0xea, 0xc0, 0xe1, 0x91, 0x1f, 0x57, 0xd9, + 0x99, 0x27, 0x17, 0x47, 0x7a, 0x88, 0x26, 0xdb, + 0xa6, 0xe5, 0xe4, 0x01, 0xe2, 0xa9, 0x0c, 0x05, + 0x3b, 0x90, 0xda, 0x3e, 0x2c, 0x2b, 0x7e, 0x77, + 0xa4, 0x7a, 0x73, 0xc8, 0x1c, 0x59, 0x0a, 0x41, + 0x3f, 0x16, 0x61, 0x47, 0x01, 0xc4, 0xb3, 0x80, + 0xba, 0xd3, 0x4d, 0x86, 0x21, 0x80, 0x52, 0xfa, + 0x48, 0x8d, 0x10, 0xc4, 0x17, 0xd2, 0xf5, 0x14, + 0x0a, 0xe2, 0x7d, 0x46, 0x54, 0x4b, 0x0c, 0x0d, + 0x05, 0x58, 0xb0, 0x95, 0x4f, 0x50, 0x83, 0x91, + 0x05, 0x39, 0x10, 0x39, 0x10, 0x38, 0x8f, 0x1b, + 0xbc, 0x85, 0x01, 0x88, 0xd3, 0xb4, 0x13, 0xb5, + 0xe5, 0x74, 0x4b, 0x03, 0x91, 0x10, 0x31, 0x8c, + 0x0a, 0x25, 0x72, 0x5b, 0x06, 0x70, 0x9e, 0x51, + 0x53, 0x55, 0x19, 0x28, 0x38, 0xa0, 0x8f, 0x83, + 0x64, 0x21, 0x5e, 0xbb, 0x19, 0xcd, 0x18, 0x06, + 0x20, 0xe3, 0xf3, 0x16, 0xe8, 0x38, 0x22, 0xd0, + 0x12, 0x62, 0xac, 0x6c, 0x1d, 0x11, 0x9d, 0xbd, + 0x28, 0x84, 0xfa, 0xfa, 0x95, 0x77, 0xa0, 0x3a, + 0x86, 0x48, 0xa9, 0xa0, 0x8e, 0x2c, 0x50, 0x8f, + 0xbc, 0x01, 0xc0, 0xb0, 0x05, 0xcc, 0xd5, 0x90, + 0x41, 0x70, 0x4e, 0x9a, 0xeb, 0x22, 0x07, 0x14, + 0x82, 0xeb, 0xe0, 0x9f, 0x4e, 0x2c, 0x07, 0xea, + 0x80, 0x0d, 0x12, 0xc2, 0x81, 0x98, 0x38, 0x56, + 0x99, 0x60, 0x38, 0x27, 0xa5, 0x00, 0xf3, 0xff, + 0xff, 0x91, 0x99, 0x54, 0x8c, 0x4d, 0x9f, 0xab, + 0xdd, 0x51, 0x57, 0x5c, 0x90, 0x60, 0xb1, 0xef, + 0xca, 0x2b, 0xc0, 0xe2, 0x2a, 0x58, 0x94, 0xf1, + 0x4a, 0x22, 0xc8, 0x5d, 0xdf, 0x50, 0x49, 0x46, + 0x68, 0xc6, 0x51, 0xd1, 0x7b, 0x03, 0x00, 0x4d, + 0xa5, 0x14, 0x1d, 0x51, 0x05, 0x4f, 0x8b, 0x76, + 0x86, 0x6b, 0x03, 0x81, 0x3b, 0xd3, 0xb5, 0x1a, + 0xa7, 0xb6, 0xce, 0x20, 0x9c, 0x5e, 0x2c, 0x6c, + 0x86, 0x79, 0xc3, 0x64, 0x9d, 0x3f, 0xb8, 0x6c, + 0x1c, 0x42, 0xd6, 0x5a, 0x76, 0x0a, 0x2a, 0x32, + 0x3d, 0x77, 0x79, 0xc4, 0x16, 0x12, 0xd0, 0xa7, + 0x41, 0x80, 0xaf, 0x76, 0x20, 0xec, 0x07, 0x05, + 0x1f, 0x11, 0x85, 0x1c, 0xa8, 0x02, 0x8d, 0x7c, + 0x0e, 0x21, 0x75, 0x4f, 0x60, 0x3a, 0xa2, 0x27, + 0x9d, 0x06, 0x0c, 0x8d, 0x0a, 0xd9, 0x22, 0xf5, + 0x4d, 0x07, 0x50, 0x4c, 0xed, 0xe2, 0x30, 0xcc, + 0x07, 0xbb, 0x4f, 0x0c, 0xd1, 0x14, 0x83, 0x83, + 0x3e, 0x0d, 0x67, 0x94, 0x62, 0x0e, 0x17, 0xf5, + 0x00, 0xd1, 0xf0, 0x1c, 0xfd, 0x62, 0x04, 0x24, + 0x18, 0x51, 0x53, 0xfc, 0x28, 0x07, 0x0d, 0x77, + 0x03, 0x31, 0x5e, 0x51, 0xc8, 0x0e, 0x0a, 0xda, + 0xd5, 0x0f, 0x16, 0x58, 0x1d, 0xc0, 0x71, 0xc6, + 0x8b, 0x22, 0xc4, 0x66, 0xc2, 0x3d, 0x77, 0x6c, + 0xd2, 0x47, 0x65, 0x15, 0x0f, 0x41, 0xc3, 0x31, + 0x3f, 0xec, 0x36, 0x0b, 0xc7, 0x3b, 0x57, 0x44, + 0x52, 0x6e, 0x8a, 0xa7, 0x37, 0x95, 0x6a, 0x09, + 0x95, 0x37, 0xc4, 0x3c, 0x81, 0x98, 0x3a, 0x04, + 0x9f, 0x8b, 0x1a, 0x19, 0x83, 0x83, 0x11, 0x35, + 0x03, 0x90, 0x50, 0x72, 0x12, 0x39, 0xb0, 0xdf, + 0x41, 0xc4, 0x71, 0x4a, 0x12, 0x6d, 0x3e, 0x58, + 0xb8, 0xc9, 0x08, 0x2c, 0x20, 0x38, 0xf7, 0x58, + 0xd7, 0x41, 0xc1, 0x3d, 0x70, 0x33, 0x05, 0xd4, + 0xa8, 0x58, 0x1c, 0x18, 0xc8, 0x14, 0x77, 0xa2, + 0xa8, 0xbf, 0xcb, 0x51, 0x83, 0x8e, 0xc5, 0x29, + 0x5c, 0x17, 0x9e, 0xa0, 0x25, 0x44, 0x28, 0x9a, + 0x2f, 0xa8, 0x43, 0x0a, 0x7a, 0xd8, 0x8f, 0xb6, + 0x82, 0x66, 0x9f, 0x5e, 0x0c, 0x0d, 0x03, 0x97, + 0x42, 0x8c, 0xf4, 0xf0, 0xda, 0x21, 0x3e, 0x47, + 0xc3, 0x64, 0xcc, 0x66, 0x0e, 0x1a, 0x51, 0x5d, + 0x5d, 0x3b, 0x8a, 0x0a, 0x0a, 0x62, 0x3e, 0x72, + 0x3d, 0xdf, 0x83, 0x90, 0xa0, 0x05, 0xf7, 0xde, + 0x45, 0xb8, 0x33, 0xe2, 0xc0, 0xb0, 0x19, 0x91, + 0x3c, 0xef, 0x43, 0x75, 0xa2, 0x33, 0x6b, 0xf0, + 0x33, 0x7e, 0x56, 0x28, 0xd3, 0xab, 0xd4, 0x52, + 0x90, 0xfe, 0x21, 0x40, 0x52, 0xe8, 0x9e, 0xe7, + 0x22, 0x00, 0xd5, 0x4d, 0x06, 0x09, 0xe7, 0x90, + 0x16, 0x3c, 0xe1, 0x42, 0x10, 0xc0, 0x69, 0x10, + 0x71, 0xd1, 0x3d, 0x27, 0x79, 0x08, 0xda, 0x81, + 0x9a, 0x30, 0x72, 0x30, 0x4d, 0x72, 0x2e, 0x83, + 0x9c, 0x07, 0x06, 0x42, 0xbd, 0xcb, 0xd2, 0x2e, + 0x74, 0x51, 0xa7, 0xd4, 0x53, 0x70, 0x63, 0xc0, + 0x70, 0x49, 0xb9, 0x06, 0x66, 0xd0, 0x02, 0xc4, + 0x17, 0x9b, 0x84, 0x88, 0xc3, 0x30, 0x70, 0x55, + 0xb8, 0x0e, 0x5c, 0x1c, 0x32, 0x09, 0x90, 0xe5, + 0x5e, 0x6d, 0x01, 0xc4, 0x7d, 0x0a, 0xfd, 0x46, + 0x48, 0x48, 0xb3, 0xb7, 0x06, 0x4b, 0x8c, 0x10, + 0x03, 0x9f, 0xba, 0x2e, 0x46, 0x19, 0xbe, 0xf5, + 0x1a, 0xc7, 0xb4, 0xe0, 0x65, 0x02, 0x7c, 0x30, + 0x0c, 0x4d, 0x8a, 0x5f, 0x0d, 0x45, 0xca, 0x28, + 0x4b, 0x2b, 0x03, 0xa0, 0x30, 0x2c, 0x42, 0x5c, + 0xe6, 0x9e, 0x28, 0x82, 0xe0, 0x5c, 0xbe, 0xa3, + 0x96, 0x06, 0x61, 0x2c, 0x40, 0x1d, 0xd2, 0x17, + 0xc5, 0xc1, 0xc3, 0x5e, 0xce, 0x1a, 0xe0, 0xaf, + 0x4f, 0x0c, 0xba, 0x19, 0x06, 0x40, 0x3c, 0x6b, + 0xe7, 0x57, 0x58, 0xd4, 0x07, 0x1b, 0x14, 0x27, + 0xce, 0x92, 0xc2, 0x94, 0x60, 0xbe, 0x60, 0xe0, + 0x9f, 0x44, 0x85, 0xfa, 0xf8, 0xd8, 0x64, 0xa3, + 0x80, 0x39, 0x10, 0x55, 0xed, 0x18, 0x9b, 0x0b, + 0x32, 0x20, 0x58, 0x02, 0xe7, 0x1b, 0x21, 0xbd, + 0x9d, 0xe9, 0x50, 0x26, 0xe9, 0xba, 0x1f, 0xa2, + 0xee, 0x14, 0x2e, 0x03, 0xc8, 0xdd, 0x10, 0x4d, + 0x66, 0x8c, 0xe9, 0x48, 0x2e, 0x51, 0xe0, 0x26, + 0xa9, 0xc6, 0x43, 0x9c, 0x92, 0x20, 0x04, 0xd2, + 0xd7, 0x43, 0x27, 0x01, 0x7d, 0xa7, 0x65, 0x7c, + 0x0e, 0xb0, 0x11, 0xc2, 0x5b, 0xbf, 0x51, 0x57, + 0xc0, 0x46, 0xb1, 0x71, 0x97, 0x5d, 0x62, 0x06, + 0x68, 0xdf, 0xba, 0x6c, 0xad, 0x18, 0xc8, 0xe4, + 0x28, 0xcc, 0x1b, 0x7b, 0x85, 0x10, 0x31, 0x3f, + 0x41, 0xc8, 0x88, 0xb4, 0xde, 0x7f, 0x7e, 0x0c, + 0x05, 0x3e, 0xb9, 0xb5, 0x10, 0x6b, 0x2a, 0x1b, + 0xe7, 0x54, 0xe6, 0x12, 0x8d, 0xe8, 0x38, 0x62, + 0x7b, 0xd2, 0x45, 0xe8, 0x51, 0xf8, 0x8d, 0x71, + 0x78, 0x38, 0x62, 0x13, 0xb2, 0xfd, 0x09, 0x62, + 0x6c, 0x0d, 0x60, 0x32, 0x1f, 0xb7, 0xfa, 0x53, + 0xc8, 0x50, 0xb7, 0x06, 0x92, 0xa3, 0x32, 0xad, + 0x38, 0x0e, 0x28, 0x3d, 0x27, 0x9f, 0x20, 0x63, + 0xd7, 0xcb, 0xd4, 0x72, 0xf0, 0x90, 0x83, 0x5f, + 0x5d, 0x18, 0x92, 0xa3, 0x0d, 0xd7, 0x3d, 0xaa, + 0x91, 0x95, 0xe9, 0x48, 0xd1, 0xf4, 0x1f, 0xc2, + 0x00, 0x3f, 0x6c, 0x44, 0xba, 0x00, 0x70, 0x72, + 0x7e, 0x70, 0x57, 0x53, 0x64, 0x92, 0x0c, 0xcd, + 0x92, 0x02, 0xeb, 0xae, 0x50, 0x2a, 0xca, 0x0a, + 0x45, 0xc0, 0x3c, 0x1c, 0xee, 0x18, 0x03, 0x90, + 0x84, 0x54, 0x35, 0xe8, 0x49, 0xa7, 0x35, 0x12, + 0x00, 0x1c, 0x2e, 0x07, 0x3b, 0x49, 0x01, 0xdd, + 0x19, 0x83, 0x90, 0x89, 0xa7, 0x85, 0x05, 0x01, + 0x1b, 0x17, 0x14, 0x03, 0xb8, 0x0b, 0xe6, 0xc2, + 0x9e, 0x94, 0x9c, 0xd3, 0xa0, 0x70, 0x66, 0x43, + 0x3c, 0x07, 0x05, 0x49, 0x74, 0xd5, 0xe0, 0xc0, + 0x07, 0xae, 0xea, 0x5f, 0xa6, 0xc1, 0xc3, 0x05, + 0x85, 0xc2, 0xb8, 0xa4, 0x90, 0x2b, 0x89, 0xb8, + 0x0e, 0x42, 0x12, 0x34, 0x46, 0x81, 0xc4, 0xa2, + 0x96, 0xb8, 0x64, 0x6e, 0x02, 0xe7, 0xa3, 0x40, + 0x32, 0x07, 0x40, 0x5c, 0x3d, 0xed, 0x5f, 0xa1, + 0x55, 0x4b, 0xf9, 0x60, 0x70, 0xa2, 0x11, 0xf4, + 0x32, 0x73, 0xe5, 0x29, 0x0c, 0x01, 0xc5, 0x03, + 0x5b, 0x57, 0x20, 0x89, 0xd8, 0x39, 0x00, 0x39, + 0x71, 0x80, 0xd1, 0x8c, 0x49, 0x3a, 0x09, 0xf0, + 0xa2, 0x23, 0x07, 0x02, 0xfa, 0x54, 0x78, 0x94, + 0x31, 0x13, 0xac, 0x2a, 0x15, 0xd5, 0xe1, 0x17, + 0x51, 0x03, 0xa5, 0x3b, 0xa1, 0x2a, 0x37, 0xed, + 0xd2, 0xa2, 0x52, 0x42, 0x8a, 0xb1, 0xa2, 0x83, + 0xb2, 0xa4, 0xa2, 0x4a, 0x50, 0x8f, 0xa1, 0x80, + 0x55, 0x29, 0xd8, 0x9e, 0x50, 0x87, 0xa7, 0x31, + 0x50, 0x3b, 0x92, 0x0c, 0x0f, 0xf1, 0x99, 0x48, + 0x38, 0x07, 0x22, 0x24, 0x3f, 0xc1, 0xcb, 0x83, + 0x81, 0x60, 0x35, 0xc1, 0x75, 0x13, 0xf1, 0x74, + 0x43, 0x12, 0x51, 0x98, 0x47, 0x84, 0x52, 0x81, + 0x82, 0xc0, 0xe1, 0xac, 0x74, 0x16, 0x04, 0xa1, + 0x81, 0xe6, 0x04, 0x83, 0x20, 0x89, 0xd6, 0x42, + 0x7f, 0x4d, 0xd1, 0x81, 0x48, 0xa1, 0x46, 0x3f, + 0x8c, 0xc5, 0x33, 0x9b, 0xe4, 0x1b, 0x9d, 0x5c, + 0x63, 0x90, 0x1c, 0x83, 0xae, 0xc8, 0x51, 0x06, + 0x50, 0x32, 0xa0, 0xbf, 0x2d, 0xc0, 0x71, 0x20, + 0x38, 0x5c, 0x4a, 0xef, 0xa7, 0xb4, 0xd0, 0xb8, + 0x4b, 0x45, 0xc2, 0xf0, 0x4e, 0x65, 0x21, 0x3f, + 0x34, 0x8c, 0x1c, 0x4a, 0x0e, 0xeb, 0xe4, 0xa0, + 0x1d, 0x46, 0x01, 0x5c, 0xe8, 0x9f, 0x5f, 0x14, + 0xa2, 0x37, 0x49, 0x44, 0xcf, 0x9c, 0x18, 0x92, + 0xa3, 0x07, 0x09, 0xe6, 0x1b, 0x09, 0x2b, 0x83, + 0x10, 0x4c, 0xe2, 0x35, 0x9d, 0x13, 0x92, 0x80, + 0x70, 0x66, 0x35, 0x6b, 0x77, 0x84, 0x6c, 0x64, + 0xb9, 0xa5, 0x96, 0x13, 0xee, 0x0c, 0x41, 0xc8, + 0xfa, 0x13, 0xb5, 0x9d, 0x25, 0x0a, 0x75, 0xde, + 0x50, 0x70, 0x2f, 0xa7, 0x56, 0x37, 0x61, 0xb2, + 0x42, 0x40, 0xae, 0x68, 0xcc, 0xa5, 0x07, 0x42, + 0x4d, 0x0d, 0xad, 0xca, 0x0b, 0xd5, 0xa3, 0x21, + 0x36, 0x9e, 0x8a, 0x22, 0xfd, 0x05, 0x88, 0x38, + 0x82, 0x4a, 0x28, 0xc1, 0x6e, 0x92, 0xad, 0x43, + 0x17, 0x4a, 0x34, 0x60, 0xfe, 0x10, 0x01, 0xe3, + 0x75, 0x6e, 0x03, 0x82, 0x4b, 0xdc, 0xa2, 0xbd, + 0x77, 0x28, 0x3b, 0xab, 0x77, 0x85, 0x21, 0x3c, + 0xc1, 0x9b, 0x9c, 0xb6, 0x76, 0xdb, 0x67, 0x78, + 0xb6, 0x5e, 0x21, 0x92, 0xde, 0x11, 0x4a, 0x20, + 0x74, 0x08, 0xa4, 0xa1, 0xb8, 0xd3, 0x5e, 0x68, + 0xd6, 0x57, 0x85, 0x01, 0x89, 0x0c, 0x5e, 0xa0, + 0x07, 0x1a, 0x07, 0x09, 0xf7, 0x11, 0x02, 0xeb, + 0x07, 0x1e, 0xd3, 0x46, 0xad, 0x11, 0x94, 0x74, + 0x1d, 0xd7, 0x29, 0xc3, 0x62, 0xf7, 0x24, 0x1f, + 0x7c, 0x18, 0x38, 0xf8, 0x30, 0xc2, 0x86, 0x12, + 0x03, 0x9f, 0xea, 0x66, 0xc1, 0x83, 0x86, 0xc6, + 0x5e, 0xa0, 0x39, 0xce, 0x51, 0x44, 0xda, 0xf8, + 0x5f, 0x01, 0xc3, 0x4f, 0x61, 0xb5, 0xe8, 0x62, + 0x8c, 0xa0, 0x17, 0x57, 0x75, 0x0f, 0x36, 0xf1, + 0x65, 0xc8, 0x1c, 0x02, 0x53, 0xab, 0xd0, 0x58, + 0xba, 0xf6, 0x44, 0x00, 0x9d, 0xaf, 0x48, 0x22, + 0x38, 0x85, 0x09, 0x48, 0x45, 0xe5, 0x28, 0x1a, + 0xfb, 0x20, 0x6f, 0x38, 0x32, 0x14, 0x54, 0xb4, + 0x63, 0xd0, 0x70, 0xd6, 0x82, 0xef, 0x5d, 0xd1, + 0x9f, 0x56, 0x3d, 0xc6, 0x1c, 0xe2, 0x11, 0x5b, + 0x46, 0x6a, 0xfd, 0x6e, 0x04, 0xad, 0x62, 0x8c, + 0x07, 0x00, 0xe2, 0x32, 0xf8, 0x1c, 0xf0, 0x51, + 0x57, 0xc0, 0xe0, 0x1c, 0x2a, 0xf1, 0x07, 0x09, + 0xb0, 0xbe, 0x03, 0xb8, 0x09, 0xfd, 0x62, 0x8b, + 0x45, 0xe1, 0x5d, 0x07, 0x2c, 0xb0, 0x4f, 0x17, + 0xf4, 0x95, 0x00, 0x26, 0xc9, 0x4a, 0x18, 0x13, + 0xe2, 0xb4, 0x6b, 0xd0, 0xb1, 0xd4, 0x11, 0x69, + 0x69, 0xc2, 0xc8, 0x75, 0xf2, 0xc0, 0xe4, 0x64, + 0x1d, 0x71, 0x80, 0xb8, 0x4c, 0xc6, 0x36, 0x3b, + 0x64, 0x90, 0x38, 0xb3, 0x56, 0x18, 0x65, 0x08, + 0x8c, 0x46, 0xb9, 0xfa, 0xbf, 0x0c, 0xaa, 0xc1, + 0x26, 0x90, 0x1e, 0x8f, 0xff, 0xf2, 0x36, 0xba, + 0x34, 0x56, 0x54, 0x2b, 0x03, 0x90, 0x9e, 0x9a, + 0x31, 0x44, 0x18, 0x11, 0xfb, 0xc8, 0x13, 0x6b, + 0xe9, 0x61, 0x24, 0xc4, 0x68, 0x85, 0x33, 0x25, + 0x29, 0xa1, 0x15, 0x5d, 0xa4, 0xb2, 0xda, 0x15, + 0x7e, 0x62, 0x35, 0x96, 0x20, 0xf3, 0xa4, 0x51, + 0x79, 0xb0, 0xa5, 0x1f, 0x20, 0xc7, 0x80, 0x9b, + 0xed, 0x24, 0xe2, 0x11, 0xab, 0xe8, 0xcb, 0xa1, + 0x54, 0xcc, 0x44, 0x8b, 0x66, 0x76, 0x3a, 0x62, + 0x20, 0x4f, 0xd7, 0xe2, 0x29, 0xbe, 0x92, 0x93, + 0xb5, 0x90, 0x03, 0xba, 0x27, 0x7d, 0xb0, 0x39, + 0x2b, 0xea, 0x31, 0x9f, 0x02, 0x7f, 0x78, 0x50, + 0x80, 0x30, 0x3f, 0x68, 0x38, 0x90, 0x5e, 0x73, + 0x5f, 0x4e, 0xc5, 0x83, 0x80, 0x58, 0x53, 0x64, + 0x0e, 0xf5, 0x75, 0xea, 0xfd, 0x28, 0x01, 0xc2, + 0x7d, 0x25, 0x24, 0x18, 0x21, 0x26, 0x63, 0x2e, + 0x14, 0x03, 0x89, 0xb0, 0x4b, 0xd7, 0xcb, 0x40, + 0x1c, 0x0e, 0x27, 0xf1, 0x0a, 0x25, 0x08, 0xf8, + 0x0b, 0x00, 0x96, 0x57, 0x24, 0xb4, 0x1c, 0xbb, + 0xf2, 0xc8, 0x90, 0x13, 0xdb, 0xc5, 0xf8, 0x0b, + 0x8d, 0x77, 0x68, 0xc5, 0x12, 0x15, 0xd6, 0x58, + 0x1c, 0x41, 0x0a, 0x24, 0x17, 0x74, 0x99, 0x86, + 0x6e, 0x7b, 0x56, 0x5b, 0x8a, 0x1e, 0xb3, 0xa8, + 0xcf, 0x6b, 0xb5, 0x34, 0x66, 0x18, 0x0c, 0x90, + 0x0c, 0x0f, 0x6e, 0x12, 0x2e, 0x50, 0x30, 0x15, + 0xb8, 0xa5, 0x61, 0xbd, 0xe7, 0x21, 0x0b, 0x51, + 0x94, 0xd4, 0xe7, 0x03, 0x00, 0x75, 0x0a, 0xfb, + 0xce, 0x9c, 0xab, 0xb2, 0x94, 0x48, 0x17, 0x0c, + 0x02, 0x67, 0xc1, 0x91, 0x45, 0xa6, 0xc1, 0x3e, + 0x49, 0x62, 0x34, 0x41, 0x33, 0xb4, 0x67, 0xd1, + 0x5c, 0x9d, 0xe2, 0xe7, 0x62, 0xee, 0x55, 0x08, + 0x81, 0xdc, 0x42, 0x0e, 0x21, 0x85, 0xe4, 0xef, + 0x00, 0x78, 0x39, 0x18, 0x55, 0x2b, 0x92, 0xde, + 0xf4, 0xd1, 0x48, 0x2e, 0x7c, 0x90, 0x91, 0x6e, + 0x83, 0x84, 0xee, 0x4b, 0x16, 0x14, 0x55, 0xf5, + 0x45, 0x10, 0x03, 0x9c, 0xe7, 0x0d, 0xf4, 0x90, + 0x64, 0x0b, 0x17, 0xcd, 0x84, 0x96, 0x4a, 0xbc, + 0x09, 0x37, 0x4a, 0x3a, 0x0f, 0x3d, 0x00, 0x19, + 0x34, 0x74, 0x5f, 0x59, 0x41, 0x18, 0x17, 0x33, + 0x95, 0x75, 0xe7, 0x14, 0x80, 0xee, 0x84, 0xcc, + 0xae, 0x12, 0x80, 0xf2, 0x0d, 0xa4, 0x9d, 0xc9, + 0x00, 0x79, 0x03, 0x3b, 0x5f, 0x5b, 0xc4, 0x3d, + 0x82, 0xf0, 0x71, 0xf9, 0xb3, 0x88, 0xfb, 0xd0, + 0x72, 0x09, 0xd1, 0xa4, 0xe2, 0xc8, 0x33, 0x7a, + 0x8d, 0x00, 0x39, 0x08, 0x2e, 0xb5, 0xc0, 0xd4, + 0xd7, 0x68, 0x38, 0x17, 0x5a, 0x33, 0xfa, 0xf3, + 0x38, 0x83, 0x8b, 0x12, 0x21, 0x39, 0x2b, 0x94, + 0xf5, 0x18, 0x38, 0x33, 0x21, 0x9b, 0x41, 0xf1, + 0xe0, 0x07, 0xd2, 0x52, 0x59, 0x11, 0x92, 0x92, + 0x2f, 0x41, 0xc4, 0x3d, 0x5e, 0x1e, 0xd3, 0x95, + 0xc0, 0x71, 0x0c, 0x7a, 0xc5, 0x38, 0x8c, 0x6e, + 0xed, 0x31, 0xb0, 0xe2, 0x82, 0x35, 0x09, 0x27, + 0x3d, 0xaa, 0x72, 0xdc, 0x43, 0x04, 0x47, 0xc5, + 0xa9, 0xb0, 0x9b, 0x7f +}; diff --git a/contrib/apps/shell/shell.c b/contrib/apps/shell/shell.c new file mode 100644 index 00000000..7763b961 --- /dev/null +++ b/contrib/apps/shell/shell.c @@ -0,0 +1,1277 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +#include "shell.h" + +#include "lwip/opt.h" + +#if LWIP_NETCONN && LWIP_TCP + +#include +#include + +#include "lwip/mem.h" +#include "lwip/debug.h" +#include "lwip/def.h" +#include "lwip/api.h" +#include "lwip/stats.h" + +#if LWIP_SOCKET +#include "lwip/errno.h" +#include "lwip/if_api.h" +#endif + +#ifdef WIN32 +#define NEWLINE "\r\n" +#else /* WIN32 */ +#define NEWLINE "\n" +#endif /* WIN32 */ + +/** Define this to 1 if you want to echo back all received characters + * (e.g. so they are displayed on a remote telnet) + */ +#ifndef SHELL_ECHO +#define SHELL_ECHO 0 +#endif + +#define BUFSIZE 1024 +static unsigned char buffer[BUFSIZE]; + +struct command { + struct netconn *conn; + s8_t (* exec)(struct command *); + u8_t nargs; + char *args[10]; +}; + +#include +#include +#include + +#define ESUCCESS 0 +#define ESYNTAX -1 +#define ETOOFEW -2 +#define ETOOMANY -3 +#define ECLOSED -4 + +#define NCONNS 10 +static struct netconn *conns[NCONNS]; + +/* help_msg is split into 3 strings to prevent exceeding the C89 maximum length of 509 per string */ +static char help_msg1[] = "Available commands:"NEWLINE"\ +open [IP address] [TCP port]: opens a TCP connection to the specified address."NEWLINE"\ +lstn [TCP port]: sets up a server on the specified port."NEWLINE"\ +acpt [connection #]: waits for an incoming connection request."NEWLINE"\ +send [connection #] [message]: sends a message on a TCP connection."NEWLINE"\ +udpc [local UDP port] [IP address] [remote port]: opens a UDP \"connection\"."NEWLINE"\ +udpl [local UDP port] [IP address] [remote port]: opens a UDP-Lite \"connection\"."NEWLINE""; +static char help_msg2[] = "udpn [local UDP port] [IP address] [remote port]: opens a UDP \"connection\" without checksums."NEWLINE"\ +udpb [local port] [remote port]: opens a UDP broadcast \"connection\"."NEWLINE"\ +usnd [connection #] [message]: sends a message on a UDP connection."NEWLINE"\ +recv [connection #]: recieves data on a TCP or UDP connection."NEWLINE"\ +clos [connection #]: closes a TCP or UDP connection."NEWLINE"\ +stat: prints out lwIP statistics."NEWLINE"\ +idxtoname [index]: outputs interface name from index."NEWLINE"\ +nametoidx [name]: outputs interface index from name."NEWLINE; +static char help_msg3[] = +"gethostnm [name]: outputs IP address of host."NEWLINE"\ +quit: quits"NEWLINE""; + +#if LWIP_STATS +static char padding_10spaces[] = " "; + +#define PROTOCOL_STATS (LINK_STATS && ETHARP_STATS && IPFRAG_STATS && IP_STATS && ICMP_STATS && UDP_STATS && TCP_STATS) + +#if PROTOCOL_STATS +static const char* shell_stat_proto_names[] = { +#if LINK_STATS + "LINK ", +#endif +#if ETHARP_STATS + "ETHARP ", +#endif +#if IPFRAG_STATS + "IP_FRAG ", +#endif +#if IP_STATS + "IP ", +#endif +#if ICMP_STATS + "ICMP ", +#endif +#if UDP_STATS + "UDP ", +#endif +#if TCP_STATS + "TCP ", +#endif + "last" +}; + +static struct stats_proto* shell_stat_proto_stats[] = { +#if LINK_STATS + &lwip_stats.link, +#endif +#if ETHARP_STATS + &lwip_stats.etharp, +#endif +#if IPFRAG_STATS + &lwip_stats.ip_frag, +#endif +#if IP_STATS + &lwip_stats.ip, +#endif +#if ICMP_STATS + &lwip_stats.icmp, +#endif +#if UDP_STATS + &lwip_stats.udp, +#endif +#if TCP_STATS + &lwip_stats.tcp, +#endif +}; +const size_t num_protostats = sizeof(shell_stat_proto_stats)/sizeof(struct stats_proto*); + +static const char *stat_msgs_proto[] = { + " * transmitted ", + " * received ", + " forwarded ", + " * dropped ", + " * checksum errors ", + " * length errors ", + " * memory errors ", + " routing errors ", + " protocol errors ", + " option errors ", + " * misc errors ", + " cache hits " +}; +#endif /* PROTOCOL_STATS */ +#endif /* LWIP_STATS */ + +/*-----------------------------------------------------------------------------------*/ +static void +sendstr(const char *str, struct netconn *conn) +{ + netconn_write(conn, (const void *)str, strlen(str), NETCONN_NOCOPY); +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_open(struct command *com) +{ + ip_addr_t ipaddr; + u16_t port; + int i; + err_t err; + long tmp; + + if (ipaddr_aton(com->args[0], &ipaddr) == -1) { + sendstr(strerror(errno), com->conn); + return ESYNTAX; + } + tmp = strtol(com->args[1], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } + port = (u16_t)tmp; + + /* Find the first unused connection in conns. */ + for(i = 0; i < NCONNS && conns[i] != NULL; i++); + + if (i == NCONNS) { + sendstr("No more connections available, sorry."NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Opening connection to ", com->conn); + netconn_write(com->conn, com->args[0], strlen(com->args[0]), NETCONN_COPY); + sendstr(":", com->conn); + netconn_write(com->conn, com->args[1], strlen(com->args[1]), NETCONN_COPY); + sendstr(NEWLINE, com->conn); + + conns[i] = netconn_new(NETCONN_TCP); + if (conns[i] == NULL) { + sendstr("Could not create connection identifier (out of memory)."NEWLINE, com->conn); + return ESUCCESS; + } + err = netconn_connect(conns[i], &ipaddr, port); + if (err != ERR_OK) { + fprintf(stderr, "error %s"NEWLINE, lwip_strerr(err)); + sendstr("Could not connect to remote host: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + netconn_delete(conns[i]); + conns[i] = NULL; + return ESUCCESS; + } + + sendstr("Opened connection, connection identifier is ", com->conn); + snprintf((char *)buffer, sizeof(buffer), "%d"NEWLINE, i); + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_lstn(struct command *com) +{ + u16_t port; + int i; + err_t err; + long tmp; + + tmp = strtol(com->args[0], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } + port = (u16_t)tmp; + + /* Find the first unused connection in conns. */ + for(i = 0; i < NCONNS && conns[i] != NULL; i++); + + if (i == NCONNS) { + sendstr("No more connections available, sorry."NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Opening a listening connection on port ", com->conn); + netconn_write(com->conn, com->args[0], strlen(com->args[0]), NETCONN_COPY); + sendstr(NEWLINE, com->conn); + + conns[i] = netconn_new(NETCONN_TCP); + if (conns[i] == NULL) { + sendstr("Could not create connection identifier (out of memory)."NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_bind(conns[i], IP_ADDR_ANY, port); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not bind: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_listen(conns[i]); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not listen: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Opened connection, connection identifier is ", com->conn); + snprintf((char *)buffer, sizeof(buffer), "%d"NEWLINE, i); + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_clos(struct command *com) +{ + int i; + err_t err; + + i = strtol(com->args[0], NULL, 10); + + if (i > NCONNS) { + sendstr("Connection identifier too high."NEWLINE, com->conn); + return ESUCCESS; + } + if (conns[i] == NULL) { + sendstr("Connection identifier not in use."NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_close(conns[i]); + if (err != ERR_OK) { + sendstr("Could not close connection: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Connection closed."NEWLINE, com->conn); + netconn_delete(conns[i]); + conns[i] = NULL; + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_acpt(struct command *com) +{ + int i, j; + err_t err; + + /* Find the first unused connection in conns. */ + for(j = 0; j < NCONNS && conns[j] != NULL; j++); + + if (j == NCONNS) { + sendstr("No more connections available, sorry."NEWLINE, com->conn); + return ESUCCESS; + } + + i = strtol(com->args[0], NULL, 10); + + if (i > NCONNS) { + sendstr("Connection identifier too high."NEWLINE, com->conn); + return ESUCCESS; + } + if (conns[i] == NULL) { + sendstr("Connection identifier not in use."NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_accept(conns[i], &conns[j]); + + if (err != ERR_OK) { + sendstr("Could not accept connection: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Accepted connection, connection identifier for new connection is ", com->conn); + snprintf((char *)buffer, sizeof(buffer), "%d"NEWLINE, j); + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +#if LWIP_STATS +static void +com_stat_write_mem(struct netconn *conn, struct stats_mem *elem, int i) +{ + u16_t len; + char buf[100]; + size_t slen; + +#ifdef LWIP_DEBUG + LWIP_UNUSED_ARG(i); + slen = strlen(elem->name); + netconn_write(conn, elem->name, slen, NETCONN_COPY); +#else /* LWIP_DEBUG */ + len = (u16_t)sprintf(buf, "%d", i); + slen = strlen(buf); + netconn_write(conn, buf, slen, NETCONN_COPY); +#endif /* LWIP_DEBUG */ + if(slen < 10) { + netconn_write(conn, padding_10spaces, 10-slen, NETCONN_COPY); + } + + len = (u16_t)sprintf(buf, " * available %"MEM_SIZE_F NEWLINE, elem->avail); + netconn_write(conn, buf, len, NETCONN_COPY); + len = (u16_t)sprintf(buf, " * used %"MEM_SIZE_F NEWLINE, elem->used); + netconn_write(conn, buf, len, NETCONN_COPY); + len = (u16_t)sprintf(buf, " * high water mark %"MEM_SIZE_F NEWLINE, elem->max); + netconn_write(conn, buf, len, NETCONN_COPY); + len = (u16_t)sprintf(buf, " * errors %"STAT_COUNTER_F NEWLINE, elem->err); + netconn_write(conn, buf, len, NETCONN_COPY); + len = (u16_t)sprintf(buf, " * illegal %"STAT_COUNTER_F NEWLINE, elem->illegal); + netconn_write(conn, buf, len, NETCONN_COPY); +} +static void +com_stat_write_sys(struct netconn *conn, struct stats_syselem *elem, const char *name) +{ + u16_t len; + char buf[100]; + size_t slen = strlen(name); + + netconn_write(conn, name, slen, NETCONN_COPY); + if(slen < 10) { + netconn_write(conn, padding_10spaces, 10-slen, NETCONN_COPY); + } + + len = (u16_t)sprintf(buf, " * used %"STAT_COUNTER_F NEWLINE, elem->used); + netconn_write(conn, buf, len, NETCONN_COPY); + len = (u16_t)sprintf(buf, " * high water mark %"STAT_COUNTER_F NEWLINE, elem->max); + netconn_write(conn, buf, len, NETCONN_COPY); + len = (u16_t)sprintf(buf, " * errors %"STAT_COUNTER_F NEWLINE, elem->err); + netconn_write(conn, buf, len, NETCONN_COPY); +} +static s8_t +com_stat(struct command *com) +{ +#if PROTOCOL_STATS || MEMP_STATS + size_t i; +#endif /* PROTOCOL_STATS || MEMP_STATS */ +#if PROTOCOL_STATS + size_t k; + char buf[100]; + u16_t len; + + /* protocol stats, @todo: add IGMP */ + for(i = 0; i < num_protostats; i++) { + size_t s = sizeof(struct stats_proto)/sizeof(STAT_COUNTER); + STAT_COUNTER *c = &shell_stat_proto_stats[i]->xmit; + LWIP_ASSERT("stats not in sync", s == sizeof(stat_msgs_proto)/sizeof(char*)); + netconn_write(com->conn, shell_stat_proto_names[i], strlen(shell_stat_proto_names[i]), NETCONN_COPY); + for(k = 0; k < s; k++) { + len = (u16_t)sprintf(buf, "%s%"STAT_COUNTER_F NEWLINE, stat_msgs_proto[k], c[k]); + netconn_write(com->conn, buf, len, NETCONN_COPY); + } + } +#endif /* PROTOCOL_STATS */ +#if MEM_STATS + com_stat_write_mem(com->conn, &lwip_stats.mem, -1); +#endif /* MEM_STATS */ +#if MEMP_STATS + for(i = 0; i < MEMP_MAX; i++) { + com_stat_write_mem(com->conn, lwip_stats.memp[i], -1); + } +#endif /* MEMP_STATS */ +#if SYS_STATS + com_stat_write_sys(com->conn, &lwip_stats.sys.sem, "SEM "); + com_stat_write_sys(com->conn, &lwip_stats.sys.mutex, "MUTEX "); + com_stat_write_sys(com->conn, &lwip_stats.sys.mbox, "MBOX "); +#endif /* SYS_STATS */ + + return ESUCCESS; +} +#endif +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_send(struct command *com) +{ + int i; + err_t err; + size_t len; + + i = strtol(com->args[0], NULL, 10); + + if (i > NCONNS) { + sendstr("Connection identifier too high."NEWLINE, com->conn); + return ESUCCESS; + } + + if (conns[i] == NULL) { + sendstr("Connection identifier not in use."NEWLINE, com->conn); + return ESUCCESS; + } + + len = strlen(com->args[1]); + com->args[1][len] = '\r'; + com->args[1][len + 1] = '\n'; + com->args[1][len + 2] = 0; + + err = netconn_write(conns[i], com->args[1], len + 3, NETCONN_COPY); + if (err != ERR_OK) { + sendstr("Could not send data: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Data enqueued for sending."NEWLINE, com->conn); + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_recv(struct command *com) +{ + int i; + err_t err; + struct netbuf *buf; + u16_t len; + + i = strtol(com->args[0], NULL, 10); + + if (i > NCONNS) { + sendstr("Connection identifier too high."NEWLINE, com->conn); + return ESUCCESS; + } + + if (conns[i] == NULL) { + sendstr("Connection identifier not in use."NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_recv(conns[i], &buf); + if (err == ERR_OK) { + + netbuf_copy(buf, buffer, BUFSIZE); + len = netbuf_len(buf); + sendstr("Reading from connection:"NEWLINE, com->conn); + netconn_write(com->conn, buffer, len, NETCONN_COPY); + netbuf_delete(buf); + } else { + sendstr("EOF."NEWLINE, com->conn); + } + err = netconn_err(conns[i]); + if (err != ERR_OK) { + sendstr("Could not receive data: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_udpc(struct command *com) +{ + ip_addr_t ipaddr; + u16_t lport, rport; + int i; + err_t err; + long tmp; + + tmp = strtol(com->args[0], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } + lport = (u16_t)tmp; + if (ipaddr_aton(com->args[1], &ipaddr) == -1) { + sendstr(strerror(errno), com->conn); + return ESYNTAX; + } + tmp = strtol(com->args[2], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } + rport = (u16_t)tmp; + + /* Find the first unused connection in conns. */ + for(i = 0; i < NCONNS && conns[i] != NULL; i++); + + if (i == NCONNS) { + sendstr("No more connections available, sorry."NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Setting up UDP connection from port ", com->conn); + netconn_write(com->conn, com->args[0], strlen(com->args[0]), NETCONN_COPY); + sendstr(" to ", com->conn); + netconn_write(com->conn, com->args[1], strlen(com->args[1]), NETCONN_COPY); + sendstr(":", com->conn); + netconn_write(com->conn, com->args[2], strlen(com->args[2]), NETCONN_COPY); + sendstr(NEWLINE, com->conn); + + conns[i] = netconn_new(NETCONN_UDP); + if (conns[i] == NULL) { + sendstr("Could not create connection identifier (out of memory)."NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_connect(conns[i], &ipaddr, rport); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not connect to remote host: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_bind(conns[i], IP_ADDR_ANY, lport); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not bind: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Connection set up, connection identifier is ", com->conn); + snprintf((char *)buffer, sizeof(buffer), "%d"NEWLINE, i); + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_udpl(struct command *com) +{ + ip_addr_t ipaddr; + u16_t lport, rport; + int i; + err_t err; + long tmp; + + tmp = strtol(com->args[0], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } + lport = (u16_t)tmp; + if (ipaddr_aton(com->args[1], &ipaddr) == -1) { + sendstr(strerror(errno), com->conn); + return ESYNTAX; + } + tmp = strtol(com->args[2], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } + rport = (u16_t)tmp; + + /* Find the first unused connection in conns. */ + for(i = 0; i < NCONNS && conns[i] != NULL; i++); + + if (i == NCONNS) { + sendstr("No more connections available, sorry."NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Setting up UDP-Lite connection from port ", com->conn); + netconn_write(com->conn, com->args[0], strlen(com->args[0]), NETCONN_COPY); + sendstr(" to ", com->conn); + netconn_write(com->conn, com->args[1], strlen(com->args[1]), NETCONN_COPY); + sendstr(":", com->conn); + netconn_write(com->conn, com->args[2], strlen(com->args[2]), NETCONN_COPY); + sendstr(NEWLINE, com->conn); + + conns[i] = netconn_new(NETCONN_UDPLITE); + if (conns[i] == NULL) { + sendstr("Could not create connection identifier (out of memory)."NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_connect(conns[i], &ipaddr, rport); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not connect to remote host: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_bind(conns[i], IP_ADDR_ANY, lport); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not bind: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Connection set up, connection identifier is ", com->conn); + snprintf((char *)buffer, sizeof(buffer), "%d"NEWLINE, i); + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_udpn(struct command *com) +{ + ip_addr_t ipaddr; + u16_t lport, rport; + int i; + err_t err; + long tmp; + + tmp = strtol(com->args[0], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } + lport = (u16_t)tmp; + if (ipaddr_aton(com->args[1], &ipaddr) == -1) { + sendstr(strerror(errno), com->conn); + return ESYNTAX; + } + tmp = strtol(com->args[2], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } + rport = (u16_t)tmp; + + /* Find the first unused connection in conns. */ + for(i = 0; i < NCONNS && conns[i] != NULL; i++); + + if (i == NCONNS) { + sendstr("No more connections available, sorry."NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Setting up UDP connection without checksums from port ", com->conn); + netconn_write(com->conn, com->args[0], strlen(com->args[0]), NETCONN_COPY); + sendstr(" to ", com->conn); + netconn_write(com->conn, com->args[1], strlen(com->args[1]), NETCONN_COPY); + sendstr(":", com->conn); + netconn_write(com->conn, com->args[2], strlen(com->args[2]), NETCONN_COPY); + sendstr(NEWLINE, com->conn); + + conns[i] = netconn_new(NETCONN_UDPNOCHKSUM); + if (conns[i] == NULL) { + sendstr("Could not create connection identifier (out of memory)."NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_connect(conns[i], &ipaddr, rport); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not connect to remote host: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_bind(conns[i], IP_ADDR_ANY, lport); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not bind: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Connection set up, connection identifier is ", com->conn); + snprintf((char *)buffer, sizeof(buffer), "%d"NEWLINE, i); + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_udpb(struct command *com) +{ + ip_addr_t ipaddr; +#if LWIP_IPV4 + u16_t lport; +#endif /* LWIP_IPV4 */ + u16_t rport; + int i; + err_t err; + long tmp; + + tmp = strtol(com->args[0], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } +#if LWIP_IPV4 + lport = (u16_t)tmp; +#endif /* LWIP_IPV4 */ + if (ipaddr_aton(com->args[1], &ipaddr) == -1) { + sendstr(strerror(errno), com->conn); + return ESYNTAX; + } + tmp = strtol(com->args[2], NULL, 10); + if((tmp < 0) || (tmp > 0xffff)) { + sendstr("Invalid port number."NEWLINE, com->conn); + return ESUCCESS; + } + rport = (u16_t)tmp; + + /* Find the first unused connection in conns. */ + for(i = 0; i < NCONNS && conns[i] != NULL; i++); + + if (i == NCONNS) { + sendstr("No more connections available, sorry."NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Setting up UDP broadcast connection from port ", com->conn); + netconn_write(com->conn, com->args[0], strlen(com->args[0]), NETCONN_COPY); + sendstr(" to ", com->conn); + netconn_write(com->conn, com->args[1], strlen(com->args[1]), NETCONN_COPY); + sendstr(NEWLINE, com->conn); + + conns[i] = netconn_new(NETCONN_UDP); + if (conns[i] == NULL) { + sendstr("Could not create connection identifier (out of memory)."NEWLINE, com->conn); + return ESUCCESS; + } + + err = netconn_connect(conns[i], &ipaddr, rport); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not connect to remote host: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + +#if LWIP_IPV4 + if (IP_IS_V6_VAL(ipaddr)) { + err = netconn_bind(conns[i], &ip_addr_broadcast, lport); + if (err != ERR_OK) { + netconn_delete(conns[i]); + conns[i] = NULL; + sendstr("Could not bind: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + } +#endif /* LWIP_IPV4 */ + + sendstr("Connection set up, connection identifier is ", com->conn); + snprintf((char *)buffer, sizeof(buffer), "%d"NEWLINE, i); + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_usnd(struct command *com) +{ + long i; + err_t err; + struct netbuf *buf; + char *mem; + u16_t len; + size_t tmp; + + i = strtol(com->args[0], NULL, 10); + + if (i > NCONNS) { + sendstr("Connection identifier too high."NEWLINE, com->conn); + return ESUCCESS; + } + + if (conns[i] == NULL) { + sendstr("Connection identifier not in use."NEWLINE, com->conn); + return ESUCCESS; + } + tmp = strlen(com->args[1]) + 1; + if (tmp > 0xffff) { + sendstr("Invalid length."NEWLINE, com->conn); + return ESUCCESS; + } + len = (u16_t)tmp; + + buf = netbuf_new(); + mem = (char *)netbuf_alloc(buf, len); + if (mem == NULL) { + sendstr("Could not allocate memory for sending."NEWLINE, com->conn); + return ESUCCESS; + } + strncpy(mem, com->args[1], len); + err = netconn_send(conns[i], buf); + netbuf_delete(buf); + if (err != ERR_OK) { + sendstr("Could not send data: ", com->conn); +#ifdef LWIP_DEBUG + sendstr(lwip_strerr(err), com->conn); +#else + sendstr("(debugging must be turned on for error message to appear)", com->conn); +#endif /* LWIP_DEBUG */ + sendstr(NEWLINE, com->conn); + return ESUCCESS; + } + + sendstr("Data sent."NEWLINE, com->conn); + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +#if LWIP_SOCKET +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_idxtoname(struct command *com) +{ + long i = strtol(com->args[0], NULL, 10); + + if (lwip_if_indextoname((unsigned int)i, (char *)buffer)) { + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + sendstr(NEWLINE, com->conn); + } else { + snprintf((char *)buffer, sizeof(buffer), "if_indextoname() failed: %d"NEWLINE, errno); + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + } + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_nametoidx(struct command *com) +{ + unsigned int idx = lwip_if_nametoindex(com->args[0]); + + if (idx) { + snprintf((char *)buffer, sizeof(buffer), "%u"NEWLINE, idx); + netconn_write(com->conn, buffer, strlen((const char *)buffer), NETCONN_COPY); + } else { + sendstr("No interface found"NEWLINE, com->conn); + } + return ESUCCESS; +} +#endif /* LWIP_SOCKET */ +/*-----------------------------------------------------------------------------------*/ +#if LWIP_DNS +static s8_t +com_gethostbyname(struct command *com) +{ + ip_addr_t addr; + err_t err = netconn_gethostbyname(com->args[0], &addr); + + if (err == ERR_OK) { + if (ipaddr_ntoa_r(&addr, (char *)buffer, sizeof(buffer))) { + sendstr("Host found: ", com->conn); + sendstr((char *)buffer, com->conn); + sendstr(NEWLINE, com->conn); + } else { + sendstr("ipaddr_ntoa_r failed", com->conn); + } + } else { + sendstr("No host found"NEWLINE, com->conn); + } + return ESUCCESS; +} +#endif /* LWIP_DNS */ +/*-----------------------------------------------------------------------------------*/ +static s8_t +com_help(struct command *com) +{ + sendstr(help_msg1, com->conn); + sendstr(help_msg2, com->conn); + sendstr(help_msg3, com->conn); + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static s8_t +parse_command(struct command *com, u32_t len) +{ + u16_t i; + u16_t bufp; + + if (strncmp((const char *)buffer, "open", 4) == 0) { + com->exec = com_open; + com->nargs = 2; + } else if (strncmp((const char *)buffer, "lstn", 4) == 0) { + com->exec = com_lstn; + com->nargs = 1; + } else if (strncmp((const char *)buffer, "acpt", 4) == 0) { + com->exec = com_acpt; + com->nargs = 1; + } else if (strncmp((const char *)buffer, "clos", 4) == 0) { + com->exec = com_clos; + com->nargs = 1; +#if LWIP_STATS + } else if (strncmp((const char *)buffer, "stat", 4) == 0) { + com->exec = com_stat; + com->nargs = 0; +#endif + } else if (strncmp((const char *)buffer, "send", 4) == 0) { + com->exec = com_send; + com->nargs = 2; + } else if (strncmp((const char *)buffer, "recv", 4) == 0) { + com->exec = com_recv; + com->nargs = 1; + } else if (strncmp((const char *)buffer, "udpc", 4) == 0) { + com->exec = com_udpc; + com->nargs = 3; + } else if (strncmp((const char *)buffer, "udpb", 4) == 0) { + com->exec = com_udpb; + com->nargs = 2; + } else if (strncmp((const char *)buffer, "udpl", 4) == 0) { + com->exec = com_udpl; + com->nargs = 3; + } else if (strncmp((const char *)buffer, "udpn", 4) == 0) { + com->exec = com_udpn; + com->nargs = 3; + } else if (strncmp((const char *)buffer, "usnd", 4) == 0) { + com->exec = com_usnd; + com->nargs = 2; +#if LWIP_SOCKET + } else if (strncmp((const char *)buffer, "idxtoname", 9) == 0) { + com->exec = com_idxtoname; + com->nargs = 1; + } else if (strncmp((const char *)buffer, "nametoidx", 9) == 0) { + com->exec = com_nametoidx; + com->nargs = 1; +#endif /* LWIP_SOCKET */ +#if LWIP_DNS + } else if (strncmp((const char *)buffer, "gethostnm", 9) == 0) { + com->exec = com_gethostbyname; + com->nargs = 1; +#endif /* LWIP_DNS */ + } else if (strncmp((const char *)buffer, "help", 4) == 0) { + com->exec = com_help; + com->nargs = 0; + } else if (strncmp((const char *)buffer, "quit", 4) == 0) { + printf("quit"NEWLINE); + return ECLOSED; + } else { + return ESYNTAX; + } + + if (com->nargs == 0) { + return ESUCCESS; + } + bufp = 0; + for(; bufp < len && buffer[bufp] != ' '; bufp++); + for(i = 0; i < 10; i++) { + for(; bufp < len && buffer[bufp] == ' '; bufp++); + if (buffer[bufp] == '\r' || + buffer[bufp] == '\n') { + buffer[bufp] = 0; + if (i < com->nargs - 1) { + return ETOOFEW; + } + if (i > com->nargs - 1) { + return ETOOMANY; + } + break; + } + if (bufp > len) { + return ETOOFEW; + } + com->args[i] = (char *)&buffer[bufp]; + for(; bufp < len && buffer[bufp] != ' ' && buffer[bufp] != '\r' && + buffer[bufp] != '\n'; bufp++) { + if (buffer[bufp] == '\\') { + buffer[bufp] = ' '; + } + } + if (bufp > len) { + return ESYNTAX; + } + buffer[bufp] = 0; + bufp++; + if (i == com->nargs - 1) { + break; + } + + } + + return ESUCCESS; +} +/*-----------------------------------------------------------------------------------*/ +static void +shell_error(s8_t err, struct netconn *conn) +{ + switch (err) { + case ESYNTAX: + sendstr("## Syntax error"NEWLINE, conn); + break; + case ETOOFEW: + sendstr("## Too few arguments to command given"NEWLINE, conn); + break; + case ETOOMANY: + sendstr("## Too many arguments to command given"NEWLINE, conn); + break; + case ECLOSED: + sendstr("## Connection closed"NEWLINE, conn); + break; + default: + /* unknown error, don't assert here */ + break; + } +} +/*-----------------------------------------------------------------------------------*/ +static void +prompt(struct netconn *conn) +{ + sendstr("> ", conn); +} +/*-----------------------------------------------------------------------------------*/ +static void +shell_main(struct netconn *conn) +{ + struct pbuf *p; + u16_t len = 0, cur_len; + struct command com; + s8_t err; + int i; + err_t ret; +#if SHELL_ECHO + void *echomem; +#endif /* SHELL_ECHO */ + + do { + ret = netconn_recv_tcp_pbuf(conn, &p); + if (ret == ERR_OK) { + pbuf_copy_partial(p, &buffer[len], (u16_t)(BUFSIZE - len), 0); + cur_len = p->tot_len; + len = (u16_t)(len + cur_len); + if ((len < cur_len) || (len > BUFSIZE)) { + len = BUFSIZE; + } +#if SHELL_ECHO + echomem = mem_malloc(cur_len); + if (echomem != NULL) { + pbuf_copy_partial(p, echomem, cur_len, 0); + netconn_write(conn, echomem, cur_len, NETCONN_COPY); + mem_free(echomem); + } +#endif /* SHELL_ECHO */ + pbuf_free(p); + if (((len > 0) && ((buffer[len-1] == '\r') || (buffer[len-1] == '\n'))) || + (len >= BUFSIZE)) { + if (buffer[0] != 0xff && + buffer[1] != 0xfe) { + err = parse_command(&com, len); + if (err == ESUCCESS) { + com.conn = conn; + err = com.exec(&com); + } + if (err == ECLOSED) { + printf("Closed"NEWLINE); + shell_error(err, conn); + goto close; + } + if (err != ESUCCESS) { + shell_error(err, conn); + } + } else { + sendstr(NEWLINE NEWLINE + "lwIP simple interactive shell."NEWLINE + "(c) Copyright 2001, Swedish Institute of Computer Science."NEWLINE + "Written by Adam Dunkels."NEWLINE + "For help, try the \"help\" command."NEWLINE, conn); + } + if (ret == ERR_OK) { + prompt(conn); + } + len = 0; + } + } + } while (ret == ERR_OK); + printf("err %s"NEWLINE, lwip_strerr(ret)); + +close: + netconn_close(conn); + + for(i = 0; i < NCONNS; i++) { + if (conns[i] != NULL) { + netconn_delete(conns[i]); + } + conns[i] = NULL; + } +} +/*-----------------------------------------------------------------------------------*/ +static void +shell_thread(void *arg) +{ + struct netconn *conn, *newconn; + err_t err; + LWIP_UNUSED_ARG(arg); + +#if LWIP_IPV6 + conn = netconn_new(NETCONN_TCP_IPV6); + LWIP_ERROR("shell: invalid conn", (conn != NULL), return;); + err = netconn_bind(conn, IP6_ADDR_ANY, 23); +#else /* LWIP_IPV6 */ + conn = netconn_new(NETCONN_TCP); + LWIP_ERROR("shell: invalid conn", (conn != NULL), return;); + err = netconn_bind(conn, IP_ADDR_ANY, 23); +#endif /* LWIP_IPV6 */ + LWIP_ERROR("shell: netconn_bind failed", (err == ERR_OK), netconn_delete(conn); return;); + err = netconn_listen(conn); + LWIP_ERROR("shell: netconn_listen failed", (err == ERR_OK), netconn_delete(conn); return;); + + while (1) { + err = netconn_accept(conn, &newconn); + if (err == ERR_OK) { + shell_main(newconn); + netconn_delete(newconn); + } + } +} +/*-----------------------------------------------------------------------------------*/ +void +shell_init(void) +{ + sys_thread_new("shell_thread", shell_thread, NULL, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); +} + +#endif /* LWIP_NETCONN && LWIP_TCP */ diff --git a/contrib/apps/shell/shell.h b/contrib/apps/shell/shell.h new file mode 100644 index 00000000..118cd2c6 --- /dev/null +++ b/contrib/apps/shell/shell.h @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_SHELL_H +#define LWIP_SHELL_H + +void shell_init(void); + +#endif /* LWIP_SHELL_H */ diff --git a/contrib/apps/socket_examples/socket_examples.c b/contrib/apps/socket_examples/socket_examples.c new file mode 100644 index 00000000..e7af5ee3 --- /dev/null +++ b/contrib/apps/socket_examples/socket_examples.c @@ -0,0 +1,680 @@ + +#include "socket_examples.h" + +#include "lwip/opt.h" + +#if LWIP_SOCKET && (LWIP_IPV4 || LWIP_IPV6) + +#include "lwip/sockets.h" +#include "lwip/sys.h" + +#include +#include + +#ifndef SOCK_TARGET_HOST4 +#define SOCK_TARGET_HOST4 "192.168.0.1" +#endif + +#ifndef SOCK_TARGET_HOST6 +#define SOCK_TARGET_HOST6 "FE80::12:34FF:FE56:78AB" +#endif + +#ifndef SOCK_TARGET_PORT +#define SOCK_TARGET_PORT 80 +#endif + +#ifndef SOCK_TARGET_MAXHTTPPAGESIZE +#define SOCK_TARGET_MAXHTTPPAGESIZE 1024 +#endif + +#ifndef SOCKET_EXAMPLES_RUN_PARALLEL +#define SOCKET_EXAMPLES_RUN_PARALLEL 0 +#endif + +const u8_t cmpbuf[8] = {0xab, 0xab, 0xab, 0xab, 0xab, 0xab, 0xab, 0xab}; + +/* a helper struct to ensure memory before/after fd_set is not touched */ +typedef struct _xx +{ + u8_t buf1[8]; + fd_set readset; + u8_t buf2[8]; + fd_set writeset; + u8_t buf3[8]; + fd_set errset; + u8_t buf4[8]; +} fdsets; + +#define INIT_FDSETS(sets) do { \ + memset((sets)->buf1, 0xab, 8); \ + memset((sets)->buf2, 0xab, 8); \ + memset((sets)->buf3, 0xab, 8); \ + memset((sets)->buf4, 0xab, 8); \ +}while(0) + +#define CHECK_FDSETS(sets) do { \ + LWIP_ASSERT("buf1 fail", !memcmp((sets)->buf1, cmpbuf, 8)); \ + LWIP_ASSERT("buf2 fail", !memcmp((sets)->buf2, cmpbuf, 8)); \ + LWIP_ASSERT("buf3 fail", !memcmp((sets)->buf3, cmpbuf, 8)); \ + LWIP_ASSERT("buf4 fail", !memcmp((sets)->buf4, cmpbuf, 8)); \ +}while(0) + +static ip_addr_t dstaddr; + +/** This is an example function that tests + blocking- and nonblocking connect. */ +static void +sockex_nonblocking_connect(void *arg) +{ +#if LWIP_SOCKET_SELECT + int s; + int ret; + int opt; +#if LWIP_IPV6 + struct sockaddr_in6 addr; +#else /* LWIP_IPV6 */ + struct sockaddr_in addr; +#endif /* LWIP_IPV6 */ + fdsets sets; + struct timeval tv; + u32_t ticks_a, ticks_b; + int err; + const ip_addr_t *ipaddr = (const ip_addr_t*)arg; + struct pollfd fds; + INIT_FDSETS(&sets); + + /* set up address to connect to */ + memset(&addr, 0, sizeof(addr)); +#if LWIP_IPV6 + addr.sin6_len = sizeof(addr); + addr.sin6_family = AF_INET6; + addr.sin6_port = PP_HTONS(SOCK_TARGET_PORT); + inet6_addr_from_ip6addr(&addr.sin6_addr, ip_2_ip6(ipaddr)); +#else /* LWIP_IPV6 */ + addr.sin_len = sizeof(addr); + addr.sin_family = AF_INET; + addr.sin_port = PP_HTONS(SOCK_TARGET_PORT); + inet_addr_from_ip4addr(&addr.sin_addr, ip_2_ip4(ipaddr)); +#endif /* LWIP_IPV6 */ + + /* first try blocking: */ + + /* create the socket */ +#if LWIP_IPV6 + s = lwip_socket(AF_INET6, SOCK_STREAM, 0); +#else /* LWIP_IPV6 */ + s = lwip_socket(AF_INET, SOCK_STREAM, 0); +#endif /* LWIP_IPV6 */ + LWIP_ASSERT("s >= 0", s >= 0); + + /* connect */ + ret = lwip_connect(s, (struct sockaddr*)&addr, sizeof(addr)); + /* should succeed */ + LWIP_ASSERT("ret == 0", ret == 0); + + /* write something */ + ret = lwip_write(s, "test", 4); + LWIP_ASSERT("ret == 4", ret == 4); + + /* close */ + ret = lwip_close(s); + LWIP_ASSERT("ret == 0", ret == 0); + + /* now try nonblocking and close before being connected */ + + /* create the socket */ +#if LWIP_IPV6 + s = lwip_socket(AF_INET6, SOCK_STREAM, 0); +#else /* LWIP_IPV6 */ + s = lwip_socket(AF_INET, SOCK_STREAM, 0); +#endif /* LWIP_IPV6 */ + LWIP_ASSERT("s >= 0", s >= 0); + /* nonblocking */ + opt = lwip_fcntl(s, F_GETFL, 0); + LWIP_ASSERT("ret != -1", ret != -1); + opt |= O_NONBLOCK; + ret = lwip_fcntl(s, F_SETFL, opt); + LWIP_ASSERT("ret != -1", ret != -1); + /* connect */ + ret = lwip_connect(s, (struct sockaddr*)&addr, sizeof(addr)); + /* should have an error: "inprogress" */ + LWIP_ASSERT("ret == -1", ret == -1); + err = errno; + LWIP_ASSERT("errno == EINPROGRESS", err == EINPROGRESS); + /* close */ + ret = lwip_close(s); + LWIP_ASSERT("ret == 0", ret == 0); + /* try to close again, should fail with EBADF */ + ret = lwip_close(s); + LWIP_ASSERT("ret == -1", ret == -1); + err = errno; + LWIP_ASSERT("errno == EBADF", err == EBADF); + printf("closing socket in nonblocking connect succeeded\n"); + + /* now try nonblocking, connect should succeed: + this test only works if it is fast enough, i.e. no breakpoints, please! */ + + /* create the socket */ +#if LWIP_IPV6 + s = lwip_socket(AF_INET6, SOCK_STREAM, 0); +#else /* LWIP_IPV6 */ + s = lwip_socket(AF_INET, SOCK_STREAM, 0); +#endif /* LWIP_IPV6 */ + LWIP_ASSERT("s >= 0", s >= 0); + + /* nonblocking */ + opt = 1; + ret = lwip_ioctl(s, FIONBIO, &opt); + LWIP_ASSERT("ret == 0", ret == 0); + + /* connect */ + ret = lwip_connect(s, (struct sockaddr*)&addr, sizeof(addr)); + /* should have an error: "inprogress" */ + LWIP_ASSERT("ret == -1", ret == -1); + err = errno; + LWIP_ASSERT("errno == EINPROGRESS", err == EINPROGRESS); + + /* write should fail, too */ + ret = lwip_write(s, "test", 4); + LWIP_ASSERT("ret == -1", ret == -1); + err = errno; + LWIP_ASSERT("errno == EINPROGRESS", err == EINPROGRESS); + + CHECK_FDSETS(&sets); + FD_ZERO(&sets.readset); + CHECK_FDSETS(&sets); + FD_SET(s, &sets.readset); + CHECK_FDSETS(&sets); + FD_ZERO(&sets.writeset); + CHECK_FDSETS(&sets); + FD_SET(s, &sets.writeset); + CHECK_FDSETS(&sets); + FD_ZERO(&sets.errset); + CHECK_FDSETS(&sets); + FD_SET(s, &sets.errset); + CHECK_FDSETS(&sets); + tv.tv_sec = 0; + tv.tv_usec = 0; + /* select without waiting should fail */ + ret = lwip_select(s + 1, &sets.readset, &sets.writeset, &sets.errset, &tv); + CHECK_FDSETS(&sets); + LWIP_ASSERT("ret == 0", ret == 0); + LWIP_ASSERT("!FD_ISSET(s, &writeset)", !FD_ISSET(s, &sets.writeset)); + LWIP_ASSERT("!FD_ISSET(s, &readset)", !FD_ISSET(s, &sets.readset)); + LWIP_ASSERT("!FD_ISSET(s, &errset)", !FD_ISSET(s, &sets.errset)); + + fds.fd = s; + fds.events = POLLIN|POLLOUT; + fds.revents = 0; + ret = lwip_poll(&fds, 1, 0); + LWIP_ASSERT("ret == 0", ret == 0); + LWIP_ASSERT("fds.revents == 0", fds.revents == 0); + + FD_ZERO(&sets.readset); + FD_SET(s, &sets.readset); + FD_ZERO(&sets.writeset); + FD_SET(s, &sets.writeset); + FD_ZERO(&sets.errset); + FD_SET(s, &sets.errset); + ticks_a = sys_now(); + /* select with waiting should succeed */ + ret = lwip_select(s + 1, &sets.readset, &sets.writeset, &sets.errset, NULL); + ticks_b = sys_now(); + LWIP_ASSERT("ret == 1", ret == 1); + LWIP_ASSERT("FD_ISSET(s, &writeset)", FD_ISSET(s, &sets.writeset)); + LWIP_ASSERT("!FD_ISSET(s, &readset)", !FD_ISSET(s, &sets.readset)); + LWIP_ASSERT("!FD_ISSET(s, &errset)", !FD_ISSET(s, &sets.errset)); + + fds.fd = s; + fds.events = POLLIN|POLLOUT; + fds.revents = 0; + ret = lwip_poll(&fds, 1, 0); + LWIP_ASSERT("ret == 1", ret == 1); + LWIP_ASSERT("fds.revents & POLLOUT", fds.revents & POLLOUT); + + /* now write should succeed */ + ret = lwip_write(s, "test", 4); + LWIP_ASSERT("ret == 4", ret == 4); + + /* close */ + ret = lwip_close(s); + LWIP_ASSERT("ret == 0", ret == 0); + + printf("select() needed %d ticks to return writable\n", (int)(ticks_b - ticks_a)); + + + /* now try nonblocking to invalid address: + this test only works if it is fast enough, i.e. no breakpoints, please! */ + + /* create the socket */ +#if LWIP_IPV6 + s = lwip_socket(AF_INET6, SOCK_STREAM, 0); +#else /* LWIP_IPV6 */ + s = lwip_socket(AF_INET, SOCK_STREAM, 0); +#endif /* LWIP_IPV6 */ + LWIP_ASSERT("s >= 0", s >= 0); + + /* nonblocking */ + opt = 1; + ret = lwip_ioctl(s, FIONBIO, &opt); + LWIP_ASSERT("ret == 0", ret == 0); + +#if LWIP_IPV6 + addr.sin6_addr.un.u8_addr[0]++; /* this should result in an invalid address */ +#else /* LWIP_IPV6 */ + addr.sin_addr.s_addr++; /* this should result in an invalid address */ +#endif /* LWIP_IPV6 */ + + /* connect */ + ret = lwip_connect(s, (struct sockaddr*)&addr, sizeof(addr)); + /* should have an error: "inprogress" */ + LWIP_ASSERT("ret == -1", ret == -1); + err = errno; + LWIP_ASSERT("errno == EINPROGRESS", err == EINPROGRESS); + + /* write should fail, too */ + ret = lwip_write(s, "test", 4); + LWIP_ASSERT("ret == -1", ret == -1); + err = errno; + LWIP_ASSERT("errno == EINPROGRESS", err == EINPROGRESS); + LWIP_UNUSED_ARG(err); + + FD_ZERO(&sets.readset); + FD_SET(s, &sets.readset); + FD_ZERO(&sets.writeset); + FD_SET(s, &sets.writeset); + FD_ZERO(&sets.errset); + FD_SET(s, &sets.errset); + tv.tv_sec = 0; + tv.tv_usec = 0; + /* select without waiting should fail */ + ret = lwip_select(s + 1, &sets.readset, &sets.writeset, &sets.errset, &tv); + LWIP_ASSERT("ret == 0", ret == 0); + + FD_ZERO(&sets.readset); + FD_SET(s, &sets.readset); + FD_ZERO(&sets.writeset); + FD_SET(s, &sets.writeset); + FD_ZERO(&sets.errset); + FD_SET(s, &sets.errset); + ticks_a = sys_now(); + /* select with waiting should eventually succeed and return errset! */ + ret = lwip_select(s + 1, &sets.readset, &sets.writeset, &sets.errset, NULL); + ticks_b = sys_now(); + LWIP_ASSERT("ret > 0", ret > 0); + LWIP_ASSERT("FD_ISSET(s, &errset)", FD_ISSET(s, &sets.errset)); + /*LWIP_ASSERT("!FD_ISSET(s, &readset)", !FD_ISSET(s, &sets.readset)); + LWIP_ASSERT("!FD_ISSET(s, &writeset)", !FD_ISSET(s, &sets.writeset));*/ + + /* close */ + ret = lwip_close(s); + LWIP_ASSERT("ret == 0", ret == 0); + LWIP_UNUSED_ARG(ret); + + printf("select() needed %d ticks to return error\n", (int)(ticks_b - ticks_a)); + printf("sockex_nonblocking_connect finished successfully\n"); +#else + LWIP_UNUSED_ARG(arg); +#endif +} + +/** This is an example function that tests + the recv function (timeout etc.). */ +static void +sockex_testrecv(void *arg) +{ + int s; + int ret; + int err; +#if LWIP_SO_SNDRCVTIMEO_NONSTANDARD + int opt, opt2; +#else + struct timeval opt, opt2; +#endif + socklen_t opt2size; +#if LWIP_IPV6 + struct sockaddr_in6 addr; +#else /* LWIP_IPV6 */ + struct sockaddr_in addr; +#endif /* LWIP_IPV6 */ + size_t len; + char rxbuf[SOCK_TARGET_MAXHTTPPAGESIZE]; +#if LWIP_SOCKET_SELECT + fd_set readset; + fd_set errset; + struct timeval tv; +#endif + const ip_addr_t *ipaddr = (const ip_addr_t*)arg; + + /* set up address to connect to */ + memset(&addr, 0, sizeof(addr)); +#if LWIP_IPV6 + addr.sin6_len = sizeof(addr); + addr.sin6_family = AF_INET6; + addr.sin6_port = PP_HTONS(SOCK_TARGET_PORT); + inet6_addr_from_ip6addr(&addr.sin6_addr, ip_2_ip6(ipaddr)); +#else /* LWIP_IPV6 */ + addr.sin_len = sizeof(addr); + addr.sin_family = AF_INET; + addr.sin_port = PP_HTONS(SOCK_TARGET_PORT); + inet_addr_from_ip4addr(&addr.sin_addr, ip_2_ip4(ipaddr)); +#endif /* LWIP_IPV6 */ + + /* first try blocking: */ + + /* create the socket */ +#if LWIP_IPV6 + s = lwip_socket(AF_INET6, SOCK_STREAM, 0); +#else /* LWIP_IPV6 */ + s = lwip_socket(AF_INET, SOCK_STREAM, 0); +#endif /* LWIP_IPV6 */ + LWIP_ASSERT("s >= 0", s >= 0); + + /* connect */ + ret = lwip_connect(s, (struct sockaddr*)&addr, sizeof(addr)); + /* should succeed */ + LWIP_ASSERT("ret == 0", ret == 0); + + /* set recv timeout (100 ms) */ +#if LWIP_SO_SNDRCVTIMEO_NONSTANDARD + opt = 100; +#else + opt.tv_sec = 0; + opt.tv_usec = 100 * 1000; +#endif + ret = lwip_setsockopt(s, SOL_SOCKET, SO_RCVTIMEO, &opt, sizeof(opt)); + LWIP_ASSERT("ret == 0", ret == 0); +#if LWIP_SO_SNDRCVTIMEO_NONSTANDARD + opt2 = 0; +#else + opt2.tv_sec = 0; + opt2.tv_usec = 0; +#endif + opt2size = sizeof(opt2); + ret = lwip_getsockopt(s, SOL_SOCKET, SO_RCVTIMEO, &opt2, &opt2size); + LWIP_ASSERT("ret == 0", ret == 0); + LWIP_ASSERT("opt2size == sizeof(opt2)", opt2size == sizeof(opt2)); +#if LWIP_SO_SNDRCVTIMEO_NONSTANDARD + LWIP_ASSERT("opt == opt2", opt == opt2); +#else + LWIP_ASSERT("opt == opt2", opt.tv_sec == opt2.tv_sec); + LWIP_ASSERT("opt == opt2", opt.tv_usec == opt2.tv_usec); +#endif + + /* write the start of a GET request */ +#define SNDSTR1 "G" + len = strlen(SNDSTR1); + ret = lwip_write(s, SNDSTR1, len); + LWIP_ASSERT("ret == len", ret == (int)len); + + /* should time out if the other side is a good HTTP server */ + ret = lwip_read(s, rxbuf, 1); + LWIP_ASSERT("ret == -1", ret == -1); + err = errno; + LWIP_ASSERT("errno == EAGAIN", err == EAGAIN); + LWIP_UNUSED_ARG(err); + + /* write the rest of a GET request */ +#define SNDSTR2 "ET / HTTP_1.1\r\n\r\n" + len = strlen(SNDSTR2); + ret = lwip_write(s, SNDSTR2, len); + LWIP_ASSERT("ret == len", ret == (int)len); + + /* wait a while: should be enough for the server to send a response */ + sys_msleep(1000); + + /* should not time out but receive a response */ + ret = lwip_read(s, rxbuf, SOCK_TARGET_MAXHTTPPAGESIZE); + LWIP_ASSERT("ret > 0", ret > 0); + +#if LWIP_SOCKET_SELECT + /* now select should directly return because the socket is readable */ + FD_ZERO(&readset); + FD_ZERO(&errset); + FD_SET(s, &readset); + FD_SET(s, &errset); + tv.tv_sec = 10; + tv.tv_usec = 0; + ret = lwip_select(s + 1, &readset, NULL, &errset, &tv); + LWIP_ASSERT("ret == 1", ret == 1); + LWIP_ASSERT("!FD_ISSET(s, &errset)", !FD_ISSET(s, &errset)); + LWIP_ASSERT("FD_ISSET(s, &readset)", FD_ISSET(s, &readset)); +#endif + + /* should not time out but receive a response */ + ret = lwip_read(s, rxbuf, SOCK_TARGET_MAXHTTPPAGESIZE); + /* might receive a second packet for HTTP/1.1 servers */ + if (ret > 0) { + /* should return 0: closed */ + ret = lwip_read(s, rxbuf, SOCK_TARGET_MAXHTTPPAGESIZE); + LWIP_ASSERT("ret == 0", ret == 0); + } + + /* close */ + ret = lwip_close(s); + LWIP_ASSERT("ret == 0", ret == 0); + LWIP_UNUSED_ARG(ret); + + printf("sockex_testrecv finished successfully\n"); +} + +#if LWIP_SOCKET_SELECT +/** helper struct for the 2 functions below (multithreaded: thread-argument) */ +struct sockex_select_helper { + int socket; + int wait_read; + int expect_read; + int wait_write; + int expect_write; + int wait_err; + int expect_err; + int wait_ms; + sys_sem_t sem; +}; + +/** helper thread to wait for socket events using select */ +static void +sockex_select_waiter(void *arg) +{ + struct sockex_select_helper *helper = (struct sockex_select_helper *)arg; + int ret; + fd_set readset; + fd_set writeset; + fd_set errset; + struct timeval tv; + + LWIP_ASSERT("helper != NULL", helper != NULL); + + FD_ZERO(&readset); + FD_ZERO(&writeset); + FD_ZERO(&errset); + if (helper->wait_read) { + FD_SET(helper->socket, &readset); + } + if (helper->wait_write) { + FD_SET(helper->socket, &writeset); + } + if (helper->wait_err) { + FD_SET(helper->socket, &errset); + } + + tv.tv_sec = helper->wait_ms / 1000; + tv.tv_usec = (helper->wait_ms % 1000) * 1000; + + ret = lwip_select(helper->socket, &readset, &writeset, &errset, &tv); + if (helper->expect_read || helper->expect_write || helper->expect_err) { + LWIP_ASSERT("ret > 0", ret > 0); + } else { + LWIP_ASSERT("ret == 0", ret == 0); + } + LWIP_UNUSED_ARG(ret); + if (helper->expect_read) { + LWIP_ASSERT("FD_ISSET(helper->socket, &readset)", FD_ISSET(helper->socket, &readset)); + } else { + LWIP_ASSERT("!FD_ISSET(helper->socket, &readset)", !FD_ISSET(helper->socket, &readset)); + } + if (helper->expect_write) { + LWIP_ASSERT("FD_ISSET(helper->socket, &writeset)", FD_ISSET(helper->socket, &writeset)); + } else { + LWIP_ASSERT("!FD_ISSET(helper->socket, &writeset)", !FD_ISSET(helper->socket, &writeset)); + } + if (helper->expect_err) { + LWIP_ASSERT("FD_ISSET(helper->socket, &errset)", FD_ISSET(helper->socket, &errset)); + } else { + LWIP_ASSERT("!FD_ISSET(helper->socket, &errset)", !FD_ISSET(helper->socket, &errset)); + } + sys_sem_signal(&helper->sem); +} + +/** This is an example function that tests + more than one thread being active in select. */ +static void +sockex_testtwoselects(void *arg) +{ + int s1; + int s2; + int ret; +#if LWIP_IPV6 + struct sockaddr_in6 addr; +#else /* LWIP_IPV6 */ + struct sockaddr_in addr; +#endif /* LWIP_IPV6 */ + size_t len; + err_t lwiperr; + struct sockex_select_helper h1, h2, h3, h4; + const ip_addr_t *ipaddr = (const ip_addr_t*)arg; + + /* set up address to connect to */ + memset(&addr, 0, sizeof(addr)); +#if LWIP_IPV6 + addr.sin6_len = sizeof(addr); + addr.sin6_family = AF_INET6; + addr.sin6_port = PP_HTONS(SOCK_TARGET_PORT); + inet6_addr_from_ip6addr(&addr.sin6_addr, ip_2_ip6(ipaddr)); +#else /* LWIP_IPV6 */ + addr.sin_len = sizeof(addr); + addr.sin_family = AF_INET; + addr.sin_port = PP_HTONS(SOCK_TARGET_PORT); + inet_addr_from_ip4addr(&addr.sin_addr, ip_2_ip4(ipaddr)); +#endif /* LWIP_IPV6 */ + + /* create the sockets */ +#if LWIP_IPV6 + s1 = lwip_socket(AF_INET6, SOCK_STREAM, 0); + s2 = lwip_socket(AF_INET6, SOCK_STREAM, 0); +#else /* LWIP_IPV6 */ + s1 = lwip_socket(AF_INET, SOCK_STREAM, 0); + s2 = lwip_socket(AF_INET, SOCK_STREAM, 0); +#endif /* LWIP_IPV6 */ + LWIP_ASSERT("s1 >= 0", s1 >= 0); + LWIP_ASSERT("s2 >= 0", s2 >= 0); + + /* connect, should succeed */ + ret = lwip_connect(s1, (struct sockaddr*)&addr, sizeof(addr)); + LWIP_ASSERT("ret == 0", ret == 0); + ret = lwip_connect(s2, (struct sockaddr*)&addr, sizeof(addr)); + LWIP_ASSERT("ret == 0", ret == 0); + + /* write the start of a GET request */ +#define SNDSTR1 "G" + len = strlen(SNDSTR1); + ret = lwip_write(s1, SNDSTR1, len); + LWIP_ASSERT("ret == len", ret == (int)len); + ret = lwip_write(s2, SNDSTR1, len); + LWIP_ASSERT("ret == len", ret == (int)len); + LWIP_UNUSED_ARG(ret); + + h1.wait_read = 1; + h1.wait_write = 1; + h1.wait_err = 1; + h1.expect_read = 0; + h1.expect_write = 0; + h1.expect_err = 0; + lwiperr = sys_sem_new(&h1.sem, 0); + LWIP_ASSERT("lwiperr == ERR_OK", lwiperr == ERR_OK); + h1.socket = s1; + h1.wait_ms = 500; + + h2 = h1; + lwiperr = sys_sem_new(&h2.sem, 0); + LWIP_ASSERT("lwiperr == ERR_OK", lwiperr == ERR_OK); + h2.socket = s2; + h2.wait_ms = 1000; + + h3 = h1; + lwiperr = sys_sem_new(&h3.sem, 0); + LWIP_ASSERT("lwiperr == ERR_OK", lwiperr == ERR_OK); + h3.socket = s2; + h3.wait_ms = 1500; + + h4 = h1; + lwiperr = sys_sem_new(&h4.sem, 0); + LWIP_ASSERT("lwiperr == ERR_OK", lwiperr == ERR_OK); + LWIP_UNUSED_ARG(lwiperr); + h4.socket = s2; + h4.wait_ms = 2000; + + /* select: all sockets should time out if the other side is a good HTTP server */ + + sys_thread_new("sockex_select_waiter1", sockex_select_waiter, &h2, 0, 0); + sys_msleep(100); + sys_thread_new("sockex_select_waiter2", sockex_select_waiter, &h1, 0, 0); + sys_msleep(100); + sys_thread_new("sockex_select_waiter2", sockex_select_waiter, &h4, 0, 0); + sys_msleep(100); + sys_thread_new("sockex_select_waiter2", sockex_select_waiter, &h3, 0, 0); + + sys_sem_wait(&h1.sem); + sys_sem_wait(&h2.sem); + sys_sem_wait(&h3.sem); + sys_sem_wait(&h4.sem); + + /* close */ + ret = lwip_close(s1); + LWIP_ASSERT("ret == 0", ret == 0); + ret = lwip_close(s2); + LWIP_ASSERT("ret == 0", ret == 0); + + printf("sockex_testtwoselects finished successfully\n"); +} +#else +static void +sockex_testtwoselects(void *arg) +{ + LWIP_UNUSED_ARG(arg); +} +#endif + +#if !SOCKET_EXAMPLES_RUN_PARALLEL +static void +socket_example_test(void* arg) +{ + sys_msleep(1000); + sockex_nonblocking_connect(arg); + sockex_testrecv(arg); + sockex_testtwoselects(arg); + printf("all tests done, thread ending\n"); +} +#endif + +void socket_examples_init(void) +{ + int addr_ok; +#if LWIP_IPV6 + IP_SET_TYPE_VAL(dstaddr, IPADDR_TYPE_V6); + addr_ok = ip6addr_aton(SOCK_TARGET_HOST6, ip_2_ip6(&dstaddr)); +#else /* LWIP_IPV6 */ + IP_SET_TYPE_VAL(dstaddr, IPADDR_TYPE_V4); + addr_ok = ip4addr_aton(SOCK_TARGET_HOST4, ip_2_ip4(&dstaddr)); +#endif /* LWIP_IPV6 */ + LWIP_ASSERT("invalid address", addr_ok); +#if SOCKET_EXAMPLES_RUN_PARALLEL + sys_thread_new("sockex_nonblocking_connect", sockex_nonblocking_connect, &dstaddr, 0, 0); + sys_thread_new("sockex_testrecv", sockex_testrecv, &dstaddr, 0, 0); + sys_thread_new("sockex_testtwoselects", sockex_testtwoselects, &dstaddr, 0, 0); +#else + sys_thread_new("socket_example_test", socket_example_test, &dstaddr, 0, 0); +#endif +} + +#endif /* LWIP_SOCKET */ diff --git a/contrib/apps/socket_examples/socket_examples.h b/contrib/apps/socket_examples/socket_examples.h new file mode 100644 index 00000000..354d03ad --- /dev/null +++ b/contrib/apps/socket_examples/socket_examples.h @@ -0,0 +1,6 @@ +#ifndef LWIP_SOCKET_EXAMPLES_H +#define LWIP_SOCKET_EXAMPLES_H + +void socket_examples_init(void); + +#endif /* LWIP_SOCKET_EXAMPLES_H */ diff --git a/contrib/apps/tcpecho/tcpecho.c b/contrib/apps/tcpecho/tcpecho.c new file mode 100644 index 00000000..ef6361a2 --- /dev/null +++ b/contrib/apps/tcpecho/tcpecho.c @@ -0,0 +1,101 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#include "tcpecho.h" + +#include "lwip/opt.h" + +#if LWIP_NETCONN + +#include "lwip/sys.h" +#include "lwip/api.h" +/*-----------------------------------------------------------------------------------*/ +static void +tcpecho_thread(void *arg) +{ + struct netconn *conn, *newconn; + err_t err; + LWIP_UNUSED_ARG(arg); + + /* Create a new connection identifier. */ + /* Bind connection to well known port number 7. */ +#if LWIP_IPV6 + conn = netconn_new(NETCONN_TCP_IPV6); + netconn_bind(conn, IP6_ADDR_ANY, 7); +#else /* LWIP_IPV6 */ + conn = netconn_new(NETCONN_TCP); + netconn_bind(conn, IP_ADDR_ANY, 7); +#endif /* LWIP_IPV6 */ + LWIP_ERROR("tcpecho: invalid conn", (conn != NULL), return;); + + /* Tell connection to go into listening mode. */ + netconn_listen(conn); + + while (1) { + + /* Grab new connection. */ + err = netconn_accept(conn, &newconn); + /*printf("accepted new connection %p\n", newconn);*/ + /* Process the new connection. */ + if (err == ERR_OK) { + struct netbuf *buf; + void *data; + u16_t len; + + while ((err = netconn_recv(newconn, &buf)) == ERR_OK) { + /*printf("Recved\n");*/ + do { + netbuf_data(buf, &data, &len); + err = netconn_write(newconn, data, len, NETCONN_COPY); +#if 0 + if (err != ERR_OK) { + printf("tcpecho: netconn_write: error \"%s\"\n", lwip_strerr(err)); + } +#endif + } while (netbuf_next(buf) >= 0); + netbuf_delete(buf); + } + /*printf("Got EOF, looping\n");*/ + /* Close connection and discard connection identifier. */ + netconn_close(newconn); + netconn_delete(newconn); + } + } +} +/*-----------------------------------------------------------------------------------*/ +void +tcpecho_init(void) +{ + sys_thread_new("tcpecho_thread", tcpecho_thread, NULL, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); +} +/*-----------------------------------------------------------------------------------*/ + +#endif /* LWIP_NETCONN */ diff --git a/contrib/apps/tcpecho/tcpecho.h b/contrib/apps/tcpecho/tcpecho.h new file mode 100644 index 00000000..5b4bcfd4 --- /dev/null +++ b/contrib/apps/tcpecho/tcpecho.h @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +#ifndef LWIP_TCPECHO_H +#define LWIP_TCPECHO_H + +void tcpecho_init(void); + +#endif /* LWIP_TCPECHO_H */ diff --git a/contrib/apps/tcpecho_raw/tcpecho_raw.c b/contrib/apps/tcpecho_raw/tcpecho_raw.c new file mode 100644 index 00000000..6b9d65bc --- /dev/null +++ b/contrib/apps/tcpecho_raw/tcpecho_raw.c @@ -0,0 +1,303 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of and a contribution to the lwIP TCP/IP stack. + * + * Credits go to Adam Dunkels (and the current maintainers) of this software. + * + * Christiaan Simons rewrote this file to get a more stable echo example. + */ + +/** + * @file + * TCP echo server example using raw API. + * + * Echos all bytes sent by connecting client, + * and passively closes when client is done. + * + */ + +#include "lwip/opt.h" +#include "lwip/debug.h" +#include "lwip/stats.h" +#include "lwip/tcp.h" +#include "tcpecho_raw.h" + +#if LWIP_TCP && LWIP_CALLBACK_API + +static struct tcp_pcb *tcpecho_raw_pcb; + +enum tcpecho_raw_states +{ + ES_NONE = 0, + ES_ACCEPTED, + ES_RECEIVED, + ES_CLOSING +}; + +struct tcpecho_raw_state +{ + u8_t state; + u8_t retries; + struct tcp_pcb *pcb; + /* pbuf (chain) to recycle */ + struct pbuf *p; +}; + +static void +tcpecho_raw_free(struct tcpecho_raw_state *es) +{ + if (es != NULL) { + if (es->p) { + /* free the buffer chain if present */ + pbuf_free(es->p); + } + + mem_free(es); + } +} + +static void +tcpecho_raw_close(struct tcp_pcb *tpcb, struct tcpecho_raw_state *es) +{ + tcp_arg(tpcb, NULL); + tcp_sent(tpcb, NULL); + tcp_recv(tpcb, NULL); + tcp_err(tpcb, NULL); + tcp_poll(tpcb, NULL, 0); + + tcpecho_raw_free(es); + + tcp_close(tpcb); +} + +static void +tcpecho_raw_send(struct tcp_pcb *tpcb, struct tcpecho_raw_state *es) +{ + struct pbuf *ptr; + err_t wr_err = ERR_OK; + + while ((wr_err == ERR_OK) && + (es->p != NULL) && + (es->p->len <= tcp_sndbuf(tpcb))) { + ptr = es->p; + + /* enqueue data for transmission */ + wr_err = tcp_write(tpcb, ptr->payload, ptr->len, 1); + if (wr_err == ERR_OK) { + u16_t plen; + + plen = ptr->len; + /* continue with next pbuf in chain (if any) */ + es->p = ptr->next; + if(es->p != NULL) { + /* new reference! */ + pbuf_ref(es->p); + } + /* chop first pbuf from chain */ + pbuf_free(ptr); + /* we can read more data now */ + tcp_recved(tpcb, plen); + } else if(wr_err == ERR_MEM) { + /* we are low on memory, try later / harder, defer to poll */ + es->p = ptr; + } else { + /* other problem ?? */ + } + } +} + +static void +tcpecho_raw_error(void *arg, err_t err) +{ + struct tcpecho_raw_state *es; + + LWIP_UNUSED_ARG(err); + + es = (struct tcpecho_raw_state *)arg; + + tcpecho_raw_free(es); +} + +static err_t +tcpecho_raw_poll(void *arg, struct tcp_pcb *tpcb) +{ + err_t ret_err; + struct tcpecho_raw_state *es; + + es = (struct tcpecho_raw_state *)arg; + if (es != NULL) { + if (es->p != NULL) { + /* there is a remaining pbuf (chain) */ + tcpecho_raw_send(tpcb, es); + } else { + /* no remaining pbuf (chain) */ + if(es->state == ES_CLOSING) { + tcpecho_raw_close(tpcb, es); + } + } + ret_err = ERR_OK; + } else { + /* nothing to be done */ + tcp_abort(tpcb); + ret_err = ERR_ABRT; + } + return ret_err; +} + +static err_t +tcpecho_raw_sent(void *arg, struct tcp_pcb *tpcb, u16_t len) +{ + struct tcpecho_raw_state *es; + + LWIP_UNUSED_ARG(len); + + es = (struct tcpecho_raw_state *)arg; + es->retries = 0; + + if(es->p != NULL) { + /* still got pbufs to send */ + tcp_sent(tpcb, tcpecho_raw_sent); + tcpecho_raw_send(tpcb, es); + } else { + /* no more pbufs to send */ + if(es->state == ES_CLOSING) { + tcpecho_raw_close(tpcb, es); + } + } + return ERR_OK; +} + +static err_t +tcpecho_raw_recv(void *arg, struct tcp_pcb *tpcb, struct pbuf *p, err_t err) +{ + struct tcpecho_raw_state *es; + err_t ret_err; + + LWIP_ASSERT("arg != NULL",arg != NULL); + es = (struct tcpecho_raw_state *)arg; + if (p == NULL) { + /* remote host closed connection */ + es->state = ES_CLOSING; + if(es->p == NULL) { + /* we're done sending, close it */ + tcpecho_raw_close(tpcb, es); + } else { + /* we're not done yet */ + tcpecho_raw_send(tpcb, es); + } + ret_err = ERR_OK; + } else if(err != ERR_OK) { + /* cleanup, for unknown reason */ + if (p != NULL) { + pbuf_free(p); + } + ret_err = err; + } + else if(es->state == ES_ACCEPTED) { + /* first data chunk in p->payload */ + es->state = ES_RECEIVED; + /* store reference to incoming pbuf (chain) */ + es->p = p; + tcpecho_raw_send(tpcb, es); + ret_err = ERR_OK; + } else if (es->state == ES_RECEIVED) { + /* read some more data */ + if(es->p == NULL) { + es->p = p; + tcpecho_raw_send(tpcb, es); + } else { + struct pbuf *ptr; + + /* chain pbufs to the end of what we recv'ed previously */ + ptr = es->p; + pbuf_cat(ptr,p); + } + ret_err = ERR_OK; + } else { + /* unkown es->state, trash data */ + tcp_recved(tpcb, p->tot_len); + pbuf_free(p); + ret_err = ERR_OK; + } + return ret_err; +} + +static err_t +tcpecho_raw_accept(void *arg, struct tcp_pcb *newpcb, err_t err) +{ + err_t ret_err; + struct tcpecho_raw_state *es; + + LWIP_UNUSED_ARG(arg); + if ((err != ERR_OK) || (newpcb == NULL)) { + return ERR_VAL; + } + + /* Unless this pcb should have NORMAL priority, set its priority now. + When running out of pcbs, low priority pcbs can be aborted to create + new pcbs of higher priority. */ + tcp_setprio(newpcb, TCP_PRIO_MIN); + + es = (struct tcpecho_raw_state *)mem_malloc(sizeof(struct tcpecho_raw_state)); + if (es != NULL) { + es->state = ES_ACCEPTED; + es->pcb = newpcb; + es->retries = 0; + es->p = NULL; + /* pass newly allocated es to our callbacks */ + tcp_arg(newpcb, es); + tcp_recv(newpcb, tcpecho_raw_recv); + tcp_err(newpcb, tcpecho_raw_error); + tcp_poll(newpcb, tcpecho_raw_poll, 0); + tcp_sent(newpcb, tcpecho_raw_sent); + ret_err = ERR_OK; + } else { + ret_err = ERR_MEM; + } + return ret_err; +} + +void +tcpecho_raw_init(void) +{ + tcpecho_raw_pcb = tcp_new_ip_type(IPADDR_TYPE_ANY); + if (tcpecho_raw_pcb != NULL) { + err_t err; + + err = tcp_bind(tcpecho_raw_pcb, IP_ANY_TYPE, 7); + if (err == ERR_OK) { + tcpecho_raw_pcb = tcp_listen(tcpecho_raw_pcb); + tcp_accept(tcpecho_raw_pcb, tcpecho_raw_accept); + } else { + /* abort? output diagnostic? */ + } + } else { + /* abort? output diagnostic? */ + } +} + +#endif /* LWIP_TCP && LWIP_CALLBACK_API */ diff --git a/contrib/apps/tcpecho_raw/tcpecho_raw.h b/contrib/apps/tcpecho_raw/tcpecho_raw.h new file mode 100644 index 00000000..b091ea70 --- /dev/null +++ b/contrib/apps/tcpecho_raw/tcpecho_raw.h @@ -0,0 +1,35 @@ +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + */ +#ifndef LWIP_TCPECHO_RAW_H +#define LWIP_TCPECHO_RAW_H + +void tcpecho_raw_init(void); + +#endif /* LWIP_TCPECHO_RAW_H */ diff --git a/contrib/apps/udpecho/udpecho.c b/contrib/apps/udpecho/udpecho.c new file mode 100644 index 00000000..71d33197 --- /dev/null +++ b/contrib/apps/udpecho/udpecho.c @@ -0,0 +1,87 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +#include "udpecho.h" + +#include "lwip/opt.h" + +#if LWIP_NETCONN + +#include "lwip/api.h" +#include "lwip/sys.h" + +/*-----------------------------------------------------------------------------------*/ +static void +udpecho_thread(void *arg) +{ + struct netconn *conn; + struct netbuf *buf; + char buffer[4096]; + err_t err; + LWIP_UNUSED_ARG(arg); + +#if LWIP_IPV6 + conn = netconn_new(NETCONN_UDP_IPV6); + netconn_bind(conn, IP6_ADDR_ANY, 7); +#else /* LWIP_IPV6 */ + conn = netconn_new(NETCONN_UDP); + netconn_bind(conn, IP_ADDR_ANY, 7); +#endif /* LWIP_IPV6 */ + LWIP_ERROR("udpecho: invalid conn", (conn != NULL), return;); + + while (1) { + err = netconn_recv(conn, &buf); + if (err == ERR_OK) { + /* no need netconn_connect here, since the netbuf contains the address */ + if(netbuf_copy(buf, buffer, sizeof(buffer)) != buf->p->tot_len) { + LWIP_DEBUGF(LWIP_DBG_ON, ("netbuf_copy failed\n")); + } else { + buffer[buf->p->tot_len] = '\0'; + err = netconn_send(conn, buf); + if(err != ERR_OK) { + LWIP_DEBUGF(LWIP_DBG_ON, ("netconn_send failed: %d\n", (int)err)); + } else { + LWIP_DEBUGF(LWIP_DBG_ON, ("got %s\n", buffer)); + } + } + netbuf_delete(buf); + } + } +} +/*-----------------------------------------------------------------------------------*/ +void +udpecho_init(void) +{ + sys_thread_new("udpecho_thread", udpecho_thread, NULL, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); +} + +#endif /* LWIP_NETCONN */ diff --git a/contrib/apps/udpecho/udpecho.h b/contrib/apps/udpecho/udpecho.h new file mode 100644 index 00000000..a3155b8b --- /dev/null +++ b/contrib/apps/udpecho/udpecho.h @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_UDPECHO_H +#define LWIP_UDPECHO_H + +void udpecho_init(void); + +#endif /* LWIP_UDPECHO_H */ diff --git a/contrib/apps/udpecho_raw/udpecho_raw.c b/contrib/apps/udpecho_raw/udpecho_raw.c new file mode 100644 index 00000000..43c9f0b1 --- /dev/null +++ b/contrib/apps/udpecho_raw/udpecho_raw.c @@ -0,0 +1,88 @@ +/* + * Copyright (c) 2016 Stephan Linz , Li-Pro.Net + * All rights reserved. + * + * Based on examples provided by + * Iwan Budi Kusnanto (https://gist.github.com/iwanbk/1399729) + * Juri Haberland (https://lists.gnu.org/archive/html/lwip-users/2007-06/msg00078.html) + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of and a contribution to the lwIP TCP/IP stack. + * + * Credits go to Adam Dunkels (and the current maintainers) of this software. + * + * Stephan Linz rewrote this file to get a basic echo example. + */ + +/** + * @file + * UDP echo server example using raw API. + * + * Echos all bytes sent by connecting client, + * and passively closes when client is done. + * + */ + +#include "lwip/opt.h" +#include "lwip/debug.h" +#include "lwip/stats.h" +#include "lwip/udp.h" +#include "udpecho_raw.h" + +#if LWIP_UDP + +static struct udp_pcb *udpecho_raw_pcb; + +static void +udpecho_raw_recv(void *arg, struct udp_pcb *upcb, struct pbuf *p, + const ip_addr_t *addr, u16_t port) +{ + LWIP_UNUSED_ARG(arg); + if (p != NULL) { + /* send received packet back to sender */ + udp_sendto(upcb, p, addr, port); + /* free the pbuf */ + pbuf_free(p); + } +} + +void +udpecho_raw_init(void) +{ + udpecho_raw_pcb = udp_new_ip_type(IPADDR_TYPE_ANY); + if (udpecho_raw_pcb != NULL) { + err_t err; + + err = udp_bind(udpecho_raw_pcb, IP_ANY_TYPE, 7); + if (err == ERR_OK) { + udp_recv(udpecho_raw_pcb, udpecho_raw_recv, NULL); + } else { + /* abort? output diagnostic? */ + } + } else { + /* abort? output diagnostic? */ + } +} + +#endif /* LWIP_UDP */ diff --git a/contrib/apps/udpecho_raw/udpecho_raw.h b/contrib/apps/udpecho_raw/udpecho_raw.h new file mode 100644 index 00000000..4a98b740 --- /dev/null +++ b/contrib/apps/udpecho_raw/udpecho_raw.h @@ -0,0 +1,39 @@ +/* + * Copyright (c) 2016 Stephan Linz , Li-Pro.Net + * All rights reserved. + * + * Based on examples provided by + * Iwan Budi Kusnanto (https://gist.github.com/iwanbk/1399729) + * Juri Haberland (https://lists.gnu.org/archive/html/lwip-users/2007-06/msg00078.html) + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + */ +#ifndef LWIP_UDPECHO_RAW_H +#define LWIP_UDPECHO_RAW_H + +void udpecho_raw_init(void); + +#endif /* LWIP_UDPECHO_RAW_H */ diff --git a/contrib/examples/ethernetif/ethernetif.c b/contrib/examples/ethernetif/ethernetif.c new file mode 100644 index 00000000..79763e8b --- /dev/null +++ b/contrib/examples/ethernetif/ethernetif.c @@ -0,0 +1,337 @@ +/** + * @file + * Ethernet Interface Skeleton + * + */ + +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +/* + * This file is a skeleton for developing Ethernet network interface + * drivers for lwIP. Add code to the low_level functions and do a + * search-and-replace for the word "ethernetif" to replace it with + * something that better describes your network interface. + */ + +#include "lwip/opt.h" + +#if 0 /* don't build, this is only a skeleton, see previous comment */ + +#include "lwip/def.h" +#include "lwip/mem.h" +#include "lwip/pbuf.h" +#include "lwip/stats.h" +#include "lwip/snmp.h" +#include "lwip/ethip6.h" +#include "lwip/etharp.h" +#include "netif/ppp/pppoe.h" + +/* Define those to better describe your network interface. */ +#define IFNAME0 'e' +#define IFNAME1 'n' + +/** + * Helper struct to hold private data used to operate your ethernet interface. + * Keeping the ethernet address of the MAC in this struct is not necessary + * as it is already kept in the struct netif. + * But this is only an example, anyway... + */ +struct ethernetif { + struct eth_addr *ethaddr; + /* Add whatever per-interface state that is needed here. */ +}; + +/* Forward declarations. */ +static void ethernetif_input(struct netif *netif); + +/** + * In this function, the hardware should be initialized. + * Called from ethernetif_init(). + * + * @param netif the already initialized lwip network interface structure + * for this ethernetif + */ +static void +low_level_init(struct netif *netif) +{ + struct ethernetif *ethernetif = netif->state; + + /* set MAC hardware address length */ + netif->hwaddr_len = ETHARP_HWADDR_LEN; + + /* set MAC hardware address */ + netif->hwaddr[0] = ; + ... + netif->hwaddr[5] = ; + + /* maximum transfer unit */ + netif->mtu = 1500; + + /* device capabilities */ + /* don't set NETIF_FLAG_ETHARP if this device is not an ethernet one */ + netif->flags = NETIF_FLAG_BROADCAST | NETIF_FLAG_ETHARP | NETIF_FLAG_LINK_UP; + +#if LWIP_IPV6 && LWIP_IPV6_MLD + /* + * For hardware/netifs that implement MAC filtering. + * All-nodes link-local is handled by default, so we must let the hardware know + * to allow multicast packets in. + * Should set mld_mac_filter previously. */ + if (netif->mld_mac_filter != NULL) { + ip6_addr_t ip6_allnodes_ll; + ip6_addr_set_allnodes_linklocal(&ip6_allnodes_ll); + netif->mld_mac_filter(netif, &ip6_allnodes_ll, NETIF_ADD_MAC_FILTER); + } +#endif /* LWIP_IPV6 && LWIP_IPV6_MLD */ + + /* Do whatever else is needed to initialize interface. */ +} + +/** + * This function should do the actual transmission of the packet. The packet is + * contained in the pbuf that is passed to the function. This pbuf + * might be chained. + * + * @param netif the lwip network interface structure for this ethernetif + * @param p the MAC packet to send (e.g. IP packet including MAC addresses and type) + * @return ERR_OK if the packet could be sent + * an err_t value if the packet couldn't be sent + * + * @note Returning ERR_MEM here if a DMA queue of your MAC is full can lead to + * strange results. You might consider waiting for space in the DMA queue + * to become available since the stack doesn't retry to send a packet + * dropped because of memory failure (except for the TCP timers). + */ + +static err_t +low_level_output(struct netif *netif, struct pbuf *p) +{ + struct ethernetif *ethernetif = netif->state; + struct pbuf *q; + + initiate transfer(); + +#if ETH_PAD_SIZE + pbuf_remove_header(p, ETH_PAD_SIZE); /* drop the padding word */ +#endif + + for (q = p; q != NULL; q = q->next) { + /* Send the data from the pbuf to the interface, one pbuf at a + time. The size of the data in each pbuf is kept in the ->len + variable. */ + send data from(q->payload, q->len); + } + + signal that packet should be sent(); + + MIB2_STATS_NETIF_ADD(netif, ifoutoctets, p->tot_len); + if (((u8_t *)p->payload)[0] & 1) { + /* broadcast or multicast packet*/ + MIB2_STATS_NETIF_INC(netif, ifoutnucastpkts); + } else { + /* unicast packet */ + MIB2_STATS_NETIF_INC(netif, ifoutucastpkts); + } + /* increase ifoutdiscards or ifouterrors on error */ + +#if ETH_PAD_SIZE + pbuf_add_header(p, ETH_PAD_SIZE); /* reclaim the padding word */ +#endif + + LINK_STATS_INC(link.xmit); + + return ERR_OK; +} + +/** + * Should allocate a pbuf and transfer the bytes of the incoming + * packet from the interface into the pbuf. + * + * @param netif the lwip network interface structure for this ethernetif + * @return a pbuf filled with the received packet (including MAC header) + * NULL on memory error + */ +static struct pbuf * +low_level_input(struct netif *netif) +{ + struct ethernetif *ethernetif = netif->state; + struct pbuf *p, *q; + u16_t len; + + /* Obtain the size of the packet and put it into the "len" + variable. */ + len = ; + +#if ETH_PAD_SIZE + len += ETH_PAD_SIZE; /* allow room for Ethernet padding */ +#endif + + /* We allocate a pbuf chain of pbufs from the pool. */ + p = pbuf_alloc(PBUF_RAW, len, PBUF_POOL); + + if (p != NULL) { + +#if ETH_PAD_SIZE + pbuf_remove_header(p, ETH_PAD_SIZE); /* drop the padding word */ +#endif + + /* We iterate over the pbuf chain until we have read the entire + * packet into the pbuf. */ + for (q = p; q != NULL; q = q->next) { + /* Read enough bytes to fill this pbuf in the chain. The + * available data in the pbuf is given by the q->len + * variable. + * This does not necessarily have to be a memcpy, you can also preallocate + * pbufs for a DMA-enabled MAC and after receiving truncate it to the + * actually received size. In this case, ensure the tot_len member of the + * pbuf is the sum of the chained pbuf len members. + */ + read data into(q->payload, q->len); + } + acknowledge that packet has been read(); + + MIB2_STATS_NETIF_ADD(netif, ifinoctets, p->tot_len); + if (((u8_t *)p->payload)[0] & 1) { + /* broadcast or multicast packet*/ + MIB2_STATS_NETIF_INC(netif, ifinnucastpkts); + } else { + /* unicast packet*/ + MIB2_STATS_NETIF_INC(netif, ifinucastpkts); + } +#if ETH_PAD_SIZE + pbuf_add_header(p, ETH_PAD_SIZE); /* reclaim the padding word */ +#endif + + LINK_STATS_INC(link.recv); + } else { + drop packet(); + LINK_STATS_INC(link.memerr); + LINK_STATS_INC(link.drop); + MIB2_STATS_NETIF_INC(netif, ifindiscards); + } + + return p; +} + +/** + * This function should be called when a packet is ready to be read + * from the interface. It uses the function low_level_input() that + * should handle the actual reception of bytes from the network + * interface. Then the type of the received packet is determined and + * the appropriate input function is called. + * + * @param netif the lwip network interface structure for this ethernetif + */ +static void +ethernetif_input(struct netif *netif) +{ + struct ethernetif *ethernetif; + struct eth_hdr *ethhdr; + struct pbuf *p; + + ethernetif = netif->state; + + /* move received packet into a new pbuf */ + p = low_level_input(netif); + /* if no packet could be read, silently ignore this */ + if (p != NULL) { + /* pass all packets to ethernet_input, which decides what packets it supports */ + if (netif->input(p, netif) != ERR_OK) { + LWIP_DEBUGF(NETIF_DEBUG, ("ethernetif_input: IP input error\n")); + pbuf_free(p); + p = NULL; + } + } +} + +/** + * Should be called at the beginning of the program to set up the + * network interface. It calls the function low_level_init() to do the + * actual setup of the hardware. + * + * This function should be passed as a parameter to netif_add(). + * + * @param netif the lwip network interface structure for this ethernetif + * @return ERR_OK if the loopif is initialized + * ERR_MEM if private data couldn't be allocated + * any other err_t on error + */ +err_t +ethernetif_init(struct netif *netif) +{ + struct ethernetif *ethernetif; + + LWIP_ASSERT("netif != NULL", (netif != NULL)); + + ethernetif = mem_malloc(sizeof(struct ethernetif)); + if (ethernetif == NULL) { + LWIP_DEBUGF(NETIF_DEBUG, ("ethernetif_init: out of memory\n")); + return ERR_MEM; + } + +#if LWIP_NETIF_HOSTNAME + /* Initialize interface hostname */ + netif->hostname = "lwip"; +#endif /* LWIP_NETIF_HOSTNAME */ + + /* + * Initialize the snmp variables and counters inside the struct netif. + * The last argument should be replaced with your link speed, in units + * of bits per second. + */ + MIB2_INIT_NETIF(netif, snmp_ifType_ethernet_csmacd, LINK_SPEED_OF_YOUR_NETIF_IN_BPS); + + netif->state = ethernetif; + netif->name[0] = IFNAME0; + netif->name[1] = IFNAME1; + /* We directly use etharp_output() here to save a function call. + * You can instead declare your own function an call etharp_output() + * from it if you have to do some checks before sending (e.g. if link + * is available...) */ +#if LWIP_IPV4 + netif->output = etharp_output; +#endif /* LWIP_IPV4 */ +#if LWIP_IPV6 + netif->output_ip6 = ethip6_output; +#endif /* LWIP_IPV6 */ + netif->linkoutput = low_level_output; + + ethernetif->ethaddr = (struct eth_addr *) & (netif->hwaddr[0]); + + /* initialize the hardware */ + low_level_init(netif); + + return ERR_OK; +} + +#endif /* 0 */ diff --git a/contrib/examples/example_app/default_netif.h b/contrib/examples/example_app/default_netif.h new file mode 100644 index 00000000..acfa22f1 --- /dev/null +++ b/contrib/examples/example_app/default_netif.h @@ -0,0 +1,47 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +#ifndef LWIP_DEFAULT_NETIF_H +#define LWIP_DEFAULT_NETIF_H + +#include "lwip/ip_addr.h" + +#if LWIP_IPV4 +void init_default_netif(const ip4_addr_t *ipaddr, const ip4_addr_t *netmask, const ip4_addr_t *gw); +#else +void init_default_netif(void); +#endif + +void default_netif_poll(void); +void default_netif_shutdown(void); + +#endif diff --git a/contrib/examples/example_app/lwipcfg.h.example b/contrib/examples/example_app/lwipcfg.h.example new file mode 100644 index 00000000..5bbf2fe9 --- /dev/null +++ b/contrib/examples/example_app/lwipcfg.h.example @@ -0,0 +1,76 @@ +/** + * Additional settings for the win32 port. + * Copy this to lwipcfg_msvc.h and make the config changes you need. + */ + +/* configuration for this port */ +#define PPP_USERNAME "Admin" +#define PPP_PASSWORD "pass" + +/** Define this to the index of the windows network adapter to use */ +#define PACKET_LIB_ADAPTER_NR 1 +/** Define this to the GUID of the windows network adapter to use + * or NOT define this if you want PACKET_LIB_ADAPTER_NR to be used */ +/*#define PACKET_LIB_ADAPTER_GUID "00000000-0000-0000-0000-000000000000"*/ +/*#define PACKET_LIB_GET_ADAPTER_NETADDRESS(addr) IP4_ADDR((addr), 192,168,1,0)*/ +/*#define PACKET_LIB_QUIET*/ + +/* If these 2 are not defined, the corresponding config setting is used */ +/* #define USE_DHCP 0 */ +/* #define USE_AUTOIP 0 */ + +/* #define USE_PCAPIF 1 */ +#define LWIP_PORT_INIT_IPADDR(addr) IP4_ADDR((addr), 192,168,1,200) +#define LWIP_PORT_INIT_GW(addr) IP4_ADDR((addr), 192,168,1,1) +#define LWIP_PORT_INIT_NETMASK(addr) IP4_ADDR((addr), 255,255,255,0) + +/* remember to change this MAC address to suit your needs! + the last octet will be increased by netif->num for each netif */ +#define LWIP_MAC_ADDR_BASE {0x00,0x01,0x02,0x03,0x04,0x05} + +/* #define USE_SLIPIF 0 */ +/* #define SIO_USE_COMPORT 0 */ +#ifdef USE_SLIPIF +#if USE_SLIPIF +#define LWIP_PORT_INIT_SLIP1_IPADDR(addr) IP4_ADDR((addr), 192, 168, 2, 2) +#define LWIP_PORT_INIT_SLIP1_GW(addr) IP4_ADDR((addr), 192, 168, 2, 1) +#define LWIP_PORT_INIT_SLIP1_NETMASK(addr) IP4_ADDR((addr), 255, 255, 255, 0) +#if USE_SLIPIF > 1 +#define LWIP_PORT_INIT_SLIP2_IPADDR(addr) IP4_ADDR((addr), 192, 168, 2, 1) +#define LWIP_PORT_INIT_SLIP2_GW(addr) IP4_ADDR((addr), 0, 0, 0, 0) +#define LWIP_PORT_INIT_SLIP2_NETMASK(addr) IP4_ADDR((addr), 255, 255, 255, 0)*/ +#endif /* USE_SLIPIF > 1 */ +#endif /* USE_SLIPIF */ +#endif /* USE_SLIPIF */ + +/* configuration for applications */ + +#define LWIP_CHARGEN_APP 0 +#define LWIP_DNS_APP 0 +#define LWIP_HTTPD_APP 0 +/* Set this to 1 to use the netconn http server, + * otherwise the raw api server will be used. */ +/*#define LWIP_HTTPD_APP_NETCONN */ +#define LWIP_NETBIOS_APP 0 +#define LWIP_NETIO_APP 0 +#define LWIP_MDNS_APP 0 +#define LWIP_MQTT_APP 0 +#define LWIP_PING_APP 0 +#define LWIP_RTP_APP 0 +#define LWIP_SHELL_APP 0 +#define LWIP_SNMP_APP 0 +#define LWIP_SNTP_APP 0 +#define LWIP_SOCKET_EXAMPLES_APP 0 +#define LWIP_TCPECHO_APP 0 +/* Set this to 1 to use the netconn tcpecho server, + * otherwise the raw api server will be used. */ +/*#define LWIP_TCPECHO_APP_NETCONN */ +#define LWIP_TFTP_APP 0 +#define LWIP_UDPECHO_APP 0 +#define LWIP_LWIPERF_APP 0 + +/*#define USE_DHCP 1*/ +/*#define USE_AUTOIP 1*/ + +/* define this to your custom application-init function */ +/* #define LWIP_APP_INIT my_app_init() */ diff --git a/contrib/examples/example_app/lwipopts.h b/contrib/examples/example_app/lwipopts.h new file mode 100644 index 00000000..a1fec97c --- /dev/null +++ b/contrib/examples/example_app/lwipopts.h @@ -0,0 +1,329 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_LWIPOPTS_H +#define LWIP_LWIPOPTS_H + +#ifdef LWIP_OPTTEST_FILE +#include "lwipopts_test.h" +#else /* LWIP_OPTTEST_FILE */ + +#define LWIP_IPV4 1 +#define LWIP_IPV6 1 + +#define NO_SYS 0 +#define LWIP_SOCKET (NO_SYS==0) +#define LWIP_NETCONN (NO_SYS==0) +#define LWIP_NETIF_API (NO_SYS==0) + +#define LWIP_IGMP LWIP_IPV4 +#define LWIP_ICMP LWIP_IPV4 + +#define LWIP_SNMP LWIP_UDP +#define MIB2_STATS LWIP_SNMP +#ifdef LWIP_HAVE_MBEDTLS +#define LWIP_SNMP_V3 (LWIP_SNMP) +#endif + +#define LWIP_DNS LWIP_UDP +#define LWIP_MDNS_RESPONDER LWIP_UDP + +#define LWIP_NUM_NETIF_CLIENT_DATA (LWIP_MDNS_RESPONDER) + +#define LWIP_HAVE_LOOPIF 1 +#define LWIP_NETIF_LOOPBACK 1 +#define LWIP_LOOPBACK_MAX_PBUFS 10 + +#define TCP_LISTEN_BACKLOG 1 + +#define LWIP_COMPAT_SOCKETS 1 +#define LWIP_SO_RCVTIMEO 1 +#define LWIP_SO_RCVBUF 1 + +#define LWIP_TCPIP_CORE_LOCKING 1 + +#define LWIP_NETIF_LINK_CALLBACK 1 +#define LWIP_NETIF_STATUS_CALLBACK 1 +#define LWIP_NETIF_EXT_STATUS_CALLBACK 1 + +#ifdef LWIP_DEBUG + +#define LWIP_DBG_MIN_LEVEL 0 +#define PPP_DEBUG LWIP_DBG_OFF +#define MEM_DEBUG LWIP_DBG_OFF +#define MEMP_DEBUG LWIP_DBG_OFF +#define PBUF_DEBUG LWIP_DBG_OFF +#define API_LIB_DEBUG LWIP_DBG_OFF +#define API_MSG_DEBUG LWIP_DBG_OFF +#define TCPIP_DEBUG LWIP_DBG_OFF +#define NETIF_DEBUG LWIP_DBG_OFF +#define SOCKETS_DEBUG LWIP_DBG_OFF +#define DNS_DEBUG LWIP_DBG_OFF +#define AUTOIP_DEBUG LWIP_DBG_OFF +#define DHCP_DEBUG LWIP_DBG_OFF +#define IP_DEBUG LWIP_DBG_OFF +#define IP_REASS_DEBUG LWIP_DBG_OFF +#define ICMP_DEBUG LWIP_DBG_OFF +#define IGMP_DEBUG LWIP_DBG_OFF +#define UDP_DEBUG LWIP_DBG_OFF +#define TCP_DEBUG LWIP_DBG_OFF +#define TCP_INPUT_DEBUG LWIP_DBG_OFF +#define TCP_OUTPUT_DEBUG LWIP_DBG_OFF +#define TCP_RTO_DEBUG LWIP_DBG_OFF +#define TCP_CWND_DEBUG LWIP_DBG_OFF +#define TCP_WND_DEBUG LWIP_DBG_OFF +#define TCP_FR_DEBUG LWIP_DBG_OFF +#define TCP_QLEN_DEBUG LWIP_DBG_OFF +#define TCP_RST_DEBUG LWIP_DBG_OFF +#endif + +#define LWIP_DBG_TYPES_ON (LWIP_DBG_ON|LWIP_DBG_TRACE|LWIP_DBG_STATE|LWIP_DBG_FRESH|LWIP_DBG_HALT) + + +/* ---------- Memory options ---------- */ +/* MEM_ALIGNMENT: should be set to the alignment of the CPU for which + lwIP is compiled. 4 byte alignment -> define MEM_ALIGNMENT to 4, 2 + byte alignment -> define MEM_ALIGNMENT to 2. */ +/* MSVC port: intel processors don't need 4-byte alignment, + but are faster that way! */ +#define MEM_ALIGNMENT 4U + +/* MEM_SIZE: the size of the heap memory. If the application will send +a lot of data that needs to be copied, this should be set high. */ +#define MEM_SIZE 10240 + +/* MEMP_NUM_PBUF: the number of memp struct pbufs. If the application + sends a lot of data out of ROM (or other static memory), this + should be set high. */ +#define MEMP_NUM_PBUF 16 +/* MEMP_NUM_RAW_PCB: the number of UDP protocol control blocks. One + per active RAW "connection". */ +#define MEMP_NUM_RAW_PCB 3 +/* MEMP_NUM_UDP_PCB: the number of UDP protocol control blocks. One + per active UDP "connection". */ +#define MEMP_NUM_UDP_PCB 4 +/* MEMP_NUM_TCP_PCB: the number of simulatenously active TCP + connections. */ +#define MEMP_NUM_TCP_PCB 5 +/* MEMP_NUM_TCP_PCB_LISTEN: the number of listening TCP + connections. */ +#define MEMP_NUM_TCP_PCB_LISTEN 8 +/* MEMP_NUM_TCP_SEG: the number of simultaneously queued TCP + segments. */ +#define MEMP_NUM_TCP_SEG 16 +/* MEMP_NUM_SYS_TIMEOUT: the number of simulateously active + timeouts. */ +#define MEMP_NUM_SYS_TIMEOUT 17 + +/* The following four are used only with the sequential API and can be + set to 0 if the application only will use the raw API. */ +/* MEMP_NUM_NETBUF: the number of struct netbufs. */ +#define MEMP_NUM_NETBUF 2 +/* MEMP_NUM_NETCONN: the number of struct netconns. */ +#define MEMP_NUM_NETCONN 10 +/* MEMP_NUM_TCPIP_MSG_*: the number of struct tcpip_msg, which is used + for sequential API communication and incoming packets. Used in + src/api/tcpip.c. */ +#define MEMP_NUM_TCPIP_MSG_API 16 +#define MEMP_NUM_TCPIP_MSG_INPKT 16 + + +/* ---------- Pbuf options ---------- */ +/* PBUF_POOL_SIZE: the number of buffers in the pbuf pool. */ +#define PBUF_POOL_SIZE 120 + +/* PBUF_POOL_BUFSIZE: the size of each pbuf in the pbuf pool. */ +#define PBUF_POOL_BUFSIZE 256 + +/** SYS_LIGHTWEIGHT_PROT + * define SYS_LIGHTWEIGHT_PROT in lwipopts.h if you want inter-task protection + * for certain critical regions during buffer allocation, deallocation and memory + * allocation and deallocation. + */ +#define SYS_LIGHTWEIGHT_PROT (NO_SYS==0) + + +/* ---------- TCP options ---------- */ +#define LWIP_TCP 1 +#define TCP_TTL 255 + +#define LWIP_ALTCP (LWIP_TCP) +#ifdef LWIP_HAVE_MBEDTLS +#define LWIP_ALTCP_TLS (LWIP_TCP) +#define LWIP_ALTCP_TLS_MBEDTLS (LWIP_TCP) +#endif + + +/* Controls if TCP should queue segments that arrive out of + order. Define to 0 if your device is low on memory. */ +#define TCP_QUEUE_OOSEQ 1 + +/* TCP Maximum segment size. */ +#define TCP_MSS 1024 + +/* TCP sender buffer space (bytes). */ +#define TCP_SND_BUF 2048 + +/* TCP sender buffer space (pbufs). This must be at least = 2 * + TCP_SND_BUF/TCP_MSS for things to work. */ +#define TCP_SND_QUEUELEN (4 * TCP_SND_BUF/TCP_MSS) + +/* TCP writable space (bytes). This must be less than or equal + to TCP_SND_BUF. It is the amount of space which must be + available in the tcp snd_buf for select to return writable */ +#define TCP_SNDLOWAT (TCP_SND_BUF/2) + +/* TCP receive window. */ +#define TCP_WND (20 * 1024) + +/* Maximum number of retransmissions of data segments. */ +#define TCP_MAXRTX 12 + +/* Maximum number of retransmissions of SYN segments. */ +#define TCP_SYNMAXRTX 4 + + +/* ---------- ARP options ---------- */ +#define LWIP_ARP 1 +#define ARP_TABLE_SIZE 10 +#define ARP_QUEUEING 1 + + +/* ---------- IP options ---------- */ +/* Define IP_FORWARD to 1 if you wish to have the ability to forward + IP packets across network interfaces. If you are going to run lwIP + on a device with only one network interface, define this to 0. */ +#define IP_FORWARD 1 + +/* IP reassembly and segmentation.These are orthogonal even + * if they both deal with IP fragments */ +#define IP_REASSEMBLY 1 +#define IP_REASS_MAX_PBUFS (10 * ((1500 + PBUF_POOL_BUFSIZE - 1) / PBUF_POOL_BUFSIZE)) +#define MEMP_NUM_REASSDATA IP_REASS_MAX_PBUFS +#define IP_FRAG 1 +#define IPV6_FRAG_COPYHEADER 1 + +/* ---------- ICMP options ---------- */ +#define ICMP_TTL 255 + + +/* ---------- DHCP options ---------- */ +/* Define LWIP_DHCP to 1 if you want DHCP configuration of + interfaces. */ +#define LWIP_DHCP LWIP_UDP + +/* 1 if you want to do an ARP check on the offered address + (recommended). */ +#define DHCP_DOES_ARP_CHECK (LWIP_DHCP) + + +/* ---------- AUTOIP options ------- */ +#define LWIP_AUTOIP (LWIP_DHCP) +#define LWIP_DHCP_AUTOIP_COOP (LWIP_DHCP && LWIP_AUTOIP) + + +/* ---------- UDP options ---------- */ +#define LWIP_UDP 1 +#define LWIP_UDPLITE LWIP_UDP +#define UDP_TTL 255 + + +/* ---------- RAW options ---------- */ +#define LWIP_RAW 1 + + +/* ---------- Statistics options ---------- */ + +#define LWIP_STATS 1 +#define LWIP_STATS_DISPLAY 1 + +#if LWIP_STATS +#define LINK_STATS 1 +#define IP_STATS 1 +#define ICMP_STATS 1 +#define IGMP_STATS 1 +#define IPFRAG_STATS 1 +#define UDP_STATS 1 +#define TCP_STATS 1 +#define MEM_STATS 1 +#define MEMP_STATS 1 +#define PBUF_STATS 1 +#define SYS_STATS 1 +#endif /* LWIP_STATS */ + +/* ---------- NETBIOS options ---------- */ +#define LWIP_NETBIOS_RESPOND_NAME_QUERY 1 + +/* ---------- PPP options ---------- */ + +#define PPP_SUPPORT 1 /* Set > 0 for PPP */ + +#if PPP_SUPPORT + +#define NUM_PPP 1 /* Max PPP sessions. */ + + +/* Select modules to enable. Ideally these would be set in the makefile but + * we're limited by the command line length so you need to modify the settings + * in this file. + */ +#define PPPOE_SUPPORT 1 +#define PPPOS_SUPPORT 1 + +#define PAP_SUPPORT 1 /* Set > 0 for PAP. */ +#define CHAP_SUPPORT 1 /* Set > 0 for CHAP. */ +#define MSCHAP_SUPPORT 0 /* Set > 0 for MSCHAP */ +#define CBCP_SUPPORT 0 /* Set > 0 for CBCP (NOT FUNCTIONAL!) */ +#define CCP_SUPPORT 0 /* Set > 0 for CCP */ +#define VJ_SUPPORT 1 /* Set > 0 for VJ header compression. */ +#define MD5_SUPPORT 1 /* Set > 0 for MD5 (see also CHAP) */ + +#endif /* PPP_SUPPORT */ + +#endif /* LWIP_OPTTEST_FILE */ + +/* The following defines must be done even in OPTTEST mode: */ + +#if !defined(NO_SYS) || !NO_SYS /* default is 0 */ +void sys_check_core_locking(void); +#define LWIP_ASSERT_CORE_LOCKED() sys_check_core_locking() +void sys_mark_tcpip_thread(void); +#define LWIP_MARK_TCPIP_THREAD() sys_mark_tcpip_thread() + +#if !defined(LWIP_TCPIP_CORE_LOCKING) || LWIP_TCPIP_CORE_LOCKING /* default is 1 */ +void sys_lock_tcpip_core(void); +#define LOCK_TCPIP_CORE() sys_lock_tcpip_core() +void sys_unlock_tcpip_core(void); +#define UNLOCK_TCPIP_CORE() sys_unlock_tcpip_core() +#endif +#endif + +#endif /* LWIP_LWIPOPTS_H */ diff --git a/contrib/examples/example_app/lwippools.h b/contrib/examples/example_app/lwippools.h new file mode 100644 index 00000000..8fc2c923 --- /dev/null +++ b/contrib/examples/example_app/lwippools.h @@ -0,0 +1,20 @@ +/* OPTIONAL: Pools to replace heap allocation + * Optional: Pools can be used instead of the heap for mem_malloc. If + * so, these should be defined here, in increasing order according to + * the pool element size. + * + * LWIP_MALLOC_MEMPOOL(number_elements, element_size) + */ +#if MEM_USE_POOLS +LWIP_MALLOC_MEMPOOL_START +LWIP_MALLOC_MEMPOOL(100, 256) +LWIP_MALLOC_MEMPOOL(50, 512) +LWIP_MALLOC_MEMPOOL(20, 1024) +LWIP_MALLOC_MEMPOOL(20, 1536) +LWIP_MALLOC_MEMPOOL_END +#endif /* MEM_USE_POOLS */ + +/* Optional: Your custom pools can go here if you would like to use + * lwIP's memory pools for anything else. + */ +LWIP_MEMPOOL(SYS_MBOX, 22, 100, "SYS_MBOX") diff --git a/contrib/examples/example_app/ppp_settings.h b/contrib/examples/example_app/ppp_settings.h new file mode 100644 index 00000000..7b3ee1aa --- /dev/null +++ b/contrib/examples/example_app/ppp_settings.h @@ -0,0 +1,6 @@ +#ifdef _MSC_VER +#pragma warning (disable: 4242) /* PPP only: conversion from 'x' to 'y', possible loss of data */ +#pragma warning (disable: 4244) /* PPP only: conversion from 'x' to 'y', possible loss of data (again?) */ +#pragma warning (disable: 4310) /* PPP only: cast truncates constant value */ +#pragma warning (disable: 4706) /* PPP only: assignment within conditional expression */ +#endif /* MSC_VER */ diff --git a/contrib/examples/example_app/test.c b/contrib/examples/example_app/test.c new file mode 100644 index 00000000..ce34bdd2 --- /dev/null +++ b/contrib/examples/example_app/test.c @@ -0,0 +1,758 @@ +/* + * Copyright (c) 2001,2002 Florian Schulze. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of the authors nor the names of the contributors + * may be used to endorse or promote products derived from this software + * without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHORS AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHORS OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * test.c - This file is part of lwIP test + * + */ + +/* C runtime includes */ +#include +#include +#include +#include + +/* lwIP core includes */ +#include "lwip/opt.h" + +#include "lwip/sys.h" +#include "lwip/timeouts.h" +#include "lwip/debug.h" +#include "lwip/stats.h" +#include "lwip/init.h" +#include "lwip/tcpip.h" +#include "lwip/netif.h" +#include "lwip/api.h" + +#include "lwip/tcp.h" +#include "lwip/udp.h" +#include "lwip/dns.h" +#include "lwip/dhcp.h" +#include "lwip/autoip.h" + +/* lwIP netif includes */ +#include "lwip/etharp.h" +#include "netif/ethernet.h" + +/* applications includes */ +#include "lwip/apps/netbiosns.h" +#include "lwip/apps/httpd.h" +#include "apps/httpserver/httpserver-netconn.h" +#include "apps/netio/netio.h" +#include "apps/ping/ping.h" +#include "apps/rtp/rtp.h" +#include "apps/chargen/chargen.h" +#include "apps/shell/shell.h" +#include "apps/tcpecho/tcpecho.h" +#include "apps/udpecho/udpecho.h" +#include "apps/tcpecho_raw/tcpecho_raw.h" +#include "apps/socket_examples/socket_examples.h" + +#include "examples/lwiperf/lwiperf_example.h" +#include "examples/mdns/mdns_example.h" +#include "examples/snmp/snmp_example.h" +#include "examples/tftp/tftp_example.h" +#include "examples/sntp/sntp_example.h" +#include "examples/mqtt/mqtt_example.h" + +#include "examples/httpd/cgi_example/cgi_example.h" +#include "examples/httpd/fs_example/fs_example.h" +#include "examples/httpd/ssi_example/ssi_example.h" + +#include "default_netif.h" + +#if NO_SYS +/* ... then we need information about the timer intervals: */ +#include "lwip/ip4_frag.h" +#include "lwip/igmp.h" +#endif /* NO_SYS */ + +#include "netif/ppp/ppp_opts.h" +#if PPP_SUPPORT +/* PPP includes */ +#include "lwip/sio.h" +#include "netif/ppp/pppapi.h" +#include "netif/ppp/pppos.h" +#include "netif/ppp/pppoe.h" +#if !NO_SYS && !LWIP_PPP_API +#error With NO_SYS==0, LWIP_PPP_API==1 is required. +#endif +#endif /* PPP_SUPPORT */ + +/* include the port-dependent configuration */ +#include "lwipcfg.h" + +#ifndef LWIP_EXAMPLE_APP_ABORT +#define LWIP_EXAMPLE_APP_ABORT() 0 +#endif + +/** Define this to 1 to enable a port-specific ethernet interface as default interface. */ +#ifndef USE_DEFAULT_ETH_NETIF +#define USE_DEFAULT_ETH_NETIF 1 +#endif + +/** Define this to 1 to enable a PPP interface. */ +#ifndef USE_PPP +#define USE_PPP 0 +#endif + +/** Define this to 1 or 2 to support 1 or 2 SLIP interfaces. */ +#ifndef USE_SLIPIF +#define USE_SLIPIF 0 +#endif + +/** Use an ethernet adapter? Default to enabled if port-specific ethernet netif or PPPoE are used. */ +#ifndef USE_ETHERNET +#define USE_ETHERNET (USE_DEFAULT_ETH_NETIF || PPPOE_SUPPORT) +#endif + +/** Use an ethernet adapter for TCP/IP? By default only if port-specific ethernet netif is used. */ +#ifndef USE_ETHERNET_TCPIP +#define USE_ETHERNET_TCPIP (USE_DEFAULT_ETH_NETIF) +#endif + +#if USE_SLIPIF +#include +#endif /* USE_SLIPIF */ + +#ifndef USE_DHCP +#define USE_DHCP LWIP_DHCP +#endif +#ifndef USE_AUTOIP +#define USE_AUTOIP LWIP_AUTOIP +#endif + +/* globales variables for netifs */ +#if USE_ETHERNET +#if LWIP_DHCP +/* dhcp struct for the ethernet netif */ +struct dhcp netif_dhcp; +#endif /* LWIP_DHCP */ +#if LWIP_AUTOIP +/* autoip struct for the ethernet netif */ +struct autoip netif_autoip; +#endif /* LWIP_AUTOIP */ +#endif /* USE_ETHERNET */ +#if USE_PPP +/* THE PPP PCB */ +ppp_pcb *ppp; +/* THE PPP interface */ +struct netif ppp_netif; +/* THE PPP descriptor */ +u8_t sio_idx = 0; +sio_fd_t ppp_sio; +#endif /* USE_PPP */ +#if USE_SLIPIF +struct netif slipif1; +#if USE_SLIPIF > 1 +struct netif slipif2; +#endif /* USE_SLIPIF > 1 */ +#endif /* USE_SLIPIF */ + + +#if USE_PPP +static void +pppLinkStatusCallback(ppp_pcb *pcb, int errCode, void *ctx) +{ + struct netif *pppif = ppp_netif(pcb); + LWIP_UNUSED_ARG(ctx); + + switch(errCode) { + case PPPERR_NONE: { /* No error. */ + printf("pppLinkStatusCallback: PPPERR_NONE\n"); +#if LWIP_IPV4 + printf(" our_ipaddr = %s\n", ip4addr_ntoa(netif_ip4_addr(pppif))); + printf(" his_ipaddr = %s\n", ip4addr_ntoa(netif_ip4_gw(pppif))); + printf(" netmask = %s\n", ip4addr_ntoa(netif_ip4_netmask(pppif))); +#endif /* LWIP_IPV4 */ +#if LWIP_DNS + printf(" dns1 = %s\n", ipaddr_ntoa(dns_getserver(0))); + printf(" dns2 = %s\n", ipaddr_ntoa(dns_getserver(1))); +#endif /* LWIP_DNS */ +#if PPP_IPV6_SUPPORT + printf(" our6_ipaddr = %s\n", ip6addr_ntoa(netif_ip6_addr(pppif, 0))); +#endif /* PPP_IPV6_SUPPORT */ + break; + } + case PPPERR_PARAM: { /* Invalid parameter. */ + printf("pppLinkStatusCallback: PPPERR_PARAM\n"); + break; + } + case PPPERR_OPEN: { /* Unable to open PPP session. */ + printf("pppLinkStatusCallback: PPPERR_OPEN\n"); + break; + } + case PPPERR_DEVICE: { /* Invalid I/O device for PPP. */ + printf("pppLinkStatusCallback: PPPERR_DEVICE\n"); + break; + } + case PPPERR_ALLOC: { /* Unable to allocate resources. */ + printf("pppLinkStatusCallback: PPPERR_ALLOC\n"); + break; + } + case PPPERR_USER: { /* User interrupt. */ + printf("pppLinkStatusCallback: PPPERR_USER\n"); + break; + } + case PPPERR_CONNECT: { /* Connection lost. */ + printf("pppLinkStatusCallback: PPPERR_CONNECT\n"); + break; + } + case PPPERR_AUTHFAIL: { /* Failed authentication challenge. */ + printf("pppLinkStatusCallback: PPPERR_AUTHFAIL\n"); + break; + } + case PPPERR_PROTOCOL: { /* Failed to meet protocol. */ + printf("pppLinkStatusCallback: PPPERR_PROTOCOL\n"); + break; + } + case PPPERR_PEERDEAD: { /* Connection timeout */ + printf("pppLinkStatusCallback: PPPERR_PEERDEAD\n"); + break; + } + case PPPERR_IDLETIMEOUT: { /* Idle Timeout */ + printf("pppLinkStatusCallback: PPPERR_IDLETIMEOUT\n"); + break; + } + case PPPERR_CONNECTTIME: { /* Max connect time reached */ + printf("pppLinkStatusCallback: PPPERR_CONNECTTIME\n"); + break; + } + case PPPERR_LOOPBACK: { /* Loopback detected */ + printf("pppLinkStatusCallback: PPPERR_LOOPBACK\n"); + break; + } + default: { + printf("pppLinkStatusCallback: unknown errCode %d\n", errCode); + break; + } + } +} + +#if PPPOS_SUPPORT +static u32_t +ppp_output_cb(ppp_pcb *pcb, u8_t *data, u32_t len, void *ctx) +{ + LWIP_UNUSED_ARG(pcb); + LWIP_UNUSED_ARG(ctx); + return sio_write(ppp_sio, data, len); +} +#endif /* PPPOS_SUPPORT */ +#endif /* USE_PPP */ + +#if LWIP_NETIF_STATUS_CALLBACK +static void +status_callback(struct netif *state_netif) +{ + if (netif_is_up(state_netif)) { +#if LWIP_IPV4 + printf("status_callback==UP, local interface IP is %s\n", ip4addr_ntoa(netif_ip4_addr(state_netif))); +#else + printf("status_callback==UP\n"); +#endif + } else { + printf("status_callback==DOWN\n"); + } +} +#endif /* LWIP_NETIF_STATUS_CALLBACK */ + +#if LWIP_NETIF_LINK_CALLBACK +static void +link_callback(struct netif *state_netif) +{ + if (netif_is_link_up(state_netif)) { + printf("link_callback==UP\n"); + } else { + printf("link_callback==DOWN\n"); + } +} +#endif /* LWIP_NETIF_LINK_CALLBACK */ + +/* This function initializes all network interfaces */ +static void +test_netif_init(void) +{ +#if LWIP_IPV4 && USE_ETHERNET + ip4_addr_t ipaddr, netmask, gw; +#endif /* LWIP_IPV4 && USE_ETHERNET */ +#if USE_SLIPIF + u8_t num_slip1 = 0; +#if LWIP_IPV4 + ip4_addr_t ipaddr_slip1, netmask_slip1, gw_slip1; +#endif +#if USE_SLIPIF > 1 + u8_t num_slip2 = 1; +#if LWIP_IPV4 + ip4_addr_t ipaddr_slip2, netmask_slip2, gw_slip2; +#endif +#endif /* USE_SLIPIF > 1 */ +#endif /* USE_SLIPIF */ +#if USE_DHCP || USE_AUTOIP + err_t err; +#endif + +#if USE_PPP + const char *username = NULL, *password = NULL; +#ifdef PPP_USERNAME + username = PPP_USERNAME; +#endif +#ifdef PPP_PASSWORD + password = PPP_PASSWORD; +#endif + printf("ppp_connect: COM%d\n", (int)sio_idx); +#if PPPOS_SUPPORT + ppp_sio = sio_open(sio_idx); + if (ppp_sio == NULL) { + printf("sio_open error\n"); + } else { + ppp = pppos_create(&ppp_netif, ppp_output_cb, pppLinkStatusCallback, NULL); + if (ppp == NULL) { + printf("pppos_create error\n"); + } else { + ppp_set_auth(ppp, PPPAUTHTYPE_ANY, username, password); + ppp_connect(ppp, 0); + } + } +#endif /* PPPOS_SUPPORT */ +#endif /* USE_PPP */ + +#if USE_ETHERNET +#if LWIP_IPV4 + ip4_addr_set_zero(&gw); + ip4_addr_set_zero(&ipaddr); + ip4_addr_set_zero(&netmask); +#if USE_ETHERNET_TCPIP +#if USE_DHCP + printf("Starting lwIP, local interface IP is dhcp-enabled\n"); +#elif USE_AUTOIP + printf("Starting lwIP, local interface IP is autoip-enabled\n"); +#else /* USE_DHCP */ + LWIP_PORT_INIT_GW(&gw); + LWIP_PORT_INIT_IPADDR(&ipaddr); + LWIP_PORT_INIT_NETMASK(&netmask); + printf("Starting lwIP, local interface IP is %s\n", ip4addr_ntoa(&ipaddr)); +#endif /* USE_DHCP */ +#endif /* USE_ETHERNET_TCPIP */ +#else /* LWIP_IPV4 */ + printf("Starting lwIP, IPv4 disable\n"); +#endif /* LWIP_IPV4 */ + +#if LWIP_IPV4 + init_default_netif(&ipaddr, &netmask, &gw); +#else + init_default_netif(); +#endif +#if LWIP_IPV6 + netif_create_ip6_linklocal_address(netif_default, 1); +#if LWIP_IPV6_AUTOCONFIG + netif_default->ip6_autoconfig_enabled = 1; +#endif + printf("ip6 linklocal address: %s\n", ip6addr_ntoa(netif_ip6_addr(netif_default, 0))); +#endif /* LWIP_IPV6 */ +#if LWIP_NETIF_STATUS_CALLBACK + netif_set_status_callback(netif_default, status_callback); +#endif /* LWIP_NETIF_STATUS_CALLBACK */ +#if LWIP_NETIF_LINK_CALLBACK + netif_set_link_callback(netif_default, link_callback); +#endif /* LWIP_NETIF_LINK_CALLBACK */ + +#if USE_ETHERNET_TCPIP +#if LWIP_AUTOIP + autoip_set_struct(netif_default, &netif_autoip); +#endif /* LWIP_AUTOIP */ +#if LWIP_DHCP + dhcp_set_struct(netif_default, &netif_dhcp); +#endif /* LWIP_DHCP */ + netif_set_up(netif_default); +#if USE_DHCP + err = dhcp_start(netif_default); + LWIP_ASSERT("dhcp_start failed", err == ERR_OK); +#elif USE_AUTOIP + err = autoip_start(netif_default); + LWIP_ASSERT("autoip_start failed", err == ERR_OK); +#endif /* USE_DHCP */ +#else /* USE_ETHERNET_TCPIP */ + /* Use ethernet for PPPoE only */ + netif.flags &= ~(NETIF_FLAG_ETHARP | NETIF_FLAG_IGMP); /* no ARP */ + netif.flags |= NETIF_FLAG_ETHERNET; /* but pure ethernet */ +#endif /* USE_ETHERNET_TCPIP */ + +#if USE_PPP && PPPOE_SUPPORT + /* start PPPoE after ethernet netif is added! */ + ppp = pppoe_create(&ppp_netif, netif_default, NULL, NULL, pppLinkStatusCallback, NULL); + if (ppp == NULL) { + printf("pppoe_create error\n"); + } else { + ppp_set_auth(ppp, PPPAUTHTYPE_ANY, username, password); + ppp_connect(ppp, 0); + } +#endif /* USE_PPP && PPPOE_SUPPORT */ + +#endif /* USE_ETHERNET */ +#if USE_SLIPIF +#if LWIP_IPV4 +#define SLIP1_ADDRS &ipaddr_slip1, &netmask_slip1, &gw_slip1, + LWIP_PORT_INIT_SLIP1_IPADDR(&ipaddr_slip1); + LWIP_PORT_INIT_SLIP1_GW(&gw_slip1); + LWIP_PORT_INIT_SLIP1_NETMASK(&netmask_slip1); + printf("Starting lwIP slipif, local interface IP is %s\n", ip4addr_ntoa(&ipaddr_slip1)); +#else +#define SLIP1_ADDRS + printf("Starting lwIP slipif\n"); +#endif +#if defined(SIO_USE_COMPORT) && SIO_USE_COMPORT + num_slip1++; /* COM ports cannot be 0-based */ +#endif + netif_add(&slipif1, SLIP1_ADDRS &num_slip1, slipif_init, ip_input); +#if !USE_ETHERNET + netif_set_default(&slipif1); +#endif /* !USE_ETHERNET */ +#if LWIP_IPV6 + netif_create_ip6_linklocal_address(&slipif1, 1); + printf("SLIP ip6 linklocal address: %s\n", ip6addr_ntoa(netif_ip6_addr(&slipif1, 0))); +#endif /* LWIP_IPV6 */ +#if LWIP_NETIF_STATUS_CALLBACK + netif_set_status_callback(&slipif1, status_callback); +#endif /* LWIP_NETIF_STATUS_CALLBACK */ +#if LWIP_NETIF_LINK_CALLBACK + netif_set_link_callback(&slipif1, link_callback); +#endif /* LWIP_NETIF_LINK_CALLBACK */ + netif_set_up(&slipif1); + +#if USE_SLIPIF > 1 +#if LWIP_IPV4 +#define SLIP2_ADDRS &ipaddr_slip2, &netmask_slip2, &gw_slip2, + LWIP_PORT_INIT_SLIP2_IPADDR(&ipaddr_slip2); + LWIP_PORT_INIT_SLIP2_GW(&gw_slip2); + LWIP_PORT_INIT_SLIP2_NETMASK(&netmask_slip2); + printf("Starting lwIP SLIP if #2, local interface IP is %s\n", ip4addr_ntoa(&ipaddr_slip2)); +#else +#define SLIP2_ADDRS + printf("Starting lwIP SLIP if #2\n"); +#endif +#if defined(SIO_USE_COMPORT) && SIO_USE_COMPORT + num_slip2++; /* COM ports cannot be 0-based */ +#endif + netif_add(&slipif2, SLIP2_ADDRS &num_slip2, slipif_init, ip_input); +#if LWIP_IPV6 + netif_create_ip6_linklocal_address(&slipif1, 1); + printf("SLIP2 ip6 linklocal address: "); + ip6_addr_debug_print(0xFFFFFFFF & ~LWIP_DBG_HALT, netif_ip6_addr(&slipif2, 0)); + printf("\n"); +#endif /* LWIP_IPV6 */ +#if LWIP_NETIF_STATUS_CALLBACK + netif_set_status_callback(&slipif2, status_callback); +#endif /* LWIP_NETIF_STATUS_CALLBACK */ +#if LWIP_NETIF_LINK_CALLBACK + netif_set_link_callback(&slipif2, link_callback); +#endif /* LWIP_NETIF_LINK_CALLBACK */ + netif_set_up(&slipif2); +#endif /* USE_SLIPIF > 1*/ +#endif /* USE_SLIPIF */ +} + +#if LWIP_DNS_APP && LWIP_DNS +static void +dns_found(const char *name, const ip_addr_t *addr, void *arg) +{ + LWIP_UNUSED_ARG(arg); + printf("%s: %s\n", name, addr ? ipaddr_ntoa(addr) : ""); +} + +static void +dns_dorequest(void *arg) +{ + const char* dnsname = "3com.com"; + ip_addr_t dnsresp; + LWIP_UNUSED_ARG(arg); + + if (dns_gethostbyname(dnsname, &dnsresp, dns_found, 0) == ERR_OK) { + dns_found(dnsname, &dnsresp, 0); + } +} +#endif /* LWIP_DNS_APP && LWIP_DNS */ + +/* This function initializes applications */ +static void +apps_init(void) +{ +#if LWIP_DNS_APP && LWIP_DNS + /* wait until the netif is up (for dhcp, autoip or ppp) */ + sys_timeout(5000, dns_dorequest, NULL); +#endif /* LWIP_DNS_APP && LWIP_DNS */ + +#if LWIP_CHARGEN_APP && LWIP_SOCKET + chargen_init(); +#endif /* LWIP_CHARGEN_APP && LWIP_SOCKET */ + +#if LWIP_PING_APP && LWIP_RAW && LWIP_ICMP + ping_init(&netif_default->gw); +#endif /* LWIP_PING_APP && LWIP_RAW && LWIP_ICMP */ + +#if LWIP_NETBIOS_APP && LWIP_UDP + netbiosns_init(); +#ifndef NETBIOS_LWIP_NAME +#if LWIP_NETIF_HOSTNAME + netbiosns_set_name(netif_default->hostname); +#else + netbiosns_set_name("NETBIOSLWIPDEV"); +#endif +#endif +#endif /* LWIP_NETBIOS_APP && LWIP_UDP */ + +#if LWIP_HTTPD_APP && LWIP_TCP +#ifdef LWIP_HTTPD_APP_NETCONN + http_server_netconn_init(); +#else /* LWIP_HTTPD_APP_NETCONN */ +#if defined(LWIP_HTTPD_EXAMPLE_CUSTOMFILES) && LWIP_HTTPD_EXAMPLE_CUSTOMFILES && defined(LWIP_HTTPD_EXAMPLE_CUSTOMFILES_ROOTDIR) + fs_ex_init(LWIP_HTTPD_EXAMPLE_CUSTOMFILES_ROOTDIR); +#endif + httpd_init(); +#if defined(LWIP_HTTPD_EXAMPLE_SSI_SIMPLE) && LWIP_HTTPD_EXAMPLE_SSI_SIMPLE + ssi_ex_init(); +#endif +#if defined(LWIP_HTTPD_EXAMPLE_CGI_SIMPLE) && LWIP_HTTPD_EXAMPLE_CGI_SIMPLE + cgi_ex_init(); +#endif +#endif /* LWIP_HTTPD_APP_NETCONN */ +#endif /* LWIP_HTTPD_APP && LWIP_TCP */ + +#if LWIP_NETIO_APP && LWIP_TCP + netio_init(); +#endif /* LWIP_NETIO_APP && LWIP_TCP */ + +#if LWIP_RTP_APP && LWIP_SOCKET && LWIP_IGMP + rtp_init(); +#endif /* LWIP_RTP_APP && LWIP_SOCKET && LWIP_IGMP */ + +#if LWIP_SHELL_APP && LWIP_NETCONN + shell_init(); +#endif /* LWIP_SHELL_APP && LWIP_NETCONN */ +#if LWIP_TCPECHO_APP +#if LWIP_NETCONN && defined(LWIP_TCPECHO_APP_NETCONN) + tcpecho_init(); +#else /* LWIP_NETCONN && defined(LWIP_TCPECHO_APP_NETCONN) */ + tcpecho_raw_init(); +#endif +#endif /* LWIP_TCPECHO_APP && LWIP_NETCONN */ +#if LWIP_UDPECHO_APP && LWIP_NETCONN + udpecho_init(); +#endif /* LWIP_UDPECHO_APP && LWIP_NETCONN */ +#if LWIP_SOCKET_EXAMPLES_APP && LWIP_SOCKET + socket_examples_init(); +#endif /* LWIP_SOCKET_EXAMPLES_APP && LWIP_SOCKET */ +#if LWIP_MDNS_APP + mdns_example_init(); +#endif +#if LWIP_SNMP_APP + snmp_example_init(); +#endif +#if LWIP_SNTP_APP + sntp_example_init(); +#endif +#if LWIP_TFTP_APP + tftp_example_init(); +#endif +#if LWIP_LWIPERF_APP + lwiperf_example_init(); +#endif +#if LWIP_MQTT_APP + mqtt_example_init(); +#endif + +#ifdef LWIP_APP_INIT + LWIP_APP_INIT(); +#endif +} + +/* This function initializes this lwIP test. When NO_SYS=1, this is done in + * the main_loop context (there is no other one), when NO_SYS=0, this is done + * in the tcpip_thread context */ +static void +test_init(void * arg) +{ /* remove compiler warning */ +#if NO_SYS + LWIP_UNUSED_ARG(arg); +#else /* NO_SYS */ + sys_sem_t *init_sem; + LWIP_ASSERT("arg != NULL", arg != NULL); + init_sem = (sys_sem_t*)arg; +#endif /* NO_SYS */ + + /* init randomizer again (seed per thread) */ + srand((unsigned int)time(0)); + + /* init network interfaces */ + test_netif_init(); + + /* init apps */ + apps_init(); + +#if !NO_SYS + sys_sem_signal(init_sem); +#endif /* !NO_SYS */ +} + +/* This is somewhat different to other ports: we have a main loop here: + * a dedicated task that waits for packets to arrive. This would normally be + * done from interrupt context with embedded hardware, but we don't get an + * interrupt in windows for that :-) */ +static void +main_loop(void) +{ +#if !NO_SYS + err_t err; + sys_sem_t init_sem; +#endif /* NO_SYS */ +#if USE_PPP +#if !USE_ETHERNET + int count; + u8_t rxbuf[1024]; +#endif + volatile int callClosePpp = 0; +#endif /* USE_PPP */ + + /* initialize lwIP stack, network interfaces and applications */ +#if NO_SYS + lwip_init(); + test_init(NULL); +#else /* NO_SYS */ + err = sys_sem_new(&init_sem, 0); + LWIP_ASSERT("failed to create init_sem", err == ERR_OK); + LWIP_UNUSED_ARG(err); + tcpip_init(test_init, &init_sem); + /* we have to wait for initialization to finish before + * calling update_adapter()! */ + sys_sem_wait(&init_sem); + sys_sem_free(&init_sem); +#endif /* NO_SYS */ + +#if (LWIP_SOCKET || LWIP_NETCONN) && LWIP_NETCONN_SEM_PER_THREAD + netconn_thread_init(); +#endif + + /* MAIN LOOP for driver update (and timers if NO_SYS) */ + while (!LWIP_EXAMPLE_APP_ABORT()) { +#if NO_SYS + /* handle timers (already done in tcpip.c when NO_SYS=0) */ + sys_check_timeouts(); +#endif /* NO_SYS */ + +#if USE_ETHERNET + default_netif_poll(); +#else /* USE_ETHERNET */ + /* try to read characters from serial line and pass them to PPPoS */ + count = sio_read(ppp_sio, (u8_t*)rxbuf, 1024); + if(count > 0) { + pppos_input(ppp, rxbuf, count); + } else { + /* nothing received, give other tasks a chance to run */ + sys_msleep(1); + } + +#endif /* USE_ETHERNET */ +#if USE_SLIPIF + slipif_poll(&slipif1); +#if USE_SLIPIF > 1 + slipif_poll(&slipif2); +#endif /* USE_SLIPIF > 1 */ +#endif /* USE_SLIPIF */ +#if ENABLE_LOOPBACK && !LWIP_NETIF_LOOPBACK_MULTITHREADING + /* check for loopback packets on all netifs */ + netif_poll_all(); +#endif /* ENABLE_LOOPBACK && !LWIP_NETIF_LOOPBACK_MULTITHREADING */ +#if USE_PPP + { + int do_hup = 0; + if(do_hup) { + ppp_close(ppp, 1); + do_hup = 0; + } + } + if(callClosePpp && ppp) { + /* make sure to disconnect PPP before stopping the program... */ + callClosePpp = 0; +#if NO_SYS + ppp_close(ppp, 0); +#else + pppapi_close(ppp, 0); +#endif + ppp = NULL; + } +#endif /* USE_PPP */ + } + +#if USE_PPP + if(ppp) { + u32_t started; + printf("Closing PPP connection...\n"); + /* make sure to disconnect PPP before stopping the program... */ +#if NO_SYS + ppp_close(ppp, 0); +#else + pppapi_close(ppp, 0); +#endif + ppp = NULL; + /* Wait for some time to let PPP finish... */ + started = sys_now(); + do + { +#if USE_ETHERNET + default_netif_poll(); +#endif + /* @todo: need a better check here: only wait until PPP is down */ + } while(sys_now() - started < 5000); + } +#endif /* USE_PPP */ +#if (LWIP_SOCKET || LWIP_NETCONN) && LWIP_NETCONN_SEM_PER_THREAD + netconn_thread_cleanup(); +#endif +#if USE_ETHERNET + default_netif_shutdown(); +#endif /* USE_ETHERNET */ +} + +#if USE_PPP && PPPOS_SUPPORT +int main(int argc, char **argv) +#else /* USE_PPP && PPPOS_SUPPORT */ +int main(void) +#endif /* USE_PPP && PPPOS_SUPPORT */ +{ +#if USE_PPP && PPPOS_SUPPORT + if(argc > 1) { + sio_idx = (u8_t)atoi(argv[1]); + } + printf("Using serial port %d for PPP\n", sio_idx); +#endif /* USE_PPP && PPPOS_SUPPORT */ + /* no stdio-buffering, please! */ + setvbuf(stdout, NULL,_IONBF, 0); + + main_loop(); + + return 0; +} diff --git a/contrib/examples/example_app/test_configs/opt_default.h b/contrib/examples/example_app/test_configs/opt_default.h new file mode 100644 index 00000000..3012194e --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_default.h @@ -0,0 +1,296 @@ +/* test an lwipopts.h file with default contents */ +#define NO_SYS 0 +#define NO_SYS_NO_TIMERS 0 +#define LWIP_TIMERS 1 +#define LWIP_TIMERS_CUSTOM 0 +#define LWIP_MPU_COMPATIBLE 0 +#define LWIP_TCPIP_CORE_LOCKING 1 +#define LWIP_TCPIP_CORE_LOCKING_INPUT 0 +#define SYS_LIGHTWEIGHT_PROT 1 +#define MEM_LIBC_MALLOC 0 +#define MEMP_MEM_MALLOC 0 +#define MEMP_MEM_INIT 0 +#define MEM_ALIGNMENT 1 +#define MEM_SIZE 1600 +#define MEMP_OVERFLOW_CHECK 0 +#define MEMP_SANITY_CHECK 0 +#define MEM_OVERFLOW_CHECK 0 +#define MEM_SANITY_CHECK 0 +#define MEM_USE_POOLS 0 +#define MEM_USE_POOLS_TRY_BIGGER_POOL 0 +#define MEMP_USE_CUSTOM_POOLS 0 +#define LWIP_ALLOW_MEM_FREE_FROM_OTHER_CONTEXT 0 +/*#define MEMP_NUM_PBUF 16 +#define MEMP_NUM_RAW_PCB 4 +#define MEMP_NUM_UDP_PCB 4 +#define MEMP_NUM_TCP_PCB 5 +#define MEMP_NUM_TCP_PCB_LISTEN 8 +#define MEMP_NUM_TCP_SEG 16 +#define MEMP_NUM_ALTCP_PCB MEMP_NUM_TCP_PCB +#define MEMP_NUM_REASSDATA 5 +#define MEMP_NUM_FRAG_PBUF 15 +#define MEMP_NUM_ARP_QUEUE 30 +#define MEMP_NUM_IGMP_GROUP 8 +#define MEMP_NUM_SYS_TIMEOUT (LWIP_NUM_SYS_TIMEOUT_INTERNAL + 2) +#define MEMP_NUM_NETBUF 2 +#define MEMP_NUM_NETCONN 4 +#define MEMP_NUM_SELECT_CB 4 +#define MEMP_NUM_TCPIP_MSG_API 8 +#define MEMP_NUM_TCPIP_MSG_INPKT 8 +#define MEMP_NUM_NETDB 1 +#define MEMP_NUM_LOCALHOSTLIST 1 +#define PBUF_POOL_SIZE 16 +#define MEMP_NUM_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_DNS_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_SOCKET_SETGETSOCKOPT_DATA MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_NETIFAPI_MSG MEMP_NUM_TCPIP_MSG_API*/ +#define LWIP_ARP 1 +#define ARP_TABLE_SIZE 10 +#define ARP_MAXAGE 300 +#define ARP_QUEUEING 0 +#define ARP_QUEUE_LEN 3 +#define ETHARP_SUPPORT_VLAN 0 +#define LWIP_ETHERNET LWIP_ARP +#define ETH_PAD_SIZE 0 +#define ETHARP_SUPPORT_STATIC_ENTRIES 0 +#define ETHARP_TABLE_MATCH_NETIF !LWIP_SINGLE_NETIF +#define LWIP_IPV4 1 +#define IP_FORWARD 0 +#define IP_REASSEMBLY 1 +#define IP_FRAG 1 +#define IP_OPTIONS_ALLOWED 1 +#define IP_REASS_MAXAGE 15 +#define IP_REASS_MAX_PBUFS 10 +#define IP_DEFAULT_TTL 255 +#define IP_SOF_BROADCAST 0 +#define IP_SOF_BROADCAST_RECV 0 +#define IP_FORWARD_ALLOW_TX_ON_RX_NETIF 0 +#define LWIP_ICMP 1 +#define ICMP_TTL (IP_DEFAULT_TTL) +#define LWIP_BROADCAST_PING 0 +#define LWIP_MULTICAST_PING 0 +#define LWIP_RAW 0 +#define RAW_TTL (IP_DEFAULT_TTL) +#define LWIP_DHCP 0 +#define DHCP_DOES_ARP_CHECK ((LWIP_DHCP) && (LWIP_ARP)) +#define LWIP_DHCP_CHECK_LINK_UP 0 +#define LWIP_DHCP_BOOTP_FILE 0 +#define LWIP_DHCP_GET_NTP_SRV 0 +#define LWIP_DHCP_MAX_NTP_SERVERS 1 +#define LWIP_DHCP_MAX_DNS_SERVERS DNS_MAX_SERVERS +#define LWIP_AUTOIP 0 +#define LWIP_DHCP_AUTOIP_COOP 0 +#define LWIP_DHCP_AUTOIP_COOP_TRIES 9 +#define LWIP_MIB2_CALLBACKS 0 +#define LWIP_MULTICAST_TX_OPTIONS ((LWIP_IGMP || LWIP_IPV6_MLD) && (LWIP_UDP || LWIP_RAW)) +#define LWIP_IGMP 0 +#define LWIP_DNS 0 +#define DNS_TABLE_SIZE 4 +#define DNS_MAX_NAME_LENGTH 256 +#define DNS_MAX_SERVERS 2 +#define DNS_MAX_RETRIES 4 +#define DNS_DOES_NAME_CHECK 1 +#define LWIP_DNS_SECURE (LWIP_DNS_SECURE_RAND_XID | LWIP_DNS_SECURE_NO_MULTIPLE_OUTSTANDING | LWIP_DNS_SECURE_RAND_SRC_PORT) +#define DNS_LOCAL_HOSTLIST 0 +#define DNS_LOCAL_HOSTLIST_IS_DYNAMIC 0 +#define LWIP_DNS_SUPPORT_MDNS_QUERIES 0 +#define LWIP_UDP 1 +#define LWIP_UDPLITE 0 +#define UDP_TTL (IP_DEFAULT_TTL) +#define LWIP_NETBUF_RECVINFO 0 +#define LWIP_TCP 1 +#define TCP_TTL (IP_DEFAULT_TTL) +#define TCP_WND (4 * TCP_MSS) +#define TCP_MAXRTX 12 +#define TCP_SYNMAXRTX 6 +#define TCP_QUEUE_OOSEQ (LWIP_TCP) +#define LWIP_TCP_SACK_OUT 0 +#define LWIP_TCP_MAX_SACK_NUM 4 +#define TCP_MSS 536 +#define TCP_CALCULATE_EFF_SEND_MSS 1 +#define TCP_SND_BUF (2 * TCP_MSS) +#define TCP_SND_QUEUELEN ((4 * (TCP_SND_BUF) + (TCP_MSS - 1))/(TCP_MSS)) +#define TCP_SNDLOWAT LWIP_MIN(LWIP_MAX(((TCP_SND_BUF)/2), (2 * TCP_MSS) + 1), (TCP_SND_BUF) - 1) +#define TCP_SNDQUEUELOWAT LWIP_MAX(((TCP_SND_QUEUELEN)/2), 5) +#define TCP_OOSEQ_MAX_BYTES 0 +#define TCP_OOSEQ_BYTES_LIMIT(pcb) TCP_OOSEQ_MAX_BYTES +#define TCP_OOSEQ_MAX_PBUFS 0 +#define TCP_OOSEQ_PBUFS_LIMIT(pcb) TCP_OOSEQ_MAX_PBUFS +#define TCP_LISTEN_BACKLOG 0 +#define TCP_DEFAULT_LISTEN_BACKLOG 0xff +#define TCP_OVERSIZE TCP_MSS +#define LWIP_TCP_TIMESTAMPS 0 +#define TCP_WND_UPDATE_THRESHOLD LWIP_MIN((TCP_WND / 4), (TCP_MSS * 4)) +#define LWIP_EVENT_API 0 +#define LWIP_CALLBACK_API 1 +#define LWIP_WND_SCALE 0 +#define TCP_RCV_SCALE 0 +#define LWIP_TCP_PCB_NUM_EXT_ARGS 0 +#define LWIP_ALTCP 0 +#define LWIP_ALTCP_TLS 0 +#define PBUF_LINK_HLEN (14 + ETH_PAD_SIZE) +#define PBUF_LINK_ENCAPSULATION_HLEN 0 +#define PBUF_POOL_BUFSIZE LWIP_MEM_ALIGN_SIZE(TCP_MSS+40+PBUF_LINK_ENCAPSULATION_HLEN+PBUF_LINK_HLEN) +#define LWIP_PBUF_REF_T u8_t +#define LWIP_SINGLE_NETIF 0 +#define LWIP_NETIF_HOSTNAME 0 +#define LWIP_NETIF_API 0 +#define LWIP_NETIF_STATUS_CALLBACK 0 +#define LWIP_NETIF_EXT_STATUS_CALLBACK 0 +#define LWIP_NETIF_LINK_CALLBACK 0 +#define LWIP_NETIF_REMOVE_CALLBACK 0 +#define LWIP_NETIF_HWADDRHINT 0 +#define LWIP_NETIF_TX_SINGLE_PBUF 0 +#define LWIP_NUM_NETIF_CLIENT_DATA 0 +#define LWIP_HAVE_LOOPIF (LWIP_NETIF_LOOPBACK && !LWIP_SINGLE_NETIF) +#define LWIP_LOOPIF_MULTICAST 0 +#define LWIP_NETIF_LOOPBACK 0 +#define LWIP_LOOPBACK_MAX_PBUFS 0 +#define LWIP_NETIF_LOOPBACK_MULTITHREADING (!NO_SYS) +/*#define TCPIP_THREAD_NAME "tcpip_thread" +#define TCPIP_THREAD_STACKSIZE 0 +#define TCPIP_THREAD_PRIO 1 +#define TCPIP_MBOX_SIZE 0 +#define LWIP_TCPIP_THREAD_ALIVE() +#define SLIPIF_THREAD_NAME "slipif_loop" +#define SLIPIF_THREAD_STACKSIZE 0 +#define SLIPIF_THREAD_PRIO 1 +#define DEFAULT_THREAD_NAME "lwIP" +#define DEFAULT_THREAD_STACKSIZE 0 +#define DEFAULT_THREAD_PRIO 1 +#define DEFAULT_RAW_RECVMBOX_SIZE 0 +#define DEFAULT_UDP_RECVMBOX_SIZE 0 +#define DEFAULT_TCP_RECVMBOX_SIZE 0 +#define DEFAULT_ACCEPTMBOX_SIZE 0*/ +#define LWIP_NETCONN 1 +#define LWIP_TCPIP_TIMEOUT 0 +#define LWIP_NETCONN_SEM_PER_THREAD 0 +#define LWIP_NETCONN_FULLDUPLEX 0 +#define LWIP_SOCKET 1 +#define LWIP_COMPAT_SOCKETS 1 /* 0..2 */ +#define LWIP_POSIX_SOCKETS_IO_NAMES 1 +#define LWIP_SOCKET_OFFSET 0 +#define LWIP_TCP_KEEPALIVE 0 +#define LWIP_SO_SNDTIMEO 0 +#define LWIP_SO_RCVTIMEO 0 +#define LWIP_SO_SNDRCVTIMEO_NONSTANDARD 0 +#define LWIP_SO_RCVBUF 0 +#define LWIP_SO_LINGER 0 +#define RECV_BUFSIZE_DEFAULT INT_MAX +#define LWIP_TCP_CLOSE_TIMEOUT_MS_DEFAULT 20000 +#define SO_REUSE 0 +#define SO_REUSE_RXTOALL 0 +#define LWIP_FIONREAD_LINUXMODE 0 +#define LWIP_SOCKET_SELECT 1 +#define LWIP_SOCKET_POLL 1 +#define LWIP_STATS 1 +#define LWIP_STATS_DISPLAY 0 +#define LINK_STATS 1 +#define ETHARP_STATS (LWIP_ARP) +#define IP_STATS 1 +#define IPFRAG_STATS (IP_REASSEMBLY || IP_FRAG) +#define ICMP_STATS 1 +#define IGMP_STATS (LWIP_IGMP) +#define UDP_STATS (LWIP_UDP) +#define TCP_STATS (LWIP_TCP) +#define MEM_STATS ((MEM_LIBC_MALLOC == 0) && (MEM_USE_POOLS == 0)) +#define MEMP_STATS (MEMP_MEM_MALLOC == 0) +#define SYS_STATS (NO_SYS == 0) +#define IP6_STATS (LWIP_IPV6) +#define ICMP6_STATS (LWIP_IPV6 && LWIP_ICMP6) +#define IP6_FRAG_STATS (LWIP_IPV6 && (LWIP_IPV6_FRAG || LWIP_IPV6_REASS)) +#define MLD6_STATS (LWIP_IPV6 && LWIP_IPV6_MLD) +#define ND6_STATS (LWIP_IPV6) +#define MIB2_STATS 0 +#define LWIP_CHECKSUM_CTRL_PER_NETIF 0 +#define CHECKSUM_GEN_IP 1 +#define CHECKSUM_GEN_UDP 1 +#define CHECKSUM_GEN_TCP 1 +#define CHECKSUM_GEN_ICMP 1 +#define CHECKSUM_GEN_ICMP6 1 +#define CHECKSUM_CHECK_IP 1 +#define CHECKSUM_CHECK_UDP 1 +#define CHECKSUM_CHECK_TCP 1 +#define CHECKSUM_CHECK_ICMP 1 +#define CHECKSUM_CHECK_ICMP6 1 +#define LWIP_CHECKSUM_ON_COPY 0 +#define LWIP_IPV6 0 +#define IPV6_REASS_MAXAGE 60 +#define LWIP_IPV6_SCOPES (LWIP_IPV6 && !LWIP_SINGLE_NETIF) +#define LWIP_IPV6_SCOPES_DEBUG 0 +#define LWIP_IPV6_NUM_ADDRESSES 3 +#define LWIP_IPV6_FORWARD 0 +#define LWIP_IPV6_FRAG 1 +#define LWIP_IPV6_REASS (LWIP_IPV6) +#define LWIP_IPV6_SEND_ROUTER_SOLICIT 1 +#define LWIP_IPV6_AUTOCONFIG (LWIP_IPV6) +#define LWIP_IPV6_ADDRESS_LIFETIMES (LWIP_IPV6_AUTOCONFIG) +#define LWIP_IPV6_DUP_DETECT_ATTEMPTS 1 +#define LWIP_ICMP6 (LWIP_IPV6) +#define LWIP_ICMP6_DATASIZE 8 +#define LWIP_ICMP6_HL 255 +#define LWIP_IPV6_MLD (LWIP_IPV6) +#define MEMP_NUM_MLD6_GROUP 4 +#define LWIP_ND6_QUEUEING (LWIP_IPV6) +#define MEMP_NUM_ND6_QUEUE 20 +#define LWIP_ND6_NUM_NEIGHBORS 10 +#define LWIP_ND6_NUM_DESTINATIONS 10 +#define LWIP_ND6_NUM_PREFIXES 5 +#define LWIP_ND6_NUM_ROUTERS 3 +#define LWIP_ND6_MAX_MULTICAST_SOLICIT 3 +#define LWIP_ND6_MAX_UNICAST_SOLICIT 3 +#define LWIP_ND6_MAX_ANYCAST_DELAY_TIME 1000 +#define LWIP_ND6_MAX_NEIGHBOR_ADVERTISEMENT 3 +#define LWIP_ND6_REACHABLE_TIME 30000 +#define LWIP_ND6_RETRANS_TIMER 1000 +#define LWIP_ND6_DELAY_FIRST_PROBE_TIME 5000 +#define LWIP_ND6_ALLOW_RA_UPDATES 1 +#define LWIP_ND6_TCP_REACHABILITY_HINTS 1 +#define LWIP_ND6_RDNSS_MAX_DNS_SERVERS 0 +#define LWIP_IPV6_DHCP6 0 +#define LWIP_IPV6_DHCP6_STATEFUL 0 +#define LWIP_IPV6_DHCP6_STATELESS LWIP_IPV6_DHCP6 +#define LWIP_DHCP6_GET_NTP_SRV 0 +#define LWIP_DHCP6_MAX_NTP_SERVERS 1 +#define LWIP_DHCP6_MAX_DNS_SERVERS DNS_MAX_SERVERS + +/* TODO: check hooks */ + +#define LWIP_DBG_MIN_LEVEL LWIP_DBG_LEVEL_ALL +#define LWIP_DBG_TYPES_ON LWIP_DBG_ON +#define ETHARP_DEBUG LWIP_DBG_OFF +#define NETIF_DEBUG LWIP_DBG_OFF +#define PBUF_DEBUG LWIP_DBG_OFF +#define API_LIB_DEBUG LWIP_DBG_OFF +#define API_MSG_DEBUG LWIP_DBG_OFF +#define SOCKETS_DEBUG LWIP_DBG_OFF +#define ICMP_DEBUG LWIP_DBG_OFF +#define IGMP_DEBUG LWIP_DBG_OFF +#define INET_DEBUG LWIP_DBG_OFF +#define IP_DEBUG LWIP_DBG_OFF +#define IP_REASS_DEBUG LWIP_DBG_OFF +#define RAW_DEBUG LWIP_DBG_OFF +#define MEM_DEBUG LWIP_DBG_OFF +#define MEMP_DEBUG LWIP_DBG_OFF +#define SYS_DEBUG LWIP_DBG_OFF +#define TIMERS_DEBUG LWIP_DBG_OFF +#define TCP_DEBUG LWIP_DBG_OFF +#define TCP_INPUT_DEBUG LWIP_DBG_OFF +#define TCP_FR_DEBUG LWIP_DBG_OFF +#define TCP_RTO_DEBUG LWIP_DBG_OFF +#define TCP_CWND_DEBUG LWIP_DBG_OFF +#define TCP_WND_DEBUG LWIP_DBG_OFF +#define TCP_OUTPUT_DEBUG LWIP_DBG_OFF +#define TCP_RST_DEBUG LWIP_DBG_OFF +#define TCP_QLEN_DEBUG LWIP_DBG_OFF +#define UDP_DEBUG LWIP_DBG_OFF +#define TCPIP_DEBUG LWIP_DBG_OFF +#define SLIP_DEBUG LWIP_DBG_OFF +#define DHCP_DEBUG LWIP_DBG_OFF +#define AUTOIP_DEBUG LWIP_DBG_OFF +#define DNS_DEBUG LWIP_DBG_OFF +#define IP6_DEBUG LWIP_DBG_OFF +#define DHCP6_DEBUG LWIP_DBG_OFF +#define LWIP_TESTMODE 0 + +#define LWIP_PERF 0 diff --git a/contrib/examples/example_app/test_configs/opt_dualstack.h b/contrib/examples/example_app/test_configs/opt_dualstack.h new file mode 100644 index 00000000..59bda770 --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_dualstack.h @@ -0,0 +1,296 @@ +/* test an lwipopts.h file with default contents */ +#define NO_SYS 0 +#define NO_SYS_NO_TIMERS 0 +#define LWIP_TIMERS 1 +#define LWIP_TIMERS_CUSTOM 0 +#define LWIP_MPU_COMPATIBLE 0 +#define LWIP_TCPIP_CORE_LOCKING 1 +#define LWIP_TCPIP_CORE_LOCKING_INPUT 0 +#define SYS_LIGHTWEIGHT_PROT 1 +#define MEM_LIBC_MALLOC 0 +#define MEMP_MEM_MALLOC 0 +#define MEMP_MEM_INIT 0 +#define MEM_ALIGNMENT 1 +#define MEM_SIZE 1600 +#define MEMP_OVERFLOW_CHECK 0 +#define MEMP_SANITY_CHECK 0 +#define MEM_OVERFLOW_CHECK 0 +#define MEM_SANITY_CHECK 0 +#define MEM_USE_POOLS 0 +#define MEM_USE_POOLS_TRY_BIGGER_POOL 0 +#define MEMP_USE_CUSTOM_POOLS 0 +#define LWIP_ALLOW_MEM_FREE_FROM_OTHER_CONTEXT 0 +/*#define MEMP_NUM_PBUF 16 +#define MEMP_NUM_RAW_PCB 4 +#define MEMP_NUM_UDP_PCB 4 +#define MEMP_NUM_TCP_PCB 5 +#define MEMP_NUM_TCP_PCB_LISTEN 8 +#define MEMP_NUM_TCP_SEG 16 +#define MEMP_NUM_ALTCP_PCB MEMP_NUM_TCP_PCB +#define MEMP_NUM_REASSDATA 5 +#define MEMP_NUM_FRAG_PBUF 15 +#define MEMP_NUM_ARP_QUEUE 30 +#define MEMP_NUM_IGMP_GROUP 8 +#define MEMP_NUM_SYS_TIMEOUT (LWIP_NUM_SYS_TIMEOUT_INTERNAL + 2) +#define MEMP_NUM_NETBUF 2 +#define MEMP_NUM_NETCONN 4 +#define MEMP_NUM_SELECT_CB 4 +#define MEMP_NUM_TCPIP_MSG_API 8 +#define MEMP_NUM_TCPIP_MSG_INPKT 8 +#define MEMP_NUM_NETDB 1 +#define MEMP_NUM_LOCALHOSTLIST 1 +#define PBUF_POOL_SIZE 16 +#define MEMP_NUM_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_DNS_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_SOCKET_SETGETSOCKOPT_DATA MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_NETIFAPI_MSG MEMP_NUM_TCPIP_MSG_API*/ +#define LWIP_ARP 1 +#define ARP_TABLE_SIZE 10 +#define ARP_MAXAGE 300 +#define ARP_QUEUEING 0 +#define ARP_QUEUE_LEN 3 +#define ETHARP_SUPPORT_VLAN 0 +#define LWIP_ETHERNET LWIP_ARP +#define ETH_PAD_SIZE 0 +#define ETHARP_SUPPORT_STATIC_ENTRIES 0 +#define ETHARP_TABLE_MATCH_NETIF !LWIP_SINGLE_NETIF +#define LWIP_IPV4 1 +#define IP_FORWARD 0 +#define IP_REASSEMBLY 1 +#define IP_FRAG 1 +#define IP_OPTIONS_ALLOWED 1 +#define IP_REASS_MAXAGE 15 +#define IP_REASS_MAX_PBUFS 10 +#define IP_DEFAULT_TTL 255 +#define IP_SOF_BROADCAST 0 +#define IP_SOF_BROADCAST_RECV 0 +#define IP_FORWARD_ALLOW_TX_ON_RX_NETIF 0 +#define LWIP_ICMP 1 +#define ICMP_TTL (IP_DEFAULT_TTL) +#define LWIP_BROADCAST_PING 0 +#define LWIP_MULTICAST_PING 0 +#define LWIP_RAW 0 +#define RAW_TTL (IP_DEFAULT_TTL) +#define LWIP_DHCP 0 +#define DHCP_DOES_ARP_CHECK ((LWIP_DHCP) && (LWIP_ARP)) +#define LWIP_DHCP_CHECK_LINK_UP 0 +#define LWIP_DHCP_BOOTP_FILE 0 +#define LWIP_DHCP_GET_NTP_SRV 0 +#define LWIP_DHCP_MAX_NTP_SERVERS 1 +#define LWIP_DHCP_MAX_DNS_SERVERS DNS_MAX_SERVERS +#define LWIP_AUTOIP 0 +#define LWIP_DHCP_AUTOIP_COOP 0 +#define LWIP_DHCP_AUTOIP_COOP_TRIES 9 +#define LWIP_MIB2_CALLBACKS 0 +#define LWIP_MULTICAST_TX_OPTIONS ((LWIP_IGMP || LWIP_IPV6_MLD) && (LWIP_UDP || LWIP_RAW)) +#define LWIP_IGMP 0 +#define LWIP_DNS 0 +#define DNS_TABLE_SIZE 4 +#define DNS_MAX_NAME_LENGTH 256 +#define DNS_MAX_SERVERS 2 +#define DNS_MAX_RETRIES 4 +#define DNS_DOES_NAME_CHECK 1 +#define LWIP_DNS_SECURE (LWIP_DNS_SECURE_RAND_XID | LWIP_DNS_SECURE_NO_MULTIPLE_OUTSTANDING | LWIP_DNS_SECURE_RAND_SRC_PORT) +#define DNS_LOCAL_HOSTLIST 0 +#define DNS_LOCAL_HOSTLIST_IS_DYNAMIC 0 +#define LWIP_DNS_SUPPORT_MDNS_QUERIES 0 +#define LWIP_UDP 1 +#define LWIP_UDPLITE 0 +#define UDP_TTL (IP_DEFAULT_TTL) +#define LWIP_NETBUF_RECVINFO 0 +#define LWIP_TCP 1 +#define TCP_TTL (IP_DEFAULT_TTL) +#define TCP_WND (4 * TCP_MSS) +#define TCP_MAXRTX 12 +#define TCP_SYNMAXRTX 6 +#define TCP_QUEUE_OOSEQ (LWIP_TCP) +#define LWIP_TCP_SACK_OUT 0 +#define LWIP_TCP_MAX_SACK_NUM 4 +#define TCP_MSS 536 +#define TCP_CALCULATE_EFF_SEND_MSS 1 +#define TCP_SND_BUF (2 * TCP_MSS) +#define TCP_SND_QUEUELEN ((4 * (TCP_SND_BUF) + (TCP_MSS - 1))/(TCP_MSS)) +#define TCP_SNDLOWAT LWIP_MIN(LWIP_MAX(((TCP_SND_BUF)/2), (2 * TCP_MSS) + 1), (TCP_SND_BUF) - 1) +#define TCP_SNDQUEUELOWAT LWIP_MAX(((TCP_SND_QUEUELEN)/2), 5) +#define TCP_OOSEQ_MAX_BYTES 0 +#define TCP_OOSEQ_BYTES_LIMIT(pcb) TCP_OOSEQ_MAX_BYTES +#define TCP_OOSEQ_MAX_PBUFS 0 +#define TCP_OOSEQ_PBUFS_LIMIT(pcb) TCP_OOSEQ_MAX_PBUFS +#define TCP_LISTEN_BACKLOG 0 +#define TCP_DEFAULT_LISTEN_BACKLOG 0xff +#define TCP_OVERSIZE TCP_MSS +#define LWIP_TCP_TIMESTAMPS 0 +#define TCP_WND_UPDATE_THRESHOLD LWIP_MIN((TCP_WND / 4), (TCP_MSS * 4)) +#define LWIP_EVENT_API 0 +#define LWIP_CALLBACK_API 1 +#define LWIP_WND_SCALE 0 +#define TCP_RCV_SCALE 0 +#define LWIP_TCP_PCB_NUM_EXT_ARGS 0 +#define LWIP_ALTCP 0 +#define LWIP_ALTCP_TLS 0 +#define PBUF_LINK_HLEN (14 + ETH_PAD_SIZE) +#define PBUF_LINK_ENCAPSULATION_HLEN 0 +#define PBUF_POOL_BUFSIZE LWIP_MEM_ALIGN_SIZE(TCP_MSS+40+PBUF_LINK_ENCAPSULATION_HLEN+PBUF_LINK_HLEN) +#define LWIP_PBUF_REF_T u8_t +#define LWIP_SINGLE_NETIF 0 +#define LWIP_NETIF_HOSTNAME 0 +#define LWIP_NETIF_API 0 +#define LWIP_NETIF_STATUS_CALLBACK 0 +#define LWIP_NETIF_EXT_STATUS_CALLBACK 0 +#define LWIP_NETIF_LINK_CALLBACK 0 +#define LWIP_NETIF_REMOVE_CALLBACK 0 +#define LWIP_NETIF_HWADDRHINT 0 +#define LWIP_NETIF_TX_SINGLE_PBUF 0 +#define LWIP_NUM_NETIF_CLIENT_DATA 0 +#define LWIP_HAVE_LOOPIF (LWIP_NETIF_LOOPBACK && !LWIP_SINGLE_NETIF) +#define LWIP_LOOPIF_MULTICAST 0 +#define LWIP_NETIF_LOOPBACK 0 +#define LWIP_LOOPBACK_MAX_PBUFS 0 +#define LWIP_NETIF_LOOPBACK_MULTITHREADING (!NO_SYS) +/*#define TCPIP_THREAD_NAME "tcpip_thread" +#define TCPIP_THREAD_STACKSIZE 0 +#define TCPIP_THREAD_PRIO 1 +#define TCPIP_MBOX_SIZE 0 +#define LWIP_TCPIP_THREAD_ALIVE() +#define SLIPIF_THREAD_NAME "slipif_loop" +#define SLIPIF_THREAD_STACKSIZE 0 +#define SLIPIF_THREAD_PRIO 1 +#define DEFAULT_THREAD_NAME "lwIP" +#define DEFAULT_THREAD_STACKSIZE 0 +#define DEFAULT_THREAD_PRIO 1 +#define DEFAULT_RAW_RECVMBOX_SIZE 0 +#define DEFAULT_UDP_RECVMBOX_SIZE 0 +#define DEFAULT_TCP_RECVMBOX_SIZE 0 +#define DEFAULT_ACCEPTMBOX_SIZE 0*/ +#define LWIP_NETCONN 1 +#define LWIP_TCPIP_TIMEOUT 0 +#define LWIP_NETCONN_SEM_PER_THREAD 0 +#define LWIP_NETCONN_FULLDUPLEX 0 +#define LWIP_SOCKET 1 +#define LWIP_COMPAT_SOCKETS 1 /* 0..2 */ +#define LWIP_POSIX_SOCKETS_IO_NAMES 1 +#define LWIP_SOCKET_OFFSET 0 +#define LWIP_TCP_KEEPALIVE 0 +#define LWIP_SO_SNDTIMEO 0 +#define LWIP_SO_RCVTIMEO 0 +#define LWIP_SO_SNDRCVTIMEO_NONSTANDARD 0 +#define LWIP_SO_RCVBUF 0 +#define LWIP_SO_LINGER 0 +#define RECV_BUFSIZE_DEFAULT INT_MAX +#define LWIP_TCP_CLOSE_TIMEOUT_MS_DEFAULT 20000 +#define SO_REUSE 0 +#define SO_REUSE_RXTOALL 0 +#define LWIP_FIONREAD_LINUXMODE 0 +#define LWIP_SOCKET_SELECT 1 +#define LWIP_SOCKET_POLL 1 +#define LWIP_STATS 1 +#define LWIP_STATS_DISPLAY 0 +#define LINK_STATS 1 +#define ETHARP_STATS (LWIP_ARP) +#define IP_STATS 1 +#define IPFRAG_STATS (IP_REASSEMBLY || IP_FRAG) +#define ICMP_STATS 1 +#define IGMP_STATS (LWIP_IGMP) +#define UDP_STATS (LWIP_UDP) +#define TCP_STATS (LWIP_TCP) +#define MEM_STATS ((MEM_LIBC_MALLOC == 0) && (MEM_USE_POOLS == 0)) +#define MEMP_STATS (MEMP_MEM_MALLOC == 0) +#define SYS_STATS (NO_SYS == 0) +#define IP6_STATS (LWIP_IPV6) +#define ICMP6_STATS (LWIP_IPV6 && LWIP_ICMP6) +#define IP6_FRAG_STATS (LWIP_IPV6 && (LWIP_IPV6_FRAG || LWIP_IPV6_REASS)) +#define MLD6_STATS (LWIP_IPV6 && LWIP_IPV6_MLD) +#define ND6_STATS (LWIP_IPV6) +#define MIB2_STATS 0 +#define LWIP_CHECKSUM_CTRL_PER_NETIF 0 +#define CHECKSUM_GEN_IP 1 +#define CHECKSUM_GEN_UDP 1 +#define CHECKSUM_GEN_TCP 1 +#define CHECKSUM_GEN_ICMP 1 +#define CHECKSUM_GEN_ICMP6 1 +#define CHECKSUM_CHECK_IP 1 +#define CHECKSUM_CHECK_UDP 1 +#define CHECKSUM_CHECK_TCP 1 +#define CHECKSUM_CHECK_ICMP 1 +#define CHECKSUM_CHECK_ICMP6 1 +#define LWIP_CHECKSUM_ON_COPY 0 +#define LWIP_IPV6 1 +#define IPV6_REASS_MAXAGE 60 +#define LWIP_IPV6_SCOPES (LWIP_IPV6 && !LWIP_SINGLE_NETIF) +#define LWIP_IPV6_SCOPES_DEBUG 0 +#define LWIP_IPV6_NUM_ADDRESSES 3 +#define LWIP_IPV6_FORWARD 0 +#define LWIP_IPV6_FRAG 1 +#define LWIP_IPV6_REASS (LWIP_IPV6) +#define LWIP_IPV6_SEND_ROUTER_SOLICIT 1 +#define LWIP_IPV6_AUTOCONFIG (LWIP_IPV6) +#define LWIP_IPV6_ADDRESS_LIFETIMES (LWIP_IPV6_AUTOCONFIG) +#define LWIP_IPV6_DUP_DETECT_ATTEMPTS 1 +#define LWIP_ICMP6 (LWIP_IPV6) +#define LWIP_ICMP6_DATASIZE 8 +#define LWIP_ICMP6_HL 255 +#define LWIP_IPV6_MLD (LWIP_IPV6) +#define MEMP_NUM_MLD6_GROUP 4 +#define LWIP_ND6_QUEUEING (LWIP_IPV6) +#define MEMP_NUM_ND6_QUEUE 20 +#define LWIP_ND6_NUM_NEIGHBORS 10 +#define LWIP_ND6_NUM_DESTINATIONS 10 +#define LWIP_ND6_NUM_PREFIXES 5 +#define LWIP_ND6_NUM_ROUTERS 3 +#define LWIP_ND6_MAX_MULTICAST_SOLICIT 3 +#define LWIP_ND6_MAX_UNICAST_SOLICIT 3 +#define LWIP_ND6_MAX_ANYCAST_DELAY_TIME 1000 +#define LWIP_ND6_MAX_NEIGHBOR_ADVERTISEMENT 3 +#define LWIP_ND6_REACHABLE_TIME 30000 +#define LWIP_ND6_RETRANS_TIMER 1000 +#define LWIP_ND6_DELAY_FIRST_PROBE_TIME 5000 +#define LWIP_ND6_ALLOW_RA_UPDATES 1 +#define LWIP_ND6_TCP_REACHABILITY_HINTS 1 +#define LWIP_ND6_RDNSS_MAX_DNS_SERVERS 0 +#define LWIP_IPV6_DHCP6 0 +#define LWIP_IPV6_DHCP6_STATEFUL 0 +#define LWIP_IPV6_DHCP6_STATELESS LWIP_IPV6_DHCP6 +#define LWIP_DHCP6_GET_NTP_SRV 0 +#define LWIP_DHCP6_MAX_NTP_SERVERS 1 +#define LWIP_DHCP6_MAX_DNS_SERVERS DNS_MAX_SERVERS + +/* TODO: check hooks */ + +#define LWIP_DBG_MIN_LEVEL LWIP_DBG_LEVEL_ALL +#define LWIP_DBG_TYPES_ON LWIP_DBG_ON +#define ETHARP_DEBUG LWIP_DBG_OFF +#define NETIF_DEBUG LWIP_DBG_OFF +#define PBUF_DEBUG LWIP_DBG_OFF +#define API_LIB_DEBUG LWIP_DBG_OFF +#define API_MSG_DEBUG LWIP_DBG_OFF +#define SOCKETS_DEBUG LWIP_DBG_OFF +#define ICMP_DEBUG LWIP_DBG_OFF +#define IGMP_DEBUG LWIP_DBG_OFF +#define INET_DEBUG LWIP_DBG_OFF +#define IP_DEBUG LWIP_DBG_OFF +#define IP_REASS_DEBUG LWIP_DBG_OFF +#define RAW_DEBUG LWIP_DBG_OFF +#define MEM_DEBUG LWIP_DBG_OFF +#define MEMP_DEBUG LWIP_DBG_OFF +#define SYS_DEBUG LWIP_DBG_OFF +#define TIMERS_DEBUG LWIP_DBG_OFF +#define TCP_DEBUG LWIP_DBG_OFF +#define TCP_INPUT_DEBUG LWIP_DBG_OFF +#define TCP_FR_DEBUG LWIP_DBG_OFF +#define TCP_RTO_DEBUG LWIP_DBG_OFF +#define TCP_CWND_DEBUG LWIP_DBG_OFF +#define TCP_WND_DEBUG LWIP_DBG_OFF +#define TCP_OUTPUT_DEBUG LWIP_DBG_OFF +#define TCP_RST_DEBUG LWIP_DBG_OFF +#define TCP_QLEN_DEBUG LWIP_DBG_OFF +#define UDP_DEBUG LWIP_DBG_OFF +#define TCPIP_DEBUG LWIP_DBG_OFF +#define SLIP_DEBUG LWIP_DBG_OFF +#define DHCP_DEBUG LWIP_DBG_OFF +#define AUTOIP_DEBUG LWIP_DBG_OFF +#define DNS_DEBUG LWIP_DBG_OFF +#define IP6_DEBUG LWIP_DBG_OFF +#define DHCP6_DEBUG LWIP_DBG_OFF +#define LWIP_TESTMODE 0 + +#define LWIP_PERF 0 diff --git a/contrib/examples/example_app/test_configs/opt_ipv4only.h b/contrib/examples/example_app/test_configs/opt_ipv4only.h new file mode 100644 index 00000000..3012194e --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_ipv4only.h @@ -0,0 +1,296 @@ +/* test an lwipopts.h file with default contents */ +#define NO_SYS 0 +#define NO_SYS_NO_TIMERS 0 +#define LWIP_TIMERS 1 +#define LWIP_TIMERS_CUSTOM 0 +#define LWIP_MPU_COMPATIBLE 0 +#define LWIP_TCPIP_CORE_LOCKING 1 +#define LWIP_TCPIP_CORE_LOCKING_INPUT 0 +#define SYS_LIGHTWEIGHT_PROT 1 +#define MEM_LIBC_MALLOC 0 +#define MEMP_MEM_MALLOC 0 +#define MEMP_MEM_INIT 0 +#define MEM_ALIGNMENT 1 +#define MEM_SIZE 1600 +#define MEMP_OVERFLOW_CHECK 0 +#define MEMP_SANITY_CHECK 0 +#define MEM_OVERFLOW_CHECK 0 +#define MEM_SANITY_CHECK 0 +#define MEM_USE_POOLS 0 +#define MEM_USE_POOLS_TRY_BIGGER_POOL 0 +#define MEMP_USE_CUSTOM_POOLS 0 +#define LWIP_ALLOW_MEM_FREE_FROM_OTHER_CONTEXT 0 +/*#define MEMP_NUM_PBUF 16 +#define MEMP_NUM_RAW_PCB 4 +#define MEMP_NUM_UDP_PCB 4 +#define MEMP_NUM_TCP_PCB 5 +#define MEMP_NUM_TCP_PCB_LISTEN 8 +#define MEMP_NUM_TCP_SEG 16 +#define MEMP_NUM_ALTCP_PCB MEMP_NUM_TCP_PCB +#define MEMP_NUM_REASSDATA 5 +#define MEMP_NUM_FRAG_PBUF 15 +#define MEMP_NUM_ARP_QUEUE 30 +#define MEMP_NUM_IGMP_GROUP 8 +#define MEMP_NUM_SYS_TIMEOUT (LWIP_NUM_SYS_TIMEOUT_INTERNAL + 2) +#define MEMP_NUM_NETBUF 2 +#define MEMP_NUM_NETCONN 4 +#define MEMP_NUM_SELECT_CB 4 +#define MEMP_NUM_TCPIP_MSG_API 8 +#define MEMP_NUM_TCPIP_MSG_INPKT 8 +#define MEMP_NUM_NETDB 1 +#define MEMP_NUM_LOCALHOSTLIST 1 +#define PBUF_POOL_SIZE 16 +#define MEMP_NUM_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_DNS_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_SOCKET_SETGETSOCKOPT_DATA MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_NETIFAPI_MSG MEMP_NUM_TCPIP_MSG_API*/ +#define LWIP_ARP 1 +#define ARP_TABLE_SIZE 10 +#define ARP_MAXAGE 300 +#define ARP_QUEUEING 0 +#define ARP_QUEUE_LEN 3 +#define ETHARP_SUPPORT_VLAN 0 +#define LWIP_ETHERNET LWIP_ARP +#define ETH_PAD_SIZE 0 +#define ETHARP_SUPPORT_STATIC_ENTRIES 0 +#define ETHARP_TABLE_MATCH_NETIF !LWIP_SINGLE_NETIF +#define LWIP_IPV4 1 +#define IP_FORWARD 0 +#define IP_REASSEMBLY 1 +#define IP_FRAG 1 +#define IP_OPTIONS_ALLOWED 1 +#define IP_REASS_MAXAGE 15 +#define IP_REASS_MAX_PBUFS 10 +#define IP_DEFAULT_TTL 255 +#define IP_SOF_BROADCAST 0 +#define IP_SOF_BROADCAST_RECV 0 +#define IP_FORWARD_ALLOW_TX_ON_RX_NETIF 0 +#define LWIP_ICMP 1 +#define ICMP_TTL (IP_DEFAULT_TTL) +#define LWIP_BROADCAST_PING 0 +#define LWIP_MULTICAST_PING 0 +#define LWIP_RAW 0 +#define RAW_TTL (IP_DEFAULT_TTL) +#define LWIP_DHCP 0 +#define DHCP_DOES_ARP_CHECK ((LWIP_DHCP) && (LWIP_ARP)) +#define LWIP_DHCP_CHECK_LINK_UP 0 +#define LWIP_DHCP_BOOTP_FILE 0 +#define LWIP_DHCP_GET_NTP_SRV 0 +#define LWIP_DHCP_MAX_NTP_SERVERS 1 +#define LWIP_DHCP_MAX_DNS_SERVERS DNS_MAX_SERVERS +#define LWIP_AUTOIP 0 +#define LWIP_DHCP_AUTOIP_COOP 0 +#define LWIP_DHCP_AUTOIP_COOP_TRIES 9 +#define LWIP_MIB2_CALLBACKS 0 +#define LWIP_MULTICAST_TX_OPTIONS ((LWIP_IGMP || LWIP_IPV6_MLD) && (LWIP_UDP || LWIP_RAW)) +#define LWIP_IGMP 0 +#define LWIP_DNS 0 +#define DNS_TABLE_SIZE 4 +#define DNS_MAX_NAME_LENGTH 256 +#define DNS_MAX_SERVERS 2 +#define DNS_MAX_RETRIES 4 +#define DNS_DOES_NAME_CHECK 1 +#define LWIP_DNS_SECURE (LWIP_DNS_SECURE_RAND_XID | LWIP_DNS_SECURE_NO_MULTIPLE_OUTSTANDING | LWIP_DNS_SECURE_RAND_SRC_PORT) +#define DNS_LOCAL_HOSTLIST 0 +#define DNS_LOCAL_HOSTLIST_IS_DYNAMIC 0 +#define LWIP_DNS_SUPPORT_MDNS_QUERIES 0 +#define LWIP_UDP 1 +#define LWIP_UDPLITE 0 +#define UDP_TTL (IP_DEFAULT_TTL) +#define LWIP_NETBUF_RECVINFO 0 +#define LWIP_TCP 1 +#define TCP_TTL (IP_DEFAULT_TTL) +#define TCP_WND (4 * TCP_MSS) +#define TCP_MAXRTX 12 +#define TCP_SYNMAXRTX 6 +#define TCP_QUEUE_OOSEQ (LWIP_TCP) +#define LWIP_TCP_SACK_OUT 0 +#define LWIP_TCP_MAX_SACK_NUM 4 +#define TCP_MSS 536 +#define TCP_CALCULATE_EFF_SEND_MSS 1 +#define TCP_SND_BUF (2 * TCP_MSS) +#define TCP_SND_QUEUELEN ((4 * (TCP_SND_BUF) + (TCP_MSS - 1))/(TCP_MSS)) +#define TCP_SNDLOWAT LWIP_MIN(LWIP_MAX(((TCP_SND_BUF)/2), (2 * TCP_MSS) + 1), (TCP_SND_BUF) - 1) +#define TCP_SNDQUEUELOWAT LWIP_MAX(((TCP_SND_QUEUELEN)/2), 5) +#define TCP_OOSEQ_MAX_BYTES 0 +#define TCP_OOSEQ_BYTES_LIMIT(pcb) TCP_OOSEQ_MAX_BYTES +#define TCP_OOSEQ_MAX_PBUFS 0 +#define TCP_OOSEQ_PBUFS_LIMIT(pcb) TCP_OOSEQ_MAX_PBUFS +#define TCP_LISTEN_BACKLOG 0 +#define TCP_DEFAULT_LISTEN_BACKLOG 0xff +#define TCP_OVERSIZE TCP_MSS +#define LWIP_TCP_TIMESTAMPS 0 +#define TCP_WND_UPDATE_THRESHOLD LWIP_MIN((TCP_WND / 4), (TCP_MSS * 4)) +#define LWIP_EVENT_API 0 +#define LWIP_CALLBACK_API 1 +#define LWIP_WND_SCALE 0 +#define TCP_RCV_SCALE 0 +#define LWIP_TCP_PCB_NUM_EXT_ARGS 0 +#define LWIP_ALTCP 0 +#define LWIP_ALTCP_TLS 0 +#define PBUF_LINK_HLEN (14 + ETH_PAD_SIZE) +#define PBUF_LINK_ENCAPSULATION_HLEN 0 +#define PBUF_POOL_BUFSIZE LWIP_MEM_ALIGN_SIZE(TCP_MSS+40+PBUF_LINK_ENCAPSULATION_HLEN+PBUF_LINK_HLEN) +#define LWIP_PBUF_REF_T u8_t +#define LWIP_SINGLE_NETIF 0 +#define LWIP_NETIF_HOSTNAME 0 +#define LWIP_NETIF_API 0 +#define LWIP_NETIF_STATUS_CALLBACK 0 +#define LWIP_NETIF_EXT_STATUS_CALLBACK 0 +#define LWIP_NETIF_LINK_CALLBACK 0 +#define LWIP_NETIF_REMOVE_CALLBACK 0 +#define LWIP_NETIF_HWADDRHINT 0 +#define LWIP_NETIF_TX_SINGLE_PBUF 0 +#define LWIP_NUM_NETIF_CLIENT_DATA 0 +#define LWIP_HAVE_LOOPIF (LWIP_NETIF_LOOPBACK && !LWIP_SINGLE_NETIF) +#define LWIP_LOOPIF_MULTICAST 0 +#define LWIP_NETIF_LOOPBACK 0 +#define LWIP_LOOPBACK_MAX_PBUFS 0 +#define LWIP_NETIF_LOOPBACK_MULTITHREADING (!NO_SYS) +/*#define TCPIP_THREAD_NAME "tcpip_thread" +#define TCPIP_THREAD_STACKSIZE 0 +#define TCPIP_THREAD_PRIO 1 +#define TCPIP_MBOX_SIZE 0 +#define LWIP_TCPIP_THREAD_ALIVE() +#define SLIPIF_THREAD_NAME "slipif_loop" +#define SLIPIF_THREAD_STACKSIZE 0 +#define SLIPIF_THREAD_PRIO 1 +#define DEFAULT_THREAD_NAME "lwIP" +#define DEFAULT_THREAD_STACKSIZE 0 +#define DEFAULT_THREAD_PRIO 1 +#define DEFAULT_RAW_RECVMBOX_SIZE 0 +#define DEFAULT_UDP_RECVMBOX_SIZE 0 +#define DEFAULT_TCP_RECVMBOX_SIZE 0 +#define DEFAULT_ACCEPTMBOX_SIZE 0*/ +#define LWIP_NETCONN 1 +#define LWIP_TCPIP_TIMEOUT 0 +#define LWIP_NETCONN_SEM_PER_THREAD 0 +#define LWIP_NETCONN_FULLDUPLEX 0 +#define LWIP_SOCKET 1 +#define LWIP_COMPAT_SOCKETS 1 /* 0..2 */ +#define LWIP_POSIX_SOCKETS_IO_NAMES 1 +#define LWIP_SOCKET_OFFSET 0 +#define LWIP_TCP_KEEPALIVE 0 +#define LWIP_SO_SNDTIMEO 0 +#define LWIP_SO_RCVTIMEO 0 +#define LWIP_SO_SNDRCVTIMEO_NONSTANDARD 0 +#define LWIP_SO_RCVBUF 0 +#define LWIP_SO_LINGER 0 +#define RECV_BUFSIZE_DEFAULT INT_MAX +#define LWIP_TCP_CLOSE_TIMEOUT_MS_DEFAULT 20000 +#define SO_REUSE 0 +#define SO_REUSE_RXTOALL 0 +#define LWIP_FIONREAD_LINUXMODE 0 +#define LWIP_SOCKET_SELECT 1 +#define LWIP_SOCKET_POLL 1 +#define LWIP_STATS 1 +#define LWIP_STATS_DISPLAY 0 +#define LINK_STATS 1 +#define ETHARP_STATS (LWIP_ARP) +#define IP_STATS 1 +#define IPFRAG_STATS (IP_REASSEMBLY || IP_FRAG) +#define ICMP_STATS 1 +#define IGMP_STATS (LWIP_IGMP) +#define UDP_STATS (LWIP_UDP) +#define TCP_STATS (LWIP_TCP) +#define MEM_STATS ((MEM_LIBC_MALLOC == 0) && (MEM_USE_POOLS == 0)) +#define MEMP_STATS (MEMP_MEM_MALLOC == 0) +#define SYS_STATS (NO_SYS == 0) +#define IP6_STATS (LWIP_IPV6) +#define ICMP6_STATS (LWIP_IPV6 && LWIP_ICMP6) +#define IP6_FRAG_STATS (LWIP_IPV6 && (LWIP_IPV6_FRAG || LWIP_IPV6_REASS)) +#define MLD6_STATS (LWIP_IPV6 && LWIP_IPV6_MLD) +#define ND6_STATS (LWIP_IPV6) +#define MIB2_STATS 0 +#define LWIP_CHECKSUM_CTRL_PER_NETIF 0 +#define CHECKSUM_GEN_IP 1 +#define CHECKSUM_GEN_UDP 1 +#define CHECKSUM_GEN_TCP 1 +#define CHECKSUM_GEN_ICMP 1 +#define CHECKSUM_GEN_ICMP6 1 +#define CHECKSUM_CHECK_IP 1 +#define CHECKSUM_CHECK_UDP 1 +#define CHECKSUM_CHECK_TCP 1 +#define CHECKSUM_CHECK_ICMP 1 +#define CHECKSUM_CHECK_ICMP6 1 +#define LWIP_CHECKSUM_ON_COPY 0 +#define LWIP_IPV6 0 +#define IPV6_REASS_MAXAGE 60 +#define LWIP_IPV6_SCOPES (LWIP_IPV6 && !LWIP_SINGLE_NETIF) +#define LWIP_IPV6_SCOPES_DEBUG 0 +#define LWIP_IPV6_NUM_ADDRESSES 3 +#define LWIP_IPV6_FORWARD 0 +#define LWIP_IPV6_FRAG 1 +#define LWIP_IPV6_REASS (LWIP_IPV6) +#define LWIP_IPV6_SEND_ROUTER_SOLICIT 1 +#define LWIP_IPV6_AUTOCONFIG (LWIP_IPV6) +#define LWIP_IPV6_ADDRESS_LIFETIMES (LWIP_IPV6_AUTOCONFIG) +#define LWIP_IPV6_DUP_DETECT_ATTEMPTS 1 +#define LWIP_ICMP6 (LWIP_IPV6) +#define LWIP_ICMP6_DATASIZE 8 +#define LWIP_ICMP6_HL 255 +#define LWIP_IPV6_MLD (LWIP_IPV6) +#define MEMP_NUM_MLD6_GROUP 4 +#define LWIP_ND6_QUEUEING (LWIP_IPV6) +#define MEMP_NUM_ND6_QUEUE 20 +#define LWIP_ND6_NUM_NEIGHBORS 10 +#define LWIP_ND6_NUM_DESTINATIONS 10 +#define LWIP_ND6_NUM_PREFIXES 5 +#define LWIP_ND6_NUM_ROUTERS 3 +#define LWIP_ND6_MAX_MULTICAST_SOLICIT 3 +#define LWIP_ND6_MAX_UNICAST_SOLICIT 3 +#define LWIP_ND6_MAX_ANYCAST_DELAY_TIME 1000 +#define LWIP_ND6_MAX_NEIGHBOR_ADVERTISEMENT 3 +#define LWIP_ND6_REACHABLE_TIME 30000 +#define LWIP_ND6_RETRANS_TIMER 1000 +#define LWIP_ND6_DELAY_FIRST_PROBE_TIME 5000 +#define LWIP_ND6_ALLOW_RA_UPDATES 1 +#define LWIP_ND6_TCP_REACHABILITY_HINTS 1 +#define LWIP_ND6_RDNSS_MAX_DNS_SERVERS 0 +#define LWIP_IPV6_DHCP6 0 +#define LWIP_IPV6_DHCP6_STATEFUL 0 +#define LWIP_IPV6_DHCP6_STATELESS LWIP_IPV6_DHCP6 +#define LWIP_DHCP6_GET_NTP_SRV 0 +#define LWIP_DHCP6_MAX_NTP_SERVERS 1 +#define LWIP_DHCP6_MAX_DNS_SERVERS DNS_MAX_SERVERS + +/* TODO: check hooks */ + +#define LWIP_DBG_MIN_LEVEL LWIP_DBG_LEVEL_ALL +#define LWIP_DBG_TYPES_ON LWIP_DBG_ON +#define ETHARP_DEBUG LWIP_DBG_OFF +#define NETIF_DEBUG LWIP_DBG_OFF +#define PBUF_DEBUG LWIP_DBG_OFF +#define API_LIB_DEBUG LWIP_DBG_OFF +#define API_MSG_DEBUG LWIP_DBG_OFF +#define SOCKETS_DEBUG LWIP_DBG_OFF +#define ICMP_DEBUG LWIP_DBG_OFF +#define IGMP_DEBUG LWIP_DBG_OFF +#define INET_DEBUG LWIP_DBG_OFF +#define IP_DEBUG LWIP_DBG_OFF +#define IP_REASS_DEBUG LWIP_DBG_OFF +#define RAW_DEBUG LWIP_DBG_OFF +#define MEM_DEBUG LWIP_DBG_OFF +#define MEMP_DEBUG LWIP_DBG_OFF +#define SYS_DEBUG LWIP_DBG_OFF +#define TIMERS_DEBUG LWIP_DBG_OFF +#define TCP_DEBUG LWIP_DBG_OFF +#define TCP_INPUT_DEBUG LWIP_DBG_OFF +#define TCP_FR_DEBUG LWIP_DBG_OFF +#define TCP_RTO_DEBUG LWIP_DBG_OFF +#define TCP_CWND_DEBUG LWIP_DBG_OFF +#define TCP_WND_DEBUG LWIP_DBG_OFF +#define TCP_OUTPUT_DEBUG LWIP_DBG_OFF +#define TCP_RST_DEBUG LWIP_DBG_OFF +#define TCP_QLEN_DEBUG LWIP_DBG_OFF +#define UDP_DEBUG LWIP_DBG_OFF +#define TCPIP_DEBUG LWIP_DBG_OFF +#define SLIP_DEBUG LWIP_DBG_OFF +#define DHCP_DEBUG LWIP_DBG_OFF +#define AUTOIP_DEBUG LWIP_DBG_OFF +#define DNS_DEBUG LWIP_DBG_OFF +#define IP6_DEBUG LWIP_DBG_OFF +#define DHCP6_DEBUG LWIP_DBG_OFF +#define LWIP_TESTMODE 0 + +#define LWIP_PERF 0 diff --git a/contrib/examples/example_app/test_configs/opt_ipv6only.h b/contrib/examples/example_app/test_configs/opt_ipv6only.h new file mode 100644 index 00000000..0047a5ec --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_ipv6only.h @@ -0,0 +1,296 @@ +/* test an lwipopts.h file with default contents */ +#define NO_SYS 0 +#define NO_SYS_NO_TIMERS 0 +#define LWIP_TIMERS 1 +#define LWIP_TIMERS_CUSTOM 0 +#define LWIP_MPU_COMPATIBLE 0 +#define LWIP_TCPIP_CORE_LOCKING 1 +#define LWIP_TCPIP_CORE_LOCKING_INPUT 0 +#define SYS_LIGHTWEIGHT_PROT 1 +#define MEM_LIBC_MALLOC 0 +#define MEMP_MEM_MALLOC 0 +#define MEMP_MEM_INIT 0 +#define MEM_ALIGNMENT 1 +#define MEM_SIZE 1600 +#define MEMP_OVERFLOW_CHECK 0 +#define MEMP_SANITY_CHECK 0 +#define MEM_OVERFLOW_CHECK 0 +#define MEM_SANITY_CHECK 0 +#define MEM_USE_POOLS 0 +#define MEM_USE_POOLS_TRY_BIGGER_POOL 0 +#define MEMP_USE_CUSTOM_POOLS 0 +#define LWIP_ALLOW_MEM_FREE_FROM_OTHER_CONTEXT 0 +/*#define MEMP_NUM_PBUF 16 +#define MEMP_NUM_RAW_PCB 4 +#define MEMP_NUM_UDP_PCB 4 +#define MEMP_NUM_TCP_PCB 5 +#define MEMP_NUM_TCP_PCB_LISTEN 8 +#define MEMP_NUM_TCP_SEG 16 +#define MEMP_NUM_ALTCP_PCB MEMP_NUM_TCP_PCB +#define MEMP_NUM_REASSDATA 5 +#define MEMP_NUM_FRAG_PBUF 15 +#define MEMP_NUM_ARP_QUEUE 30 +#define MEMP_NUM_IGMP_GROUP 8 +#define MEMP_NUM_SYS_TIMEOUT (LWIP_NUM_SYS_TIMEOUT_INTERNAL + 2) +#define MEMP_NUM_NETBUF 2 +#define MEMP_NUM_NETCONN 4 +#define MEMP_NUM_SELECT_CB 4 +#define MEMP_NUM_TCPIP_MSG_API 8 +#define MEMP_NUM_TCPIP_MSG_INPKT 8 +#define MEMP_NUM_NETDB 1 +#define MEMP_NUM_LOCALHOSTLIST 1 +#define PBUF_POOL_SIZE 16 +#define MEMP_NUM_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_DNS_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_SOCKET_SETGETSOCKOPT_DATA MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_NETIFAPI_MSG MEMP_NUM_TCPIP_MSG_API*/ +#define LWIP_ARP 1 +#define ARP_TABLE_SIZE 10 +#define ARP_MAXAGE 300 +#define ARP_QUEUEING 0 +#define ARP_QUEUE_LEN 3 +#define ETHARP_SUPPORT_VLAN 0 +#define LWIP_ETHERNET LWIP_ARP +#define ETH_PAD_SIZE 0 +#define ETHARP_SUPPORT_STATIC_ENTRIES 0 +#define ETHARP_TABLE_MATCH_NETIF !LWIP_SINGLE_NETIF +#define LWIP_IPV4 0 +#define IP_FORWARD 0 +#define IP_REASSEMBLY 1 +#define IP_FRAG 1 +#define IP_OPTIONS_ALLOWED 1 +#define IP_REASS_MAXAGE 15 +#define IP_REASS_MAX_PBUFS 10 +#define IP_DEFAULT_TTL 255 +#define IP_SOF_BROADCAST 0 +#define IP_SOF_BROADCAST_RECV 0 +#define IP_FORWARD_ALLOW_TX_ON_RX_NETIF 0 +#define LWIP_ICMP 1 +#define ICMP_TTL (IP_DEFAULT_TTL) +#define LWIP_BROADCAST_PING 0 +#define LWIP_MULTICAST_PING 0 +#define LWIP_RAW 0 +#define RAW_TTL (IP_DEFAULT_TTL) +#define LWIP_DHCP 0 +#define DHCP_DOES_ARP_CHECK ((LWIP_DHCP) && (LWIP_ARP)) +#define LWIP_DHCP_CHECK_LINK_UP 0 +#define LWIP_DHCP_BOOTP_FILE 0 +#define LWIP_DHCP_GET_NTP_SRV 0 +#define LWIP_DHCP_MAX_NTP_SERVERS 1 +#define LWIP_DHCP_MAX_DNS_SERVERS DNS_MAX_SERVERS +#define LWIP_AUTOIP 0 +#define LWIP_DHCP_AUTOIP_COOP 0 +#define LWIP_DHCP_AUTOIP_COOP_TRIES 9 +#define LWIP_MIB2_CALLBACKS 0 +#define LWIP_MULTICAST_TX_OPTIONS ((LWIP_IGMP || LWIP_IPV6_MLD) && (LWIP_UDP || LWIP_RAW)) +#define LWIP_IGMP 0 +#define LWIP_DNS 0 +#define DNS_TABLE_SIZE 4 +#define DNS_MAX_NAME_LENGTH 256 +#define DNS_MAX_SERVERS 2 +#define DNS_MAX_RETRIES 4 +#define DNS_DOES_NAME_CHECK 1 +#define LWIP_DNS_SECURE (LWIP_DNS_SECURE_RAND_XID | LWIP_DNS_SECURE_NO_MULTIPLE_OUTSTANDING | LWIP_DNS_SECURE_RAND_SRC_PORT) +#define DNS_LOCAL_HOSTLIST 0 +#define DNS_LOCAL_HOSTLIST_IS_DYNAMIC 0 +#define LWIP_DNS_SUPPORT_MDNS_QUERIES 0 +#define LWIP_UDP 1 +#define LWIP_UDPLITE 0 +#define UDP_TTL (IP_DEFAULT_TTL) +#define LWIP_NETBUF_RECVINFO 0 +#define LWIP_TCP 1 +#define TCP_TTL (IP_DEFAULT_TTL) +#define TCP_WND (4 * TCP_MSS) +#define TCP_MAXRTX 12 +#define TCP_SYNMAXRTX 6 +#define TCP_QUEUE_OOSEQ (LWIP_TCP) +#define LWIP_TCP_SACK_OUT 0 +#define LWIP_TCP_MAX_SACK_NUM 4 +#define TCP_MSS 536 +#define TCP_CALCULATE_EFF_SEND_MSS 1 +#define TCP_SND_BUF (2 * TCP_MSS) +#define TCP_SND_QUEUELEN ((4 * (TCP_SND_BUF) + (TCP_MSS - 1))/(TCP_MSS)) +#define TCP_SNDLOWAT LWIP_MIN(LWIP_MAX(((TCP_SND_BUF)/2), (2 * TCP_MSS) + 1), (TCP_SND_BUF) - 1) +#define TCP_SNDQUEUELOWAT LWIP_MAX(((TCP_SND_QUEUELEN)/2), 5) +#define TCP_OOSEQ_MAX_BYTES 0 +#define TCP_OOSEQ_BYTES_LIMIT(pcb) TCP_OOSEQ_MAX_BYTES +#define TCP_OOSEQ_MAX_PBUFS 0 +#define TCP_OOSEQ_PBUFS_LIMIT(pcb) TCP_OOSEQ_MAX_PBUFS +#define TCP_LISTEN_BACKLOG 0 +#define TCP_DEFAULT_LISTEN_BACKLOG 0xff +#define TCP_OVERSIZE TCP_MSS +#define LWIP_TCP_TIMESTAMPS 0 +#define TCP_WND_UPDATE_THRESHOLD LWIP_MIN((TCP_WND / 4), (TCP_MSS * 4)) +#define LWIP_EVENT_API 0 +#define LWIP_CALLBACK_API 1 +#define LWIP_WND_SCALE 0 +#define TCP_RCV_SCALE 0 +#define LWIP_TCP_PCB_NUM_EXT_ARGS 0 +#define LWIP_ALTCP 0 +#define LWIP_ALTCP_TLS 0 +#define PBUF_LINK_HLEN (14 + ETH_PAD_SIZE) +#define PBUF_LINK_ENCAPSULATION_HLEN 0 +#define PBUF_POOL_BUFSIZE LWIP_MEM_ALIGN_SIZE(TCP_MSS+40+PBUF_LINK_ENCAPSULATION_HLEN+PBUF_LINK_HLEN) +#define LWIP_PBUF_REF_T u8_t +#define LWIP_SINGLE_NETIF 0 +#define LWIP_NETIF_HOSTNAME 0 +#define LWIP_NETIF_API 0 +#define LWIP_NETIF_STATUS_CALLBACK 0 +#define LWIP_NETIF_EXT_STATUS_CALLBACK 0 +#define LWIP_NETIF_LINK_CALLBACK 0 +#define LWIP_NETIF_REMOVE_CALLBACK 0 +#define LWIP_NETIF_HWADDRHINT 0 +#define LWIP_NETIF_TX_SINGLE_PBUF 0 +#define LWIP_NUM_NETIF_CLIENT_DATA 0 +#define LWIP_HAVE_LOOPIF (LWIP_NETIF_LOOPBACK && !LWIP_SINGLE_NETIF) +#define LWIP_LOOPIF_MULTICAST 0 +#define LWIP_NETIF_LOOPBACK 0 +#define LWIP_LOOPBACK_MAX_PBUFS 0 +#define LWIP_NETIF_LOOPBACK_MULTITHREADING (!NO_SYS) +/*#define TCPIP_THREAD_NAME "tcpip_thread" +#define TCPIP_THREAD_STACKSIZE 0 +#define TCPIP_THREAD_PRIO 1 +#define TCPIP_MBOX_SIZE 0 +#define LWIP_TCPIP_THREAD_ALIVE() +#define SLIPIF_THREAD_NAME "slipif_loop" +#define SLIPIF_THREAD_STACKSIZE 0 +#define SLIPIF_THREAD_PRIO 1 +#define DEFAULT_THREAD_NAME "lwIP" +#define DEFAULT_THREAD_STACKSIZE 0 +#define DEFAULT_THREAD_PRIO 1 +#define DEFAULT_RAW_RECVMBOX_SIZE 0 +#define DEFAULT_UDP_RECVMBOX_SIZE 0 +#define DEFAULT_TCP_RECVMBOX_SIZE 0 +#define DEFAULT_ACCEPTMBOX_SIZE 0*/ +#define LWIP_NETCONN 1 +#define LWIP_TCPIP_TIMEOUT 0 +#define LWIP_NETCONN_SEM_PER_THREAD 0 +#define LWIP_NETCONN_FULLDUPLEX 0 +#define LWIP_SOCKET 1 +#define LWIP_COMPAT_SOCKETS 1 /* 0..2 */ +#define LWIP_POSIX_SOCKETS_IO_NAMES 1 +#define LWIP_SOCKET_OFFSET 0 +#define LWIP_TCP_KEEPALIVE 0 +#define LWIP_SO_SNDTIMEO 0 +#define LWIP_SO_RCVTIMEO 0 +#define LWIP_SO_SNDRCVTIMEO_NONSTANDARD 0 +#define LWIP_SO_RCVBUF 0 +#define LWIP_SO_LINGER 0 +#define RECV_BUFSIZE_DEFAULT INT_MAX +#define LWIP_TCP_CLOSE_TIMEOUT_MS_DEFAULT 20000 +#define SO_REUSE 0 +#define SO_REUSE_RXTOALL 0 +#define LWIP_FIONREAD_LINUXMODE 0 +#define LWIP_SOCKET_SELECT 1 +#define LWIP_SOCKET_POLL 1 +#define LWIP_STATS 1 +#define LWIP_STATS_DISPLAY 0 +#define LINK_STATS 1 +#define ETHARP_STATS (LWIP_ARP) +#define IP_STATS 1 +#define IPFRAG_STATS (IP_REASSEMBLY || IP_FRAG) +#define ICMP_STATS 1 +#define IGMP_STATS (LWIP_IGMP) +#define UDP_STATS (LWIP_UDP) +#define TCP_STATS (LWIP_TCP) +#define MEM_STATS ((MEM_LIBC_MALLOC == 0) && (MEM_USE_POOLS == 0)) +#define MEMP_STATS (MEMP_MEM_MALLOC == 0) +#define SYS_STATS (NO_SYS == 0) +#define IP6_STATS (LWIP_IPV6) +#define ICMP6_STATS (LWIP_IPV6 && LWIP_ICMP6) +#define IP6_FRAG_STATS (LWIP_IPV6 && (LWIP_IPV6_FRAG || LWIP_IPV6_REASS)) +#define MLD6_STATS (LWIP_IPV6 && LWIP_IPV6_MLD) +#define ND6_STATS (LWIP_IPV6) +#define MIB2_STATS 0 +#define LWIP_CHECKSUM_CTRL_PER_NETIF 0 +#define CHECKSUM_GEN_IP 1 +#define CHECKSUM_GEN_UDP 1 +#define CHECKSUM_GEN_TCP 1 +#define CHECKSUM_GEN_ICMP 1 +#define CHECKSUM_GEN_ICMP6 1 +#define CHECKSUM_CHECK_IP 1 +#define CHECKSUM_CHECK_UDP 1 +#define CHECKSUM_CHECK_TCP 1 +#define CHECKSUM_CHECK_ICMP 1 +#define CHECKSUM_CHECK_ICMP6 1 +#define LWIP_CHECKSUM_ON_COPY 0 +#define LWIP_IPV6 1 +#define IPV6_REASS_MAXAGE 60 +#define LWIP_IPV6_SCOPES (LWIP_IPV6 && !LWIP_SINGLE_NETIF) +#define LWIP_IPV6_SCOPES_DEBUG 0 +#define LWIP_IPV6_NUM_ADDRESSES 3 +#define LWIP_IPV6_FORWARD 0 +#define LWIP_IPV6_FRAG 1 +#define LWIP_IPV6_REASS (LWIP_IPV6) +#define LWIP_IPV6_SEND_ROUTER_SOLICIT 1 +#define LWIP_IPV6_AUTOCONFIG (LWIP_IPV6) +#define LWIP_IPV6_ADDRESS_LIFETIMES (LWIP_IPV6_AUTOCONFIG) +#define LWIP_IPV6_DUP_DETECT_ATTEMPTS 1 +#define LWIP_ICMP6 (LWIP_IPV6) +#define LWIP_ICMP6_DATASIZE 8 +#define LWIP_ICMP6_HL 255 +#define LWIP_IPV6_MLD (LWIP_IPV6) +#define MEMP_NUM_MLD6_GROUP 4 +#define LWIP_ND6_QUEUEING (LWIP_IPV6) +#define MEMP_NUM_ND6_QUEUE 20 +#define LWIP_ND6_NUM_NEIGHBORS 10 +#define LWIP_ND6_NUM_DESTINATIONS 10 +#define LWIP_ND6_NUM_PREFIXES 5 +#define LWIP_ND6_NUM_ROUTERS 3 +#define LWIP_ND6_MAX_MULTICAST_SOLICIT 3 +#define LWIP_ND6_MAX_UNICAST_SOLICIT 3 +#define LWIP_ND6_MAX_ANYCAST_DELAY_TIME 1000 +#define LWIP_ND6_MAX_NEIGHBOR_ADVERTISEMENT 3 +#define LWIP_ND6_REACHABLE_TIME 30000 +#define LWIP_ND6_RETRANS_TIMER 1000 +#define LWIP_ND6_DELAY_FIRST_PROBE_TIME 5000 +#define LWIP_ND6_ALLOW_RA_UPDATES 1 +#define LWIP_ND6_TCP_REACHABILITY_HINTS 1 +#define LWIP_ND6_RDNSS_MAX_DNS_SERVERS 0 +#define LWIP_IPV6_DHCP6 0 +#define LWIP_IPV6_DHCP6_STATEFUL 0 +#define LWIP_IPV6_DHCP6_STATELESS LWIP_IPV6_DHCP6 +#define LWIP_DHCP6_GET_NTP_SRV 0 +#define LWIP_DHCP6_MAX_NTP_SERVERS 1 +#define LWIP_DHCP6_MAX_DNS_SERVERS DNS_MAX_SERVERS + +/* TODO: check hooks */ + +#define LWIP_DBG_MIN_LEVEL LWIP_DBG_LEVEL_ALL +#define LWIP_DBG_TYPES_ON LWIP_DBG_ON +#define ETHARP_DEBUG LWIP_DBG_OFF +#define NETIF_DEBUG LWIP_DBG_OFF +#define PBUF_DEBUG LWIP_DBG_OFF +#define API_LIB_DEBUG LWIP_DBG_OFF +#define API_MSG_DEBUG LWIP_DBG_OFF +#define SOCKETS_DEBUG LWIP_DBG_OFF +#define ICMP_DEBUG LWIP_DBG_OFF +#define IGMP_DEBUG LWIP_DBG_OFF +#define INET_DEBUG LWIP_DBG_OFF +#define IP_DEBUG LWIP_DBG_OFF +#define IP_REASS_DEBUG LWIP_DBG_OFF +#define RAW_DEBUG LWIP_DBG_OFF +#define MEM_DEBUG LWIP_DBG_OFF +#define MEMP_DEBUG LWIP_DBG_OFF +#define SYS_DEBUG LWIP_DBG_OFF +#define TIMERS_DEBUG LWIP_DBG_OFF +#define TCP_DEBUG LWIP_DBG_OFF +#define TCP_INPUT_DEBUG LWIP_DBG_OFF +#define TCP_FR_DEBUG LWIP_DBG_OFF +#define TCP_RTO_DEBUG LWIP_DBG_OFF +#define TCP_CWND_DEBUG LWIP_DBG_OFF +#define TCP_WND_DEBUG LWIP_DBG_OFF +#define TCP_OUTPUT_DEBUG LWIP_DBG_OFF +#define TCP_RST_DEBUG LWIP_DBG_OFF +#define TCP_QLEN_DEBUG LWIP_DBG_OFF +#define UDP_DEBUG LWIP_DBG_OFF +#define TCPIP_DEBUG LWIP_DBG_OFF +#define SLIP_DEBUG LWIP_DBG_OFF +#define DHCP_DEBUG LWIP_DBG_OFF +#define AUTOIP_DEBUG LWIP_DBG_OFF +#define DNS_DEBUG LWIP_DBG_OFF +#define IP6_DEBUG LWIP_DBG_OFF +#define DHCP6_DEBUG LWIP_DBG_OFF +#define LWIP_TESTMODE 0 + +#define LWIP_PERF 0 diff --git a/contrib/examples/example_app/test_configs/opt_no_tcp_dualstack.h b/contrib/examples/example_app/test_configs/opt_no_tcp_dualstack.h new file mode 100644 index 00000000..154028b4 --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_no_tcp_dualstack.h @@ -0,0 +1,4 @@ +#include "test_configs/opt_dualstack.h" + +#undef LWIP_TCP +#define LWIP_TCP 0 \ No newline at end of file diff --git a/contrib/examples/example_app/test_configs/opt_no_tcp_ipv4only.h b/contrib/examples/example_app/test_configs/opt_no_tcp_ipv4only.h new file mode 100644 index 00000000..d102a1c4 --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_no_tcp_ipv4only.h @@ -0,0 +1,4 @@ +#include "test_configs/opt_ipv4only.h" + +#undef LWIP_TCP +#define LWIP_TCP 0 \ No newline at end of file diff --git a/contrib/examples/example_app/test_configs/opt_no_tcp_ipv6only.h b/contrib/examples/example_app/test_configs/opt_no_tcp_ipv6only.h new file mode 100644 index 00000000..af77df32 --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_no_tcp_ipv6only.h @@ -0,0 +1,4 @@ +#include "test_configs/opt_ipv6only.h" + +#undef LWIP_TCP +#define LWIP_TCP 0 \ No newline at end of file diff --git a/contrib/examples/example_app/test_configs/opt_no_udp_dualstack.h b/contrib/examples/example_app/test_configs/opt_no_udp_dualstack.h new file mode 100644 index 00000000..9b297b4e --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_no_udp_dualstack.h @@ -0,0 +1,4 @@ +#include "test_configs/opt_dualstack.h" + +#undef LWIP_UDP +#define LWIP_UDP 0 \ No newline at end of file diff --git a/contrib/examples/example_app/test_configs/opt_no_udp_ipv4only.h b/contrib/examples/example_app/test_configs/opt_no_udp_ipv4only.h new file mode 100644 index 00000000..3c6062bd --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_no_udp_ipv4only.h @@ -0,0 +1,4 @@ +#include "test_configs/opt_ipv4only.h" + +#undef LWIP_UDP +#define LWIP_UDP 0 \ No newline at end of file diff --git a/contrib/examples/example_app/test_configs/opt_no_udp_ipv6only.h b/contrib/examples/example_app/test_configs/opt_no_udp_ipv6only.h new file mode 100644 index 00000000..12ac14d8 --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_no_udp_ipv6only.h @@ -0,0 +1,4 @@ +#include "test_configs/opt_ipv6only.h" + +#undef LWIP_UDP +#define LWIP_UDP 0 \ No newline at end of file diff --git a/contrib/examples/example_app/test_configs/opt_none.h b/contrib/examples/example_app/test_configs/opt_none.h new file mode 100644 index 00000000..3c393218 --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_none.h @@ -0,0 +1,2 @@ +/* test and empty lwipopts.h file */ + diff --git a/contrib/examples/example_app/test_configs/opt_nosys_dual.h b/contrib/examples/example_app/test_configs/opt_nosys_dual.h new file mode 100644 index 00000000..301b4bb2 --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_nosys_dual.h @@ -0,0 +1,296 @@ +/* test an lwipopts.h file with default contents */ +#define NO_SYS 0 +#define NO_SYS_NO_TIMERS 0 +#define LWIP_TIMERS 1 +#define LWIP_TIMERS_CUSTOM 0 +#define LWIP_MPU_COMPATIBLE 0 +#define LWIP_TCPIP_CORE_LOCKING 1 +#define LWIP_TCPIP_CORE_LOCKING_INPUT 0 +#define SYS_LIGHTWEIGHT_PROT 1 +#define MEM_LIBC_MALLOC 0 +#define MEMP_MEM_MALLOC 0 +#define MEMP_MEM_INIT 0 +#define MEM_ALIGNMENT 1 +#define MEM_SIZE 1600 +#define MEMP_OVERFLOW_CHECK 0 +#define MEMP_SANITY_CHECK 0 +#define MEM_OVERFLOW_CHECK 0 +#define MEM_SANITY_CHECK 0 +#define MEM_USE_POOLS 0 +#define MEM_USE_POOLS_TRY_BIGGER_POOL 0 +#define MEMP_USE_CUSTOM_POOLS 0 +#define LWIP_ALLOW_MEM_FREE_FROM_OTHER_CONTEXT 0 +/*#define MEMP_NUM_PBUF 16 +#define MEMP_NUM_RAW_PCB 4 +#define MEMP_NUM_UDP_PCB 4 +#define MEMP_NUM_TCP_PCB 5 +#define MEMP_NUM_TCP_PCB_LISTEN 8 +#define MEMP_NUM_TCP_SEG 16 +#define MEMP_NUM_ALTCP_PCB MEMP_NUM_TCP_PCB +#define MEMP_NUM_REASSDATA 5 +#define MEMP_NUM_FRAG_PBUF 15 +#define MEMP_NUM_ARP_QUEUE 30 +#define MEMP_NUM_IGMP_GROUP 8 +#define MEMP_NUM_SYS_TIMEOUT (LWIP_NUM_SYS_TIMEOUT_INTERNAL + 2) +#define MEMP_NUM_NETBUF 2 +#define MEMP_NUM_NETCONN 4 +#define MEMP_NUM_SELECT_CB 4 +#define MEMP_NUM_TCPIP_MSG_API 8 +#define MEMP_NUM_TCPIP_MSG_INPKT 8 +#define MEMP_NUM_NETDB 1 +#define MEMP_NUM_LOCALHOSTLIST 1 +#define PBUF_POOL_SIZE 16 +#define MEMP_NUM_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_DNS_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_SOCKET_SETGETSOCKOPT_DATA MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_NETIFAPI_MSG MEMP_NUM_TCPIP_MSG_API*/ +#define LWIP_ARP 1 +#define ARP_TABLE_SIZE 10 +#define ARP_MAXAGE 300 +#define ARP_QUEUEING 0 +#define ARP_QUEUE_LEN 3 +#define ETHARP_SUPPORT_VLAN 0 +#define LWIP_ETHERNET LWIP_ARP +#define ETH_PAD_SIZE 0 +#define ETHARP_SUPPORT_STATIC_ENTRIES 0 +#define ETHARP_TABLE_MATCH_NETIF !LWIP_SINGLE_NETIF +#define LWIP_IPV4 1 +#define IP_FORWARD 0 +#define IP_REASSEMBLY 1 +#define IP_FRAG 1 +#define IP_OPTIONS_ALLOWED 1 +#define IP_REASS_MAXAGE 15 +#define IP_REASS_MAX_PBUFS 10 +#define IP_DEFAULT_TTL 255 +#define IP_SOF_BROADCAST 0 +#define IP_SOF_BROADCAST_RECV 0 +#define IP_FORWARD_ALLOW_TX_ON_RX_NETIF 0 +#define LWIP_ICMP 1 +#define ICMP_TTL (IP_DEFAULT_TTL) +#define LWIP_BROADCAST_PING 0 +#define LWIP_MULTICAST_PING 0 +#define LWIP_RAW 0 +#define RAW_TTL (IP_DEFAULT_TTL) +#define LWIP_DHCP 0 +#define DHCP_DOES_ARP_CHECK ((LWIP_DHCP) && (LWIP_ARP)) +#define LWIP_DHCP_CHECK_LINK_UP 0 +#define LWIP_DHCP_BOOTP_FILE 0 +#define LWIP_DHCP_GET_NTP_SRV 0 +#define LWIP_DHCP_MAX_NTP_SERVERS 1 +#define LWIP_DHCP_MAX_DNS_SERVERS DNS_MAX_SERVERS +#define LWIP_AUTOIP 0 +#define LWIP_DHCP_AUTOIP_COOP 0 +#define LWIP_DHCP_AUTOIP_COOP_TRIES 9 +#define LWIP_MIB2_CALLBACKS 0 +#define LWIP_MULTICAST_TX_OPTIONS ((LWIP_IGMP || LWIP_IPV6_MLD) && (LWIP_UDP || LWIP_RAW)) +#define LWIP_IGMP 0 +#define LWIP_DNS 0 +#define DNS_TABLE_SIZE 4 +#define DNS_MAX_NAME_LENGTH 256 +#define DNS_MAX_SERVERS 2 +#define DNS_MAX_RETRIES 4 +#define DNS_DOES_NAME_CHECK 1 +#define LWIP_DNS_SECURE (LWIP_DNS_SECURE_RAND_XID | LWIP_DNS_SECURE_NO_MULTIPLE_OUTSTANDING | LWIP_DNS_SECURE_RAND_SRC_PORT) +#define DNS_LOCAL_HOSTLIST 0 +#define DNS_LOCAL_HOSTLIST_IS_DYNAMIC 0 +#define LWIP_DNS_SUPPORT_MDNS_QUERIES 0 +#define LWIP_UDP 1 +#define LWIP_UDPLITE 0 +#define UDP_TTL (IP_DEFAULT_TTL) +#define LWIP_NETBUF_RECVINFO 0 +#define LWIP_TCP 1 +#define TCP_TTL (IP_DEFAULT_TTL) +#define TCP_WND (4 * TCP_MSS) +#define TCP_MAXRTX 12 +#define TCP_SYNMAXRTX 6 +#define TCP_QUEUE_OOSEQ (LWIP_TCP) +#define LWIP_TCP_SACK_OUT 0 +#define LWIP_TCP_MAX_SACK_NUM 4 +#define TCP_MSS 536 +#define TCP_CALCULATE_EFF_SEND_MSS 1 +#define TCP_SND_BUF (2 * TCP_MSS) +#define TCP_SND_QUEUELEN ((4 * (TCP_SND_BUF) + (TCP_MSS - 1))/(TCP_MSS)) +#define TCP_SNDLOWAT LWIP_MIN(LWIP_MAX(((TCP_SND_BUF)/2), (2 * TCP_MSS) + 1), (TCP_SND_BUF) - 1) +#define TCP_SNDQUEUELOWAT LWIP_MAX(((TCP_SND_QUEUELEN)/2), 5) +#define TCP_OOSEQ_MAX_BYTES 0 +#define TCP_OOSEQ_BYTES_LIMIT(pcb) TCP_OOSEQ_MAX_BYTES +#define TCP_OOSEQ_MAX_PBUFS 0 +#define TCP_OOSEQ_PBUFS_LIMIT(pcb) TCP_OOSEQ_MAX_PBUFS +#define TCP_LISTEN_BACKLOG 0 +#define TCP_DEFAULT_LISTEN_BACKLOG 0xff +#define TCP_OVERSIZE TCP_MSS +#define LWIP_TCP_TIMESTAMPS 0 +#define TCP_WND_UPDATE_THRESHOLD LWIP_MIN((TCP_WND / 4), (TCP_MSS * 4)) +#define LWIP_EVENT_API 0 +#define LWIP_CALLBACK_API 1 +#define LWIP_WND_SCALE 0 +#define TCP_RCV_SCALE 0 +#define LWIP_TCP_PCB_NUM_EXT_ARGS 0 +#define LWIP_ALTCP 0 +#define LWIP_ALTCP_TLS 0 +#define PBUF_LINK_HLEN (14 + ETH_PAD_SIZE) +#define PBUF_LINK_ENCAPSULATION_HLEN 0 +#define PBUF_POOL_BUFSIZE LWIP_MEM_ALIGN_SIZE(TCP_MSS+40+PBUF_LINK_ENCAPSULATION_HLEN+PBUF_LINK_HLEN) +#define LWIP_PBUF_REF_T u8_t +#define LWIP_SINGLE_NETIF 0 +#define LWIP_NETIF_HOSTNAME 0 +#define LWIP_NETIF_API 0 +#define LWIP_NETIF_STATUS_CALLBACK 0 +#define LWIP_NETIF_EXT_STATUS_CALLBACK 0 +#define LWIP_NETIF_LINK_CALLBACK 0 +#define LWIP_NETIF_REMOVE_CALLBACK 0 +#define LWIP_NETIF_HWADDRHINT 0 +#define LWIP_NETIF_TX_SINGLE_PBUF 0 +#define LWIP_NUM_NETIF_CLIENT_DATA 0 +#define LWIP_HAVE_LOOPIF (LWIP_NETIF_LOOPBACK && !LWIP_SINGLE_NETIF) +#define LWIP_LOOPIF_MULTICAST 0 +#define LWIP_NETIF_LOOPBACK 0 +#define LWIP_LOOPBACK_MAX_PBUFS 0 +#define LWIP_NETIF_LOOPBACK_MULTITHREADING (!NO_SYS) +/*#define TCPIP_THREAD_NAME "tcpip_thread" +#define TCPIP_THREAD_STACKSIZE 0 +#define TCPIP_THREAD_PRIO 1 +#define TCPIP_MBOX_SIZE 0 +#define LWIP_TCPIP_THREAD_ALIVE() +#define SLIPIF_THREAD_NAME "slipif_loop" +#define SLIPIF_THREAD_STACKSIZE 0 +#define SLIPIF_THREAD_PRIO 1 +#define DEFAULT_THREAD_NAME "lwIP" +#define DEFAULT_THREAD_STACKSIZE 0 +#define DEFAULT_THREAD_PRIO 1 +#define DEFAULT_RAW_RECVMBOX_SIZE 0 +#define DEFAULT_UDP_RECVMBOX_SIZE 0 +#define DEFAULT_TCP_RECVMBOX_SIZE 0 +#define DEFAULT_ACCEPTMBOX_SIZE 0*/ +#define LWIP_NETCONN 0 +#define LWIP_TCPIP_TIMEOUT 0 +#define LWIP_NETCONN_SEM_PER_THREAD 0 +#define LWIP_NETCONN_FULLDUPLEX 0 +#define LWIP_SOCKET 0 +#define LWIP_COMPAT_SOCKETS 1 /* 0..2 */ +#define LWIP_POSIX_SOCKETS_IO_NAMES 1 +#define LWIP_SOCKET_OFFSET 0 +#define LWIP_TCP_KEEPALIVE 0 +#define LWIP_SO_SNDTIMEO 0 +#define LWIP_SO_RCVTIMEO 0 +#define LWIP_SO_SNDRCVTIMEO_NONSTANDARD 0 +#define LWIP_SO_RCVBUF 0 +#define LWIP_SO_LINGER 0 +#define RECV_BUFSIZE_DEFAULT INT_MAX +#define LWIP_TCP_CLOSE_TIMEOUT_MS_DEFAULT 20000 +#define SO_REUSE 0 +#define SO_REUSE_RXTOALL 0 +#define LWIP_FIONREAD_LINUXMODE 0 +#define LWIP_SOCKET_SELECT 1 +#define LWIP_SOCKET_POLL 1 +#define LWIP_STATS 1 +#define LWIP_STATS_DISPLAY 0 +#define LINK_STATS 1 +#define ETHARP_STATS (LWIP_ARP) +#define IP_STATS 1 +#define IPFRAG_STATS (IP_REASSEMBLY || IP_FRAG) +#define ICMP_STATS 1 +#define IGMP_STATS (LWIP_IGMP) +#define UDP_STATS (LWIP_UDP) +#define TCP_STATS (LWIP_TCP) +#define MEM_STATS ((MEM_LIBC_MALLOC == 0) && (MEM_USE_POOLS == 0)) +#define MEMP_STATS (MEMP_MEM_MALLOC == 0) +#define SYS_STATS (NO_SYS == 0) +#define IP6_STATS (LWIP_IPV6) +#define ICMP6_STATS (LWIP_IPV6 && LWIP_ICMP6) +#define IP6_FRAG_STATS (LWIP_IPV6 && (LWIP_IPV6_FRAG || LWIP_IPV6_REASS)) +#define MLD6_STATS (LWIP_IPV6 && LWIP_IPV6_MLD) +#define ND6_STATS (LWIP_IPV6) +#define MIB2_STATS 0 +#define LWIP_CHECKSUM_CTRL_PER_NETIF 0 +#define CHECKSUM_GEN_IP 1 +#define CHECKSUM_GEN_UDP 1 +#define CHECKSUM_GEN_TCP 1 +#define CHECKSUM_GEN_ICMP 1 +#define CHECKSUM_GEN_ICMP6 1 +#define CHECKSUM_CHECK_IP 1 +#define CHECKSUM_CHECK_UDP 1 +#define CHECKSUM_CHECK_TCP 1 +#define CHECKSUM_CHECK_ICMP 1 +#define CHECKSUM_CHECK_ICMP6 1 +#define LWIP_CHECKSUM_ON_COPY 0 +#define LWIP_IPV6 1 +#define IPV6_REASS_MAXAGE 60 +#define LWIP_IPV6_SCOPES (LWIP_IPV6 && !LWIP_SINGLE_NETIF) +#define LWIP_IPV6_SCOPES_DEBUG 0 +#define LWIP_IPV6_NUM_ADDRESSES 3 +#define LWIP_IPV6_FORWARD 0 +#define LWIP_IPV6_FRAG 1 +#define LWIP_IPV6_REASS (LWIP_IPV6) +#define LWIP_IPV6_SEND_ROUTER_SOLICIT 1 +#define LWIP_IPV6_AUTOCONFIG (LWIP_IPV6) +#define LWIP_IPV6_ADDRESS_LIFETIMES (LWIP_IPV6_AUTOCONFIG) +#define LWIP_IPV6_DUP_DETECT_ATTEMPTS 1 +#define LWIP_ICMP6 (LWIP_IPV6) +#define LWIP_ICMP6_DATASIZE 8 +#define LWIP_ICMP6_HL 255 +#define LWIP_IPV6_MLD (LWIP_IPV6) +#define MEMP_NUM_MLD6_GROUP 4 +#define LWIP_ND6_QUEUEING (LWIP_IPV6) +#define MEMP_NUM_ND6_QUEUE 20 +#define LWIP_ND6_NUM_NEIGHBORS 10 +#define LWIP_ND6_NUM_DESTINATIONS 10 +#define LWIP_ND6_NUM_PREFIXES 5 +#define LWIP_ND6_NUM_ROUTERS 3 +#define LWIP_ND6_MAX_MULTICAST_SOLICIT 3 +#define LWIP_ND6_MAX_UNICAST_SOLICIT 3 +#define LWIP_ND6_MAX_ANYCAST_DELAY_TIME 1000 +#define LWIP_ND6_MAX_NEIGHBOR_ADVERTISEMENT 3 +#define LWIP_ND6_REACHABLE_TIME 30000 +#define LWIP_ND6_RETRANS_TIMER 1000 +#define LWIP_ND6_DELAY_FIRST_PROBE_TIME 5000 +#define LWIP_ND6_ALLOW_RA_UPDATES 1 +#define LWIP_ND6_TCP_REACHABILITY_HINTS 1 +#define LWIP_ND6_RDNSS_MAX_DNS_SERVERS 0 +#define LWIP_IPV6_DHCP6 0 +#define LWIP_IPV6_DHCP6_STATEFUL 0 +#define LWIP_IPV6_DHCP6_STATELESS LWIP_IPV6_DHCP6 +#define LWIP_DHCP6_GET_NTP_SRV 0 +#define LWIP_DHCP6_MAX_NTP_SERVERS 1 +#define LWIP_DHCP6_MAX_DNS_SERVERS DNS_MAX_SERVERS + +/* TODO: check hooks */ + +#define LWIP_DBG_MIN_LEVEL LWIP_DBG_LEVEL_ALL +#define LWIP_DBG_TYPES_ON LWIP_DBG_ON +#define ETHARP_DEBUG LWIP_DBG_OFF +#define NETIF_DEBUG LWIP_DBG_OFF +#define PBUF_DEBUG LWIP_DBG_OFF +#define API_LIB_DEBUG LWIP_DBG_OFF +#define API_MSG_DEBUG LWIP_DBG_OFF +#define SOCKETS_DEBUG LWIP_DBG_OFF +#define ICMP_DEBUG LWIP_DBG_OFF +#define IGMP_DEBUG LWIP_DBG_OFF +#define INET_DEBUG LWIP_DBG_OFF +#define IP_DEBUG LWIP_DBG_OFF +#define IP_REASS_DEBUG LWIP_DBG_OFF +#define RAW_DEBUG LWIP_DBG_OFF +#define MEM_DEBUG LWIP_DBG_OFF +#define MEMP_DEBUG LWIP_DBG_OFF +#define SYS_DEBUG LWIP_DBG_OFF +#define TIMERS_DEBUG LWIP_DBG_OFF +#define TCP_DEBUG LWIP_DBG_OFF +#define TCP_INPUT_DEBUG LWIP_DBG_OFF +#define TCP_FR_DEBUG LWIP_DBG_OFF +#define TCP_RTO_DEBUG LWIP_DBG_OFF +#define TCP_CWND_DEBUG LWIP_DBG_OFF +#define TCP_WND_DEBUG LWIP_DBG_OFF +#define TCP_OUTPUT_DEBUG LWIP_DBG_OFF +#define TCP_RST_DEBUG LWIP_DBG_OFF +#define TCP_QLEN_DEBUG LWIP_DBG_OFF +#define UDP_DEBUG LWIP_DBG_OFF +#define TCPIP_DEBUG LWIP_DBG_OFF +#define SLIP_DEBUG LWIP_DBG_OFF +#define DHCP_DEBUG LWIP_DBG_OFF +#define AUTOIP_DEBUG LWIP_DBG_OFF +#define DNS_DEBUG LWIP_DBG_OFF +#define IP6_DEBUG LWIP_DBG_OFF +#define DHCP6_DEBUG LWIP_DBG_OFF +#define LWIP_TESTMODE 0 + +#define LWIP_PERF 0 diff --git a/contrib/examples/example_app/test_configs/opt_nosys_ipv4.h b/contrib/examples/example_app/test_configs/opt_nosys_ipv4.h new file mode 100644 index 00000000..440ae513 --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_nosys_ipv4.h @@ -0,0 +1,296 @@ +/* test an lwipopts.h file with default contents */ +#define NO_SYS 0 +#define NO_SYS_NO_TIMERS 0 +#define LWIP_TIMERS 1 +#define LWIP_TIMERS_CUSTOM 0 +#define LWIP_MPU_COMPATIBLE 0 +#define LWIP_TCPIP_CORE_LOCKING 1 +#define LWIP_TCPIP_CORE_LOCKING_INPUT 0 +#define SYS_LIGHTWEIGHT_PROT 1 +#define MEM_LIBC_MALLOC 0 +#define MEMP_MEM_MALLOC 0 +#define MEMP_MEM_INIT 0 +#define MEM_ALIGNMENT 1 +#define MEM_SIZE 1600 +#define MEMP_OVERFLOW_CHECK 0 +#define MEMP_SANITY_CHECK 0 +#define MEM_OVERFLOW_CHECK 0 +#define MEM_SANITY_CHECK 0 +#define MEM_USE_POOLS 0 +#define MEM_USE_POOLS_TRY_BIGGER_POOL 0 +#define MEMP_USE_CUSTOM_POOLS 0 +#define LWIP_ALLOW_MEM_FREE_FROM_OTHER_CONTEXT 0 +/*#define MEMP_NUM_PBUF 16 +#define MEMP_NUM_RAW_PCB 4 +#define MEMP_NUM_UDP_PCB 4 +#define MEMP_NUM_TCP_PCB 5 +#define MEMP_NUM_TCP_PCB_LISTEN 8 +#define MEMP_NUM_TCP_SEG 16 +#define MEMP_NUM_ALTCP_PCB MEMP_NUM_TCP_PCB +#define MEMP_NUM_REASSDATA 5 +#define MEMP_NUM_FRAG_PBUF 15 +#define MEMP_NUM_ARP_QUEUE 30 +#define MEMP_NUM_IGMP_GROUP 8 +#define MEMP_NUM_SYS_TIMEOUT (LWIP_NUM_SYS_TIMEOUT_INTERNAL + 2) +#define MEMP_NUM_NETBUF 2 +#define MEMP_NUM_NETCONN 4 +#define MEMP_NUM_SELECT_CB 4 +#define MEMP_NUM_TCPIP_MSG_API 8 +#define MEMP_NUM_TCPIP_MSG_INPKT 8 +#define MEMP_NUM_NETDB 1 +#define MEMP_NUM_LOCALHOSTLIST 1 +#define PBUF_POOL_SIZE 16 +#define MEMP_NUM_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_DNS_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_SOCKET_SETGETSOCKOPT_DATA MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_NETIFAPI_MSG MEMP_NUM_TCPIP_MSG_API*/ +#define LWIP_ARP 1 +#define ARP_TABLE_SIZE 10 +#define ARP_MAXAGE 300 +#define ARP_QUEUEING 0 +#define ARP_QUEUE_LEN 3 +#define ETHARP_SUPPORT_VLAN 0 +#define LWIP_ETHERNET LWIP_ARP +#define ETH_PAD_SIZE 0 +#define ETHARP_SUPPORT_STATIC_ENTRIES 0 +#define ETHARP_TABLE_MATCH_NETIF !LWIP_SINGLE_NETIF +#define LWIP_IPV4 1 +#define IP_FORWARD 0 +#define IP_REASSEMBLY 1 +#define IP_FRAG 1 +#define IP_OPTIONS_ALLOWED 1 +#define IP_REASS_MAXAGE 15 +#define IP_REASS_MAX_PBUFS 10 +#define IP_DEFAULT_TTL 255 +#define IP_SOF_BROADCAST 0 +#define IP_SOF_BROADCAST_RECV 0 +#define IP_FORWARD_ALLOW_TX_ON_RX_NETIF 0 +#define LWIP_ICMP 1 +#define ICMP_TTL (IP_DEFAULT_TTL) +#define LWIP_BROADCAST_PING 0 +#define LWIP_MULTICAST_PING 0 +#define LWIP_RAW 0 +#define RAW_TTL (IP_DEFAULT_TTL) +#define LWIP_DHCP 0 +#define DHCP_DOES_ARP_CHECK ((LWIP_DHCP) && (LWIP_ARP)) +#define LWIP_DHCP_CHECK_LINK_UP 0 +#define LWIP_DHCP_BOOTP_FILE 0 +#define LWIP_DHCP_GET_NTP_SRV 0 +#define LWIP_DHCP_MAX_NTP_SERVERS 1 +#define LWIP_DHCP_MAX_DNS_SERVERS DNS_MAX_SERVERS +#define LWIP_AUTOIP 0 +#define LWIP_DHCP_AUTOIP_COOP 0 +#define LWIP_DHCP_AUTOIP_COOP_TRIES 9 +#define LWIP_MIB2_CALLBACKS 0 +#define LWIP_MULTICAST_TX_OPTIONS ((LWIP_IGMP || LWIP_IPV6_MLD) && (LWIP_UDP || LWIP_RAW)) +#define LWIP_IGMP 0 +#define LWIP_DNS 0 +#define DNS_TABLE_SIZE 4 +#define DNS_MAX_NAME_LENGTH 256 +#define DNS_MAX_SERVERS 2 +#define DNS_MAX_RETRIES 4 +#define DNS_DOES_NAME_CHECK 1 +#define LWIP_DNS_SECURE (LWIP_DNS_SECURE_RAND_XID | LWIP_DNS_SECURE_NO_MULTIPLE_OUTSTANDING | LWIP_DNS_SECURE_RAND_SRC_PORT) +#define DNS_LOCAL_HOSTLIST 0 +#define DNS_LOCAL_HOSTLIST_IS_DYNAMIC 0 +#define LWIP_DNS_SUPPORT_MDNS_QUERIES 0 +#define LWIP_UDP 1 +#define LWIP_UDPLITE 0 +#define UDP_TTL (IP_DEFAULT_TTL) +#define LWIP_NETBUF_RECVINFO 0 +#define LWIP_TCP 1 +#define TCP_TTL (IP_DEFAULT_TTL) +#define TCP_WND (4 * TCP_MSS) +#define TCP_MAXRTX 12 +#define TCP_SYNMAXRTX 6 +#define TCP_QUEUE_OOSEQ (LWIP_TCP) +#define LWIP_TCP_SACK_OUT 0 +#define LWIP_TCP_MAX_SACK_NUM 4 +#define TCP_MSS 536 +#define TCP_CALCULATE_EFF_SEND_MSS 1 +#define TCP_SND_BUF (2 * TCP_MSS) +#define TCP_SND_QUEUELEN ((4 * (TCP_SND_BUF) + (TCP_MSS - 1))/(TCP_MSS)) +#define TCP_SNDLOWAT LWIP_MIN(LWIP_MAX(((TCP_SND_BUF)/2), (2 * TCP_MSS) + 1), (TCP_SND_BUF) - 1) +#define TCP_SNDQUEUELOWAT LWIP_MAX(((TCP_SND_QUEUELEN)/2), 5) +#define TCP_OOSEQ_MAX_BYTES 0 +#define TCP_OOSEQ_BYTES_LIMIT(pcb) TCP_OOSEQ_MAX_BYTES +#define TCP_OOSEQ_MAX_PBUFS 0 +#define TCP_OOSEQ_PBUFS_LIMIT(pcb) TCP_OOSEQ_MAX_PBUFS +#define TCP_LISTEN_BACKLOG 0 +#define TCP_DEFAULT_LISTEN_BACKLOG 0xff +#define TCP_OVERSIZE TCP_MSS +#define LWIP_TCP_TIMESTAMPS 0 +#define TCP_WND_UPDATE_THRESHOLD LWIP_MIN((TCP_WND / 4), (TCP_MSS * 4)) +#define LWIP_EVENT_API 0 +#define LWIP_CALLBACK_API 1 +#define LWIP_WND_SCALE 0 +#define TCP_RCV_SCALE 0 +#define LWIP_TCP_PCB_NUM_EXT_ARGS 0 +#define LWIP_ALTCP 0 +#define LWIP_ALTCP_TLS 0 +#define PBUF_LINK_HLEN (14 + ETH_PAD_SIZE) +#define PBUF_LINK_ENCAPSULATION_HLEN 0 +#define PBUF_POOL_BUFSIZE LWIP_MEM_ALIGN_SIZE(TCP_MSS+40+PBUF_LINK_ENCAPSULATION_HLEN+PBUF_LINK_HLEN) +#define LWIP_PBUF_REF_T u8_t +#define LWIP_SINGLE_NETIF 0 +#define LWIP_NETIF_HOSTNAME 0 +#define LWIP_NETIF_API 0 +#define LWIP_NETIF_STATUS_CALLBACK 0 +#define LWIP_NETIF_EXT_STATUS_CALLBACK 0 +#define LWIP_NETIF_LINK_CALLBACK 0 +#define LWIP_NETIF_REMOVE_CALLBACK 0 +#define LWIP_NETIF_HWADDRHINT 0 +#define LWIP_NETIF_TX_SINGLE_PBUF 0 +#define LWIP_NUM_NETIF_CLIENT_DATA 0 +#define LWIP_HAVE_LOOPIF (LWIP_NETIF_LOOPBACK && !LWIP_SINGLE_NETIF) +#define LWIP_LOOPIF_MULTICAST 0 +#define LWIP_NETIF_LOOPBACK 0 +#define LWIP_LOOPBACK_MAX_PBUFS 0 +#define LWIP_NETIF_LOOPBACK_MULTITHREADING (!NO_SYS) +/*#define TCPIP_THREAD_NAME "tcpip_thread" +#define TCPIP_THREAD_STACKSIZE 0 +#define TCPIP_THREAD_PRIO 1 +#define TCPIP_MBOX_SIZE 0 +#define LWIP_TCPIP_THREAD_ALIVE() +#define SLIPIF_THREAD_NAME "slipif_loop" +#define SLIPIF_THREAD_STACKSIZE 0 +#define SLIPIF_THREAD_PRIO 1 +#define DEFAULT_THREAD_NAME "lwIP" +#define DEFAULT_THREAD_STACKSIZE 0 +#define DEFAULT_THREAD_PRIO 1 +#define DEFAULT_RAW_RECVMBOX_SIZE 0 +#define DEFAULT_UDP_RECVMBOX_SIZE 0 +#define DEFAULT_TCP_RECVMBOX_SIZE 0 +#define DEFAULT_ACCEPTMBOX_SIZE 0*/ +#define LWIP_NETCONN 0 +#define LWIP_TCPIP_TIMEOUT 0 +#define LWIP_NETCONN_SEM_PER_THREAD 0 +#define LWIP_NETCONN_FULLDUPLEX 0 +#define LWIP_SOCKET 0 +#define LWIP_COMPAT_SOCKETS 1 /* 0..2 */ +#define LWIP_POSIX_SOCKETS_IO_NAMES 1 +#define LWIP_SOCKET_OFFSET 0 +#define LWIP_TCP_KEEPALIVE 0 +#define LWIP_SO_SNDTIMEO 0 +#define LWIP_SO_RCVTIMEO 0 +#define LWIP_SO_SNDRCVTIMEO_NONSTANDARD 0 +#define LWIP_SO_RCVBUF 0 +#define LWIP_SO_LINGER 0 +#define RECV_BUFSIZE_DEFAULT INT_MAX +#define LWIP_TCP_CLOSE_TIMEOUT_MS_DEFAULT 20000 +#define SO_REUSE 0 +#define SO_REUSE_RXTOALL 0 +#define LWIP_FIONREAD_LINUXMODE 0 +#define LWIP_SOCKET_SELECT 1 +#define LWIP_SOCKET_POLL 1 +#define LWIP_STATS 1 +#define LWIP_STATS_DISPLAY 0 +#define LINK_STATS 1 +#define ETHARP_STATS (LWIP_ARP) +#define IP_STATS 1 +#define IPFRAG_STATS (IP_REASSEMBLY || IP_FRAG) +#define ICMP_STATS 1 +#define IGMP_STATS (LWIP_IGMP) +#define UDP_STATS (LWIP_UDP) +#define TCP_STATS (LWIP_TCP) +#define MEM_STATS ((MEM_LIBC_MALLOC == 0) && (MEM_USE_POOLS == 0)) +#define MEMP_STATS (MEMP_MEM_MALLOC == 0) +#define SYS_STATS (NO_SYS == 0) +#define IP6_STATS (LWIP_IPV6) +#define ICMP6_STATS (LWIP_IPV6 && LWIP_ICMP6) +#define IP6_FRAG_STATS (LWIP_IPV6 && (LWIP_IPV6_FRAG || LWIP_IPV6_REASS)) +#define MLD6_STATS (LWIP_IPV6 && LWIP_IPV6_MLD) +#define ND6_STATS (LWIP_IPV6) +#define MIB2_STATS 0 +#define LWIP_CHECKSUM_CTRL_PER_NETIF 0 +#define CHECKSUM_GEN_IP 1 +#define CHECKSUM_GEN_UDP 1 +#define CHECKSUM_GEN_TCP 1 +#define CHECKSUM_GEN_ICMP 1 +#define CHECKSUM_GEN_ICMP6 1 +#define CHECKSUM_CHECK_IP 1 +#define CHECKSUM_CHECK_UDP 1 +#define CHECKSUM_CHECK_TCP 1 +#define CHECKSUM_CHECK_ICMP 1 +#define CHECKSUM_CHECK_ICMP6 1 +#define LWIP_CHECKSUM_ON_COPY 0 +#define LWIP_IPV6 0 +#define IPV6_REASS_MAXAGE 60 +#define LWIP_IPV6_SCOPES (LWIP_IPV6 && !LWIP_SINGLE_NETIF) +#define LWIP_IPV6_SCOPES_DEBUG 0 +#define LWIP_IPV6_NUM_ADDRESSES 3 +#define LWIP_IPV6_FORWARD 0 +#define LWIP_IPV6_FRAG 1 +#define LWIP_IPV6_REASS (LWIP_IPV6) +#define LWIP_IPV6_SEND_ROUTER_SOLICIT 1 +#define LWIP_IPV6_AUTOCONFIG (LWIP_IPV6) +#define LWIP_IPV6_ADDRESS_LIFETIMES (LWIP_IPV6_AUTOCONFIG) +#define LWIP_IPV6_DUP_DETECT_ATTEMPTS 1 +#define LWIP_ICMP6 (LWIP_IPV6) +#define LWIP_ICMP6_DATASIZE 8 +#define LWIP_ICMP6_HL 255 +#define LWIP_IPV6_MLD (LWIP_IPV6) +#define MEMP_NUM_MLD6_GROUP 4 +#define LWIP_ND6_QUEUEING (LWIP_IPV6) +#define MEMP_NUM_ND6_QUEUE 20 +#define LWIP_ND6_NUM_NEIGHBORS 10 +#define LWIP_ND6_NUM_DESTINATIONS 10 +#define LWIP_ND6_NUM_PREFIXES 5 +#define LWIP_ND6_NUM_ROUTERS 3 +#define LWIP_ND6_MAX_MULTICAST_SOLICIT 3 +#define LWIP_ND6_MAX_UNICAST_SOLICIT 3 +#define LWIP_ND6_MAX_ANYCAST_DELAY_TIME 1000 +#define LWIP_ND6_MAX_NEIGHBOR_ADVERTISEMENT 3 +#define LWIP_ND6_REACHABLE_TIME 30000 +#define LWIP_ND6_RETRANS_TIMER 1000 +#define LWIP_ND6_DELAY_FIRST_PROBE_TIME 5000 +#define LWIP_ND6_ALLOW_RA_UPDATES 1 +#define LWIP_ND6_TCP_REACHABILITY_HINTS 1 +#define LWIP_ND6_RDNSS_MAX_DNS_SERVERS 0 +#define LWIP_IPV6_DHCP6 0 +#define LWIP_IPV6_DHCP6_STATEFUL 0 +#define LWIP_IPV6_DHCP6_STATELESS LWIP_IPV6_DHCP6 +#define LWIP_DHCP6_GET_NTP_SRV 0 +#define LWIP_DHCP6_MAX_NTP_SERVERS 1 +#define LWIP_DHCP6_MAX_DNS_SERVERS DNS_MAX_SERVERS + +/* TODO: check hooks */ + +#define LWIP_DBG_MIN_LEVEL LWIP_DBG_LEVEL_ALL +#define LWIP_DBG_TYPES_ON LWIP_DBG_ON +#define ETHARP_DEBUG LWIP_DBG_OFF +#define NETIF_DEBUG LWIP_DBG_OFF +#define PBUF_DEBUG LWIP_DBG_OFF +#define API_LIB_DEBUG LWIP_DBG_OFF +#define API_MSG_DEBUG LWIP_DBG_OFF +#define SOCKETS_DEBUG LWIP_DBG_OFF +#define ICMP_DEBUG LWIP_DBG_OFF +#define IGMP_DEBUG LWIP_DBG_OFF +#define INET_DEBUG LWIP_DBG_OFF +#define IP_DEBUG LWIP_DBG_OFF +#define IP_REASS_DEBUG LWIP_DBG_OFF +#define RAW_DEBUG LWIP_DBG_OFF +#define MEM_DEBUG LWIP_DBG_OFF +#define MEMP_DEBUG LWIP_DBG_OFF +#define SYS_DEBUG LWIP_DBG_OFF +#define TIMERS_DEBUG LWIP_DBG_OFF +#define TCP_DEBUG LWIP_DBG_OFF +#define TCP_INPUT_DEBUG LWIP_DBG_OFF +#define TCP_FR_DEBUG LWIP_DBG_OFF +#define TCP_RTO_DEBUG LWIP_DBG_OFF +#define TCP_CWND_DEBUG LWIP_DBG_OFF +#define TCP_WND_DEBUG LWIP_DBG_OFF +#define TCP_OUTPUT_DEBUG LWIP_DBG_OFF +#define TCP_RST_DEBUG LWIP_DBG_OFF +#define TCP_QLEN_DEBUG LWIP_DBG_OFF +#define UDP_DEBUG LWIP_DBG_OFF +#define TCPIP_DEBUG LWIP_DBG_OFF +#define SLIP_DEBUG LWIP_DBG_OFF +#define DHCP_DEBUG LWIP_DBG_OFF +#define AUTOIP_DEBUG LWIP_DBG_OFF +#define DNS_DEBUG LWIP_DBG_OFF +#define IP6_DEBUG LWIP_DBG_OFF +#define DHCP6_DEBUG LWIP_DBG_OFF +#define LWIP_TESTMODE 0 + +#define LWIP_PERF 0 diff --git a/contrib/examples/example_app/test_configs/opt_nosys_ipv6.h b/contrib/examples/example_app/test_configs/opt_nosys_ipv6.h new file mode 100644 index 00000000..aa6495ba --- /dev/null +++ b/contrib/examples/example_app/test_configs/opt_nosys_ipv6.h @@ -0,0 +1,296 @@ +/* test an lwipopts.h file with default contents */ +#define NO_SYS 0 +#define NO_SYS_NO_TIMERS 0 +#define LWIP_TIMERS 1 +#define LWIP_TIMERS_CUSTOM 0 +#define LWIP_MPU_COMPATIBLE 0 +#define LWIP_TCPIP_CORE_LOCKING 1 +#define LWIP_TCPIP_CORE_LOCKING_INPUT 0 +#define SYS_LIGHTWEIGHT_PROT 1 +#define MEM_LIBC_MALLOC 0 +#define MEMP_MEM_MALLOC 0 +#define MEMP_MEM_INIT 0 +#define MEM_ALIGNMENT 1 +#define MEM_SIZE 1600 +#define MEMP_OVERFLOW_CHECK 0 +#define MEMP_SANITY_CHECK 0 +#define MEM_OVERFLOW_CHECK 0 +#define MEM_SANITY_CHECK 0 +#define MEM_USE_POOLS 0 +#define MEM_USE_POOLS_TRY_BIGGER_POOL 0 +#define MEMP_USE_CUSTOM_POOLS 0 +#define LWIP_ALLOW_MEM_FREE_FROM_OTHER_CONTEXT 0 +/*#define MEMP_NUM_PBUF 16 +#define MEMP_NUM_RAW_PCB 4 +#define MEMP_NUM_UDP_PCB 4 +#define MEMP_NUM_TCP_PCB 5 +#define MEMP_NUM_TCP_PCB_LISTEN 8 +#define MEMP_NUM_TCP_SEG 16 +#define MEMP_NUM_ALTCP_PCB MEMP_NUM_TCP_PCB +#define MEMP_NUM_REASSDATA 5 +#define MEMP_NUM_FRAG_PBUF 15 +#define MEMP_NUM_ARP_QUEUE 30 +#define MEMP_NUM_IGMP_GROUP 8 +#define MEMP_NUM_SYS_TIMEOUT (LWIP_NUM_SYS_TIMEOUT_INTERNAL + 2) +#define MEMP_NUM_NETBUF 2 +#define MEMP_NUM_NETCONN 4 +#define MEMP_NUM_SELECT_CB 4 +#define MEMP_NUM_TCPIP_MSG_API 8 +#define MEMP_NUM_TCPIP_MSG_INPKT 8 +#define MEMP_NUM_NETDB 1 +#define MEMP_NUM_LOCALHOSTLIST 1 +#define PBUF_POOL_SIZE 16 +#define MEMP_NUM_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_DNS_API_MSG MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_SOCKET_SETGETSOCKOPT_DATA MEMP_NUM_TCPIP_MSG_API +#define MEMP_NUM_NETIFAPI_MSG MEMP_NUM_TCPIP_MSG_API*/ +#define LWIP_ARP 1 +#define ARP_TABLE_SIZE 10 +#define ARP_MAXAGE 300 +#define ARP_QUEUEING 0 +#define ARP_QUEUE_LEN 3 +#define ETHARP_SUPPORT_VLAN 0 +#define LWIP_ETHERNET LWIP_ARP +#define ETH_PAD_SIZE 0 +#define ETHARP_SUPPORT_STATIC_ENTRIES 0 +#define ETHARP_TABLE_MATCH_NETIF !LWIP_SINGLE_NETIF +#define LWIP_IPV4 0 +#define IP_FORWARD 0 +#define IP_REASSEMBLY 1 +#define IP_FRAG 1 +#define IP_OPTIONS_ALLOWED 1 +#define IP_REASS_MAXAGE 15 +#define IP_REASS_MAX_PBUFS 10 +#define IP_DEFAULT_TTL 255 +#define IP_SOF_BROADCAST 0 +#define IP_SOF_BROADCAST_RECV 0 +#define IP_FORWARD_ALLOW_TX_ON_RX_NETIF 0 +#define LWIP_ICMP 1 +#define ICMP_TTL (IP_DEFAULT_TTL) +#define LWIP_BROADCAST_PING 0 +#define LWIP_MULTICAST_PING 0 +#define LWIP_RAW 0 +#define RAW_TTL (IP_DEFAULT_TTL) +#define LWIP_DHCP 0 +#define DHCP_DOES_ARP_CHECK ((LWIP_DHCP) && (LWIP_ARP)) +#define LWIP_DHCP_CHECK_LINK_UP 0 +#define LWIP_DHCP_BOOTP_FILE 0 +#define LWIP_DHCP_GET_NTP_SRV 0 +#define LWIP_DHCP_MAX_NTP_SERVERS 1 +#define LWIP_DHCP_MAX_DNS_SERVERS DNS_MAX_SERVERS +#define LWIP_AUTOIP 0 +#define LWIP_DHCP_AUTOIP_COOP 0 +#define LWIP_DHCP_AUTOIP_COOP_TRIES 9 +#define LWIP_MIB2_CALLBACKS 0 +#define LWIP_MULTICAST_TX_OPTIONS ((LWIP_IGMP || LWIP_IPV6_MLD) && (LWIP_UDP || LWIP_RAW)) +#define LWIP_IGMP 0 +#define LWIP_DNS 0 +#define DNS_TABLE_SIZE 4 +#define DNS_MAX_NAME_LENGTH 256 +#define DNS_MAX_SERVERS 2 +#define DNS_MAX_RETRIES 4 +#define DNS_DOES_NAME_CHECK 1 +#define LWIP_DNS_SECURE (LWIP_DNS_SECURE_RAND_XID | LWIP_DNS_SECURE_NO_MULTIPLE_OUTSTANDING | LWIP_DNS_SECURE_RAND_SRC_PORT) +#define DNS_LOCAL_HOSTLIST 0 +#define DNS_LOCAL_HOSTLIST_IS_DYNAMIC 0 +#define LWIP_DNS_SUPPORT_MDNS_QUERIES 0 +#define LWIP_UDP 1 +#define LWIP_UDPLITE 0 +#define UDP_TTL (IP_DEFAULT_TTL) +#define LWIP_NETBUF_RECVINFO 0 +#define LWIP_TCP 1 +#define TCP_TTL (IP_DEFAULT_TTL) +#define TCP_WND (4 * TCP_MSS) +#define TCP_MAXRTX 12 +#define TCP_SYNMAXRTX 6 +#define TCP_QUEUE_OOSEQ (LWIP_TCP) +#define LWIP_TCP_SACK_OUT 0 +#define LWIP_TCP_MAX_SACK_NUM 4 +#define TCP_MSS 536 +#define TCP_CALCULATE_EFF_SEND_MSS 1 +#define TCP_SND_BUF (2 * TCP_MSS) +#define TCP_SND_QUEUELEN ((4 * (TCP_SND_BUF) + (TCP_MSS - 1))/(TCP_MSS)) +#define TCP_SNDLOWAT LWIP_MIN(LWIP_MAX(((TCP_SND_BUF)/2), (2 * TCP_MSS) + 1), (TCP_SND_BUF) - 1) +#define TCP_SNDQUEUELOWAT LWIP_MAX(((TCP_SND_QUEUELEN)/2), 5) +#define TCP_OOSEQ_MAX_BYTES 0 +#define TCP_OOSEQ_BYTES_LIMIT(pcb) TCP_OOSEQ_MAX_BYTES +#define TCP_OOSEQ_MAX_PBUFS 0 +#define TCP_OOSEQ_PBUFS_LIMIT(pcb) TCP_OOSEQ_MAX_PBUFS +#define TCP_LISTEN_BACKLOG 0 +#define TCP_DEFAULT_LISTEN_BACKLOG 0xff +#define TCP_OVERSIZE TCP_MSS +#define LWIP_TCP_TIMESTAMPS 0 +#define TCP_WND_UPDATE_THRESHOLD LWIP_MIN((TCP_WND / 4), (TCP_MSS * 4)) +#define LWIP_EVENT_API 0 +#define LWIP_CALLBACK_API 1 +#define LWIP_WND_SCALE 0 +#define TCP_RCV_SCALE 0 +#define LWIP_TCP_PCB_NUM_EXT_ARGS 0 +#define LWIP_ALTCP 0 +#define LWIP_ALTCP_TLS 0 +#define PBUF_LINK_HLEN (14 + ETH_PAD_SIZE) +#define PBUF_LINK_ENCAPSULATION_HLEN 0 +#define PBUF_POOL_BUFSIZE LWIP_MEM_ALIGN_SIZE(TCP_MSS+40+PBUF_LINK_ENCAPSULATION_HLEN+PBUF_LINK_HLEN) +#define LWIP_PBUF_REF_T u8_t +#define LWIP_SINGLE_NETIF 0 +#define LWIP_NETIF_HOSTNAME 0 +#define LWIP_NETIF_API 0 +#define LWIP_NETIF_STATUS_CALLBACK 0 +#define LWIP_NETIF_EXT_STATUS_CALLBACK 0 +#define LWIP_NETIF_LINK_CALLBACK 0 +#define LWIP_NETIF_REMOVE_CALLBACK 0 +#define LWIP_NETIF_HWADDRHINT 0 +#define LWIP_NETIF_TX_SINGLE_PBUF 0 +#define LWIP_NUM_NETIF_CLIENT_DATA 0 +#define LWIP_HAVE_LOOPIF (LWIP_NETIF_LOOPBACK && !LWIP_SINGLE_NETIF) +#define LWIP_LOOPIF_MULTICAST 0 +#define LWIP_NETIF_LOOPBACK 0 +#define LWIP_LOOPBACK_MAX_PBUFS 0 +#define LWIP_NETIF_LOOPBACK_MULTITHREADING (!NO_SYS) +/*#define TCPIP_THREAD_NAME "tcpip_thread" +#define TCPIP_THREAD_STACKSIZE 0 +#define TCPIP_THREAD_PRIO 1 +#define TCPIP_MBOX_SIZE 0 +#define LWIP_TCPIP_THREAD_ALIVE() +#define SLIPIF_THREAD_NAME "slipif_loop" +#define SLIPIF_THREAD_STACKSIZE 0 +#define SLIPIF_THREAD_PRIO 1 +#define DEFAULT_THREAD_NAME "lwIP" +#define DEFAULT_THREAD_STACKSIZE 0 +#define DEFAULT_THREAD_PRIO 1 +#define DEFAULT_RAW_RECVMBOX_SIZE 0 +#define DEFAULT_UDP_RECVMBOX_SIZE 0 +#define DEFAULT_TCP_RECVMBOX_SIZE 0 +#define DEFAULT_ACCEPTMBOX_SIZE 0*/ +#define LWIP_NETCONN 0 +#define LWIP_TCPIP_TIMEOUT 0 +#define LWIP_NETCONN_SEM_PER_THREAD 0 +#define LWIP_NETCONN_FULLDUPLEX 0 +#define LWIP_SOCKET 0 +#define LWIP_COMPAT_SOCKETS 1 /* 0..2 */ +#define LWIP_POSIX_SOCKETS_IO_NAMES 1 +#define LWIP_SOCKET_OFFSET 0 +#define LWIP_TCP_KEEPALIVE 0 +#define LWIP_SO_SNDTIMEO 0 +#define LWIP_SO_RCVTIMEO 0 +#define LWIP_SO_SNDRCVTIMEO_NONSTANDARD 0 +#define LWIP_SO_RCVBUF 0 +#define LWIP_SO_LINGER 0 +#define RECV_BUFSIZE_DEFAULT INT_MAX +#define LWIP_TCP_CLOSE_TIMEOUT_MS_DEFAULT 20000 +#define SO_REUSE 0 +#define SO_REUSE_RXTOALL 0 +#define LWIP_FIONREAD_LINUXMODE 0 +#define LWIP_SOCKET_SELECT 1 +#define LWIP_SOCKET_POLL 1 +#define LWIP_STATS 1 +#define LWIP_STATS_DISPLAY 0 +#define LINK_STATS 1 +#define ETHARP_STATS (LWIP_ARP) +#define IP_STATS 1 +#define IPFRAG_STATS (IP_REASSEMBLY || IP_FRAG) +#define ICMP_STATS 1 +#define IGMP_STATS (LWIP_IGMP) +#define UDP_STATS (LWIP_UDP) +#define TCP_STATS (LWIP_TCP) +#define MEM_STATS ((MEM_LIBC_MALLOC == 0) && (MEM_USE_POOLS == 0)) +#define MEMP_STATS (MEMP_MEM_MALLOC == 0) +#define SYS_STATS (NO_SYS == 0) +#define IP6_STATS (LWIP_IPV6) +#define ICMP6_STATS (LWIP_IPV6 && LWIP_ICMP6) +#define IP6_FRAG_STATS (LWIP_IPV6 && (LWIP_IPV6_FRAG || LWIP_IPV6_REASS)) +#define MLD6_STATS (LWIP_IPV6 && LWIP_IPV6_MLD) +#define ND6_STATS (LWIP_IPV6) +#define MIB2_STATS 0 +#define LWIP_CHECKSUM_CTRL_PER_NETIF 0 +#define CHECKSUM_GEN_IP 1 +#define CHECKSUM_GEN_UDP 1 +#define CHECKSUM_GEN_TCP 1 +#define CHECKSUM_GEN_ICMP 1 +#define CHECKSUM_GEN_ICMP6 1 +#define CHECKSUM_CHECK_IP 1 +#define CHECKSUM_CHECK_UDP 1 +#define CHECKSUM_CHECK_TCP 1 +#define CHECKSUM_CHECK_ICMP 1 +#define CHECKSUM_CHECK_ICMP6 1 +#define LWIP_CHECKSUM_ON_COPY 0 +#define LWIP_IPV6 1 +#define IPV6_REASS_MAXAGE 60 +#define LWIP_IPV6_SCOPES (LWIP_IPV6 && !LWIP_SINGLE_NETIF) +#define LWIP_IPV6_SCOPES_DEBUG 0 +#define LWIP_IPV6_NUM_ADDRESSES 3 +#define LWIP_IPV6_FORWARD 0 +#define LWIP_IPV6_FRAG 1 +#define LWIP_IPV6_REASS (LWIP_IPV6) +#define LWIP_IPV6_SEND_ROUTER_SOLICIT 1 +#define LWIP_IPV6_AUTOCONFIG (LWIP_IPV6) +#define LWIP_IPV6_ADDRESS_LIFETIMES (LWIP_IPV6_AUTOCONFIG) +#define LWIP_IPV6_DUP_DETECT_ATTEMPTS 1 +#define LWIP_ICMP6 (LWIP_IPV6) +#define LWIP_ICMP6_DATASIZE 8 +#define LWIP_ICMP6_HL 255 +#define LWIP_IPV6_MLD (LWIP_IPV6) +#define MEMP_NUM_MLD6_GROUP 4 +#define LWIP_ND6_QUEUEING (LWIP_IPV6) +#define MEMP_NUM_ND6_QUEUE 20 +#define LWIP_ND6_NUM_NEIGHBORS 10 +#define LWIP_ND6_NUM_DESTINATIONS 10 +#define LWIP_ND6_NUM_PREFIXES 5 +#define LWIP_ND6_NUM_ROUTERS 3 +#define LWIP_ND6_MAX_MULTICAST_SOLICIT 3 +#define LWIP_ND6_MAX_UNICAST_SOLICIT 3 +#define LWIP_ND6_MAX_ANYCAST_DELAY_TIME 1000 +#define LWIP_ND6_MAX_NEIGHBOR_ADVERTISEMENT 3 +#define LWIP_ND6_REACHABLE_TIME 30000 +#define LWIP_ND6_RETRANS_TIMER 1000 +#define LWIP_ND6_DELAY_FIRST_PROBE_TIME 5000 +#define LWIP_ND6_ALLOW_RA_UPDATES 1 +#define LWIP_ND6_TCP_REACHABILITY_HINTS 1 +#define LWIP_ND6_RDNSS_MAX_DNS_SERVERS 0 +#define LWIP_IPV6_DHCP6 0 +#define LWIP_IPV6_DHCP6_STATEFUL 0 +#define LWIP_IPV6_DHCP6_STATELESS LWIP_IPV6_DHCP6 +#define LWIP_DHCP6_GET_NTP_SRV 0 +#define LWIP_DHCP6_MAX_NTP_SERVERS 1 +#define LWIP_DHCP6_MAX_DNS_SERVERS DNS_MAX_SERVERS + +/* TODO: check hooks */ + +#define LWIP_DBG_MIN_LEVEL LWIP_DBG_LEVEL_ALL +#define LWIP_DBG_TYPES_ON LWIP_DBG_ON +#define ETHARP_DEBUG LWIP_DBG_OFF +#define NETIF_DEBUG LWIP_DBG_OFF +#define PBUF_DEBUG LWIP_DBG_OFF +#define API_LIB_DEBUG LWIP_DBG_OFF +#define API_MSG_DEBUG LWIP_DBG_OFF +#define SOCKETS_DEBUG LWIP_DBG_OFF +#define ICMP_DEBUG LWIP_DBG_OFF +#define IGMP_DEBUG LWIP_DBG_OFF +#define INET_DEBUG LWIP_DBG_OFF +#define IP_DEBUG LWIP_DBG_OFF +#define IP_REASS_DEBUG LWIP_DBG_OFF +#define RAW_DEBUG LWIP_DBG_OFF +#define MEM_DEBUG LWIP_DBG_OFF +#define MEMP_DEBUG LWIP_DBG_OFF +#define SYS_DEBUG LWIP_DBG_OFF +#define TIMERS_DEBUG LWIP_DBG_OFF +#define TCP_DEBUG LWIP_DBG_OFF +#define TCP_INPUT_DEBUG LWIP_DBG_OFF +#define TCP_FR_DEBUG LWIP_DBG_OFF +#define TCP_RTO_DEBUG LWIP_DBG_OFF +#define TCP_CWND_DEBUG LWIP_DBG_OFF +#define TCP_WND_DEBUG LWIP_DBG_OFF +#define TCP_OUTPUT_DEBUG LWIP_DBG_OFF +#define TCP_RST_DEBUG LWIP_DBG_OFF +#define TCP_QLEN_DEBUG LWIP_DBG_OFF +#define UDP_DEBUG LWIP_DBG_OFF +#define TCPIP_DEBUG LWIP_DBG_OFF +#define SLIP_DEBUG LWIP_DBG_OFF +#define DHCP_DEBUG LWIP_DBG_OFF +#define AUTOIP_DEBUG LWIP_DBG_OFF +#define DNS_DEBUG LWIP_DBG_OFF +#define IP6_DEBUG LWIP_DBG_OFF +#define DHCP6_DEBUG LWIP_DBG_OFF +#define LWIP_TESTMODE 0 + +#define LWIP_PERF 0 diff --git a/contrib/examples/httpd/cgi_example/cgi_example.c b/contrib/examples/httpd/cgi_example/cgi_example.c new file mode 100644 index 00000000..c9c74763 --- /dev/null +++ b/contrib/examples/httpd/cgi_example/cgi_example.c @@ -0,0 +1,107 @@ +/** + * @file + * HTTPD simple CGI example + * + * This file demonstrates how to add support for basic CGI. + */ + + /* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +#include "lwip/opt.h" +#include "cgi_example.h" + +#include "lwip/apps/httpd.h" + +#include "lwip/def.h" +#include "lwip/mem.h" + +#include +#include + +/** define LWIP_HTTPD_EXAMPLE_CGI_SIMPLE to 1 to enable this cgi example */ +#ifndef LWIP_HTTPD_EXAMPLE_CGI_SIMPLE +#define LWIP_HTTPD_EXAMPLE_CGI_SIMPLE 0 +#endif + +#if LWIP_HTTPD_EXAMPLE_CGI_SIMPLE + +#if !LWIP_HTTPD_CGI +#error LWIP_HTTPD_EXAMPLE_CGI_SIMPLE needs LWIP_HTTPD_CGI +#endif + +static const char *cgi_handler_basic(int iIndex, int iNumParams, char *pcParam[], char *pcValue[]); + +static const tCGI cgi_handlers[] = { + { + "/basic_cgi", + cgi_handler_basic + }, + { + "/basic_cgi_2", + cgi_handler_basic + } +}; + +void +cgi_ex_init(void) +{ + http_set_cgi_handlers(cgi_handlers, LWIP_ARRAYSIZE(cgi_handlers)); +} + +/** This basic CGI function can parse param/value pairs and return an url that + * is sent as a response by httpd. + * + * This example function just checks that the input url has two key value + * parameter pairs: "foo=bar" and "test=123" + * If not, it returns 404 + */ +static const char * +cgi_handler_basic(int iIndex, int iNumParams, char *pcParam[], char *pcValue[]) +{ + LWIP_ASSERT("check index", iIndex < LWIP_ARRAYSIZE(cgi_handlers)); + + if (iNumParams == 2) { + if (!strcmp(pcParam[0], "foo")) { + if (!strcmp(pcValue[0], "bar")) { + if (!strcmp(pcParam[1], "test")) { + if (!strcmp(pcValue[1], "123")) { + return "/index.html"; + } + } + } + } + } + return "/404.html"; +} + +#endif /* LWIP_HTTPD_EXAMPLE_CGI_SIMPLE */ diff --git a/contrib/examples/httpd/cgi_example/cgi_example.h b/contrib/examples/httpd/cgi_example/cgi_example.h new file mode 100644 index 00000000..b655661b --- /dev/null +++ b/contrib/examples/httpd/cgi_example/cgi_example.h @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +#ifndef LWIP_HDR_HTTP_EXAMPLES_CGI_EXAMPLE +#define LWIP_HDR_HTTP_EXAMPLES_CGI_EXAMPLE + +void cgi_ex_init(void); + +#endif /* LWIP_HDR_HTTP_EXAMPLES_CGI_EXAMPLE */ diff --git a/contrib/examples/httpd/examples_fs/404.html b/contrib/examples/httpd/examples_fs/404.html new file mode 100644 index 00000000..40b343a9 --- /dev/null +++ b/contrib/examples/httpd/examples_fs/404.html @@ -0,0 +1,21 @@ + +lwIP - A Lightweight TCP/IP Stack + + + + +
+ SICS logo + +

lwIP - A Lightweight TCP/IP Stack

+

404 - Page not found

+

+ Sorry, the page you are requesting was not found on this + server. +

+ 		+   +
+ + diff --git a/contrib/examples/httpd/examples_fs/img/sics.gif b/contrib/examples/httpd/examples_fs/img/sics.gif new file mode 100644 index 0000000000000000000000000000000000000000..0a4fc7bb07050eec9226ca93bc9ad237f35502c8 GIT binary patch literal 724 zcmZ?wbhEHbbYoCrSjxa~Q`<5tD{KG${gWq8=I7_%uwlcpWy=~G8p_Jb4zT=SA;^3z!7uBu>UZ()&> z+r1;Oh0mFly?klC)5cAV$sD}98F{LBUHERS_hGGKac5`W-mvIltqUt73*&`X?UVf< z%Uqmm^}K~z9MaFS-jwgVGIUF9Z77P_s7Vc}y?@_XT+GT)AcZF$6%$qQsA+Q0bF z!Mss%ktc&>+n*qp2aIzy6-8A8zNf3ovHkU%wPnH@(O;*7g5`QX{a~M@%VFg!JaWkVUk6yFE1wL^V{({yi?^s!by^W;pXIz%mY}~L;uBR^JK|)kW|Avap zVzxyL+2N;b1q1f77^T<4c)gUoN8c;6;F^+^0^VN o#HPS7gPr3^SVM!%(d|c@c+6frXclnOc-SHmma$O4k%7S)08~d;ZvX%Q literal 0 HcmV?d00001 diff --git a/contrib/examples/httpd/examples_fs/index.html b/contrib/examples/httpd/examples_fs/index.html new file mode 100644 index 00000000..ab575ef0 --- /dev/null +++ b/contrib/examples/httpd/examples_fs/index.html @@ -0,0 +1,47 @@ + +lwIP - A Lightweight TCP/IP Stack + + + + +
+ SICS logo + +

lwIP - A Lightweight TCP/IP Stack

+

+ The web page you are watching was served by a simple web + server running on top of the lightweight TCP/IP stack lwIP. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ The focus of the lwIP TCP/IP implementation is to reduce + the RAM usage while still having a full scale TCP. This + makes lwIP suitable for use in embedded systems with tens + of kilobytes of free RAM and room for around 40 kilobytes + of code ROM. +

+

+ More information about lwIP can be found at the lwIP + homepage at http://savannah.nongnu.org/projects/lwip/ + or at the lwIP wiki at http://lwip.wikia.com/. +

+ 		+   +
+ + + diff --git a/contrib/examples/httpd/examples_fs/login.html b/contrib/examples/httpd/examples_fs/login.html new file mode 100644 index 00000000..71c535b4 --- /dev/null +++ b/contrib/examples/httpd/examples_fs/login.html @@ -0,0 +1,28 @@ + +lwIP - A Lightweight TCP/IP Stack + + + + + + + + +
+ SICS logo + +

Login

+
+
+ + + + + +
+
+ 		+   +
+ + diff --git a/contrib/examples/httpd/examples_fs/loginfail.html b/contrib/examples/httpd/examples_fs/loginfail.html new file mode 100644 index 00000000..6d5c742b --- /dev/null +++ b/contrib/examples/httpd/examples_fs/loginfail.html @@ -0,0 +1,25 @@ + +lwIP - A Lightweight TCP/IP Stack + + + + + + + + +
+ SICS logo + +

lwIP - A Lightweight TCP/IP Stack

+

+ Login failed. +

+

+ Click here to retry login. +

+ 		+   +
+ + diff --git a/contrib/examples/httpd/examples_fs/session.html b/contrib/examples/httpd/examples_fs/session.html new file mode 100644 index 00000000..72d3bff9 --- /dev/null +++ b/contrib/examples/httpd/examples_fs/session.html @@ -0,0 +1,25 @@ + +lwIP - A Lightweight TCP/IP Stack + + + + + + + + +
+ SICS logo + +

lwIP - A Lightweight TCP/IP Stack

+

+ Login succeeded, session active. +

+

+ Click here to retry login. +

+ 		+   +
+ + diff --git a/contrib/examples/httpd/examples_fs/ssi.shtml b/contrib/examples/httpd/examples_fs/ssi.shtml new file mode 100644 index 00000000..153d0167 --- /dev/null +++ b/contrib/examples/httpd/examples_fs/ssi.shtml @@ -0,0 +1,315 @@ + +lwIP - A Lightweight TCP/IP Stack + + + + +
+ SICS logo + +

lwIP - A Lightweight TCP/IP Stack

+

+

+ The web page you are watching was served by a simple web + server running on top of the lightweight TCP/IP stack lwIP. +

+

+ This page is here to test SSI, so here is a counter as + an example of content changing for every request: + "" +

+

+ And here is an example of a tag result buffer return in + multiple parts: "" +

+

+ To test LWIP_HTTPD_CGI_SSI, here are the CGI parameters: + +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ lwIP is an open source implementation of the TCP/IP + protocol suite that was originally written by Adam Dunkels + of the Swedish Institute of Computer Science but now is + being actively developed by a team of developers + distributed world-wide. Since it's release, lwIP has + spurred a lot of interest and has been ported to several + platforms and operating systems. lwIP can be used either + with or without an underlying OS. +

+

+ The focus of the lwIP TCP/IP implementation is to reduce + the RAM usage while still having a full scale TCP. This + makes lwIP suitable for use in embedded systems with tens + of kilobytes of free RAM and room for around 40 kilobytes + of code ROM. +

+

+ More information about lwIP can be found at the lwIP + homepage at http://savannah.nongnu.org/projects/lwip/ + or at the lwIP wiki at http://lwip.wikia.com/. +

+ 		+   +
+ + + diff --git a/contrib/examples/httpd/examples_fsdata.c b/contrib/examples/httpd/examples_fsdata.c new file mode 100644 index 00000000..7eed926a --- /dev/null +++ b/contrib/examples/httpd/examples_fsdata.c @@ -0,0 +1,1543 @@ +#include "lwip/apps/fs.h" +#include "lwip/def.h" + + +#define file_NULL (struct fsdata_file *) NULL + + +#ifndef FS_FILE_FLAGS_HEADER_INCLUDED +#define FS_FILE_FLAGS_HEADER_INCLUDED 1 +#endif +#ifndef FS_FILE_FLAGS_HEADER_PERSISTENT +#define FS_FILE_FLAGS_HEADER_PERSISTENT 0 +#endif +/* FSDATA_FILE_ALIGNMENT: 0=off, 1=by variable, 2=by include */ +#ifndef FSDATA_FILE_ALIGNMENT +#define FSDATA_FILE_ALIGNMENT 0 +#endif +#ifndef FSDATA_ALIGN_PRE +#define FSDATA_ALIGN_PRE +#endif +#ifndef FSDATA_ALIGN_POST +#define FSDATA_ALIGN_POST +#endif +#if FSDATA_FILE_ALIGNMENT==2 +#include "fsdata_alignment.h" +#endif +#if FSDATA_FILE_ALIGNMENT==1 +static const unsigned int dummy_align__img_sics_gif = 0; +#endif +static const unsigned char FSDATA_ALIGN_PRE data__img_sics_gif[] FSDATA_ALIGN_POST = { +/* /img/sics.gif (14 chars) */ +0x2f,0x69,0x6d,0x67,0x2f,0x73,0x69,0x63,0x73,0x2e,0x67,0x69,0x66,0x00,0x00,0x00, + +/* HTTP header */ +/* "HTTP/1.1 200 OK +" (17 bytes) */ +0x48,0x54,0x54,0x50,0x2f,0x31,0x2e,0x31,0x20,0x32,0x30,0x30,0x20,0x4f,0x4b,0x0d, +0x0a, +/* "Server: lwIP/2.0.3d (http://savannah.nongnu.org/projects/lwip) +" (64 bytes) */ +0x53,0x65,0x72,0x76,0x65,0x72,0x3a,0x20,0x6c,0x77,0x49,0x50,0x2f,0x32,0x2e,0x30, +0x2e,0x33,0x64,0x20,0x28,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61, +0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e,0x67,0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f, +0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73,0x2f,0x6c,0x77,0x69,0x70,0x29,0x0d,0x0a, + +/* "Content-Length: 724 +" (18+ bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x4c,0x65,0x6e,0x67,0x74,0x68,0x3a,0x20, +0x37,0x32,0x34,0x0d,0x0a, +/* "Connection: keep-alive +" (24 bytes) */ +0x43,0x6f,0x6e,0x6e,0x65,0x63,0x74,0x69,0x6f,0x6e,0x3a,0x20,0x6b,0x65,0x65,0x70, +0x2d,0x61,0x6c,0x69,0x76,0x65,0x0d,0x0a, +/* "Content-Type: image/gif + +" (27 bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x54,0x79,0x70,0x65,0x3a,0x20,0x69,0x6d, +0x61,0x67,0x65,0x2f,0x67,0x69,0x66,0x0d,0x0a,0x0d,0x0a, +/* raw file data (724 bytes) */ +0x47,0x49,0x46,0x38,0x39,0x61,0x46,0x00,0x22,0x00,0xa5,0x00,0x00,0xd9,0x2b,0x39, +0x6a,0x6a,0x6a,0xbf,0xbf,0xbf,0x93,0x93,0x93,0x0f,0x0f,0x0f,0xb0,0xb0,0xb0,0xa6, +0xa6,0xa6,0x80,0x80,0x80,0x76,0x76,0x76,0x1e,0x1e,0x1e,0x9d,0x9d,0x9d,0x2e,0x2e, +0x2e,0x49,0x49,0x49,0x54,0x54,0x54,0x8a,0x8a,0x8a,0x60,0x60,0x60,0xc6,0xa6,0x99, +0xbd,0xb5,0xb2,0xc2,0xab,0xa1,0xd9,0x41,0x40,0xd5,0x67,0x55,0xc0,0xb0,0xaa,0xd5, +0x5e,0x4e,0xd6,0x50,0x45,0xcc,0x93,0x7d,0xc8,0xa1,0x90,0xce,0x8b,0x76,0xd2,0x7b, +0x65,0xd1,0x84,0x6d,0xc9,0x99,0x86,0x3a,0x3a,0x3a,0x00,0x00,0x00,0xb8,0xb8,0xb8, +0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff, +0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff, +0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff, +0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff, +0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff, +0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x2c,0x00,0x00, +0x00,0x00,0x46,0x00,0x22,0x00,0x00,0x06,0xfe,0x40,0x90,0x70,0x48,0x2c,0x1a,0x8f, +0xc8,0xa4,0x72,0xc9,0x6c,0x3a,0x9f,0xd0,0xa8,0x74,0x4a,0xad,0x5a,0xaf,0xd8,0xac, +0x76,0xa9,0x40,0x04,0xbe,0x83,0xe2,0x60,0x3c,0x50,0x20,0x0d,0x8e,0x6f,0x00,0x31, +0x28,0x1c,0x0d,0x07,0xb5,0xc3,0x60,0x75,0x24,0x3e,0xf8,0xfc,0x87,0x11,0x06,0xe9, +0x3d,0x46,0x07,0x0b,0x7a,0x7a,0x7c,0x43,0x06,0x1e,0x84,0x78,0x0b,0x07,0x6e,0x51, +0x01,0x8a,0x84,0x08,0x7e,0x79,0x80,0x87,0x89,0x91,0x7a,0x93,0x0a,0x04,0x99,0x78, +0x96,0x4f,0x03,0x9e,0x79,0x01,0x94,0x9f,0x43,0x9c,0xa3,0xa4,0x05,0x77,0xa3,0xa0, +0x4e,0x98,0x79,0x0b,0x1e,0x83,0xa4,0xa6,0x1f,0x96,0x05,0x9d,0xaa,0x78,0x01,0x07, +0x84,0x04,0x1e,0x1e,0xbb,0xb8,0x51,0x84,0x0e,0x43,0x05,0x07,0x77,0xa5,0x7f,0x42, +0xb1,0xb2,0x01,0x63,0x08,0x0d,0xbb,0x01,0x0c,0x7a,0x0d,0x44,0x0e,0xd8,0xaf,0x4c, +0x05,0x7a,0x04,0x47,0x07,0x07,0xb7,0x80,0xa2,0xe1,0x7d,0x44,0x05,0x01,0x04,0x01, +0xd0,0xea,0x87,0x93,0x4f,0xe0,0x9a,0x49,0xce,0xd8,0x79,0x04,0x66,0x20,0x15,0x10, +0x10,0x11,0x92,0x29,0x80,0xb6,0xc0,0x91,0x15,0x45,0x1e,0x90,0x19,0x71,0x46,0xa8, +0x5c,0x04,0x0e,0x00,0x22,0x4e,0xe8,0x40,0x24,0x9f,0x3e,0x04,0x06,0xa7,0x58,0xd4, +0x93,0xa0,0x1c,0x91,0x3f,0xe8,0xf0,0x88,0x03,0xb1,0x21,0xa2,0x49,0x00,0x19,0x86, +0xfc,0x52,0x44,0xe0,0x01,0x9d,0x29,0x21,0x15,0x25,0x50,0xf7,0x67,0x25,0x1e,0x06, +0xfd,0x4e,0x9a,0xb4,0x90,0xac,0x15,0xfa,0xcb,0x52,0x53,0x1e,0x8c,0xf2,0xf8,0x07, +0x92,0x2d,0x08,0x3a,0x4d,0x12,0x49,0x95,0x49,0xdb,0x14,0x04,0xc4,0x14,0x85,0x29, +0xaa,0xe7,0x01,0x08,0xa4,0x49,0x01,0x14,0x51,0xe0,0x53,0x91,0xd5,0x29,0x06,0x1a, +0x64,0x02,0xf4,0xc7,0x81,0x9e,0x05,0x20,0x22,0x64,0xa5,0x30,0xae,0xab,0x9e,0x97, +0x53,0xd8,0xb9,0xfd,0x50,0xef,0x93,0x02,0x42,0x74,0x34,0xe8,0x9c,0x20,0x21,0xc9, +0x01,0x68,0x78,0xe6,0x55,0x29,0x20,0x56,0x4f,0x4c,0x40,0x51,0x71,0x82,0xc0,0x70, +0x21,0x22,0x85,0xbe,0x4b,0x1c,0x44,0x05,0xea,0xa4,0x01,0xbf,0x22,0xb5,0xf0,0x1c, +0x06,0x51,0x38,0x8f,0xe0,0x22,0xec,0x18,0xac,0x39,0x22,0xd4,0xd6,0x93,0x44,0x01, +0x32,0x82,0xc8,0xfc,0x61,0xb3,0x01,0x45,0x0c,0x2e,0x83,0x30,0xd0,0x0e,0x17,0x24, +0x0f,0x70,0x85,0x94,0xee,0x05,0x05,0x53,0x4b,0x32,0x1b,0x3f,0x98,0xd3,0x1d,0x29, +0x81,0xb0,0xae,0x1e,0x8c,0x7e,0x68,0xe0,0x60,0x5a,0x54,0x8f,0xb0,0x78,0x69,0x73, +0x06,0xa2,0x00,0x6b,0x57,0xca,0x3d,0x11,0x50,0xbd,0x04,0x30,0x4b,0x3a,0xd4,0xab, +0x5f,0x1f,0x9b,0x3d,0x13,0x74,0x27,0x88,0x3c,0x25,0xe0,0x17,0xbe,0x7a,0x79,0x45, +0x0d,0x0c,0xb0,0x8b,0xda,0x90,0xca,0x80,0x06,0x5d,0x17,0x60,0x1c,0x22,0x4c,0xd8, +0x57,0x22,0x06,0x20,0x00,0x98,0x07,0x08,0xe4,0x56,0x80,0x80,0x1c,0xc5,0xb7,0xc5, +0x82,0x0c,0x36,0xe8,0xe0,0x83,0x10,0x46,0x28,0xe1,0x84,0x14,0x56,0x68,0xa1,0x10, +0x41,0x00,0x00,0x3b,}; + +#if FSDATA_FILE_ALIGNMENT==1 +static const unsigned int dummy_align__404_html = 1; +#endif +static const unsigned char FSDATA_ALIGN_PRE data__404_html[] FSDATA_ALIGN_POST = { +/* /404.html (10 chars) */ +0x2f,0x34,0x30,0x34,0x2e,0x68,0x74,0x6d,0x6c,0x00,0x00,0x00, + +/* HTTP header */ +/* "HTTP/1.1 404 File not found +" (29 bytes) */ +0x48,0x54,0x54,0x50,0x2f,0x31,0x2e,0x31,0x20,0x34,0x30,0x34,0x20,0x46,0x69,0x6c, +0x65,0x20,0x6e,0x6f,0x74,0x20,0x66,0x6f,0x75,0x6e,0x64,0x0d,0x0a, +/* "Server: lwIP/2.0.3d (http://savannah.nongnu.org/projects/lwip) +" (64 bytes) */ +0x53,0x65,0x72,0x76,0x65,0x72,0x3a,0x20,0x6c,0x77,0x49,0x50,0x2f,0x32,0x2e,0x30, +0x2e,0x33,0x64,0x20,0x28,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61, +0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e,0x67,0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f, +0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73,0x2f,0x6c,0x77,0x69,0x70,0x29,0x0d,0x0a, + +/* "Content-Length: 565 +" (18+ bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x4c,0x65,0x6e,0x67,0x74,0x68,0x3a,0x20, +0x35,0x36,0x35,0x0d,0x0a, +/* "Connection: keep-alive +" (24 bytes) */ +0x43,0x6f,0x6e,0x6e,0x65,0x63,0x74,0x69,0x6f,0x6e,0x3a,0x20,0x6b,0x65,0x65,0x70, +0x2d,0x61,0x6c,0x69,0x76,0x65,0x0d,0x0a, +/* "Content-Type: text/html + +" (27 bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x54,0x79,0x70,0x65,0x3a,0x20,0x74,0x65, +0x78,0x74,0x2f,0x68,0x74,0x6d,0x6c,0x0d,0x0a,0x0d,0x0a, +/* raw file data (565 bytes) */ +0x3c,0x68,0x74,0x6d,0x6c,0x3e,0x0d,0x0a,0x3c,0x68,0x65,0x61,0x64,0x3e,0x3c,0x74, +0x69,0x74,0x6c,0x65,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c,0x69, +0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49,0x50, +0x20,0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x74,0x69,0x74,0x6c,0x65,0x3e,0x3c,0x2f, +0x68,0x65,0x61,0x64,0x3e,0x0d,0x0a,0x3c,0x62,0x6f,0x64,0x79,0x20,0x62,0x67,0x63, +0x6f,0x6c,0x6f,0x72,0x3d,0x22,0x77,0x68,0x69,0x74,0x65,0x22,0x20,0x74,0x65,0x78, +0x74,0x3d,0x22,0x62,0x6c,0x61,0x63,0x6b,0x22,0x3e,0x0d,0x0a,0x0d,0x0a,0x20,0x20, +0x20,0x20,0x3c,0x74,0x61,0x62,0x6c,0x65,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22, +0x31,0x30,0x30,0x25,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x20,0x3c,0x74, +0x72,0x20,0x76,0x61,0x6c,0x69,0x67,0x6e,0x3d,0x22,0x74,0x6f,0x70,0x22,0x3e,0x3c, +0x74,0x64,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22,0x38,0x30,0x22,0x3e,0x09,0x20, +0x20,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x61,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68, +0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73, +0x65,0x2f,0x22,0x3e,0x3c,0x69,0x6d,0x67,0x20,0x73,0x72,0x63,0x3d,0x22,0x2f,0x69, +0x6d,0x67,0x2f,0x73,0x69,0x63,0x73,0x2e,0x67,0x69,0x66,0x22,0x0d,0x0a,0x09,0x20, +0x20,0x62,0x6f,0x72,0x64,0x65,0x72,0x3d,0x22,0x30,0x22,0x20,0x61,0x6c,0x74,0x3d, +0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f,0x67,0x6f,0x22,0x20,0x74,0x69,0x74,0x6c, +0x65,0x3d,0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f,0x67,0x6f,0x22,0x3e,0x3c,0x2f, +0x61,0x3e,0x0d,0x0a,0x09,0x3c,0x2f,0x74,0x64,0x3e,0x3c,0x74,0x64,0x20,0x77,0x69, +0x64,0x74,0x68,0x3d,0x22,0x35,0x30,0x30,0x22,0x3e,0x09,0x20,0x20,0x0d,0x0a,0x09, +0x20,0x20,0x3c,0x68,0x31,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c, +0x69,0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49, +0x50,0x20,0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x68,0x31,0x3e,0x0d,0x0a,0x09,0x20, +0x20,0x3c,0x68,0x32,0x3e,0x34,0x30,0x34,0x20,0x2d,0x20,0x50,0x61,0x67,0x65,0x20, +0x6e,0x6f,0x74,0x20,0x66,0x6f,0x75,0x6e,0x64,0x3c,0x2f,0x68,0x32,0x3e,0x0d,0x0a, +0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x53,0x6f,0x72, +0x72,0x79,0x2c,0x20,0x74,0x68,0x65,0x20,0x70,0x61,0x67,0x65,0x20,0x79,0x6f,0x75, +0x20,0x61,0x72,0x65,0x20,0x72,0x65,0x71,0x75,0x65,0x73,0x74,0x69,0x6e,0x67,0x20, +0x77,0x61,0x73,0x20,0x6e,0x6f,0x74,0x20,0x66,0x6f,0x75,0x6e,0x64,0x20,0x6f,0x6e, +0x20,0x74,0x68,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x65,0x72,0x76, +0x65,0x72,0x2e,0x20,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09, +0x3c,0x2f,0x74,0x64,0x3e,0x3c,0x74,0x64,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x26,0x6e, +0x62,0x73,0x70,0x3b,0x0d,0x0a,0x09,0x3c,0x2f,0x74,0x64,0x3e,0x3c,0x2f,0x74,0x72, +0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x20,0x3c,0x2f,0x74,0x61,0x62,0x6c,0x65, +0x3e,0x0d,0x0a,0x3c,0x2f,0x62,0x6f,0x64,0x79,0x3e,0x0d,0x0a,0x3c,0x2f,0x68,0x74, +0x6d,0x6c,0x3e,0x0d,0x0a,}; + +#if FSDATA_FILE_ALIGNMENT==1 +static const unsigned int dummy_align__index_html = 2; +#endif +static const unsigned char FSDATA_ALIGN_PRE data__index_html[] FSDATA_ALIGN_POST = { +/* /index.html (12 chars) */ +0x2f,0x69,0x6e,0x64,0x65,0x78,0x2e,0x68,0x74,0x6d,0x6c,0x00, + +/* HTTP header */ +/* "HTTP/1.1 200 OK +" (17 bytes) */ +0x48,0x54,0x54,0x50,0x2f,0x31,0x2e,0x31,0x20,0x32,0x30,0x30,0x20,0x4f,0x4b,0x0d, +0x0a, +/* "Server: lwIP/2.0.3d (http://savannah.nongnu.org/projects/lwip) +" (64 bytes) */ +0x53,0x65,0x72,0x76,0x65,0x72,0x3a,0x20,0x6c,0x77,0x49,0x50,0x2f,0x32,0x2e,0x30, +0x2e,0x33,0x64,0x20,0x28,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61, +0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e,0x67,0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f, +0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73,0x2f,0x6c,0x77,0x69,0x70,0x29,0x0d,0x0a, + +/* "Content-Length: 1751 +" (18+ bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x4c,0x65,0x6e,0x67,0x74,0x68,0x3a,0x20, +0x31,0x37,0x35,0x31,0x0d,0x0a, +/* "Connection: keep-alive +" (24 bytes) */ +0x43,0x6f,0x6e,0x6e,0x65,0x63,0x74,0x69,0x6f,0x6e,0x3a,0x20,0x6b,0x65,0x65,0x70, +0x2d,0x61,0x6c,0x69,0x76,0x65,0x0d,0x0a, +/* "Content-Type: text/html + +" (27 bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x54,0x79,0x70,0x65,0x3a,0x20,0x74,0x65, +0x78,0x74,0x2f,0x68,0x74,0x6d,0x6c,0x0d,0x0a,0x0d,0x0a, +/* raw file data (1751 bytes) */ +0x3c,0x68,0x74,0x6d,0x6c,0x3e,0x0d,0x0a,0x3c,0x68,0x65,0x61,0x64,0x3e,0x3c,0x74, +0x69,0x74,0x6c,0x65,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c,0x69, +0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49,0x50, +0x20,0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x74,0x69,0x74,0x6c,0x65,0x3e,0x3c,0x2f, +0x68,0x65,0x61,0x64,0x3e,0x0d,0x0a,0x3c,0x62,0x6f,0x64,0x79,0x20,0x62,0x67,0x63, +0x6f,0x6c,0x6f,0x72,0x3d,0x22,0x77,0x68,0x69,0x74,0x65,0x22,0x20,0x74,0x65,0x78, +0x74,0x3d,0x22,0x62,0x6c,0x61,0x63,0x6b,0x22,0x3e,0x0d,0x0a,0x0d,0x0a,0x20,0x20, +0x20,0x20,0x3c,0x74,0x61,0x62,0x6c,0x65,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22, +0x31,0x30,0x30,0x25,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x20,0x3c,0x74, +0x72,0x20,0x76,0x61,0x6c,0x69,0x67,0x6e,0x3d,0x22,0x74,0x6f,0x70,0x22,0x3e,0x3c, +0x74,0x64,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22,0x38,0x30,0x22,0x3e,0x09,0x20, +0x20,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x61,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68, +0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73, +0x65,0x2f,0x22,0x3e,0x3c,0x69,0x6d,0x67,0x20,0x73,0x72,0x63,0x3d,0x22,0x2f,0x69, +0x6d,0x67,0x2f,0x73,0x69,0x63,0x73,0x2e,0x67,0x69,0x66,0x22,0x0d,0x0a,0x09,0x20, +0x20,0x62,0x6f,0x72,0x64,0x65,0x72,0x3d,0x22,0x30,0x22,0x20,0x61,0x6c,0x74,0x3d, +0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f,0x67,0x6f,0x22,0x20,0x74,0x69,0x74,0x6c, +0x65,0x3d,0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f,0x67,0x6f,0x22,0x3e,0x3c,0x2f, +0x61,0x3e,0x0d,0x0a,0x09,0x3c,0x2f,0x74,0x64,0x3e,0x3c,0x74,0x64,0x20,0x77,0x69, +0x64,0x74,0x68,0x3d,0x22,0x35,0x30,0x30,0x22,0x3e,0x09,0x20,0x20,0x0d,0x0a,0x09, +0x20,0x20,0x3c,0x68,0x31,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c, +0x69,0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49, +0x50,0x20,0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x68,0x31,0x3e,0x0d,0x0a,0x09,0x20, +0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x54,0x68,0x65,0x20,0x77, +0x65,0x62,0x20,0x70,0x61,0x67,0x65,0x20,0x79,0x6f,0x75,0x20,0x61,0x72,0x65,0x20, +0x77,0x61,0x74,0x63,0x68,0x69,0x6e,0x67,0x20,0x77,0x61,0x73,0x20,0x73,0x65,0x72, +0x76,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x73,0x69,0x6d,0x70,0x6c,0x65,0x20, +0x77,0x65,0x62,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x65,0x72,0x76,0x65,0x72, +0x20,0x72,0x75,0x6e,0x6e,0x69,0x6e,0x67,0x20,0x6f,0x6e,0x20,0x74,0x6f,0x70,0x20, +0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x6c,0x69,0x67,0x68,0x74,0x77,0x65,0x69,0x67, +0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x20,0x73,0x74,0x61,0x63,0x6b,0x20, +0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68, +0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73, +0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x6c, +0x77,0x49,0x50,0x3c,0x2f,0x61,0x3e,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70, +0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20, +0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74, +0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50, +0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63, +0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61, +0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69, +0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77, +0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f, +0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b, +0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65, +0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75, +0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53, +0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e, +0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e, +0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c, +0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f, +0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77, +0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65, +0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c, +0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70, +0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69, +0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20, +0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73, +0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61, +0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61, +0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77, +0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65, +0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68, +0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75, +0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09, +0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x54,0x68,0x65,0x20,0x66,0x6f,0x63,0x75,0x73,0x20,0x6f, +0x66,0x20,0x74,0x68,0x65,0x20,0x6c,0x77,0x49,0x50,0x20,0x54,0x43,0x50,0x2f,0x49, +0x50,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e, +0x20,0x69,0x73,0x20,0x74,0x6f,0x20,0x72,0x65,0x64,0x75,0x63,0x65,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x74,0x68,0x65,0x20,0x52,0x41,0x4d,0x20,0x75,0x73,0x61,0x67, +0x65,0x20,0x77,0x68,0x69,0x6c,0x65,0x20,0x73,0x74,0x69,0x6c,0x6c,0x20,0x68,0x61, +0x76,0x69,0x6e,0x67,0x20,0x61,0x20,0x66,0x75,0x6c,0x6c,0x20,0x73,0x63,0x61,0x6c, +0x65,0x20,0x54,0x43,0x50,0x2e,0x20,0x54,0x68,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x6d,0x61,0x6b,0x65,0x73,0x20,0x6c,0x77,0x49,0x50,0x20,0x73,0x75,0x69, +0x74,0x61,0x62,0x6c,0x65,0x20,0x66,0x6f,0x72,0x20,0x75,0x73,0x65,0x20,0x69,0x6e, +0x20,0x65,0x6d,0x62,0x65,0x64,0x64,0x65,0x64,0x20,0x73,0x79,0x73,0x74,0x65,0x6d, +0x73,0x20,0x77,0x69,0x74,0x68,0x20,0x74,0x65,0x6e,0x73,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x6f,0x66,0x20,0x6b,0x69,0x6c,0x6f,0x62,0x79,0x74,0x65,0x73,0x20,0x6f, +0x66,0x20,0x66,0x72,0x65,0x65,0x20,0x52,0x41,0x4d,0x20,0x61,0x6e,0x64,0x20,0x72, +0x6f,0x6f,0x6d,0x20,0x66,0x6f,0x72,0x20,0x61,0x72,0x6f,0x75,0x6e,0x64,0x20,0x34, +0x30,0x20,0x6b,0x69,0x6c,0x6f,0x62,0x79,0x74,0x65,0x73,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x6f,0x66,0x20,0x63,0x6f,0x64,0x65,0x20,0x52,0x4f,0x4d,0x2e,0x0d,0x0a, +0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x4d,0x6f,0x72,0x65,0x20,0x69,0x6e,0x66,0x6f,0x72, +0x6d,0x61,0x74,0x69,0x6f,0x6e,0x20,0x61,0x62,0x6f,0x75,0x74,0x20,0x6c,0x77,0x49, +0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x66,0x6f,0x75,0x6e,0x64,0x20,0x61, +0x74,0x20,0x74,0x68,0x65,0x20,0x6c,0x77,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x68,0x6f,0x6d,0x65,0x70,0x61,0x67,0x65,0x20,0x61,0x74,0x20,0x3c,0x61,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70, +0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61,0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e,0x67, +0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f,0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73,0x2f, +0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x73,0x61, +0x76,0x61,0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e,0x67,0x6e,0x75,0x2e,0x6f,0x72, +0x67,0x2f,0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73,0x2f,0x6c,0x77,0x69,0x70,0x2f, +0x3c,0x2f,0x61,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x72,0x20,0x61,0x74, +0x20,0x74,0x68,0x65,0x20,0x6c,0x77,0x49,0x50,0x20,0x77,0x69,0x6b,0x69,0x20,0x61, +0x74,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d, +0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x6c,0x77,0x69,0x70,0x2e,0x77,0x69,0x6b, +0x69,0x61,0x2e,0x63,0x6f,0x6d,0x2f,0x22,0x3e,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f, +0x6c,0x77,0x69,0x70,0x2e,0x77,0x69,0x6b,0x69,0x61,0x2e,0x63,0x6f,0x6d,0x2f,0x3c, +0x2f,0x61,0x3e,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09, +0x3c,0x2f,0x74,0x64,0x3e,0x3c,0x74,0x64,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x26,0x6e, +0x62,0x73,0x70,0x3b,0x0d,0x0a,0x09,0x3c,0x2f,0x74,0x64,0x3e,0x3c,0x2f,0x74,0x72, +0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x20,0x3c,0x2f,0x74,0x61,0x62,0x6c,0x65, +0x3e,0x0d,0x0a,0x3c,0x2f,0x62,0x6f,0x64,0x79,0x3e,0x0d,0x0a,0x3c,0x2f,0x68,0x74, +0x6d,0x6c,0x3e,0x0d,0x0a,0x0d,0x0a,}; + +#if FSDATA_FILE_ALIGNMENT==1 +static const unsigned int dummy_align__login_html = 3; +#endif +static const unsigned char FSDATA_ALIGN_PRE data__login_html[] FSDATA_ALIGN_POST = { +/* /login.html (12 chars) */ +0x2f,0x6c,0x6f,0x67,0x69,0x6e,0x2e,0x68,0x74,0x6d,0x6c,0x00, + +/* HTTP header */ +/* "HTTP/1.1 200 OK +" (17 bytes) */ +0x48,0x54,0x54,0x50,0x2f,0x31,0x2e,0x31,0x20,0x32,0x30,0x30,0x20,0x4f,0x4b,0x0d, +0x0a, +/* "Server: lwIP/2.0.3d (http://savannah.nongnu.org/projects/lwip) +" (64 bytes) */ +0x53,0x65,0x72,0x76,0x65,0x72,0x3a,0x20,0x6c,0x77,0x49,0x50,0x2f,0x32,0x2e,0x30, +0x2e,0x33,0x64,0x20,0x28,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61, +0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e,0x67,0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f, +0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73,0x2f,0x6c,0x77,0x69,0x70,0x29,0x0d,0x0a, + +/* "Content-Length: 768 +" (18+ bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x4c,0x65,0x6e,0x67,0x74,0x68,0x3a,0x20, +0x37,0x36,0x38,0x0d,0x0a, +/* "Connection: keep-alive +" (24 bytes) */ +0x43,0x6f,0x6e,0x6e,0x65,0x63,0x74,0x69,0x6f,0x6e,0x3a,0x20,0x6b,0x65,0x65,0x70, +0x2d,0x61,0x6c,0x69,0x76,0x65,0x0d,0x0a, +/* "Content-Type: text/html + +" (27 bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x54,0x79,0x70,0x65,0x3a,0x20,0x74,0x65, +0x78,0x74,0x2f,0x68,0x74,0x6d,0x6c,0x0d,0x0a,0x0d,0x0a, +/* raw file data (768 bytes) */ +0x3c,0x68,0x74,0x6d,0x6c,0x3e,0x0d,0x0a,0x3c,0x68,0x65,0x61,0x64,0x3e,0x3c,0x74, +0x69,0x74,0x6c,0x65,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c,0x69, +0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49,0x50, +0x20,0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x74,0x69,0x74,0x6c,0x65,0x3e,0x3c,0x2f, +0x68,0x65,0x61,0x64,0x3e,0x0d,0x0a,0x3c,0x62,0x6f,0x64,0x79,0x20,0x62,0x67,0x63, +0x6f,0x6c,0x6f,0x72,0x3d,0x22,0x77,0x68,0x69,0x74,0x65,0x22,0x20,0x74,0x65,0x78, +0x74,0x3d,0x22,0x62,0x6c,0x61,0x63,0x6b,0x22,0x3e,0x0d,0x0a,0x0d,0x0a,0x3c,0x74, +0x61,0x62,0x6c,0x65,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22,0x31,0x30,0x30,0x25, +0x22,0x3e,0x0d,0x0a,0x20,0x3c,0x74,0x72,0x20,0x76,0x61,0x6c,0x69,0x67,0x6e,0x3d, +0x22,0x74,0x6f,0x70,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x3c,0x74,0x64,0x20,0x77,0x69, +0x64,0x74,0x68,0x3d,0x22,0x38,0x30,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x61, +0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77, +0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x22,0x3e,0x3c,0x69,0x6d,0x67, +0x20,0x73,0x72,0x63,0x3d,0x22,0x2f,0x69,0x6d,0x67,0x2f,0x73,0x69,0x63,0x73,0x2e, +0x67,0x69,0x66,0x22,0x20,0x62,0x6f,0x72,0x64,0x65,0x72,0x3d,0x22,0x30,0x22,0x20, +0x61,0x6c,0x74,0x3d,0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f,0x67,0x6f,0x22,0x20, +0x74,0x69,0x74,0x6c,0x65,0x3d,0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f,0x67,0x6f, +0x22,0x2f,0x3e,0x3c,0x2f,0x61,0x3e,0x0d,0x0a,0x20,0x20,0x3c,0x2f,0x74,0x64,0x3e, +0x0d,0x0a,0x20,0x20,0x3c,0x74,0x64,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22,0x35, +0x30,0x30,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x68,0x31,0x3e,0x4c,0x6f,0x67, +0x69,0x6e,0x3c,0x2f,0x68,0x31,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x66,0x6f,0x72, +0x6d,0x20,0x6e,0x61,0x6d,0x65,0x3d,0x22,0x6c,0x6f,0x67,0x69,0x6e,0x22,0x20,0x61, +0x63,0x74,0x69,0x6f,0x6e,0x3d,0x22,0x6c,0x6f,0x67,0x69,0x6e,0x2e,0x63,0x67,0x69, +0x22,0x20,0x6d,0x65,0x74,0x68,0x6f,0x64,0x3d,0x22,0x70,0x6f,0x73,0x74,0x22,0x3e, +0x0d,0x0a,0x20,0x20,0x20,0x20,0x3c,0x64,0x69,0x76,0x3e,0x0d,0x0a,0x20,0x20,0x20, +0x20,0x20,0x3c,0x6c,0x61,0x62,0x65,0x6c,0x3e,0x3c,0x62,0x3e,0x55,0x73,0x65,0x72, +0x6e,0x61,0x6d,0x65,0x3c,0x2f,0x62,0x3e,0x3c,0x2f,0x6c,0x61,0x62,0x65,0x6c,0x3e, +0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x3c,0x69,0x6e,0x70,0x75,0x74,0x20,0x74,0x79, +0x70,0x65,0x3d,0x22,0x74,0x65,0x78,0x74,0x22,0x20,0x70,0x6c,0x61,0x63,0x65,0x68, +0x6f,0x6c,0x64,0x65,0x72,0x3d,0x22,0x45,0x6e,0x74,0x65,0x72,0x20,0x55,0x73,0x65, +0x72,0x6e,0x61,0x6d,0x65,0x22,0x20,0x6e,0x61,0x6d,0x65,0x3d,0x22,0x75,0x73,0x65, +0x72,0x22,0x20,0x72,0x65,0x71,0x75,0x69,0x72,0x65,0x64,0x3e,0x0d,0x0a,0x20,0x20, +0x20,0x20,0x20,0x3c,0x6c,0x61,0x62,0x65,0x6c,0x3e,0x3c,0x62,0x3e,0x50,0x61,0x73, +0x73,0x77,0x6f,0x72,0x64,0x3c,0x2f,0x62,0x3e,0x3c,0x2f,0x6c,0x61,0x62,0x65,0x6c, +0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x3c,0x69,0x6e,0x70,0x75,0x74,0x20,0x74, +0x79,0x70,0x65,0x3d,0x22,0x70,0x61,0x73,0x73,0x77,0x6f,0x72,0x64,0x22,0x20,0x70, +0x6c,0x61,0x63,0x65,0x68,0x6f,0x6c,0x64,0x65,0x72,0x3d,0x22,0x45,0x6e,0x74,0x65, +0x72,0x20,0x50,0x61,0x73,0x73,0x77,0x6f,0x72,0x64,0x22,0x20,0x6e,0x61,0x6d,0x65, +0x3d,0x22,0x70,0x61,0x73,0x73,0x22,0x20,0x72,0x65,0x71,0x75,0x69,0x72,0x65,0x64, +0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x3c,0x62,0x75,0x74,0x74,0x6f,0x6e,0x20, +0x74,0x79,0x70,0x65,0x3d,0x22,0x73,0x75,0x62,0x6d,0x69,0x74,0x22,0x3e,0x4c,0x6f, +0x67,0x69,0x6e,0x3c,0x2f,0x62,0x75,0x74,0x74,0x6f,0x6e,0x3e,0x0d,0x0a,0x20,0x20, +0x20,0x20,0x3c,0x2f,0x64,0x69,0x76,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x2f,0x66, +0x6f,0x72,0x6d,0x3e,0x20,0x0d,0x0a,0x20,0x20,0x3c,0x2f,0x74,0x64,0x3e,0x0d,0x0a, +0x20,0x20,0x3c,0x74,0x64,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x26,0x6e,0x62,0x73,0x70, +0x3b,0x0d,0x0a,0x20,0x20,0x3c,0x2f,0x74,0x64,0x3e,0x0d,0x0a,0x20,0x3c,0x2f,0x74, +0x72,0x3e,0x0d,0x0a,0x3c,0x2f,0x74,0x61,0x62,0x6c,0x65,0x3e,0x0d,0x0a,0x3c,0x2f, +0x62,0x6f,0x64,0x79,0x3e,0x0d,0x0a,0x3c,0x2f,0x68,0x74,0x6d,0x6c,0x3e,0x0d,0x0a, +}; + +#if FSDATA_FILE_ALIGNMENT==1 +static const unsigned int dummy_align__loginfail_html = 4; +#endif +static const unsigned char FSDATA_ALIGN_PRE data__loginfail_html[] FSDATA_ALIGN_POST = { +/* /loginfail.html (16 chars) */ +0x2f,0x6c,0x6f,0x67,0x69,0x6e,0x66,0x61,0x69,0x6c,0x2e,0x68,0x74,0x6d,0x6c,0x00, + + +/* HTTP header */ +/* "HTTP/1.1 200 OK +" (17 bytes) */ +0x48,0x54,0x54,0x50,0x2f,0x31,0x2e,0x31,0x20,0x32,0x30,0x30,0x20,0x4f,0x4b,0x0d, +0x0a, +/* "Server: lwIP/2.0.3d (http://savannah.nongnu.org/projects/lwip) +" (64 bytes) */ +0x53,0x65,0x72,0x76,0x65,0x72,0x3a,0x20,0x6c,0x77,0x49,0x50,0x2f,0x32,0x2e,0x30, +0x2e,0x33,0x64,0x20,0x28,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61, +0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e,0x67,0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f, +0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73,0x2f,0x6c,0x77,0x69,0x70,0x29,0x0d,0x0a, + +/* "Content-Length: 559 +" (18+ bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x4c,0x65,0x6e,0x67,0x74,0x68,0x3a,0x20, +0x35,0x35,0x39,0x0d,0x0a, +/* "Connection: keep-alive +" (24 bytes) */ +0x43,0x6f,0x6e,0x6e,0x65,0x63,0x74,0x69,0x6f,0x6e,0x3a,0x20,0x6b,0x65,0x65,0x70, +0x2d,0x61,0x6c,0x69,0x76,0x65,0x0d,0x0a, +/* "Content-Type: text/html + +" (27 bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x54,0x79,0x70,0x65,0x3a,0x20,0x74,0x65, +0x78,0x74,0x2f,0x68,0x74,0x6d,0x6c,0x0d,0x0a,0x0d,0x0a, +/* raw file data (559 bytes) */ +0x3c,0x68,0x74,0x6d,0x6c,0x3e,0x0d,0x0a,0x3c,0x68,0x65,0x61,0x64,0x3e,0x3c,0x74, +0x69,0x74,0x6c,0x65,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c,0x69, +0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49,0x50, +0x20,0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x74,0x69,0x74,0x6c,0x65,0x3e,0x3c,0x2f, +0x68,0x65,0x61,0x64,0x3e,0x0d,0x0a,0x3c,0x62,0x6f,0x64,0x79,0x20,0x62,0x67,0x63, +0x6f,0x6c,0x6f,0x72,0x3d,0x22,0x77,0x68,0x69,0x74,0x65,0x22,0x20,0x74,0x65,0x78, +0x74,0x3d,0x22,0x62,0x6c,0x61,0x63,0x6b,0x22,0x3e,0x0d,0x0a,0x0d,0x0a,0x20,0x3c, +0x74,0x61,0x62,0x6c,0x65,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22,0x31,0x30,0x30, +0x25,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x3c,0x74,0x72,0x20,0x76,0x61,0x6c,0x69,0x67, +0x6e,0x3d,0x22,0x74,0x6f,0x70,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x74,0x64, +0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22,0x38,0x30,0x22,0x3e,0x0d,0x0a,0x20,0x20, +0x20,0x20,0x3c,0x61,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a, +0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x22,0x3e, +0x3c,0x69,0x6d,0x67,0x20,0x73,0x72,0x63,0x3d,0x22,0x2f,0x69,0x6d,0x67,0x2f,0x73, +0x69,0x63,0x73,0x2e,0x67,0x69,0x66,0x22,0x20,0x62,0x6f,0x72,0x64,0x65,0x72,0x3d, +0x22,0x30,0x22,0x20,0x61,0x6c,0x74,0x3d,0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f, +0x67,0x6f,0x22,0x20,0x74,0x69,0x74,0x6c,0x65,0x3d,0x22,0x53,0x49,0x43,0x53,0x20, +0x6c,0x6f,0x67,0x6f,0x22,0x2f,0x3e,0x3c,0x2f,0x61,0x3e,0x0d,0x0a,0x20,0x20,0x20, +0x3c,0x2f,0x74,0x64,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x74,0x64,0x20,0x77,0x69, +0x64,0x74,0x68,0x3d,0x22,0x35,0x30,0x30,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20, +0x3c,0x68,0x31,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c,0x69,0x67, +0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x20, +0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x68,0x31,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20, +0x3c,0x70,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x4c,0x6f,0x67,0x69,0x6e,0x20, +0x66,0x61,0x69,0x6c,0x65,0x64,0x2e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x3c,0x2f,0x70, +0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20, +0x20,0x43,0x6c,0x69,0x63,0x6b,0x20,0x3c,0x61,0x20,0x68,0x72,0x65,0x66,0x3d,0x22, +0x6c,0x6f,0x67,0x69,0x6e,0x2e,0x68,0x74,0x6d,0x6c,0x22,0x3e,0x68,0x65,0x72,0x65, +0x3c,0x2f,0x61,0x3e,0x20,0x74,0x6f,0x20,0x72,0x65,0x74,0x72,0x79,0x20,0x6c,0x6f, +0x67,0x69,0x6e,0x2e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a, +0x20,0x20,0x20,0x3c,0x2f,0x74,0x64,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x74,0x64, +0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x26,0x6e,0x62,0x73,0x70,0x3b,0x0d,0x0a,0x20, +0x20,0x20,0x3c,0x2f,0x74,0x64,0x3e,0x0d,0x0a,0x20,0x20,0x3c,0x2f,0x74,0x72,0x3e, +0x0d,0x0a,0x20,0x3c,0x2f,0x74,0x61,0x62,0x6c,0x65,0x3e,0x0d,0x0a,0x3c,0x2f,0x62, +0x6f,0x64,0x79,0x3e,0x0d,0x0a,0x3c,0x2f,0x68,0x74,0x6d,0x6c,0x3e,0x0d,0x0a,}; + +#if FSDATA_FILE_ALIGNMENT==1 +static const unsigned int dummy_align__session_html = 5; +#endif +static const unsigned char FSDATA_ALIGN_PRE data__session_html[] FSDATA_ALIGN_POST = { +/* /session.html (14 chars) */ +0x2f,0x73,0x65,0x73,0x73,0x69,0x6f,0x6e,0x2e,0x68,0x74,0x6d,0x6c,0x00,0x00,0x00, + +/* HTTP header */ +/* "HTTP/1.1 200 OK +" (17 bytes) */ +0x48,0x54,0x54,0x50,0x2f,0x31,0x2e,0x31,0x20,0x32,0x30,0x30,0x20,0x4f,0x4b,0x0d, +0x0a, +/* "Server: lwIP/2.0.3d (http://savannah.nongnu.org/projects/lwip) +" (64 bytes) */ +0x53,0x65,0x72,0x76,0x65,0x72,0x3a,0x20,0x6c,0x77,0x49,0x50,0x2f,0x32,0x2e,0x30, +0x2e,0x33,0x64,0x20,0x28,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61, +0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e,0x67,0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f, +0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73,0x2f,0x6c,0x77,0x69,0x70,0x29,0x0d,0x0a, + +/* "Content-Length: 578 +" (18+ bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x4c,0x65,0x6e,0x67,0x74,0x68,0x3a,0x20, +0x35,0x37,0x38,0x0d,0x0a, +/* "Connection: keep-alive +" (24 bytes) */ +0x43,0x6f,0x6e,0x6e,0x65,0x63,0x74,0x69,0x6f,0x6e,0x3a,0x20,0x6b,0x65,0x65,0x70, +0x2d,0x61,0x6c,0x69,0x76,0x65,0x0d,0x0a, +/* "Content-Type: text/html + +" (27 bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x54,0x79,0x70,0x65,0x3a,0x20,0x74,0x65, +0x78,0x74,0x2f,0x68,0x74,0x6d,0x6c,0x0d,0x0a,0x0d,0x0a, +/* raw file data (578 bytes) */ +0x3c,0x68,0x74,0x6d,0x6c,0x3e,0x0d,0x0a,0x3c,0x68,0x65,0x61,0x64,0x3e,0x3c,0x74, +0x69,0x74,0x6c,0x65,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c,0x69, +0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49,0x50, +0x20,0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x74,0x69,0x74,0x6c,0x65,0x3e,0x3c,0x2f, +0x68,0x65,0x61,0x64,0x3e,0x0d,0x0a,0x3c,0x62,0x6f,0x64,0x79,0x20,0x62,0x67,0x63, +0x6f,0x6c,0x6f,0x72,0x3d,0x22,0x77,0x68,0x69,0x74,0x65,0x22,0x20,0x74,0x65,0x78, +0x74,0x3d,0x22,0x62,0x6c,0x61,0x63,0x6b,0x22,0x3e,0x0d,0x0a,0x0d,0x0a,0x20,0x3c, +0x74,0x61,0x62,0x6c,0x65,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22,0x31,0x30,0x30, +0x25,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x3c,0x74,0x72,0x20,0x76,0x61,0x6c,0x69,0x67, +0x6e,0x3d,0x22,0x74,0x6f,0x70,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x74,0x64, +0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22,0x38,0x30,0x22,0x3e,0x0d,0x0a,0x20,0x20, +0x20,0x20,0x3c,0x61,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a, +0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x22,0x3e, +0x3c,0x69,0x6d,0x67,0x20,0x73,0x72,0x63,0x3d,0x22,0x2f,0x69,0x6d,0x67,0x2f,0x73, +0x69,0x63,0x73,0x2e,0x67,0x69,0x66,0x22,0x20,0x62,0x6f,0x72,0x64,0x65,0x72,0x3d, +0x22,0x30,0x22,0x20,0x61,0x6c,0x74,0x3d,0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f, +0x67,0x6f,0x22,0x20,0x74,0x69,0x74,0x6c,0x65,0x3d,0x22,0x53,0x49,0x43,0x53,0x20, +0x6c,0x6f,0x67,0x6f,0x22,0x2f,0x3e,0x3c,0x2f,0x61,0x3e,0x0d,0x0a,0x20,0x20,0x20, +0x3c,0x2f,0x74,0x64,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x74,0x64,0x20,0x77,0x69, +0x64,0x74,0x68,0x3d,0x22,0x35,0x30,0x30,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20, +0x3c,0x68,0x31,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c,0x69,0x67, +0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x20, +0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x68,0x31,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20, +0x3c,0x70,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x4c,0x6f,0x67,0x69,0x6e,0x20, +0x73,0x75,0x63,0x63,0x65,0x65,0x64,0x65,0x64,0x2c,0x20,0x73,0x65,0x73,0x73,0x69, +0x6f,0x6e,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x2e,0x0d,0x0a,0x20,0x20,0x20,0x20, +0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x20, +0x20,0x20,0x20,0x20,0x43,0x6c,0x69,0x63,0x6b,0x20,0x3c,0x61,0x20,0x68,0x72,0x65, +0x66,0x3d,0x22,0x6c,0x6f,0x67,0x69,0x6e,0x2e,0x68,0x74,0x6d,0x6c,0x22,0x3e,0x68, +0x65,0x72,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x74,0x6f,0x20,0x72,0x65,0x74,0x72,0x79, +0x20,0x6c,0x6f,0x67,0x69,0x6e,0x2e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x3c,0x2f,0x70, +0x3e,0x0d,0x0a,0x20,0x20,0x20,0x3c,0x2f,0x74,0x64,0x3e,0x0d,0x0a,0x20,0x20,0x20, +0x3c,0x74,0x64,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x26,0x6e,0x62,0x73,0x70,0x3b, +0x0d,0x0a,0x20,0x20,0x20,0x3c,0x2f,0x74,0x64,0x3e,0x0d,0x0a,0x20,0x20,0x3c,0x2f, +0x74,0x72,0x3e,0x0d,0x0a,0x20,0x3c,0x2f,0x74,0x61,0x62,0x6c,0x65,0x3e,0x0d,0x0a, +0x3c,0x2f,0x62,0x6f,0x64,0x79,0x3e,0x0d,0x0a,0x3c,0x2f,0x68,0x74,0x6d,0x6c,0x3e, +0x0d,0x0a,}; + +#if FSDATA_FILE_ALIGNMENT==1 +static const unsigned int dummy_align__ssi_shtml = 6; +#endif +static const unsigned char FSDATA_ALIGN_PRE data__ssi_shtml[] FSDATA_ALIGN_POST = { +/* /ssi.shtml (11 chars) */ +0x2f,0x73,0x73,0x69,0x2e,0x73,0x68,0x74,0x6d,0x6c,0x00,0x00, + +/* HTTP header */ +/* "HTTP/1.1 200 OK +" (17 bytes) */ +0x48,0x54,0x54,0x50,0x2f,0x31,0x2e,0x31,0x20,0x32,0x30,0x30,0x20,0x4f,0x4b,0x0d, +0x0a, +/* "Server: lwIP/2.0.3d (http://savannah.nongnu.org/projects/lwip) +" (64 bytes) */ +0x53,0x65,0x72,0x76,0x65,0x72,0x3a,0x20,0x6c,0x77,0x49,0x50,0x2f,0x32,0x2e,0x30, +0x2e,0x33,0x64,0x20,0x28,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61, +0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e,0x67,0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f, +0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73,0x2f,0x6c,0x77,0x69,0x70,0x29,0x0d,0x0a, + +/* "Connection: Close +" (19 bytes) */ +0x43,0x6f,0x6e,0x6e,0x65,0x63,0x74,0x69,0x6f,0x6e,0x3a,0x20,0x43,0x6c,0x6f,0x73, +0x65,0x0d,0x0a, +/* "Content-Type: text/html +Expires: Fri, 10 Apr 2008 14:00:00 GMT +Pragma: no-cache + +" (85 bytes) */ +0x43,0x6f,0x6e,0x74,0x65,0x6e,0x74,0x2d,0x54,0x79,0x70,0x65,0x3a,0x20,0x74,0x65, +0x78,0x74,0x2f,0x68,0x74,0x6d,0x6c,0x0d,0x0a,0x45,0x78,0x70,0x69,0x72,0x65,0x73, +0x3a,0x20,0x46,0x72,0x69,0x2c,0x20,0x31,0x30,0x20,0x41,0x70,0x72,0x20,0x32,0x30, +0x30,0x38,0x20,0x31,0x34,0x3a,0x30,0x30,0x3a,0x30,0x30,0x20,0x47,0x4d,0x54,0x0d, +0x0a,0x50,0x72,0x61,0x67,0x6d,0x61,0x3a,0x20,0x6e,0x6f,0x2d,0x63,0x61,0x63,0x68, +0x65,0x0d,0x0a,0x0d,0x0a, +/* raw file data (14429 bytes) */ +0x3c,0x68,0x74,0x6d,0x6c,0x3e,0x0d,0x0a,0x3c,0x68,0x65,0x61,0x64,0x3e,0x3c,0x74, +0x69,0x74,0x6c,0x65,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c,0x69, +0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49,0x50, +0x20,0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x74,0x69,0x74,0x6c,0x65,0x3e,0x3c,0x2f, +0x68,0x65,0x61,0x64,0x3e,0x0d,0x0a,0x3c,0x62,0x6f,0x64,0x79,0x20,0x62,0x67,0x63, +0x6f,0x6c,0x6f,0x72,0x3d,0x22,0x77,0x68,0x69,0x74,0x65,0x22,0x20,0x74,0x65,0x78, +0x74,0x3d,0x22,0x62,0x6c,0x61,0x63,0x6b,0x22,0x3e,0x0d,0x0a,0x0d,0x0a,0x20,0x20, +0x20,0x20,0x3c,0x74,0x61,0x62,0x6c,0x65,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22, +0x31,0x30,0x30,0x25,0x22,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x20,0x3c,0x74, +0x72,0x20,0x76,0x61,0x6c,0x69,0x67,0x6e,0x3d,0x22,0x74,0x6f,0x70,0x22,0x3e,0x3c, +0x74,0x64,0x20,0x77,0x69,0x64,0x74,0x68,0x3d,0x22,0x38,0x30,0x22,0x3e,0x09,0x20, +0x20,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x61,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68, +0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73, +0x65,0x2f,0x22,0x3e,0x3c,0x69,0x6d,0x67,0x20,0x73,0x72,0x63,0x3d,0x22,0x2f,0x69, +0x6d,0x67,0x2f,0x73,0x69,0x63,0x73,0x2e,0x67,0x69,0x66,0x22,0x0d,0x0a,0x09,0x20, +0x20,0x62,0x6f,0x72,0x64,0x65,0x72,0x3d,0x22,0x30,0x22,0x20,0x61,0x6c,0x74,0x3d, +0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f,0x67,0x6f,0x22,0x20,0x74,0x69,0x74,0x6c, +0x65,0x3d,0x22,0x53,0x49,0x43,0x53,0x20,0x6c,0x6f,0x67,0x6f,0x22,0x3e,0x3c,0x2f, +0x61,0x3e,0x0d,0x0a,0x09,0x3c,0x2f,0x74,0x64,0x3e,0x3c,0x74,0x64,0x20,0x77,0x69, +0x64,0x74,0x68,0x3d,0x22,0x35,0x30,0x30,0x22,0x3e,0x09,0x20,0x20,0x0d,0x0a,0x09, +0x20,0x20,0x3c,0x68,0x31,0x3e,0x6c,0x77,0x49,0x50,0x20,0x2d,0x20,0x41,0x20,0x4c, +0x69,0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74,0x20,0x54,0x43,0x50,0x2f,0x49, +0x50,0x20,0x53,0x74,0x61,0x63,0x6b,0x3c,0x2f,0x68,0x31,0x3e,0x0d,0x0a,0x09,0x20, +0x20,0x3c,0x68,0x31,0x3e,0x3c,0x21,0x2d,0x2d,0x23,0x48,0x65,0x6c,0x6c,0x57,0x6f, +0x72,0x6c,0x2d,0x2d,0x3e,0x3c,0x2f,0x68,0x31,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c, +0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x54,0x68,0x65,0x20,0x77,0x65,0x62, +0x20,0x70,0x61,0x67,0x65,0x20,0x79,0x6f,0x75,0x20,0x61,0x72,0x65,0x20,0x77,0x61, +0x74,0x63,0x68,0x69,0x6e,0x67,0x20,0x77,0x61,0x73,0x20,0x73,0x65,0x72,0x76,0x65, +0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x73,0x69,0x6d,0x70,0x6c,0x65,0x20,0x77,0x65, +0x62,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x65,0x72,0x76,0x65,0x72,0x20,0x72, +0x75,0x6e,0x6e,0x69,0x6e,0x67,0x20,0x6f,0x6e,0x20,0x74,0x6f,0x70,0x20,0x6f,0x66, +0x20,0x74,0x68,0x65,0x20,0x6c,0x69,0x67,0x68,0x74,0x77,0x65,0x69,0x67,0x68,0x74, +0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x20,0x73,0x74,0x61,0x63,0x6b,0x20,0x3c,0x61, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74, +0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f, +0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x6c,0x77,0x49, +0x50,0x3c,0x2f,0x61,0x3e,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d, +0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x54,0x68, +0x69,0x73,0x20,0x70,0x61,0x67,0x65,0x20,0x69,0x73,0x20,0x68,0x65,0x72,0x65,0x20, +0x74,0x6f,0x20,0x74,0x65,0x73,0x74,0x20,0x53,0x53,0x49,0x2c,0x20,0x73,0x6f,0x20, +0x68,0x65,0x72,0x65,0x20,0x69,0x73,0x20,0x61,0x20,0x63,0x6f,0x75,0x6e,0x74,0x65, +0x72,0x20,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x61,0x6e,0x20,0x65,0x78, +0x61,0x6d,0x70,0x6c,0x65,0x20,0x6f,0x66,0x20,0x63,0x6f,0x6e,0x74,0x65,0x6e,0x74, +0x20,0x63,0x68,0x61,0x6e,0x67,0x69,0x6e,0x67,0x20,0x66,0x6f,0x72,0x20,0x65,0x76, +0x65,0x72,0x79,0x20,0x72,0x65,0x71,0x75,0x65,0x73,0x74,0x3a,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x22,0x3c,0x21,0x2d,0x2d,0x23,0x63,0x6f,0x75,0x6e,0x74,0x65,0x72, +0x2d,0x2d,0x3e,0x22,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09, +0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x41,0x6e,0x64,0x20, +0x68,0x65,0x72,0x65,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x65,0x78,0x61,0x6d,0x70, +0x6c,0x65,0x20,0x6f,0x66,0x20,0x61,0x20,0x74,0x61,0x67,0x20,0x72,0x65,0x73,0x75, +0x6c,0x74,0x20,0x62,0x75,0x66,0x66,0x65,0x72,0x20,0x72,0x65,0x74,0x75,0x72,0x6e, +0x20,0x69,0x6e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6d,0x75,0x6c,0x74,0x69,0x70, +0x6c,0x65,0x20,0x70,0x61,0x72,0x74,0x73,0x3a,0x20,0x22,0x3c,0x21,0x2d,0x2d,0x23, +0x4d,0x75,0x6c,0x74,0x50,0x61,0x72,0x74,0x2d,0x2d,0x3e,0x22,0x0d,0x0a,0x09,0x20, +0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x54,0x6f,0x20,0x74,0x65,0x73,0x74,0x20,0x4c,0x57,0x49,0x50, +0x5f,0x48,0x54,0x54,0x50,0x44,0x5f,0x43,0x47,0x49,0x5f,0x53,0x53,0x49,0x2c,0x20, +0x68,0x65,0x72,0x65,0x20,0x61,0x72,0x65,0x20,0x74,0x68,0x65,0x20,0x43,0x47,0x49, +0x20,0x70,0x61,0x72,0x61,0x6d,0x65,0x74,0x65,0x72,0x73,0x3a,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x3c,0x21,0x2d,0x2d,0x23,0x43,0x67,0x69,0x50,0x61,0x72,0x61,0x6d, +0x2d,0x2d,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20, +0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20, +0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63, +0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e, +0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75, +0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69, +0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20, +0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66, +0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63, +0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f, +0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64, +0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66, +0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63, +0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74, +0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20, +0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76, +0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69, +0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d, +0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73, +0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68, +0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64, +0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65, +0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20, +0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61, +0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d, +0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20, +0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61, +0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77, +0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c, +0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70, +0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70, +0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20, +0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69, +0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66, +0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65, +0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e, +0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20, +0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68, +0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73, +0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41, +0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68, +0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f, +0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f, +0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65, +0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20, +0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f, +0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72, +0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64, +0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65, +0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20, +0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20, +0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72, +0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61, +0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73, +0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62, +0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68, +0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e, +0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a, +0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49, +0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75, +0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69, +0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20, +0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f, +0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65, +0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72, +0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73, +0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69, +0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77, +0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20, +0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65, +0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20, +0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61, +0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65, +0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64, +0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c, +0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74, +0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50, +0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72, +0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65, +0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65, +0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65, +0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f, +0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e, +0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20, +0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68, +0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72, +0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65, +0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c, +0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65, +0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65, +0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54, +0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74, +0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20, +0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77, +0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f, +0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61, +0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75, +0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74, +0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69, +0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72, +0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74, +0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65, +0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76, +0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d, +0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64, +0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e, +0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c, +0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66, +0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61, +0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f, +0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70, +0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65, +0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20, +0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64, +0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69, +0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e, +0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d, +0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61, +0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d, +0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20, +0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20, +0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61, +0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c, +0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74, +0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65, +0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64, +0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20, +0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d, +0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61, +0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c, +0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61, +0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70, +0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69, +0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65, +0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c, +0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c, +0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61, +0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74, +0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e, +0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74, +0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65, +0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f, +0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67, +0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09, +0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50, +0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72, +0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f, +0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73, +0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72, +0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e, +0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65, +0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69, +0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70, +0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65, +0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f, +0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e, +0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69, +0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63, +0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64, +0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65, +0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64, +0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64, +0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27, +0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20, +0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65, +0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72, +0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e, +0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72, +0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72, +0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67, +0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63, +0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65, +0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20, +0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72, +0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f, +0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e, +0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e, +0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43, +0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f, +0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77, +0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72, +0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77, +0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d, +0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e, +0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68, +0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74, +0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20, +0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20, +0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69, +0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65, +0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20, +0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20, +0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63, +0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20, +0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73, +0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20, +0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73, +0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20, +0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c, +0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72, +0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c, +0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20, +0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74, +0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20, +0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a, +0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e, +0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70, +0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74, +0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74, +0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c, +0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74, +0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f, +0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61, +0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49, +0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70, +0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e, +0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79, +0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20, +0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65, +0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62, +0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e, +0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65, +0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f, +0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e, +0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65, +0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64, +0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65, +0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20, +0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75, +0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20, +0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20, +0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20, +0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63, +0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e, +0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75, +0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69, +0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20, +0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66, +0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63, +0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f, +0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64, +0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66, +0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63, +0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74, +0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20, +0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76, +0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69, +0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d, +0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73, +0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68, +0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64, +0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65, +0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20, +0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61, +0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d, +0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20, +0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61, +0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77, +0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c, +0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70, +0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20, +0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74, +0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50, +0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63, +0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61, +0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69, +0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77, +0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f, +0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b, +0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65, +0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75, +0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53, +0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e, +0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e, +0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c, +0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f, +0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77, +0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65, +0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c, +0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70, +0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69, +0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20, +0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73, +0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61, +0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61, +0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77, +0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65, +0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68, +0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75, +0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09, +0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20, +0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c, +0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68, +0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70, +0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68, +0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c, +0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70, +0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e, +0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d, +0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f, +0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e, +0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75, +0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20, +0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20, +0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74, +0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72, +0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75, +0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20, +0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61, +0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74, +0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64, +0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64, +0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20, +0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d, +0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75, +0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74, +0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f, +0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20, +0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69, +0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65, +0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20, +0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69, +0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67, +0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62, +0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d, +0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73, +0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22, +0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69, +0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20, +0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65, +0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69, +0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62, +0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65, +0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73, +0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77, +0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20, +0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61, +0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20, +0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73, +0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70, +0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73, +0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73, +0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e, +0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69, +0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79, +0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e, +0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c, +0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73, +0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61, +0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f, +0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f, +0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73, +0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74, +0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77, +0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c, +0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65, +0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20, +0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74, +0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63, +0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f, +0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67, +0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f, +0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66, +0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f, +0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20, +0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77, +0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75, +0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e, +0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62, +0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65, +0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74, +0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74, +0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49, +0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69, +0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20, +0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e, +0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20, +0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f, +0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65, +0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65, +0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72, +0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61, +0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79, +0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a, +0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61, +0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20, +0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66, +0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73, +0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74, +0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62, +0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64, +0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65, +0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74, +0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53, +0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73, +0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20, +0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20, +0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20, +0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f, +0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73, +0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73, +0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20, +0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53, +0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c, +0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73, +0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20, +0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f, +0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74, +0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69, +0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79, +0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22, +0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e, +0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e, +0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73, +0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43, +0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c, +0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76, +0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79, +0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c, +0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74, +0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69, +0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72, +0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61, +0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74, +0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f, +0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20, +0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79, +0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20, +0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74, +0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69, +0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d, +0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77, +0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f, +0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74, +0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49, +0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c, +0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20, +0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74, +0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68, +0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e, +0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77, +0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c, +0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53, +0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65, +0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69, +0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77, +0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20, +0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70, +0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20, +0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72, +0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69, +0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49, +0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72, +0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74, +0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65, +0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76, +0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66, +0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69, +0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50, +0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74, +0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f, +0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64, +0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20, +0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70, +0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d, +0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20, +0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f, +0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74, +0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20, +0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f, +0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64, +0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44, +0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20, +0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74, +0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65, +0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75, +0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62, +0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65, +0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61, +0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65, +0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69, +0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65, +0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f, +0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68, +0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74, +0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70, +0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e, +0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65, +0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77, +0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61, +0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e, +0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70, +0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20, +0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69, +0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66, +0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65, +0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e, +0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20, +0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68, +0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73, +0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41, +0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68, +0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f, +0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f, +0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65, +0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20, +0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f, +0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72, +0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64, +0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65, +0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20, +0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20, +0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72, +0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61, +0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73, +0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62, +0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68, +0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e, +0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a, +0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49, +0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75, +0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69, +0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20, +0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f, +0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65, +0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72, +0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73, +0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69, +0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77, +0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20, +0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65, +0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20, +0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61, +0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65, +0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64, +0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c, +0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74, +0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50, +0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72, +0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65, +0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65, +0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65, +0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f, +0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e, +0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20, +0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68, +0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72, +0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65, +0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c, +0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65, +0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65, +0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54, +0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74, +0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20, +0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77, +0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f, +0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61, +0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75, +0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74, +0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69, +0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72, +0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74, +0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65, +0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76, +0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d, +0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64, +0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e, +0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c, +0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66, +0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61, +0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f, +0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70, +0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65, +0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20, +0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64, +0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69, +0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e, +0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d, +0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61, +0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d, +0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20, +0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20, +0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61, +0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c, +0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74, +0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65, +0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64, +0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20, +0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d, +0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61, +0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c, +0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61, +0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70, +0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69, +0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65, +0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c, +0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a, +0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c, +0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61, +0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74, +0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e, +0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74, +0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65, +0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f, +0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67, +0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09, +0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50, +0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72, +0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f, +0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73, +0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72, +0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e, +0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65, +0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69, +0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70, +0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65, +0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f, +0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e, +0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69, +0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63, +0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64, +0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65, +0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64, +0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64, +0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27, +0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20, +0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65, +0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72, +0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e, +0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72, +0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72, +0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67, +0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63, +0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65, +0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20, +0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72, +0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f, +0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e,0x20,0x6f,0x70,0x65,0x6e, +0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e, +0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x54,0x43, +0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x72,0x6f,0x74,0x6f, +0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74,0x68,0x61,0x74,0x20,0x77, +0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c,0x6c,0x79,0x20,0x77,0x72, +0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x77, +0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f,0x7e,0x61,0x64,0x61,0x6d, +0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61,0x6d,0x20,0x44,0x75,0x6e, +0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x74,0x68, +0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49,0x6e,0x73,0x74,0x69,0x74, +0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70,0x75,0x74,0x65,0x72,0x20, +0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e,0x20,0x62,0x75,0x74,0x20, +0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x62,0x65,0x69, +0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79,0x20,0x64,0x65,0x76,0x65, +0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20,0x74,0x65,0x61,0x6d,0x20, +0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x72,0x73,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62,0x75,0x74,0x65,0x64,0x20, +0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e,0x20,0x53,0x69,0x6e,0x63, +0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65,0x61,0x73,0x65,0x2c,0x20, +0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x73, +0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f,0x74,0x20,0x6f,0x66,0x20, +0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e,0x64,0x20,0x68,0x61,0x73, +0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65,0x64,0x20,0x74,0x6f,0x20, +0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x70,0x6c, +0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64,0x20,0x6f,0x70,0x65,0x72, +0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x2e,0x20,0x6c, +0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x75,0x73,0x65,0x64,0x20, +0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x77,0x69,0x74, +0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75,0x74,0x20,0x61,0x6e,0x20, +0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20,0x4f,0x53,0x2e,0x0d,0x0a, +0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x70,0x3e,0x0d, +0x0a,0x09,0x20,0x20,0x20,0x20,0x6c,0x77,0x49,0x50,0x20,0x69,0x73,0x20,0x61,0x6e, +0x20,0x6f,0x70,0x65,0x6e,0x20,0x73,0x6f,0x75,0x72,0x63,0x65,0x20,0x69,0x6d,0x70, +0x6c,0x65,0x6d,0x65,0x6e,0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x6f,0x66,0x20,0x74, +0x68,0x65,0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x70,0x72,0x6f,0x74,0x6f,0x63,0x6f,0x6c,0x20,0x73,0x75,0x69,0x74,0x65,0x20,0x74, +0x68,0x61,0x74,0x20,0x77,0x61,0x73,0x20,0x6f,0x72,0x69,0x67,0x69,0x6e,0x61,0x6c, +0x6c,0x79,0x20,0x77,0x72,0x69,0x74,0x74,0x65,0x6e,0x20,0x62,0x79,0x20,0x3c,0x61, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74, +0x70,0x3a,0x2f,0x2f,0x77,0x77,0x77,0x2e,0x73,0x69,0x63,0x73,0x2e,0x73,0x65,0x2f, +0x7e,0x61,0x64,0x61,0x6d,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x41,0x64,0x61, +0x6d,0x20,0x44,0x75,0x6e,0x6b,0x65,0x6c,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20, +0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x53,0x77,0x65,0x64,0x69,0x73,0x68,0x20,0x49, +0x6e,0x73,0x74,0x69,0x74,0x75,0x74,0x65,0x20,0x6f,0x66,0x20,0x43,0x6f,0x6d,0x70, +0x75,0x74,0x65,0x72,0x20,0x53,0x63,0x69,0x65,0x6e,0x63,0x65,0x3c,0x2f,0x61,0x3e, +0x20,0x62,0x75,0x74,0x20,0x6e,0x6f,0x77,0x20,0x69,0x73,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x62,0x65,0x69,0x6e,0x67,0x20,0x61,0x63,0x74,0x69,0x76,0x65,0x6c,0x79, +0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65,0x64,0x20,0x62,0x79,0x20,0x61,0x20, +0x74,0x65,0x61,0x6d,0x20,0x6f,0x66,0x20,0x64,0x65,0x76,0x65,0x6c,0x6f,0x70,0x65, +0x72,0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x64,0x69,0x73,0x74,0x72,0x69,0x62, +0x75,0x74,0x65,0x64,0x20,0x77,0x6f,0x72,0x6c,0x64,0x2d,0x77,0x69,0x64,0x65,0x2e, +0x20,0x53,0x69,0x6e,0x63,0x65,0x20,0x69,0x74,0x27,0x73,0x20,0x72,0x65,0x6c,0x65, +0x61,0x73,0x65,0x2c,0x20,0x6c,0x77,0x49,0x50,0x20,0x68,0x61,0x73,0x0d,0x0a,0x09, +0x20,0x20,0x20,0x20,0x73,0x70,0x75,0x72,0x72,0x65,0x64,0x20,0x61,0x20,0x6c,0x6f, +0x74,0x20,0x6f,0x66,0x20,0x69,0x6e,0x74,0x65,0x72,0x65,0x73,0x74,0x20,0x61,0x6e, +0x64,0x20,0x68,0x61,0x73,0x20,0x62,0x65,0x65,0x6e,0x20,0x70,0x6f,0x72,0x74,0x65, +0x64,0x20,0x74,0x6f,0x20,0x73,0x65,0x76,0x65,0x72,0x61,0x6c,0x0d,0x0a,0x09,0x20, +0x20,0x20,0x20,0x70,0x6c,0x61,0x74,0x66,0x6f,0x72,0x6d,0x73,0x20,0x61,0x6e,0x64, +0x20,0x6f,0x70,0x65,0x72,0x61,0x74,0x69,0x6e,0x67,0x20,0x73,0x79,0x73,0x74,0x65, +0x6d,0x73,0x2e,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20, +0x75,0x73,0x65,0x64,0x20,0x65,0x69,0x74,0x68,0x65,0x72,0x0d,0x0a,0x09,0x20,0x20, +0x20,0x20,0x77,0x69,0x74,0x68,0x20,0x6f,0x72,0x20,0x77,0x69,0x74,0x68,0x6f,0x75, +0x74,0x20,0x61,0x6e,0x20,0x75,0x6e,0x64,0x65,0x72,0x6c,0x79,0x69,0x6e,0x67,0x20, +0x4f,0x53,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x20, +0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x54,0x68,0x65,0x20,0x66, +0x6f,0x63,0x75,0x73,0x20,0x6f,0x66,0x20,0x74,0x68,0x65,0x20,0x6c,0x77,0x49,0x50, +0x20,0x54,0x43,0x50,0x2f,0x49,0x50,0x20,0x69,0x6d,0x70,0x6c,0x65,0x6d,0x65,0x6e, +0x74,0x61,0x74,0x69,0x6f,0x6e,0x20,0x69,0x73,0x20,0x74,0x6f,0x20,0x72,0x65,0x64, +0x75,0x63,0x65,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x74,0x68,0x65,0x20,0x52,0x41, +0x4d,0x20,0x75,0x73,0x61,0x67,0x65,0x20,0x77,0x68,0x69,0x6c,0x65,0x20,0x73,0x74, +0x69,0x6c,0x6c,0x20,0x68,0x61,0x76,0x69,0x6e,0x67,0x20,0x61,0x20,0x66,0x75,0x6c, +0x6c,0x20,0x73,0x63,0x61,0x6c,0x65,0x20,0x54,0x43,0x50,0x2e,0x20,0x54,0x68,0x69, +0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6d,0x61,0x6b,0x65,0x73,0x20,0x6c,0x77, +0x49,0x50,0x20,0x73,0x75,0x69,0x74,0x61,0x62,0x6c,0x65,0x20,0x66,0x6f,0x72,0x20, +0x75,0x73,0x65,0x20,0x69,0x6e,0x20,0x65,0x6d,0x62,0x65,0x64,0x64,0x65,0x64,0x20, +0x73,0x79,0x73,0x74,0x65,0x6d,0x73,0x20,0x77,0x69,0x74,0x68,0x20,0x74,0x65,0x6e, +0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x6b,0x69,0x6c,0x6f,0x62, +0x79,0x74,0x65,0x73,0x20,0x6f,0x66,0x20,0x66,0x72,0x65,0x65,0x20,0x52,0x41,0x4d, +0x20,0x61,0x6e,0x64,0x20,0x72,0x6f,0x6f,0x6d,0x20,0x66,0x6f,0x72,0x20,0x61,0x72, +0x6f,0x75,0x6e,0x64,0x20,0x34,0x30,0x20,0x6b,0x69,0x6c,0x6f,0x62,0x79,0x74,0x65, +0x73,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x6f,0x66,0x20,0x63,0x6f,0x64,0x65,0x20, +0x52,0x4f,0x4d,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c,0x2f,0x70,0x3e,0x0d,0x0a,0x09, +0x20,0x20,0x3c,0x70,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x4d,0x6f,0x72,0x65, +0x20,0x69,0x6e,0x66,0x6f,0x72,0x6d,0x61,0x74,0x69,0x6f,0x6e,0x20,0x61,0x62,0x6f, +0x75,0x74,0x20,0x6c,0x77,0x49,0x50,0x20,0x63,0x61,0x6e,0x20,0x62,0x65,0x20,0x66, +0x6f,0x75,0x6e,0x64,0x20,0x61,0x74,0x20,0x74,0x68,0x65,0x20,0x6c,0x77,0x49,0x50, +0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x6f,0x6d,0x65,0x70,0x61,0x67,0x65,0x20, +0x61,0x74,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20,0x20,0x68,0x72,0x65,0x66, +0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61,0x6e,0x6e,0x61, +0x68,0x2e,0x6e,0x6f,0x6e,0x67,0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f,0x70,0x72,0x6f, +0x6a,0x65,0x63,0x74,0x73,0x2f,0x6c,0x77,0x69,0x70,0x2f,0x22,0x3e,0x68,0x74,0x74, +0x70,0x3a,0x2f,0x2f,0x73,0x61,0x76,0x61,0x6e,0x6e,0x61,0x68,0x2e,0x6e,0x6f,0x6e, +0x67,0x6e,0x75,0x2e,0x6f,0x72,0x67,0x2f,0x70,0x72,0x6f,0x6a,0x65,0x63,0x74,0x73, +0x2f,0x6c,0x77,0x69,0x70,0x2f,0x3c,0x2f,0x61,0x3e,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x6f,0x72,0x20,0x61,0x74,0x20,0x74,0x68,0x65,0x20,0x6c,0x77,0x49,0x50,0x20, +0x77,0x69,0x6b,0x69,0x20,0x61,0x74,0x20,0x3c,0x61,0x0d,0x0a,0x09,0x20,0x20,0x20, +0x20,0x68,0x72,0x65,0x66,0x3d,0x22,0x68,0x74,0x74,0x70,0x3a,0x2f,0x2f,0x6c,0x77, +0x69,0x70,0x2e,0x77,0x69,0x6b,0x69,0x61,0x2e,0x63,0x6f,0x6d,0x2f,0x22,0x3e,0x68, +0x74,0x74,0x70,0x3a,0x2f,0x2f,0x6c,0x77,0x69,0x70,0x2e,0x77,0x69,0x6b,0x69,0x61, +0x2e,0x63,0x6f,0x6d,0x2f,0x3c,0x2f,0x61,0x3e,0x2e,0x0d,0x0a,0x09,0x20,0x20,0x3c, +0x2f,0x70,0x3e,0x0d,0x0a,0x09,0x3c,0x2f,0x74,0x64,0x3e,0x3c,0x74,0x64,0x3e,0x0d, +0x0a,0x09,0x20,0x20,0x26,0x6e,0x62,0x73,0x70,0x3b,0x0d,0x0a,0x09,0x3c,0x2f,0x74, +0x64,0x3e,0x3c,0x2f,0x74,0x72,0x3e,0x0d,0x0a,0x20,0x20,0x20,0x20,0x20,0x20,0x3c, +0x2f,0x74,0x61,0x62,0x6c,0x65,0x3e,0x0d,0x0a,0x3c,0x2f,0x62,0x6f,0x64,0x79,0x3e, +0x0d,0x0a,0x3c,0x2f,0x68,0x74,0x6d,0x6c,0x3e,0x0d,0x0a,0x0d,0x0a,}; + + + +const struct fsdata_file file__img_sics_gif[] = { { +file_NULL, +data__img_sics_gif, +data__img_sics_gif + 16, +sizeof(data__img_sics_gif) - 16, +FS_FILE_FLAGS_HEADER_INCLUDED | FS_FILE_FLAGS_HEADER_PERSISTENT | FS_FILE_FLAGS_HEADER_HTTPVER_1_1, +}}; + +const struct fsdata_file file__404_html[] = { { +file__img_sics_gif, +data__404_html, +data__404_html + 12, +sizeof(data__404_html) - 12, +FS_FILE_FLAGS_HEADER_INCLUDED | FS_FILE_FLAGS_HEADER_PERSISTENT | FS_FILE_FLAGS_HEADER_HTTPVER_1_1, +}}; + +const struct fsdata_file file__index_html[] = { { +file__404_html, +data__index_html, +data__index_html + 12, +sizeof(data__index_html) - 12, +FS_FILE_FLAGS_HEADER_INCLUDED | FS_FILE_FLAGS_HEADER_PERSISTENT | FS_FILE_FLAGS_HEADER_HTTPVER_1_1, +}}; + +const struct fsdata_file file__login_html[] = { { +file__index_html, +data__login_html, +data__login_html + 12, +sizeof(data__login_html) - 12, +FS_FILE_FLAGS_HEADER_INCLUDED | FS_FILE_FLAGS_HEADER_PERSISTENT | FS_FILE_FLAGS_HEADER_HTTPVER_1_1, +}}; + +const struct fsdata_file file__loginfail_html[] = { { +file__login_html, +data__loginfail_html, +data__loginfail_html + 16, +sizeof(data__loginfail_html) - 16, +FS_FILE_FLAGS_HEADER_INCLUDED | FS_FILE_FLAGS_HEADER_PERSISTENT | FS_FILE_FLAGS_HEADER_HTTPVER_1_1, +}}; + +const struct fsdata_file file__session_html[] = { { +file__loginfail_html, +data__session_html, +data__session_html + 16, +sizeof(data__session_html) - 16, +FS_FILE_FLAGS_HEADER_INCLUDED | FS_FILE_FLAGS_HEADER_PERSISTENT | FS_FILE_FLAGS_HEADER_HTTPVER_1_1, +}}; + +const struct fsdata_file file__ssi_shtml[] = { { +file__session_html, +data__ssi_shtml, +data__ssi_shtml + 12, +sizeof(data__ssi_shtml) - 12, +FS_FILE_FLAGS_HEADER_INCLUDED | FS_FILE_FLAGS_SSI, +}}; + +#define FS_ROOT file__ssi_shtml +#define FS_NUMFILES 7 + diff --git a/contrib/examples/httpd/fs_example/fs_example.c b/contrib/examples/httpd/fs_example/fs_example.c new file mode 100644 index 00000000..92c64354 --- /dev/null +++ b/contrib/examples/httpd/fs_example/fs_example.c @@ -0,0 +1,321 @@ +/** + * @file + * HTTPD custom file system example + * + * This file demonstrates how to add support for an external file system to httpd. + * It provides access to the specified root directory and uses stdio.h file functions + * to read files. + * + * ATTENTION: This implementation is *not* secure: no checks are added to ensure + * files are only read below the specified root directory! + */ + + /* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +#include "lwip/opt.h" +#include "fs_example.h" + +#include "lwip/apps/fs.h" +#include "lwip/def.h" +#include "lwip/mem.h" + +#include +#include + +/** define LWIP_HTTPD_EXAMPLE_CUSTOMFILES to 1 to enable this file system */ +#ifndef LWIP_HTTPD_EXAMPLE_CUSTOMFILES +#define LWIP_HTTPD_EXAMPLE_CUSTOMFILES 0 +#endif + +/** define LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED to 1 to delay open and read + * as if e.g. reading from external SPI flash */ +#ifndef LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED +#define LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED 1 +#endif + +/** define LWIP_HTTPD_EXAMPLE_CUSTOMFILES_LIMIT_READ to the number of bytes + * to read to emulate limited transfer buffers and don't read whole files in + * one chunk. + * WARNING: lowering this slows down the connection! + */ +#ifndef LWIP_HTTPD_EXAMPLE_CUSTOMFILES_LIMIT_READ +#define LWIP_HTTPD_EXAMPLE_CUSTOMFILES_LIMIT_READ 0 +#endif + +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES + +#if !LWIP_HTTPD_CUSTOM_FILES +#error This needs LWIP_HTTPD_CUSTOM_FILES +#endif +#if !LWIP_HTTPD_DYNAMIC_HEADERS +#error This needs LWIP_HTTPD_DYNAMIC_HEADERS +#endif +#if !LWIP_HTTPD_DYNAMIC_FILE_READ +#error This wants to demonstrate read-after-open, so LWIP_HTTPD_DYNAMIC_FILE_READ is required! +#endif +#if !LWIP_HTTPD_FS_ASYNC_READ +#error This needs LWIP_HTTPD_FS_ASYNC_READ +#endif + +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED +#include "lwip/tcpip.h" +#endif + +struct fs_custom_data { + FILE *f; +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED + int delay_read; + fs_wait_cb callback_fn; + void *callback_arg; +#endif +}; + +const char* fs_ex_root_dir; + +void +fs_ex_init(const char *httpd_root_dir) +{ + fs_ex_root_dir = strdup(httpd_root_dir); +} + +#if LWIP_HTTPD_CUSTOM_FILES +int +fs_open_custom(struct fs_file *file, const char *name) +{ + char full_filename[256]; + FILE *f; + + snprintf(full_filename, 255, "%s%s", fs_ex_root_dir, name); + full_filename[255] = 0; + + f = fopen(full_filename, "rb"); + if (f != NULL) { + if (!fseek(f, 0, SEEK_END)) { + int len = (int)ftell(f); + if(!fseek(f, 0, SEEK_SET)) { + struct fs_custom_data *data = (struct fs_custom_data *)mem_malloc(sizeof(struct fs_custom_data)); + LWIP_ASSERT("out of memory?", data != NULL); + memset(file, 0, sizeof(struct fs_file)); +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED + file->len = 0; /* read size delayed */ + data->delay_read = 3; + LWIP_UNUSED_ARG(len); +#else + file->len = len; +#endif + file->flags = FS_FILE_FLAGS_HEADER_PERSISTENT; + data->f = f; + file->pextension = data; + return 1; + } + } + fclose(f); + } + return 0; +} + +void +fs_close_custom(struct fs_file *file) +{ + if (file && file->pextension) { + struct fs_custom_data *data = (struct fs_custom_data *)file->pextension; + if (data->f != NULL) { + fclose(data->f); + data->f = NULL; + } + mem_free(data); + } +} + +#if LWIP_HTTPD_FS_ASYNC_READ +u8_t +fs_canread_custom(struct fs_file *file) +{ + /* This function is only necessary for asynchronous I/O: + If reading would block, return 0 and implement fs_wait_read_custom() to call the + supplied callback if reading works. */ +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED + struct fs_custom_data *data; + LWIP_ASSERT("file != NULL", file != NULL); + data = (struct fs_custom_data *)file->pextension; + if (data == NULL) { + /* file transfer has been completed already */ + LWIP_ASSERT("transfer complete", file->index == file->len); + return 1; + } + LWIP_ASSERT("data != NULL", data != NULL); + /* This just simulates a simple delay. This delay would normally come e.g. from SPI transfer */ + if (data->delay_read == 3) { + /* delayed file size mode */ + data->delay_read = 1; + LWIP_ASSERT("", file->len == 0); + if (!fseek(data->f, 0, SEEK_END)) { + int len = (int)ftell(data->f); + if(!fseek(data->f, 0, SEEK_SET)) { + file->len = len; /* read size delayed */ + data->delay_read = 1; + return 0; + } + } + /* if we come here, something is wrong with the file */ + LWIP_ASSERT("file error", 0); + } + if (data->delay_read == 1) { + /* tell read function to delay further */ + } +#endif + LWIP_UNUSED_ARG(file); + return 1; +} + +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED +static void +fs_example_read_cb(void *arg) +{ + struct fs_custom_data *data = (struct fs_custom_data *)arg; + fs_wait_cb callback_fn = data->callback_fn; + void *callback_arg = data->callback_arg; + data->callback_fn = NULL; + data->callback_arg = NULL; + + LWIP_ASSERT("no callback_fn", callback_fn != NULL); + + callback_fn(callback_arg); +} +#endif + +u8_t +fs_wait_read_custom(struct fs_file *file, fs_wait_cb callback_fn, void *callback_arg) +{ +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED + err_t err; + struct fs_custom_data *data = (struct fs_custom_data *)file->pextension; + LWIP_ASSERT("data not set", data != NULL); + data->callback_fn = callback_fn; + data->callback_arg = callback_arg; + err = tcpip_try_callback(fs_example_read_cb, data); + LWIP_ASSERT("out of queue elements?", err == ERR_OK); + LWIP_UNUSED_ARG(err); +#else + LWIP_ASSERT("not implemented in this example configuration", 0); +#endif + LWIP_UNUSED_ARG(file); + LWIP_UNUSED_ARG(callback_fn); + LWIP_UNUSED_ARG(callback_arg); + /* Return + - 1 if ready to read (at least one byte) + - 0 if reading should be delayed (call 'tcpip_callback(callback_fn, callback_arg)' when ready) */ + return 1; +} + +int +fs_read_async_custom(struct fs_file *file, char *buffer, int count, fs_wait_cb callback_fn, void *callback_arg) +{ + struct fs_custom_data *data = (struct fs_custom_data *)file->pextension; + FILE *f; + int len; + int read_count = count; + LWIP_ASSERT("data not set", data != NULL); + +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES_DELAYED + /* This just simulates a delay. This delay would normally come e.g. from SPI transfer */ + LWIP_ASSERT("invalid state", data->delay_read >= 0 && data->delay_read <= 2); + if (data->delay_read == 2) { + /* no delay next time */ + data->delay_read = 0; + return FS_READ_DELAYED; + } else if (data->delay_read == 1) { + err_t err; + /* execute requested delay */ + data->delay_read = 2; + LWIP_ASSERT("duplicate callback request", data->callback_fn == NULL); + data->callback_fn = callback_fn; + data->callback_arg = callback_arg; + err = tcpip_try_callback(fs_example_read_cb, data); + LWIP_ASSERT("out of queue elements?", err == ERR_OK); + LWIP_UNUSED_ARG(err); + return FS_READ_DELAYED; + } + /* execute this read but delay the next one */ + data->delay_read = 1; +#endif + +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES_LIMIT_READ + read_count = LWIP_MIN(read_count, LWIP_HTTPD_EXAMPLE_CUSTOMFILES_LIMIT_READ); +#endif + + f = data->f; + len = (int)fread(buffer, 1, read_count, f); + + LWIP_UNUSED_ARG(callback_fn); + LWIP_UNUSED_ARG(callback_arg); + + file->index += len; + + /* Return + - FS_READ_EOF if all bytes have been read + - FS_READ_DELAYED if reading is delayed (call 'tcpip_callback(callback_fn, callback_arg)' when done) */ + if (len == 0) { + /* all bytes read already */ + return FS_READ_EOF; + } + return len; +} + +#else /* LWIP_HTTPD_FS_ASYNC_READ */ +int +fs_read_custom(struct fs_file *file, char *buffer, int count) +{ + struct fs_custom_data *data = (struct fs_custom_data *)file->pextension; + FILE *f; + int len; + int read_count = count; + LWIP_ASSERT("data not set", data != NULL); + +#if LWIP_HTTPD_EXAMPLE_CUSTOMFILES_LIMIT_READ + read_count = LWIP_MIN(read_count, LWIP_HTTPD_EXAMPLE_CUSTOMFILES_LIMIT_READ); +#endif + + f = data->f; + len = (int)fread(buffer, 1, read_count, f); + + file->index += len; + + /* Return FS_READ_EOF if all bytes have been read */ + return len; +} + +#endif /* LWIP_HTTPD_FS_ASYNC_READ */ +#endif /* LWIP_HTTPD_CUSTOM_FILES */ + +#endif /* LWIP_HTTPD_EXAMPLE_CUSTOMFILES */ diff --git a/contrib/examples/httpd/fs_example/fs_example.h b/contrib/examples/httpd/fs_example/fs_example.h new file mode 100644 index 00000000..b399e4d5 --- /dev/null +++ b/contrib/examples/httpd/fs_example/fs_example.h @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +#ifndef LWIP_HDR_HTTP_EXAMPLES_FS_EXAMPLE +#define LWIP_HDR_HTTP_EXAMPLES_FS_EXAMPLE + +void fs_ex_init(const char *httpd_root_dir); + +#endif /* LWIP_HDR_HTTP_EXAMPLES_FS_EXAMPLE */ diff --git a/contrib/examples/httpd/genfiles_example/genfiles_example.c b/contrib/examples/httpd/genfiles_example/genfiles_example.c new file mode 100644 index 00000000..95e5bdb7 --- /dev/null +++ b/contrib/examples/httpd/genfiles_example/genfiles_example.c @@ -0,0 +1,183 @@ +/** + * @file + * HTTPD custom file system example for runtime generated files + * + * This file demonstrates how to add support for generated files to httpd. + */ + + /* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +#include "lwip/opt.h" +#include "genfiles_example.h" + +#include "lwip/apps/fs.h" +#include "lwip/def.h" +#include "lwip/mem.h" + +#include +#include + +/** define LWIP_HTTPD_EXAMPLE_GENERATEDFILES to 1 to enable this file system */ +#ifndef LWIP_HTTPD_EXAMPLE_GENERATEDFILES +#define LWIP_HTTPD_EXAMPLE_GENERATEDFILES 0 +#endif + +#if LWIP_HTTPD_EXAMPLE_GENERATEDFILES + +#if !LWIP_HTTPD_CUSTOM_FILES +#error This needs LWIP_HTTPD_CUSTOM_FILES +#endif +#if !LWIP_HTTPD_DYNAMIC_HEADERS +#error This needs LWIP_HTTPD_DYNAMIC_HEADERS +#endif + +/* This is the page we send. It's not generated, as you see. + * Generating custom things instead of memcpy is left to your imagination :-) + */ +const char generated_html[] = +"\n" +"lwIP - A Lightweight TCP/IP Stack\n" +" \n" +" \n" +" \n" +" \n" +" \n" +" \n" +" \n" +"
\n" +" \"SICS\n" +" \n" +"

lwIP - A Lightweight TCP/IP Stack

\n" +"

Generated page

\n" +"

This page might be generated in-memory at runtime

\n" +" 		\n" +"  \n" +"
\n" +" \n" +""; + + +void +genfiles_ex_init(void) +{ + /* nothing to do here yet */ +} + +int +fs_open_custom(struct fs_file *file, const char *name) +{ + /* this example only provides one file */ + if (!strcmp(name, "/generated.html")) { + /* initialize fs_file correctly */ + memset(file, 0, sizeof(struct fs_file)); + file->pextension = mem_malloc(sizeof(generated_html)); + if (file->pextension != NULL) { + /* instead of doing memcpy, you would generate e.g. a JSON here */ + memcpy(file->pextension, generated_html, sizeof(generated_html)); + file->data = (const char *)file->pextension; + file->len = sizeof(generated_html) - 1; /* don't send the trailing 0 */ + file->index = file->len; + /* allow persisteng connections */ + file->flags = FS_FILE_FLAGS_HEADER_PERSISTENT; + return 1; + } + } + return 0; +} + +void +fs_close_custom(struct fs_file *file) +{ + if (file && file->pextension) { + mem_free(file->pextension); + file->pextension = NULL; + } +} + +#if LWIP_HTTPD_FS_ASYNC_READ +u8_t +fs_canread_custom(struct fs_file *file) +{ + LWIP_UNUSED_ARG(file); + /* This example does not use delayed/async reading */ + return 1; +} + +u8_t +fs_wait_read_custom(struct fs_file *file, fs_wait_cb callback_fn, void *callback_arg) +{ + LWIP_ASSERT("not implemented in this example configuration", 0); + LWIP_UNUSED_ARG(file); + LWIP_UNUSED_ARG(callback_fn); + LWIP_UNUSED_ARG(callback_arg); + /* Return + - 1 if ready to read (at least one byte) + - 0 if reading should be delayed (call 'tcpip_callback(callback_fn, callback_arg)' when ready) */ + return 1; +} + +int +fs_read_async_custom(struct fs_file *file, char *buffer, int count, fs_wait_cb callback_fn, void *callback_arg) +{ + LWIP_ASSERT("not implemented in this example configuration", 0); + LWIP_UNUSED_ARG(file); + LWIP_UNUSED_ARG(buffer); + LWIP_UNUSED_ARG(count); + LWIP_UNUSED_ARG(callback_fn); + LWIP_UNUSED_ARG(callback_arg); + /* Return + - FS_READ_EOF if all bytes have been read + - FS_READ_DELAYED if reading is delayed (call 'tcpip_callback(callback_fn, callback_arg)' when done) */ + /* all bytes read already */ + return FS_READ_EOF; +} + +#else /* LWIP_HTTPD_FS_ASYNC_READ */ +int +fs_read_custom(struct fs_file *file, char *buffer, int count) +{ + LWIP_ASSERT("not implemented in this example configuration", 0); + LWIP_UNUSED_ARG(file); + LWIP_UNUSED_ARG(buffer); + LWIP_UNUSED_ARG(count); + /* Return + - FS_READ_EOF if all bytes have been read + - FS_READ_DELAYED if reading is delayed (call 'tcpip_callback(callback_fn, callback_arg)' when done) */ + /* all bytes read already */ + return FS_READ_EOF; +} + +#endif /* LWIP_HTTPD_FS_ASYNC_READ */ + +#endif /* LWIP_HTTPD_EXAMPLE_GENERATEDFILES */ diff --git a/contrib/examples/httpd/genfiles_example/genfiles_example.h b/contrib/examples/httpd/genfiles_example/genfiles_example.h new file mode 100644 index 00000000..dd9731e0 --- /dev/null +++ b/contrib/examples/httpd/genfiles_example/genfiles_example.h @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +#ifndef LWIP_HDR_HTTP_EXAMPLES_GENFILES_EXAMPLE +#define LWIP_HDR_HTTP_EXAMPLES_GENFILES_EXAMPLE + +void genfiles_ex_init(void); + +#endif /* LWIP_HDR_HTTP_EXAMPLES_GENFILES_EXAMPLE */ diff --git a/contrib/examples/httpd/post_example/post_example.c b/contrib/examples/httpd/post_example/post_example.c new file mode 100644 index 00000000..110b3f12 --- /dev/null +++ b/contrib/examples/httpd/post_example/post_example.c @@ -0,0 +1,157 @@ +/** + * @file + * HTTPD example for simple POST + */ + + /* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +#include "lwip/opt.h" + +#include "lwip/apps/httpd.h" +#include "lwip/def.h" +#include "lwip/mem.h" + +#include +#include + +/** define LWIP_HTTPD_EXAMPLE_GENERATEDFILES to 1 to enable this file system */ +#ifndef LWIP_HTTPD_EXAMPLE_SIMPLEPOST +#define LWIP_HTTPD_EXAMPLE_SIMPLEPOST 0 +#endif + +#if LWIP_HTTPD_EXAMPLE_SIMPLEPOST + +#if !LWIP_HTTPD_SUPPORT_POST +#error This needs LWIP_HTTPD_SUPPORT_POST +#endif + +#define USER_PASS_BUFSIZE 16 + +static void *current_connection; +static void *valid_connection; +static char last_user[USER_PASS_BUFSIZE]; + +err_t +httpd_post_begin(void *connection, const char *uri, const char *http_request, + u16_t http_request_len, int content_len, char *response_uri, + u16_t response_uri_len, u8_t *post_auto_wnd) +{ + LWIP_UNUSED_ARG(connection); + LWIP_UNUSED_ARG(http_request); + LWIP_UNUSED_ARG(http_request_len); + LWIP_UNUSED_ARG(content_len); + LWIP_UNUSED_ARG(post_auto_wnd); + if (!memcmp(uri, "/login.cgi", 11)) { + if (current_connection != connection) { + current_connection = connection; + valid_connection = NULL; + /* default page is "login failed" */ + snprintf(response_uri, response_uri_len, "/loginfail.html"); + /* e.g. for large uploads to slow flash over a fast connection, you should + manually update the rx window. That way, a sender can only send a full + tcp window at a time. If this is required, set 'post_aut_wnd' to 0. + We do not need to throttle upload speed here, so: */ + *post_auto_wnd = 1; + return ERR_OK; + } + } + return ERR_VAL; +} + +err_t +httpd_post_receive_data(void *connection, struct pbuf *p) +{ + if (current_connection == connection) { + u16_t token_user = pbuf_memfind(p, "user=", 5, 0); + u16_t token_pass = pbuf_memfind(p, "pass=", 5, 0); + if ((token_user != 0xFFFF) && (token_pass != 0xFFFF)) { + u16_t value_user = token_user + 5; + u16_t value_pass = token_pass + 5; + u16_t len_user = 0; + u16_t len_pass = 0; + u16_t tmp; + /* find user len */ + tmp = pbuf_memfind(p, "&", 1, value_user); + if (tmp != 0xFFFF) { + len_user = tmp - value_user; + } else { + len_user = p->tot_len - value_user; + } + /* find pass len */ + tmp = pbuf_memfind(p, "&", 1, value_pass); + if (tmp != 0xFFFF) { + len_pass = tmp - value_pass; + } else { + len_pass = p->tot_len - value_pass; + } + if ((len_user > 0) && (len_user < USER_PASS_BUFSIZE) && + (len_pass > 0) && (len_pass < USER_PASS_BUFSIZE)) { + /* provide contiguous storage if p is a chained pbuf */ + char buf_user[USER_PASS_BUFSIZE]; + char buf_pass[USER_PASS_BUFSIZE]; + char *user = (char *)pbuf_get_contiguous(p, buf_user, sizeof(buf_user), len_user, value_user); + char *pass = (char *)pbuf_get_contiguous(p, buf_pass, sizeof(buf_pass), len_pass, value_pass); + if (user && pass) { + user[len_user] = 0; + pass[len_pass] = 0; + if (!strcmp(user, "lwip") && !strcmp(pass, "post")) { + /* user and password are correct, create a "session" */ + valid_connection = connection; + memcpy(last_user, user, sizeof(last_user)); + } + } + } + } + /* not returning ERR_OK aborts the connection, so return ERR_OK unless the + conenction is unknown */ + return ERR_OK; + } + return ERR_VAL; +} + +void +httpd_post_finished(void *connection, char *response_uri, u16_t response_uri_len) +{ + /* default page is "login failed" */ + snprintf(response_uri, response_uri_len, "/loginfail.html"); + if (current_connection == connection) { + if (valid_connection == connection) { + /* login succeeded */ + snprintf(response_uri, response_uri_len, "/session.html"); + } + current_connection = NULL; + valid_connection = NULL; + } +} + +#endif /* LWIP_HTTPD_EXAMPLE_SIMPLEPOST*/ diff --git a/contrib/examples/httpd/ssi_example/ssi_example.c b/contrib/examples/httpd/ssi_example/ssi_example.c new file mode 100644 index 00000000..2024e2ea --- /dev/null +++ b/contrib/examples/httpd/ssi_example/ssi_example.c @@ -0,0 +1,264 @@ +/** + * @file + * HTTPD simple SSI example + * + * This file demonstrates how to add support for SSI. + * It does this in a very simple way by providing the three tags 'HelloWorld' + * 'counter', and 'MultiPart'. + * + * This file also demonstrates how to integrate CGI with SSI. + */ + + /* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +#include "lwip/opt.h" +#include "ssi_example.h" + +#include "lwip/apps/httpd.h" + +#include "lwip/def.h" +#include "lwip/mem.h" + +#include +#include + +/** define LWIP_HTTPD_EXAMPLE_SSI_SIMPLE to 1 to enable this ssi example*/ +#ifndef LWIP_HTTPD_EXAMPLE_SSI_SIMPLE +#define LWIP_HTTPD_EXAMPLE_SSI_SIMPLE 0 +#endif + +/** define LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION to 1 to show how to + * integrate CGI into SSI (LWIP_HTTPD_CGI_SSI) */ +#ifndef LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION +#define LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION 0 +#endif + +#if LWIP_HTTPD_EXAMPLE_SSI_SIMPLE + +#if LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION +#if !LWIP_HTTPD_FILE_STATE +#error LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION needs LWIP_HTTPD_FILE_STATE +#endif +#if !LWIP_HTTPD_CGI_SSI +#error LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION needs LWIP_HTTPD_CGI_SSI +#endif + +#define MAX_CGI_LEN 16 +#endif + +const char * ssi_example_tags[] = { + "HellWorl", + "counter", + "MultPart" +#if LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION + ,"CgiParam" +#endif +}; + +u16_t ssi_example_ssi_handler( +#if LWIP_HTTPD_SSI_RAW + const char* ssi_tag_name, +#else /* LWIP_HTTPD_SSI_RAW */ + int iIndex, +#endif /* LWIP_HTTPD_SSI_RAW */ + char *pcInsert, int iInsertLen +#if LWIP_HTTPD_SSI_MULTIPART + , u16_t current_tag_part, u16_t *next_tag_part +#endif /* LWIP_HTTPD_SSI_MULTIPART */ +#if defined(LWIP_HTTPD_FILE_STATE) && LWIP_HTTPD_FILE_STATE + , void *connection_state +#endif /* LWIP_HTTPD_FILE_STATE */ + ) +{ + size_t printed; +#if LWIP_HTTPD_SSI_RAW + /* a real application could use if(!strcmp) blocks here, but we want to keep + the differences between configurations small, so translate string to index here */ + int iIndex; + for (iIndex = 0; iIndex < LWIP_ARRAYSIZE(ssi_example_tags); iIndex++) { + if(!strcmp(ssi_tag_name, ssi_example_tags[iIndex])) { + break; + } + } +#endif +#if defined(LWIP_HTTPD_FILE_STATE) && LWIP_HTTPD_FILE_STATE + LWIP_UNUSED_ARG(connection_state); +#endif + + switch (iIndex) { + case 0: /* "HelloWorld" */ + printed = snprintf(pcInsert, iInsertLen, "Hello World!"); + break; + case 1: /* "counter" */ + { + static int counter; + counter++; + printed = snprintf(pcInsert, iInsertLen, "%d", counter); + } + break; + case 2: /* "MultPart" */ +#if LWIP_HTTPD_SSI_MULTIPART + switch (current_tag_part) { + case 0: + printed = snprintf(pcInsert, iInsertLen, "part0"); + *next_tag_part = 1; + break; + case 1: + printed = snprintf(pcInsert, iInsertLen, "part1"); + *next_tag_part = 2; + break; + case 2: + printed = snprintf(pcInsert, iInsertLen, "part2"); + break; + default: + printed = snprintf(pcInsert, iInsertLen, "unhandled part: %d", (int)current_tag_part); + break; + } +#else + printed = snprintf(pcInsert, iInsertLen, "LWIP_HTTPD_SSI_MULTIPART disabled"); +#endif + break; +#if LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION + case 3: + if (connection_state) { + char *params = (char *)connection_state; + if (*params) { + printed = snprintf(pcInsert, iInsertLen, "%s", (char *)params); + } else { + printed = snprintf(pcInsert, iInsertLen, "none"); + } + } else { + printed = snprintf(pcInsert, iInsertLen, "NULL"); + } + break; +#endif + default: /* unknown tag */ + printed = 0; + break; + } + LWIP_ASSERT("sane length", printed <= 0xFFFF); + return (u16_t)printed; +} + +void +ssi_ex_init(void) +{ + int i; + for (i = 0; i < LWIP_ARRAYSIZE(ssi_example_tags); i++) { + LWIP_ASSERT("tag too long for LWIP_HTTPD_MAX_TAG_NAME_LEN", + strlen(ssi_example_tags[i]) <= LWIP_HTTPD_MAX_TAG_NAME_LEN); + } + + http_set_ssi_handler(ssi_example_ssi_handler, +#if LWIP_HTTPD_SSI_RAW + NULL, 0 +#else + ssi_example_tags, LWIP_ARRAYSIZE(ssi_example_tags) +#endif + ); +} + +#if LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION +void * +fs_state_init(struct fs_file *file, const char *name) +{ + char *ret; + LWIP_UNUSED_ARG(file); + LWIP_UNUSED_ARG(name); + ret = (char *)mem_malloc(MAX_CGI_LEN); + if (ret) { + *ret = 0; + } + return ret; +} + +void +fs_state_free(struct fs_file *file, void *state) +{ + LWIP_UNUSED_ARG(file); + if (state != NULL) { + mem_free(state); + } +} + +void +httpd_cgi_handler(struct fs_file *file, const char* uri, int iNumParams, + char **pcParam, char **pcValue +#if defined(LWIP_HTTPD_FILE_STATE) && LWIP_HTTPD_FILE_STATE + , void *connection_state +#endif /* LWIP_HTTPD_FILE_STATE */ + ) +{ + LWIP_UNUSED_ARG(file); + LWIP_UNUSED_ARG(uri); + if (connection_state != NULL) { + char *start = (char *)connection_state; + char *end = start + MAX_CGI_LEN; + int i; + memset(start, 0, MAX_CGI_LEN); + /* print a string of the arguments: */ + for (i = 0; i < iNumParams; i++) { + size_t len; + len = end - start; + if (len) { + size_t inlen = strlen(pcParam[i]); + size_t copylen = LWIP_MIN(inlen, len); + memcpy(start, pcParam[i], copylen); + start += copylen; + len -= copylen; + } + if (len) { + *start = '='; + start++; + len--; + } + if (len) { + size_t inlen = strlen(pcValue[i]); + size_t copylen = LWIP_MIN(inlen, len); + memcpy(start, pcValue[i], copylen); + start += copylen; + len -= copylen; + } + if (len) { + *start = ';'; + len--; + } + /* ensure NULL termination */ + end--; + *end = 0; + } + } +} +#endif /* LWIP_HTTPD_EXAMPLE_SSI_SIMPLE_CGI_INTEGRATION */ + +#endif /* LWIP_HTTPD_EXAMPLE_SSI_SIMPLE */ diff --git a/contrib/examples/httpd/ssi_example/ssi_example.h b/contrib/examples/httpd/ssi_example/ssi_example.h new file mode 100644 index 00000000..b7ec298a --- /dev/null +++ b/contrib/examples/httpd/ssi_example/ssi_example.h @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +#ifndef LWIP_HDR_HTTP_EXAMPLES_SSI_EXAMPLE +#define LWIP_HDR_HTTP_EXAMPLES_SSI_EXAMPLE + +void ssi_ex_init(void); + +#endif /* LWIP_HDR_HTTP_EXAMPLES_SSI_EXAMPLE */ diff --git a/contrib/examples/lwiperf/lwiperf_example.c b/contrib/examples/lwiperf/lwiperf_example.c new file mode 100644 index 00000000..b406f96c --- /dev/null +++ b/contrib/examples/lwiperf/lwiperf_example.c @@ -0,0 +1,50 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#include "lwip/apps/lwiperf.h" +#include "lwiperf_example.h" + +static void +lwiperf_report(void *arg, enum lwiperf_report_type report_type, + const ip_addr_t* local_addr, u16_t local_port, const ip_addr_t* remote_addr, u16_t remote_port, + u32_t bytes_transferred, u32_t ms_duration, u32_t bandwidth_kbitpsec) +{ + LWIP_UNUSED_ARG(arg); + LWIP_UNUSED_ARG(local_addr); + LWIP_UNUSED_ARG(local_port); + + printf("IPERF report: type=%d, remote: %s:%d, total bytes: %"U32_F", duration in ms: %"U32_F", kbits/s: %"U32_F"\n", + (int)report_type, ipaddr_ntoa(remote_addr), (int)remote_port, bytes_transferred, ms_duration, bandwidth_kbitpsec); +} + +void +lwiperf_example_init(void) +{ + lwiperf_start_tcp_server_default(lwiperf_report, NULL); +} diff --git a/contrib/examples/lwiperf/lwiperf_example.h b/contrib/examples/lwiperf/lwiperf_example.h new file mode 100644 index 00000000..d7b35c88 --- /dev/null +++ b/contrib/examples/lwiperf/lwiperf_example.h @@ -0,0 +1,43 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#ifndef LWIPERF_EXAMPLE_H +#define LWIPERF_EXAMPLE_H + +#ifdef __cplusplus +extern "C" { +#endif + +void lwiperf_example_init(void); + +#ifdef __cplusplus +} +#endif + +#endif /* LWIPERF_EXAMPLE_H */ diff --git a/contrib/examples/mdns/mdns_example.c b/contrib/examples/mdns/mdns_example.c new file mode 100644 index 00000000..f5cc0585 --- /dev/null +++ b/contrib/examples/mdns/mdns_example.c @@ -0,0 +1,63 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#include "lwip/apps/mdns.h" +#include "mdns_example.h" + +#if LWIP_MDNS_RESPONDER +static void +srv_txt(struct mdns_service *service, void *txt_userdata) +{ + err_t res; + LWIP_UNUSED_ARG(txt_userdata); + + res = mdns_resp_add_service_txtitem(service, "path=/", 6); + LWIP_ERROR("mdns add service txt failed\n", (res == ERR_OK), return); +} +#endif + +#if LWIP_MDNS_RESPONDER +static void +mdns_example_report(struct netif* netif, u8_t result) +{ + LWIP_PLATFORM_DIAG(("mdns status[netif %d]: %d\n", netif->num, result)); +} +#endif + +void +mdns_example_init(void) +{ +#if LWIP_MDNS_RESPONDER + mdns_resp_register_name_result_cb(mdns_example_report); + mdns_resp_init(); + mdns_resp_add_netif(netif_default, "lwip", 3600); + mdns_resp_add_service(netif_default, "myweb", "_http", DNSSD_PROTO_TCP, 80, 3600, srv_txt, NULL); + mdns_resp_announce(netif_default); +#endif +} diff --git a/contrib/examples/mdns/mdns_example.h b/contrib/examples/mdns/mdns_example.h new file mode 100644 index 00000000..ab51ade5 --- /dev/null +++ b/contrib/examples/mdns/mdns_example.h @@ -0,0 +1,43 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#ifndef MDNS_EXAMPLE_H +#define MDNS_EXAMPLE_H + +#ifdef __cplusplus +extern "C" { +#endif + +void mdns_example_init(void); + +#ifdef __cplusplus +} +#endif + +#endif /* MDNS_EXAMPLE_H */ diff --git a/contrib/examples/mqtt/mqtt_example.c b/contrib/examples/mqtt/mqtt_example.c new file mode 100644 index 00000000..f57b005f --- /dev/null +++ b/contrib/examples/mqtt/mqtt_example.c @@ -0,0 +1,128 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#include "lwip/apps/mqtt.h" +#include "mqtt_example.h" + +#if LWIP_TCP + +/** Define this to a compile-time IP address initialization + * to connect anything else than IPv4 loopback + */ +#ifndef LWIP_MQTT_EXAMPLE_IPADDR_INIT +#if LWIP_IPV4 +#define LWIP_MQTT_EXAMPLE_IPADDR_INIT = IPADDR4_INIT(IPADDR_LOOPBACK) +#else +#define LWIP_MQTT_EXAMPLE_IPADDR_INIT +#endif +#endif + +static ip_addr_t mqtt_ip LWIP_MQTT_EXAMPLE_IPADDR_INIT; +static mqtt_client_t* mqtt_client; + +static const struct mqtt_connect_client_info_t mqtt_client_info = +{ + "test", + NULL, /* user */ + NULL, /* pass */ + 100, /* keep alive */ + NULL, /* will_topic */ + NULL, /* will_msg */ + 0, /* will_qos */ + 0 /* will_retain */ +#if LWIP_ALTCP && LWIP_ALTCP_TLS + , NULL +#endif +}; + +static void +mqtt_incoming_data_cb(void *arg, const u8_t *data, u16_t len, u8_t flags) +{ + const struct mqtt_connect_client_info_t* client_info = (const struct mqtt_connect_client_info_t*)arg; + LWIP_UNUSED_ARG(data); + + printf("MQTT client \"%s\" data cb: len %d, flags %d\n", client_info->client_id, + (int)len, (int)flags); +} + +static void +mqtt_incoming_publish_cb(void *arg, const char *topic, u32_t tot_len) +{ + const struct mqtt_connect_client_info_t* client_info = (const struct mqtt_connect_client_info_t*)arg; + + printf("MQTT client \"%s\" publish cb: topic %s, len %d\n", client_info->client_id, + topic, (int)tot_len); +} + +static void +mqtt_request_cb(void *arg, err_t err) +{ + const struct mqtt_connect_client_info_t* client_info = (const struct mqtt_connect_client_info_t*)arg; + + printf("MQTT client \"%s\" request cb: err %d\n", client_info->client_id, (int)err); +} + +static void +mqtt_connection_cb(mqtt_client_t *client, void *arg, mqtt_connection_status_t status) +{ + const struct mqtt_connect_client_info_t* client_info = (const struct mqtt_connect_client_info_t*)arg; + LWIP_UNUSED_ARG(client); + + printf("MQTT client \"%s\" connection cb: status %d\n", client_info->client_id, (int)status); + + if (status == MQTT_CONNECT_ACCEPTED) { + mqtt_sub_unsub(client, + "topic_qos1", 1, + mqtt_request_cb, LWIP_CONST_CAST(void*, client_info), + 1); + mqtt_sub_unsub(client, + "topic_qos0", 0, + mqtt_request_cb, LWIP_CONST_CAST(void*, client_info), + 1); + } +} +#endif /* LWIP_TCP */ + +void +mqtt_example_init(void) +{ +#if LWIP_TCP + mqtt_client = mqtt_client_new(); + + mqtt_set_inpub_callback(mqtt_client, + mqtt_incoming_publish_cb, + mqtt_incoming_data_cb, + LWIP_CONST_CAST(void*, &mqtt_client_info)); + + mqtt_client_connect(mqtt_client, + &mqtt_ip, MQTT_PORT, + mqtt_connection_cb, LWIP_CONST_CAST(void*, &mqtt_client_info), + &mqtt_client_info); +#endif /* LWIP_TCP */ +} diff --git a/contrib/examples/mqtt/mqtt_example.h b/contrib/examples/mqtt/mqtt_example.h new file mode 100644 index 00000000..797678b2 --- /dev/null +++ b/contrib/examples/mqtt/mqtt_example.h @@ -0,0 +1,43 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#ifndef MQTT_EXAMPLE_H +#define MQTT_EXAMPLE_H + +#ifdef __cplusplus +extern "C" { +#endif + +void mqtt_example_init(void); + +#ifdef __cplusplus +} +#endif + +#endif /* MQTT_EXAMPLE_H */ diff --git a/contrib/examples/ppp/pppos_example.c b/contrib/examples/ppp/pppos_example.c new file mode 100644 index 00000000..b738d1ee --- /dev/null +++ b/contrib/examples/ppp/pppos_example.c @@ -0,0 +1,219 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#include "lwip/dns.h" + +#ifndef PPPOS_SUPPORT +#define PPPOS_SUPPORT 0 +#endif /* PPPOS_SUPPORT */ + +#if PPPOS_SUPPORT +#include "netif/ppp/pppos.h" +#include "lwip/sio.h" +#define PPP_PTY_TEST 1 +#endif /* PPPOS_SUPPORT */ + +#include "pppos_example.h" + +#if PPPOS_SUPPORT +static sio_fd_t ppp_sio; +static ppp_pcb *ppp; +static struct netif pppos_netif; + +static void +pppos_rx_thread(void *arg) +{ + u32_t len; + u8_t buffer[128]; + LWIP_UNUSED_ARG(arg); + + /* Please read the "PPPoS input path" chapter in the PPP documentation. */ + while (1) { + len = sio_read(ppp_sio, buffer, sizeof(buffer)); + if (len > 0) { + /* Pass received raw characters from PPPoS to be decoded through lwIP + * TCPIP thread using the TCPIP API. This is thread safe in all cases + * but you should avoid passing data byte after byte. */ + pppos_input_tcpip(ppp, buffer, len); + } + } +} + +static void +ppp_link_status_cb(ppp_pcb *pcb, int err_code, void *ctx) +{ + struct netif *pppif = ppp_netif(pcb); + LWIP_UNUSED_ARG(ctx); + + switch(err_code) { + case PPPERR_NONE: /* No error. */ + { +#if LWIP_DNS + const ip_addr_t *ns; +#endif /* LWIP_DNS */ + fprintf(stderr, "ppp_link_status_cb: PPPERR_NONE\n\r"); +#if LWIP_IPV4 + fprintf(stderr, " our_ip4addr = %s\n\r", ip4addr_ntoa(netif_ip4_addr(pppif))); + fprintf(stderr, " his_ipaddr = %s\n\r", ip4addr_ntoa(netif_ip4_gw(pppif))); + fprintf(stderr, " netmask = %s\n\r", ip4addr_ntoa(netif_ip4_netmask(pppif))); +#endif /* LWIP_IPV4 */ +#if LWIP_IPV6 + fprintf(stderr, " our_ip6addr = %s\n\r", ip6addr_ntoa(netif_ip6_addr(pppif, 0))); +#endif /* LWIP_IPV6 */ + +#if LWIP_DNS + ns = dns_getserver(0); + fprintf(stderr, " dns1 = %s\n\r", ipaddr_ntoa(ns)); + ns = dns_getserver(1); + fprintf(stderr, " dns2 = %s\n\r", ipaddr_ntoa(ns)); +#endif /* LWIP_DNS */ +#if PPP_IPV6_SUPPORT + fprintf(stderr, " our6_ipaddr = %s\n\r", ip6addr_ntoa(netif_ip6_addr(pppif, 0))); +#endif /* PPP_IPV6_SUPPORT */ + } + break; + + case PPPERR_PARAM: /* Invalid parameter. */ + printf("ppp_link_status_cb: PPPERR_PARAM\n"); + break; + + case PPPERR_OPEN: /* Unable to open PPP session. */ + printf("ppp_link_status_cb: PPPERR_OPEN\n"); + break; + + case PPPERR_DEVICE: /* Invalid I/O device for PPP. */ + printf("ppp_link_status_cb: PPPERR_DEVICE\n"); + break; + + case PPPERR_ALLOC: /* Unable to allocate resources. */ + printf("ppp_link_status_cb: PPPERR_ALLOC\n"); + break; + + case PPPERR_USER: /* User interrupt. */ + printf("ppp_link_status_cb: PPPERR_USER\n"); + break; + + case PPPERR_CONNECT: /* Connection lost. */ + printf("ppp_link_status_cb: PPPERR_CONNECT\n"); + break; + + case PPPERR_AUTHFAIL: /* Failed authentication challenge. */ + printf("ppp_link_status_cb: PPPERR_AUTHFAIL\n"); + break; + + case PPPERR_PROTOCOL: /* Failed to meet protocol. */ + printf("ppp_link_status_cb: PPPERR_PROTOCOL\n"); + break; + + case PPPERR_PEERDEAD: /* Connection timeout. */ + printf("ppp_link_status_cb: PPPERR_PEERDEAD\n"); + break; + + case PPPERR_IDLETIMEOUT: /* Idle Timeout. */ + printf("ppp_link_status_cb: PPPERR_IDLETIMEOUT\n"); + break; + + case PPPERR_CONNECTTIME: /* PPPERR_CONNECTTIME. */ + printf("ppp_link_status_cb: PPPERR_CONNECTTIME\n"); + break; + + case PPPERR_LOOPBACK: /* Connection timeout. */ + printf("ppp_link_status_cb: PPPERR_LOOPBACK\n"); + break; + + default: + printf("ppp_link_status_cb: unknown errCode %d\n", err_code); + break; + } +} + +static u32_t +ppp_output_cb(ppp_pcb *pcb, u8_t *data, u32_t len, void *ctx) +{ + LWIP_UNUSED_ARG(pcb); + LWIP_UNUSED_ARG(ctx); + return sio_write(ppp_sio, data, len); +} + +#if LWIP_NETIF_STATUS_CALLBACK +static void +netif_status_callback(struct netif *nif) +{ + printf("PPPNETIF: %c%c%d is %s\n", nif->name[0], nif->name[1], nif->num, + netif_is_up(nif) ? "UP" : "DOWN"); +#if LWIP_IPV4 + printf("IPV4: Host at %s ", ip4addr_ntoa(netif_ip4_addr(nif))); + printf("mask %s ", ip4addr_ntoa(netif_ip4_netmask(nif))); + printf("gateway %s\n", ip4addr_ntoa(netif_ip4_gw(nif))); +#endif /* LWIP_IPV4 */ +#if LWIP_IPV6 + printf("IPV6: Host at %s\n", ip6addr_ntoa(netif_ip6_addr(nif, 0))); +#endif /* LWIP_IPV6 */ +#if LWIP_NETIF_HOSTNAME + printf("FQDN: %s\n", netif_get_hostname(nif)); +#endif /* LWIP_NETIF_HOSTNAME */ +} +#endif /* LWIP_NETIF_STATUS_CALLBACK */ +#endif + +void +pppos_example_init(void) +{ +#if PPPOS_SUPPORT +#if PPP_PTY_TEST + ppp_sio = sio_open(2); +#else + ppp_sio = sio_open(0); +#endif + if(!ppp_sio) + { + perror("PPPOS example: Error opening device"); + return; + } + + ppp = pppos_create(&pppos_netif, ppp_output_cb, ppp_link_status_cb, NULL); + if (!ppp) + { + printf("PPPOS example: Could not create PPP control interface"); + return; + } + +#ifdef LWIP_PPP_CHAP_TEST + ppp_set_auth(ppp, PPPAUTHTYPE_CHAP, "lwip", "mysecret"); +#endif + + ppp_connect(ppp, 0); + +#if LWIP_NETIF_STATUS_CALLBACK + netif_set_status_callback(&pppos_netif, netif_status_callback); +#endif /* LWIP_NETIF_STATUS_CALLBACK */ + + sys_thread_new("pppos_rx_thread", pppos_rx_thread, NULL, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); +#endif /* PPPOS_SUPPORT */ +} diff --git a/contrib/examples/ppp/pppos_example.h b/contrib/examples/ppp/pppos_example.h new file mode 100644 index 00000000..726961c8 --- /dev/null +++ b/contrib/examples/ppp/pppos_example.h @@ -0,0 +1,43 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#ifndef PPPOS_EXAMPLE_H +#define PPPOS_EXAMPLE_H + +#ifdef __cplusplus +extern "C" { +#endif + +void pppos_example_init(void); + +#ifdef __cplusplus +} +#endif + +#endif /* PPPOS_EXAMPLE_H */ diff --git a/contrib/examples/snmp/snmp_example.c b/contrib/examples/snmp/snmp_example.c new file mode 100644 index 00000000..62c41f0d --- /dev/null +++ b/contrib/examples/snmp/snmp_example.c @@ -0,0 +1,72 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#include "lwip/apps/snmp.h" +#include "lwip/apps/snmp_mib2.h" +#include "lwip/apps/snmpv3.h" +#include "lwip/apps/snmp_snmpv2_framework.h" +#include "lwip/apps/snmp_snmpv2_usm.h" +#include "examples/snmp/snmp_v3/snmpv3_dummy.h" +#include "examples/snmp/snmp_private_mib/private_mib.h" +#include "snmp_example.h" + + +#if LWIP_SNMP +static const struct snmp_mib *mibs[] = { + &mib2, + &mib_private +#if LWIP_SNMP_V3 + , &snmpframeworkmib + , &snmpusmmib +#endif +}; +#endif /* LWIP_SNMP */ + +void +snmp_example_init(void) +{ +#if LWIP_SNMP + lwip_privmib_init(); +#if SNMP_LWIP_MIB2 +#if SNMP_USE_NETCONN + snmp_threadsync_init(&snmp_mib2_lwip_locks, snmp_mib2_lwip_synchronizer); +#endif /* SNMP_USE_NETCONN */ + snmp_mib2_set_syscontact_readonly((const u8_t*)"root", NULL); + snmp_mib2_set_syslocation_readonly((const u8_t*)"lwIP development PC", NULL); + snmp_mib2_set_sysdescr((const u8_t*)"simhost", NULL); +#endif /* SNMP_LWIP_MIB2 */ + +#if LWIP_SNMP_V3 + snmpv3_dummy_init(); +#endif + + snmp_set_mibs(mibs, LWIP_ARRAYSIZE(mibs)); + snmp_init(); +#endif /* LWIP_SNMP */ +} diff --git a/contrib/examples/snmp/snmp_example.h b/contrib/examples/snmp/snmp_example.h new file mode 100644 index 00000000..fafcd68f --- /dev/null +++ b/contrib/examples/snmp/snmp_example.h @@ -0,0 +1,43 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#ifndef SNMP_EXAMPLE_H +#define SNMP_EXAMPLE_H + +#ifdef __cplusplus +extern "C" { +#endif + +void snmp_example_init(void); + +#ifdef __cplusplus +} +#endif + +#endif /* SNMP_EXAMPLE_H */ diff --git a/contrib/examples/snmp/snmp_private_mib/lwip_prvmib.c b/contrib/examples/snmp/snmp_private_mib/lwip_prvmib.c new file mode 100644 index 00000000..51a49fe1 --- /dev/null +++ b/contrib/examples/snmp/snmp_private_mib/lwip_prvmib.c @@ -0,0 +1,401 @@ +/** + * @file + * lwip Private MIB + * + * @todo create MIB file for this example + * @note the lwip enterprise tree root (26381) is owned by the lwIP project. + * It is NOT allowed to allocate new objects under this ID (26381) without our, + * the lwip developers, permission! + * + * Please apply for your own ID with IANA: http://www.iana.org/numbers.html + * + * lwip OBJECT IDENTIFIER ::= { enterprises 26381 } + * example OBJECT IDENTIFIER ::= { lwip 1 } + */ + +/* + * Copyright (c) 2006 Axon Digital Design B.V., The Netherlands. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * Author: Christiaan Simons + */ + +#include "private_mib.h" + +#if LWIP_SNMP + +/** Directory where the sensor files are */ +#define SENSORS_DIR "w:\\sensors" +/** Set to 1 to read sensor values from files (in directory defined by SENSORS_DIR) */ +#define SENSORS_USE_FILES 0 +/** Set to 1 to search sensor files at startup (in directory defined by SENSORS_DIR) */ +#define SENSORS_SEARCH_FILES 0 + +#if SENSORS_SEARCH_FILES +#include +#include +#include +#include +#include +#endif /* SENSORS_SEARCH_FILES */ + +#include +#include + +#include "lwip/apps/snmp_table.h" +#include "lwip/apps/snmp_scalar.h" + +#if !SENSORS_USE_FILES || !SENSORS_SEARCH_FILES +/** When not using & searching files, defines the number of sensors */ +#define SENSOR_COUNT 4 +#endif /* !SENSORS_USE_FILES || !SENSORS_SEARCH_FILES */ + +/* + This example presents a table for a few (at most 10) sensors. + Sensor detection takes place at initialization (once only). + Sensors may and can not be added or removed after agent + has started. Note this is only a limitation of this crude example, + the agent does support dynamic object insertions and removals. + + You'll need to manually create a directory called "sensors" and + a few single line text files with an integer temperature value. + The files must be called [0..9].txt. + + ./sensors/0.txt [content: 20] + ./sensors/3.txt [content: 75] + + The sensor values may be changed in runtime by editing the + text files in the "sensors" directory. +*/ + +#define SENSOR_MAX 10 +#define SENSOR_NAME_LEN 20 + +struct sensor_inf +{ + u8_t num; + + char file[SENSOR_NAME_LEN + 1]; + +#if !SENSORS_USE_FILES + /** When not using files, contains the value of the sensor */ + s32_t value; +#endif /* !SENSORS_USE_FILES */ +}; + +static struct sensor_inf sensors[SENSOR_MAX]; + +static s16_t sensor_count_get_value(struct snmp_node_instance* instance, void* value); +static snmp_err_t sensor_table_get_cell_instance(const u32_t* column, const u32_t* row_oid, u8_t row_oid_len, struct snmp_node_instance* cell_instance); +static snmp_err_t sensor_table_get_next_cell_instance(const u32_t* column, struct snmp_obj_id* row_oid, struct snmp_node_instance* cell_instance); +static s16_t sensor_table_get_value(struct snmp_node_instance* instance, void* value); +static snmp_err_t sensor_table_set_value(struct snmp_node_instance* instance, u16_t len, void *value); + +/* sensorentry .1.3.6.1.4.1.26381.1.1.1 (.level0.level1) + where level 0 is the table column (temperature/file name) + and level 1 the table row (sensor index) */ +static const struct snmp_table_col_def sensor_table_columns[] = { + { 1, SNMP_ASN1_TYPE_INTEGER, SNMP_NODE_INSTANCE_READ_WRITE }, + { 2, SNMP_ASN1_TYPE_OCTET_STRING, SNMP_NODE_INSTANCE_READ_ONLY } +}; + +/* sensortable .1.3.6.1.4.1.26381.1.1 */ +static const struct snmp_table_node sensor_table = SNMP_TABLE_CREATE( + 1, sensor_table_columns, + sensor_table_get_cell_instance, sensor_table_get_next_cell_instance, + sensor_table_get_value, snmp_set_test_ok, sensor_table_set_value); + +/* sensorcount .1.3.6.1.4.1.26381.1.2 */ +static const struct snmp_scalar_node sensor_count = SNMP_SCALAR_CREATE_NODE_READONLY( + 2, SNMP_ASN1_TYPE_INTEGER, sensor_count_get_value); + +/* example .1.3.6.1.4.1.26381.1 */ +static const struct snmp_node* const example_nodes[] = { + &sensor_table.node.node, + &sensor_count.node.node +}; +static const struct snmp_tree_node example_node = SNMP_CREATE_TREE_NODE(1, example_nodes); + +static const u32_t prvmib_base_oid[] = { 1,3,6,1,4,1,26381,1 }; +const struct snmp_mib mib_private = SNMP_MIB_CREATE(prvmib_base_oid, &example_node.node); + +#if 0 +/* for reference: we could also have expressed it like this: */ + +/* lwip .1.3.6.1.4.1.26381 */ +static const struct snmp_node* const lwip_nodes[] = { + &example_node.node +}; +static const struct snmp_tree_node lwip_node = SNMP_CREATE_TREE_NODE(26381, lwip_nodes); + +/* enterprises .1.3.6.1.4.1 */ +static const struct snmp_node* const enterprises_nodes[] = { + &lwip_node.node +}; +static const struct snmp_tree_node enterprises_node = SNMP_CREATE_TREE_NODE(1, enterprises_nodes); + +/* private .1.3.6.1.4 */ +static const struct snmp_node* const private_nodes[] = { + &enterprises_node.node +}; +static const struct snmp_tree_node private_root = SNMP_CREATE_TREE_NODE(4, private_nodes); + +static const u32_t prvmib_base_oid[] = { 1,3,6,1,4 }; +const struct snmp_mib mib_private = SNMP_MIB_CREATE(prvmib_base_oid, &private_root.node); +#endif + +/** + * Initialises this private MIB before use. + * @see main.c + */ +void +lwip_privmib_init(void) +{ +#if SENSORS_USE_FILES && SENSORS_SEARCH_FILES + char *buf, *ebuf, *cp; + size_t bufsize; + int nbytes; + struct stat sb; + struct dirent *dp; + int fd; +#else /* SENSORS_USE_FILES && SENSORS_SEARCH_FILES */ + u8_t i; +#endif /* SENSORS_USE_FILES && SENSORS_SEARCH_FILES */ + + memset(sensors, 0, sizeof(sensors)); + + printf("SNMP private MIB start, detecting sensors.\n"); + +#if SENSORS_USE_FILES && SENSORS_SEARCH_FILES + /* look for sensors in sensors directory */ + fd = open(SENSORS_DIR, O_RDONLY); + if (fd > -1) + { + fstat(fd, &sb); + bufsize = sb.st_size; + if (bufsize < (size_t)sb.st_blksize) + { + bufsize = sb.st_blksize; + } + buf = (char*)malloc(bufsize); + if (buf != NULL) + { + do + { + long base; + + nbytes = getdirentries(fd, buf, bufsize, &base); + if (nbytes > 0) + { + ebuf = buf + nbytes; + cp = buf; + while (cp < ebuf) + { + dp = (struct dirent *)cp; + if (lwip_isdigit(dp->d_name[0])) + { + unsigned char idx = dp->d_name[0] - '0'; + + sensors[idx].num = idx+1; + strncpy(&sensors[idx].file[0], dp->d_name, SENSOR_NAME_LEN); + printf("%s\n", sensors[idx].file); + } + cp += dp->d_reclen; + } + } + } + while (nbytes > 0); + + free(buf); + } + close(fd); + } +#else /* SENSORS_USE_FILES && SENSORS_SEARCH_FILES */ + for (i = 0; i < SENSOR_COUNT; i++) { + sensors[i].num = (u8_t)(i + 1); + snprintf(sensors[i].file, sizeof(sensors[i].file), "%d.txt", i); + +#if !SENSORS_USE_FILES + /* initialize sensor value to != zero */ + sensors[i].value = 11 * (i+1); +#endif /* !SENSORS_USE_FILES */ + } +#endif /* SENSORS_USE_FILE && SENSORS_SEARCH_FILES */ +} + +/* sensorcount .1.3.6.1.4.1.26381.1.2 */ +static s16_t +sensor_count_get_value(struct snmp_node_instance* instance, void* value) +{ + size_t count = 0; + u32_t *uint_ptr = (u32_t*)value; + + LWIP_UNUSED_ARG(instance); + + for(count=0; countreference.u32 = (u32_t)i; + return SNMP_ERR_NOERROR; + } + } + } + + /* not found */ + return SNMP_ERR_NOSUCHINSTANCE; +} + +static snmp_err_t +sensor_table_get_next_cell_instance(const u32_t* column, struct snmp_obj_id* row_oid, struct snmp_node_instance* cell_instance) +{ + size_t i; + struct snmp_next_oid_state state; + u32_t result_temp[LWIP_ARRAYSIZE(sensor_table_oid_ranges)]; + + LWIP_UNUSED_ARG(column); + + /* init struct to search next oid */ + snmp_next_oid_init(&state, row_oid->id, row_oid->len, result_temp, LWIP_ARRAYSIZE(sensor_table_oid_ranges)); + + /* iterate over all possible OIDs to find the next one */ + for(i=0; ireference.u32 = LWIP_CONST_CAST(u32_t, state.reference); + return SNMP_ERR_NOERROR; + } + + /* not found */ + return SNMP_ERR_NOSUCHINSTANCE; +} + +static s16_t +sensor_table_get_value(struct snmp_node_instance* instance, void* value) +{ + u32_t i = instance->reference.u32; + s32_t *temperature = (s32_t *)value; + + switch (SNMP_TABLE_GET_COLUMN_FROM_OID(instance->instance_oid.id)) + { + case 1: /* sensor value */ +#if SENSORS_USE_FILES + FILE* sensf; + char senspath[sizeof(SENSORS_DIR)+1+SENSOR_NAME_LEN+1] = SENSORS_DIR"/"; + + strncpy(&senspath[sizeof(SENSORS_DIR)], + sensors[i].file, + SENSOR_NAME_LEN); + sensf = fopen(senspath,"r"); + if (sensf != NULL) + { + fscanf(sensf,"%"S32_F,temperature); + fclose(sensf); + } +#else /* SENSORS_USE_FILES */ + *temperature = sensors[i].value; +#endif /* SENSORS_USE_FILES */ + return sizeof(s32_t); + case 2: /* file name */ + MEMCPY(value, sensors[i].file, strlen(sensors[i].file)); + return (s16_t)strlen(sensors[i].file); + default: + return 0; + } +} + +static snmp_err_t +sensor_table_set_value(struct snmp_node_instance* instance, u16_t len, void *value) +{ + u32_t i = instance->reference.u32; + s32_t *temperature = (s32_t *)value; +#if SENSORS_USE_FILES + FILE* sensf; + char senspath[sizeof(SENSORS_DIR)+1+SENSOR_NAME_LEN+1] = SENSORS_DIR"/"; + + strncpy(&senspath[sizeof(SENSORS_DIR)], + sensors[i].file, + SENSOR_NAME_LEN); + sensf = fopen(senspath, "w"); + if (sensf != NULL) + { + fprintf(sensf, "%"S32_F, *temperature); + fclose(sensf); + } +#else /* SENSORS_USE_FILES */ + sensors[i].value = *temperature; +#endif /* SENSORS_USE_FILES */ + + LWIP_UNUSED_ARG(len); + + return SNMP_ERR_NOERROR; +} + +#endif /* LWIP_SNMP */ diff --git a/contrib/examples/snmp/snmp_private_mib/private_mib.h b/contrib/examples/snmp/snmp_private_mib/private_mib.h new file mode 100644 index 00000000..69be8a4f --- /dev/null +++ b/contrib/examples/snmp/snmp_private_mib/private_mib.h @@ -0,0 +1,26 @@ +/** + * @file + * Exports Private lwIP MIB + */ + +#ifndef LWIP_HDR_PRIVATE_MIB_H +#define LWIP_HDR_PRIVATE_MIB_H + +#include "lwip/apps/snmp_opts.h" + +#include "lwip/apps/snmp_core.h" + +#ifdef __cplusplus +extern "C" { +#endif + +/* export MIB */ +extern const struct snmp_mib mib_private; + +void lwip_privmib_init(void); + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/contrib/examples/snmp/snmp_v3/snmpv3_dummy.c b/contrib/examples/snmp/snmp_v3/snmpv3_dummy.c new file mode 100644 index 00000000..a7c53ed7 --- /dev/null +++ b/contrib/examples/snmp/snmp_v3/snmpv3_dummy.c @@ -0,0 +1,395 @@ +/** + * @file + * Dummy SNMPv3 functions. + */ + +/* + * Copyright (c) 2016 Elias Oenal. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * Author: Elias Oenal + * Dirk Ziegelmeier + */ + +#include "lwip/apps/snmpv3.h" +#include "snmpv3_dummy.h" +#include +#include "lwip/err.h" +#include "lwip/def.h" +#include "lwip/timeouts.h" + +#if LWIP_SNMP && LWIP_SNMP_V3 + +struct user_table_entry { + char username[32]; + snmpv3_auth_algo_t auth_algo; + u8_t auth_key[20]; + snmpv3_priv_algo_t priv_algo; + u8_t priv_key[20]; +}; + +static struct user_table_entry user_table[] = { + { "lwip", SNMP_V3_AUTH_ALGO_INVAL, "" , SNMP_V3_PRIV_ALGO_INVAL, "" }, + { "piwl", SNMP_V3_AUTH_ALGO_INVAL, "" , SNMP_V3_PRIV_ALGO_INVAL, "" }, + { "test", SNMP_V3_AUTH_ALGO_INVAL, "" , SNMP_V3_PRIV_ALGO_INVAL, "" } +}; + +static char snmpv3_engineid[32]; +static u8_t snmpv3_engineid_len; + +static u32_t enginetime = 0; + +/* In this implementation engineboots is volatile. In a real world application this value should be stored in non-volatile memory.*/ +static u32_t engineboots = 0; + +/** + * @brief Get the user table entry for the given username. + * + * @param[in] username pointer to the username + * + * @return pointer to the user table entry or NULL if not found. + */ +static struct user_table_entry* +get_user(const char *username) +{ + size_t i; + + for (i = 0; i < LWIP_ARRAYSIZE(user_table); i++) { + if (strnlen(username, 32) != strnlen(user_table[i].username, 32)) { + continue; + } + + if (memcmp(username, user_table[i].username, strnlen(username, 32)) == 0) { + return &user_table[i]; + } + } + + return NULL; +} + +u8_t +snmpv3_get_amount_of_users(void) +{ + return LWIP_ARRAYSIZE(user_table); +} + +/** + * @brief Get the username of a user number (index) + * @param username is a pointer to a string. + * @param index is the user index. + * @return ERR_OK if user is found, ERR_VAL is user is not found. + */ +err_t +snmpv3_get_username(char *username, u8_t index) +{ + if (index < LWIP_ARRAYSIZE(user_table)) { + MEMCPY(username, user_table[index].username, sizeof(user_table[0].username)); + return ERR_OK; + } + + return ERR_VAL; +} + +/** + * Timer callback function that increments enginetime and reschedules itself. + * + * @param arg unused argument + */ +static void +snmpv3_enginetime_timer(void *arg) +{ + LWIP_UNUSED_ARG(arg); + + enginetime++; + + /* This handles the engine time reset */ + snmpv3_get_engine_time_internal(); + + /* restart timer */ + sys_timeout(1000, snmpv3_enginetime_timer, NULL); +} + +err_t +snmpv3_set_user_auth_algo(const char *username, snmpv3_auth_algo_t algo) +{ + struct user_table_entry *p = get_user(username); + + if (p) { + switch (algo) { + case SNMP_V3_AUTH_ALGO_INVAL: + if (p->priv_algo != SNMP_V3_PRIV_ALGO_INVAL) { + /* Privacy MUST be disabled before configuring authentication */ + break; + } else { + p->auth_algo = algo; + return ERR_OK; + } +#if LWIP_SNMP_V3_CRYPTO + case SNMP_V3_AUTH_ALGO_MD5: + case SNMP_V3_AUTH_ALGO_SHA: +#endif + p->auth_algo = algo; + return ERR_OK; + default: + break; + } + } + + return ERR_VAL; +} + +err_t +snmpv3_set_user_priv_algo(const char *username, snmpv3_priv_algo_t algo) +{ + struct user_table_entry *p = get_user(username); + + if (p) { + switch (algo) { +#if LWIP_SNMP_V3_CRYPTO + case SNMP_V3_PRIV_ALGO_AES: + case SNMP_V3_PRIV_ALGO_DES: + if (p->auth_algo == SNMP_V3_AUTH_ALGO_INVAL) { + /* Authentication MUST be enabled before configuring privacy */ + break; + } else { + p->priv_algo = algo; + return ERR_OK; + } +#endif + case SNMP_V3_PRIV_ALGO_INVAL: + p->priv_algo = algo; + return ERR_OK; + default: + break; + } + } + + return ERR_VAL; +} + +err_t +snmpv3_set_user_auth_key(const char *username, const char *password) +{ + struct user_table_entry *p = get_user(username); + const char *engineid; + u8_t engineid_len; + + if (p) { + /* password should be at least 8 characters long */ + if (strlen(password) >= 8) { + memset(p->auth_key, 0, sizeof(p->auth_key)); + snmpv3_get_engine_id(&engineid, &engineid_len); + switch (p->auth_algo) { + case SNMP_V3_AUTH_ALGO_INVAL: + return ERR_OK; +#if LWIP_SNMP_V3_CRYPTO + case SNMP_V3_AUTH_ALGO_MD5: + snmpv3_password_to_key_md5((const u8_t*)password, strlen(password), (const u8_t*)engineid, engineid_len, p->auth_key); + return ERR_OK; + case SNMP_V3_AUTH_ALGO_SHA: + snmpv3_password_to_key_sha((const u8_t*)password, strlen(password), (const u8_t*)engineid, engineid_len, p->auth_key); + return ERR_OK; +#endif + default: + return ERR_VAL; + } + } + } + + return ERR_VAL; +} + +err_t +snmpv3_set_user_priv_key(const char *username, const char *password) +{ + struct user_table_entry *p = get_user(username); + const char *engineid; + u8_t engineid_len; + + if (p) { + /* password should be at least 8 characters long */ + if (strlen(password) >= 8) { + memset(p->priv_key, 0, sizeof(p->priv_key)); + snmpv3_get_engine_id(&engineid, &engineid_len); + switch (p->auth_algo) { + case SNMP_V3_AUTH_ALGO_INVAL: + return ERR_OK; +#if LWIP_SNMP_V3_CRYPTO + case SNMP_V3_AUTH_ALGO_MD5: + snmpv3_password_to_key_md5((const u8_t*)password, strlen(password), (const u8_t*)engineid, engineid_len, p->priv_key); + return ERR_OK; + case SNMP_V3_AUTH_ALGO_SHA: + snmpv3_password_to_key_sha((const u8_t*)password, strlen(password), (const u8_t*)engineid, engineid_len, p->priv_key); + return ERR_OK; +#endif + default: + return ERR_VAL; + } + } + } + + return ERR_VAL; +} + +/** + * @brief Get the storage type of the given username. + * + * @param[in] username pointer to the username + * @param[out] type the storage type + * + * @return ERR_OK if the user was found, ERR_VAL if not. + */ +err_t +snmpv3_get_user_storagetype(const char *username, snmpv3_user_storagetype_t *type) +{ + if (get_user(username) != NULL) { + /* Found user in user table + * In this dummy implementation, storage is permanent because no user can be deleted. + * All changes to users are lost after a reboot.*/ + *type = SNMP_V3_USER_STORAGETYPE_PERMANENT; + return ERR_OK; + } + + return ERR_VAL; +} + +/** + * @param username is a pointer to a string. + * @param auth_algo is a pointer to u8_t. The implementation has to set this if user was found. + * @param auth_key is a pointer to a pointer to a string. Implementation has to set this if user was found. + * @param priv_algo is a pointer to u8_t. The implementation has to set this if user was found. + * @param priv_key is a pointer to a pointer to a string. Implementation has to set this if user was found. + */ +err_t +snmpv3_get_user(const char* username, snmpv3_auth_algo_t *auth_algo, u8_t *auth_key, snmpv3_priv_algo_t *priv_algo, u8_t *priv_key) +{ + const struct user_table_entry *p; + + /* The msgUserName specifies the user (principal) on whose behalf the + message is being exchanged. Note that a zero-length userName will + not match any user, but it can be used for snmpEngineID discovery. */ + if(strlen(username) == 0) { + return ERR_OK; + } + + p = get_user(username); + + if (!p) { + return ERR_VAL; + } + + if (auth_algo != NULL) { + *auth_algo = p->auth_algo; + } + if(auth_key != NULL) { + MEMCPY(auth_key, p->auth_key, sizeof(p->auth_key)); + } + if (priv_algo != NULL) { + *priv_algo = p->priv_algo; + } + if(priv_key != NULL) { + MEMCPY(priv_key, p->priv_key, sizeof(p->priv_key)); + } + return ERR_OK; +} + +/** + * Get engine ID from persistence + */ +void +snmpv3_get_engine_id(const char **id, u8_t *len) +{ + *id = snmpv3_engineid; + *len = snmpv3_engineid_len; +} + +/** + * Store engine ID in persistence + */ +err_t +snmpv3_set_engine_id(const char *id, u8_t len) +{ + MEMCPY(snmpv3_engineid, id, len); + snmpv3_engineid_len = len; + return ERR_OK; +} + +/** + * Get engine boots from persistence. Must be increased on each boot. + */ +u32_t +snmpv3_get_engine_boots(void) +{ + return engineboots; +} + +/** + * Store engine boots in persistence + */ +void +snmpv3_set_engine_boots(u32_t boots) +{ + engineboots = boots; +} + +/** + * RFC3414 2.2.2. + * Once the timer reaches 2147483647 it gets reset to zero and the + * engine boot ups get incremented. + */ +u32_t +snmpv3_get_engine_time(void) +{ + return enginetime; +} + +/** + * Reset current engine time to 0 + */ +void +snmpv3_reset_engine_time(void) +{ + enginetime = 0; +} + +/** + * Initialize dummy SNMPv3 implementation + */ +void +snmpv3_dummy_init(void) +{ + snmpv3_set_engine_id("FOO", 3); + + snmpv3_set_user_auth_algo("lwip", SNMP_V3_AUTH_ALGO_SHA); + snmpv3_set_user_auth_key("lwip", "maplesyrup"); + + snmpv3_set_user_priv_algo("lwip", SNMP_V3_PRIV_ALGO_DES); + snmpv3_set_user_priv_key("lwip", "maplesyrup"); + + /* Start the engine time timer */ + snmpv3_enginetime_timer(NULL); +} + +#endif /* LWIP_SNMP && LWIP_SNMP_V3 */ diff --git a/contrib/examples/snmp/snmp_v3/snmpv3_dummy.h b/contrib/examples/snmp/snmp_v3/snmpv3_dummy.h new file mode 100644 index 00000000..ba25b6d7 --- /dev/null +++ b/contrib/examples/snmp/snmp_v3/snmpv3_dummy.h @@ -0,0 +1,53 @@ +/** + * @file + * Dummy SNMPv3 functions. + */ + +/* + * Copyright (c) 2017 Dirk Ziegelmeier. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * Author: Dirk Ziegelmeier + */ + +#ifndef LWIP_HDR_APPS_SNMP_V3_DUMMY_H +#define LWIP_HDR_APPS_SNMP_V3_DUMMY_H + +#include "lwip/apps/snmp_opts.h" +#include "lwip/err.h" +#include "lwip/apps/snmpv3.h" + +#if LWIP_SNMP && LWIP_SNMP_V3 + +err_t snmpv3_set_user_auth_algo(const char *username, snmpv3_auth_algo_t algo); +err_t snmpv3_set_user_priv_algo(const char *username, snmpv3_priv_algo_t algo); +err_t snmpv3_set_user_auth_key(const char *username, const char *password); +err_t snmpv3_set_user_priv_key(const char *username, const char *password); + +void snmpv3_dummy_init(void); + +#endif /* LWIP_SNMP && LWIP_SNMP_V3 */ + +#endif /* LWIP_HDR_APPS_SNMP_V3_DUMMY_H */ diff --git a/contrib/examples/sntp/sntp_example.c b/contrib/examples/sntp/sntp_example.c new file mode 100644 index 00000000..f68e1660 --- /dev/null +++ b/contrib/examples/sntp/sntp_example.c @@ -0,0 +1,66 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#include + +#include "lwip/opt.h" +#include "lwip/apps/sntp.h" +#include "sntp_example.h" +#include "lwip/netif.h" + +void +sntp_set_system_time(u32_t sec) +{ + char buf[32]; + struct tm current_time_val; + time_t current_time = (time_t)sec; + +#ifdef _MSC_VER + localtime_s(¤t_time_val, ¤t_time); +#else + localtime_r(¤t_time, ¤t_time_val); +#endif + + strftime(buf, sizeof(buf), "%d.%m.%Y %H:%M:%S", ¤t_time_val); + printf("SNTP time: %s\n", buf); +} + +void +sntp_example_init(void) +{ + sntp_setoperatingmode(SNTP_OPMODE_POLL); +#if LWIP_DHCP + sntp_servermode_dhcp(1); /* get SNTP server via DHCP */ +#else /* LWIP_DHCP */ +#if LWIP_IPV4 + sntp_setserver(0, netif_ip_gw4(netif_default)); +#endif /* LWIP_IPV4 */ +#endif /* LWIP_DHCP */ + sntp_init(); +} diff --git a/contrib/examples/sntp/sntp_example.h b/contrib/examples/sntp/sntp_example.h new file mode 100644 index 00000000..94fc10db --- /dev/null +++ b/contrib/examples/sntp/sntp_example.h @@ -0,0 +1,45 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#ifndef SNTP_EXAMPLE_H +#define SNTP_EXAMPLE_H + +#ifdef __cplusplus +extern "C" { +#endif + +void sntp_example_init(void); + +void sntp_set_system_time(u32_t sec); + +#ifdef __cplusplus +} +#endif + +#endif /* SNTP_EXAMPLE_H */ diff --git a/contrib/examples/tftp/tftp_example.c b/contrib/examples/tftp/tftp_example.c new file mode 100644 index 00000000..60a9c2f7 --- /dev/null +++ b/contrib/examples/tftp/tftp_example.c @@ -0,0 +1,91 @@ +/* + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Dirk Ziegelmeier + * + */ + +#include + +#include "lwip/apps/tftp_server.h" +#include "tftp_example.h" + +#if LWIP_UDP + +static void* +tftp_open(const char* fname, const char* mode, u8_t is_write) +{ + LWIP_UNUSED_ARG(mode); + + if (is_write) { + return (void*)fopen(fname, "wb"); + } else { + return (void*)fopen(fname, "rb"); + } +} + +static void +tftp_close(void* handle) +{ + fclose((FILE*)handle); +} + +static int +tftp_read(void* handle, void* buf, int bytes) +{ + int ret = fread(buf, 1, bytes, (FILE*)handle); + if (ret <= 0) { + return -1; + } + return ret; +} + +static int +tftp_write(void* handle, struct pbuf* p) +{ + while (p != NULL) { + if (fwrite(p->payload, 1, p->len, (FILE*)handle) != (size_t)p->len) { + return -1; + } + p = p->next; + } + + return 0; +} + +static const struct tftp_context tftp = { + tftp_open, + tftp_close, + tftp_read, + tftp_write +}; + +void +tftp_example_init(void) +{ + tftp_init(&tftp); +} + +#endif /* LWIP_UDP */ diff --git a/contrib/examples/tftp/tftp_example.h b/contrib/examples/tftp/tftp_example.h new file mode 100644 index 00000000..12b13d13 --- /dev/null +++ b/contrib/examples/tftp/tftp_example.h @@ -0,0 +1,28 @@ +/* + * To change this license header, choose License Headers in Project Properties. + * To change this template file, choose Tools | Templates + * and open the template in the editor. + */ + +/* + * File: tftp_example.h + * Author: dziegel + * + * Created on February 17, 2018, 3:43 PM + */ + +#ifndef TFTP_EXAMPLE_H +#define TFTP_EXAMPLE_H + +#ifdef __cplusplus +extern "C" { +#endif + +void tftp_example_init(void); + +#ifdef __cplusplus +} +#endif + +#endif /* TFTP_EXAMPLE_H */ + diff --git a/contrib/ports/CMakeCommon.cmake b/contrib/ports/CMakeCommon.cmake new file mode 100644 index 00000000..36950509 --- /dev/null +++ b/contrib/ports/CMakeCommon.cmake @@ -0,0 +1,105 @@ +# ARM mbedtls support https://tls.mbed.org/ +set(MBEDTLSDIR ${LWIP_CONTRIB_DIR}/../mbedtls) +if(EXISTS ${MBEDTLSDIR}/CMakeLists.txt) + set(LWIP_HAVE_MBEDTLS ON BOOL) + + # Prevent building MBEDTLS programs and tests + set(ENABLE_PROGRAMS OFF CACHE BOOL "") + set(ENABLE_TESTING OFF CACHE BOOL "") + + # mbedtls uses cmake. Sweet! + add_subdirectory(${MBEDTLSDIR} mbedtls) + + set (LWIP_MBEDTLS_DEFINITIONS + -DLWIP_HAVE_MBEDTLS=1 + ) + set (LWIP_MBEDTLS_INCLUDE_DIRS + ${MBEDTLSDIR}/include + ) + set (LWIP_MBEDTLS_LINK_LIBRARIES + mbedtls + mbedcrypto + mbedx509 + ) +endif() + +set(LWIP_COMPILER_FLAGS_GNU_CLANG + -g + -Wall + -pedantic + -Werror + -Wparentheses + -Wsequence-point + -Wswitch-default + -Wextra -Wundef + -Wshadow + -Wpointer-arith + -Wcast-qual + -Wc++-compat + -Wwrite-strings + -Wold-style-definition + -Wcast-align + -Wmissing-prototypes + -Wnested-externs + -Wunreachable-code + -Wuninitialized + -Wmissing-prototypes + -Waggregate-return + -Wlogical-not-parentheses +) + +if (NOT LWIP_HAVE_MBEDTLS) + list(APPEND LWIP_COMPILER_FLAGS_GNU_CLANG + -Wredundant-decls + ) +endif() + +if(CMAKE_C_COMPILER_ID STREQUAL GNU) + list(APPEND LWIP_COMPILER_FLAGS_GNU_CLANG + -Wlogical-op + -Wtrampolines + ) + + if (NOT LWIP_HAVE_MBEDTLS) + list(APPEND LWIP_COMPILER_FLAGS_GNU_CLANG + -Wc90-c99-compat + ) + endif() + + if(NOT CMAKE_C_COMPILER_VERSION VERSION_LESS 4.9) + if(LWIP_USE_SANITIZERS) + list(APPEND LWIP_COMPILER_FLAGS_GNU_CLANG + -fsanitize=address + -fsanitize=undefined + -fno-sanitize=alignment + -fstack-protector + -fstack-check + ) + set(LWIP_SANITIZER_LIBS asan ubsan) + endif() + endif() + + set(LWIP_COMPILER_FLAGS ${LWIP_COMPILER_FLAGS_GNU_CLANG}) +endif() + +if(CMAKE_C_COMPILER_ID STREQUAL Clang) + list(APPEND LWIP_COMPILER_FLAGS_GNU_CLANG + -Wdocumentation + -Wno-documentation-deprecated-sync + ) + + if(LWIP_USE_SANITIZERS) + list(APPEND LWIP_COMPILER_FLAGS_GNU_CLANG + -fsanitize=address + -fsanitize=undefined + -fno-sanitize=alignment + ) + set(LWIP_SANITIZER_LIBS asan ubsan) + endif() + + set(LWIP_COMPILER_FLAGS ${LWIP_COMPILER_FLAGS_GNU_CLANG}) +endif() + +if(CMAKE_C_COMPILER_ID STREQUAL MSVC) + # TODO +endif() diff --git a/contrib/ports/Common.allports.mk b/contrib/ports/Common.allports.mk new file mode 100644 index 00000000..7e9d2e47 --- /dev/null +++ b/contrib/ports/Common.allports.mk @@ -0,0 +1,91 @@ +# +# Copyright (c) 2001, 2002 Swedish Institute of Computer Science. +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without modification, +# are permitted provided that the following conditions are met: +# +# 1. Redistributions of source code must retain the above copyright notice, +# this list of conditions and the following disclaimer. +# 2. Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# 3. The name of the author may not be used to endorse or promote products +# derived from this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED +# WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +# MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT +# SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +# EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT +# OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING +# IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY +# OF SUCH DAMAGE. +# +# This file is part of the lwIP TCP/IP stack. +# +# Author: Adam Dunkels +# + +#CC=gcc +#CC=clang +CCDEP?=$(CC) + +CFLAGS+=-g -DLWIP_DEBUG -Wall -pedantic -Werror \ + -Wparentheses -Wsequence-point -Wswitch-default \ + -Wextra -Wundef -Wshadow -Wpointer-arith -Wcast-qual \ + -Wc++-compat -Wwrite-strings -Wold-style-definition -Wcast-align \ + -Wmissing-prototypes -Wredundant-decls -Wnested-externs \ + -Wunreachable-code -Wuninitialized -Wmissing-prototypes \ + -Wredundant-decls -Waggregate-return -Wlogical-not-parentheses +# -Wconversion -Wsign-compare -Wmissing-include-dirs + +ifeq (,$(findstring clang,$(CC))) +CFLAGS+= -Wlogical-op -Wc90-c99-compat -Wtrampolines +# if GCC is newer than 4.8/4.9 you may use: +#CFLAGS:=$(CFLAGS) -fsanitize=address -fstack-protector -fstack-check -fsanitize=undefined -fno-sanitize=alignment +else +# we cannot sanitize alignment on x86-64 targets because clang wants 64 bit alignment +CFLAGS+= -fsanitize=address -fsanitize=undefined -fno-sanitize=alignment -Wdocumentation -Wno-documentation-deprecated-sync +endif + +CONTRIBDIR?=../../.. +ARFLAGS?=rs + +#Set this to where you have the lwip core module checked out from git +#default assumes it's a dir named lwip at the same level as the contrib module +LWIPDIR?=$(CONTRIBDIR)/../lwip/src + +CFLAGS+=-I. \ + -I$(CONTRIBDIR) \ + -I$(LWIPDIR)/include \ + -I$(LWIPARCH)/include + +# Add include path and link to mbedTLS lib if available +MBEDTLSDIR?=$(CONTRIBDIR)/../mbedtls +ifneq (,$(wildcard $(MBEDTLSDIR)/include/mbedtls/*.h)) +LDFLAGS+=-L$(MBEDTLSDIR)/library -lmbedtls -lmbedcrypto -lmbedx509 +CFLAGS+=-I$(MBEDTLSDIR)/include -Wno-redundant-decls -DLWIP_HAVE_MBEDTLS=1 -Wno-c90-c99-compat +endif + +include $(CONTRIBDIR)/Filelists.mk +include $(LWIPDIR)/Filelists.mk + +# LWIPFILES: All the above. +LWIPFILES=$(LWIPNOAPPSFILES) $(ARCHFILES) +LWIPOBJS=$(notdir $(LWIPFILES:.c=.o)) + +LWIPLIBCOMMON=liblwipcommon.a +$(LWIPLIBCOMMON): $(LWIPOBJS) + $(AR) $(ARFLAGS) $(LWIPLIBCOMMON) $? + +APPFILES=$(CONTRIBAPPFILES) $(LWIPAPPFILES) +APPLIB=liblwipapps.a +APPOBJS=$(notdir $(APPFILES:.c=.o)) +$(APPLIB): $(APPOBJS) + $(AR) $(ARFLAGS) $(APPLIB) $? + +%.o: + $(CC) $(CFLAGS) -c $< diff --git a/contrib/ports/FILES b/contrib/ports/FILES new file mode 100644 index 00000000..a8db240a --- /dev/null +++ b/contrib/ports/FILES @@ -0,0 +1,8 @@ +unix/ - Architectural files for testing on unix-like systems + (assuming gcc and pthreads). + - Maintained by Kieran Mansley + +msvc6/ - Architectural files for Microsoft Visual C++ 6.0. + - Maintained by Simon Goldschmidt + +old/ - Ports that are no longer actively maintained diff --git a/contrib/ports/freertos/include/arch/sys_arch.h b/contrib/ports/freertos/include/arch/sys_arch.h new file mode 100644 index 00000000..0cfc889d --- /dev/null +++ b/contrib/ports/freertos/include/arch/sys_arch.h @@ -0,0 +1,95 @@ +/* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmdit + * + */ +#ifndef LWIP_ARCH_SYS_ARCH_H +#define LWIP_ARCH_SYS_ARCH_H + +#include "lwip/opt.h" +#include "lwip/arch.h" + +/** This is returned by _fromisr() sys functions to tell the outermost function + * that a higher priority task was woken and the scheduler needs to be invoked. + */ +#define ERR_NEED_SCHED 123 + +/* This port includes FreeRTOS headers in sys_arch.c only. + * FreeRTOS uses pointers as object types. We use wrapper structs instead of + * void pointers directly to get a tiny bit of type safety. + */ + +void sys_arch_msleep(u32_t delay_ms); +#define sys_msleep(ms) sys_arch_msleep(ms) + +#if SYS_LIGHTWEIGHT_PROT +typedef u32_t sys_prot_t; +#endif /* SYS_LIGHTWEIGHT_PROT */ + +#if !LWIP_COMPAT_MUTEX +struct _sys_mut { + void *mut; +}; +typedef struct _sys_mut sys_mutex_t; +#define sys_mutex_valid_val(mutex) ((mutex).mut != NULL) +#define sys_mutex_valid(mutex) (((mutex) != NULL) && sys_mutex_valid_val(*(mutex))) +#define sys_mutex_set_invalid(mutex) ((mutex)->mut = NULL) +#endif /* !LWIP_COMPAT_MUTEX */ + +struct _sys_sem { + void *sem; +}; +typedef struct _sys_sem sys_sem_t; +#define sys_sem_valid_val(sema) ((sema).sem != NULL) +#define sys_sem_valid(sema) (((sema) != NULL) && sys_sem_valid_val(*(sema))) +#define sys_sem_set_invalid(sema) ((sema)->sem = NULL) + +struct _sys_mbox { + void *mbx; +}; +typedef struct _sys_mbox sys_mbox_t; +#define sys_mbox_valid_val(mbox) ((mbox).mbx != NULL) +#define sys_mbox_valid(mbox) (((mbox) != NULL) && sys_mbox_valid_val(*(mbox))) +#define sys_mbox_set_invalid(mbox) ((mbox)->mbx = NULL) + +struct _sys_thread { + void *thread_handle; +}; +typedef struct _sys_thread sys_thread_t; + +#if LWIP_NETCONN_SEM_PER_THREAD +sys_sem_t* sys_arch_netconn_sem_get(void); +void sys_arch_netconn_sem_alloc(void); +void sys_arch_netconn_sem_free(void); +#define LWIP_NETCONN_THREAD_SEM_GET() sys_arch_netconn_sem_get() +#define LWIP_NETCONN_THREAD_SEM_ALLOC() sys_arch_netconn_sem_alloc() +#define LWIP_NETCONN_THREAD_SEM_FREE() sys_arch_netconn_sem_free() +#endif /* LWIP_NETCONN_SEM_PER_THREAD */ + +#endif /* LWIP_ARCH_SYS_ARCH_H */ diff --git a/contrib/ports/freertos/sys_arch.c b/contrib/ports/freertos/sys_arch.c new file mode 100644 index 00000000..84bd4637 --- /dev/null +++ b/contrib/ports/freertos/sys_arch.c @@ -0,0 +1,609 @@ +/* + * Copyright (c) 2017 Simon Goldschmidt + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Simon Goldschmidt + * + */ + +/* lwIP includes. */ +#include "lwip/debug.h" +#include "lwip/def.h" +#include "lwip/sys.h" +#include "lwip/mem.h" +#include "lwip/stats.h" +#include "FreeRTOS.h" +#include "semphr.h" +#include "task.h" + +/** Set this to 1 if you want the stack size passed to sys_thread_new() to be + * interpreted as number of stack words (FreeRTOS-like). + * Default is that they are interpreted as byte count (lwIP-like). + */ +#ifndef LWIP_FREERTOS_THREAD_STACKSIZE_IS_STACKWORDS +#define LWIP_FREERTOS_THREAD_STACKSIZE_IS_STACKWORDS 0 +#endif + +/** Set this to 1 to use a mutex for SYS_ARCH_PROTECT() critical regions. + * Default is 0 and locks interrupts/scheduler for SYS_ARCH_PROTECT(). + */ +#ifndef LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX +#define LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX 0 +#endif + +/** Set this to 1 to include a sanity check that SYS_ARCH_PROTECT() and + * SYS_ARCH_UNPROTECT() are called matching. + */ +#ifndef LWIP_FREERTOS_SYS_ARCH_PROTECT_SANITY_CHECK +#define LWIP_FREERTOS_SYS_ARCH_PROTECT_SANITY_CHECK 0 +#endif + +/** Set this to 1 to let sys_mbox_free check that queues are empty when freed */ +#ifndef LWIP_FREERTOS_CHECK_QUEUE_EMPTY_ON_FREE +#define LWIP_FREERTOS_CHECK_QUEUE_EMPTY_ON_FREE 0 +#endif + +/** Set this to 1 to enable core locking check functions in this port. + * For this to work, you'll have to define LWIP_ASSERT_CORE_LOCKED() + * and LWIP_MARK_TCPIP_THREAD() correctly in your lwipopts.h! */ +#ifndef LWIP_FREERTOS_CHECK_CORE_LOCKING +#define LWIP_FREERTOS_CHECK_CORE_LOCKING 0 +#endif + +/** Set this to 0 to implement sys_now() yourself, e.g. using a hw timer. + * Default is 1, where FreeRTOS ticks are used to calculate back to ms. + */ +#ifndef LWIP_FREERTOS_SYS_NOW_FROM_FREERTOS +#define LWIP_FREERTOS_SYS_NOW_FROM_FREERTOS 1 +#endif + +#if !configSUPPORT_DYNAMIC_ALLOCATION +# error "lwIP FreeRTOS port requires configSUPPORT_DYNAMIC_ALLOCATION" +#endif +#if !INCLUDE_vTaskDelay +# error "lwIP FreeRTOS port requires INCLUDE_vTaskDelay" +#endif +#if !INCLUDE_vTaskSuspend +# error "lwIP FreeRTOS port requires INCLUDE_vTaskSuspend" +#endif +#if LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX || !LWIP_COMPAT_MUTEX +#if !configUSE_MUTEXES +# error "lwIP FreeRTOS port requires configUSE_MUTEXES" +#endif +#endif + +#if SYS_LIGHTWEIGHT_PROT && LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX +static SemaphoreHandle_t sys_arch_protect_mutex; +#endif +#if SYS_LIGHTWEIGHT_PROT && LWIP_FREERTOS_SYS_ARCH_PROTECT_SANITY_CHECK +static sys_prot_t sys_arch_protect_nesting; +#endif + +/* Initialize this module (see description in sys.h) */ +void +sys_init(void) +{ +#if SYS_LIGHTWEIGHT_PROT && LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX + /* initialize sys_arch_protect global mutex */ + sys_arch_protect_mutex = xSemaphoreCreateRecursiveMutex(); + LWIP_ASSERT("failed to create sys_arch_protect mutex", + sys_arch_protect_mutex != NULL); +#endif /* SYS_LIGHTWEIGHT_PROT && LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX */ +} + +#if configUSE_16_BIT_TICKS == 1 +#error This port requires 32 bit ticks or timer overflow will fail +#endif + +#if LWIP_FREERTOS_SYS_NOW_FROM_FREERTOS +u32_t +sys_now(void) +{ + return xTaskGetTickCount() * portTICK_PERIOD_MS; +} +#endif + +u32_t +sys_jiffies(void) +{ + return xTaskGetTickCount(); +} + +#if SYS_LIGHTWEIGHT_PROT + +sys_prot_t +sys_arch_protect(void) +{ +#if LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX + BaseType_t ret; + LWIP_ASSERT("sys_arch_protect_mutex != NULL", sys_arch_protect_mutex != NULL); + + ret = xSemaphoreTakeRecursive(sys_arch_protect_mutex, portMAX_DELAY); + LWIP_ASSERT("sys_arch_protect failed to take the mutex", ret == pdTRUE); +#else /* LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX */ + taskENTER_CRITICAL(); +#endif /* LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX */ +#if LWIP_FREERTOS_SYS_ARCH_PROTECT_SANITY_CHECK + { + /* every nested call to sys_arch_protect() returns an increased number */ + sys_prot_t ret = sys_arch_protect_nesting; + sys_arch_protect_nesting++; + LWIP_ASSERT("sys_arch_protect overflow", sys_arch_protect_nesting > ret); + return ret; + } +#else + return 1; +#endif +} + +void +sys_arch_unprotect(sys_prot_t pval) +{ +#if LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX + BaseType_t ret; +#endif +#if LWIP_FREERTOS_SYS_ARCH_PROTECT_SANITY_CHECK + LWIP_ASSERT("unexpected sys_arch_protect_nesting", sys_arch_protect_nesting > 0); + sys_arch_protect_nesting--; + LWIP_ASSERT("unexpected sys_arch_protect_nesting", sys_arch_protect_nesting == pval); +#endif + +#if LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX + LWIP_ASSERT("sys_arch_protect_mutex != NULL", sys_arch_protect_mutex != NULL); + + ret = xSemaphoreGiveRecursive(sys_arch_protect_mutex); + LWIP_ASSERT("sys_arch_unprotect failed to give the mutex", ret == pdTRUE); +#else /* LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX */ + taskEXIT_CRITICAL(); +#endif /* LWIP_FREERTOS_SYS_ARCH_PROTECT_USES_MUTEX */ + LWIP_UNUSED_ARG(pval); +} + +#endif /* SYS_LIGHTWEIGHT_PROT */ + +void +sys_arch_msleep(u32_t delay_ms) +{ + TickType_t delay_ticks = delay_ms / portTICK_RATE_MS; + vTaskDelay(delay_ticks); +} + +#if !LWIP_COMPAT_MUTEX + +/* Create a new mutex*/ +err_t +sys_mutex_new(sys_mutex_t *mutex) +{ + LWIP_ASSERT("mutex != NULL", mutex != NULL); + + mutex->mut = xSemaphoreCreateRecursiveMutex(); + if(mutex->mut == NULL) { + SYS_STATS_INC(mutex.err); + return ERR_MEM; + } + SYS_STATS_INC_USED(mutex); + return ERR_OK; +} + +void +sys_mutex_lock(sys_mutex_t *mutex) +{ + BaseType_t ret; + LWIP_ASSERT("mutex != NULL", mutex != NULL); + LWIP_ASSERT("mutex->mut != NULL", mutex->mut != NULL); + + ret = xSemaphoreTakeRecursive(mutex->mut, portMAX_DELAY); + LWIP_ASSERT("failed to take the mutex", ret == pdTRUE); +} + +void +sys_mutex_unlock(sys_mutex_t *mutex) +{ + BaseType_t ret; + LWIP_ASSERT("mutex != NULL", mutex != NULL); + LWIP_ASSERT("mutex->mut != NULL", mutex->mut != NULL); + + ret = xSemaphoreGiveRecursive(mutex->mut); + LWIP_ASSERT("failed to give the mutex", ret == pdTRUE); +} + +void +sys_mutex_free(sys_mutex_t *mutex) +{ + LWIP_ASSERT("mutex != NULL", mutex != NULL); + LWIP_ASSERT("mutex->mut != NULL", mutex->mut != NULL); + + SYS_STATS_DEC(mutex.used); + vSemaphoreDelete(mutex->mut); + mutex->mut = NULL; +} + +#endif /* !LWIP_COMPAT_MUTEX */ + +err_t +sys_sem_new(sys_sem_t *sem, u8_t initial_count) +{ + LWIP_ASSERT("sem != NULL", sem != NULL); + LWIP_ASSERT("initial_count invalid (not 0 or 1)", + (initial_count == 0) || (initial_count == 1)); + + sem->sem = xSemaphoreCreateBinary(); + if(sem->sem == NULL) { + SYS_STATS_INC(sem.err); + return ERR_MEM; + } + SYS_STATS_INC_USED(sem); + + if(initial_count == 1) { + BaseType_t ret = xSemaphoreGive(sem->sem); + LWIP_ASSERT("sys_sem_new: initial give failed", ret == pdTRUE); + } + return ERR_OK; +} + +void +sys_sem_signal(sys_sem_t *sem) +{ + BaseType_t ret; + LWIP_ASSERT("sem != NULL", sem != NULL); + LWIP_ASSERT("sem->sem != NULL", sem->sem != NULL); + + ret = xSemaphoreGive(sem->sem); + /* queue full is OK, this is a signal only... */ + LWIP_ASSERT("sys_sem_signal: sane return value", + (ret == pdTRUE) || (ret == errQUEUE_FULL)); +} + +u32_t +sys_arch_sem_wait(sys_sem_t *sem, u32_t timeout_ms) +{ + BaseType_t ret; + LWIP_ASSERT("sem != NULL", sem != NULL); + LWIP_ASSERT("sem->sem != NULL", sem->sem != NULL); + + if(!timeout_ms) { + /* wait infinite */ + ret = xSemaphoreTake(sem->sem, portMAX_DELAY); + LWIP_ASSERT("taking semaphore failed", ret == pdTRUE); + } else { + TickType_t timeout_ticks = timeout_ms / portTICK_RATE_MS; + ret = xSemaphoreTake(sem->sem, timeout_ticks); + if (ret == errQUEUE_EMPTY) { + /* timed out */ + return SYS_ARCH_TIMEOUT; + } + LWIP_ASSERT("taking semaphore failed", ret == pdTRUE); + } + + /* Old versions of lwIP required us to return the time waited. + This is not the case any more. Just returning != SYS_ARCH_TIMEOUT + here is enough. */ + return 1; +} + +void +sys_sem_free(sys_sem_t *sem) +{ + LWIP_ASSERT("sem != NULL", sem != NULL); + LWIP_ASSERT("sem->sem != NULL", sem->sem != NULL); + + SYS_STATS_DEC(sem.used); + vSemaphoreDelete(sem->sem); + sem->sem = NULL; +} + +err_t +sys_mbox_new(sys_mbox_t *mbox, int size) +{ + LWIP_ASSERT("mbox != NULL", mbox != NULL); + LWIP_ASSERT("size > 0", size > 0); + + mbox->mbx = xQueueCreate((UBaseType_t)size, sizeof(void *)); + if(mbox->mbx == NULL) { + SYS_STATS_INC(mbox.err); + return ERR_MEM; + } + SYS_STATS_INC_USED(mbox); + return ERR_OK; +} + +void +sys_mbox_post(sys_mbox_t *mbox, void *msg) +{ + BaseType_t ret; + LWIP_ASSERT("mbox != NULL", mbox != NULL); + LWIP_ASSERT("mbox->mbx != NULL", mbox->mbx != NULL); + + ret = xQueueSendToBack(mbox->mbx, &msg, portMAX_DELAY); + LWIP_ASSERT("mbox post failed", ret == pdTRUE); +} + +err_t +sys_mbox_trypost(sys_mbox_t *mbox, void *msg) +{ + BaseType_t ret; + LWIP_ASSERT("mbox != NULL", mbox != NULL); + LWIP_ASSERT("mbox->mbx != NULL", mbox->mbx != NULL); + + ret = xQueueSendToBack(mbox->mbx, &msg, 0); + if (ret == pdTRUE) { + return ERR_OK; + } else { + LWIP_ASSERT("mbox trypost failed", ret == errQUEUE_FULL); + SYS_STATS_INC(mbox.err); + return ERR_MEM; + } +} + +err_t +sys_mbox_trypost_fromisr(sys_mbox_t *mbox, void *msg) +{ + BaseType_t ret; + BaseType_t xHigherPriorityTaskWoken = pdFALSE; + LWIP_ASSERT("mbox != NULL", mbox != NULL); + LWIP_ASSERT("mbox->mbx != NULL", mbox->mbx != NULL); + + ret = xQueueSendToBackFromISR(mbox->mbx, &msg, &xHigherPriorityTaskWoken); + if (ret == pdTRUE) { + if (xHigherPriorityTaskWoken == pdTRUE) { + return ERR_NEED_SCHED; + } + return ERR_OK; + } else { + LWIP_ASSERT("mbox trypost failed", ret == errQUEUE_FULL); + SYS_STATS_INC(mbox.err); + return ERR_MEM; + } +} + +u32_t +sys_arch_mbox_fetch(sys_mbox_t *mbox, void **msg, u32_t timeout_ms) +{ + BaseType_t ret; + void *msg_dummy; + LWIP_ASSERT("mbox != NULL", mbox != NULL); + LWIP_ASSERT("mbox->mbx != NULL", mbox->mbx != NULL); + + if (!msg) { + msg = &msg_dummy; + } + + if (!timeout_ms) { + /* wait infinite */ + ret = xQueueReceive(mbox->mbx, &(*msg), portMAX_DELAY); + LWIP_ASSERT("mbox fetch failed", ret == pdTRUE); + } else { + TickType_t timeout_ticks = timeout_ms / portTICK_RATE_MS; + ret = xQueueReceive(mbox->mbx, &(*msg), timeout_ticks); + if (ret == errQUEUE_EMPTY) { + /* timed out */ + *msg = NULL; + return SYS_ARCH_TIMEOUT; + } + LWIP_ASSERT("mbox fetch failed", ret == pdTRUE); + } + + /* Old versions of lwIP required us to return the time waited. + This is not the case any more. Just returning != SYS_ARCH_TIMEOUT + here is enough. */ + return 1; +} + +u32_t +sys_arch_mbox_tryfetch(sys_mbox_t *mbox, void **msg) +{ + BaseType_t ret; + void *msg_dummy; + LWIP_ASSERT("mbox != NULL", mbox != NULL); + LWIP_ASSERT("mbox->mbx != NULL", mbox->mbx != NULL); + + if (!msg) { + msg = &msg_dummy; + } + + ret = xQueueReceive(mbox->mbx, &(*msg), 0); + if (ret == errQUEUE_EMPTY) { + *msg = NULL; + return SYS_MBOX_EMPTY; + } + LWIP_ASSERT("mbox fetch failed", ret == pdTRUE); + + /* Old versions of lwIP required us to return the time waited. + This is not the case any more. Just returning != SYS_ARCH_TIMEOUT + here is enough. */ + return 1; +} + +void +sys_mbox_free(sys_mbox_t *mbox) +{ + LWIP_ASSERT("mbox != NULL", mbox != NULL); + LWIP_ASSERT("mbox->mbx != NULL", mbox->mbx != NULL); + +#if LWIP_FREERTOS_CHECK_QUEUE_EMPTY_ON_FREE + { + UBaseType_t msgs_waiting = uxQueueMessagesWaiting(mbox->mbx); + LWIP_ASSERT("mbox quence not empty", msgs_waiting == 0); + + if (msgs_waiting != 0) { + SYS_STATS_INC(mbox.err); + } + } +#endif + + vQueueDelete(mbox->mbx); + + SYS_STATS_DEC(mbox.used); +} + +sys_thread_t +sys_thread_new(const char *name, lwip_thread_fn thread, void *arg, int stacksize, int prio) +{ + TaskHandle_t rtos_task; + BaseType_t ret; + sys_thread_t lwip_thread; + size_t rtos_stacksize; + + LWIP_ASSERT("invalid stacksize", stacksize > 0); +#if LWIP_FREERTOS_THREAD_STACKSIZE_IS_STACKWORDS + rtos_stacksize = (size_t)stacksize; +#else + rtos_stacksize = (size_t)stacksize / sizeof(StackType_t); +#endif + + /* lwIP's lwip_thread_fn matches FreeRTOS' TaskFunction_t, so we can pass the + thread function without adaption here. */ + ret = xTaskCreate(thread, name, (configSTACK_DEPTH_TYPE)rtos_stacksize, arg, prio, &rtos_task); + LWIP_ASSERT("task creation failed", ret == pdTRUE); + + lwip_thread.thread_handle = rtos_task; + return lwip_thread; +} + +#if LWIP_NETCONN_SEM_PER_THREAD +#if configNUM_THREAD_LOCAL_STORAGE_POINTERS > 0 + +sys_sem_t * +sys_arch_netconn_sem_get(void) +{ + void* ret; + TaskHandle_t task = xTaskGetCurrentTaskHandle(); + LWIP_ASSERT("task != NULL", task != NULL); + + ret = pvTaskGetThreadLocalStoragePointer(task, 0); + return ret; +} + +void +sys_arch_netconn_sem_alloc(void) +{ + void *ret; + TaskHandle_t task = xTaskGetCurrentTaskHandle(); + LWIP_ASSERT("task != NULL", task != NULL); + + ret = pvTaskGetThreadLocalStoragePointer(task, 0); + if(ret == NULL) { + sys_sem_t *sem; + err_t err; + /* need to allocate the memory for this semaphore */ + sem = mem_malloc(sizeof(sys_sem_t)); + LWIP_ASSERT("sem != NULL", sem != NULL); + err = sys_sem_new(sem, 0); + LWIP_ASSERT("err == ERR_OK", err == ERR_OK); + LWIP_ASSERT("sem invalid", sys_sem_valid(sem)); + vTaskSetThreadLocalStoragePointer(task, 0, sem); + } +} + +void sys_arch_netconn_sem_free(void) +{ + void* ret; + TaskHandle_t task = xTaskGetCurrentTaskHandle(); + LWIP_ASSERT("task != NULL", task != NULL); + + ret = pvTaskGetThreadLocalStoragePointer(task, 0); + if(ret != NULL) { + sys_sem_t *sem = ret; + sys_sem_free(sem); + mem_free(sem); + vTaskSetThreadLocalStoragePointer(task, 0, NULL); + } +} + +#else /* configNUM_THREAD_LOCAL_STORAGE_POINTERS > 0 */ +#error LWIP_NETCONN_SEM_PER_THREAD needs configNUM_THREAD_LOCAL_STORAGE_POINTERS +#endif /* configNUM_THREAD_LOCAL_STORAGE_POINTERS > 0 */ + +#endif /* LWIP_NETCONN_SEM_PER_THREAD */ + +#if LWIP_FREERTOS_CHECK_CORE_LOCKING +#if LWIP_TCPIP_CORE_LOCKING + +/** Flag the core lock held. A counter for recursive locks. */ +static u8_t lwip_core_lock_count; +static TaskHandle_t lwip_core_lock_holder_thread; + +void +sys_lock_tcpip_core(void) +{ + sys_mutex_lock(&lock_tcpip_core); + if (lwip_core_lock_count == 0) { + lwip_core_lock_holder_thread = xTaskGetCurrentTaskHandle(); + } + lwip_core_lock_count++; +} + +void +sys_unlock_tcpip_core(void) +{ + lwip_core_lock_count--; + if (lwip_core_lock_count == 0) { + lwip_core_lock_holder_thread = 0; + } + sys_mutex_unlock(&lock_tcpip_core); +} + +#endif /* LWIP_TCPIP_CORE_LOCKING */ + +#if !NO_SYS +static TaskHandle_t lwip_tcpip_thread; +#endif + +void +sys_mark_tcpip_thread(void) +{ +#if !NO_SYS + lwip_tcpip_thread = xTaskGetCurrentTaskHandle(); +#endif +} + +void +sys_check_core_locking(void) +{ + /* Embedded systems should check we are NOT in an interrupt context here */ + /* E.g. core Cortex-M3/M4 ports: + configASSERT( ( portNVIC_INT_CTRL_REG & portVECTACTIVE_MASK ) == 0 ); + + Instead, we use more generic FreeRTOS functions here, which should fail from ISR: */ + taskENTER_CRITICAL(); + taskEXIT_CRITICAL(); + +#if !NO_SYS + if (lwip_tcpip_thread != 0) { + TaskHandle_t current_thread = xTaskGetCurrentTaskHandle(); + +#if LWIP_TCPIP_CORE_LOCKING + LWIP_ASSERT("Function called without core lock", + current_thread == lwip_core_lock_holder_thread && lwip_core_lock_count > 0); +#else /* LWIP_TCPIP_CORE_LOCKING */ + LWIP_ASSERT("Function called from wrong thread", current_thread == lwip_tcpip_thread); +#endif /* LWIP_TCPIP_CORE_LOCKING */ + } +#endif /* !NO_SYS */ +} + +#endif /* LWIP_FREERTOS_CHECK_CORE_LOCKING*/ diff --git a/contrib/ports/unix/Common.mk b/contrib/ports/unix/Common.mk new file mode 100644 index 00000000..f80a9807 --- /dev/null +++ b/contrib/ports/unix/Common.mk @@ -0,0 +1,51 @@ +# +# Copyright (c) 2001, 2002 Swedish Institute of Computer Science. +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without modification, +# are permitted provided that the following conditions are met: +# +# 1. Redistributions of source code must retain the above copyright notice, +# this list of conditions and the following disclaimer. +# 2. Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# 3. The name of the author may not be used to endorse or promote products +# derived from this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED +# WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +# MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT +# SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +# EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT +# OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING +# IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY +# OF SUCH DAMAGE. +# +# This file is part of the lwIP TCP/IP stack. +# +# Author: Adam Dunkels +# + +# Architecture specific files. +LWIPARCH?=$(CONTRIBDIR)/ports/unix/port +SYSARCH?=$(LWIPARCH)/sys_arch.c +ARCHFILES=$(LWIPARCH)/perf.c \ + $(SYSARCH) \ + $(LWIPARCH)/netif/tapif.c \ + $(LWIPARCH)/netif/list.c \ + $(LWIPARCH)/netif/sio.c \ + $(LWIPARCH)/netif/fifo.c + +UNIX_COMMON_MK_DIR := $(dir $(abspath $(lastword $(MAKEFILE_LIST)))) +include $(UNIX_COMMON_MK_DIR)../Common.allports.mk + +LDFLAGS+=-lutil + +UNAME_S:= $(shell uname -s) +ifneq ($(UNAME_S),Darwin) +# Darwin doesn't have pthreads or POSIX real-time extensions libs +LDFLAGS+=-pthread -lrt +endif diff --git a/contrib/ports/unix/Filelists.cmake b/contrib/ports/unix/Filelists.cmake new file mode 100644 index 00000000..f0542fb1 --- /dev/null +++ b/contrib/ports/unix/Filelists.cmake @@ -0,0 +1,40 @@ +# This file is indended to be included in end-user CMakeLists.txt +# include(/path/to/Filelists.cmake) +# It assumes the variable LWIP_CONTRIB_DIR is defined pointing to the +# root path of lwIP contrib sources. +# +# This file is NOT designed (on purpose) to be used as cmake +# subdir via add_subdirectory() +# The intention is to provide greater flexibility to users to +# create their own targets using the *_SRCS variables. + +set(lwipcontribportunix_SRCS + ${LWIP_CONTRIB_DIR}/ports/unix/port/sys_arch.c + ${LWIP_CONTRIB_DIR}/ports/unix/port/perf.c +) + +set(lwipcontribportunixnetifs_SRCS + ${LWIP_CONTRIB_DIR}/ports/unix/port/netif/tapif.c + ${LWIP_CONTRIB_DIR}/ports/unix/port/netif/list.c + ${LWIP_CONTRIB_DIR}/ports/unix/port/netif/sio.c + ${LWIP_CONTRIB_DIR}/ports/unix/port/netif/fifo.c +) + +add_library(lwipcontribportunix EXCLUDE_FROM_ALL ${lwipcontribportunix_SRCS} ${lwipcontribportunixnetifs_SRCS}) +target_include_directories(lwipcontribportunix PRIVATE ${LWIP_INCLUDE_DIRS} ${LWIP_MBEDTLS_INCLUDE_DIRS}) +target_compile_options(lwipcontribportunix PRIVATE ${LWIP_COMPILER_FLAGS}) +target_compile_definitions(lwipcontribportunix PRIVATE ${LWIP_DEFINITIONS} ${LWIP_MBEDTLS_DEFINITIONS}) +target_link_libraries(lwipcontribportunix PUBLIC ${LWIP_MBEDTLS_LINK_LIBRARIES}) + +if (CMAKE_SYSTEM_NAME STREQUAL Linux) + find_library(LIBUTIL util) + find_library(LIBPTHREAD pthread) + find_library(LIBRT rt) + target_link_libraries(lwipcontribportunix PUBLIC ${LIBUTIL} ${LIBPTHREAD} ${LIBRT}) +endif() + +if (CMAKE_SYSTEM_NAME STREQUAL Darwin) + # Darwin doesn't have pthreads or POSIX real-time extensions libs + find_library(LIBUTIL util) + target_link_libraries(lwipcontribportunix PUBLIC ${LIBUTIL}) +endif() diff --git a/contrib/ports/unix/README b/contrib/ports/unix/README new file mode 100644 index 00000000..45d256dc --- /dev/null +++ b/contrib/ports/unix/README @@ -0,0 +1,25 @@ +This port contains infrastructure and examples for running lwIP on Unix-like +operating systems (Linux, OpenBSD, cygwin). Much of this is targetted towards +testing lwIP applications. + +* port/sys_arch.c, port/perf.c, port/include/arch/: Generic platform porting, + for both states of NO_SYS. (Mapping debugging to printf, providing + sys_now & co from the system time etc.) + +* check: Runs the unit tests shipped with main lwIP on the Unix port. + +* port/netif, port/include/netif: Various network interface implementations and + their helpers, some explicitly for Unix infrastructure, some generic (but most + useful on an easy to debug system): + + * fifo: Helper for sio + + * list: Helper for unixif + + * pcapif: Network interface that replays packages from a PCAP dump file, and + discards packages sent out from it + + * sio: Mapping Unix character devices to lwIP's sio mechanisms + + * tapif: Network interface that is mapped to a tap interface (Unix user + space layer 2 network device). Uses lwIP threads. diff --git a/contrib/ports/unix/check/CMakeLists.txt b/contrib/ports/unix/check/CMakeLists.txt new file mode 100644 index 00000000..a5063ea9 --- /dev/null +++ b/contrib/ports/unix/check/CMakeLists.txt @@ -0,0 +1,59 @@ +cmake_minimum_required(VERSION 3.8) + +project(lwipunittests C) + +if (NOT CMAKE_SYSTEM_NAME STREQUAL Linux AND NOT CMAKE_SYSTEM_NAME STREQUAL Darwin) + message(FATAL_ERROR "Unit test are currently only working on Linux or Darwin") +endif() + +set(LWIP_CONTRIB_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../../..) +set(LWIP_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../../../../lwip) + +set(LWIP_USE_SANITIZERS true) +include(${LWIP_CONTRIB_DIR}/ports/CMakeCommon.cmake) + +if(CMAKE_C_COMPILER_ID STREQUAL Clang) + # check.h causes 'error: token pasting of ',' and __VA_ARGS__ is a GNU extension' with clang 9.0.0 + list(LWIP_COMPILER_FLAGS APPEND -Wno-gnu-zero-variadic-macro-arguments) +endif() + +set (LWIP_DEFINITIONS -DLWIP_DEBUG -DLWIP_NOASSERT_ON_ERROR) +set (LWIP_INCLUDE_DIRS + "${LWIP_DIR}/test/unit" + "${LWIP_DIR}/src/include" + "${LWIP_CONTRIB_DIR}/" + "${LWIP_CONTRIB_DIR}/ports/unix/port/include" + "${CMAKE_CURRENT_SOURCE_DIR}/" +) + +include(${LWIP_CONTRIB_DIR}/ports/unix/Filelists.cmake) +include(${LWIP_DIR}/src/Filelists.cmake) +include(${LWIP_DIR}/test/unit/Filelists.cmake) + +add_executable(lwip_unittests ${LWIP_TESTFILES}) +target_include_directories(lwip_unittests PRIVATE ${LWIP_INCLUDE_DIRS}) +target_compile_options(lwip_unittests PRIVATE ${LWIP_COMPILER_FLAGS}) +target_compile_definitions(lwip_unittests PRIVATE ${LWIP_DEFINITIONS} ${LWIP_MBEDTLS_DEFINITIONS}) + +find_library(LIBCHECK check) +find_library(LIBM m) +target_link_libraries(lwip_unittests ${LWIP_SANITIZER_LIBS} lwipallapps lwipcore ${LIBCHECK} ${LIBM}) + +if (NOT CMAKE_SYSTEM_NAME STREQUAL Darwin) + # check installed via brew on Darwin doesn't have a separate subunit library (must be statically linked) + find_library(LIBSUBUNIT subunit) + target_link_libraries(lwip_unittests ${LIBSUBUNIT}) +endif() + +if (CMAKE_SYSTEM_NAME STREQUAL Linux) + find_library(LIBUTIL util) + find_library(LIBPTHREAD pthread) + find_library(LIBRT rt) + target_link_libraries(lwip_unittests ${LIBUTIL} ${LIBPTHREAD} ${LIBRT}) +endif() + +if (CMAKE_SYSTEM_NAME STREQUAL Darwin) + # Darwin doesn't have pthreads or POSIX real-time extensions libs + find_library(LIBUTIL util) + target_link_libraries(lwip_unittests ${LIBUTIL}) +endif() diff --git a/contrib/ports/unix/check/Makefile b/contrib/ports/unix/check/Makefile new file mode 100644 index 00000000..38957a8f --- /dev/null +++ b/contrib/ports/unix/check/Makefile @@ -0,0 +1,78 @@ +# +# Copyright (c) 2001, 2002 Swedish Institute of Computer Science. +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without modification, +# are permitted provided that the following conditions are met: +# +# 1. Redistributions of source code must retain the above copyright notice, +# this list of conditions and the following disclaimer. +# 2. Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# 3. The name of the author may not be used to endorse or promote products +# derived from this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED +# WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +# MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT +# SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +# EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT +# OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING +# IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY +# OF SUCH DAMAGE. +# +# This file is part of the lwIP TCP/IP stack. +# +# Author: Adam Dunkels +# + +all compile: lwip_unittests +.PHONY: all clean check + +# The include path to sys_arch.h and lwipopts.h must be first, so this must be before Common.mk +CFLAGS=-DLWIP_NOASSERT_ON_ERROR -I/usr/include/check -I$(LWIPDIR)/../test/unit + +ifeq (clang,$(findstring clang,$(CC))) +# check.h causes 'error: token pasting of ',' and __VA_ARGS__ is a GNU extension' with clang 9.0.0 +CFLAGS+=-Wno-gnu-zero-variadic-macro-arguments +endif + +# Prevent compiling sys_arch.c of unix port because unit test provide their own port +SYSARCH?= +include ../Common.mk + +LDFLAGS:=-lcheck -lm $(LDFLAGS) + +ifneq ($(UNAME_S),Darwin) +# check installed via brew on Darwin doesn't have a separate subunit library (must be statically linked) +LDFLAGS+=-lsubunit +endif + +TESTDIR=$(LWIPDIR)/../test/unit +include $(TESTDIR)/Filelists.mk +TESTOBJS=$(notdir $(TESTFILES:.c=.o)) + +clean: + @rm -f *.o $(LWIPLIBCOMMON) $(APPLIB) lwip_unittests *.s .depend* *.core core lwip_unittests.xml + +depend dep: .depend + +include .depend + +.depend: $(LWIPFILES) $(APPFILES) $(TESTFILES) + $(CCDEP) $(CFLAGS) -MM $^ > .depend || rm -f .depend + +ifneq ($(UNAME_S),Darwin) +# clang on Darwin doesn't support --start-group +lwip_unittests: .depend $(TESTOBJS) $(LWIPLIBCOMMON) $(APPLIB) + $(CC) $(CFLAGS) -o lwip_unittests $(TESTOBJS) -Wl,--start-group $(LWIPLIBCOMMON) $(APPLIB) $(LDFLAGS) -Wl,--end-group +else +lwip_unittests: .depend $(TESTOBJS) $(LWIPLIBCOMMON) $(APPLIB) + $(CC) $(CFLAGS) -o lwip_unittests $(TESTOBJS) $(LWIPLIBCOMMON) $(APPLIB) $(LDFLAGS) +endif + +check: lwip_unittests + @./lwip_unittests diff --git a/contrib/ports/unix/check/README b/contrib/ports/unix/check/README new file mode 100644 index 00000000..421ae3b7 --- /dev/null +++ b/contrib/ports/unix/check/README @@ -0,0 +1,8 @@ + +Helper files to run lwIP unit tests on unix-like systems. + +1. Install the check library, through a package manager or from http://check.sourceforge.net/ +2. Put the lwip code in a directory called 'lwip' in the same directory as lwip-contrib is +3. Run `make check` +4. Make sure all tests pass + diff --git a/contrib/ports/unix/check/config.h b/contrib/ports/unix/check/config.h new file mode 100644 index 00000000..0d84b36a --- /dev/null +++ b/contrib/ports/unix/check/config.h @@ -0,0 +1,2 @@ +/* Enable this to simplify debugging */ +/* #define LWIP_UNITTESTS_NOFORK */ diff --git a/contrib/ports/unix/example_app/CMakeLists.txt b/contrib/ports/unix/example_app/CMakeLists.txt new file mode 100644 index 00000000..902c1a6e --- /dev/null +++ b/contrib/ports/unix/example_app/CMakeLists.txt @@ -0,0 +1,33 @@ +cmake_minimum_required(VERSION 3.8) + +project(example_app C) + +set (CMAKE_EXPORT_COMPILE_COMMANDS ON) + +set(LWIP_CONTRIB_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../../..) +set(LWIP_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../../../../lwip) + +include(${LWIP_CONTRIB_DIR}/ports/CMakeCommon.cmake) + +set (LWIP_DEFINITIONS -DLWIP_DEBUG) +set (LWIP_INCLUDE_DIRS + "${LWIP_DIR}/src/include" + "${LWIP_CONTRIB_DIR}/" + "${LWIP_CONTRIB_DIR}/ports/unix/port/include" + "${LWIP_CONTRIB_DIR}/examples/example_app" +) + +include(${LWIP_DIR}/src/Filelists.cmake) +include(${LWIP_CONTRIB_DIR}/Filelists.cmake) +include(${LWIP_CONTRIB_DIR}/ports/unix/Filelists.cmake) + +add_executable(example_app ${LWIP_CONTRIB_DIR}/examples/example_app/test.c default_netif.c) +target_include_directories(example_app PRIVATE ${LWIP_INCLUDE_DIRS}) +target_compile_options(example_app PRIVATE ${LWIP_COMPILER_FLAGS}) +target_compile_definitions(example_app PRIVATE ${LWIP_DEFINITIONS} ${LWIP_MBEDTLS_DEFINITIONS}) +target_link_libraries(example_app ${LWIP_SANITIZER_LIBS} lwipcontribexamples lwipcontribapps lwipcontribaddons lwipallapps lwipcontribportunix lwipcore) + +add_executable(makefsdata ${lwipmakefsdata_SRCS}) +target_compile_options(makefsdata PRIVATE ${LWIP_COMPILER_FLAGS}) +target_include_directories(makefsdata PRIVATE ${LWIP_INCLUDE_DIRS}) +target_link_libraries(makefsdata ${LWIP_SANITIZER_LIBS}) \ No newline at end of file diff --git a/contrib/ports/unix/example_app/Makefile b/contrib/ports/unix/example_app/Makefile new file mode 100644 index 00000000..f4a5a834 --- /dev/null +++ b/contrib/ports/unix/example_app/Makefile @@ -0,0 +1,58 @@ +# +# Copyright (c) 2001, 2002 Swedish Institute of Computer Science. +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without modification, +# are permitted provided that the following conditions are met: +# +# 1. Redistributions of source code must retain the above copyright notice, +# this list of conditions and the following disclaimer. +# 2. Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# 3. The name of the author may not be used to endorse or promote products +# derived from this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED +# WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +# MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT +# SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +# EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT +# OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING +# IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY +# OF SUCH DAMAGE. +# +# This file is part of the lwIP TCP/IP stack. +# +# Author: Adam Dunkels +# + +all compile: example_app makefsdata +.PHONY: all + +include ../Common.mk + +CFLAGS+=-I$(CONTRIBDIR)/examples/example_app + +TESTFLAGS?= +CFLAGS+=$(TESTFLAGS) + +MAKEFSDATAOBJS=$(notdir $(MAKEFSDATAFILES:.c=.o)) + +clean: + rm -f *.o $(LWIPLIBCOMMON) $(APPLIB) example_app makefsdata *.s .depend* *.core core + +depend dep: .depend + +include .depend + +.depend: $(CONTRIBDIR)/examples/example_app/test.c default_netif.c $(LWIPFILES) $(APPFILES) $(MAKEFSDATAFILES) + $(CCDEP) $(CFLAGS) -MM $^ > .depend || rm -f .depend + +example_app: .depend $(LWIPLIBCOMMON) $(APPLIB) default_netif.o test.o + $(CC) $(CFLAGS) -o example_app test.o default_netif.o -Wl,--start-group $(APPLIB) $(LWIPLIBCOMMON) -Wl,--end-group $(LDFLAGS) + +makefsdata: .depend $(MAKEFSDATAOBJS) + $(CC) $(CFLAGS) -o makefsdata $(MAKEFSDATAOBJS) diff --git a/contrib/ports/unix/example_app/default_netif.c b/contrib/ports/unix/example_app/default_netif.c new file mode 100644 index 00000000..8a9138de --- /dev/null +++ b/contrib/ports/unix/example_app/default_netif.c @@ -0,0 +1,68 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +#include "lwip/opt.h" + +#include "lwip/netif.h" +#include "lwip/ip_addr.h" +#include "lwip/tcpip.h" +#include "netif/tapif.h" +#include "examples/example_app/default_netif.h" + +static struct netif netif; + +#if LWIP_IPV4 +#define NETIF_ADDRS ipaddr, netmask, gw, +void init_default_netif(const ip4_addr_t *ipaddr, const ip4_addr_t *netmask, const ip4_addr_t *gw) +#else +#define NETIF_ADDRS +void init_default_netif(void) +#endif +{ +#if NO_SYS +netif_add(&netif, NETIF_ADDRS NULL, tapif_init, netif_input); +#else + netif_add(&netif, NETIF_ADDRS NULL, tapif_init, tcpip_input); +#endif + netif_set_default(&netif); +} + +void +default_netif_poll(void) +{ + tapif_poll(&netif); +} + +void +default_netif_shutdown(void) +{ +} diff --git a/contrib/ports/unix/example_app/iteropts.sh b/contrib/ports/unix/example_app/iteropts.sh new file mode 100644 index 00000000..42ac4e57 --- /dev/null +++ b/contrib/ports/unix/example_app/iteropts.sh @@ -0,0 +1,24 @@ +#!/bin/bash + +LOGFILE=iteropts.log +EXAPPDIR=../../../examples/example_app + +pushd `dirname "$0"` +pwd +echo Starting Iteropts run >> $LOGFILE +for f in $EXAPPDIR/test_configs/*.h +do + echo Cleaning... + make clean + BUILDLOG=$(basename "$f" ".h").log + echo testing $f + echo testing $f >> $LOGFILE + rm $EXAPPDIR/lwipopts_test.h + # cat the file to update its timestamp + cat $f > $EXAPPDIR/lwipopts_test.h + make TESTFLAGS=-DLWIP_OPTTEST_FILE -j 8 &> $BUILDLOG 2>&1 || echo file $f failed >> $LOGFILE + echo test $f done >> $LOGFILE +done +echo done, cleaning +make clean +popd diff --git a/contrib/ports/unix/lib/CMakeLists.txt b/contrib/ports/unix/lib/CMakeLists.txt new file mode 100644 index 00000000..9c80f868 --- /dev/null +++ b/contrib/ports/unix/lib/CMakeLists.txt @@ -0,0 +1,34 @@ +cmake_minimum_required(VERSION 3.8) + +project(lwip C) + +set (BUILD_SHARED_LIBS ON) + +if (NOT CMAKE_SYSTEM_NAME STREQUAL Linux AND NOT CMAKE_SYSTEM_NAME STREQUAL GNU) + message(FATAL_ERROR "Lwip shared library is only working on Linux or the Hurd") +endif() + +set(LWIP_CONTRIB_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../../..) +set(LWIP_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../../../../lwip) + +include(${LWIP_CONTRIB_DIR}/ports/CMakeCommon.cmake) + +set (LWIP_DEFINITIONS -DLWIP_DEBUG) +set (LWIP_INCLUDE_DIRS + "${LWIP_DIR}/src/include" + "${LWIP_CONTRIB_DIR}/" + "${LWIP_CONTRIB_DIR}/ports/unix/port/include" + "${CMAKE_CURRENT_SOURCE_DIR}/" +) + +include(${LWIP_CONTRIB_DIR}/ports/unix/Filelists.cmake) +include(${LWIP_DIR}/src/Filelists.cmake) + +add_library(lwip ${lwipnoapps_SRCS} ${lwipcontribportunix_SRCS} ${lwipcontribportunixnetifs_SRCS}) +target_compile_options(lwip PRIVATE ${LWIP_COMPILER_FLAGS}) +target_compile_definitions(lwip PRIVATE ${LWIP_DEFINITIONS} ${LWIP_MBEDTLS_DEFINITIONS}) +target_include_directories(lwip PRIVATE ${LWIP_INCLUDE_DIRS} ${LWIP_MBEDTLS_INCLUDE_DIRS}) +target_link_libraries(lwip ${LWIP_SANITIZER_LIBS}) + +find_library(LIBPTHREAD pthread) +target_link_libraries(lwip ${LIBPTHREAD}) diff --git a/contrib/ports/unix/lib/README b/contrib/ports/unix/lib/README new file mode 100644 index 00000000..3e6d0b1a --- /dev/null +++ b/contrib/ports/unix/lib/README @@ -0,0 +1,28 @@ +This directory contains an example of how to compile lwIP as a shared library +on Linux. + +Some brief instructions: + +* Compile the code: + + > mkdir build + > cd build + > cmake .. + > make clean all + + This should produce liblwip.so. This is the shared library. + +* Link an application against the shared library + + If you're using gcc you can do this by including -llwip in your link command. + +* Run your application + + Ensure that LD_LIBRARY_PATH includes the directory that contains liblwip.so + (ie. this directory) + + +If you are unsure about shared libraries and libraries on linux in +general, you might find this HOWTO useful: + + diff --git a/contrib/ports/unix/lib/lwipopts.h b/contrib/ports/unix/lib/lwipopts.h new file mode 100644 index 00000000..660f7f70 --- /dev/null +++ b/contrib/ports/unix/lib/lwipopts.h @@ -0,0 +1,445 @@ +/** + * @file + * + * lwIP Options Configuration + */ + +/* + * Copyright (c) 2001-2004 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_LWIPOPTS_H +#define LWIP_LWIPOPTS_H + +/* + * Include user defined options first. Anything not defined in these files + * will be set to standard values. Override anything you dont like! + */ +#include "lwipopts.h" +#include "lwip/debug.h" + +/* + ----------------------------------------------- + ---------- Platform specific locking ---------- + ----------------------------------------------- +*/ + +/** + * SYS_LIGHTWEIGHT_PROT==1: if you want inter-task protection for certain + * critical regions during buffer allocation, deallocation and memory + * allocation and deallocation. + */ +#define SYS_LIGHTWEIGHT_PROT 0 + +/** + * NO_SYS==1: Provides VERY minimal functionality. Otherwise, + * use lwIP facilities. + */ +#define NO_SYS 0 + +/* + ------------------------------------ + ---------- Memory options ---------- + ------------------------------------ +*/ + +/** + * MEM_ALIGNMENT: should be set to the alignment of the CPU + * 4 byte alignment -> #define MEM_ALIGNMENT 4 + * 2 byte alignment -> #define MEM_ALIGNMENT 2 + */ +#define MEM_ALIGNMENT 1U + +/** + * MEM_SIZE: the size of the heap memory. If the application will send + * a lot of data that needs to be copied, this should be set high. + */ +#define MEM_SIZE 1600 + +/* + ------------------------------------------------ + ---------- Internal Memory Pool Sizes ---------- + ------------------------------------------------ +*/ +/** + * MEMP_NUM_PBUF: the number of memp struct pbufs (used for PBUF_ROM and PBUF_REF). + * If the application sends a lot of data out of ROM (or other static memory), + * this should be set high. + */ +#define MEMP_NUM_PBUF 16 + +/** + * MEMP_NUM_RAW_PCB: Number of raw connection PCBs + * (requires the LWIP_RAW option) + */ +#define MEMP_NUM_RAW_PCB 4 + +/** + * MEMP_NUM_UDP_PCB: the number of UDP protocol control blocks. One + * per active UDP "connection". + * (requires the LWIP_UDP option) + */ +#define MEMP_NUM_UDP_PCB 4 + +/** + * MEMP_NUM_TCP_PCB: the number of simulatenously active TCP connections. + * (requires the LWIP_TCP option) + */ +#define MEMP_NUM_TCP_PCB 4 + +/** + * MEMP_NUM_TCP_PCB_LISTEN: the number of listening TCP connections. + * (requires the LWIP_TCP option) + */ +#define MEMP_NUM_TCP_PCB_LISTEN 4 + +/** + * MEMP_NUM_TCP_SEG: the number of simultaneously queued TCP segments. + * (requires the LWIP_TCP option) + */ +#define MEMP_NUM_TCP_SEG 16 + +/** + * MEMP_NUM_REASSDATA: the number of simultaneously IP packets queued for + * reassembly (whole packets, not fragments!) + */ +#define MEMP_NUM_REASSDATA 1 + +/** + * MEMP_NUM_ARP_QUEUE: the number of simulateously queued outgoing + * packets (pbufs) that are waiting for an ARP request (to resolve + * their destination address) to finish. + * (requires the ARP_QUEUEING option) + */ +#define MEMP_NUM_ARP_QUEUE 2 + +/** + * MEMP_NUM_SYS_TIMEOUT: the number of simulateously active timeouts. + * (requires NO_SYS==0) + */ +#define MEMP_NUM_SYS_TIMEOUT 8 + +/** + * MEMP_NUM_NETBUF: the number of struct netbufs. + * (only needed if you use the sequential API, like api_lib.c) + */ +#define MEMP_NUM_NETBUF 2 + +/** + * MEMP_NUM_NETCONN: the number of struct netconns. + * (only needed if you use the sequential API, like api_lib.c) + */ +#define MEMP_NUM_NETCONN 32 + +/** + * MEMP_NUM_TCPIP_MSG_API: the number of struct tcpip_msg, which are used + * for callback/timeout API communication. + * (only needed if you use tcpip.c) + */ +#define MEMP_NUM_TCPIP_MSG_API 8 + +/** + * MEMP_NUM_TCPIP_MSG_INPKT: the number of struct tcpip_msg, which are used + * for incoming packets. + * (only needed if you use tcpip.c) + */ +#define MEMP_NUM_TCPIP_MSG_INPKT 8 + +/** + * PBUF_POOL_SIZE: the number of buffers in the pbuf pool. + */ +#define PBUF_POOL_SIZE 8 + +/* + --------------------------------- + ---------- ARP options ---------- + --------------------------------- +*/ +/** + * LWIP_ARP==1: Enable ARP functionality. + */ +#define LWIP_ARP 1 + +/* + -------------------------------- + ---------- IP options ---------- + -------------------------------- +*/ +/** + * IP_FORWARD==1: Enables the ability to forward IP packets across network + * interfaces. If you are going to run lwIP on a device with only one network + * interface, define this to 0. + */ +#define IP_FORWARD 0 + +/** + * IP_OPTIONS: Defines the behavior for IP options. + * IP_OPTIONS_ALLOWED==0: All packets with IP options are dropped. + * IP_OPTIONS_ALLOWED==1: IP options are allowed (but not parsed). + */ +#define IP_OPTIONS_ALLOWED 1 + +/** + * IP_REASSEMBLY==1: Reassemble incoming fragmented IP packets. Note that + * this option does not affect outgoing packet sizes, which can be controlled + * via IP_FRAG. + */ +#define IP_REASSEMBLY 1 + +/** + * IP_FRAG==1: Fragment outgoing IP packets if their size exceeds MTU. Note + * that this option does not affect incoming packet sizes, which can be + * controlled via IP_REASSEMBLY. + */ +#define IP_FRAG 1 + +/** + * IP_REASS_MAXAGE: Maximum time (in multiples of IP_TMR_INTERVAL - so seconds, normally) + * a fragmented IP packet waits for all fragments to arrive. If not all fragments arrived + * in this time, the whole packet is discarded. + */ +#define IP_REASS_MAXAGE 3 + +/** + * IP_REASS_MAX_PBUFS: Total maximum amount of pbufs waiting to be reassembled. + * Since the received pbufs are enqueued, be sure to configure + * PBUF_POOL_SIZE > IP_REASS_MAX_PBUFS so that the stack is still able to receive + * packets even if the maximum amount of fragments is enqueued for reassembly! + */ +#define IP_REASS_MAX_PBUFS 4 + +/** + * IP_FRAG_USES_STATIC_BUF==1: Use a static MTU-sized buffer for IP + * fragmentation. Otherwise pbufs are allocated and reference the original + * packet data to be fragmented. +*/ +#define IP_FRAG_USES_STATIC_BUF 0 + +/** + * IP_DEFAULT_TTL: Default value for Time-To-Live used by transport layers. + */ +#define IP_DEFAULT_TTL 255 + +/* + ---------------------------------- + ---------- ICMP options ---------- + ---------------------------------- +*/ +/** + * LWIP_ICMP==1: Enable ICMP module inside the IP stack. + * Be careful, disable that make your product non-compliant to RFC1122 + */ +#define LWIP_ICMP 1 + +/* + --------------------------------- + ---------- RAW options ---------- + --------------------------------- +*/ +/** + * LWIP_RAW==1: Enable application layer to hook into the IP layer itself. + */ +#define LWIP_RAW 1 + +/* + ---------------------------------- + ---------- DHCP options ---------- + ---------------------------------- +*/ +/** + * LWIP_DHCP==1: Enable DHCP module. + */ +#define LWIP_DHCP 0 + + +/* + ------------------------------------ + ---------- AUTOIP options ---------- + ------------------------------------ +*/ +/** + * LWIP_AUTOIP==1: Enable AUTOIP module. + */ +#define LWIP_AUTOIP 0 + +/* + ---------------------------------- + ---------- SNMP options ---------- + ---------------------------------- +*/ +/** + * LWIP_SNMP==1: Turn on SNMP module. UDP must be available for SNMP + * transport. + */ +#define LWIP_SNMP 0 + +/* + ---------------------------------- + ---------- IGMP options ---------- + ---------------------------------- +*/ +/** + * LWIP_IGMP==1: Turn on IGMP module. + */ +#define LWIP_IGMP 0 + +/* + ---------------------------------- + ---------- DNS options ----------- + ---------------------------------- +*/ +/** + * LWIP_DNS==1: Turn on DNS module. UDP must be available for DNS + * transport. + */ +#define LWIP_DNS 0 + +/* + --------------------------------- + ---------- UDP options ---------- + --------------------------------- +*/ +/** + * LWIP_UDP==1: Turn on UDP. + */ +#define LWIP_UDP 1 + +/* + --------------------------------- + ---------- TCP options ---------- + --------------------------------- +*/ +/** + * LWIP_TCP==1: Turn on TCP. + */ +#define LWIP_TCP 1 + +#define LWIP_LISTEN_BACKLOG 0 + +/* + ---------------------------------- + ---------- Pbuf options ---------- + ---------------------------------- +*/ +/** + * PBUF_LINK_HLEN: the number of bytes that should be allocated for a + * link level header. The default is 14, the standard value for + * Ethernet. + */ +#define PBUF_LINK_HLEN 16 + +/** + * PBUF_POOL_BUFSIZE: the size of each pbuf in the pbuf pool. The default is + * designed to accomodate single full size TCP frame in one pbuf, including + * TCP_MSS, IP header, and link header. +* + */ +#define PBUF_POOL_BUFSIZE LWIP_MEM_ALIGN_SIZE(TCP_MSS+40+PBUF_LINK_HLEN) + +/* + ------------------------------------ + ---------- LOOPIF options ---------- + ------------------------------------ +*/ +/** + * LWIP_HAVE_LOOPIF==1: Support loop interface (127.0.0.1) and loopif.c + */ +#define LWIP_HAVE_LOOPIF 0 + +/* + ---------------------------------------------- + ---------- Sequential layer options ---------- + ---------------------------------------------- +*/ + +/** + * LWIP_NETCONN==1: Enable Netconn API (require to use api_lib.c) + */ +#define LWIP_NETCONN 1 + +/* + ------------------------------------ + ---------- Socket options ---------- + ------------------------------------ +*/ +/** + * LWIP_SOCKET==1: Enable Socket API (require to use sockets.c) + */ +#define LWIP_SOCKET 1 + +/** + * SO_REUSE==1: Enable SO_REUSEADDR + */ +#define SO_REUSE 1 + +/* + ---------------------------------------- + ---------- Statistics options ---------- + ---------------------------------------- +*/ +/** + * LWIP_STATS==1: Enable statistics collection in lwip_stats. + */ +#define LWIP_STATS 0 +/* + --------------------------------- + ---------- PPP options ---------- + --------------------------------- +*/ +/** + * PPP_SUPPORT==1: Enable PPP. + */ +#define PPP_SUPPORT 0 + + + +/* + --------------------------------------- + ---------- Threading options ---------- + --------------------------------------- +*/ + +#define LWIP_TCPIP_CORE_LOCKING 1 + +#if !NO_SYS +void sys_check_core_locking(void); +#define LWIP_ASSERT_CORE_LOCKED() sys_check_core_locking() +void sys_mark_tcpip_thread(void); +#define LWIP_MARK_TCPIP_THREAD() sys_mark_tcpip_thread() + +#if LWIP_TCPIP_CORE_LOCKING +void sys_lock_tcpip_core(void); +#define LOCK_TCPIP_CORE() sys_lock_tcpip_core() +void sys_unlock_tcpip_core(void); +#define UNLOCK_TCPIP_CORE() sys_unlock_tcpip_core() +#endif +#endif + +#endif /* LWIP_LWIPOPTS_H */ diff --git a/contrib/ports/unix/port/include/arch/cc.h b/contrib/ports/unix/port/include/arch/cc.h new file mode 100644 index 00000000..80b37d8a --- /dev/null +++ b/contrib/ports/unix/port/include/arch/cc.h @@ -0,0 +1,86 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_ARCH_CC_H +#define LWIP_ARCH_CC_H + +/* see https://sourceforge.net/p/predef/wiki/OperatingSystems/ */ +#if defined __ANDROID__ +#define LWIP_UNIX_ANDROID +#elif defined __linux__ +#define LWIP_UNIX_LINUX +#elif defined __APPLE__ +#define LWIP_UNIX_MACH +#elif defined __OpenBSD__ +#define LWIP_UNIX_OPENBSD +#elif defined __CYGWIN__ +#define LWIP_UNIX_CYGWIN +#elif defined __GNU__ +#define LWIP_UNIX_HURD +#endif + +#define LWIP_TIMEVAL_PRIVATE 0 +#include + +#define LWIP_ERRNO_INCLUDE + +#if defined(LWIP_UNIX_LINUX) || defined(LWIP_UNIX_HURD) +#define LWIP_ERRNO_STDINCLUDE 1 +#endif + +#define LWIP_RAND() ((u32_t)rand()) + +/* different handling for unit test, normally not needed */ +#ifdef LWIP_NOASSERT_ON_ERROR +#define LWIP_ERROR(message, expression, handler) do { if (!(expression)) { \ + handler;}} while(0) +#endif + +#if defined(LWIP_UNIX_ANDROID) && defined(FD_SET) +typedef __kernel_fd_set fd_set; +#endif + +#if defined(LWIP_UNIX_MACH) +/* sys/types.h and signal.h bring in Darwin byte order macros. pull the + header here and disable LwIP's version so that apps still can get + the macros via LwIP headers and use system headers */ +#include +#define LWIP_DONT_PROVIDE_BYTEORDER_FUNCTIONS +#endif + +struct sio_status_s; +typedef struct sio_status_s sio_status_t; +#define sio_fd_t sio_status_t* +#define __sio_fd_t_defined + +typedef unsigned int sys_prot_t; + +#endif /* LWIP_ARCH_CC_H */ diff --git a/contrib/ports/unix/port/include/arch/perf.h b/contrib/ports/unix/port/include/arch/perf.h new file mode 100644 index 00000000..326ac9e8 --- /dev/null +++ b/contrib/ports/unix/port/include/arch/perf.h @@ -0,0 +1,63 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_ARCH_PERF_H +#define LWIP_ARCH_PERF_H + +#include + +#ifdef PERF +#define PERF_START { \ + unsigned long __c1l, __c1h, __c2l, __c2h; \ + __asm__(".byte 0x0f, 0x31" : "=a" (__c1l), "=d" (__c1h)) +#define PERF_STOP(x) __asm__(".byte 0x0f, 0x31" : "=a" (__c2l), "=d" (__c2h)); \ + perf_print(__c1l, __c1h, __c2l, __c2h, x);} + +/*#define PERF_START do { \ + struct tms __perf_start, __perf_end; \ + times(&__perf_start) +#define PERF_STOP(x) times(&__perf_end); \ + perf_print_times(&__perf_start, &__perf_end, x);\ + } while(0)*/ +#else /* PERF */ +#define PERF_START /* null definition */ +#define PERF_STOP(x) /* null definition */ +#endif /* PERF */ + +void perf_print(unsigned long c1l, unsigned long c1h, + unsigned long c2l, unsigned long c2h, + char *key); + +void perf_print_times(struct tms *start, struct tms *end, char *key); + +void perf_init(char *fname); + +#endif /* LWIP_ARCH_PERF_H */ diff --git a/contrib/ports/unix/port/include/arch/sys_arch.h b/contrib/ports/unix/port/include/arch/sys_arch.h new file mode 100644 index 00000000..c41be0bb --- /dev/null +++ b/contrib/ports/unix/port/include/arch/sys_arch.h @@ -0,0 +1,63 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_ARCH_SYS_ARCH_H +#define LWIP_ARCH_SYS_ARCH_H + +#define SYS_MBOX_NULL NULL +#define SYS_SEM_NULL NULL + +/*typedef u32_t sys_prot_t;*/ + +struct sys_sem; +typedef struct sys_sem * sys_sem_t; +#define sys_sem_valid(sem) (((sem) != NULL) && (*(sem) != NULL)) +#define sys_sem_valid_val(sem) ((sem) != NULL) +#define sys_sem_set_invalid(sem) do { if((sem) != NULL) { *(sem) = NULL; }}while(0) +#define sys_sem_set_invalid_val(sem) do { (sem) = NULL; }while(0) + +struct sys_mutex; +typedef struct sys_mutex * sys_mutex_t; +#define sys_mutex_valid(mutex) sys_sem_valid(mutex) +#define sys_mutex_set_invalid(mutex) sys_sem_set_invalid(mutex) + +struct sys_mbox; +typedef struct sys_mbox * sys_mbox_t; +#define sys_mbox_valid(mbox) sys_sem_valid(mbox) +#define sys_mbox_valid_val(mbox) sys_sem_valid_val(mbox) +#define sys_mbox_set_invalid(mbox) sys_sem_set_invalid(mbox) +#define sys_mbox_set_invalid_val(mbox) sys_sem_set_invalid_val(mbox) + +struct sys_thread; +typedef struct sys_thread * sys_thread_t; + +#endif /* LWIP_ARCH_SYS_ARCH_H */ + diff --git a/contrib/ports/unix/port/include/netif/fifo.h b/contrib/ports/unix/port/include/netif/fifo.h new file mode 100644 index 00000000..6c2ad207 --- /dev/null +++ b/contrib/ports/unix/port/include/netif/fifo.h @@ -0,0 +1,54 @@ +#ifndef FIFO_H +#define FIFO_H + +#include "lwip/sys.h" + +/** How many bytes in fifo */ +#define FIFOSIZE 2048 + +/** fifo data structure, this one is passed to all fifo functions */ +typedef struct fifo_t { + u8_t data[FIFOSIZE+10]; /* data segment, +10 is a hack probably not needed.. FIXME! */ + int dataslot; /* index to next char to be read */ + int emptyslot; /* index to next empty slot */ + int len; /* len probably not needed, may be calculated from dataslot and emptyslot in conjunction with FIFOSIZE */ + + sys_sem_t sem; /* semaphore protecting simultaneous data manipulation */ + sys_sem_t getSem; /* sepaphore used to signal new data if getWaiting is set */ + u8_t getWaiting; /* flag used to indicate that fifoget is waiting for data. fifoput is suposed to clear */ + /* this flag prior to signaling the getSem semaphore */ +} fifo_t; + + +/** +* Get a character from fifo +* Blocking call. +* @param fifo pointer to fifo data structure +* @return character read from fifo +*/ +u8_t fifoGet(fifo_t * fifo); + +/** +* Get a character from fifo +* Non blocking call. +* @param fifo pointer to fifo data structure +* @return character read from fifo, or < zero if non was available +*/ +s16_t fifoGetNonBlock(fifo_t * fifo); + +/** +* fifoput is called by the signalhandler when new data has arrived (or some other event is indicated) +* fifoput reads directly from the serialport and is thus highly dependent on unix arch at this moment +* @param fifo pointer to fifo data structure +* @param fd unix file descriptor +*/ +void fifoPut(fifo_t * fifo, int fd); + +/** +* fifoinit initiate fifo +* @param fifo pointer to fifo data structure, allocated by the user +*/ +void fifoInit(fifo_t * fifo); + +#endif + diff --git a/contrib/ports/unix/port/include/netif/list.h b/contrib/ports/unix/port/include/netif/list.h new file mode 100644 index 00000000..2c4d142a --- /dev/null +++ b/contrib/ports/unix/port/include/netif/list.h @@ -0,0 +1,26 @@ + +#ifndef LWIP_LIST_H +#define LWIP_LIST_H + +struct elem; + +struct list { + struct elem *first, *last; + int size, elems; +}; + +struct elem { + struct elem *next; + void *data; +}; + +struct list *list_new(int size); +int list_push(struct list *list, void *data); +void *list_pop(struct list *list); +void *list_first(struct list *list); +int list_elems(struct list *list); +void list_delete(struct list *list); +int list_remove(struct list *list, void *elem); +void list_map(struct list *list, void (* func)(void *arg)); + +#endif diff --git a/contrib/ports/unix/port/include/netif/pcapif.h b/contrib/ports/unix/port/include/netif/pcapif.h new file mode 100644 index 00000000..ef7abd5f --- /dev/null +++ b/contrib/ports/unix/port/include/netif/pcapif.h @@ -0,0 +1,39 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_PCAPIF_H +#define LWIP_PCAPIF_H + +#include "lwip/netif.h" + +err_t pcapif_init(struct netif *netif); + +#endif /* LWIP_PCAPIF_H */ diff --git a/contrib/ports/unix/port/include/netif/sio.h b/contrib/ports/unix/port/include/netif/sio.h new file mode 100644 index 00000000..4822b536 --- /dev/null +++ b/contrib/ports/unix/port/include/netif/sio.h @@ -0,0 +1,60 @@ +#ifndef SIO_UNIX_H +#define SIO_UNIX_H + +#include "lwip/sys.h" +#include "lwip/netif.h" +#include "netif/fifo.h" +/*#include "netif/pppif.h"*/ + +struct sio_status_s { + int fd; + fifo_t myfifo; +}; + +/* BAUDRATE is defined in sio.c as it is implementation specific */ +/** Baudrates */ +typedef enum sioBaudrates { + SIO_BAUD_9600, + SIO_BAUD_19200, + SIO_BAUD_38400, + SIO_BAUD_57600, + SIO_BAUD_115200 +} sioBaudrates; + +/** +* Poll for a new character from incoming data stream +* @param siostat siostatus struct, contains sio instance data, given by sio_open +* @return char read from input stream, or < 0 if no char was available +*/ +s16_t sio_poll(sio_status_t * siostat); + +/** +* Parse incoming characters until a string str is recieved, blocking call +* @param str zero terminated string to expect +* @param siostat siostatus struct, contains sio instance data, given by sio_open +*/ +void sio_expect_string(u8_t *str, sio_status_t * siostat); + +/** +* Write a char to output data stream +* @param str pointer to a zero terminated string +* @param siostat siostatus struct, contains sio instance data, given by sio_open +*/ +void sio_send_string(u8_t *str, sio_status_t * siostat); + +/** +* Flush outbuffer (send everything in buffer now), useful if some layer below is +* holding on to data, waitng to fill a buffer +* @param siostat siostatus struct, contains sio instance data, given by sio_open +*/ +void sio_flush( sio_status_t * siostat ); + +/** +* Change baudrate of port, may close and reopen port +* @param baud new baudrate +* @param siostat siostatus struct, contains sio instance data, given by sio_open +*/ +void sio_change_baud( sioBaudrates baud, sio_status_t * siostat ); + +#endif + diff --git a/contrib/ports/unix/port/include/netif/tapif.h b/contrib/ports/unix/port/include/netif/tapif.h new file mode 100644 index 00000000..4c0fa6b3 --- /dev/null +++ b/contrib/ports/unix/port/include/netif/tapif.h @@ -0,0 +1,43 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_TAPIF_H +#define LWIP_TAPIF_H + +#include "lwip/netif.h" + +err_t tapif_init(struct netif *netif); +void tapif_poll(struct netif *netif); +#if NO_SYS +int tapif_select(struct netif *netif); +#endif /* NO_SYS */ + +#endif /* LWIP_TAPIF_H */ diff --git a/contrib/ports/unix/port/netif/fifo.c b/contrib/ports/unix/port/netif/fifo.c new file mode 100644 index 00000000..9fee0bde --- /dev/null +++ b/contrib/ports/unix/port/netif/fifo.c @@ -0,0 +1,139 @@ +/* Author: Magnus Ivarsson */ + +/* ---------------------------------------------- */ +/* --- fifo 4 unix ------------------------------ */ +/* ---------------------------------------------- */ +#include "lwip/err.h" +#include "netif/fifo.h" +#include "lwip/debug.h" +#include "lwip/def.h" +#include "lwip/sys.h" +#include "lwip/arch.h" +#include + +#ifndef TRUE +#define TRUE 1 +#endif +#ifndef FALSE +#define FALSE 0 +#endif + +#ifndef SIO_FIFO_DEBUG +#define SIO_FIFO_DEBUG LWIP_DBG_OFF +#endif + +u8_t fifoGet(fifo_t * fifo) +{ + u8_t c; + + sys_sem_wait(&fifo->sem); /* enter critical section */ + + if (fifo->dataslot == fifo->emptyslot) + { + fifo->getWaiting = TRUE; /* tell putFifo to signal us when data is available */ + sys_sem_signal(&fifo->sem); /* leave critical section (allow input from serial port..) */ + sys_sem_wait(&fifo->getSem); /* wait 4 data */ + sys_sem_wait(&fifo->sem); /* reenter critical section */ + } + + c = fifo->data[fifo->dataslot++]; + fifo->len--; + + if (fifo->dataslot == FIFOSIZE) + { + fifo->dataslot = 0; + } + sys_sem_signal(&fifo->sem); /* leave critical section */ + return c; +} + + +s16_t fifoGetNonBlock(fifo_t * fifo) +{ + u16_t c; + + sys_sem_wait(&fifo->sem); /* enter critical section */ + + if (fifo->dataslot == fifo->emptyslot) + { + /* empty fifo */ + c = -1; + } + else + { + c = fifo->data[fifo->dataslot++]; + fifo->len--; + + if (fifo->dataslot == FIFOSIZE) + { + fifo->dataslot = 0; + } + } + sys_sem_signal(&fifo->sem); /* leave critical section */ + return c; +} + + +void fifoPut(fifo_t * fifo, int fd) +{ + /* FIXME: mutex around struct data.. */ + int cnt=0; + + sys_sem_wait(&fifo->sem ); /* enter critical */ + + LWIP_DEBUGF( SIO_FIFO_DEBUG,("fifoput: len%d dat%d empt%d --> ", fifo->len, fifo->dataslot, fifo->emptyslot ) ); + + if ( fifo->emptyslot < fifo->dataslot ) + { + cnt = read( fd, &fifo->data[fifo->emptyslot], fifo->dataslot - fifo->emptyslot ); + } + else + { + cnt = read( fd, &fifo->data[fifo->emptyslot], FIFOSIZE-fifo->emptyslot ); + } + fifo->emptyslot += cnt; + fifo->len += cnt; + + LWIP_DEBUGF( SIO_FIFO_DEBUG,("len%d dat%d empt%d\n", fifo->len, fifo->dataslot, fifo->emptyslot ) ); + + if ( fifo->len > FIFOSIZE ) + { + printf( "ERROR: fifo overrun detected len=%d, flushing\n", fifo->len ); + fifo->dataslot = 0; + fifo->emptyslot = 0; + fifo->len = 0; + } + + if ( fifo->emptyslot == FIFOSIZE ) + { + fifo->emptyslot = 0; + LWIP_DEBUGF( SIO_FIFO_DEBUG, ("(WRAP) ") ); + + sys_sem_signal(&fifo->sem ); /* leave critical */ + fifoPut( fifo, fd ); + return; + } + if ( fifo->getWaiting ) + { + fifo->getWaiting = FALSE; + sys_sem_signal(&fifo->getSem ); + } + + sys_sem_signal(&fifo->sem ); /* leave critical */ + return; +} + + +void fifoInit(fifo_t * fifo) +{ + fifo->dataslot = 0; + fifo->emptyslot = 0; + fifo->len = 0; + if(sys_sem_new(&fifo->sem, 1) != ERR_OK) { /* critical section 1=free to enter */ + LWIP_ASSERT("Failed to create semaphore", 0); + } + if(sys_sem_new(&fifo->getSem, 0) != ERR_OK) { /* 0 = no one waiting */ + LWIP_ASSERT("Failed to create semaphore", 0); + } + fifo->getWaiting = FALSE; +} diff --git a/contrib/ports/unix/port/netif/list.c b/contrib/ports/unix/port/netif/list.c new file mode 100644 index 00000000..fd61f538 --- /dev/null +++ b/contrib/ports/unix/port/netif/list.c @@ -0,0 +1,153 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + + + +#include +#include + + +/*-----------------------------------------------------------------------------------*/ +struct list * +list_new(int size) +{ + struct list *list; + list = (struct list *)malloc(sizeof(struct list)); + list->first = list->last = NULL; + list->size = size; + list->elems = 0; + return list; +} +/*-----------------------------------------------------------------------------------*/ +int +list_push(struct list *list, void *data) +{ + struct elem *elem; + + if (list->elems < list->size) { + elem = (struct elem *)malloc(sizeof(struct elem)); + elem->data = data; + elem->next = NULL; + if (list->last != NULL) { + list->last->next = elem; + } + list->last = elem; + if (list->first == NULL) { + list->first = elem; + } + list->elems++; + return 1; + } + return 0; +} +/*-----------------------------------------------------------------------------------*/ +void * +list_pop(struct list *list) +{ + struct elem *elem; + void *data; + + if (list->elems > 0) { + elem = list->first; + if (elem == list->last) { + list->last = elem->next; + } + list->first = elem->next; + + list->elems--; + + data = elem->data; + free(elem); + + return data; + } + return NULL; +} +/*-----------------------------------------------------------------------------------*/ +void * +list_first(struct list *list) +{ + return list->first; +} +/*-----------------------------------------------------------------------------------*/ +int +list_elems(struct list *list) +{ + return list->elems; +} +/*-----------------------------------------------------------------------------------*/ +void +list_delete(struct list *list) +{ + while (list_pop(list) != NULL); + free(list); +} +/*-----------------------------------------------------------------------------------*/ +int +list_remove(struct list *list, void *elem) +{ + struct elem *e, *p; + + p = NULL; + for(e = list->first; e != NULL; e = e->next) { + if (e->data == elem) { + if (p != NULL) { + p->next = e->next; + } else { + list->first = e->next; + } + if (list->last == e) { + list->last = p; + if (p != NULL) { + p->next = NULL; + } + } + free(e); + list->elems--; + return 1; + } + p = e; + } + return 0; +} +/*-----------------------------------------------------------------------------------*/ +void +list_map(struct list *list, void (* func)(void *arg)) +{ + struct elem *e; + + for(e = list->first; e != NULL; e = e->next) { + func(e->data); + } +} +/*-----------------------------------------------------------------------------------*/ + diff --git a/contrib/ports/unix/port/netif/pcapif.c b/contrib/ports/unix/port/netif/pcapif.c new file mode 100644 index 00000000..2dcac482 --- /dev/null +++ b/contrib/ports/unix/port/netif/pcapif.c @@ -0,0 +1,207 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +#ifndef linux /* Apparently, this doesn't work under Linux. */ + +#include "lwip/debug.h" + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#include + +#include "netif/etharp.h" + +#include "lwip/stats.h" + +#include "lwip/def.h" +#include "lwip/mem.h" +#include "lwip/pbuf.h" +#include "lwip/sys.h" + +#include "lwip/ip.h" + + +struct pcapif { + pcap_t *pd; + sys_sem_t sem; + u8_t pkt[2048]; + u32_t len; + u32_t lasttime; + struct pbuf *p; + struct eth_addr *ethaddr; +}; + +static char errbuf[PCAP_ERRBUF_SIZE]; + +/*-----------------------------------------------------------------------------------*/ +static err_t +pcapif_output(struct netif *netif, struct pbuf *p, + ip_addr_t *ipaddr) +{ + return ERR_OK; +} +/*-----------------------------------------------------------------------------------*/ +static void +timeout(void *arg) +{ + struct netif *netif; + struct pcapif *pcapif; + struct pbuf *p; + struct eth_hdr *ethhdr; + + netif = (struct netif *)arg; + pcapif = netif->state; + ethhdr = (struct eth_hdr *)pcapif->pkt; + + + if (lwip_htons(ethhdr->type) != ETHTYPE_IP || + ip_lookup(pcapif->pkt + 14, netif)) { + + /* We allocate a pbuf chain of pbufs from the pool. */ + p = pbuf_alloc(PBUF_LINK, pcapif->len, PBUF_POOL); + + if (p != NULL) { + pbuf_take(p, pcapif->pkt, pcapif->len); + + ethhdr = p->payload; + switch (lwip_htons(ethhdr->type)) { + /* IP or ARP packet? */ + case ETHTYPE_IP: + case ETHTYPE_ARP: +#if PPPOE_SUPPORT + /* PPPoE packet? */ + case ETHTYPE_PPPOEDISC: + case ETHTYPE_PPPOE: +#endif /* PPPOE_SUPPORT */ + /* full packet send to tcpip_thread to process */ + if (netif->input(p, netif) != ERR_OK) { + LWIP_DEBUGF(NETIF_DEBUG, ("ethernetif_input: IP input error\n")); + pbuf_free(p); + p = NULL; + } + break; + default: + pbuf_free(p); + break; + } + } + } else { + printf("ip_lookup dropped\n"); + } + + sys_sem_signal(&pcapif->sem); +} +/*-----------------------------------------------------------------------------------*/ +static void +callback(u_char *arg, const struct pcap_pkthdr *hdr, const u_char *pkt) +{ + struct netif *netif; + struct pcapif *pcapif; + u32_t time, lasttime; + + netif = (struct netif *)arg; + pcapif = netif->state; + + pcapif->len = hdr->len; + + bcopy(pkt, pcapif->pkt, hdr->len); + + time = hdr->ts.tv_sec * 1000 + hdr->ts.tv_usec / 1000; + + lasttime = pcapif->lasttime; + pcapif->lasttime = time; + + + if (lasttime == 0) { + sys_timeout(1000, timeout, netif); + } else { + sys_timeout(time - lasttime, timeout, netif); + } +} +/*-----------------------------------------------------------------------------------*/ +static void +pcapif_thread(void *arg) +{ + struct netif *netif; + struct pcapif *pcapif; + netif = arg; + pcapif = netif->state; + + while (1) { + pcap_loop(pcapif->pd, 1, callback, (u_char *)netif); + sys_sem_wait(&pcapif->sem); + if (pcapif->p != NULL) { + netif->input(pcapif->p, netif); + } + } +} +/*-----------------------------------------------------------------------------------*/ +err_t +pcapif_init(struct netif *netif) +{ + struct pcapif *p; + + p = malloc(sizeof(struct pcapif)); + if (p == NULL) + return ERR_MEM; + netif->state = p; + netif->name[0] = 'p'; + netif->name[1] = 'c'; + netif->output = pcapif_output; + + p->pd = pcap_open_offline("pcapdump", errbuf); + if (p->pd == NULL) { + printf("pcapif_init: failed %s\n", errbuf); + return ERR_IF; + } + + if(sys_sem_new(&p->sem, 0) != ERR_OK) { + LWIP_ASSERT("Failed to create semaphore", 0); + } + p->p = NULL; + p->lasttime = 0; + + sys_thread_new("pcapif_thread", pcapif_thread, netif, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); + return ERR_OK; +} +/*-----------------------------------------------------------------------------------*/ +#endif /* linux */ diff --git a/contrib/ports/unix/port/netif/sio.c b/contrib/ports/unix/port/netif/sio.c new file mode 100644 index 00000000..8653fc9e --- /dev/null +++ b/contrib/ports/unix/port/netif/sio.c @@ -0,0 +1,489 @@ +/* Author: Magnus Ivarsson */ + +/* to get rid of implicit function declarations */ +#define _XOPEN_SOURCE 600 +#define _GNU_SOURCE + +/* build with Darwin C extensions not part of POSIX, i.e. FASYNC, SIGIO. + we can't use LWIP_UNIX_MACH because extensions need to be turned + on before any system headers (which are pulled in through cc.h) + are included */ +#if defined(__APPLE__) +#define _DARWIN_C_SOURCE +#endif + +#include "netif/sio.h" +#include "netif/fifo.h" +#include "lwip/debug.h" +#include "lwip/def.h" +#include "lwip/sys.h" +#include "lwip/arch.h" +#include "lwip/sio.h" +#include "netif/ppp/ppp_opts.h" + +/* Following #undefs are here to keep compiler from issuing warnings + about them being double defined. (They are defined in lwip/inet.h + as well as the Unix #includes below.) */ +#undef htonl +#undef ntohl +#undef htons +#undef ntohs +#undef HTONL +#undef NTOHL +#undef HTONS +#undef NTOHS + +#include +#include +#if defined(LWIP_UNIX_OPENBSD) +#include +#endif +#include +#include +#include +#include +#include +#include +#include +#include + +#ifndef LWIP_HAVE_SLIPIF +#define LWIP_HAVE_SLIPIF 0 +#endif + +#if (PPP_SUPPORT || LWIP_HAVE_SLIPIF) && defined(LWIP_UNIX_LINUX) +#include +#endif + +/*#define BAUDRATE B19200 */ +/*#define BAUDRATE B57600 */ +#define BAUDRATE B115200 + +#ifndef TRUE +#define TRUE 1 +#endif +#ifndef FALSE +#define FALSE 0 +#endif + +/* for all of you who dont define SIO_DEBUG in debug.h */ +#ifndef SIO_DEBUG +#define SIO_DEBUG 0 +#endif + + +/* typedef struct siostruct_t */ +/* { */ +/* sio_status_t *sio; */ +/* } siostruct_t; */ + +/** array of ((siostruct*)netif->state)->sio structs */ +static sio_status_t statusar[4]; + +#if ! (PPP_SUPPORT || LWIP_HAVE_SLIPIF) +/* --private-functions----------------------------------------------------------------- */ +/** + * Signal handler for ttyXX0 to indicate bytes received + * one per interface is needed since we cannot send a instance number / pointer as callback argument (?) + */ +static void signal_handler_IO_0( int status ) +{ + LWIP_UNUSED_ARG(status); + LWIP_DEBUGF(SIO_DEBUG, ("SigHand: rxSignal channel 0\n")); + fifoPut( &statusar[0].myfifo, statusar[0].fd ); +} + +/** + * Signal handler for ttyXX1 to indicate bytes received + * one per interface is needed since we cannot send a instance number / pointer as callback argument (?) + */ +static void signal_handler_IO_1( int status ) +{ + LWIP_UNUSED_ARG(status); + LWIP_DEBUGF(SIO_DEBUG, ("SigHand: rxSignal channel 1\n")); + fifoPut( &statusar[1].myfifo, statusar[1].fd ); +} +#endif /* ! (PPP_SUPPORT || LWIP_HAVE_SLIPIF) */ + +/** +* Initiation of serial device +* @param device string with the device name and path, eg. "/dev/ttyS0" +* @param devnum device number +* @param siostat status +* @return file handle to serial dev. +*/ +static int sio_init( char * device, int devnum, sio_status_t * siostat ) +{ + struct termios oldtio,newtio; +#if ! (PPP_SUPPORT || LWIP_HAVE_SLIPIF) + struct sigaction saio; /* definition of signal action */ +#endif + int fd; + LWIP_UNUSED_ARG(siostat); + LWIP_UNUSED_ARG(devnum); + + /* open the device to be non-blocking (read will return immediately) */ + fd = open( device, O_RDWR | O_NOCTTY | O_NONBLOCK ); + if ( fd < 0 ) + { + perror( device ); + exit( -1 ); + } + +#if ! (PPP_SUPPORT || LWIP_HAVE_SLIPIF) + /* install the signal handler before making the device asynchronous */ + switch ( devnum ) + { + case 0: + LWIP_DEBUGF( SIO_DEBUG, ("sioinit, signal_handler_IO_0\n") ); + saio.sa_handler = signal_handler_IO_0; + break; + case 1: + LWIP_DEBUGF( SIO_DEBUG, ("sioinit, signal_handler_IO_1\n") ); + saio.sa_handler = signal_handler_IO_1; + break; + default: + LWIP_DEBUGF( SIO_DEBUG,("sioinit, devnum not allowed\n") ); + break; + } + + saio.sa_flags = 0; +#if defined(LWIP_UNIX_LINUX) + saio.sa_restorer = NULL; +#endif /* LWIP_UNIX_LINUX */ + sigaction( SIGIO,&saio,NULL ); + + /* allow the process to receive SIGIO */ + if ( fcntl( fd, F_SETOWN, getpid( ) ) != 0) + { + perror( device ); + exit( -1 ); + } + /* Make the file descriptor asynchronous (the manual page says only + O_APPEND and O_NONBLOCK, will work with F_SETFL...) */ + if ( fcntl( fd, F_SETFL, FASYNC ) != 0) + { + perror( device ); + exit( -1 ); + } +#else + if ( fcntl( fd, F_SETFL, 0 ) != 0) + { + perror( device ); + exit( -1 ); + } + +#endif /* ! (PPP_SUPPORT || LWIP_HAVE_SLIPIF) */ + + tcgetattr( fd,&oldtio ); /* save current port settings */ + /* set new port settings */ + /* see 'man termios' for further settings */ + memset(&newtio, 0, sizeof(newtio)); + newtio.c_cflag = BAUDRATE | CS8 | CLOCAL | CREAD | CRTSCTS; + newtio.c_iflag = 0; + newtio.c_oflag = 0; + newtio.c_lflag = 0; /*ECHO; */ + newtio.c_cc[VMIN] = 1; /* Read 1 byte at a time, no timer */ + newtio.c_cc[VTIME] = 0; + + tcsetattr( fd,TCSANOW,&newtio ); + tcflush( fd, TCIOFLUSH ); + + return fd; +} + +/** +* +*/ +static void sio_speed( int fd, int speed ) +{ + struct termios oldtio,newtio; + /* int fd; */ + + LWIP_DEBUGF(SIO_DEBUG, ("sio_speed[%d]: baudcode:%d enter\n", fd, speed)); + + if ( fd < 0 ) + { + LWIP_DEBUGF(SIO_DEBUG, ("sio_speed[%d]: fd ERROR\n", fd)); + exit( -1 ); + } + + tcgetattr( fd,&oldtio ); /* get current port settings */ + + /* set new port settings + * see 'man termios' for further settings */ + memset(&newtio, 0, sizeof(newtio)); + newtio.c_cflag = speed | CS8 | CLOCAL | CREAD; /* | CRTSCTS; */ + newtio.c_iflag = 0; + newtio.c_oflag = 0; + newtio.c_lflag = 0; /*ECHO; */ + newtio.c_cc[VMIN] = 1; /* Read 1 byte at a time, no timer */ + newtio.c_cc[VTIME] = 0; + + tcsetattr( fd,TCSANOW,&newtio ); + tcflush( fd, TCIOFLUSH ); + + LWIP_DEBUGF(SIO_DEBUG, ("sio_speed[%d]: leave\n", fd)); +} + +/* --public-functions----------------------------------------------------------------------------- */ +void sio_send( u8_t c, sio_status_t * siostat ) +{ + /* sio_status_t * siostat = ((siostruct_t*)netif->state)->sio; */ + + if ( write( siostat->fd, &c, 1 ) <= 0 ) + { + LWIP_DEBUGF(SIO_DEBUG, ("sio_send[%d]: write refused\n", siostat->fd)); + } +} + +void sio_send_string( u8_t *str, sio_status_t * siostat ) +{ + /* sio_status_t * siostat = ((siostruct_t*)netif->state)->sio; */ + int len = strlen( (const char *)str ); + + if ( write( siostat->fd, str, len ) <= 0 ) + { + LWIP_DEBUGF(SIO_DEBUG, ("sio_send_string[%d]: write refused\n", siostat->fd)); + } + LWIP_DEBUGF(SIO_DEBUG, ("sio_send_string[%d]: sent: %s\n", siostat->fd, str)); +} + + +void sio_flush( sio_status_t * siostat ) +{ + LWIP_UNUSED_ARG(siostat); + /* not implemented in unix as it is not needed */ + /*sio_status_t * siostat = ((siostruct_t*)netif->state)->sio; */ +} + + +#if ! (PPP_SUPPORT || LWIP_HAVE_SLIPIF) +/*u8_t sio_recv( struct netif * netif )*/ +u8_t sio_recv( sio_status_t * siostat ) +{ + /* sio_status_t * siostat = ((siostruct_t*)netif->state)->sio; */ + return fifoGet( &(siostat->myfifo) ); +} + +s16_t sio_poll(sio_status_t * siostat) +{ + /* sio_status_t * siostat = ((siostruct_t*)netif->state)->sio;*/ + return fifoGetNonBlock( &(siostat->myfifo) ); +} + + +void sio_expect_string( u8_t *str, sio_status_t * siostat ) +{ + /* sio_status_t * siostat = ((siostruct_t*)netif->state)->sio;*/ + u8_t c; + int finger=0; + + LWIP_DEBUGF(SIO_DEBUG, ("sio_expect_string[%d]: %s\n", siostat->fd, str)); + while ( 1 ) + { + c=fifoGet( &(siostat->myfifo) ); + LWIP_DEBUGF(SIO_DEBUG, ("_%c", c)); + if ( c==str[finger] ) + { + finger++; + } else if ( finger > 0 ) + { + /*it might fit in the beginning? */ + if ( str[0] == c ) + { + finger = 1; + } + } + if ( 0 == str[finger] ) + break; /* done, we have a match */ + } + LWIP_DEBUGF(SIO_DEBUG, ("sio_expect_string[%d]: [match]\n", siostat->fd)); +} +#endif /* ! (PPP_SUPPORT || LWIP_HAVE_SLIPIF) */ + +#if (PPP_SUPPORT || LWIP_HAVE_SLIPIF) +u32_t sio_write(sio_status_t * siostat, u8_t *buf, u32_t size) +{ + ssize_t wsz = write( siostat->fd, buf, size ); + return wsz < 0 ? 0 : wsz; +} + +u32_t sio_read(sio_status_t * siostat, u8_t *buf, u32_t size) +{ + ssize_t rsz = read( siostat->fd, buf, size ); + return rsz < 0 ? 0 : rsz; +} + +void sio_read_abort(sio_status_t * siostat) +{ + LWIP_UNUSED_ARG(siostat); + printf("sio_read_abort[%d]: not yet implemented for unix\n", siostat->fd); +} +#endif /* (PPP_SUPPORT || LWIP_HAVE_SLIPIF) */ + +sio_fd_t sio_open(u8_t devnum) +{ + char dev[20]; + + /* would be nice with dynamic memory alloc */ + sio_status_t * siostate = &statusar[ devnum ]; +/* siostruct_t * tmp; */ + + +/* tmp = (siostruct_t*)(netif->state); */ +/* tmp->sio = siostate; */ + +/* tmp = (siostruct_t*)(netif->state); */ + +/* ((sio_status_t*)(tmp->sio))->fd = 0; */ + + LWIP_DEBUGF(SIO_DEBUG, ("sio_open: for devnum %d\n", devnum)); + +#if ! (PPP_SUPPORT || LWIP_HAVE_SLIPIF) + fifoInit( &siostate->myfifo ); +#endif /* ! PPP_SUPPORT */ + + snprintf( dev, sizeof(dev), "/dev/ttyS%d", devnum ); + + if ( (devnum == 1) || (devnum == 0) ) + { + if ( ( siostate->fd = sio_init( dev, devnum, siostate ) ) == 0 ) + { + LWIP_DEBUGF(SIO_DEBUG, ("sio_open: ERROR opening serial device dev=%s\n", dev)); + abort( ); + return NULL; + } + LWIP_DEBUGF(SIO_DEBUG, ("sio_open[%d]: dev=%s open.\n", siostate->fd, dev)); + } +#if PPP_SUPPORT + else if (devnum == 2) { + pid_t childpid; + char name[256]; + childpid = forkpty(&siostate->fd, name, NULL, NULL); + if(childpid < 0) { + perror("forkpty"); + exit (1); + } + if(childpid == 0) { + execl("/usr/sbin/pppd", "pppd", + "ms-dns", "198.168.100.7", + "local", "crtscts", + "debug", +#ifdef LWIP_PPP_CHAP_TEST + "auth", + "require-chap", + "remotename", "lwip", +#else + "noauth", +#endif +#if LWIP_IPV6 + "+ipv6", +#endif + "192.168.1.1:192.168.1.2", + NULL); + perror("execl pppd"); + exit (1); + } else { + LWIP_DEBUGF(SIO_DEBUG, ("sio_open[%d]: spawned pppd pid %d on %s\n", + siostate->fd, childpid, name)); + } + + } +#endif +#if LWIP_HAVE_SLIPIF + else if (devnum == 3) { + pid_t childpid; + /* create PTY pair */ + siostate->fd = posix_openpt(O_RDWR | O_NOCTTY); + if (siostate->fd < 0) { + perror("open pty master"); + exit (1); + } + if (grantpt(siostate->fd) != 0) { + perror("grant pty master"); + exit (1); + } + if (unlockpt(siostate->fd) != 0) { + perror("unlock pty master"); + exit (1); + } + LWIP_DEBUGF(SIO_DEBUG, ("sio_open[%d]: for %s\n", + siostate->fd, ptsname(siostate->fd))); + /* fork for slattach */ + childpid = fork(); + if(childpid < 0) { + perror("fork"); + exit (1); + } + if(childpid == 0) { + /* esteblish SLIP interface on host side connected to PTY slave */ + execl("/sbin/slattach", "slattach", + "-d", "-v", "-L", "-p", "slip", + ptsname(siostate->fd), + NULL); + perror("execl slattach"); + exit (1); + } else { + int ret; + char buf[1024]; + LWIP_DEBUGF(SIO_DEBUG, ("sio_open[%d]: spawned slattach pid %d on %s\n", + siostate->fd, childpid, ptsname(siostate->fd))); + /* wait a moment for slattach startup */ + sleep(1); + /* configure SLIP interface on host side as P2P interface */ + snprintf(buf, sizeof(buf), + "/sbin/ifconfig sl0 mtu %d %s pointopoint %s up", + SLIP_MAX_SIZE, "192.168.2.1", "192.168.2.2"); + LWIP_DEBUGF(SIO_DEBUG, ("sio_open[%d]: system(\"%s\");\n", siostate->fd, buf)); + ret = system(buf); + if (ret < 0) { + perror("ifconfig failed"); + exit(1); + } + } + } +#endif /* LWIP_HAVE_SLIPIF */ + else + { + LWIP_DEBUGF(SIO_DEBUG, ("sio_open: device %s (%d) is not supported\n", dev, devnum)); + return NULL; + } + + return siostate; +} + +/** +* +*/ +void sio_change_baud( sioBaudrates baud, sio_status_t * siostat ) +{ + /* sio_status_t * siostat = ((siostruct_t*)netif->state)->sio;*/ + + LWIP_DEBUGF(SIO_DEBUG, ("sio_change_baud[%d]\n", siostat->fd)); + + switch ( baud ) + { + case SIO_BAUD_9600: + sio_speed( siostat->fd, B9600 ); + break; + case SIO_BAUD_19200: + sio_speed( siostat->fd, B19200 ); + break; + case SIO_BAUD_38400: + sio_speed( siostat->fd, B38400 ); + break; + case SIO_BAUD_57600: + sio_speed( siostat->fd, B57600 ); + break; + case SIO_BAUD_115200: + sio_speed( siostat->fd, B115200 ); + break; + + default: + LWIP_DEBUGF(SIO_DEBUG, ("sio_change_baud[%d]: Unknown baudrate, code:%d\n", + siostat->fd, baud)); + break; + } +} + diff --git a/contrib/ports/unix/port/netif/tapif.c b/contrib/ports/unix/port/netif/tapif.c new file mode 100644 index 00000000..3a717154 --- /dev/null +++ b/contrib/ports/unix/port/netif/tapif.c @@ -0,0 +1,432 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#include "lwip/opt.h" + +#include "lwip/debug.h" +#include "lwip/def.h" +#include "lwip/ip.h" +#include "lwip/mem.h" +#include "lwip/stats.h" +#include "lwip/snmp.h" +#include "lwip/pbuf.h" +#include "lwip/sys.h" +#include "lwip/timeouts.h" +#include "netif/etharp.h" +#include "lwip/ethip6.h" + +#include "netif/tapif.h" + +#define IFCONFIG_BIN "/sbin/ifconfig " + +#if defined(LWIP_UNIX_LINUX) +#include +#include +#include +/* + * Creating a tap interface requires special privileges. If the interfaces + * is created in advance with `tunctl -u ` it can be opened as a regular + * user. The network must already be configured. If DEVTAP_IF is defined it + * will be opened instead of creating a new tap device. + * + * You can also use PRECONFIGURED_TAPIF environment variable to do so. + */ +#ifndef DEVTAP_DEFAULT_IF +#define DEVTAP_DEFAULT_IF "tap0" +#endif +#ifndef DEVTAP +#define DEVTAP "/dev/net/tun" +#endif +#define NETMASK_ARGS "netmask %d.%d.%d.%d" +#define IFCONFIG_ARGS "tap0 inet %d.%d.%d.%d " NETMASK_ARGS +#elif defined(LWIP_UNIX_OPENBSD) +#define DEVTAP "/dev/tun0" +#define NETMASK_ARGS "netmask %d.%d.%d.%d" +#define IFCONFIG_ARGS "tun0 inet %d.%d.%d.%d " NETMASK_ARGS " link0" +#else /* others */ +#define DEVTAP "/dev/tap0" +#define NETMASK_ARGS "netmask %d.%d.%d.%d" +#define IFCONFIG_ARGS "tap0 inet %d.%d.%d.%d " NETMASK_ARGS +#endif + +/* Define those to better describe your network interface. */ +#define IFNAME0 't' +#define IFNAME1 'p' + +#ifndef TAPIF_DEBUG +#define TAPIF_DEBUG LWIP_DBG_OFF +#endif + +struct tapif { + /* Add whatever per-interface state that is needed here. */ + int fd; +}; + +/* Forward declarations. */ +static void tapif_input(struct netif *netif); +#if !NO_SYS +static void tapif_thread(void *arg); +#endif /* !NO_SYS */ + +/*-----------------------------------------------------------------------------------*/ +static void +low_level_init(struct netif *netif) +{ + struct tapif *tapif; +#if LWIP_IPV4 + int ret; + char buf[1024]; +#endif /* LWIP_IPV4 */ + char *preconfigured_tapif = getenv("PRECONFIGURED_TAPIF"); + + tapif = (struct tapif *)netif->state; + + /* Obtain MAC address from network interface. */ + + /* (We just fake an address...) */ + netif->hwaddr[0] = 0x02; + netif->hwaddr[1] = 0x12; + netif->hwaddr[2] = 0x34; + netif->hwaddr[3] = 0x56; + netif->hwaddr[4] = 0x78; + netif->hwaddr[5] = 0xab; + netif->hwaddr_len = 6; + + /* device capabilities */ + netif->flags = NETIF_FLAG_BROADCAST | NETIF_FLAG_ETHARP | NETIF_FLAG_IGMP; + + tapif->fd = open(DEVTAP, O_RDWR); + LWIP_DEBUGF(TAPIF_DEBUG, ("tapif_init: fd %d\n", tapif->fd)); + if (tapif->fd == -1) { +#ifdef LWIP_UNIX_LINUX + perror("tapif_init: try running \"modprobe tun\" or rebuilding your kernel with CONFIG_TUN; cannot open "DEVTAP); +#else /* LWIP_UNIX_LINUX */ + perror("tapif_init: cannot open "DEVTAP); +#endif /* LWIP_UNIX_LINUX */ + exit(1); + } + +#ifdef LWIP_UNIX_LINUX + { + struct ifreq ifr; + memset(&ifr, 0, sizeof(ifr)); + + if (preconfigured_tapif) { + strncpy(ifr.ifr_name, preconfigured_tapif, sizeof(ifr.ifr_name)); + } else { + strncpy(ifr.ifr_name, DEVTAP_DEFAULT_IF, sizeof(ifr.ifr_name)); + } + ifr.ifr_name[sizeof(ifr.ifr_name)-1] = 0; /* ensure \0 termination */ + + ifr.ifr_flags = IFF_TAP|IFF_NO_PI; + if (ioctl(tapif->fd, TUNSETIFF, (void *) &ifr) < 0) { + perror("tapif_init: "DEVTAP" ioctl TUNSETIFF"); + exit(1); + } + } +#endif /* LWIP_UNIX_LINUX */ + + netif_set_link_up(netif); + + if (preconfigured_tapif == NULL) { +#if LWIP_IPV4 + snprintf(buf, 1024, IFCONFIG_BIN IFCONFIG_ARGS, + ip4_addr1(netif_ip4_gw(netif)), + ip4_addr2(netif_ip4_gw(netif)), + ip4_addr3(netif_ip4_gw(netif)), + ip4_addr4(netif_ip4_gw(netif)) +#ifdef NETMASK_ARGS + , + ip4_addr1(netif_ip4_netmask(netif)), + ip4_addr2(netif_ip4_netmask(netif)), + ip4_addr3(netif_ip4_netmask(netif)), + ip4_addr4(netif_ip4_netmask(netif)) +#endif /* NETMASK_ARGS */ + ); + + LWIP_DEBUGF(TAPIF_DEBUG, ("tapif_init: system(\"%s\");\n", buf)); + ret = system(buf); + if (ret < 0) { + perror("ifconfig failed"); + exit(1); + } + if (ret != 0) { + printf("ifconfig returned %d\n", ret); + } +#else /* LWIP_IPV4 */ + perror("todo: support IPv6 support for non-preconfigured tapif"); + exit(1); +#endif /* LWIP_IPV4 */ + } + +#if !NO_SYS + sys_thread_new("tapif_thread", tapif_thread, netif, DEFAULT_THREAD_STACKSIZE, DEFAULT_THREAD_PRIO); +#endif /* !NO_SYS */ +} +/*-----------------------------------------------------------------------------------*/ +/* + * low_level_output(): + * + * Should do the actual transmission of the packet. The packet is + * contained in the pbuf that is passed to the function. This pbuf + * might be chained. + * + */ +/*-----------------------------------------------------------------------------------*/ + +static err_t +low_level_output(struct netif *netif, struct pbuf *p) +{ + struct tapif *tapif = (struct tapif *)netif->state; + char buf[1518]; /* max packet size including VLAN excluding CRC */ + ssize_t written; + +#if 0 + if (((double)rand()/(double)RAND_MAX) < 0.2) { + printf("drop output\n"); + return ERR_OK; /* ERR_OK because we simulate packet loss on cable */ + } +#endif + + if (p->tot_len > sizeof(buf)) { + MIB2_STATS_NETIF_INC(netif, ifoutdiscards); + perror("tapif: packet too large"); + return ERR_IF; + } + + /* initiate transfer(); */ + pbuf_copy_partial(p, buf, p->tot_len, 0); + + /* signal that packet should be sent(); */ + written = write(tapif->fd, buf, p->tot_len); + if (written < p->tot_len) { + MIB2_STATS_NETIF_INC(netif, ifoutdiscards); + perror("tapif: write"); + return ERR_IF; + } else { + MIB2_STATS_NETIF_ADD(netif, ifoutoctets, (u32_t)written); + return ERR_OK; + } +} +/*-----------------------------------------------------------------------------------*/ +/* + * low_level_input(): + * + * Should allocate a pbuf and transfer the bytes of the incoming + * packet from the interface into the pbuf. + * + */ +/*-----------------------------------------------------------------------------------*/ +static struct pbuf * +low_level_input(struct netif *netif) +{ + struct pbuf *p; + u16_t len; + ssize_t readlen; + char buf[1518]; /* max packet size including VLAN excluding CRC */ + struct tapif *tapif = (struct tapif *)netif->state; + + /* Obtain the size of the packet and put it into the "len" + variable. */ + readlen = read(tapif->fd, buf, sizeof(buf)); + if (readlen < 0) { + perror("read returned -1"); + exit(1); + } + len = (u16_t)readlen; + + MIB2_STATS_NETIF_ADD(netif, ifinoctets, len); + +#if 0 + if (((double)rand()/(double)RAND_MAX) < 0.2) { + printf("drop\n"); + return NULL; + } +#endif + + /* We allocate a pbuf chain of pbufs from the pool. */ + p = pbuf_alloc(PBUF_RAW, len, PBUF_POOL); + if (p != NULL) { + pbuf_take(p, buf, len); + /* acknowledge that packet has been read(); */ + } else { + /* drop packet(); */ + MIB2_STATS_NETIF_INC(netif, ifindiscards); + LWIP_DEBUGF(NETIF_DEBUG, ("tapif_input: could not allocate pbuf\n")); + } + + return p; +} + +/*-----------------------------------------------------------------------------------*/ +/* + * tapif_input(): + * + * This function should be called when a packet is ready to be read + * from the interface. It uses the function low_level_input() that + * should handle the actual reception of bytes from the network + * interface. + * + */ +/*-----------------------------------------------------------------------------------*/ +static void +tapif_input(struct netif *netif) +{ + struct pbuf *p = low_level_input(netif); + + if (p == NULL) { +#if LINK_STATS + LINK_STATS_INC(link.recv); +#endif /* LINK_STATS */ + LWIP_DEBUGF(TAPIF_DEBUG, ("tapif_input: low_level_input returned NULL\n")); + return; + } + + if (netif->input(p, netif) != ERR_OK) { + LWIP_DEBUGF(NETIF_DEBUG, ("tapif_input: netif input error\n")); + pbuf_free(p); + } +} +/*-----------------------------------------------------------------------------------*/ +/* + * tapif_init(): + * + * Should be called at the beginning of the program to set up the + * network interface. It calls the function low_level_init() to do the + * actual setup of the hardware. + * + */ +/*-----------------------------------------------------------------------------------*/ +err_t +tapif_init(struct netif *netif) +{ + struct tapif *tapif = (struct tapif *)mem_malloc(sizeof(struct tapif)); + + if (tapif == NULL) { + LWIP_DEBUGF(NETIF_DEBUG, ("tapif_init: out of memory for tapif\n")); + return ERR_MEM; + } + netif->state = tapif; + MIB2_INIT_NETIF(netif, snmp_ifType_other, 100000000); + + netif->name[0] = IFNAME0; + netif->name[1] = IFNAME1; +#if LWIP_IPV4 + netif->output = etharp_output; +#endif /* LWIP_IPV4 */ +#if LWIP_IPV6 + netif->output_ip6 = ethip6_output; +#endif /* LWIP_IPV6 */ + netif->linkoutput = low_level_output; + netif->mtu = 1500; + + low_level_init(netif); + + return ERR_OK; +} + + +/*-----------------------------------------------------------------------------------*/ +void +tapif_poll(struct netif *netif) +{ + tapif_input(netif); +} + +#if NO_SYS + +int +tapif_select(struct netif *netif) +{ + fd_set fdset; + int ret; + struct timeval tv; + struct tapif *tapif; + u32_t msecs = sys_timeouts_sleeptime(); + + tapif = (struct tapif *)netif->state; + + tv.tv_sec = msecs / 1000; + tv.tv_usec = (msecs % 1000) * 1000; + + FD_ZERO(&fdset); + FD_SET(tapif->fd, &fdset); + + ret = select(tapif->fd + 1, &fdset, NULL, NULL, &tv); + if (ret > 0) { + tapif_input(netif); + } + return ret; +} + +#else /* NO_SYS */ + +static void +tapif_thread(void *arg) +{ + struct netif *netif; + struct tapif *tapif; + fd_set fdset; + int ret; + + netif = (struct netif *)arg; + tapif = (struct tapif *)netif->state; + + while(1) { + FD_ZERO(&fdset); + FD_SET(tapif->fd, &fdset); + + /* Wait for a packet to arrive. */ + ret = select(tapif->fd + 1, &fdset, NULL, NULL, NULL); + + if(ret == 1) { + /* Handle incoming packet. */ + tapif_input(netif); + } else if(ret == -1) { + perror("tapif_thread: select"); + } + } +} + +#endif /* NO_SYS */ diff --git a/contrib/ports/unix/port/perf.c b/contrib/ports/unix/port/perf.c new file mode 100644 index 00000000..bed4614a --- /dev/null +++ b/contrib/ports/unix/port/perf.c @@ -0,0 +1,65 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +#include "arch/perf.h" + +#include + +static FILE *f; + +void +perf_print(unsigned long c1l, unsigned long c1h, + unsigned long c2l, unsigned long c2h, + char *key) +{ + unsigned long sub_ms, sub_ls; + + sub_ms = c2h - c1h; + sub_ls = c2l - c1l; + if (c2l < c1l) sub_ms--; + fprintf(f, "%s: %.8lu%.8lu\n", key, sub_ms, sub_ls); + fflush(NULL); +} + +void +perf_print_times(struct tms *start, struct tms *end, char *key) +{ + fprintf(f, "%s: %lu\n", key, end->tms_stime - start->tms_stime); + fflush(NULL); +} + +void +perf_init(char *fname) +{ + f = fopen(fname, "w"); +} + diff --git a/contrib/ports/unix/port/sys_arch.c b/contrib/ports/unix/port/sys_arch.c new file mode 100644 index 00000000..33365399 --- /dev/null +++ b/contrib/ports/unix/port/sys_arch.c @@ -0,0 +1,719 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +/* + * Wed Apr 17 16:05:29 EDT 2002 (James Roth) + * + * - Fixed an unlikely sys_thread_new() race condition. + * + * - Made current_thread() work with threads which where + * not created with sys_thread_new(). This includes + * the main thread and threads made with pthread_create(). + * + * - Catch overflows where more than SYS_MBOX_SIZE messages + * are waiting to be read. The sys_mbox_post() routine + * will block until there is more room instead of just + * leaking messages. + */ +#include "lwip/debug.h" + +#include +#include +#include +#include +#include +#include +#include + +#include "lwip/def.h" + +#ifdef LWIP_UNIX_MACH +#include +#include +#endif + +#include "lwip/sys.h" +#include "lwip/opt.h" +#include "lwip/stats.h" +#include "lwip/tcpip.h" + +static void +get_monotonic_time(struct timespec *ts) +{ +#ifdef LWIP_UNIX_MACH + /* darwin impl (no CLOCK_MONOTONIC) */ + uint64_t t = mach_absolute_time(); + mach_timebase_info_data_t timebase_info = {0, 0}; + mach_timebase_info(&timebase_info); + uint64_t nano = (t * timebase_info.numer) / (timebase_info.denom); + uint64_t sec = nano/1000000000L; + nano -= sec * 1000000000L; + ts->tv_sec = sec; + ts->tv_nsec = nano; +#else + clock_gettime(CLOCK_MONOTONIC, ts); +#endif +} + +#if SYS_LIGHTWEIGHT_PROT +static pthread_mutex_t lwprot_mutex = PTHREAD_MUTEX_INITIALIZER; +static pthread_t lwprot_thread = (pthread_t)0xDEAD; +static int lwprot_count = 0; +#endif /* SYS_LIGHTWEIGHT_PROT */ + +#if !NO_SYS + +static struct sys_thread *threads = NULL; +static pthread_mutex_t threads_mutex = PTHREAD_MUTEX_INITIALIZER; + +struct sys_mbox_msg { + struct sys_mbox_msg *next; + void *msg; +}; + +#define SYS_MBOX_SIZE 128 + +struct sys_mbox { + int first, last; + void *msgs[SYS_MBOX_SIZE]; + struct sys_sem *not_empty; + struct sys_sem *not_full; + struct sys_sem *mutex; + int wait_send; +}; + +struct sys_sem { + unsigned int c; + pthread_condattr_t condattr; + pthread_cond_t cond; + pthread_mutex_t mutex; +}; + +struct sys_mutex { + pthread_mutex_t mutex; +}; + +struct sys_thread { + struct sys_thread *next; + pthread_t pthread; +}; + +static struct sys_sem *sys_sem_new_internal(u8_t count); +static void sys_sem_free_internal(struct sys_sem *sem); + +static u32_t cond_wait(pthread_cond_t * cond, pthread_mutex_t * mutex, + u32_t timeout); + +/*-----------------------------------------------------------------------------------*/ +/* Threads */ +static struct sys_thread * +introduce_thread(pthread_t id) +{ + struct sys_thread *thread; + + thread = (struct sys_thread *)malloc(sizeof(struct sys_thread)); + + if (thread != NULL) { + pthread_mutex_lock(&threads_mutex); + thread->next = threads; + thread->pthread = id; + threads = thread; + pthread_mutex_unlock(&threads_mutex); + } + + return thread; +} + +struct thread_wrapper_data +{ + lwip_thread_fn function; + void *arg; +}; + +static void * +thread_wrapper(void *arg) +{ + struct thread_wrapper_data *thread_data = (struct thread_wrapper_data *)arg; + + thread_data->function(thread_data->arg); + + /* we should never get here */ + free(arg); + return NULL; +} + +sys_thread_t +sys_thread_new(const char *name, lwip_thread_fn function, void *arg, int stacksize, int prio) +{ + int code; + pthread_t tmp; + struct sys_thread *st = NULL; + struct thread_wrapper_data *thread_data; + LWIP_UNUSED_ARG(name); + LWIP_UNUSED_ARG(stacksize); + LWIP_UNUSED_ARG(prio); + + thread_data = (struct thread_wrapper_data *)malloc(sizeof(struct thread_wrapper_data)); + thread_data->arg = arg; + thread_data->function = function; + code = pthread_create(&tmp, + NULL, + thread_wrapper, + thread_data); + + if (0 == code) { + st = introduce_thread(tmp); + } + + if (NULL == st) { + LWIP_DEBUGF(SYS_DEBUG, ("sys_thread_new: pthread_create %d, st = 0x%lx", + code, (unsigned long)st)); + abort(); + } + return st; +} + +#if LWIP_TCPIP_CORE_LOCKING +static pthread_t lwip_core_lock_holder_thread_id; +void sys_lock_tcpip_core(void) +{ + sys_mutex_lock(&lock_tcpip_core); + lwip_core_lock_holder_thread_id = pthread_self(); +} + +void sys_unlock_tcpip_core(void) +{ + lwip_core_lock_holder_thread_id = 0; + sys_mutex_unlock(&lock_tcpip_core); +} +#endif /* LWIP_TCPIP_CORE_LOCKING */ + +static pthread_t lwip_tcpip_thread_id; +void sys_mark_tcpip_thread(void) +{ + lwip_tcpip_thread_id = pthread_self(); +} + +void sys_check_core_locking(void) +{ + /* Embedded systems should check we are NOT in an interrupt context here */ + + if (lwip_tcpip_thread_id != 0) { + pthread_t current_thread_id = pthread_self(); + +#if LWIP_TCPIP_CORE_LOCKING + LWIP_ASSERT("Function called without core lock", current_thread_id == lwip_core_lock_holder_thread_id); +#else /* LWIP_TCPIP_CORE_LOCKING */ + LWIP_ASSERT("Function called from wrong thread", current_thread_id == lwip_tcpip_thread_id); +#endif /* LWIP_TCPIP_CORE_LOCKING */ + } +} + +/*-----------------------------------------------------------------------------------*/ +/* Mailbox */ +err_t +sys_mbox_new(struct sys_mbox **mb, int size) +{ + struct sys_mbox *mbox; + LWIP_UNUSED_ARG(size); + + mbox = (struct sys_mbox *)malloc(sizeof(struct sys_mbox)); + if (mbox == NULL) { + return ERR_MEM; + } + mbox->first = mbox->last = 0; + mbox->not_empty = sys_sem_new_internal(0); + mbox->not_full = sys_sem_new_internal(0); + mbox->mutex = sys_sem_new_internal(1); + mbox->wait_send = 0; + + SYS_STATS_INC_USED(mbox); + *mb = mbox; + return ERR_OK; +} + +void +sys_mbox_free(struct sys_mbox **mb) +{ + if ((mb != NULL) && (*mb != SYS_MBOX_NULL)) { + struct sys_mbox *mbox = *mb; + SYS_STATS_DEC(mbox.used); + sys_arch_sem_wait(&mbox->mutex, 0); + + sys_sem_free_internal(mbox->not_empty); + sys_sem_free_internal(mbox->not_full); + sys_sem_free_internal(mbox->mutex); + mbox->not_empty = mbox->not_full = mbox->mutex = NULL; + /* LWIP_DEBUGF("sys_mbox_free: mbox 0x%lx\n", mbox); */ + free(mbox); + } +} + +err_t +sys_mbox_trypost(struct sys_mbox **mb, void *msg) +{ + u8_t first; + struct sys_mbox *mbox; + LWIP_ASSERT("invalid mbox", (mb != NULL) && (*mb != NULL)); + mbox = *mb; + + sys_arch_sem_wait(&mbox->mutex, 0); + + LWIP_DEBUGF(SYS_DEBUG, ("sys_mbox_trypost: mbox %p msg %p\n", + (void *)mbox, (void *)msg)); + + if ((mbox->last + 1) >= (mbox->first + SYS_MBOX_SIZE)) { + sys_sem_signal(&mbox->mutex); + return ERR_MEM; + } + + mbox->msgs[mbox->last % SYS_MBOX_SIZE] = msg; + + if (mbox->last == mbox->first) { + first = 1; + } else { + first = 0; + } + + mbox->last++; + + if (first) { + sys_sem_signal(&mbox->not_empty); + } + + sys_sem_signal(&mbox->mutex); + + return ERR_OK; +} + +err_t +sys_mbox_trypost_fromisr(sys_mbox_t *q, void *msg) +{ + return sys_mbox_trypost(q, msg); +} + +void +sys_mbox_post(struct sys_mbox **mb, void *msg) +{ + u8_t first; + struct sys_mbox *mbox; + LWIP_ASSERT("invalid mbox", (mb != NULL) && (*mb != NULL)); + mbox = *mb; + + sys_arch_sem_wait(&mbox->mutex, 0); + + LWIP_DEBUGF(SYS_DEBUG, ("sys_mbox_post: mbox %p msg %p\n", (void *)mbox, (void *)msg)); + + while ((mbox->last + 1) >= (mbox->first + SYS_MBOX_SIZE)) { + mbox->wait_send++; + sys_sem_signal(&mbox->mutex); + sys_arch_sem_wait(&mbox->not_full, 0); + sys_arch_sem_wait(&mbox->mutex, 0); + mbox->wait_send--; + } + + mbox->msgs[mbox->last % SYS_MBOX_SIZE] = msg; + + if (mbox->last == mbox->first) { + first = 1; + } else { + first = 0; + } + + mbox->last++; + + if (first) { + sys_sem_signal(&mbox->not_empty); + } + + sys_sem_signal(&mbox->mutex); +} + +u32_t +sys_arch_mbox_tryfetch(struct sys_mbox **mb, void **msg) +{ + struct sys_mbox *mbox; + LWIP_ASSERT("invalid mbox", (mb != NULL) && (*mb != NULL)); + mbox = *mb; + + sys_arch_sem_wait(&mbox->mutex, 0); + + if (mbox->first == mbox->last) { + sys_sem_signal(&mbox->mutex); + return SYS_MBOX_EMPTY; + } + + if (msg != NULL) { + LWIP_DEBUGF(SYS_DEBUG, ("sys_mbox_tryfetch: mbox %p msg %p\n", (void *)mbox, *msg)); + *msg = mbox->msgs[mbox->first % SYS_MBOX_SIZE]; + } + else{ + LWIP_DEBUGF(SYS_DEBUG, ("sys_mbox_tryfetch: mbox %p, null msg\n", (void *)mbox)); + } + + mbox->first++; + + if (mbox->wait_send) { + sys_sem_signal(&mbox->not_full); + } + + sys_sem_signal(&mbox->mutex); + + return 0; +} + +u32_t +sys_arch_mbox_fetch(struct sys_mbox **mb, void **msg, u32_t timeout) +{ + u32_t time_needed = 0; + struct sys_mbox *mbox; + LWIP_ASSERT("invalid mbox", (mb != NULL) && (*mb != NULL)); + mbox = *mb; + + /* The mutex lock is quick so we don't bother with the timeout + stuff here. */ + sys_arch_sem_wait(&mbox->mutex, 0); + + while (mbox->first == mbox->last) { + sys_sem_signal(&mbox->mutex); + + /* We block while waiting for a mail to arrive in the mailbox. We + must be prepared to timeout. */ + if (timeout != 0) { + time_needed = sys_arch_sem_wait(&mbox->not_empty, timeout); + + if (time_needed == SYS_ARCH_TIMEOUT) { + return SYS_ARCH_TIMEOUT; + } + } else { + sys_arch_sem_wait(&mbox->not_empty, 0); + } + + sys_arch_sem_wait(&mbox->mutex, 0); + } + + if (msg != NULL) { + LWIP_DEBUGF(SYS_DEBUG, ("sys_mbox_fetch: mbox %p msg %p\n", (void *)mbox, *msg)); + *msg = mbox->msgs[mbox->first % SYS_MBOX_SIZE]; + } + else{ + LWIP_DEBUGF(SYS_DEBUG, ("sys_mbox_fetch: mbox %p, null msg\n", (void *)mbox)); + } + + mbox->first++; + + if (mbox->wait_send) { + sys_sem_signal(&mbox->not_full); + } + + sys_sem_signal(&mbox->mutex); + + return time_needed; +} + +/*-----------------------------------------------------------------------------------*/ +/* Semaphore */ +static struct sys_sem * +sys_sem_new_internal(u8_t count) +{ + struct sys_sem *sem; + + sem = (struct sys_sem *)malloc(sizeof(struct sys_sem)); + if (sem != NULL) { + sem->c = count; + pthread_condattr_init(&(sem->condattr)); +#if !(defined(LWIP_UNIX_MACH) || (defined(LWIP_UNIX_ANDROID) && __ANDROID_API__ < 21)) + pthread_condattr_setclock(&(sem->condattr), CLOCK_MONOTONIC); +#endif + pthread_cond_init(&(sem->cond), &(sem->condattr)); + pthread_mutex_init(&(sem->mutex), NULL); + } + return sem; +} + +err_t +sys_sem_new(struct sys_sem **sem, u8_t count) +{ + SYS_STATS_INC_USED(sem); + *sem = sys_sem_new_internal(count); + if (*sem == NULL) { + return ERR_MEM; + } + return ERR_OK; +} + +static u32_t +cond_wait(pthread_cond_t *cond, pthread_mutex_t *mutex, u32_t timeout) +{ + struct timespec rtime1, rtime2, ts; + int ret; + +#ifdef __GNU__ + #define pthread_cond_wait pthread_hurd_cond_wait_np + #define pthread_cond_timedwait pthread_hurd_cond_timedwait_np +#endif + + if (timeout == 0) { + pthread_cond_wait(cond, mutex); + return 0; + } + + /* Get a timestamp and add the timeout value. */ + get_monotonic_time(&rtime1); +#if defined(LWIP_UNIX_MACH) || (defined(LWIP_UNIX_ANDROID) && __ANDROID_API__ < 21) + ts.tv_sec = timeout / 1000L; + ts.tv_nsec = (timeout % 1000L) * 1000000L; + ret = pthread_cond_timedwait_relative_np(cond, mutex, &ts); +#else + ts.tv_sec = rtime1.tv_sec + timeout / 1000L; + ts.tv_nsec = rtime1.tv_nsec + (timeout % 1000L) * 1000000L; + if (ts.tv_nsec >= 1000000000L) { + ts.tv_sec++; + ts.tv_nsec -= 1000000000L; + } + + ret = pthread_cond_timedwait(cond, mutex, &ts); +#endif + if (ret == ETIMEDOUT) { + return SYS_ARCH_TIMEOUT; + } + + /* Calculate for how long we waited for the cond. */ + get_monotonic_time(&rtime2); + ts.tv_sec = rtime2.tv_sec - rtime1.tv_sec; + ts.tv_nsec = rtime2.tv_nsec - rtime1.tv_nsec; + if (ts.tv_nsec < 0) { + ts.tv_sec--; + ts.tv_nsec += 1000000000L; + } + return (u32_t)(ts.tv_sec * 1000L + ts.tv_nsec / 1000000L); +} + +u32_t +sys_arch_sem_wait(struct sys_sem **s, u32_t timeout) +{ + u32_t time_needed = 0; + struct sys_sem *sem; + LWIP_ASSERT("invalid sem", (s != NULL) && (*s != NULL)); + sem = *s; + + pthread_mutex_lock(&(sem->mutex)); + while (sem->c <= 0) { + if (timeout > 0) { + time_needed = cond_wait(&(sem->cond), &(sem->mutex), timeout); + + if (time_needed == SYS_ARCH_TIMEOUT) { + pthread_mutex_unlock(&(sem->mutex)); + return SYS_ARCH_TIMEOUT; + } + /* pthread_mutex_unlock(&(sem->mutex)); + return time_needed; */ + } else { + cond_wait(&(sem->cond), &(sem->mutex), 0); + } + } + sem->c--; + pthread_mutex_unlock(&(sem->mutex)); + return (u32_t)time_needed; +} + +void +sys_sem_signal(struct sys_sem **s) +{ + struct sys_sem *sem; + LWIP_ASSERT("invalid sem", (s != NULL) && (*s != NULL)); + sem = *s; + + pthread_mutex_lock(&(sem->mutex)); + sem->c++; + + if (sem->c > 1) { + sem->c = 1; + } + + pthread_cond_broadcast(&(sem->cond)); + pthread_mutex_unlock(&(sem->mutex)); +} + +static void +sys_sem_free_internal(struct sys_sem *sem) +{ + pthread_cond_destroy(&(sem->cond)); + pthread_condattr_destroy(&(sem->condattr)); + pthread_mutex_destroy(&(sem->mutex)); + free(sem); +} + +void +sys_sem_free(struct sys_sem **sem) +{ + if ((sem != NULL) && (*sem != SYS_SEM_NULL)) { + SYS_STATS_DEC(sem.used); + sys_sem_free_internal(*sem); + } +} + +/*-----------------------------------------------------------------------------------*/ +/* Mutex */ +/** Create a new mutex + * @param mutex pointer to the mutex to create + * @return a new mutex */ +err_t +sys_mutex_new(struct sys_mutex **mutex) +{ + struct sys_mutex *mtx; + + mtx = (struct sys_mutex *)malloc(sizeof(struct sys_mutex)); + if (mtx != NULL) { + pthread_mutex_init(&(mtx->mutex), NULL); + *mutex = mtx; + return ERR_OK; + } + else { + return ERR_MEM; + } +} + +/** Lock a mutex + * @param mutex the mutex to lock */ +void +sys_mutex_lock(struct sys_mutex **mutex) +{ + pthread_mutex_lock(&((*mutex)->mutex)); +} + +/** Unlock a mutex + * @param mutex the mutex to unlock */ +void +sys_mutex_unlock(struct sys_mutex **mutex) +{ + pthread_mutex_unlock(&((*mutex)->mutex)); +} + +/** Delete a mutex + * @param mutex the mutex to delete */ +void +sys_mutex_free(struct sys_mutex **mutex) +{ + pthread_mutex_destroy(&((*mutex)->mutex)); + free(*mutex); +} + +#endif /* !NO_SYS */ + +/*-----------------------------------------------------------------------------------*/ +/* Time */ +u32_t +sys_now(void) +{ + struct timespec ts; + + get_monotonic_time(&ts); + return (u32_t)(ts.tv_sec * 1000L + ts.tv_nsec / 1000000L); +} + +u32_t +sys_jiffies(void) +{ + struct timespec ts; + + get_monotonic_time(&ts); + return (u32_t)(ts.tv_sec * 1000000000L + ts.tv_nsec); +} + +/*-----------------------------------------------------------------------------------*/ +/* Init */ + +void +sys_init(void) +{ +} + +/*-----------------------------------------------------------------------------------*/ +/* Critical section */ +#if SYS_LIGHTWEIGHT_PROT +/** sys_prot_t sys_arch_protect(void) + +This optional function does a "fast" critical region protection and returns +the previous protection level. This function is only called during very short +critical regions. An embedded system which supports ISR-based drivers might +want to implement this function by disabling interrupts. Task-based systems +might want to implement this by using a mutex or disabling tasking. This +function should support recursive calls from the same task or interrupt. In +other words, sys_arch_protect() could be called while already protected. In +that case the return value indicates that it is already protected. + +sys_arch_protect() is only required if your port is supporting an operating +system. +*/ +sys_prot_t +sys_arch_protect(void) +{ + /* Note that for the UNIX port, we are using a lightweight mutex, and our + * own counter (which is locked by the mutex). The return code is not actually + * used. */ + if (lwprot_thread != pthread_self()) + { + /* We are locking the mutex where it has not been locked before * + * or is being locked by another thread */ + pthread_mutex_lock(&lwprot_mutex); + lwprot_thread = pthread_self(); + lwprot_count = 1; + } + else + /* It is already locked by THIS thread */ + lwprot_count++; + return 0; +} + +/** void sys_arch_unprotect(sys_prot_t pval) + +This optional function does a "fast" set of critical region protection to the +value specified by pval. See the documentation for sys_arch_protect() for +more information. This function is only required if your port is supporting +an operating system. +*/ +void +sys_arch_unprotect(sys_prot_t pval) +{ + LWIP_UNUSED_ARG(pval); + if (lwprot_thread == pthread_self()) + { + lwprot_count--; + if (lwprot_count == 0) + { + lwprot_thread = (pthread_t) 0xDEAD; + pthread_mutex_unlock(&lwprot_mutex); + } + } +} +#endif /* SYS_LIGHTWEIGHT_PROT */ diff --git a/contrib/ports/unix/setup-tapif b/contrib/ports/unix/setup-tapif new file mode 100644 index 00000000..3846e966 --- /dev/null +++ b/contrib/ports/unix/setup-tapif @@ -0,0 +1,15 @@ +#!/bin/bash + +# Run me using "source setup-tapif" to get exported PRECONFIGURED_TAPIF variable +# Alternatively, add "export PRECONFIGURED_TAPIF=tap0" to ~/.bashrc + +# http://backreference.org/2010/03/26/tuntap-interface-tutorial/ + +# After executing this script, start unixsim/simhost. +# Enter 192.168.0.2 or "http://simhost.local/" (Zeroconf) +# in your webbrowser to see simhost webpage. + +sudo ip tuntap add dev tap0 mode tap user `whoami` +sudo ip link set tap0 up +sudo ip addr add 192.168.0.1/24 dev tap0 +export PRECONFIGURED_TAPIF=tap0 diff --git a/contrib/ports/win32/Common.mk b/contrib/ports/win32/Common.mk new file mode 100644 index 00000000..22601621 --- /dev/null +++ b/contrib/ports/win32/Common.mk @@ -0,0 +1,51 @@ +# +# Copyright (c) 2001, 2002 Swedish Institute of Computer Science. +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without modification, +# are permitted provided that the following conditions are met: +# +# 1. Redistributions of source code must retain the above copyright notice, +# this list of conditions and the following disclaimer. +# 2. Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# 3. The name of the author may not be used to endorse or promote products +# derived from this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED +# WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +# MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT +# SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +# EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT +# OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING +# IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY +# OF SUCH DAMAGE. +# +# This file is part of the lwIP TCP/IP stack. +# +# Author: Adam Dunkels +# + +CC=gcc + +# Architecture specific files. +LWIPARCH?=$(CONTRIBDIR)/ports/win32 +SYSARCH?=$(LWIPARCH)/sys_arch.c +ARCHFILES=$(SYSARCH) $(LWIPARCH)/pcapif.c \ + $(LWIPARCH)/pcapif_helper.c $(LWIPARCH)/sio.c + +WIN32_COMMON_MK_DIR := $(dir $(abspath $(lastword $(MAKEFILE_LIST)))) +include $(WIN32_COMMON_MK_DIR)/../Common.allports.mk + +PCAPDIR=$(PCAP_DIR)/Include +LDFLAGS+=-L$(PCAP_DIR)/lib -lwpcap -lpacket +# -Wno-format: GCC complains about non-standard 64 bit modifier needed for MSVC runtime +CFLAGS+=-I$(PCAPDIR) -Wno-format + +pcapif.o: + $(CC) $(CFLAGS) -Wno-error -Wno-redundant-decls -c $(<:.o=.c) +pcapif_helper.o: + $(CC) $(CFLAGS) -std=c99 -Wno-redundant-decls -c $(<:.o=.c) diff --git a/contrib/ports/win32/Filelists.cmake b/contrib/ports/win32/Filelists.cmake new file mode 100644 index 00000000..26c70eaa --- /dev/null +++ b/contrib/ports/win32/Filelists.cmake @@ -0,0 +1,27 @@ +# This file is indended to be included in end-user CMakeLists.txt +# include(/path/to/Filelists.cmake) +# It assumes the variable LWIP_CONTRIB_DIR is defined pointing to the +# root path of lwIP contrib sources. +# +# This file is NOT designed (on purpose) to be used as cmake +# subdir via add_subdirectory() +# The intention is to provide greater flexibility to users to +# create their own targets using the *_SRCS variables. + +set(lwipcontribportwindows_SRCS + ${LWIP_CONTRIB_DIR}/ports/win32/sys_arch.c + ${LWIP_CONTRIB_DIR}/ports/win32/sio.c + ${LWIP_CONTRIB_DIR}/ports/win32/pcapif.c + ${LWIP_CONTRIB_DIR}/ports/win32/pcapif_helper.c +) + +# pcapif needs WinPcap developer package: https://www.winpcap.org/devel.htm +set(WPDPACK_DIR ${LWIP_CONTRIB_DIR}/../WpdPack) +find_library(WPCAP wpcap HINTS ${WPDPACK_DIR}/lib) +find_library(PACKET packet HINTS ${WPDPACK_DIR}/lib) + +add_library(lwipcontribportwindows EXCLUDE_FROM_ALL ${lwipcontribportwindows_SRCS}) +target_include_directories(lwipcontribportwindows PRIVATE ${LWIP_INCLUDE_DIRS} "${WPDPACK_DIR}/include" ${LWIP_MBEDTLS_INCLUDE_DIRS}) +target_compile_options(lwipcontribportwindows PRIVATE ${LWIP_COMPILER_FLAGS}) +target_compile_definitions(lwipcontribaddons PRIVATE ${LWIP_DEFINITIONS} ${LWIP_MBEDTLS_DEFINITIONS}) +target_link_libraries(lwipcontribportwindows PUBLIC ${WPCAP} ${PACKET} ${LWIP_MBEDTLS_LINK_LIBRARIES}) diff --git a/contrib/ports/win32/check/check_stdint.h b/contrib/ports/win32/check/check_stdint.h new file mode 100644 index 00000000..c2c100d5 --- /dev/null +++ b/contrib/ports/win32/check/check_stdint.h @@ -0,0 +1 @@ +/* deliberateliy empty */ diff --git a/contrib/ports/win32/check/config.h b/contrib/ports/win32/check/config.h new file mode 100644 index 00000000..69c04f9b --- /dev/null +++ b/contrib/ports/win32/check/config.h @@ -0,0 +1,30 @@ +/* config.h for check-0.11.0 on win32 under MSVC/MinGW */ + +#ifdef _MSC_VER + +typedef unsigned int pid_t; +typedef unsigned int uint32_t; + +typedef int ssize_t; +#define snprintf _snprintf + +#define HAVE_DECL_STRDUP 1 +#define HAVE_DECL_FILENO 1 +#define HAVE_DECL_PUTENV 1 + +#define _CRT_SECURE_NO_WARNINGS + +/* disable some warnings */ +#pragma warning (disable: 4090) /* const assigned to non-const */ +#pragma warning (disable: 4996) /* fileno is deprecated */ + +#endif /* _ MSC_VER */ + + +#define LWIP_UNITTESTS_NOFORK + +#include + +typedef unsigned int clockid_t; +typedef unsigned int timer_t; +#define STRUCT_TIMESPEC_DEFINITION_MISSING diff --git a/contrib/ports/win32/check/stdbool.h b/contrib/ports/win32/check/stdbool.h new file mode 100644 index 00000000..aa4e74c9 --- /dev/null +++ b/contrib/ports/win32/check/stdbool.h @@ -0,0 +1,9 @@ +#ifndef MY_STDBOOL_H +#define MY_STDBOOL_H + +typedef int bool; +#define true 1 +#define false 0 +#define __bool_true_false_are_defined 1 + +#endif \ No newline at end of file diff --git a/contrib/ports/win32/check/sys/time.h b/contrib/ports/win32/check/sys/time.h new file mode 100644 index 00000000..d71d827d --- /dev/null +++ b/contrib/ports/win32/check/sys/time.h @@ -0,0 +1,12 @@ +#ifndef LWIP_SYS__TIME_H +#define LWIP_SYS__TIME_H + +#include /* time_t */ + +struct timeval { + time_t tv_sec; /* seconds */ + long tv_usec; /* and microseconds */ +}; +int gettimeofday(struct timeval* tp, void* tzp); + +#endif diff --git a/contrib/ports/win32/check/time.c b/contrib/ports/win32/check/time.c new file mode 100644 index 00000000..bd7d6bd8 --- /dev/null +++ b/contrib/ports/win32/check/time.c @@ -0,0 +1,66 @@ +#include + +#include +#if defined(_MSC_VER) || defined(_MSC_EXTENSIONS) + #define DELTA_EPOCH_IN_MICROSECS 11644473600000000Ui64 +#else + #define DELTA_EPOCH_IN_MICROSECS 11644473600000000ULL +#endif + +#include "config.h" + +struct timezone +{ + int tz_minuteswest; /* minutes W of Greenwich */ + int tz_dsttime; /* type of dst correction */ +}; + +int gettimeofday(struct timeval *tv, struct timezone *tz) +{ + FILETIME ft; + unsigned __int64 tmpres = 0; + static int tzflag; + + if (NULL != tv) { + GetSystemTimeAsFileTime(&ft); + + tmpres |= ft.dwHighDateTime; + tmpres <<= 32; + tmpres |= ft.dwLowDateTime; + + /*converting file time to unix epoch*/ + tmpres -= DELTA_EPOCH_IN_MICROSECS; + tmpres /= 10; /*convert into microseconds*/ + tv->tv_sec = (long)(tmpres / 1000000UL); + tv->tv_usec = (long)(tmpres % 1000000UL); + } + + if (NULL != tz) { + if (!tzflag) { + _tzset(); + tzflag++; + } + tz->tz_minuteswest = _timezone / 60; + tz->tz_dsttime = _daylight; + } + + return 0; +} + +struct tm * +localtime_r(const time_t *timer, struct tm *result) +{ + struct tm *local_result; + + if (result == NULL) { + return NULL; + } + + local_result = localtime (timer); + if (local_result == NULL) { + return NULL; + } + + memcpy(result, local_result, sizeof(*result)); + return result; +} diff --git a/contrib/ports/win32/check/unistd.h b/contrib/ports/win32/check/unistd.h new file mode 100644 index 00000000..332e6e12 --- /dev/null +++ b/contrib/ports/win32/check/unistd.h @@ -0,0 +1,7 @@ +#ifndef LWIP_UNISTD_H +#define LWIP_UNISTD_H + +/* include io.h for read() and write() */ +#include + +#endif diff --git a/contrib/ports/win32/example_app/CMakeLists.txt b/contrib/ports/win32/example_app/CMakeLists.txt new file mode 100644 index 00000000..4a91052c --- /dev/null +++ b/contrib/ports/win32/example_app/CMakeLists.txt @@ -0,0 +1,33 @@ +cmake_minimum_required(VERSION 3.8) + +project(example_app C) + +set (CMAKE_EXPORT_COMPILE_COMMANDS ON) + +set(LWIP_CONTRIB_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../../..) +set(LWIP_DIR ${CMAKE_CURRENT_SOURCE_DIR}/../../../../lwip) + +include(${LWIP_CONTRIB_DIR}/ports/CMakeCommon.cmake) + +set (LWIP_DEFINITIONS -DLWIP_DEBUG) +set (LWIP_INCLUDE_DIRS + "${LWIP_DIR}/src/include" + "${LWIP_CONTRIB_DIR}/" + "${LWIP_CONTRIB_DIR}/ports/win32/include" + "${LWIP_CONTRIB_DIR}/examples/example_app" +) + +include(${LWIP_DIR}/src/Filelists.cmake) +include(${LWIP_CONTRIB_DIR}/Filelists.cmake) +include(${LWIP_CONTRIB_DIR}/ports/win32/Filelists.cmake) + +add_executable(example_app ${LWIP_CONTRIB_DIR}/examples/example_app/test.c default_netif.c) +target_include_directories(example_app PRIVATE ${LWIP_INCLUDE_DIRS}) +target_compile_options(example_app PRIVATE ${LWIP_COMPILER_FLAGS}) +target_compile_definitions(example_app PRIVATE ${LWIP_DEFINITIONS} ${LWIP_MBEDTLS_DEFINITIONS}) +target_link_libraries(example_app ${LWIP_SANITIZER_LIBS} lwipcontribexamples lwipcontribapps lwipcontribaddons lwipallapps lwipcore lwipcontribportwindows) + +add_executable(makefsdata ${lwipmakefsdata_SRCS}) +target_compile_options(makefsdata PRIVATE ${LWIP_COMPILER_FLAGS}) +target_include_directories(makefsdata PRIVATE ${LWIP_INCLUDE_DIRS}) +target_link_libraries(makefsdata ${LWIP_SANITIZER_LIBS} lwipcore lwipcontribportwindows) diff --git a/contrib/ports/win32/example_app/Makefile b/contrib/ports/win32/example_app/Makefile new file mode 100644 index 00000000..452af7a9 --- /dev/null +++ b/contrib/ports/win32/example_app/Makefile @@ -0,0 +1,55 @@ +# +# Copyright (c) 2001, 2002 Swedish Institute of Computer Science. +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without modification, +# are permitted provided that the following conditions are met: +# +# 1. Redistributions of source code must retain the above copyright notice, +# this list of conditions and the following disclaimer. +# 2. Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# 3. The name of the author may not be used to endorse or promote products +# derived from this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED +# WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +# MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT +# SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +# EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT +# OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING +# IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY +# OF SUCH DAMAGE. +# +# This file is part of the lwIP TCP/IP stack. +# +# Author: Adam Dunkels +# + +all compile: example_app makefsdata +.PHONY: all + +include ../Common.mk + +CFLAGS+=-I$(CONTRIBDIR)/examples/example_app + +MAKEFSDATAOBJS=$(notdir $(MAKEFSDATAFILES:.c=.o)) + +clean: + cmd /c del /q *.o $(LWIPLIBCOMMON) $(APPLIB) test.exe *.s .depend* *.map + +depend dep: .depend + +include .depend + +.depend: $(CONTRIBDIR)/examples/example_app/test.c default_netif.c $(LWIPFILES) $(APPFILES) $(MAKEFSDATAFILES) + $(CCDEP) $(CFLAGS) -MM $^ > .depend || cmd /c del .depend + +example_app: .depend $(LWIPLIBCOMMON) $(APPLIB) default_netif.o test.o + $(CC) $(CFLAGS) -o example_app test.o default_netif.o -Wl,--start-group $(APPLIB) $(LWIPLIBCOMMON) -Wl,--end-group $(LDFLAGS) -Xlinker -Map=test.map + +makefsdata: .depend $(MAKEFSDATAOBJS) + $(CC) $(CFLAGS) -o makefsdata $(MAKEFSDATAOBJS) diff --git a/contrib/ports/win32/example_app/default_netif.c b/contrib/ports/win32/example_app/default_netif.c new file mode 100644 index 00000000..b5a86dee --- /dev/null +++ b/contrib/ports/win32/example_app/default_netif.c @@ -0,0 +1,79 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ + +#include "lwip/opt.h" + +#include "lwip/netif.h" +#include "lwip/ip_addr.h" +#include "lwip/tcpip.h" +#include "../pcapif.h" +#include "examples/example_app/default_netif.h" + +static struct netif netif; + +#if LWIP_IPV4 +#define NETIF_ADDRS ipaddr, netmask, gw, +void init_default_netif(const ip4_addr_t *ipaddr, const ip4_addr_t *netmask, const ip4_addr_t *gw) +#else +#define NETIF_ADDRS +void init_default_netif(void) +#endif +{ +#if NO_SYS + netif_add(&netif, NETIF_ADDRS NULL, pcapif_init, netif_input); +#else /* NO_SYS */ + netif_add(&netif, NETIF_ADDRS NULL, pcapif_init, tcpip_input); +#endif /* NO_SYS */ + netif_set_default(&netif); +} + +void +default_netif_poll(void) +{ +#if !PCAPIF_RX_USE_THREAD + /* check for packets and link status*/ + pcapif_poll(&netif); + /* When pcapif_poll comes back, there are not packets, so sleep to + prevent 100% CPU load. Don't do this in an embedded system since it + increases latency! */ + sys_msleep(1); +#else /* !PCAPIF_RX_USE_THREAD */ + sys_msleep(50); +#endif /* !PCAPIF_RX_USE_THREAD */ +} + +void +default_netif_shutdown(void) +{ + /* release the pcap library... */ + pcapif_shutdown(&netif); +} diff --git a/contrib/ports/win32/include/arch/bpstruct.h b/contrib/ports/win32/include/arch/bpstruct.h new file mode 100644 index 00000000..1d81e3f7 --- /dev/null +++ b/contrib/ports/win32/include/arch/bpstruct.h @@ -0,0 +1 @@ +#pragma pack(push,1) diff --git a/contrib/ports/win32/include/arch/cc.h b/contrib/ports/win32/include/arch/cc.h new file mode 100644 index 00000000..cb7d5009 --- /dev/null +++ b/contrib/ports/win32/include/arch/cc.h @@ -0,0 +1,112 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_ARCH_CC_H +#define LWIP_ARCH_CC_H + +#ifdef _MSC_VER +#pragma warning (disable: 4127) /* conditional expression is constant */ +#pragma warning (disable: 4996) /* 'strncpy' was declared deprecated */ +#pragma warning (disable: 4103) /* structure packing changed by including file */ +#pragma warning (disable: 4820) /* 'x' bytes padding added after data member 'y' */ +#pragma warning (disable: 4711) /* The compiler performed inlining on the given function, although it was not marked for inlining */ +#endif + +#ifdef _MSC_VER +#if _MSC_VER >= 1910 +#include /* use MSVC errno for >= 2017 */ +#else +#define LWIP_PROVIDE_ERRNO /* provide errno for MSVC pre-2017 */ +#endif +#else /* _MSC_VER */ +#define LWIP_PROVIDE_ERRNO /* provide errno for non-MSVC */ +#endif /* _MSC_VER */ + +/* Define platform endianness (might already be defined) */ +#ifndef BYTE_ORDER +#define BYTE_ORDER LITTLE_ENDIAN +#endif /* BYTE_ORDER */ + +typedef int sys_prot_t; + +#ifdef _MSC_VER +/* define _INTPTR for Win32 MSVC stdint.h */ +#define _INTPTR 2 + +/* Do not use lwIP default definitions for format strings + * because these do not work with MSVC 2010 compiler (no inttypes.h) + */ +#define LWIP_NO_INTTYPES_H 1 + +/* Define (sn)printf formatters for these lwIP types */ +#define X8_F "02x" +#define U16_F "hu" +#define U32_F "lu" +#define S32_F "ld" +#define X32_F "lx" + +#define S16_F "hd" +#define X16_F "hx" +#define SZT_F "lu" +#endif /* _MSC_VER */ + +/* Compiler hints for packing structures */ +#define PACK_STRUCT_USE_INCLUDES + +#define LWIP_ERROR(message, expression, handler) do { if (!(expression)) { \ + printf("Assertion \"%s\" failed at line %d in %s\n", message, __LINE__, __FILE__); \ + fflush(NULL);handler;} } while(0) + +#ifdef _MSC_VER +/* C runtime functions redefined */ +#if _MSC_VER < 1910 +#define snprintf _snprintf +#endif +#define strdup _strdup +#endif + +/* Define an example for LWIP_PLATFORM_DIAG: since this uses varargs and the old + * C standard lwIP targets does not support this in macros, we have extra brackets + * around the arguments, which are left out in the following macro definition: + */ +#if !defined(LWIP_TESTMODE) || !LWIP_TESTMODE +void lwip_win32_platform_diag(const char *format, ...); +#define LWIP_PLATFORM_DIAG(x) lwip_win32_platform_diag x +#endif + +#ifndef LWIP_NORAND +extern unsigned int sys_win_rand(void); +#define LWIP_RAND() (sys_win_rand()) +#endif + +#define PPP_INCLUDE_SETTINGS_HEADER + +#endif /* LWIP_ARCH_CC_H */ diff --git a/contrib/ports/win32/include/arch/epstruct.h b/contrib/ports/win32/include/arch/epstruct.h new file mode 100644 index 00000000..65898b54 --- /dev/null +++ b/contrib/ports/win32/include/arch/epstruct.h @@ -0,0 +1 @@ +#pragma pack(pop) diff --git a/contrib/ports/win32/include/arch/perf.h b/contrib/ports/win32/include/arch/perf.h new file mode 100644 index 00000000..4580aabc --- /dev/null +++ b/contrib/ports/win32/include/arch/perf.h @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2001, Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of the Institute nor the names of its contributors + * may be used to endorse or promote products derived from this software + * without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE INSTITUTE AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE INSTITUTE OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_PERF_H +#define LWIP_PERF_H + +#define PERF_START /* null definition */ +#define PERF_STOP(x) /* null definition */ + +#endif /* LWIP_PERF_H */ diff --git a/contrib/ports/win32/include/arch/sys_arch.h b/contrib/ports/win32/include/arch/sys_arch.h new file mode 100644 index 00000000..f56c9df2 --- /dev/null +++ b/contrib/ports/win32/include/arch/sys_arch.h @@ -0,0 +1,81 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * + */ +#ifndef LWIP_ARCH_SYS_ARCH_H +#define LWIP_ARCH_SYS_ARCH_H + +/* HANDLE is used for sys_sem_t but we won't include windows.h */ +struct _sys_sem { + void *sem; +}; +typedef struct _sys_sem sys_sem_t; +#define sys_sem_valid_val(sema) (((sema).sem != NULL) && ((sema).sem != (void*)-1)) +#define sys_sem_valid(sema) (((sema) != NULL) && sys_sem_valid_val(*(sema))) +#define sys_sem_set_invalid(sema) ((sema)->sem = NULL) + +/* HANDLE is used for sys_mutex_t but we won't include windows.h */ +struct _sys_mut { + void *mut; +}; +typedef struct _sys_mut sys_mutex_t; +#define sys_mutex_valid_val(mutex) (((mutex).mut != NULL) && ((mutex).mut != (void*)-1)) +#define sys_mutex_valid(mutex) (((mutex) != NULL) && sys_mutex_valid_val(*(mutex))) +#define sys_mutex_set_invalid(mutex) ((mutex)->mut = NULL) + +#ifndef MAX_QUEUE_ENTRIES +#define MAX_QUEUE_ENTRIES 100 +#endif +struct lwip_mbox { + void* sem; + void* q_mem[MAX_QUEUE_ENTRIES]; + u32_t head, tail; +}; +typedef struct lwip_mbox sys_mbox_t; +#define SYS_MBOX_NULL NULL +#define sys_mbox_valid_val(mbox) (((mbox).sem != NULL) && ((mbox).sem != (void*)-1)) +#define sys_mbox_valid(mbox) ((mbox != NULL) && sys_mbox_valid_val(*(mbox))) +#define sys_mbox_set_invalid(mbox) ((mbox)->sem = NULL) + +/* DWORD (thread id) is used for sys_thread_t but we won't include windows.h */ +typedef u32_t sys_thread_t; + +sys_sem_t* sys_arch_netconn_sem_get(void); +void sys_arch_netconn_sem_alloc(void); +void sys_arch_netconn_sem_free(void); +#define LWIP_NETCONN_THREAD_SEM_GET() sys_arch_netconn_sem_get() +#define LWIP_NETCONN_THREAD_SEM_ALLOC() sys_arch_netconn_sem_alloc() +#define LWIP_NETCONN_THREAD_SEM_FREE() sys_arch_netconn_sem_free() + +#define LWIP_EXAMPLE_APP_ABORT() lwip_win32_keypressed() +int lwip_win32_keypressed(void); + +#endif /* LWIP_ARCH_SYS_ARCH_H */ + diff --git a/contrib/ports/win32/msvc/build_coverity.cmd b/contrib/ports/win32/msvc/build_coverity.cmd new file mode 100644 index 00000000..f96cc632 --- /dev/null +++ b/contrib/ports/win32/msvc/build_coverity.cmd @@ -0,0 +1,26 @@ +@echo off +rem Usage: pass the path to cov-build.exe (with trailing backslash, without the exe) as first parameter +rem ATTENTION: this deletes the output folder "cov-int" and the output file "cov-int.zip" first! + +set devenv="%ProgramFiles%\Microsoft Visual Studio 10.0\Common7\IDE\devenv.exe" +if not exist %devenv% set devenv="%ProgramFiles%\Microsoft Visual Studio 10.0\Common7\IDE\vcexpress.exe" +if not exist %devenv% set devenv="%ProgramFiles(x86)%\Microsoft Visual Studio 10.0\Common7\IDE\devenv.exe" +if not exist %devenv% set devenv="%ProgramFiles(x86)%\Microsoft Visual Studio 10.0\Common7\IDE\vcexpress.exe" +set covbuild=%1cov-build.exe +set covoutput=cov-int +set zip7="c:\Program Files\7-Zip\7z.exe" + +pushd %~dp0 + +if exist %covoutput% rd /s /q %covoutput% +if exist %covoutput%.zip del %covoutput%.zip + +%covbuild% --dir %covoutput% %devenv% lwip_test.sln /build Debug || goto error + +if exist %zip7% goto dozip +echo error: 7zip not found at \"%zip7% +goto error +:dozip +%zip7% a %covoutput%.zip %covoutput% +:error +popd \ No newline at end of file diff --git a/contrib/ports/win32/msvc/libcheck.vcxproj b/contrib/ports/win32/msvc/libcheck.vcxproj new file mode 100644 index 00000000..6cad78b8 --- /dev/null +++ b/contrib/ports/win32/msvc/libcheck.vcxproj @@ -0,0 +1,100 @@ + + + + + Debug + Win32 + + + Release + Win32 + + + + {EBB156DC-01BF-47B2-B69C-1A750B6B5F09} + libcheck + + + + StaticLibrary + MultiByte + true + + + StaticLibrary + MultiByte + + + + + + + + + + + + + <_ProjectFileVersion>10.0.40219.1 + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + + + + Disabled + ..\check;..\..\..\..\check\src;%(AdditionalIncludeDirectories) + _LIB;WIN32;_DEBUG;HAVE_CONFIG_H;%(PreprocessorDefinitions) + true + EnableFastChecks + MultiThreadedDebug + Level3 + EditAndContinue + + + + + MaxSpeed + true + ..\check;..\..\..\..\check\src;%(AdditionalIncludeDirectories) + WIN32;NDEBUG;_LIB;HAVE_CONFIG_H;%(PreprocessorDefinitions) + MultiThreaded + true + Level3 + ProgramDatabase + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/libcheck.vcxproj.filters b/contrib/ports/win32/msvc/libcheck.vcxproj.filters new file mode 100644 index 00000000..9be370e7 --- /dev/null +++ b/contrib/ports/win32/msvc/libcheck.vcxproj.filters @@ -0,0 +1,96 @@ + + + + + {05d172f9-8ca6-4d9c-96e4-2b0480a8222f} + + + {eb9ccf88-7e08-4202-bb4f-5a51443fa480} + + + {3f044d95-ab52-45ce-b4ae-27797eb221b2} + + + {abb21abe-51c2-45df-bdc9-8e00ce7fe404} + + + + + Win32 + + + Win32 + + + Win32\sys + + + src + + + src + + + src + + + src + + + src + + + src + + + src + + + src + + + src + + + libcompat + + + + + Win32 + + + src + + + src + + + src + + + src + + + src + + + src + + + src + + + src + + + src + + + libcompat + + + libcompat + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/lwIP.vcxproj b/contrib/ports/win32/msvc/lwIP.vcxproj new file mode 100644 index 00000000..7ffc2afe --- /dev/null +++ b/contrib/ports/win32/msvc/lwIP.vcxproj @@ -0,0 +1,577 @@ + + + + + Debug unittests + Win32 + + + Debug + Win32 + + + Release unittests + Win32 + + + Release + Win32 + + + + {2CC276FA-B226-49C9-8F82-7FCD5A228E28} + + + + StaticLibrary + false + MultiByte + + + StaticLibrary + false + MultiByte + + + StaticLibrary + false + MultiByte + + + StaticLibrary + false + MultiByte + + + + + + + + + + + + + + + + + + + + + + + <_ProjectFileVersion>10.0.40219.1 + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + + + + MaxSpeed + OnlyExplicitInline + ..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;..\..\..\apps\snmp_private_mib;%(AdditionalIncludeDirectories) + WIN32;NDEBUG;_LIB;%(PreprocessorDefinitions) + true + MultiThreaded + true + $(IntDir)$(ProjectName).pdb + EnableAllWarnings + true + ProgramDatabase + Default + true + + + NDEBUG;%(PreprocessorDefinitions) + 0x0407 + + + true + + + + + Disabled + ..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;..\..\..\apps\snmp_private_mib;%(AdditionalIncludeDirectories) + _LIB;WIN32;_DEBUG;LWIP_DEBUG;%(PreprocessorDefinitions) + EnableFastChecks + MultiThreadedDebug + + + $(IntDir)$(ProjectName).pdb + EnableAllWarnings + true + EditAndContinue + Default + true + + + _DEBUG;%(PreprocessorDefinitions) + 0x0407 + + + true + + + + + Disabled + ..\..\..\..\lwip\test\unit;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;%(AdditionalIncludeDirectories) + LWIP_NORAND;_LIB;WIN32;_DEBUG;LWIP_DEBUG;%(PreprocessorDefinitions) + EnableFastChecks + MultiThreadedDebug + + + $(IntDir)$(ProjectName).pdb + EnableAllWarnings + true + EditAndContinue + Default + true + + + _DEBUG;%(PreprocessorDefinitions) + 0x0407 + + + true + + + + + MaxSpeed + OnlyExplicitInline + ..\..\..\..\lwip\test\unit;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;%(AdditionalIncludeDirectories) + LWIP_NORAND;WIN32;NDEBUG;_LIB;%(PreprocessorDefinitions) + true + MultiThreaded + true + $(IntDir)$(ProjectName).pdb + EnableAllWarnings + true + ProgramDatabase + Default + true + + + NDEBUG;%(PreprocessorDefinitions) + 0x0407 + + + true + + + + + true + true + true + true + + + Document + true + true + true + true + + + true + true + true + true + + + true + true + true + true + + + true + true + true + true + + + true + true + true + true + + + Document + true + true + true + true + + + Document + + + Document + true + true + true + true + + + + + + + + + + + + + + + + true + true + true + true + + + + + true + true + true + true + + + + + + + + + + + + ..\..\..\..\mbedtls\include;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;..\..\..\apps\snmp_private_mib;%(AdditionalIncludeDirectories) + ..\..\..\..\mbedtls\include;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;..\..\..\apps\snmp_private_mib;%(AdditionalIncludeDirectories) + ..\..\..\..\mbedtls\include;..\..\..\..\lwip\test\unit;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;%(AdditionalIncludeDirectories) + ..\..\..\..\mbedtls\include;..\..\..\..\lwip\test\unit;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;%(AdditionalIncludeDirectories) + + + ..\..\..\..\mbedtls\include;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;..\..\..\apps\snmp_private_mib;%(AdditionalIncludeDirectories) + ..\..\..\..\mbedtls\include;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;..\..\..\apps\snmp_private_mib;%(AdditionalIncludeDirectories) + ..\..\..\..\mbedtls\include;..\..\..\..\lwip\test\unit;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;%(AdditionalIncludeDirectories) + ..\..\..\..\mbedtls\include;..\..\..\..\lwip\test\unit;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;%(AdditionalIncludeDirectories) + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + true + true + true + true + + + + + + + + + + + + + + + + + + + + + + + + + + + + ..\..\..\..\mbedtls\include;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;..\..\..\apps\snmp_private_mib;%(AdditionalIncludeDirectories) + + + + + true + true + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/lwIP.vcxproj.filters b/contrib/ports/win32/msvc/lwIP.vcxproj.filters new file mode 100644 index 00000000..903c84ea --- /dev/null +++ b/contrib/ports/win32/msvc/lwIP.vcxproj.filters @@ -0,0 +1,1048 @@ + + + + + {51757ae3-05ca-4e6a-a745-19c9ffc62278} + + + {e40d58ed-58be-4618-9664-6df29e27f835} + + + {5752fd8f-90c3-4381-8b6a-86c09a2f9859} + + + {48a805a9-e5d2-4eed-b29c-02b57140a03d} + + + {8a8dba58-934c-4292-aa8d-d20e2b801bd4} + + + {20594706-d6e1-4503-bc38-f297892d752a} + + + {1075aec7-b001-47bd-9846-ed635687e26e} + + + {9b7b3b39-f3b0-4915-81d9-d66c3443c348} + + + {75f75ac5-73a4-4458-bc23-eaed529c37e1} + + + {97772339-4210-4a32-82d0-d25269d3e3d6} + + + {06467ead-0683-44db-bc41-6aa5a82490f0} + + + {166a3203-ccc3-4eff-9eaa-1e5648a7fb5b} + + + {6b889738-b59a-450a-b4dd-0d1986bffca1} + + + {c64c0664-acd9-4f2f-8bd7-78250f4b7b4b} + + + {56e8d041-f1e0-4b02-a173-563190c0eb4a} + + + {dc783ea8-63ed-4de6-b576-a87c318a7ad1} + + + {7822191b-1cd0-4ce8-a852-da0474977fc4} + + + {b22a3b7a-d076-44a5-9a16-1e6f49cd5a94} + + + {0109fdbb-3aed-45fa-a308-493988755364} + + + {32a9c4ed-7687-48bb-8b9d-482c2f6c7554} + + + {c6c4a1a7-dab8-4463-b155-07e7303b54e4} + + + {2e87d0f7-38a3-45f8-870d-f8622c20e9d9} + + + {45f6a578-1f4b-4741-9b55-5b5084ecc1d9} + + + {92215272-cad9-4cf0-a2e1-705f6220e2a9} + + + {bdd3995a-aa34-4a4e-891e-a13c5373d618} + + + {d0ce6e8b-4b30-498b-a1bb-aecee958df42} + + + {6db73869-23f6-48ab-8d92-c8e478e55892} + + + {65542a97-c588-47b3-b1f6-ae51645c736e} + + + {ffd283f4-44f0-4be2-83a3-8bd55f29e80f} + + + {d9456888-d299-48ff-8165-ff499e5a0ba3} + + + {5aa786e4-df26-432c-b32c-9c4fac00b951} + + + {8fb42d78-1e77-4208-b457-44f41c4cc901} + + + {81578f11-9d3c-4bc8-a518-6f78f082fe0e} + + + {f8d65087-0cee-46de-8d8c-dca719bf2a4b} + + + {91d8473a-deb5-4943-8b63-b43d86c7fa1c} + + + {15855a74-48c6-473c-b4cb-40ec065698d4} + + + {2c795490-531d-4a03-b30d-73760b09975a} + + + + + + + + + + doc + + + doc + + + doc + + + doc + + + doc + + + doc\doxygen + + + doc\doxygen + + + doc\doxygen + + + example_app + + + + + src\api + + + src\api + + + src\api + + + src\api + + + src\api + + + src\api + + + src\api + + + src\api + + + src\apps\lwiperf + + + src\apps\netbiosns + + + src\apps\sntp + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core + + + src\core\ipv4 + + + src\core\ipv4 + + + src\core\ipv4 + + + src\core\ipv4 + + + src\core\ipv4 + + + src\core\ipv4 + + + src\core\ipv6 + + + src\core\ipv6 + + + src\core\ipv6 + + + src\core\ipv6 + + + src\core\ipv6 + + + src\core\ipv6 + + + src\core\ipv6 + + + src\core\ipv6 + + + src\core\ipv6 + + + src\netif + + + src\netif + + + src\netif + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp + + + src\netif\ppp\polarssl + + + src\netif\ppp\polarssl + + + src\netif\ppp\polarssl + + + src\netif\ppp\polarssl + + + src\netif\ppp\polarssl + + + arch + + + arch + + + src\apps\http + + + src\apps\http + + + src\apps\http + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\core + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\netif\ppp + + + src\core\ipv4 + + + src\core\ipv4 + + + src\core + + + src\apps\mdns + + + src\apps\snmp + + + doc + + + src\apps\tftp + + + src\apps\mqtt + + + src\api + + + src\netif + + + src\apps\snmp + + + src\apps\snmp + + + src\core + + + src\core + + + src\apps\altcp_tls + + + src\apps\altcp_tls + + + src\apps\smtp + + + src\netif + + + src\apps\http + + + src\core + + + src\apps\http + + + src\netif + + + src\netif + + + src\netif + + + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\netif + + + src\include\netif + + + src\include\netif + + + src\include\netif + + + src\include\netif + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp + + + src\include\netif\ppp\polarssl + + + src\include\netif\ppp\polarssl + + + src\include\netif\ppp\polarssl + + + src\include\netif\ppp\polarssl + + + src\include\netif\ppp\polarssl + + + arch + + + arch + + + arch + + + arch + + + arch + + + src\include\lwip\priv + + + src\include\lwip\priv + + + src\include\lwip\priv + + + src\include\lwip\priv + + + src\include\lwip\priv + + + src\apps\http + + + src\apps\http + + + src\apps\snmp + + + src\apps\snmp + + + src\apps\snmp + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\apps\snmp + + + src\include\netif\ppp + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\apps\snmp + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\apps + + + src\include\lwip\prot + + + src\include\lwip\prot + + + doc\doxygen + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip + + + src\include\lwip\priv + + + src\include\lwip\apps + + + src\include\lwip + + + src\include\lwip + + + src\include\lwip\priv + + + src\include\netif + + + src\include\netif + + + src\include\lwip + + + src\include\lwip + + + src\apps\altcp_tls + + + src\apps\altcp_tls + + + src\include\lwip + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\priv + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\compat\posix\sys + + + src\include\compat\posix + + + src\include\compat\posix\net + + + src\include\compat\posix\arpa + + + src\include\compat\stdc + + + src\include\lwip\prot + + + src\include\lwip\prot + + + src\include\lwip\priv + + + src\include\lwip\priv + + + src\include\lwip\apps + + + src\include\lwip\apps + + + src\include\lwip\prot + + + src\include\netif + + + src\include\netif + + + src\include\netif + + + src\include\netif + + + example_app + + + example_app + + + example_app + + + example_app + + + example_app + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/lwIP_Test.sln b/contrib/ports/win32/msvc/lwIP_Test.sln new file mode 100644 index 00000000..ce59abd2 --- /dev/null +++ b/contrib/ports/win32/msvc/lwIP_Test.sln @@ -0,0 +1,37 @@ +Microsoft Visual Studio Solution File, Format Version 11.00 +# Visual C++ Express 2010 +Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "lwIP_Test", "lwIP_Test.vcxproj", "{8CC0CE51-32CF-4585-BFAF-A9343BC5A96D}" +EndProject +Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "lwIP pcapif", "lwIP_pcapif.vcxproj", "{6F44E49E-9F21-4144-91EC-53B92AEF62CE}" +EndProject +Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "lwIP", "lwIP.vcxproj", "{2CC276FA-B226-49C9-8F82-7FCD5A228E28}" +EndProject +Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "makefsdata", "makefsdata.vcxproj", "{0BFC0F21-8E84-4E68-A9E1-CE2A09B72F6D}" +EndProject +Global + GlobalSection(SolutionConfigurationPlatforms) = preSolution + Debug|Win32 = Debug|Win32 + Release|Win32 = Release|Win32 + EndGlobalSection + GlobalSection(ProjectConfigurationPlatforms) = postSolution + {8CC0CE51-32CF-4585-BFAF-A9343BC5A96D}.Debug|Win32.ActiveCfg = Debug|Win32 + {8CC0CE51-32CF-4585-BFAF-A9343BC5A96D}.Debug|Win32.Build.0 = Debug|Win32 + {8CC0CE51-32CF-4585-BFAF-A9343BC5A96D}.Release|Win32.ActiveCfg = Release|Win32 + {8CC0CE51-32CF-4585-BFAF-A9343BC5A96D}.Release|Win32.Build.0 = Release|Win32 + {6F44E49E-9F21-4144-91EC-53B92AEF62CE}.Debug|Win32.ActiveCfg = Debug|Win32 + {6F44E49E-9F21-4144-91EC-53B92AEF62CE}.Debug|Win32.Build.0 = Debug|Win32 + {6F44E49E-9F21-4144-91EC-53B92AEF62CE}.Release|Win32.ActiveCfg = Release|Win32 + {6F44E49E-9F21-4144-91EC-53B92AEF62CE}.Release|Win32.Build.0 = Release|Win32 + {2CC276FA-B226-49C9-8F82-7FCD5A228E28}.Debug|Win32.ActiveCfg = Debug|Win32 + {2CC276FA-B226-49C9-8F82-7FCD5A228E28}.Debug|Win32.Build.0 = Debug|Win32 + {2CC276FA-B226-49C9-8F82-7FCD5A228E28}.Release|Win32.ActiveCfg = Release|Win32 + {2CC276FA-B226-49C9-8F82-7FCD5A228E28}.Release|Win32.Build.0 = Release|Win32 + {0BFC0F21-8E84-4E68-A9E1-CE2A09B72F6D}.Debug|Win32.ActiveCfg = Debug|Win32 + {0BFC0F21-8E84-4E68-A9E1-CE2A09B72F6D}.Debug|Win32.Build.0 = Debug|Win32 + {0BFC0F21-8E84-4E68-A9E1-CE2A09B72F6D}.Release|Win32.ActiveCfg = Release|Win32 + {0BFC0F21-8E84-4E68-A9E1-CE2A09B72F6D}.Release|Win32.Build.0 = Release|Win32 + EndGlobalSection + GlobalSection(SolutionProperties) = preSolution + HideSolutionNode = FALSE + EndGlobalSection +EndGlobal diff --git a/contrib/ports/win32/msvc/lwIP_Test.vcxproj b/contrib/ports/win32/msvc/lwIP_Test.vcxproj new file mode 100644 index 00000000..8af03826 --- /dev/null +++ b/contrib/ports/win32/msvc/lwIP_Test.vcxproj @@ -0,0 +1,203 @@ + + + + + Debug + Win32 + + + Release + Win32 + + + + {8CC0CE51-32CF-4585-BFAF-A9343BC5A96D} + lwIP_test + + + + Application + false + MultiByte + + + Application + false + MultiByte + + + + + + + + + + + + + + + <_ProjectFileVersion>10.0.40219.1 + .\$(Configuration)\ + .\$(Configuration)\$(ProjectName)\ + false + true + + + + .\Release/test.tlb + + + + + MaxSpeed + OnlyExplicitInline + ..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;..\..\..;%(AdditionalIncludeDirectories) + WIN32;NDEBUG;_CONSOLE;_CRT_SECURE_NO_DEPRECATE;%(PreprocessorDefinitions) + true + MultiThreaded + true + + + $(IntDir)$(TargetName).pch + $(IntDir)$(ProjectName).pdb + EnableAllWarnings + true + Default + true + + + NDEBUG;%(PreprocessorDefinitions) + 0x0407 + + + Packet.lib;wpcap.lib;%(AdditionalDependencies) + true + $(PCAP_DIR)\Lib;..\..\..\..\winpcap\WpdPack\Lib;%(AdditionalLibraryDirectories) + .\Release/test.pdb + Console + false + + + MachineX86 + true + $(TargetDir)$(TargetName).map + + + + + .\Debug/test.tlb + + + + + Disabled + ..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;..\..\..;%(AdditionalIncludeDirectories) + _CONSOLE;WIN32;_DEBUG;LWIP_DEBUG;_CRT_SECURE_NO_DEPRECATE;%(PreprocessorDefinitions) + EnableFastChecks + MultiThreadedDebug + + + $(IntDir)$(TargetName).pch + $(IntDir)$(ProjectName).pdb + EnableAllWarnings + true + EditAndContinue + Default + true + + + _DEBUG;%(PreprocessorDefinitions) + 0x0407 + + + Packet.lib;wpcap.lib;%(AdditionalDependencies) + true + $(PCAP_DIR)\Lib;..\..\..\..\winpcap\WpdPack\Lib;%(AdditionalLibraryDirectories) + true + Console + false + + + MachineX86 + false + $(TargetDir)$(TargetName).map + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + {2cc276fa-b226-49c9-8f82-7fcd5a228e28} + false + + + {6f44e49e-9f21-4144-91ec-53b92aef62ce} + false + + + + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/lwIP_Test.vcxproj.filters b/contrib/ports/win32/msvc/lwIP_Test.vcxproj.filters new file mode 100644 index 00000000..499334bc --- /dev/null +++ b/contrib/ports/win32/msvc/lwIP_Test.vcxproj.filters @@ -0,0 +1,243 @@ + + + + + {e858c3d0-1558-4d47-bc6a-9d4a55ce3d3a} + cpp;c;cxx;rc;def;r;odl;idl;hpj;bat + + + {0582eefd-a68e-45f8-b93c-f828c4794f30} + + + {ed0627c2-099a-4da8-af0c-142003828f9f} + + + {4ffb2268-6fc6-44d7-8e3b-2a3f68b8d5a3} + + + {93b36161-88b2-448c-9c45-ac6f27b98290} + + + {6456d2d6-61e6-4c99-9f1f-1f225437a642} + + + {75bb877e-aa45-4e2e-82fe-946ddadc6a64} + + + {78411edf-fe39-4edb-a6bd-2833755e0342} + + + {531dd0cf-ec13-42b7-a3bb-b837382d4ecd} + + + {d71bdb12-c5ed-4823-99f0-2d537765a2eb} + + + {0b9db8c7-f352-4ca6-86c6-1a6c58482c5d} + + + {97f0ea5c-16cf-4640-a6b3-ace059ed2388} + + + {24079d2d-aab1-49f9-b0fa-57910a18b93a} + + + {d38ed32b-9498-429e-a02c-08332c463725} + + + {672a49fd-94ff-4126-8de3-e96c9c32dfb8} + + + {e5276e3f-3e2a-4376-aee3-85aafd12c77b} + + + {f6d95ce0-df4f-4988-8654-624468dd4ecd} + + + {a37e5539-232e-4d91-9c10-3d7a851b8c4c} + + + {a2a65260-5055-4a0d-bd0b-4a3ca3560918} + + + {aa359e5e-131e-4f20-9e5d-416f9ae76abd} + + + {bd6f1fcc-c88f-4b96-a267-401f6bf9898b} + + + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\addons\tcp_isn + + + Source Files\addons\ipv6_static_routing + + + Source Files\examples\httpd\fs_example + + + Source Files\examples\httpd\ssi_example + + + Source Files\examples\snmp\snmp_private_mib + + + Source Files\examples\snmp\snmp_v3 + + + Source Files\examples\httpd\cgi_example + + + Source Files\examples\httpd\genfiles_example + + + Source Files\examples\httpd\post_example + + + Source Files\examples\mdns + + + Source Files\examples\tftp + + + Source Files\examples\snmp + + + Source Files\examples\sntp + + + Source Files\examples\ppp + + + Source Files\examples\lwiperf + + + Source Files\examples\mqtt + + + Source Files + + + Source Files + + + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\apps + + + Source Files\addons\tcp_isn + + + Source Files\addons\ipv6_static_routing + + + Source Files\examples\httpd\fs_example + + + Source Files\examples\httpd\ssi_example + + + Source Files\examples\snmp\snmp_private_mib + + + Source Files\examples\snmp\snmp_v3 + + + Source Files\examples\httpd\cgi_example + + + Source Files\examples\httpd\genfiles_example + + + Source Files\examples\mdns + + + Source Files\examples\tftp + + + Source Files\examples\snmp + + + Source Files\examples\sntp + + + Source Files\examples\ppp + + + Source Files\examples\lwiperf + + + Source Files\examples\mqtt + + + + + Source Files\addons\ipv6_static_routing + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/lwIP_pcapif.vcxproj b/contrib/ports/win32/msvc/lwIP_pcapif.vcxproj new file mode 100644 index 00000000..db8948a7 --- /dev/null +++ b/contrib/ports/win32/msvc/lwIP_pcapif.vcxproj @@ -0,0 +1,111 @@ + + + + + Debug + Win32 + + + Release + Win32 + + + + lwIP pcapif + {6F44E49E-9F21-4144-91EC-53B92AEF62CE} + lwIP pcapif + + + + StaticLibrary + false + MultiByte + + + StaticLibrary + false + MultiByte + + + + + + + + + + + + + + + <_ProjectFileVersion>10.0.40219.1 + .\$(Configuration)\ + .\$(Configuration)\$(ProjectName)\ + + + + Disabled + ..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;.\;$(PCAP_DIR)\Include;..\..\..\..\winpcap\WpdPack\Include\;%(AdditionalIncludeDirectories) + _LIB;WIN32;_DEBUG;LWIP_DEBUG;%(PreprocessorDefinitions) + EnableFastChecks + MultiThreadedDebug + + + $(IntDir)$(ProjectName).pdb + EnableAllWarnings + true + EditAndContinue + Default + true + + + _DEBUG;%(PreprocessorDefinitions) + 0x0407 + + + + + + MaxSpeed + OnlyExplicitInline + ..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;.\;$(PCAP_DIR)\Include;..\..\..\..\winpcap\WpdPack\Include\;%(AdditionalIncludeDirectories) + WIN32;NDEBUG;_LIB;%(PreprocessorDefinitions) + true + MultiThreaded + true + + + $(IntDir)$(TargetName).pch + $(IntDir)$(ProjectName).pdb + EnableAllWarnings + true + Default + true + + + NDEBUG;%(PreprocessorDefinitions) + 0x0407 + + + true + + + + + + + + + + + + + {2cc276fa-b226-49c9-8f82-7fcd5a228e28} + false + + + + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/lwIP_pcapif.vcxproj.filters b/contrib/ports/win32/msvc/lwIP_pcapif.vcxproj.filters new file mode 100644 index 00000000..f933f17a --- /dev/null +++ b/contrib/ports/win32/msvc/lwIP_pcapif.vcxproj.filters @@ -0,0 +1,28 @@ + + + + + {0d38b8c3-e694-4572-89b8-fc6e825a092d} + cpp;c;cxx;rc;def;r;odl;idl;hpj;bat + + + {e5ce29d5-319e-4e99-978b-b88e8d6167e4} + + + + + Source Files + + + Source Files + + + + + Header Files + + + Header Files + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/lwIP_unittests.sln b/contrib/ports/win32/msvc/lwIP_unittests.sln new file mode 100644 index 00000000..2dfefb06 --- /dev/null +++ b/contrib/ports/win32/msvc/lwIP_unittests.sln @@ -0,0 +1,31 @@ +Microsoft Visual Studio Solution File, Format Version 11.00 +# Visual C++ Express 2010 +Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "lwip_unittests", "lwip_unittests.vcxproj", "{6CCABAA4-F86F-4119-AFF8-43C9A4A234C2}" +EndProject +Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "lwIP", "lwIP.vcxproj", "{2CC276FA-B226-49C9-8F82-7FCD5A228E28}" +EndProject +Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "libcheck", "libcheck.vcxproj", "{EBB156DC-01BF-47B2-B69C-1A750B6B5F09}" +EndProject +Global + GlobalSection(SolutionConfigurationPlatforms) = preSolution + Debug|Win32 = Debug|Win32 + Release|Win32 = Release|Win32 + EndGlobalSection + GlobalSection(ProjectConfigurationPlatforms) = postSolution + {6CCABAA4-F86F-4119-AFF8-43C9A4A234C2}.Debug|Win32.ActiveCfg = Debug|Win32 + {6CCABAA4-F86F-4119-AFF8-43C9A4A234C2}.Debug|Win32.Build.0 = Debug|Win32 + {6CCABAA4-F86F-4119-AFF8-43C9A4A234C2}.Release|Win32.ActiveCfg = Release|Win32 + {6CCABAA4-F86F-4119-AFF8-43C9A4A234C2}.Release|Win32.Build.0 = Release|Win32 + {2CC276FA-B226-49C9-8F82-7FCD5A228E28}.Debug|Win32.ActiveCfg = Debug unittests|Win32 + {2CC276FA-B226-49C9-8F82-7FCD5A228E28}.Debug|Win32.Build.0 = Debug unittests|Win32 + {2CC276FA-B226-49C9-8F82-7FCD5A228E28}.Release|Win32.ActiveCfg = Release unittests|Win32 + {2CC276FA-B226-49C9-8F82-7FCD5A228E28}.Release|Win32.Build.0 = Release unittests|Win32 + {EBB156DC-01BF-47B2-B69C-1A750B6B5F09}.Debug|Win32.ActiveCfg = Debug|Win32 + {EBB156DC-01BF-47B2-B69C-1A750B6B5F09}.Debug|Win32.Build.0 = Debug|Win32 + {EBB156DC-01BF-47B2-B69C-1A750B6B5F09}.Release|Win32.ActiveCfg = Release|Win32 + {EBB156DC-01BF-47B2-B69C-1A750B6B5F09}.Release|Win32.Build.0 = Release|Win32 + EndGlobalSection + GlobalSection(SolutionProperties) = preSolution + HideSolutionNode = FALSE + EndGlobalSection +EndGlobal diff --git a/contrib/ports/win32/msvc/lwip_unittests.vcxproj b/contrib/ports/win32/msvc/lwip_unittests.vcxproj new file mode 100644 index 00000000..4dccb92b --- /dev/null +++ b/contrib/ports/win32/msvc/lwip_unittests.vcxproj @@ -0,0 +1,137 @@ + + + + + Debug + Win32 + + + Release + Win32 + + + + {6CCABAA4-F86F-4119-AFF8-43C9A4A234C2} + lwip_unittests + + + + Application + MultiByte + true + + + Application + MultiByte + + + + + + + + + + + + + <_ProjectFileVersion>10.0.40219.1 + $(Configuration)\$(ProjectName)\ + $(Configuration)\$(ProjectName)\ + + + + Disabled + ..\check;..\..\..\..\check\src;..\..\..\..\lwip\test\unit;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;%(AdditionalIncludeDirectories) + _LIB;WIN32;_DEBUG;LWIP_DEBUG;%(PreprocessorDefinitions) + true + EnableFastChecks + MultiThreadedDebug + EnableAllWarnings + EditAndContinue + 4820 + + + true + false + + + MachineX86 + + + + + MaxSpeed + true + ..\check;..\..\..\..\check\src;..\..\..\..\lwip\test\unit;..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..;%(AdditionalIncludeDirectories) + WIN32;NDEBUG;_LIB;%(PreprocessorDefinitions) + MultiThreaded + true + Level4 + ProgramDatabase + + + true + true + true + false + + + MachineX86 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + {ebb156dc-01bf-47b2-b69c-1a750b6b5f09} + false + + + {2cc276fa-b226-49c9-8f82-7fcd5a228e28} + false + + + + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/lwip_unittests.vcxproj.filters b/contrib/ports/win32/msvc/lwip_unittests.vcxproj.filters new file mode 100644 index 00000000..79cc8618 --- /dev/null +++ b/contrib/ports/win32/msvc/lwip_unittests.vcxproj.filters @@ -0,0 +1,147 @@ + + + + + {e351c538-9f2b-4a01-bf46-3ee8873cbc0f} + + + {5805c4bc-32c1-49cf-a35e-af58757e2d7a} + + + {173ba4ab-b194-4933-8e02-319044c2a8fa} + + + {70c655a7-f40f-4728-b586-33fd9598b355} + + + {a6b60d4e-4b81-44f2-9408-2e45cc769391} + + + {d454902e-ce5b-48ae-a690-e6490bdbbf17} + + + {d9501476-6102-4f14-90bd-35322fbd2fb2} + + + {b04f182c-1910-456d-9388-397dfe82dbc9} + + + {fd48ae04-ec85-478f-a97c-a7c8384a2d94} + + + {fe93fc95-f1af-4a1f-a086-c1771dbf4d79} + + + {924d29be-e5e4-4b25-8bc4-92db91ce4c49} + + + + + core + + + core + + + tcp + + + tcp + + + tcp + + + udp + + + etharp + + + dhcp + + + + mdns + + + api + + + arch + + + mqtt + + + ip4 + + + core + + + core + + + core + + + ipv6 + + + + + core + + + core + + + tcp + + + tcp + + + tcp + + + udp + + + etharp + + + dhcp + + + + + mdns + + + api + + + arch + + + mqtt + + + ip4 + + + core + + + core + + + core + + + ipv6 + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/makefsdata.vcxproj b/contrib/ports/win32/msvc/makefsdata.vcxproj new file mode 100644 index 00000000..1b45aff4 --- /dev/null +++ b/contrib/ports/win32/msvc/makefsdata.vcxproj @@ -0,0 +1,99 @@ + + + + + Debug + Win32 + + + Release + Win32 + + + + + + + {0BFC0F21-8E84-4E68-A9E1-CE2A09B72F6D} + makefsdata + Win32Proj + + + + Application + Unicode + true + + + Application + Unicode + + + + + + + + + + + + + <_ProjectFileVersion>10.0.40219.1 + true + $(SolutionDir)$(Configuration)\ + $(Configuration)\ + false + + + + Disabled + ..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;%(AdditionalIncludeDirectories) + WIN32;_DEBUG;_CONSOLE;_CRT_SECURE_NO_WARNINGS;%(PreprocessorDefinitions) + true + EnableFastChecks + MultiThreadedDebugDLL + + + Level4 + true + EditAndContinue + + + true + Console + false + + + MachineX86 + + + + + MaxSpeed + true + ..\..\..\..\lwip\src\include;..\..\..\..\lwip\src\include\ipv4;..\..\..\..\lwip\src\include\ipv6;..\include;..\..\..\examples\example_app;%(AdditionalIncludeDirectories) + WIN32;NDEBUG;_CONSOLE;_CRT_SECURE_NO_WARNINGS;%(PreprocessorDefinitions) + MultiThreadedDLL + true + + + Level4 + true + ProgramDatabase + + + true + Console + true + true + false + + + MachineX86 + + + + + + \ No newline at end of file diff --git a/contrib/ports/win32/msvc/makefsdata.vcxproj.filters b/contrib/ports/win32/msvc/makefsdata.vcxproj.filters new file mode 100644 index 00000000..e94f2b5b --- /dev/null +++ b/contrib/ports/win32/msvc/makefsdata.vcxproj.filters @@ -0,0 +1,14 @@ + + + + + {4FC737F1-C7A5-4376-A066-2A32D752A2FF} + cpp;c;cc;cxx;def;odl;idl;hpj;bat;asm;asmx + + + + + Quelldateien + + + \ No newline at end of file diff --git a/contrib/ports/win32/pcapif.c b/contrib/ports/win32/pcapif.c new file mode 100644 index 00000000..e5e1ec9d --- /dev/null +++ b/contrib/ports/win32/pcapif.c @@ -0,0 +1,1091 @@ +/** + * pcapif.c - This file is part of lwIP pcapif + * + **************************************************************************** + * + * This file is derived from an example in lwIP with the following license: + * + * Copyright (c) 2001, Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of the Institute nor the names of its contributors + * may be used to endorse or promote products derived from this software + * without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE INSTITUTE AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE INSTITUTE OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + */ + +/* include the port-dependent configuration */ +#include "lwipcfg.h" + +#include +#include + +#ifdef _MSC_VER +#pragma warning( push, 3 ) +#include "pcap.h" +#pragma warning ( pop ) +#else +/* e.g. mingw */ +#define _MSC_VER 1500 +#include "pcap.h" +#undef _MSC_VER +#endif + +#include "lwip/opt.h" + +#if LWIP_ETHERNET + +#include "pcapif.h" + +#include +#include +#include + +#include "lwip/debug.h" + +#include "lwip/def.h" +#include "lwip/mem.h" +#include "lwip/pbuf.h" +#include "lwip/stats.h" +#include "lwip/sys.h" +#include "lwip/ip.h" +#include "lwip/snmp.h" +#include "lwip/tcpip.h" +#include "lwip/timeouts.h" +#include "lwip/ethip6.h" + +#include "lwip/etharp.h" + +/* For compatibility with old pcap */ +#ifndef PCAP_OPENFLAG_PROMISCUOUS +#define PCAP_OPENFLAG_PROMISCUOUS 1 +#endif + +/** Set this to 0 to receive all multicast ethernet destination addresses */ +#ifndef PCAPIF_FILTER_GROUP_ADDRESSES +#define PCAPIF_FILTER_GROUP_ADDRESSES 1 +#endif + +/** Set this to 1 to receive all frames (also unicast to other addresses) + * In this mode, filtering out our own tx packets from loopback receiving + * is done via matching rx against recent tx (memcmp). + */ +#ifndef PCAPIF_RECEIVE_PROMISCUOUS +#define PCAPIF_RECEIVE_PROMISCUOUS 0 +#endif + +/* Define those to better describe your network interface. + For now, we use 'e0', 'e1', 'e2' and so on */ +#define IFNAME0 'e' +#define IFNAME1 '0' + +/** index of the network adapter to use for lwIP */ +#ifndef PACKET_LIB_ADAPTER_NR +#define PACKET_LIB_ADAPTER_NR 0 +#endif + +/** If 1, check link state and report it to lwIP. + * If 0, don't check link state (lwIP link state is always UP). + */ +#ifndef PCAPIF_HANDLE_LINKSTATE +#define PCAPIF_HANDLE_LINKSTATE 1 +#endif + +/** If 1, use PBUF_REF for RX (for testing purposes mainly). + * For this, LWIP_SUPPORT_CUSTOM_PBUF must be enabled. + */ +#ifndef PCAPIF_RX_REF +#define PCAPIF_RX_REF 0 +#endif + +/** This can be used when netif->state is used for something else in your + * application (e.g. when wrapping a class around this interface). Just + * make sure this define returns the state pointer set by + * pcapif_low_level_init() (e.g. by using an offset or a callback). + */ +#ifndef PCAPIF_GET_STATE_PTR +#define PCAPIF_GET_STATE_PTR(netif) ((netif)->state) +#endif + +#if PCAPIF_HANDLE_LINKSTATE +#include "pcapif_helper.h" + +/* Define "PHY" delay when "link up" */ +#ifndef PCAPIF_LINKUP_DELAY +#define PCAPIF_LINKUP_DELAY 0 +#endif + +#define PCAPIF_LINKCHECK_INTERVAL_MS 500 + +/* link state notification macro */ +#if PCAPIF_LINKUP_DELAY +#define PCAPIF_NOTIFY_LINKSTATE(netif, linkfunc) sys_timeout(PCAPIF_LINKUP_DELAY, (sys_timeout_handler)linkfunc, netif) +#else /* PHY_LINKUP_DELAY */ +#define PCAPIF_NOTIFY_LINKSTATE(netif, linkfunc) linkfunc(netif) +#endif /* PHY_LINKUP_DELAY */ + +#endif /* PCAPIF_HANDLE_LINKSTATE */ + +/* Define PCAPIF_RX_LOCK_LWIP and PCAPIF_RX_UNLOCK_LWIP if you need to lock the lwIP core + before/after pbuf_alloc() or netif->input() are called on RX. */ +#ifndef PCAPIF_RX_LOCK_LWIP +#define PCAPIF_RX_LOCK_LWIP() +#endif +#ifndef PCAPIF_RX_UNLOCK_LWIP +#define PCAPIF_RX_UNLOCK_LWIP() +#endif + +#define ETH_MIN_FRAME_LEN 60U +#define ETH_MAX_FRAME_LEN 1518U + +#define ADAPTER_NAME_LEN 128 +#define ADAPTER_DESC_LEN 128 + +#if PCAPIF_RECEIVE_PROMISCUOUS +#ifndef PCAPIF_LOOPBACKFILTER_NUM_TX_PACKETS +#define PCAPIF_LOOPBACKFILTER_NUM_TX_PACKETS 128 +#endif +struct pcapipf_pending_packet { + struct pcapipf_pending_packet *next; + u16_t len; + u8_t data[ETH_MAX_FRAME_LEN]; +}; +#endif /* PCAPIF_RECEIVE_PROMISCUOUS */ + +/* Packet Adapter informations */ +struct pcapif_private { + void *input_fn_arg; + pcap_t *adapter; + char name[ADAPTER_NAME_LEN]; + char description[ADAPTER_DESC_LEN]; + int shutdown_called; +#if PCAPIF_RX_USE_THREAD + volatile int rx_run; + volatile int rx_running; +#endif /* PCAPIF_RX_USE_THREAD */ +#if PCAPIF_HANDLE_LINKSTATE + struct pcapifh_linkstate *link_state; + enum pcapifh_link_event last_link_event; +#endif /* PCAPIF_HANDLE_LINKSTATE */ +#if PCAPIF_RECEIVE_PROMISCUOUS + struct pcapipf_pending_packet packets[PCAPIF_LOOPBACKFILTER_NUM_TX_PACKETS]; + struct pcapipf_pending_packet *tx_packets; + struct pcapipf_pending_packet *free_packets; +#endif /* PCAPIF_RECEIVE_PROMISCUOUS */ +}; + +#if PCAPIF_RECEIVE_PROMISCUOUS +static void +pcapif_init_tx_packets(struct pcapif_private *priv) +{ + int i; + priv->tx_packets = NULL; + priv->free_packets = NULL; + for (i = 0; i < PCAPIF_LOOPBACKFILTER_NUM_TX_PACKETS; i++) { + struct pcapipf_pending_packet *pack = &priv->packets[i]; + pack->len = 0; + pack->next = priv->free_packets; + priv->free_packets = pack; + } +} + +static void +pcapif_add_tx_packet(struct pcapif_private *priv, unsigned char *buf, u16_t tot_len) +{ + struct pcapipf_pending_packet *tx; + struct pcapipf_pending_packet *pack; + SYS_ARCH_DECL_PROTECT(lev); + + /* get a free packet (locked) */ + SYS_ARCH_PROTECT(lev); + pack = priv->free_packets; + if ((pack == NULL) && (priv->tx_packets != NULL)) { + /* no free packets, reuse the oldest */ + pack = priv->tx_packets; + priv->tx_packets = pack->next; + } + LWIP_ASSERT("no free packet", pack != NULL); + priv->free_packets = pack->next; + pack->next = NULL; + SYS_ARCH_UNPROTECT(lev); + + /* set up the packet (unlocked) */ + pack->len = tot_len; + memcpy(pack->data, buf, tot_len); + + /* put the packet on the list (locked) */ + SYS_ARCH_PROTECT(lev); + if (priv->tx_packets != NULL) { + for (tx = priv->tx_packets; tx->next != NULL; tx = tx->next); + LWIP_ASSERT("bug", tx != NULL); + tx->next = pack; + } else { + priv->tx_packets = pack; + } + SYS_ARCH_UNPROTECT(lev); +} + +static int +pcapif_compare_packets(struct pcapipf_pending_packet *pack, const void *packet, int packet_len) +{ + if (pack->len == packet_len) { + if (!memcmp(pack->data, packet, packet_len)) { + return 1; + } + } + return 0; +} + +static int +pcaipf_is_tx_packet(struct netif *netif, const void *packet, int packet_len) +{ + struct pcapif_private *priv = (struct pcapif_private*)PCAPIF_GET_STATE_PTR(netif); + struct pcapipf_pending_packet *iter, *last; + SYS_ARCH_DECL_PROTECT(lev); + + last = priv->tx_packets; + if (last == NULL) { + /* list is empty */ + return 0; + } + /* compare the first packet */ + if (pcapif_compare_packets(last, packet, packet_len)) { + SYS_ARCH_PROTECT(lev); + LWIP_ASSERT("list has changed", last == priv->tx_packets); + priv->tx_packets = last->next; + last->next = priv->free_packets; + priv->free_packets = last; + last->len = 0; + SYS_ARCH_UNPROTECT(lev); + return 1; + } + SYS_ARCH_PROTECT(lev); + for (iter = last->next; iter != NULL; last = iter, iter = iter->next) { + /* unlock while comparing (this works because we have a clean threading separation + of adding and removing items and adding is only done at the end) */ + SYS_ARCH_UNPROTECT(lev); + if (pcapif_compare_packets(iter, packet, packet_len)) { + SYS_ARCH_PROTECT(lev); + LWIP_ASSERT("last != NULL", last != NULL); + last->next = iter->next; + iter->next = priv->free_packets; + priv->free_packets = iter; + last->len = 0; + SYS_ARCH_UNPROTECT(lev); + return 1; + } + SYS_ARCH_PROTECT(lev); + } + SYS_ARCH_UNPROTECT(lev); + return 0; +} +#else /* PCAPIF_RECEIVE_PROMISCUOUS */ +#define pcapif_init_tx_packets(priv) +#define pcapif_add_tx_packet(priv, buf, tot_len) +static int +pcaipf_is_tx_packet(struct netif *netif, const void *packet, int packet_len) +{ + const struct eth_addr *src = (const struct eth_addr *)packet + 1; + if (packet_len >= (ETH_HWADDR_LEN * 2)) { + /* Don't let feedback packets through (limitation in winpcap?) */ + if(!memcmp(src, netif->hwaddr, ETH_HWADDR_LEN)) { + return 1; + } + } + return 0; +} +#endif /* PCAPIF_RECEIVE_PROMISCUOUS */ + +#if PCAPIF_RX_REF +struct pcapif_pbuf_custom +{ + struct pbuf_custom pc; + struct pbuf* p; +}; +#endif /* PCAPIF_RX_REF */ + +/* Forward declarations. */ +static void pcapif_input(u_char *user, const struct pcap_pkthdr *pkt_header, const u_char *packet); + +#ifdef PACKET_LIB_GET_ADAPTER_NETADDRESS +/** Get the index of an adapter by its network address + * + * @param netaddr network address of the adapter (e.g. 192.168.1.0) + * @return index of the adapter or negative on error + */ +static int +get_adapter_index_from_addr(struct in_addr *netaddr, char *guid, size_t guid_len) +{ + pcap_if_t *alldevs; + pcap_if_t *d; + char errbuf[PCAP_ERRBUF_SIZE+1]; + int index = 0; + + memset(guid, 0, guid_len); + + /* Retrieve the interfaces list */ + if (pcap_findalldevs(&alldevs, errbuf) == -1) { + printf("Error in pcap_findalldevs: %s\n", errbuf); + return -1; + } + /* Scan the list printing every entry */ + for (d = alldevs; d != NULL; d = d->next, index++) { + pcap_addr_t *a; + for(a = d->addresses; a != NULL; a = a->next) { + if (a->addr->sa_family == AF_INET) { + ULONG a_addr = ((struct sockaddr_in *)a->addr)->sin_addr.s_addr; + ULONG a_netmask = ((struct sockaddr_in *)a->netmask)->sin_addr.s_addr; + ULONG a_netaddr = a_addr & a_netmask; + ULONG addr = (*netaddr).s_addr; + if (a_netaddr == addr) { + int ret = -1; + char name[128]; + char *start, *end; + size_t len = strlen(d->name); + if(len > 127) { + len = 127; + } + MEMCPY(name, d->name, len); + name[len] = 0; + start = strstr(name, "{"); + if (start != NULL) { + end = strstr(start, "}"); + if (end != NULL) { + size_t len = end - start + 1; + MEMCPY(guid, start, len); + ret = index; + } + } + pcap_freealldevs(alldevs); + return ret; + } + } + } + } + printf("Network address not found.\n"); + + pcap_freealldevs(alldevs); + return -1; +} +#endif /* PACKET_LIB_GET_ADAPTER_NETADDRESS */ + +#if defined(PACKET_LIB_GET_ADAPTER_NETADDRESS) || defined(PACKET_LIB_ADAPTER_GUID) +/** Get the index of an adapter by its GUID + * + * @param adapter_guid GUID of the adapter + * @return index of the adapter or negative on error + */ +static int +get_adapter_index(const char* adapter_guid) +{ + pcap_if_t *alldevs; + pcap_if_t *d; + char errbuf[PCAP_ERRBUF_SIZE+1]; + int idx = 0; + + /* Retrieve the interfaces list */ + if (pcap_findalldevs(&alldevs, errbuf) == -1) { + printf("Error in pcap_findalldevs: %s\n", errbuf); + return -1; + } + /* Scan the list and compare name vs. adapter_guid */ + for (d = alldevs; d != NULL; d = d->next, idx++) { + if(strstr(d->name, adapter_guid)) { + pcap_freealldevs(alldevs); + return idx; + } + } + /* not found, dump all adapters */ + printf("%d available adapters:\n", idx); + for (d = alldevs, idx = 0; d != NULL; d = d->next, idx++) { + printf("- %d: %s\n", idx, d->name); + } + pcap_freealldevs(alldevs); + return -1; +} +#endif /* defined(PACKET_LIB_GET_ADAPTER_NETADDRESS) || defined(PACKET_LIB_ADAPTER_GUID) */ + +static pcap_t* +pcapif_open_adapter(const char* adapter_name, char* errbuf) +{ + pcap_t* adapter = pcap_open_live(adapter_name,/* name of the device */ + 65536, /* portion of the packet to capture */ + /* 65536 guarantees that the whole packet will be captured on all the link layers */ + PCAP_OPENFLAG_PROMISCUOUS,/* promiscuous mode */ +#if PCAPIF_RX_USE_THREAD + /*-*/1, /* don't wait at all for lower latency */ +#else + 1, /* wait 1 ms in ethernetif_poll */ +#endif + errbuf); /* error buffer */ + return adapter; +} + +#if !PCAPIF_RX_USE_THREAD +static void +pcap_reopen_adapter(struct pcapif_private *pa) +{ + char errbuf[PCAP_ERRBUF_SIZE+1]; + pcap_if_t *alldevs; + if (pa->adapter != NULL) { + pcap_close(pa->adapter); + pa->adapter = NULL; + } + if (pcap_findalldevs(&alldevs, errbuf) != -1) { + pcap_if_t *d; + for (d = alldevs; d != NULL; d = d->next) { + if (!strcmp(d->name, pa->name)) { + pa->adapter = pcapif_open_adapter(pa->name, errbuf); + if (pa->adapter == NULL) { + printf("failed to reopen pcap adapter after failure: %s\n", errbuf); + } + break; + } + } + pcap_freealldevs(alldevs); + } +} +#endif + +/** + * Open a network adapter and set it up for packet input + * + * @param adapter_num the index of the adapter to use + * @param arg argument to pass to input + * @return an adapter handle on success, NULL on failure + */ +static struct pcapif_private* +pcapif_init_adapter(int adapter_num, void *arg) +{ + int i; + int number_of_adapters; + struct pcapif_private *pa; + char errbuf[PCAP_ERRBUF_SIZE+1]; + + pcap_if_t *alldevs; + pcap_if_t *d; + pcap_if_t *used_adapter = NULL; + + pa = (struct pcapif_private *)malloc(sizeof(struct pcapif_private)); + if (!pa) { + printf("Unable to alloc the adapter!\n"); + return NULL; + } + + memset(pa, 0, sizeof(struct pcapif_private)); + pcapif_init_tx_packets(pa); + pa->input_fn_arg = arg; + + /* Retrieve the interfaces list */ + if (pcap_findalldevs(&alldevs, errbuf) == -1) { + free(pa); + return NULL; /* no adapters found */ + } + /* get number of adapters and adapter pointer */ + for (d = alldevs, number_of_adapters = 0; d != NULL; d = d->next, number_of_adapters++) { + if (number_of_adapters == adapter_num) { + char *desc = d->description; + size_t len; + + len = strlen(d->name); + LWIP_ASSERT("len < ADAPTER_NAME_LEN", len < ADAPTER_NAME_LEN); + strcpy(pa->name, d->name); + + used_adapter = d; + /* format vendor description */ + if (desc != NULL) { + len = strlen(desc); + if (strstr(desc, " ' on local host") != NULL) { + len -= 16; + } + else if (strstr(desc, "' on local host") != NULL) { + len -= 15; + } + if (strstr(desc, "Network adapter '") == desc) { + len -= 17; + desc += 17; + } + len = LWIP_MIN(len, ADAPTER_DESC_LEN-1); + while ((desc[len-1] == ' ') || (desc[len-1] == '\t')) { + /* don't copy trailing whitespace */ + len--; + } + strncpy(pa->description, desc, len); + pa->description[len] = 0; + } else { + strcpy(pa->description, ""); + } + } + } + +#ifndef PCAPIF_LIB_QUIET + /* Scan the list printing every entry */ + for (d = alldevs, i = 0; d != NULL; d = d->next, i++) { + char *desc = d->description; + char descBuf[128]; + size_t len; + const char* devname = d->name; + if (d->name == NULL) { + devname = ""; + } else { + if (strstr(devname, "\\Device\\") == devname) { + /* windows: strip the first part */ + devname += 8; + } + } + printf("%2i: %s\n", i, devname); + if (desc != NULL) { + /* format vendor description */ + len = strlen(desc); + if (strstr(desc, " ' on local host") != NULL) { + len -= 16; + } + else if (strstr(desc, "' on local host") != NULL) { + len -= 15; + } + if (strstr(desc, "Network adapter '") == desc) { + len -= 17; + desc += 17; + } + len = LWIP_MIN(len, 127); + while ((desc[len-1] == ' ') || (desc[len-1] == '\t')) { + /* don't copy trailing whitespace */ + len--; + } + strncpy(descBuf, desc, len); + descBuf[len] = 0; + printf(" Desc: \"%s\"\n", descBuf); + } + } +#endif /* PCAPIF_LIB_QUIET */ + + /* invalid adapter index -> check this after printing the adapters */ + if (adapter_num < 0) { + printf("Invalid adapter_num: %d\n", adapter_num); + free(pa); + pcap_freealldevs(alldevs); + return NULL; + } + /* adapter index out of range */ + if (adapter_num >= number_of_adapters) { + printf("Invalid adapter_num: %d\n", adapter_num); + free(pa); + pcap_freealldevs(alldevs); + return NULL; + } +#ifndef PCAPIF_LIB_QUIET + printf("Using adapter_num: %d\n", adapter_num); +#endif /* PCAPIF_LIB_QUIET */ + /* set up the selected adapter */ + + LWIP_ASSERT("used_adapter != NULL", used_adapter != NULL); + + /* Open the device */ + pa->adapter = pcapif_open_adapter(used_adapter->name, errbuf); + if (pa->adapter == NULL) { + printf("\nUnable to open the adapter. %s is not supported by pcap (\"%s\").\n", used_adapter->name, errbuf); + /* Free the device list */ + pcap_freealldevs(alldevs); + free(pa); + return NULL; + } + printf("Using adapter: \"%s\"\n", pa->description); + pcap_freealldevs(alldevs); + +#if PCAPIF_HANDLE_LINKSTATE + pa->link_state = pcapifh_linkstate_init(pa->name); + pa->last_link_event = PCAPIF_LINKEVENT_UNKNOWN; +#endif /* PCAPIF_HANDLE_LINKSTATE */ + + return pa; +} + +#if PCAPIF_HANDLE_LINKSTATE +static void +pcapif_check_linkstate(void *netif_ptr) +{ + struct netif *netif = (struct netif*)netif_ptr; + struct pcapif_private *pa = (struct pcapif_private*)PCAPIF_GET_STATE_PTR(netif); + enum pcapifh_link_event le; + + le = pcapifh_linkstate_get(pa->link_state); + + if (pa->last_link_event != le) { + pa->last_link_event = le; + switch (le) { + case PCAPIF_LINKEVENT_UP: { + PCAPIF_NOTIFY_LINKSTATE(netif, netif_set_link_up); + break; + } + case PCAPIF_LINKEVENT_DOWN: { + PCAPIF_NOTIFY_LINKSTATE(netif, netif_set_link_down); + break; + } + case PCAPIF_LINKEVENT_UNKNOWN: /* fall through */ + default: + break; + } + } + sys_timeout(PCAPIF_LINKCHECK_INTERVAL_MS, pcapif_check_linkstate, netif); +} +#endif /* PCAPIF_HANDLE_LINKSTATE */ + + +/** + * Close the adapter (no more packets can be sent or received) + * + * @param netif netif to shutdown + */ +void +pcapif_shutdown(struct netif *netif) +{ + struct pcapif_private *pa = (struct pcapif_private*)PCAPIF_GET_STATE_PTR(netif); + if (pa) { +#if PCAPIF_RX_USE_THREAD + pa->rx_run = 0; +#endif /* PCAPIF_RX_USE_THREAD */ + if (pa->adapter) { + pcap_breakloop(pa->adapter); + pcap_close(pa->adapter); + } +#if PCAPIF_RX_USE_THREAD + /* wait for rxthread to end */ + while(pa->rx_running); +#endif /* PCAPIF_RX_USE_THREAD */ +#if PCAPIF_HANDLE_LINKSTATE + pcapifh_linkstate_close(pa->link_state); +#endif /* PCAPIF_HANDLE_LINKSTATE */ + free(pa); + } +} + +#if PCAPIF_RX_USE_THREAD +/** RX running in its own thread */ +static void +pcapif_input_thread(void *arg) +{ + struct netif *netif = (struct netif *)arg; + struct pcapif_private *pa = (struct pcapif_private*)PCAPIF_GET_STATE_PTR(netif); + do + { + struct pcap_pkthdr pkt_header; + const u_char *packet = pcap_next(pa->adapter, &pkt_header); + if(packet != NULL) { + pcapif_input((u_char*)pa, &pkt_header, packet); + } + } while (pa->rx_run); + pa->rx_running = 0; +} +#endif /* PCAPIF_RX_USE_THREAD */ + +/** Low-level initialization: find the correct adapter and initialize it. + */ +static void +pcapif_low_level_init(struct netif *netif) +{ + u8_t my_mac_addr[ETH_HWADDR_LEN] = LWIP_MAC_ADDR_BASE; + int adapter_num = PACKET_LIB_ADAPTER_NR; + struct pcapif_private *pa; +#ifdef PACKET_LIB_GET_ADAPTER_NETADDRESS + ip4_addr_t netaddr; +#define GUID_LEN 128 + char guid[GUID_LEN + 1]; +#endif /* PACKET_LIB_GET_ADAPTER_NETADDRESS */ + + /* If 'state' is != NULL at this point, we assume it is an 'int' giving + the index of the adapter to use (+ 1 because 0==NULL is invalid). + This can be used to instantiate multiple PCAP drivers. */ + if (netif->state != NULL) { + adapter_num = (LWIP_PTR_NUMERIC_CAST(int, netif->state)) - 1; + if (adapter_num < 0) { + printf("ERROR: invalid adapter index \"%d\"!\n", adapter_num); + LWIP_ASSERT("ERROR initializing network adapter!\n", 0); + return; + } + } + +#ifdef PACKET_LIB_GET_ADAPTER_NETADDRESS + memset(&guid, 0, sizeof(guid)); + PACKET_LIB_GET_ADAPTER_NETADDRESS(&netaddr); + if (get_adapter_index_from_addr((struct in_addr *)&netaddr, guid, GUID_LEN) < 0) { + printf("ERROR initializing network adapter, failed to get GUID for network address %s\n", ip4addr_ntoa(&netaddr)); + LWIP_ASSERT("ERROR initializing network adapter, failed to get GUID for network address!", 0); + return; + } + adapter_num = get_adapter_index(guid); + if (adapter_num < 0) { + printf("ERROR finding network adapter with GUID \"%s\"!\n", guid); + LWIP_ASSERT("ERROR finding network adapter with expected GUID!", 0); + return; + } + +#else /* PACKET_LIB_GET_ADAPTER_NETADDRESS */ +#ifdef PACKET_LIB_ADAPTER_GUID + /* get adapter index for guid string */ + adapter_num = get_adapter_index(PACKET_LIB_ADAPTER_GUID); + if (adapter_num < 0) { + printf("ERROR finding network adapter with GUID \"%s\"!\n", PACKET_LIB_ADAPTER_GUID); + LWIP_ASSERT("ERROR initializing network adapter!\n", 0); + return; + } +#endif /* PACKET_LIB_ADAPTER_GUID */ +#endif /* PACKET_LIB_GET_ADAPTER_NETADDRESS */ + + /* Do whatever else is needed to initialize interface. */ + pa = pcapif_init_adapter(adapter_num, netif); + if (pa == NULL) { + printf("ERROR initializing network adapter %d!\n", adapter_num); + LWIP_ASSERT("ERROR initializing network adapter!", 0); + return; + } + netif->state = pa; + + /* change the MAC address to a unique value + so that multiple ethernetifs are supported */ + /* @todo: this does NOT support multiple processes using this adapter! */ + my_mac_addr[ETH_HWADDR_LEN - 1] += netif->num; + /* Copy MAC addr */ + SMEMCPY(&netif->hwaddr, my_mac_addr, ETH_HWADDR_LEN); + + /* get the initial link state of the selected interface */ +#if PCAPIF_HANDLE_LINKSTATE + pa->last_link_event = pcapifh_linkstate_get(pa->link_state); + if (pa->last_link_event == PCAPIF_LINKEVENT_DOWN) { + netif_set_link_down(netif); + } else { + netif_set_link_up(netif); + } + sys_timeout(PCAPIF_LINKCHECK_INTERVAL_MS, pcapif_check_linkstate, netif); +#else /* PCAPIF_HANDLE_LINKSTATE */ + /* just set the link up so that lwIP can transmit */ + netif_set_link_up(netif); +#endif /* PCAPIF_HANDLE_LINKSTATE */ + +#if PCAPIF_RX_USE_THREAD + pa->rx_run = 1; + pa->rx_running = 1; + sys_thread_new("pcapif_rxthread", pcapif_input_thread, netif, 0, 0); +#endif + + LWIP_DEBUGF(NETIF_DEBUG, ("pcapif: eth_addr %02X%02X%02X%02X%02X%02X\n",netif->hwaddr[0],netif->hwaddr[1],netif->hwaddr[2],netif->hwaddr[3],netif->hwaddr[4],netif->hwaddr[5])); +} + +/** low_level_output(): + * Transmit a packet. The packet is contained in the pbuf that is passed to + * the function. This pbuf might be chained. + */ +static err_t +pcapif_low_level_output(struct netif *netif, struct pbuf *p) +{ + struct pbuf *q; + unsigned char buffer[ETH_MAX_FRAME_LEN + ETH_PAD_SIZE]; + unsigned char *buf = buffer; + unsigned char *ptr; + struct eth_hdr *ethhdr; + u16_t tot_len = p->tot_len - ETH_PAD_SIZE; + struct pcapif_private *pa = (struct pcapif_private*)PCAPIF_GET_STATE_PTR(netif); + +#if defined(LWIP_DEBUG) && LWIP_NETIF_TX_SINGLE_PBUF && !(LWIP_IPV4 && IP_FRAG) && (LWIP_IPV6 && LWIP_IPV6_FRAG) + LWIP_ASSERT("p->next == NULL && p->len == p->tot_len", p->next == NULL && p->len == p->tot_len); +#endif + + /* initiate transfer */ + if ((p->len == p->tot_len) && (p->len >= ETH_MIN_FRAME_LEN + ETH_PAD_SIZE)) { + /* no pbuf chain, don't have to copy -> faster */ + buf = &((unsigned char*)p->payload)[ETH_PAD_SIZE]; + } else { + /* pbuf chain, copy into contiguous buffer */ + if (p->tot_len >= sizeof(buffer)) { + LINK_STATS_INC(link.lenerr); + LINK_STATS_INC(link.drop); + MIB2_STATS_NETIF_INC(netif, ifoutdiscards); + return ERR_BUF; + } + ptr = buffer; + for(q = p; q != NULL; q = q->next) { + /* Send the data from the pbuf to the interface, one pbuf at a + time. The size of the data in each pbuf is kept in the ->len + variable. */ + /* send data from(q->payload, q->len); */ + LWIP_DEBUGF(NETIF_DEBUG, ("netif: send ptr %p q->payload %p q->len %i q->next %p\n", ptr, q->payload, (int)q->len, (void*)q->next)); + if (q == p) { + MEMCPY(ptr, &((char*)q->payload)[ETH_PAD_SIZE], q->len - ETH_PAD_SIZE); + ptr += q->len - ETH_PAD_SIZE; + } else { + MEMCPY(ptr, q->payload, q->len); + ptr += q->len; + } + } + } + + if (tot_len < ETH_MIN_FRAME_LEN) { + /* ensure minimal frame length */ + memset(&buf[tot_len], 0, ETH_MIN_FRAME_LEN - tot_len); + tot_len = ETH_MIN_FRAME_LEN; + } + + /* signal that packet should be sent */ + if (pcap_sendpacket(pa->adapter, buf, tot_len) < 0) { + LINK_STATS_INC(link.memerr); + LINK_STATS_INC(link.drop); + MIB2_STATS_NETIF_INC(netif, ifoutdiscards); + return ERR_BUF; + } + if (netif_is_link_up(netif)) { + pcapif_add_tx_packet(pa, buf, tot_len); + } + + LINK_STATS_INC(link.xmit); + MIB2_STATS_NETIF_ADD(netif, ifoutoctets, tot_len); + ethhdr = (struct eth_hdr *)p->payload; + if ((ethhdr->dest.addr[0] & 1) != 0) { + /* broadcast or multicast packet*/ + MIB2_STATS_NETIF_INC(netif, ifoutnucastpkts); + } else { + /* unicast packet */ + MIB2_STATS_NETIF_INC(netif, ifoutucastpkts); + } + return ERR_OK; +} + +/** low_level_input(): Allocate a pbuf and transfer the bytes of the incoming + * packet from the interface into the pbuf. + */ +static struct pbuf * +pcapif_low_level_input(struct netif *netif, const void *packet, int packet_len) +{ + struct pbuf *p, *q; + int start; + int length = packet_len; + const struct eth_addr *dest = (const struct eth_addr*)packet; + int unicast; +#if PCAPIF_FILTER_GROUP_ADDRESSES && !PCAPIF_RECEIVE_PROMISCUOUS + const u8_t bcast[] = {0xff, 0xff, 0xff, 0xff, 0xff, 0xff}; + const u8_t ipv4mcast[] = {0x01, 0x00, 0x5e}; + const u8_t ipv6mcast[] = {0x33, 0x33}; +#endif /* PCAPIF_FILTER_GROUP_ADDRESSES && !PCAPIF_RECEIVE_PROMISCUOUS */ + + if (pcaipf_is_tx_packet(netif, packet, packet_len)) { + /* don't update counters here! */ + return NULL; + } + + unicast = ((dest->addr[0] & 0x01) == 0); +#if !PCAPIF_RECEIVE_PROMISCUOUS + /* MAC filter: only let my MAC or non-unicast through (pcap receives loopback traffic, too) */ + if (memcmp(dest, &netif->hwaddr, ETH_HWADDR_LEN) && +#if PCAPIF_FILTER_GROUP_ADDRESSES + (memcmp(dest, ipv4mcast, 3) || ((dest->addr[3] & 0x80) != 0)) && + memcmp(dest, ipv6mcast, 2) && + memcmp(dest, bcast, 6) +#else /* PCAPIF_FILTER_GROUP_ADDRESSES */ + unicast +#endif /* PCAPIF_FILTER_GROUP_ADDRESSES */ + ) { + /* don't update counters here! */ + return NULL; + } +#endif /* !PCAPIF_RECEIVE_PROMISCUOUS */ + + /* We allocate a pbuf chain of pbufs from the pool. */ + p = pbuf_alloc(PBUF_RAW, (u16_t)length + ETH_PAD_SIZE, PBUF_POOL); + LWIP_DEBUGF(NETIF_DEBUG, ("netif: recv length %i p->tot_len %i\n", length, (int)p->tot_len)); + + if (p != NULL) { + /* We iterate over the pbuf chain until we have read the entire + packet into the pbuf. */ + start = 0; + for (q = p; q != NULL; q = q->next) { + u16_t copy_len = q->len; + /* Read enough bytes to fill this pbuf in the chain. The + available data in the pbuf is given by the q->len + variable. */ + /* read data into(q->payload, q->len); */ + LWIP_DEBUGF(NETIF_DEBUG, ("netif: recv start %i length %i q->payload %p q->len %i q->next %p\n", start, length, q->payload, (int)q->len, (void*)q->next)); + if (q == p) { +#if ETH_PAD_SIZE + LWIP_ASSERT("q->len >= ETH_PAD_SIZE", q->len >= ETH_PAD_SIZE); + copy_len -= ETH_PAD_SIZE; +#endif /* ETH_PAD_SIZE*/ + MEMCPY(&((char*)q->payload)[ETH_PAD_SIZE], &((const char*)packet)[start], copy_len); + } else { + MEMCPY(q->payload, &((const char*)packet)[start], copy_len); + } + start += copy_len; + length -= copy_len; + if (length <= 0) { + break; + } + } + LINK_STATS_INC(link.recv); + MIB2_STATS_NETIF_ADD(netif, ifinoctets, p->tot_len - ETH_PAD_SIZE); + if (unicast) { + MIB2_STATS_NETIF_INC(netif, ifinucastpkts); + } else { + MIB2_STATS_NETIF_INC(netif, ifinnucastpkts); + } + } else { + /* drop packet */ + LINK_STATS_INC(link.memerr); + LINK_STATS_INC(link.drop); + MIB2_STATS_NETIF_INC(netif, ifindiscards); + } + + return p; +} + +#if PCAPIF_RX_REF +static void +pcapif_rx_pbuf_free_custom(struct pbuf *p) +{ + struct pcapif_pbuf_custom* ppc; + LWIP_ASSERT("NULL pointer", p != NULL); + ppc = (struct pcapif_pbuf_custom*)p; + LWIP_ASSERT("NULL pointer", ppc->p != NULL); + pbuf_free(ppc->p); + ppc->p = NULL; + mem_free(p); +} + +static struct pbuf* +pcapif_rx_ref(struct pbuf* p) +{ + struct pcapif_pbuf_custom* ppc; + struct pbuf* q; + + LWIP_ASSERT("NULL pointer", p != NULL); + LWIP_ASSERT("chained pbuf not supported here", p->next == NULL); + + ppc = (struct pcapif_pbuf_custom*)mem_malloc(sizeof(struct pcapif_pbuf_custom)); + LWIP_ASSERT("out of memory for RX", ppc != NULL); + ppc->pc.custom_free_function = pcapif_rx_pbuf_free_custom; + ppc->p = p; + + q = pbuf_alloced_custom(PBUF_RAW, p->tot_len, PBUF_REF, &ppc->pc, p->payload, p->tot_len); + LWIP_ASSERT("pbuf_alloced_custom returned NULL", q != NULL); + return q; +} +#endif /* PCAPIF_RX_REF */ + +/** pcapif_input: This function is called when a packet is ready to be read + * from the interface. It uses the function low_level_input() that should + * handle the actual reception of bytes from the network interface. + */ +static void +pcapif_input(u_char *user, const struct pcap_pkthdr *pkt_header, const u_char *packet) +{ + struct pcapif_private *pa = (struct pcapif_private*)user; + int packet_len = pkt_header->caplen; + struct netif *netif = (struct netif *)pa->input_fn_arg; + struct pbuf *p; + + PCAPIF_RX_LOCK_LWIP(); + + /* move received packet into a new pbuf */ + p = pcapif_low_level_input(netif, packet, packet_len); + /* if no packet could be read, silently ignore this */ + if (p != NULL) { +#if PCAPIF_RX_REF + p = pcapif_rx_ref(p); +#endif + /* pass all packets to ethernet_input, which decides what packets it supports */ + if (netif->input(p, netif) != ERR_OK) { + LWIP_DEBUGF(NETIF_DEBUG, ("ethernetif_input: IP input error\n")); + pbuf_free(p); + } + } + PCAPIF_RX_UNLOCK_LWIP(); +} + +/** + * pcapif_init(): initialization function, pass to netif_add(). + */ +err_t +pcapif_init(struct netif *netif) +{ + static int ethernetif_index; + + int local_index; + SYS_ARCH_DECL_PROTECT(lev); + SYS_ARCH_PROTECT(lev); + local_index = ethernetif_index++; + SYS_ARCH_UNPROTECT(lev); + + LWIP_ASSERT("pcapif needs an input callback", netif->input != NULL); + + netif->name[0] = IFNAME0; + netif->name[1] = (char)(IFNAME1 + local_index); + netif->linkoutput = pcapif_low_level_output; +#if LWIP_IPV4 +#if LWIP_ARP + netif->output = etharp_output; +#else /* LWIP_ARP */ + netif->output = NULL; /* not used for PPPoE */ +#endif /* LWIP_ARP */ +#endif /* LWIP_IPV4 */ +#if LWIP_IPV6 + netif->output_ip6 = ethip6_output; +#endif /* LWIP_IPV6 */ +#if LWIP_NETIF_HOSTNAME + /* Initialize interface hostname */ + netif_set_hostname(netif, "lwip"); +#endif /* LWIP_NETIF_HOSTNAME */ + + netif->mtu = 1500; + netif->flags = NETIF_FLAG_BROADCAST | NETIF_FLAG_ETHARP | NETIF_FLAG_ETHERNET | NETIF_FLAG_IGMP; +#if LWIP_IPV6 && LWIP_IPV6_MLD + netif->flags |= NETIF_FLAG_MLD6; +#endif /* LWIP_IPV6 && LWIP_IPV6_MLD */ + netif->hwaddr_len = ETH_HWADDR_LEN; + + NETIF_INIT_SNMP(netif, snmp_ifType_ethernet_csmacd, 100000000); + + /* sets link up or down based on current status */ + pcapif_low_level_init(netif); + + return ERR_OK; +} + +#if !PCAPIF_RX_USE_THREAD +void +pcapif_poll(struct netif *netif) +{ + struct pcapif_private *pa = (struct pcapif_private*)PCAPIF_GET_STATE_PTR(netif); + + int ret; + do { + if (pa->adapter != NULL) { + ret = pcap_dispatch(pa->adapter, -1, pcapif_input, (u_char*)pa); + } else { + ret = -1; + } + if (ret < 0) { + /* error (e.g. adapter removed or resume from standby), try to reopen the adapter */ + pcap_reopen_adapter(pa); + } + } while (ret > 0); + +} +#endif /* !PCAPIF_RX_USE_THREAD */ + +#endif /* LWIP_ETHERNET */ diff --git a/contrib/ports/win32/pcapif.h b/contrib/ports/win32/pcapif.h new file mode 100644 index 00000000..8d67ea42 --- /dev/null +++ b/contrib/ports/win32/pcapif.h @@ -0,0 +1,32 @@ +#ifndef LWIP_PCAPIF_H +#define LWIP_PCAPIF_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include "lwip/err.h" + +/** Set to 1 to let rx use an own thread (only for NO_SYS==0). + * If set to 0, ethernetif_poll is used to poll for packets. + */ +#ifndef PCAPIF_RX_USE_THREAD +#define PCAPIF_RX_USE_THREAD !NO_SYS +#endif +#if PCAPIF_RX_USE_THREAD && NO_SYS +#error "Can't create a dedicated RX thread with NO_SYS==1" +#endif + +struct netif; + +err_t pcapif_init (struct netif *netif); +void pcapif_shutdown(struct netif *netif); +#if !PCAPIF_RX_USE_THREAD +void pcapif_poll (struct netif *netif); +#endif /* !PCAPIF_RX_USE_THREAD */ + +#ifdef __cplusplus +} +#endif + +#endif /* LWIP_PCAPIF_H */ diff --git a/contrib/ports/win32/pcapif_helper.c b/contrib/ports/win32/pcapif_helper.c new file mode 100644 index 00000000..de5147fd --- /dev/null +++ b/contrib/ports/win32/pcapif_helper.c @@ -0,0 +1,105 @@ +/** + * pcapif_helper.c - This file is part of lwIP pcapif and provides helper functions + * for managing the link state. + */ + +#include "pcapif_helper.h" + +#include +#include + +#include "lwip/arch.h" + +#ifdef WIN32 + +#define WIN32_LEAN_AND_MEAN + +#ifdef _MSC_VER +#pragma warning( push, 3 ) +#endif +#include +#include +#include +#ifdef _MSC_VER +#pragma warning ( pop ) +#endif + +struct pcapifh_linkstate { + LPADAPTER lpAdapter; + PPACKET_OID_DATA ppacket_oid_data; +}; + +struct pcapifh_linkstate* pcapifh_linkstate_init(char *adapter_name) +{ + struct pcapifh_linkstate* state = (struct pcapifh_linkstate*)malloc(sizeof(struct pcapifh_linkstate)); + if (state != NULL) { + memset(state, 0, sizeof(struct pcapifh_linkstate)); + state->ppacket_oid_data = (PPACKET_OID_DATA)malloc(sizeof(PACKET_OID_DATA) + sizeof(NDIS_MEDIA_STATE)); + if (state->ppacket_oid_data == NULL) { + free(state); + state = NULL; + } else { + state->lpAdapter = PacketOpenAdapter((char*)adapter_name); + if ((state->lpAdapter == NULL) || (state->lpAdapter->hFile == INVALID_HANDLE_VALUE)) { + /* failed to open adapter */ + free(state); + state = NULL; + } + } + } + return state; +} + +enum pcapifh_link_event pcapifh_linkstate_get(struct pcapifh_linkstate* state) +{ + enum pcapifh_link_event ret = PCAPIF_LINKEVENT_UNKNOWN; + if (state != NULL) { + state->ppacket_oid_data->Oid = OID_GEN_MEDIA_CONNECT_STATUS; + state->ppacket_oid_data->Length = sizeof(NDIS_MEDIA_STATE); + if (PacketRequest(state->lpAdapter, FALSE, state->ppacket_oid_data)) { + NDIS_MEDIA_STATE fNdisMediaState; + fNdisMediaState = (*((PNDIS_MEDIA_STATE)(state->ppacket_oid_data->Data))); + ret = ((fNdisMediaState == NdisMediaStateConnected) ? PCAPIF_LINKEVENT_UP : PCAPIF_LINKEVENT_DOWN); + } + } + return ret; +} + +void pcapifh_linkstate_close(struct pcapifh_linkstate* state) +{ + if (state != NULL) { + if (state->lpAdapter != NULL) { + PacketCloseAdapter(state->lpAdapter); + } + if (state->ppacket_oid_data != NULL) { + free(state->ppacket_oid_data); + } + free(state); + } +} + +#else /* WIN32 */ + +/* @todo: add linux/unix implementation? */ + +struct pcapifh_linkstate { + u8_t empty; +}; + +struct pcapifh_linkstate* pcapifh_linkstate_init(char *adapter_name) +{ + LWIP_UNUSED_ARG(adapter_name); + return NULL; +} + +enum pcapifh_link_event pcapifh_linkstate_get(struct pcapifh_linkstate* state) +{ + LWIP_UNUSED_ARG(state); + return PCAPIF_LINKEVENT_UP; +} +void pcapifh_linkstate_close(struct pcapifh_linkstate* state) +{ + LWIP_UNUSED_ARG(state); +} + +#endif /* WIN32 */ \ No newline at end of file diff --git a/contrib/ports/win32/pcapif_helper.h b/contrib/ports/win32/pcapif_helper.h new file mode 100644 index 00000000..da088548 --- /dev/null +++ b/contrib/ports/win32/pcapif_helper.h @@ -0,0 +1,25 @@ +#ifndef LWIP_PCAPIF_HELPER_H +#define LWIP_PCAPIF_HELPER_H + +#ifdef __cplusplus +extern "C" { +#endif + +struct pcapifh_linkstate; + +enum pcapifh_link_event { + PCAPIF_LINKEVENT_UNKNOWN, + PCAPIF_LINKEVENT_UP, + PCAPIF_LINKEVENT_DOWN +}; + +struct pcapifh_linkstate* pcapifh_linkstate_init(char *adapter_name); +enum pcapifh_link_event pcapifh_linkstate_get(struct pcapifh_linkstate* state); +void pcapifh_linkstate_close(struct pcapifh_linkstate* state); + + +#ifdef __cplusplus +} +#endif + +#endif /* LWIP_PCAPIF_HELPER_H */ \ No newline at end of file diff --git a/contrib/ports/win32/readme.txt b/contrib/ports/win32/readme.txt new file mode 100644 index 00000000..02a79e25 --- /dev/null +++ b/contrib/ports/win32/readme.txt @@ -0,0 +1,26 @@ +lwIP for Win32 + +This is an example port of lwIP for Win32. It uses WinPCAP to send & receive packets. +To compile it, use the MSVC projects in the 'msvc' subdir or the Makefile in the 'mingw' subdir. + +For both compilers: +- the lwIP core repository must be in a folder "lwip" next to the "contrib" folder +- you have to set an environment variable PCAP_DIR pointing to the WinPcap Developer's + Pack (containing 'include' and 'lib') + alternatively, place the WinPcap Developer's pack next to the "lwip" and "contrib" folders: + "winpcap\WpdPack" + +You also will have to copy the file 'lwipcfg_msvc.h.example' to +'lwipcfg_msvc.h' and modify to suit your needs (WinPcap adapter number, +IP configuration, applications...). + +Included in the contrib\ports\win32 directory is the network interface driver +using the winpcap library. + +lwIP: http://savannah.nongnu.org/projects/lwip/ +WinPCap: https://www.winpcap.org/devel.htm +Visual C++: http://www.microsoft.com/express/download/ + +To compile the unittests (msvc\lwIP_unittests.sln), download check (tested with v0.11.0) from +https://github.com/libcheck/check/releases/ +and place it in a folder "check" next to the "contrib" folder. diff --git a/contrib/ports/win32/sio.c b/contrib/ports/win32/sio.c new file mode 100644 index 00000000..aa957e92 --- /dev/null +++ b/contrib/ports/win32/sio.c @@ -0,0 +1,304 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + */ + +#include +#include +#include + +#include +#include + +#ifdef _MSC_VER +#pragma warning (push, 3) +#endif +#include +#ifdef _MSC_VER +#pragma warning (pop) +#endif +#include "lwipcfg.h" + +/** When 1, use COM ports, when 0, use named pipes (for simulation). */ +#ifndef SIO_USE_COMPORT +#define SIO_USE_COMPORT 1 +#endif + +/** If SIO_USE_COMPORT==1, use COMx, if 0, use a pipe (default) */ +#if SIO_USE_COMPORT +#define SIO_DEVICENAME "\\\\.\\COM" +#else +#define SIO_DEVICENAME "\\\\.\\pipe\\lwip" +#endif + +#if SIO_USE_COMPORT +#ifndef SIO_COMPORT_SPEED +#define SIO_COMPORT_SPEED 115200 +#endif +#ifndef SIO_COMPORT_BYTESIZE +#define SIO_COMPORT_BYTESIZE 8 +#endif +#ifndef SIO_COMPORT_STOPBITS +#define SIO_COMPORT_STOPBITS 0 /* ONESTOPBIT */ +#endif +#ifndef SIO_COMPORT_PARITY +#define SIO_COMPORT_PARITY 0 /* NOPARITY */ +#endif +#endif /* SIO_USE_COMPORT */ + +static int sio_abort = 0; + +/* \\.\pipe\lwip0 */ +/* pppd /dev/ttyS0 logfile mylog debug nocrtscts local noauth noccp ms-dns 212.27.54.252 192.168.0.4:192.168.0.5 + */ + +/** + * SIO_DEBUG: Enable debugging for SIO. + */ +#ifndef SIO_DEBUG +#define SIO_DEBUG LWIP_DBG_OFF +#endif + +#if SIO_USE_COMPORT +/** When using a real COM port, set up the + * serial line settings (baudrate etc.) + */ +static BOOL +sio_setup(HANDLE fd) +{ + COMMTIMEOUTS cto; + DCB dcb; + + /* set up baudrate and other communication settings */ + memset(&dcb, 0, sizeof(dcb)); + /* Obtain the DCB structure for the device */ + if (!GetCommState(fd, &dcb)) { + return FALSE; + } + /* Set the new data */ + dcb.BaudRate = SIO_COMPORT_SPEED; + dcb.ByteSize = SIO_COMPORT_BYTESIZE; + dcb.StopBits = 0; /* ONESTOPBIT */ + dcb.Parity = 0; /* NOPARITY */ + dcb.fParity = 0; /* parity is not used */ + /* do not use flow control */ + /*dcb.fOutxDsrFlow = dcb.fDtrControl = 0; + dcb.fOutxCtsFlow = dcb.fRtsControl = 0; + dcb.fErrorChar = dcb.fNull = 0; + dcb.fInX = dcb.fOutX = 0; + dcb.XonChar = dcb.XoffChar = 0; + dcb.XonLim = dcb.XoffLim = 100;*/ + + /* Set the new DCB structure */ + if (!SetCommState(fd, &dcb)) { + return FALSE; + } + + memset(&cto, 0, sizeof(cto)); + if(!GetCommTimeouts(fd, &cto)) + { + return FALSE; + } + /* change read timeout, leave write timeout as it is */ + cto.ReadIntervalTimeout = 1; + cto.ReadTotalTimeoutMultiplier = 0; + cto.ReadTotalTimeoutConstant = 1; /* 1 ms */ + if(!SetCommTimeouts(fd, &cto)) { + return FALSE; + } + + return TRUE; +} +#endif /* SIO_USE_COMPORT */ + +/** + * Opens a serial device for communication. + * + * @param devnum device number + * @return handle to serial device if successful, NULL otherwise + */ +sio_fd_t sio_open(u8_t devnum) +{ + HANDLE fileHandle = INVALID_HANDLE_VALUE; + CHAR fileName[256]; + LWIP_DEBUGF(SIO_DEBUG, ("sio_open(%lu)\n", (DWORD)devnum)); +#if SIO_USE_COMPORT + snprintf(fileName, 255, SIO_DEVICENAME"%lu", (DWORD)(devnum)); +#else /* SIO_USE_COMPORT */ + snprintf(fileName, 255, SIO_DEVICENAME"%lu", (DWORD)(devnum & ~1)); + if ((devnum & 1) == 0) { + fileHandle = CreateNamedPipeA(fileName, PIPE_ACCESS_DUPLEX, PIPE_TYPE_BYTE | PIPE_NOWAIT, + PIPE_UNLIMITED_INSTANCES, 102400, 102400, 100, NULL); + } else +#endif /* SIO_USE_COMPORT */ + { + fileHandle = CreateFileA(fileName, GENERIC_READ | GENERIC_WRITE, 0, NULL, OPEN_EXISTING, 0, NULL); + } + if (fileHandle != INVALID_HANDLE_VALUE) { + sio_abort = 0; +#if !SIO_USE_COMPORT + if (devnum & 1) { + DWORD mode = PIPE_NOWAIT; + if (!SetNamedPipeHandleState(fileHandle, &mode, NULL, NULL)) { + LWIP_DEBUGF(SIO_DEBUG, ("sio_open(%lu): SetNamedPipeHandleState failed. GetLastError() returns %d\n", + (DWORD)devnum, GetLastError())); + } + } else +#endif /* !SIO_USE_COMPORT */ + { + FlushFileBuffers(fileHandle); + } +#if SIO_USE_COMPORT + if(!sio_setup(fileHandle)) { + CloseHandle(fileHandle); + LWIP_DEBUGF(SIO_DEBUG, ("sio_open(%lu): sio_setup failed. GetLastError() returns %lu\n", + (DWORD)devnum, GetLastError())); + return NULL; + } +#endif /* SIO_USE_COMPORT */ + LWIP_DEBUGF(SIO_DEBUG, ("sio_open: file \"%s\" successfully opened.\n", fileName)); + printf("sio_open: file \"%s\" (%d) successfully opened: 0x%08x\n", fileName, devnum, LWIP_PTR_NUMERIC_CAST(unsigned int, fileHandle)); + return (sio_fd_t)(fileHandle); + } + LWIP_DEBUGF(SIO_DEBUG, ("sio_open(%lu) failed. GetLastError() returns %lu\n", + (DWORD)devnum, GetLastError())); + printf("sio_open(%lu) failed. GetLastError() returns %lu\n", + (DWORD)devnum, GetLastError()); + return NULL; +} + +/** + * Sends a single character to the serial device. + * + * @param c character to send + * @param fd serial device handle + * + * @note This function will block until the character can be sent. + */ +void sio_send(u8_t c, sio_fd_t fd) +{ + DWORD dwNbBytesWritten = 0; + LWIP_DEBUGF(SIO_DEBUG, ("sio_send(%lu)\n", (DWORD)c)); + while ((!WriteFile((HANDLE)(fd), &c, 1, &dwNbBytesWritten, NULL)) || (dwNbBytesWritten < 1)) { + } +} + +/** + * Receives a single character from the serial device. + * + * @param fd serial device handle + * + * @note This function will block until a character is received. + */ +u8_t sio_recv(sio_fd_t fd) +{ + DWORD dwNbBytesReadden = 0; + u8_t byte = 0; + LWIP_DEBUGF(SIO_DEBUG, ("sio_recv()\n")); + while ((sio_abort == 0) && ((!ReadFile((HANDLE)(fd), &byte, 1, &dwNbBytesReadden, NULL)) || (dwNbBytesReadden < 1))); + LWIP_DEBUGF(SIO_DEBUG, ("sio_recv()=%lu\n", (DWORD)byte)); + return byte; +} + +/** + * Reads from the serial device. + * + * @param fd serial device handle + * @param data pointer to data buffer for receiving + * @param len maximum length (in bytes) of data to receive + * @return number of bytes actually received - may be 0 if aborted by sio_read_abort + * + * @note This function will block until data can be received. The blocking + * can be cancelled by calling sio_read_abort(). + */ +u32_t sio_read(sio_fd_t fd, u8_t* data, u32_t len) +{ + BOOL ret; + DWORD dwNbBytesReadden = 0; + LWIP_DEBUGF(SIO_DEBUG, ("sio_read()...\n")); + ret = ReadFile((HANDLE)(fd), data, len, &dwNbBytesReadden, NULL); + LWIP_DEBUGF(SIO_DEBUG, ("sio_read()=%lu bytes -> %d\n", dwNbBytesReadden, ret)); + LWIP_UNUSED_ARG(ret); + return dwNbBytesReadden; +} + +/** + * Tries to read from the serial device. Same as sio_read but returns + * immediately if no data is available and never blocks. + * + * @param fd serial device handle + * @param data pointer to data buffer for receiving + * @param len maximum length (in bytes) of data to receive + * @return number of bytes actually received + */ +u32_t sio_tryread(sio_fd_t fd, u8_t* data, u32_t len) +{ + /* @todo: implement non-blocking read */ + BOOL ret; + DWORD dwNbBytesReadden = 0; + LWIP_DEBUGF(SIO_DEBUG, ("sio_read()...\n")); + ret = ReadFile((HANDLE)(fd), data, len, &dwNbBytesReadden, NULL); + LWIP_DEBUGF(SIO_DEBUG, ("sio_read()=%lu bytes -> %d\n", dwNbBytesReadden, ret)); + LWIP_UNUSED_ARG(ret); + return dwNbBytesReadden; +} + +/** + * Writes to the serial device. + * + * @param fd serial device handle + * @param data pointer to data to send + * @param len length (in bytes) of data to send + * @return number of bytes actually sent + * + * @note This function will block until all data can be sent. + */ +u32_t sio_write(sio_fd_t fd, u8_t* data, u32_t len) +{ + BOOL ret; + DWORD dwNbBytesWritten = 0; + LWIP_DEBUGF(SIO_DEBUG, ("sio_write()...\n")); + ret = WriteFile((HANDLE)(fd), data, len, &dwNbBytesWritten, NULL); + LWIP_DEBUGF(SIO_DEBUG, ("sio_write()=%lu bytes -> %d\n", dwNbBytesWritten, ret)); + LWIP_UNUSED_ARG(ret); + return dwNbBytesWritten; +} + +/** + * Aborts a blocking sio_read() call. + * @todo: This currently ignores fd and aborts all reads + * + * @param fd serial device handle + */ +void sio_read_abort(sio_fd_t fd) +{ + LWIP_UNUSED_ARG(fd); + LWIP_DEBUGF(SIO_DEBUG, ("sio_read_abort() !!!!!...\n")); + sio_abort = 1; + return; +} diff --git a/contrib/ports/win32/sys_arch.c b/contrib/ports/win32/sys_arch.c new file mode 100644 index 00000000..84232d5b --- /dev/null +++ b/contrib/ports/win32/sys_arch.c @@ -0,0 +1,772 @@ +/* + * Copyright (c) 2001-2003 Swedish Institute of Computer Science. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT + * SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT + * OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING + * IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY + * OF SUCH DAMAGE. + * + * This file is part of the lwIP TCP/IP stack. + * + * Author: Adam Dunkels + * Simon Goldschmidt + * + */ + +#include +#include /* sprintf() for task names */ + +#ifdef _MSC_VER +#pragma warning (push, 3) +#endif +#include +#ifdef _MSC_VER +#pragma warning (pop) +#endif +#include + +#include +#include +#include +#include +#include +#include + +/** Set this to 1 to enable assertion checks that SYS_ARCH_PROTECT() is only + * called once in a call stack (calling it nested might cause trouble in some + * implementations, so let's avoid this in core code as long as we can). + */ +#ifndef LWIP_SYS_ARCH_CHECK_NESTED_PROTECT +#define LWIP_SYS_ARCH_CHECK_NESTED_PROTECT 1 +#endif + +/** Set this to 1 to enable assertion checks that SYS_ARCH_PROTECT() is *not* + * called before functions potentiolly involving the OS scheduler. + * + * This scheme is currently broken only for non-core-locking when waking up + * threads waiting on a socket via select/poll. + */ +#ifndef LWIP_SYS_ARCH_CHECK_SCHEDULING_UNPROTECTED +#define LWIP_SYS_ARCH_CHECK_SCHEDULING_UNPROTECTED LWIP_TCPIP_CORE_LOCKING +#endif + +#define LWIP_WIN32_SYS_ARCH_ENABLE_PROTECT_COUNTER (LWIP_SYS_ARCH_CHECK_NESTED_PROTECT || LWIP_SYS_ARCH_CHECK_SCHEDULING_UNPROTECTED) + +/* These functions are used from NO_SYS also, for precise timer triggering */ +static LARGE_INTEGER freq, sys_start_time; +#define SYS_INITIALIZED() (freq.QuadPart != 0) + +static DWORD netconn_sem_tls_index; + +static HCRYPTPROV hcrypt; + +u32_t +sys_win_rand(void) +{ + u32_t ret; + if (CryptGenRandom(hcrypt, sizeof(ret), (BYTE*)&ret)) { + return ret; + } + LWIP_ASSERT("CryptGenRandom failed", 0); + return 0; +} + +static void +sys_win_rand_init(void) +{ + if (!CryptAcquireContext(&hcrypt, NULL, NULL, PROV_RSA_FULL, 0)) { + DWORD err = GetLastError(); + LWIP_PLATFORM_DIAG(("CryptAcquireContext failed with error %d, trying to create NEWKEYSET", (int)err)); + if(!CryptAcquireContext(&hcrypt, NULL, NULL, PROV_RSA_FULL, CRYPT_NEWKEYSET)) { + char errbuf[128]; + err = GetLastError(); + snprintf(errbuf, sizeof(errbuf), "CryptAcquireContext failed with error %d", (int)err); + LWIP_UNUSED_ARG(err); + LWIP_ASSERT(errbuf, 0); + } + } +} + +static void +sys_init_timing(void) +{ + QueryPerformanceFrequency(&freq); + QueryPerformanceCounter(&sys_start_time); +} + +static LONGLONG +sys_get_ms_longlong(void) +{ + LONGLONG ret; + LARGE_INTEGER now; +#if NO_SYS + if (!SYS_INITIALIZED()) { + sys_init(); + LWIP_ASSERT("initialization failed", SYS_INITIALIZED()); + } +#endif /* NO_SYS */ + QueryPerformanceCounter(&now); + ret = now.QuadPart-sys_start_time.QuadPart; + return (u32_t)(((ret)*1000)/freq.QuadPart); +} + +u32_t +sys_jiffies(void) +{ + return (u32_t)sys_get_ms_longlong(); +} + +u32_t +sys_now(void) +{ + return (u32_t)sys_get_ms_longlong(); +} + +CRITICAL_SECTION critSec; +#if LWIP_WIN32_SYS_ARCH_ENABLE_PROTECT_COUNTER +static int protection_depth; +#endif + +static void +InitSysArchProtect(void) +{ + InitializeCriticalSection(&critSec); +} + +sys_prot_t +sys_arch_protect(void) +{ +#if NO_SYS + if (!SYS_INITIALIZED()) { + sys_init(); + LWIP_ASSERT("initialization failed", SYS_INITIALIZED()); + } +#endif + EnterCriticalSection(&critSec); +#if LWIP_SYS_ARCH_CHECK_NESTED_PROTECT + LWIP_ASSERT("nested SYS_ARCH_PROTECT", protection_depth == 0); +#endif +#if LWIP_WIN32_SYS_ARCH_ENABLE_PROTECT_COUNTER + protection_depth++; +#endif + return 0; +} + +void +sys_arch_unprotect(sys_prot_t pval) +{ + LWIP_UNUSED_ARG(pval); +#if LWIP_SYS_ARCH_CHECK_NESTED_PROTECT + LWIP_ASSERT("missing SYS_ARCH_PROTECT", protection_depth == 1); +#else + LWIP_ASSERT("missing SYS_ARCH_PROTECT", protection_depth > 0); +#endif +#if LWIP_WIN32_SYS_ARCH_ENABLE_PROTECT_COUNTER + protection_depth--; +#endif + LeaveCriticalSection(&critSec); +} + +#if LWIP_SYS_ARCH_CHECK_SCHEDULING_UNPROTECTED +/** This checks that SYS_ARCH_PROTECT() hasn't been called by protecting + * and then checking the level + */ +static void +sys_arch_check_not_protected(void) +{ + sys_arch_protect(); + LWIP_ASSERT("SYS_ARCH_PROTECT before scheduling", protection_depth == 1); + sys_arch_unprotect(0); +} +#else +#define sys_arch_check_not_protected() +#endif + +static void +msvc_sys_init(void) +{ + sys_win_rand_init(); + sys_init_timing(); + InitSysArchProtect(); + netconn_sem_tls_index = TlsAlloc(); + LWIP_ASSERT("TlsAlloc failed", netconn_sem_tls_index != TLS_OUT_OF_INDEXES); +} + +void +sys_init(void) +{ + msvc_sys_init(); +} + +#if !NO_SYS + +struct threadlist { + lwip_thread_fn function; + void *arg; + DWORD id; + struct threadlist *next; +}; + +static struct threadlist *lwip_win32_threads = NULL; + +err_t +sys_sem_new(sys_sem_t *sem, u8_t count) +{ + HANDLE new_sem = NULL; + + LWIP_ASSERT("sem != NULL", sem != NULL); + + new_sem = CreateSemaphore(0, count, 100000, 0); + LWIP_ASSERT("Error creating semaphore", new_sem != NULL); + if(new_sem != NULL) { + if (SYS_INITIALIZED()) { + SYS_ARCH_LOCKED(SYS_STATS_INC_USED(sem)); + } else { + SYS_STATS_INC_USED(sem); + } +#if LWIP_STATS && SYS_STATS + LWIP_ASSERT("sys_sem_new() counter overflow", lwip_stats.sys.sem.used != 0); +#endif /* LWIP_STATS && SYS_STATS*/ + sem->sem = new_sem; + return ERR_OK; + } + + /* failed to allocate memory... */ + if (SYS_INITIALIZED()) { + SYS_ARCH_LOCKED(SYS_STATS_INC(sem.err)); + } else { + SYS_STATS_INC(sem.err); + } + sem->sem = NULL; + return ERR_MEM; +} + +void +sys_sem_free(sys_sem_t *sem) +{ + /* parameter check */ + LWIP_ASSERT("sem != NULL", sem != NULL); + LWIP_ASSERT("sem->sem != NULL", sem->sem != NULL); + LWIP_ASSERT("sem->sem != INVALID_HANDLE_VALUE", sem->sem != INVALID_HANDLE_VALUE); + CloseHandle(sem->sem); + + SYS_ARCH_LOCKED(SYS_STATS_DEC(sem.used)); +#if LWIP_STATS && SYS_STATS + LWIP_ASSERT("sys_sem_free() closed more than created", lwip_stats.sys.sem.used != (u16_t)-1); +#endif /* LWIP_STATS && SYS_STATS */ + sem->sem = NULL; +} + +u32_t +sys_arch_sem_wait(sys_sem_t *sem, u32_t timeout) +{ + DWORD ret; + LONGLONG starttime, endtime; + LWIP_ASSERT("sem != NULL", sem != NULL); + LWIP_ASSERT("sem->sem != NULL", sem->sem != NULL); + LWIP_ASSERT("sem->sem != INVALID_HANDLE_VALUE", sem->sem != INVALID_HANDLE_VALUE); + if (!timeout) { + /* wait infinite */ + starttime = sys_get_ms_longlong(); + ret = WaitForSingleObject(sem->sem, INFINITE); + LWIP_ASSERT("Error waiting for semaphore", ret == WAIT_OBJECT_0); + endtime = sys_get_ms_longlong(); + /* return the time we waited for the sem */ + return (u32_t)(endtime - starttime); + } else { + starttime = sys_get_ms_longlong(); + ret = WaitForSingleObject(sem->sem, timeout); + LWIP_ASSERT("Error waiting for semaphore", (ret == WAIT_OBJECT_0) || (ret == WAIT_TIMEOUT)); + if (ret == WAIT_OBJECT_0) { + endtime = sys_get_ms_longlong(); + /* return the time we waited for the sem */ + return (u32_t)(endtime - starttime); + } else { + /* timeout */ + return SYS_ARCH_TIMEOUT; + } + } +} + +void +sys_sem_signal(sys_sem_t *sem) +{ + BOOL ret; + sys_arch_check_not_protected(); + LWIP_ASSERT("sem != NULL", sem != NULL); + LWIP_ASSERT("sem->sem != NULL", sem->sem != NULL); + LWIP_ASSERT("sem->sem != INVALID_HANDLE_VALUE", sem->sem != INVALID_HANDLE_VALUE); + ret = ReleaseSemaphore(sem->sem, 1, NULL); + LWIP_ASSERT("Error releasing semaphore", ret != 0); + LWIP_UNUSED_ARG(ret); +} + +err_t +sys_mutex_new(sys_mutex_t *mutex) +{ + HANDLE new_mut = NULL; + + LWIP_ASSERT("mutex != NULL", mutex != NULL); + + new_mut = CreateMutex(NULL, FALSE, NULL); + LWIP_ASSERT("Error creating mutex", new_mut != NULL); + if (new_mut != NULL) { + SYS_ARCH_LOCKED(SYS_STATS_INC_USED(mutex)); +#if LWIP_STATS && SYS_STATS + LWIP_ASSERT("sys_mutex_new() counter overflow", lwip_stats.sys.mutex.used != 0); +#endif /* LWIP_STATS && SYS_STATS*/ + mutex->mut = new_mut; + return ERR_OK; + } + + /* failed to allocate memory... */ + SYS_ARCH_LOCKED(SYS_STATS_INC(mutex.err)); + mutex->mut = NULL; + return ERR_MEM; +} + +void +sys_mutex_free(sys_mutex_t *mutex) +{ + /* parameter check */ + LWIP_ASSERT("mutex != NULL", mutex != NULL); + LWIP_ASSERT("mutex->mut != NULL", mutex->mut != NULL); + LWIP_ASSERT("mutex->mut != INVALID_HANDLE_VALUE", mutex->mut != INVALID_HANDLE_VALUE); + CloseHandle(mutex->mut); + + SYS_ARCH_LOCKED(SYS_STATS_DEC(mutex.used)); +#if LWIP_STATS && SYS_STATS + LWIP_ASSERT("sys_mutex_free() closed more than created", lwip_stats.sys.mutex.used != (u16_t)-1); +#endif /* LWIP_STATS && SYS_STATS */ + mutex->mut = NULL; +} + +void sys_mutex_lock(sys_mutex_t *mutex) +{ + DWORD ret; + LWIP_ASSERT("mutex != NULL", mutex != NULL); + LWIP_ASSERT("mutex->mut != NULL", mutex->mut != NULL); + LWIP_ASSERT("mutex->mut != INVALID_HANDLE_VALUE", mutex->mut != INVALID_HANDLE_VALUE); + /* wait infinite */ + ret = WaitForSingleObject(mutex->mut, INFINITE); + LWIP_ASSERT("Error waiting for mutex", ret == WAIT_OBJECT_0); + LWIP_UNUSED_ARG(ret); +} + +void +sys_mutex_unlock(sys_mutex_t *mutex) +{ + sys_arch_check_not_protected(); + LWIP_ASSERT("mutex != NULL", mutex != NULL); + LWIP_ASSERT("mutex->mut != NULL", mutex->mut != NULL); + LWIP_ASSERT("mutex->mut != INVALID_HANDLE_VALUE", mutex->mut != INVALID_HANDLE_VALUE); + /* wait infinite */ + if (!ReleaseMutex(mutex->mut)) { + LWIP_ASSERT("Error releasing mutex", 0); + } +} + + +#ifdef _MSC_VER +const DWORD MS_VC_EXCEPTION=0x406D1388; +#pragma pack(push,8) +typedef struct tagTHREADNAME_INFO +{ + DWORD dwType; /* Must be 0x1000. */ + LPCSTR szName; /* Pointer to name (in user addr space). */ + DWORD dwThreadID; /* Thread ID (-1=caller thread). */ + DWORD dwFlags; /* Reserved for future use, must be zero. */ +} THREADNAME_INFO; +#pragma pack(pop) + +static void +SetThreadName(DWORD dwThreadID, const char* threadName) +{ + THREADNAME_INFO info; + info.dwType = 0x1000; + info.szName = threadName; + info.dwThreadID = dwThreadID; + info.dwFlags = 0; + + __try { + RaiseException(MS_VC_EXCEPTION, 0, sizeof(info)/sizeof(ULONG_PTR), (ULONG_PTR*)&info); + } + __except(EXCEPTION_EXECUTE_HANDLER) { + } +} +#else /* _MSC_VER */ +static void +SetThreadName(DWORD dwThreadID, const char* threadName) +{ + LWIP_UNUSED_ARG(dwThreadID); + LWIP_UNUSED_ARG(threadName); +} +#endif /* _MSC_VER */ + +static void +sys_thread_function(void* arg) +{ + struct threadlist* t = (struct threadlist*)arg; +#if LWIP_NETCONN_SEM_PER_THREAD + sys_arch_netconn_sem_alloc(); +#endif + t->function(t->arg); +#if LWIP_NETCONN_SEM_PER_THREAD + sys_arch_netconn_sem_free(); +#endif +} + +sys_thread_t +sys_thread_new(const char *name, lwip_thread_fn function, void *arg, int stacksize, int prio) +{ + struct threadlist *new_thread; + HANDLE h; + SYS_ARCH_DECL_PROTECT(lev); + + LWIP_UNUSED_ARG(name); + LWIP_UNUSED_ARG(stacksize); + LWIP_UNUSED_ARG(prio); + + new_thread = (struct threadlist*)malloc(sizeof(struct threadlist)); + LWIP_ASSERT("new_thread != NULL", new_thread != NULL); + if (new_thread != NULL) { + new_thread->function = function; + new_thread->arg = arg; + SYS_ARCH_PROTECT(lev); + new_thread->next = lwip_win32_threads; + lwip_win32_threads = new_thread; + + h = CreateThread(0, 0, (LPTHREAD_START_ROUTINE)sys_thread_function, new_thread, 0, &(new_thread->id)); + LWIP_ASSERT("h != 0", h != 0); + LWIP_ASSERT("h != -1", h != INVALID_HANDLE_VALUE); + LWIP_UNUSED_ARG(h); + SetThreadName(new_thread->id, name); + + SYS_ARCH_UNPROTECT(lev); + return new_thread->id; + } + return 0; +} + +#if !NO_SYS +#if LWIP_TCPIP_CORE_LOCKING + +static DWORD lwip_core_lock_holder_thread_id; + +void +sys_lock_tcpip_core(void) +{ + sys_mutex_lock(&lock_tcpip_core); + lwip_core_lock_holder_thread_id = GetCurrentThreadId(); +} + +void +sys_unlock_tcpip_core(void) +{ + lwip_core_lock_holder_thread_id = 0; + sys_mutex_unlock(&lock_tcpip_core); +} +#endif /* LWIP_TCPIP_CORE_LOCKING */ + +static DWORD lwip_tcpip_thread_id; + +void +sys_mark_tcpip_thread(void) +{ + lwip_tcpip_thread_id = GetCurrentThreadId(); +} + +void +sys_check_core_locking(void) +{ + /* Embedded systems should check we are NOT in an interrupt context here */ + + if (lwip_tcpip_thread_id != 0) { + DWORD current_thread_id = GetCurrentThreadId(); + +#if LWIP_TCPIP_CORE_LOCKING + LWIP_ASSERT("Function called without core lock", current_thread_id == lwip_core_lock_holder_thread_id); +#else /* LWIP_TCPIP_CORE_LOCKING */ + LWIP_ASSERT("Function called from wrong thread", current_thread_id == lwip_tcpip_thread_id); +#endif /* LWIP_TCPIP_CORE_LOCKING */ + LWIP_UNUSED_ARG(current_thread_id); /* for LWIP_NOASSERT */ + } +} +#endif /* !NO_SYS */ + +err_t +sys_mbox_new(sys_mbox_t *mbox, int size) +{ + LWIP_ASSERT("mbox != NULL", mbox != NULL); + LWIP_UNUSED_ARG(size); + + mbox->sem = CreateSemaphore(0, 0, MAX_QUEUE_ENTRIES, 0); + LWIP_ASSERT("Error creating semaphore", mbox->sem != NULL); + if (mbox->sem == NULL) { + SYS_ARCH_LOCKED(SYS_STATS_INC(mbox.err)); + return ERR_MEM; + } + memset(&mbox->q_mem, 0, sizeof(u32_t)*MAX_QUEUE_ENTRIES); + mbox->head = 0; + mbox->tail = 0; + SYS_ARCH_LOCKED(SYS_STATS_INC_USED(mbox)); +#if LWIP_STATS && SYS_STATS + LWIP_ASSERT("sys_mbox_new() counter overflow", lwip_stats.sys.mbox.used != 0); +#endif /* LWIP_STATS && SYS_STATS */ + return ERR_OK; +} + +void +sys_mbox_free(sys_mbox_t *mbox) +{ + /* parameter check */ + LWIP_ASSERT("mbox != NULL", mbox != NULL); + LWIP_ASSERT("mbox->sem != NULL", mbox->sem != NULL); + LWIP_ASSERT("mbox->sem != INVALID_HANDLE_VALUE", mbox->sem != INVALID_HANDLE_VALUE); + + CloseHandle(mbox->sem); + + SYS_STATS_DEC(mbox.used); +#if LWIP_STATS && SYS_STATS + LWIP_ASSERT( "sys_mbox_free() ", lwip_stats.sys.mbox.used != (u16_t)-1); +#endif /* LWIP_STATS && SYS_STATS */ + mbox->sem = NULL; +} + +void +sys_mbox_post(sys_mbox_t *q, void *msg) +{ + BOOL ret; + SYS_ARCH_DECL_PROTECT(lev); + sys_arch_check_not_protected(); + + /* parameter check */ + LWIP_ASSERT("q != SYS_MBOX_NULL", q != SYS_MBOX_NULL); + LWIP_ASSERT("q->sem != NULL", q->sem != NULL); + LWIP_ASSERT("q->sem != INVALID_HANDLE_VALUE", q->sem != INVALID_HANDLE_VALUE); + + SYS_ARCH_PROTECT(lev); + q->q_mem[q->head] = msg; + q->head++; + if (q->head >= MAX_QUEUE_ENTRIES) { + q->head = 0; + } + LWIP_ASSERT("mbox is full!", q->head != q->tail); + ret = ReleaseSemaphore(q->sem, 1, 0); + LWIP_ASSERT("Error releasing sem", ret != 0); + LWIP_UNUSED_ARG(ret); + + SYS_ARCH_UNPROTECT(lev); +} + +err_t +sys_mbox_trypost(sys_mbox_t *q, void *msg) +{ + u32_t new_head; + BOOL ret; + SYS_ARCH_DECL_PROTECT(lev); + sys_arch_check_not_protected(); + + /* parameter check */ + LWIP_ASSERT("q != SYS_MBOX_NULL", q != SYS_MBOX_NULL); + LWIP_ASSERT("q->sem != NULL", q->sem != NULL); + LWIP_ASSERT("q->sem != INVALID_HANDLE_VALUE", q->sem != INVALID_HANDLE_VALUE); + + SYS_ARCH_PROTECT(lev); + + new_head = q->head + 1; + if (new_head >= MAX_QUEUE_ENTRIES) { + new_head = 0; + } + if (new_head == q->tail) { + SYS_ARCH_UNPROTECT(lev); + return ERR_MEM; + } + + q->q_mem[q->head] = msg; + q->head = new_head; + LWIP_ASSERT("mbox is full!", q->head != q->tail); + ret = ReleaseSemaphore(q->sem, 1, 0); + LWIP_ASSERT("Error releasing sem", ret != 0); + LWIP_UNUSED_ARG(ret); + + SYS_ARCH_UNPROTECT(lev); + return ERR_OK; +} + +err_t +sys_mbox_trypost_fromisr(sys_mbox_t *q, void *msg) +{ + return sys_mbox_trypost(q, msg); +} + +u32_t +sys_arch_mbox_fetch(sys_mbox_t *q, void **msg, u32_t timeout) +{ + DWORD ret; + LONGLONG starttime, endtime; + SYS_ARCH_DECL_PROTECT(lev); + + /* parameter check */ + LWIP_ASSERT("q != SYS_MBOX_NULL", q != SYS_MBOX_NULL); + LWIP_ASSERT("q->sem != NULL", q->sem != NULL); + LWIP_ASSERT("q->sem != INVALID_HANDLE_VALUE", q->sem != INVALID_HANDLE_VALUE); + + if (timeout == 0) { + timeout = INFINITE; + } + starttime = sys_get_ms_longlong(); + ret = WaitForSingleObject(q->sem, timeout); + if (ret == WAIT_OBJECT_0) { + SYS_ARCH_PROTECT(lev); + if (msg != NULL) { + *msg = q->q_mem[q->tail]; + } + + q->tail++; + if (q->tail >= MAX_QUEUE_ENTRIES) { + q->tail = 0; + } + SYS_ARCH_UNPROTECT(lev); + endtime = sys_get_ms_longlong(); + return (u32_t)(endtime - starttime); + } else { + LWIP_ASSERT("Error waiting for sem", ret == WAIT_TIMEOUT); + if (msg != NULL) { + *msg = NULL; + } + + return SYS_ARCH_TIMEOUT; + } +} + +u32_t +sys_arch_mbox_tryfetch(sys_mbox_t *q, void **msg) +{ + DWORD ret; + SYS_ARCH_DECL_PROTECT(lev); + + /* parameter check */ + LWIP_ASSERT("q != SYS_MBOX_NULL", q != SYS_MBOX_NULL); + LWIP_ASSERT("q->sem != NULL", q->sem != NULL); + LWIP_ASSERT("q->sem != INVALID_HANDLE_VALUE", q->sem != INVALID_HANDLE_VALUE); + + ret = WaitForSingleObject(q->sem, 0); + if (ret == WAIT_OBJECT_0) { + SYS_ARCH_PROTECT(lev); + if (msg != NULL) { + *msg = q->q_mem[q->tail]; + } + + q->tail++; + if (q->tail >= MAX_QUEUE_ENTRIES) { + q->tail = 0; + } + SYS_ARCH_UNPROTECT(lev); + return 0; + } else { + LWIP_ASSERT("Error waiting for sem", ret == WAIT_TIMEOUT); + if (msg != NULL) { + *msg = NULL; + } + + return SYS_ARCH_TIMEOUT; + } +} + +#if LWIP_NETCONN_SEM_PER_THREAD +sys_sem_t* +sys_arch_netconn_sem_get(void) +{ + LPVOID tls_data = TlsGetValue(netconn_sem_tls_index); + return (sys_sem_t*)tls_data; +} + +void +sys_arch_netconn_sem_alloc(void) +{ + sys_sem_t *sem; + err_t err; + BOOL done; + + sem = (sys_sem_t*)malloc(sizeof(sys_sem_t)); + LWIP_ASSERT("failed to allocate memory for TLS semaphore", sem != NULL); + err = sys_sem_new(sem, 0); + LWIP_ASSERT("failed to initialise TLS semaphore", err == ERR_OK); + done = TlsSetValue(netconn_sem_tls_index, sem); + LWIP_UNUSED_ARG(done); + LWIP_ASSERT("failed to initialise TLS semaphore storage", done == TRUE); +} + +void +sys_arch_netconn_sem_free(void) +{ + LPVOID tls_data = TlsGetValue(netconn_sem_tls_index); + if (tls_data != NULL) { + BOOL done; + free(tls_data); + done = TlsSetValue(netconn_sem_tls_index, NULL); + LWIP_UNUSED_ARG(done); + LWIP_ASSERT("failed to de-init TLS semaphore storage", done == TRUE); + } +} +#endif /* LWIP_NETCONN_SEM_PER_THREAD */ + +#endif /* !NO_SYS */ + +/* get keyboard state to terminate the debug app on any kbhit event using win32 API */ +int +lwip_win32_keypressed(void) +{ + INPUT_RECORD rec; + DWORD num = 0; + HANDLE h = GetStdHandle(STD_INPUT_HANDLE); + BOOL ret = PeekConsoleInput(h, &rec, 1, &num); + if (ret && num) { + ReadConsoleInput(h, &rec, 1, &num); + if (rec.EventType == KEY_EVENT) { + if (rec.Event.KeyEvent.bKeyDown) { + /* not a special key? */ + if (rec.Event.KeyEvent.uChar.AsciiChar != 0) { + return 1; + } + } + } + } + return 0; +} + +#include + +/* This is an example implementation for LWIP_PLATFORM_DIAG: + * format a string and pass it to your output function. + */ +void +lwip_win32_platform_diag(const char *format, ...) +{ + va_list ap; + /* get the varargs */ + va_start(ap, format); + /* print via varargs; to use another output function, you could use + vsnprintf here */ + vprintf(format, ap); + va_end(ap); +}